From 0058967bb0b6d9395ceae3916f85ba7bcbfa3e8f Mon Sep 17 00:00:00 2001 From: Richard Guenther Date: Tue, 31 Jan 2006 11:56:46 +0000 Subject: [PATCH] Makefile.def (target_modules): Add libgcc-math target module. 2006-01-31 Richard Guenther Paolo Bonzini * Makefile.def (target_modules): Add libgcc-math target module. * configure.in (target_libraries): Add libgcc-math target library. (--enable-libgcc-math): New configure switch. * Makefile.in: Re-generate. * configure: Re-generate. * libgcc-math: New toplevel directory. * doc/install.texi (--disable-libgcc-math): Document. libgcc-math/ * configure.ac: New file. * Makefile.am: Likewise. * configure: New generated file. * Makefile.in: Likewise. * aclocal.m4: Likewise. * libtool-version: New file. * include/ieee754.h: New file. * include/libc-symbols.h: Likewise. * include/math_private.h: Likewise. * i386/Makefile.am: New file. * i386/Makefile.in: New generated file. * i386/sse2.h: New file. * i386/endian.h: Likewise. * i386/sse2.map: Linker script for SSE2 ABI math intrinsics. * flt-32/: Import from glibc. * dbl-64/: Likewise. Co-Authored-By: Paolo Bonzini From-SVN: r110434 --- ChangeLog | 10 + Makefile.def | 1 + Makefile.in | 378 +- configure | 299 +- configure.in | 16 + gcc/ChangeLog | 5 + gcc/doc/install.texi | 4 + libgcc-math/ChangeLog | 20 + libgcc-math/Makefile.am | 88 + libgcc-math/Makefile.in | 760 ++ libgcc-math/aclocal.m4 | 940 +++ libgcc-math/configure | 5861 ++++++++++++++ libgcc-math/configure.ac | 148 + libgcc-math/dbl-64/MathLib.h | 103 + libgcc-math/dbl-64/asincos.tbl | 5169 +++++++++++++ libgcc-math/dbl-64/atnat.h | 167 + libgcc-math/dbl-64/atnat2.h | 185 + libgcc-math/dbl-64/branred.c | 144 + libgcc-math/dbl-64/branred.h | 80 + libgcc-math/dbl-64/dla.h | 174 + libgcc-math/dbl-64/doasin.c | 76 + libgcc-math/dbl-64/doasin.h | 64 + libgcc-math/dbl-64/dosincos.c | 189 + libgcc-math/dbl-64/dosincos.h | 81 + libgcc-math/dbl-64/e_asin.c | 637 ++ libgcc-math/dbl-64/e_atan2.c | 406 + libgcc-math/dbl-64/e_exp.c | 252 + libgcc-math/dbl-64/e_log.c | 203 + libgcc-math/dbl-64/e_log10.c | 98 + libgcc-math/dbl-64/e_pow.c | 388 + libgcc-math/dbl-64/e_rem_pio2.c | 183 + libgcc-math/dbl-64/e_sqrt.c | 88 + libgcc-math/dbl-64/halfulp.c | 123 + libgcc-math/dbl-64/k_rem_pio2.c | 320 + libgcc-math/dbl-64/mpa.c | 508 ++ libgcc-math/dbl-64/mpa.h | 89 + libgcc-math/dbl-64/mpa2.h | 98 + libgcc-math/dbl-64/mpatan.c | 102 + libgcc-math/dbl-64/mpatan.h | 174 + libgcc-math/dbl-64/mpatan2.c | 70 + libgcc-math/dbl-64/mpexp.c | 106 + libgcc-math/dbl-64/mpexp.h | 135 + libgcc-math/dbl-64/mplog.c | 72 + libgcc-math/dbl-64/mplog.h | 45 + libgcc-math/dbl-64/mpsqrt.c | 103 + libgcc-math/dbl-64/mpsqrt.h | 51 + libgcc-math/dbl-64/mptan.c | 60 + libgcc-math/dbl-64/mydefs.h | 38 + libgcc-math/dbl-64/powtwo.tbl | 32 + libgcc-math/dbl-64/root.tbl | 58 + libgcc-math/dbl-64/s_atan.c | 230 + libgcc-math/dbl-64/s_floor.c | 86 + libgcc-math/dbl-64/s_isinf.c | 33 + libgcc-math/dbl-64/s_scalbn.c | 70 + libgcc-math/dbl-64/s_sin.c | 1129 +++ libgcc-math/dbl-64/s_tan.c | 486 ++ libgcc-math/dbl-64/sincos.tbl | 912 +++ libgcc-math/dbl-64/sincos32.c | 352 + libgcc-math/dbl-64/sincos32.h | 82 + libgcc-math/dbl-64/slowexp.c | 66 + libgcc-math/dbl-64/slowpow.c | 74 + libgcc-math/dbl-64/t_exp.c | 436 ++ libgcc-math/dbl-64/t_exp2.h | 585 ++ libgcc-math/dbl-64/uasncs.h | 70 + libgcc-math/dbl-64/uatan.tbl | 11135 +++++++++++++++++++++++++++ libgcc-math/dbl-64/uexp.h | 70 + libgcc-math/dbl-64/uexp.tbl | 1787 +++++ libgcc-math/dbl-64/ulog.h | 200 + libgcc-math/dbl-64/ulog.tbl | 3327 ++++++++ libgcc-math/dbl-64/upow.h | 81 + libgcc-math/dbl-64/upow.tbl | 10189 ++++++++++++++++++++++++ libgcc-math/dbl-64/urem.h | 51 + libgcc-math/dbl-64/uroot.h | 44 + libgcc-math/dbl-64/usncs.h | 80 + libgcc-math/dbl-64/utan.h | 280 + libgcc-math/dbl-64/utan.tbl | 1526 ++++ libgcc-math/flt-32/e_acosf.c | 89 + libgcc-math/flt-32/e_asinf.c | 110 + libgcc-math/flt-32/e_atan2f.c | 105 + libgcc-math/flt-32/e_expf.c | 140 + libgcc-math/flt-32/e_log10f.c | 67 + libgcc-math/flt-32/e_logf.c | 99 + libgcc-math/flt-32/e_powf.c | 257 + libgcc-math/flt-32/e_rem_pio2f.c | 196 + libgcc-math/flt-32/e_sqrtf.c | 97 + libgcc-math/flt-32/k_cosf.c | 64 + libgcc-math/flt-32/k_rem_pio2f.c | 213 + libgcc-math/flt-32/k_sinf.c | 54 + libgcc-math/flt-32/k_tanf.c | 101 + libgcc-math/flt-32/s_atanf.c | 120 + libgcc-math/flt-32/s_cosf.c | 60 + libgcc-math/flt-32/s_floorf.c | 71 + libgcc-math/flt-32/s_isinff.c | 29 + libgcc-math/flt-32/s_scalbnf.c | 63 + libgcc-math/flt-32/s_sinf.c | 54 + libgcc-math/flt-32/s_tanf.c | 49 + libgcc-math/flt-32/t_exp2f.h | 352 + libgcc-math/i386/Makefile.am | 117 + libgcc-math/i386/Makefile.in | 953 +++ libgcc-math/i386/endian.h | 57 + libgcc-math/i386/sse2.h | 94 + libgcc-math/i386/sse2.map | 11 + libgcc-math/include/ieee754.h | 136 + libgcc-math/include/libc-symbols.h | 50 + libgcc-math/include/math_private.h | 322 + libgcc-math/libtool-version | 6 + 106 files changed, 56779 insertions(+), 139 deletions(-) create mode 100644 libgcc-math/ChangeLog create mode 100644 libgcc-math/Makefile.am create mode 100644 libgcc-math/Makefile.in create mode 100644 libgcc-math/aclocal.m4 create mode 100755 libgcc-math/configure create mode 100644 libgcc-math/configure.ac create mode 100644 libgcc-math/dbl-64/MathLib.h create mode 100644 libgcc-math/dbl-64/asincos.tbl create mode 100644 libgcc-math/dbl-64/atnat.h create mode 100644 libgcc-math/dbl-64/atnat2.h create mode 100644 libgcc-math/dbl-64/branred.c create mode 100644 libgcc-math/dbl-64/branred.h create mode 100644 libgcc-math/dbl-64/dla.h create mode 100644 libgcc-math/dbl-64/doasin.c create mode 100644 libgcc-math/dbl-64/doasin.h create mode 100644 libgcc-math/dbl-64/dosincos.c create mode 100644 libgcc-math/dbl-64/dosincos.h create mode 100644 libgcc-math/dbl-64/e_asin.c create mode 100644 libgcc-math/dbl-64/e_atan2.c create mode 100644 libgcc-math/dbl-64/e_exp.c create mode 100644 libgcc-math/dbl-64/e_log.c create mode 100644 libgcc-math/dbl-64/e_log10.c create mode 100644 libgcc-math/dbl-64/e_pow.c create mode 100644 libgcc-math/dbl-64/e_rem_pio2.c create mode 100644 libgcc-math/dbl-64/e_sqrt.c create mode 100644 libgcc-math/dbl-64/halfulp.c create mode 100644 libgcc-math/dbl-64/k_rem_pio2.c create mode 100644 libgcc-math/dbl-64/mpa.c create mode 100644 libgcc-math/dbl-64/mpa.h create mode 100644 libgcc-math/dbl-64/mpa2.h create mode 100644 libgcc-math/dbl-64/mpatan.c create mode 100644 libgcc-math/dbl-64/mpatan.h create mode 100644 libgcc-math/dbl-64/mpatan2.c create mode 100644 libgcc-math/dbl-64/mpexp.c create mode 100644 libgcc-math/dbl-64/mpexp.h create mode 100644 libgcc-math/dbl-64/mplog.c create mode 100644 libgcc-math/dbl-64/mplog.h create mode 100644 libgcc-math/dbl-64/mpsqrt.c create mode 100644 libgcc-math/dbl-64/mpsqrt.h create mode 100644 libgcc-math/dbl-64/mptan.c create mode 100644 libgcc-math/dbl-64/mydefs.h create mode 100644 libgcc-math/dbl-64/powtwo.tbl create mode 100644 libgcc-math/dbl-64/root.tbl create mode 100644 libgcc-math/dbl-64/s_atan.c create mode 100644 libgcc-math/dbl-64/s_floor.c create mode 100644 libgcc-math/dbl-64/s_isinf.c create mode 100644 libgcc-math/dbl-64/s_scalbn.c create mode 100644 libgcc-math/dbl-64/s_sin.c create mode 100644 libgcc-math/dbl-64/s_tan.c create mode 100644 libgcc-math/dbl-64/sincos.tbl create mode 100644 libgcc-math/dbl-64/sincos32.c create mode 100644 libgcc-math/dbl-64/sincos32.h create mode 100644 libgcc-math/dbl-64/slowexp.c create mode 100644 libgcc-math/dbl-64/slowpow.c create mode 100644 libgcc-math/dbl-64/t_exp.c create mode 100644 libgcc-math/dbl-64/t_exp2.h create mode 100644 libgcc-math/dbl-64/uasncs.h create mode 100644 libgcc-math/dbl-64/uatan.tbl create mode 100644 libgcc-math/dbl-64/uexp.h create mode 100644 libgcc-math/dbl-64/uexp.tbl create mode 100644 libgcc-math/dbl-64/ulog.h create mode 100644 libgcc-math/dbl-64/ulog.tbl create mode 100644 libgcc-math/dbl-64/upow.h create mode 100644 libgcc-math/dbl-64/upow.tbl create mode 100644 libgcc-math/dbl-64/urem.h create mode 100644 libgcc-math/dbl-64/uroot.h create mode 100644 libgcc-math/dbl-64/usncs.h create mode 100644 libgcc-math/dbl-64/utan.h create mode 100644 libgcc-math/dbl-64/utan.tbl create mode 100644 libgcc-math/flt-32/e_acosf.c create mode 100644 libgcc-math/flt-32/e_asinf.c create mode 100644 libgcc-math/flt-32/e_atan2f.c create mode 100644 libgcc-math/flt-32/e_expf.c create mode 100644 libgcc-math/flt-32/e_log10f.c create mode 100644 libgcc-math/flt-32/e_logf.c create mode 100644 libgcc-math/flt-32/e_powf.c create mode 100644 libgcc-math/flt-32/e_rem_pio2f.c create mode 100644 libgcc-math/flt-32/e_sqrtf.c create mode 100644 libgcc-math/flt-32/k_cosf.c create mode 100644 libgcc-math/flt-32/k_rem_pio2f.c create mode 100644 libgcc-math/flt-32/k_sinf.c create mode 100644 libgcc-math/flt-32/k_tanf.c create mode 100644 libgcc-math/flt-32/s_atanf.c create mode 100644 libgcc-math/flt-32/s_cosf.c create mode 100644 libgcc-math/flt-32/s_floorf.c create mode 100644 libgcc-math/flt-32/s_isinff.c create mode 100644 libgcc-math/flt-32/s_scalbnf.c create mode 100644 libgcc-math/flt-32/s_sinf.c create mode 100644 libgcc-math/flt-32/s_tanf.c create mode 100644 libgcc-math/flt-32/t_exp2f.h create mode 100644 libgcc-math/i386/Makefile.am create mode 100644 libgcc-math/i386/Makefile.in create mode 100644 libgcc-math/i386/endian.h create mode 100644 libgcc-math/i386/sse2.h create mode 100644 libgcc-math/i386/sse2.map create mode 100644 libgcc-math/include/ieee754.h create mode 100644 libgcc-math/include/libc-symbols.h create mode 100644 libgcc-math/include/math_private.h create mode 100644 libgcc-math/libtool-version diff --git a/ChangeLog b/ChangeLog index c788cc720cd..14b6f7d836b 100644 --- a/ChangeLog +++ b/ChangeLog @@ -1,3 +1,13 @@ +2006-01-31 Richard Guenther + Paolo Bonzini + + * Makefile.def (target_modules): Add libgcc-math target module. + * configure.in (target_libraries): Add libgcc-math target library. + (--enable-libgcc-math): New configure switch. + * Makefile.in: Re-generate. + * configure: Re-generate. + * libgcc-math: New toplevel directory. + 2006-01-26 Paolo Bonzini * configure.in: Set with_gnu_as, with_gnu_ld, with_newlib earlier. diff --git a/Makefile.def b/Makefile.def index cdf25d2ee36..49b33f025b3 100644 --- a/Makefile.def +++ b/Makefile.def @@ -117,6 +117,7 @@ host_modules= { module= gnattools; }; target_modules = { module= libstdc++-v3; lib_path=.libs; raw_cxx=true; }; target_modules = { module= libmudflap; lib_path=.libs; }; target_modules = { module= libssp; lib_path=.libs; }; +target_modules = { module= libgcc-math; lib_path=.libs; }; target_modules = { module= newlib; }; target_modules = { module= libgfortran; }; target_modules = { module= libobjc; }; diff --git a/Makefile.in b/Makefile.in index f8fb0472c39..a5468ab22a0 100644 --- a/Makefile.in +++ b/Makefile.in @@ -356,7 +356,7 @@ all: # This is the list of directories that may be needed in RPATH_ENVVAR # so that prorgams built for the target machine work. -TARGET_LIB_PATH = $(TARGET_LIB_PATH_libstdc++-v3)$(TARGET_LIB_PATH_libmudflap)$(TARGET_LIB_PATH_libssp)$(TARGET_LIB_PATH_libgomp)$(HOST_LIB_PATH_gcc) +TARGET_LIB_PATH = $(TARGET_LIB_PATH_libstdc++-v3)$(TARGET_LIB_PATH_libmudflap)$(TARGET_LIB_PATH_libssp)$(TARGET_LIB_PATH_libgcc-math)$(TARGET_LIB_PATH_libgomp)$(HOST_LIB_PATH_gcc) @if target-libstdc++-v3 TARGET_LIB_PATH_libstdc++-v3 = $$r/$(TARGET_SUBDIR)/libstdc++-v3/.libs: @@ -370,6 +370,10 @@ TARGET_LIB_PATH_libmudflap = $$r/$(TARGET_SUBDIR)/libmudflap/.libs: TARGET_LIB_PATH_libssp = $$r/$(TARGET_SUBDIR)/libssp/.libs: @endif target-libssp +@if target-libgcc-math +TARGET_LIB_PATH_libgcc-math = $$r/$(TARGET_SUBDIR)/libgcc-math/.libs: +@endif target-libgcc-math + @if target-libgomp TARGET_LIB_PATH_libgomp = $$r/$(TARGET_SUBDIR)/libgomp/.libs: @endif target-libgomp @@ -622,6 +626,7 @@ configure-target: \ maybe-configure-target-libstdc++-v3 \ maybe-configure-target-libmudflap \ maybe-configure-target-libssp \ + maybe-configure-target-libgcc-math \ maybe-configure-target-newlib \ maybe-configure-target-libgfortran \ maybe-configure-target-libobjc \ @@ -742,6 +747,7 @@ all-target: \ maybe-all-target-libstdc++-v3 \ maybe-all-target-libmudflap \ maybe-all-target-libssp \ + maybe-all-target-libgcc-math \ maybe-all-target-newlib \ maybe-all-target-libgfortran \ maybe-all-target-libobjc \ @@ -850,6 +856,7 @@ info-target: \ maybe-info-target-libstdc++-v3 \ maybe-info-target-libmudflap \ maybe-info-target-libssp \ + maybe-info-target-libgcc-math \ maybe-info-target-newlib \ maybe-info-target-libgfortran \ maybe-info-target-libobjc \ @@ -953,6 +960,7 @@ dvi-target: \ maybe-dvi-target-libstdc++-v3 \ maybe-dvi-target-libmudflap \ maybe-dvi-target-libssp \ + maybe-dvi-target-libgcc-math \ maybe-dvi-target-newlib \ maybe-dvi-target-libgfortran \ maybe-dvi-target-libobjc \ @@ -1056,6 +1064,7 @@ html-target: \ maybe-html-target-libstdc++-v3 \ maybe-html-target-libmudflap \ maybe-html-target-libssp \ + maybe-html-target-libgcc-math \ maybe-html-target-newlib \ maybe-html-target-libgfortran \ maybe-html-target-libobjc \ @@ -1159,6 +1168,7 @@ TAGS-target: \ maybe-TAGS-target-libstdc++-v3 \ maybe-TAGS-target-libmudflap \ maybe-TAGS-target-libssp \ + maybe-TAGS-target-libgcc-math \ maybe-TAGS-target-newlib \ maybe-TAGS-target-libgfortran \ maybe-TAGS-target-libobjc \ @@ -1262,6 +1272,7 @@ install-info-target: \ maybe-install-info-target-libstdc++-v3 \ maybe-install-info-target-libmudflap \ maybe-install-info-target-libssp \ + maybe-install-info-target-libgcc-math \ maybe-install-info-target-newlib \ maybe-install-info-target-libgfortran \ maybe-install-info-target-libobjc \ @@ -1365,6 +1376,7 @@ installcheck-target: \ maybe-installcheck-target-libstdc++-v3 \ maybe-installcheck-target-libmudflap \ maybe-installcheck-target-libssp \ + maybe-installcheck-target-libgcc-math \ maybe-installcheck-target-newlib \ maybe-installcheck-target-libgfortran \ maybe-installcheck-target-libobjc \ @@ -1468,6 +1480,7 @@ mostlyclean-target: \ maybe-mostlyclean-target-libstdc++-v3 \ maybe-mostlyclean-target-libmudflap \ maybe-mostlyclean-target-libssp \ + maybe-mostlyclean-target-libgcc-math \ maybe-mostlyclean-target-newlib \ maybe-mostlyclean-target-libgfortran \ maybe-mostlyclean-target-libobjc \ @@ -1571,6 +1584,7 @@ clean-target: \ maybe-clean-target-libstdc++-v3 \ maybe-clean-target-libmudflap \ maybe-clean-target-libssp \ + maybe-clean-target-libgcc-math \ maybe-clean-target-newlib \ maybe-clean-target-libgfortran \ maybe-clean-target-libobjc \ @@ -1674,6 +1688,7 @@ distclean-target: \ maybe-distclean-target-libstdc++-v3 \ maybe-distclean-target-libmudflap \ maybe-distclean-target-libssp \ + maybe-distclean-target-libgcc-math \ maybe-distclean-target-newlib \ maybe-distclean-target-libgfortran \ maybe-distclean-target-libobjc \ @@ -1777,6 +1792,7 @@ maintainer-clean-target: \ maybe-maintainer-clean-target-libstdc++-v3 \ maybe-maintainer-clean-target-libmudflap \ maybe-maintainer-clean-target-libssp \ + maybe-maintainer-clean-target-libgcc-math \ maybe-maintainer-clean-target-newlib \ maybe-maintainer-clean-target-libgfortran \ maybe-maintainer-clean-target-libobjc \ @@ -1933,6 +1949,7 @@ check-target: \ maybe-check-target-libstdc++-v3 \ maybe-check-target-libmudflap \ maybe-check-target-libssp \ + maybe-check-target-libgcc-math \ maybe-check-target-newlib \ maybe-check-target-libgfortran \ maybe-check-target-libobjc \ @@ -2133,6 +2150,7 @@ install-target: \ maybe-install-target-libstdc++-v3 \ maybe-install-target-libmudflap \ maybe-install-target-libssp \ + maybe-install-target-libgcc-math \ maybe-install-target-newlib \ maybe-install-target-libgfortran \ maybe-install-target-libobjc \ @@ -29949,6 +29967,362 @@ maintainer-clean-target-libssp: +.PHONY: configure-target-libgcc-math maybe-configure-target-libgcc-math +maybe-configure-target-libgcc-math: +@if target-libgcc-math +maybe-configure-target-libgcc-math: configure-target-libgcc-math +configure-target-libgcc-math: + @: $(MAKE); $(unstage) + @r=`${PWD_COMMAND}`; export r; \ + s=`cd $(srcdir); ${PWD_COMMAND}`; export s; \ + echo "Checking multilib configuration for libgcc-math..."; \ + $(SHELL) $(srcdir)/mkinstalldirs $(TARGET_SUBDIR)/libgcc-math ; \ + $(CC_FOR_TARGET) --print-multi-lib > $(TARGET_SUBDIR)/libgcc-math/multilib.tmp 2> /dev/null ; \ + if test -r $(TARGET_SUBDIR)/libgcc-math/multilib.out; then \ + if cmp -s $(TARGET_SUBDIR)/libgcc-math/multilib.tmp $(TARGET_SUBDIR)/libgcc-math/multilib.out; then \ + rm -f $(TARGET_SUBDIR)/libgcc-math/multilib.tmp; \ + else \ + rm -f $(TARGET_SUBDIR)/libgcc-math/Makefile; \ + mv $(TARGET_SUBDIR)/libgcc-math/multilib.tmp $(TARGET_SUBDIR)/libgcc-math/multilib.out; \ + fi; \ + else \ + mv $(TARGET_SUBDIR)/libgcc-math/multilib.tmp $(TARGET_SUBDIR)/libgcc-math/multilib.out; \ + fi + @test ! -f $(TARGET_SUBDIR)/libgcc-math/Makefile || exit 0; \ + $(SHELL) $(srcdir)/mkinstalldirs $(TARGET_SUBDIR)/libgcc-math ; \ + r=`${PWD_COMMAND}`; export r; \ + s=`cd $(srcdir); ${PWD_COMMAND}`; export s; \ + $(NORMAL_TARGET_EXPORTS) \ + echo Configuring in $(TARGET_SUBDIR)/libgcc-math; \ + cd "$(TARGET_SUBDIR)/libgcc-math" || exit 1; \ + case $(srcdir) in \ + /* | [A-Za-z]:[\\/]*) topdir=$(srcdir) ;; \ + *) topdir=`echo $(TARGET_SUBDIR)/libgcc-math/ | \ + sed -e 's,\./,,g' -e 's,[^/]*/,../,g' `$(srcdir) ;; \ + esac; \ + srcdiroption="--srcdir=$${topdir}/libgcc-math"; \ + libsrcdir="$$s/libgcc-math"; \ + rm -f no-such-file || : ; \ + CONFIG_SITE=no-such-file $(SHELL) $${libsrcdir}/configure \ + $(TARGET_CONFIGARGS) $${srcdiroption} \ + || exit 1 +@endif target-libgcc-math + + + + + +.PHONY: all-target-libgcc-math maybe-all-target-libgcc-math +maybe-all-target-libgcc-math: +@if target-libgcc-math +TARGET-target-libgcc-math=all +maybe-all-target-libgcc-math: all-target-libgcc-math +all-target-libgcc-math: configure-target-libgcc-math + @: $(MAKE); $(unstage) + @r=`${PWD_COMMAND}`; export r; \ + s=`cd $(srcdir); ${PWD_COMMAND}`; export s; \ + $(NORMAL_TARGET_EXPORTS) \ + (cd $(TARGET_SUBDIR)/libgcc-math && \ + $(MAKE) $(TARGET_FLAGS_TO_PASS) $(TARGET-target-libgcc-math)) +@endif target-libgcc-math + + + + + +.PHONY: check-target-libgcc-math maybe-check-target-libgcc-math +maybe-check-target-libgcc-math: +@if target-libgcc-math +maybe-check-target-libgcc-math: check-target-libgcc-math + +check-target-libgcc-math: + @: $(MAKE); $(unstage) + @r=`${PWD_COMMAND}`; export r; \ + s=`cd $(srcdir); ${PWD_COMMAND}`; export s; \ + $(NORMAL_TARGET_EXPORTS) \ + (cd $(TARGET_SUBDIR)/libgcc-math && \ + $(MAKE) $(TARGET_FLAGS_TO_PASS) check) + +@endif target-libgcc-math + +.PHONY: install-target-libgcc-math maybe-install-target-libgcc-math +maybe-install-target-libgcc-math: +@if target-libgcc-math +maybe-install-target-libgcc-math: install-target-libgcc-math + +install-target-libgcc-math: installdirs + @: $(MAKE); $(unstage) + @r=`${PWD_COMMAND}`; export r; \ + s=`cd $(srcdir); ${PWD_COMMAND}`; export s; \ + $(NORMAL_TARGET_EXPORTS) \ + (cd $(TARGET_SUBDIR)/libgcc-math && \ + $(MAKE) $(TARGET_FLAGS_TO_PASS) install) + +@endif target-libgcc-math + +# Other targets (info, dvi, etc.) + +.PHONY: maybe-info-target-libgcc-math info-target-libgcc-math +maybe-info-target-libgcc-math: +@if target-libgcc-math +maybe-info-target-libgcc-math: info-target-libgcc-math + +info-target-libgcc-math: \ + configure-target-libgcc-math + @: $(MAKE); $(unstage) + @[ -f $(TARGET_SUBDIR)/libgcc-math/Makefile ] || exit 0 ; \ + r=`${PWD_COMMAND}`; export r; \ + s=`cd $(srcdir); ${PWD_COMMAND}`; export s; \ + $(NORMAL_TARGET_EXPORTS) \ + echo "Doing info in $(TARGET_SUBDIR)/libgcc-math" ; \ + for flag in $(EXTRA_TARGET_FLAGS); do \ + eval `echo "$$flag" | sed -e "s|^\([^=]*\)=\(.*\)|\1='\2'; export \1|"`; \ + done; \ + (cd $(TARGET_SUBDIR)/libgcc-math && \ + $(MAKE) $(BASE_FLAGS_TO_PASS) "AR=$${AR}" "AS=$${AS}" \ + "CC=$${CC}" "CXX=$${CXX}" "LD=$${LD}" "NM=$${NM}" \ + "RANLIB=$${RANLIB}" \ + "DLLTOOL=$${DLLTOOL}" "WINDRES=$${WINDRES}" \ + info) \ + || exit 1 + +@endif target-libgcc-math + +.PHONY: maybe-dvi-target-libgcc-math dvi-target-libgcc-math +maybe-dvi-target-libgcc-math: +@if target-libgcc-math +maybe-dvi-target-libgcc-math: dvi-target-libgcc-math + +dvi-target-libgcc-math: \ + configure-target-libgcc-math + @: $(MAKE); $(unstage) + @[ -f $(TARGET_SUBDIR)/libgcc-math/Makefile ] || exit 0 ; \ + r=`${PWD_COMMAND}`; export r; \ + s=`cd $(srcdir); ${PWD_COMMAND}`; export s; \ + $(NORMAL_TARGET_EXPORTS) \ + echo "Doing dvi in $(TARGET_SUBDIR)/libgcc-math" ; \ + for flag in $(EXTRA_TARGET_FLAGS); do \ + eval `echo "$$flag" | sed -e "s|^\([^=]*\)=\(.*\)|\1='\2'; export \1|"`; \ + done; \ + (cd $(TARGET_SUBDIR)/libgcc-math && \ + $(MAKE) $(BASE_FLAGS_TO_PASS) "AR=$${AR}" "AS=$${AS}" \ + "CC=$${CC}" "CXX=$${CXX}" "LD=$${LD}" "NM=$${NM}" \ + "RANLIB=$${RANLIB}" \ + "DLLTOOL=$${DLLTOOL}" "WINDRES=$${WINDRES}" \ + dvi) \ + || exit 1 + +@endif target-libgcc-math + +.PHONY: maybe-html-target-libgcc-math html-target-libgcc-math +maybe-html-target-libgcc-math: +@if target-libgcc-math +maybe-html-target-libgcc-math: html-target-libgcc-math + +html-target-libgcc-math: \ + configure-target-libgcc-math + @: $(MAKE); $(unstage) + @[ -f $(TARGET_SUBDIR)/libgcc-math/Makefile ] || exit 0 ; \ + r=`${PWD_COMMAND}`; export r; \ + s=`cd $(srcdir); ${PWD_COMMAND}`; export s; \ + $(NORMAL_TARGET_EXPORTS) \ + echo "Doing html in $(TARGET_SUBDIR)/libgcc-math" ; \ + for flag in $(EXTRA_TARGET_FLAGS); do \ + eval `echo "$$flag" | sed -e "s|^\([^=]*\)=\(.*\)|\1='\2'; export \1|"`; \ + done; \ + (cd $(TARGET_SUBDIR)/libgcc-math && \ + $(MAKE) $(BASE_FLAGS_TO_PASS) "AR=$${AR}" "AS=$${AS}" \ + "CC=$${CC}" "CXX=$${CXX}" "LD=$${LD}" "NM=$${NM}" \ + "RANLIB=$${RANLIB}" \ + "DLLTOOL=$${DLLTOOL}" "WINDRES=$${WINDRES}" \ + html) \ + || exit 1 + +@endif target-libgcc-math + +.PHONY: maybe-TAGS-target-libgcc-math TAGS-target-libgcc-math +maybe-TAGS-target-libgcc-math: +@if target-libgcc-math +maybe-TAGS-target-libgcc-math: TAGS-target-libgcc-math + +TAGS-target-libgcc-math: \ + configure-target-libgcc-math + @: $(MAKE); $(unstage) + @[ -f $(TARGET_SUBDIR)/libgcc-math/Makefile ] || exit 0 ; \ + r=`${PWD_COMMAND}`; export r; \ + s=`cd $(srcdir); ${PWD_COMMAND}`; export s; \ + $(NORMAL_TARGET_EXPORTS) \ + echo "Doing TAGS in $(TARGET_SUBDIR)/libgcc-math" ; \ + for flag in $(EXTRA_TARGET_FLAGS); do \ + eval `echo "$$flag" | sed -e "s|^\([^=]*\)=\(.*\)|\1='\2'; export \1|"`; \ + done; \ + (cd $(TARGET_SUBDIR)/libgcc-math && \ + $(MAKE) $(BASE_FLAGS_TO_PASS) "AR=$${AR}" "AS=$${AS}" \ + "CC=$${CC}" "CXX=$${CXX}" "LD=$${LD}" "NM=$${NM}" \ + "RANLIB=$${RANLIB}" \ + "DLLTOOL=$${DLLTOOL}" "WINDRES=$${WINDRES}" \ + TAGS) \ + || exit 1 + +@endif target-libgcc-math + +.PHONY: maybe-install-info-target-libgcc-math install-info-target-libgcc-math +maybe-install-info-target-libgcc-math: +@if target-libgcc-math +maybe-install-info-target-libgcc-math: install-info-target-libgcc-math + +install-info-target-libgcc-math: \ + configure-target-libgcc-math \ + info-target-libgcc-math + @: $(MAKE); $(unstage) + @[ -f $(TARGET_SUBDIR)/libgcc-math/Makefile ] || exit 0 ; \ + r=`${PWD_COMMAND}`; export r; \ + s=`cd $(srcdir); ${PWD_COMMAND}`; export s; \ + $(NORMAL_TARGET_EXPORTS) \ + echo "Doing install-info in $(TARGET_SUBDIR)/libgcc-math" ; \ + for flag in $(EXTRA_TARGET_FLAGS); do \ + eval `echo "$$flag" | sed -e "s|^\([^=]*\)=\(.*\)|\1='\2'; export \1|"`; \ + done; \ + (cd $(TARGET_SUBDIR)/libgcc-math && \ + $(MAKE) $(BASE_FLAGS_TO_PASS) "AR=$${AR}" "AS=$${AS}" \ + "CC=$${CC}" "CXX=$${CXX}" "LD=$${LD}" "NM=$${NM}" \ + "RANLIB=$${RANLIB}" \ + "DLLTOOL=$${DLLTOOL}" "WINDRES=$${WINDRES}" \ + install-info) \ + || exit 1 + +@endif target-libgcc-math + +.PHONY: maybe-installcheck-target-libgcc-math installcheck-target-libgcc-math +maybe-installcheck-target-libgcc-math: +@if target-libgcc-math +maybe-installcheck-target-libgcc-math: installcheck-target-libgcc-math + +installcheck-target-libgcc-math: \ + configure-target-libgcc-math + @: $(MAKE); $(unstage) + @[ -f $(TARGET_SUBDIR)/libgcc-math/Makefile ] || exit 0 ; \ + r=`${PWD_COMMAND}`; export r; \ + s=`cd $(srcdir); ${PWD_COMMAND}`; export s; \ + $(NORMAL_TARGET_EXPORTS) \ + echo "Doing installcheck in $(TARGET_SUBDIR)/libgcc-math" ; \ + for flag in $(EXTRA_TARGET_FLAGS); do \ + eval `echo "$$flag" | sed -e "s|^\([^=]*\)=\(.*\)|\1='\2'; export \1|"`; \ + done; \ + (cd $(TARGET_SUBDIR)/libgcc-math && \ + $(MAKE) $(BASE_FLAGS_TO_PASS) "AR=$${AR}" "AS=$${AS}" \ + "CC=$${CC}" "CXX=$${CXX}" "LD=$${LD}" "NM=$${NM}" \ + "RANLIB=$${RANLIB}" \ + "DLLTOOL=$${DLLTOOL}" "WINDRES=$${WINDRES}" \ + installcheck) \ + || exit 1 + +@endif target-libgcc-math + +.PHONY: maybe-mostlyclean-target-libgcc-math mostlyclean-target-libgcc-math +maybe-mostlyclean-target-libgcc-math: +@if target-libgcc-math +maybe-mostlyclean-target-libgcc-math: mostlyclean-target-libgcc-math + +mostlyclean-target-libgcc-math: + @: $(MAKE); $(unstage) + @[ -f $(TARGET_SUBDIR)/libgcc-math/Makefile ] || exit 0 ; \ + r=`${PWD_COMMAND}`; export r; \ + s=`cd $(srcdir); ${PWD_COMMAND}`; export s; \ + $(NORMAL_TARGET_EXPORTS) \ + echo "Doing mostlyclean in $(TARGET_SUBDIR)/libgcc-math" ; \ + for flag in $(EXTRA_TARGET_FLAGS); do \ + eval `echo "$$flag" | sed -e "s|^\([^=]*\)=\(.*\)|\1='\2'; export \1|"`; \ + done; \ + (cd $(TARGET_SUBDIR)/libgcc-math && \ + $(MAKE) $(BASE_FLAGS_TO_PASS) "AR=$${AR}" "AS=$${AS}" \ + "CC=$${CC}" "CXX=$${CXX}" "LD=$${LD}" "NM=$${NM}" \ + "RANLIB=$${RANLIB}" \ + "DLLTOOL=$${DLLTOOL}" "WINDRES=$${WINDRES}" \ + mostlyclean) \ + || exit 1 + +@endif target-libgcc-math + +.PHONY: maybe-clean-target-libgcc-math clean-target-libgcc-math +maybe-clean-target-libgcc-math: +@if target-libgcc-math +maybe-clean-target-libgcc-math: clean-target-libgcc-math + +clean-target-libgcc-math: + @: $(MAKE); $(unstage) + @[ -f $(TARGET_SUBDIR)/libgcc-math/Makefile ] || exit 0 ; \ + r=`${PWD_COMMAND}`; export r; \ + s=`cd $(srcdir); ${PWD_COMMAND}`; export s; \ + $(NORMAL_TARGET_EXPORTS) \ + echo "Doing clean in $(TARGET_SUBDIR)/libgcc-math" ; \ + for flag in $(EXTRA_TARGET_FLAGS); do \ + eval `echo "$$flag" | sed -e "s|^\([^=]*\)=\(.*\)|\1='\2'; export \1|"`; \ + done; \ + (cd $(TARGET_SUBDIR)/libgcc-math && \ + $(MAKE) $(BASE_FLAGS_TO_PASS) "AR=$${AR}" "AS=$${AS}" \ + "CC=$${CC}" "CXX=$${CXX}" "LD=$${LD}" "NM=$${NM}" \ + "RANLIB=$${RANLIB}" \ + "DLLTOOL=$${DLLTOOL}" "WINDRES=$${WINDRES}" \ + clean) \ + || exit 1 + +@endif target-libgcc-math + +.PHONY: maybe-distclean-target-libgcc-math distclean-target-libgcc-math +maybe-distclean-target-libgcc-math: +@if target-libgcc-math +maybe-distclean-target-libgcc-math: distclean-target-libgcc-math + +distclean-target-libgcc-math: + @: $(MAKE); $(unstage) + @[ -f $(TARGET_SUBDIR)/libgcc-math/Makefile ] || exit 0 ; \ + r=`${PWD_COMMAND}`; export r; \ + s=`cd $(srcdir); ${PWD_COMMAND}`; export s; \ + $(NORMAL_TARGET_EXPORTS) \ + echo "Doing distclean in $(TARGET_SUBDIR)/libgcc-math" ; \ + for flag in $(EXTRA_TARGET_FLAGS); do \ + eval `echo "$$flag" | sed -e "s|^\([^=]*\)=\(.*\)|\1='\2'; export \1|"`; \ + done; \ + (cd $(TARGET_SUBDIR)/libgcc-math && \ + $(MAKE) $(BASE_FLAGS_TO_PASS) "AR=$${AR}" "AS=$${AS}" \ + "CC=$${CC}" "CXX=$${CXX}" "LD=$${LD}" "NM=$${NM}" \ + "RANLIB=$${RANLIB}" \ + "DLLTOOL=$${DLLTOOL}" "WINDRES=$${WINDRES}" \ + distclean) \ + || exit 1 + +@endif target-libgcc-math + +.PHONY: maybe-maintainer-clean-target-libgcc-math maintainer-clean-target-libgcc-math +maybe-maintainer-clean-target-libgcc-math: +@if target-libgcc-math +maybe-maintainer-clean-target-libgcc-math: maintainer-clean-target-libgcc-math + +maintainer-clean-target-libgcc-math: + @: $(MAKE); $(unstage) + @[ -f $(TARGET_SUBDIR)/libgcc-math/Makefile ] || exit 0 ; \ + r=`${PWD_COMMAND}`; export r; \ + s=`cd $(srcdir); ${PWD_COMMAND}`; export s; \ + $(NORMAL_TARGET_EXPORTS) \ + echo "Doing maintainer-clean in $(TARGET_SUBDIR)/libgcc-math" ; \ + for flag in $(EXTRA_TARGET_FLAGS); do \ + eval `echo "$$flag" | sed -e "s|^\([^=]*\)=\(.*\)|\1='\2'; export \1|"`; \ + done; \ + (cd $(TARGET_SUBDIR)/libgcc-math && \ + $(MAKE) $(BASE_FLAGS_TO_PASS) "AR=$${AR}" "AS=$${AS}" \ + "CC=$${CC}" "CXX=$${CXX}" "LD=$${LD}" "NM=$${NM}" \ + "RANLIB=$${RANLIB}" \ + "DLLTOOL=$${DLLTOOL}" "WINDRES=$${WINDRES}" \ + maintainer-clean) \ + || exit 1 + +@endif target-libgcc-math + + + + + .PHONY: configure-target-newlib maybe-configure-target-newlib maybe-configure-target-newlib: @if target-newlib @@ -37396,6 +37770,8 @@ configure-target-libmudflap: maybe-all-gcc configure-target-libssp: maybe-all-gcc +configure-target-libgcc-math: maybe-all-gcc + configure-target-newlib: maybe-all-gcc configure-target-libgfortran: maybe-all-gcc diff --git a/configure b/configure index 9b8e2b30fc3..421fe9386c5 100755 --- a/configure +++ b/configure @@ -15,6 +15,8 @@ ac_help="$ac_help --enable-libada Builds libada directory" ac_help="$ac_help --enable-libssp Builds libssp directory" +ac_help="$ac_help + --enable-libgcc-math Builds libgcc-math directory" ac_help="$ac_help --with-mpfr-dir=PATH Specify source directory for MPFR library" ac_help="$ac_help @@ -599,7 +601,7 @@ else { echo "configure: error: can not run $ac_config_sub" 1>&2; exit 1; } fi echo $ac_n "checking host system type""... $ac_c" 1>&6 -echo "configure:603: checking host system type" >&5 +echo "configure:605: checking host system type" >&5 host_alias=$host case "$host_alias" in @@ -620,7 +622,7 @@ host_os=`echo $host | sed 's/^\([^-]*\)-\([^-]*\)-\(.*\)$/\3/'` echo "$ac_t""$host" 1>&6 echo $ac_n "checking target system type""... $ac_c" 1>&6 -echo "configure:624: checking target system type" >&5 +echo "configure:626: checking target system type" >&5 target_alias=$target case "$target_alias" in @@ -638,7 +640,7 @@ target_os=`echo $target | sed 's/^\([^-]*\)-\([^-]*\)-\(.*\)$/\3/'` echo "$ac_t""$target" 1>&6 echo $ac_n "checking build system type""... $ac_c" 1>&6 -echo "configure:642: checking build system type" >&5 +echo "configure:644: checking build system type" >&5 build_alias=$build case "$build_alias" in @@ -693,7 +695,7 @@ test "$program_transform_name" = "" && program_transform_name="s,x,x," # SVR4 /usr/ucb/install, which tries to use the nonexistent group "staff" # ./install, which can be erroneously created by make from ./install.sh. echo $ac_n "checking for a BSD compatible install""... $ac_c" 1>&6 -echo "configure:697: checking for a BSD compatible install" >&5 +echo "configure:699: checking for a BSD compatible install" >&5 if test -z "$INSTALL"; then if eval "test \"`echo '$''{'ac_cv_path_install'+set}'`\" = set"; then echo $ac_n "(cached) $ac_c" 1>&6 @@ -746,7 +748,7 @@ test -z "$INSTALL_SCRIPT" && INSTALL_SCRIPT='${INSTALL_PROGRAM}' test -z "$INSTALL_DATA" && INSTALL_DATA='${INSTALL} -m 644' echo $ac_n "checking whether ln works""... $ac_c" 1>&6 -echo "configure:750: checking whether ln works" >&5 +echo "configure:752: checking whether ln works" >&5 if eval "test \"`echo '$''{'acx_cv_prog_LN'+set}'`\" = set"; then echo $ac_n "(cached) $ac_c" 1>&6 else @@ -770,7 +772,7 @@ else fi echo $ac_n "checking whether ln -s works""... $ac_c" 1>&6 -echo "configure:774: checking whether ln -s works" >&5 +echo "configure:776: checking whether ln -s works" >&5 if eval "test \"`echo '$''{'ac_cv_prog_LN_S'+set}'`\" = set"; then echo $ac_n "(cached) $ac_c" 1>&6 else @@ -909,6 +911,7 @@ target_libraries="target-libiberty \ target-libstdc++-v3 \ target-libmudflap \ target-libssp \ + target-libgcc-math \ target-libgfortran \ ${libgcj} \ target-libobjc \ @@ -1111,6 +1114,26 @@ if test "${ENABLE_LIBSSP}" != "yes" ; then noconfigdirs="$noconfigdirs target-libssp" fi +# Set the default so we build libgcc-math for ix86 and x86_64 +# Check whether --enable-libgcc-math or --disable-libgcc-math was given. +if test "${enable_libgcc_math+set}" = set; then + enableval="$enable_libgcc_math" + : +else + +case "${target}" in + i?86-* | x86_64-* ) + enable_libgcc_math=yes ;; + *) + enable_libgcc_math=no ;; +esac + +fi + +if test "${enable_libgcc_math}" != "yes"; then + noconfigdirs="$noconfigdirs target-libgcc-math" +fi + # Save it here so that, even in case of --enable-libgcj, if the Java # front-end isn't enabled, we still get libgcj disabled. libgcj_saved=$libgcj @@ -1855,7 +1878,7 @@ else # Extract the first word of "gcc", so it can be a program name with args. set dummy gcc; ac_word=$2 echo $ac_n "checking for $ac_word""... $ac_c" 1>&6 -echo "configure:1859: checking for $ac_word" >&5 +echo "configure:1882: checking for $ac_word" >&5 if eval "test \"`echo '$''{'ac_cv_prog_CC'+set}'`\" = set"; then echo $ac_n "(cached) $ac_c" 1>&6 else @@ -1885,7 +1908,7 @@ if test -z "$CC"; then # Extract the first word of "cc", so it can be a program name with args. set dummy cc; ac_word=$2 echo $ac_n "checking for $ac_word""... $ac_c" 1>&6 -echo "configure:1889: checking for $ac_word" >&5 +echo "configure:1912: checking for $ac_word" >&5 if eval "test \"`echo '$''{'ac_cv_prog_CC'+set}'`\" = set"; then echo $ac_n "(cached) $ac_c" 1>&6 else @@ -1936,7 +1959,7 @@ fi # Extract the first word of "cl", so it can be a program name with args. set dummy cl; ac_word=$2 echo $ac_n "checking for $ac_word""... $ac_c" 1>&6 -echo "configure:1940: checking for $ac_word" >&5 +echo "configure:1963: checking for $ac_word" >&5 if eval "test \"`echo '$''{'ac_cv_prog_CC'+set}'`\" = set"; then echo $ac_n "(cached) $ac_c" 1>&6 else @@ -1968,7 +1991,7 @@ fi fi echo $ac_n "checking whether the C compiler ($CC $CFLAGS $LDFLAGS) works""... $ac_c" 1>&6 -echo "configure:1972: checking whether the C compiler ($CC $CFLAGS $LDFLAGS) works" >&5 +echo "configure:1995: checking whether the C compiler ($CC $CFLAGS $LDFLAGS) works" >&5 ac_ext=c # CFLAGS is not in ac_cpp because -g, -O, etc. are not valid cpp options. @@ -1979,12 +2002,12 @@ cross_compiling=$ac_cv_prog_cc_cross cat > conftest.$ac_ext << EOF -#line 1983 "configure" +#line 2006 "configure" #include "confdefs.h" main(){return(0);} EOF -if { (eval echo configure:1988: \"$ac_link\") 1>&5; (eval $ac_link) 2>&5; } && test -s conftest${ac_exeext}; then +if { (eval echo configure:2011: \"$ac_link\") 1>&5; (eval $ac_link) 2>&5; } && test -s conftest${ac_exeext}; then ac_cv_prog_cc_works=yes # If we can't run a trivial program, we are probably using a cross compiler. if (./conftest; exit) 2>/dev/null; then @@ -2010,12 +2033,12 @@ if test $ac_cv_prog_cc_works = no; then { echo "configure: error: installation or configuration problem: C compiler cannot create executables." 1>&2; exit 1; } fi echo $ac_n "checking whether the C compiler ($CC $CFLAGS $LDFLAGS) is a cross-compiler""... $ac_c" 1>&6 -echo "configure:2014: checking whether the C compiler ($CC $CFLAGS $LDFLAGS) is a cross-compiler" >&5 +echo "configure:2037: checking whether the C compiler ($CC $CFLAGS $LDFLAGS) is a cross-compiler" >&5 echo "$ac_t""$ac_cv_prog_cc_cross" 1>&6 cross_compiling=$ac_cv_prog_cc_cross echo $ac_n "checking whether we are using GNU C""... $ac_c" 1>&6 -echo "configure:2019: checking whether we are using GNU C" >&5 +echo "configure:2042: checking whether we are using GNU C" >&5 if eval "test \"`echo '$''{'ac_cv_prog_gcc'+set}'`\" = set"; then echo $ac_n "(cached) $ac_c" 1>&6 else @@ -2024,7 +2047,7 @@ else yes; #endif EOF -if { ac_try='${CC-cc} -E conftest.c'; { (eval echo configure:2028: \"$ac_try\") 1>&5; (eval $ac_try) 2>&5; }; } | egrep yes >/dev/null 2>&1; then +if { ac_try='${CC-cc} -E conftest.c'; { (eval echo configure:2051: \"$ac_try\") 1>&5; (eval $ac_try) 2>&5; }; } | egrep yes >/dev/null 2>&1; then ac_cv_prog_gcc=yes else ac_cv_prog_gcc=no @@ -2043,7 +2066,7 @@ ac_test_CFLAGS="${CFLAGS+set}" ac_save_CFLAGS="$CFLAGS" CFLAGS= echo $ac_n "checking whether ${CC-cc} accepts -g""... $ac_c" 1>&6 -echo "configure:2047: checking whether ${CC-cc} accepts -g" >&5 +echo "configure:2070: checking whether ${CC-cc} accepts -g" >&5 if eval "test \"`echo '$''{'ac_cv_prog_cc_g'+set}'`\" = set"; then echo $ac_n "(cached) $ac_c" 1>&6 else @@ -2110,7 +2133,7 @@ fi # Extract the first word of "${ac_tool_prefix}gnatbind", so it can be a program name with args. set dummy ${ac_tool_prefix}gnatbind; ac_word=$2 echo $ac_n "checking for $ac_word""... $ac_c" 1>&6 -echo "configure:2114: checking for $ac_word" >&5 +echo "configure:2137: checking for $ac_word" >&5 if eval "test \"`echo '$''{'ac_cv_prog_GNATBIND'+set}'`\" = set"; then echo $ac_n "(cached) $ac_c" 1>&6 else @@ -2142,7 +2165,7 @@ if test -n "$ac_tool_prefix"; then # Extract the first word of "gnatbind", so it can be a program name with args. set dummy gnatbind; ac_word=$2 echo $ac_n "checking for $ac_word""... $ac_c" 1>&6 -echo "configure:2146: checking for $ac_word" >&5 +echo "configure:2169: checking for $ac_word" >&5 if eval "test \"`echo '$''{'ac_cv_prog_GNATBIND'+set}'`\" = set"; then echo $ac_n "(cached) $ac_c" 1>&6 else @@ -2175,7 +2198,7 @@ fi fi echo $ac_n "checking whether compiler driver understands Ada""... $ac_c" 1>&6 -echo "configure:2179: checking whether compiler driver understands Ada" >&5 +echo "configure:2202: checking whether compiler driver understands Ada" >&5 if eval "test \"`echo '$''{'acx_cv_cc_gcc_supports_ada'+set}'`\" = set"; then echo $ac_n "(cached) $ac_c" 1>&6 else @@ -2207,7 +2230,7 @@ else fi echo $ac_n "checking how to compare bootstrapped objects""... $ac_c" 1>&6 -echo "configure:2211: checking how to compare bootstrapped objects" >&5 +echo "configure:2234: checking how to compare bootstrapped objects" >&5 if eval "test \"`echo '$''{'gcc_cv_prog_cmp_skip'+set}'`\" = set"; then echo $ac_n "(cached) $ac_c" 1>&6 else @@ -2305,9 +2328,9 @@ saved_CFLAGS="$CFLAGS" CFLAGS="$CFLAGS $gmpinc" # Check GMP actually works echo $ac_n "checking for correct version of gmp.h""... $ac_c" 1>&6 -echo "configure:2309: checking for correct version of gmp.h" >&5 +echo "configure:2332: checking for correct version of gmp.h" >&5 cat > conftest.$ac_ext <&5; (eval $ac_compile) 2>&5; }; then +if { (eval echo configure:2345: \"$ac_compile\") 1>&5; (eval $ac_compile) 2>&5; }; then rm -rf conftest* echo "$ac_t""yes" 1>&6 else @@ -2331,12 +2354,12 @@ rm -f conftest* if test x"$have_gmp" = xyes; then echo $ac_n "checking for MPFR""... $ac_c" 1>&6 -echo "configure:2335: checking for MPFR" >&5 +echo "configure:2358: checking for MPFR" >&5 saved_LIBS="$LIBS" LIBS="$LIBS $gmplibs" cat > conftest.$ac_ext < #include @@ -2344,7 +2367,7 @@ int main() { mpfr_t n; mpfr_init(n); ; return 0; } EOF -if { (eval echo configure:2348: \"$ac_link\") 1>&5; (eval $ac_link) 2>&5; } && test -s conftest${ac_exeext}; then +if { (eval echo configure:2371: \"$ac_link\") 1>&5; (eval $ac_link) 2>&5; } && test -s conftest${ac_exeext}; then rm -rf conftest* echo "$ac_t""yes" 1>&6 else @@ -3389,7 +3412,7 @@ do # Extract the first word of "$ac_prog", so it can be a program name with args. set dummy $ac_prog; ac_word=$2 echo $ac_n "checking for $ac_word""... $ac_c" 1>&6 -echo "configure:3393: checking for $ac_word" >&5 +echo "configure:3416: checking for $ac_word" >&5 if eval "test \"`echo '$''{'ac_cv_prog_YACC'+set}'`\" = set"; then echo $ac_n "(cached) $ac_c" 1>&6 else @@ -3429,7 +3452,7 @@ do # Extract the first word of "$ac_prog", so it can be a program name with args. set dummy $ac_prog; ac_word=$2 echo $ac_n "checking for $ac_word""... $ac_c" 1>&6 -echo "configure:3433: checking for $ac_word" >&5 +echo "configure:3456: checking for $ac_word" >&5 if eval "test \"`echo '$''{'ac_cv_prog_BISON'+set}'`\" = set"; then echo $ac_n "(cached) $ac_c" 1>&6 else @@ -3468,7 +3491,7 @@ do # Extract the first word of "$ac_prog", so it can be a program name with args. set dummy $ac_prog; ac_word=$2 echo $ac_n "checking for $ac_word""... $ac_c" 1>&6 -echo "configure:3472: checking for $ac_word" >&5 +echo "configure:3495: checking for $ac_word" >&5 if eval "test \"`echo '$''{'ac_cv_prog_M4'+set}'`\" = set"; then echo $ac_n "(cached) $ac_c" 1>&6 else @@ -3507,7 +3530,7 @@ do # Extract the first word of "$ac_prog", so it can be a program name with args. set dummy $ac_prog; ac_word=$2 echo $ac_n "checking for $ac_word""... $ac_c" 1>&6 -echo "configure:3511: checking for $ac_word" >&5 +echo "configure:3534: checking for $ac_word" >&5 if eval "test \"`echo '$''{'ac_cv_prog_LEX'+set}'`\" = set"; then echo $ac_n "(cached) $ac_c" 1>&6 else @@ -3547,7 +3570,7 @@ do # Extract the first word of "$ac_prog", so it can be a program name with args. set dummy $ac_prog; ac_word=$2 echo $ac_n "checking for $ac_word""... $ac_c" 1>&6 -echo "configure:3551: checking for $ac_word" >&5 +echo "configure:3574: checking for $ac_word" >&5 if eval "test \"`echo '$''{'ac_cv_prog_FLEX'+set}'`\" = set"; then echo $ac_n "(cached) $ac_c" 1>&6 else @@ -3586,7 +3609,7 @@ do # Extract the first word of "$ac_prog", so it can be a program name with args. set dummy $ac_prog; ac_word=$2 echo $ac_n "checking for $ac_word""... $ac_c" 1>&6 -echo "configure:3590: checking for $ac_word" >&5 +echo "configure:3613: checking for $ac_word" >&5 if eval "test \"`echo '$''{'ac_cv_prog_MAKEINFO'+set}'`\" = set"; then echo $ac_n "(cached) $ac_c" 1>&6 else @@ -3639,7 +3662,7 @@ do # Extract the first word of "$ac_prog", so it can be a program name with args. set dummy $ac_prog; ac_word=$2 echo $ac_n "checking for $ac_word""... $ac_c" 1>&6 -echo "configure:3643: checking for $ac_word" >&5 +echo "configure:3666: checking for $ac_word" >&5 if eval "test \"`echo '$''{'ac_cv_prog_EXPECT'+set}'`\" = set"; then echo $ac_n "(cached) $ac_c" 1>&6 else @@ -3680,7 +3703,7 @@ do # Extract the first word of "$ac_prog", so it can be a program name with args. set dummy $ac_prog; ac_word=$2 echo $ac_n "checking for $ac_word""... $ac_c" 1>&6 -echo "configure:3684: checking for $ac_word" >&5 +echo "configure:3707: checking for $ac_word" >&5 if eval "test \"`echo '$''{'ac_cv_prog_RUNTEST'+set}'`\" = set"; then echo $ac_n "(cached) $ac_c" 1>&6 else @@ -3728,7 +3751,7 @@ test -n "$target_alias" && ncn_target_tool_prefix=$target_alias- # Extract the first word of "${ncn_tool_prefix}${ncn_progname}", so it can be a program name with args. set dummy ${ncn_tool_prefix}${ncn_progname}; ac_word=$2 echo $ac_n "checking for $ac_word""... $ac_c" 1>&6 -echo "configure:3732: checking for $ac_word" >&5 +echo "configure:3755: checking for $ac_word" >&5 if eval "test \"`echo '$''{'ac_cv_prog_AR'+set}'`\" = set"; then echo $ac_n "(cached) $ac_c" 1>&6 else @@ -3759,7 +3782,7 @@ fi # Extract the first word of "${ncn_progname}", so it can be a program name with args. set dummy ${ncn_progname}; ac_word=$2 echo $ac_n "checking for $ac_word""... $ac_c" 1>&6 -echo "configure:3763: checking for $ac_word" >&5 +echo "configure:3786: checking for $ac_word" >&5 if eval "test \"`echo '$''{'ac_cv_prog_AR'+set}'`\" = set"; then echo $ac_n "(cached) $ac_c" 1>&6 else @@ -3803,7 +3826,7 @@ fi # Extract the first word of "${ncn_tool_prefix}${ncn_progname}", so it can be a program name with args. set dummy ${ncn_tool_prefix}${ncn_progname}; ac_word=$2 echo $ac_n "checking for $ac_word""... $ac_c" 1>&6 -echo "configure:3807: checking for $ac_word" >&5 +echo "configure:3830: checking for $ac_word" >&5 if eval "test \"`echo '$''{'ac_cv_prog_AS'+set}'`\" = set"; then echo $ac_n "(cached) $ac_c" 1>&6 else @@ -3834,7 +3857,7 @@ fi # Extract the first word of "${ncn_progname}", so it can be a program name with args. set dummy ${ncn_progname}; ac_word=$2 echo $ac_n "checking for $ac_word""... $ac_c" 1>&6 -echo "configure:3838: checking for $ac_word" >&5 +echo "configure:3861: checking for $ac_word" >&5 if eval "test \"`echo '$''{'ac_cv_prog_AS'+set}'`\" = set"; then echo $ac_n "(cached) $ac_c" 1>&6 else @@ -3878,7 +3901,7 @@ fi # Extract the first word of "${ncn_tool_prefix}${ncn_progname}", so it can be a program name with args. set dummy ${ncn_tool_prefix}${ncn_progname}; ac_word=$2 echo $ac_n "checking for $ac_word""... $ac_c" 1>&6 -echo "configure:3882: checking for $ac_word" >&5 +echo "configure:3905: checking for $ac_word" >&5 if eval "test \"`echo '$''{'ac_cv_prog_DLLTOOL'+set}'`\" = set"; then echo $ac_n "(cached) $ac_c" 1>&6 else @@ -3909,7 +3932,7 @@ fi # Extract the first word of "${ncn_progname}", so it can be a program name with args. set dummy ${ncn_progname}; ac_word=$2 echo $ac_n "checking for $ac_word""... $ac_c" 1>&6 -echo "configure:3913: checking for $ac_word" >&5 +echo "configure:3936: checking for $ac_word" >&5 if eval "test \"`echo '$''{'ac_cv_prog_DLLTOOL'+set}'`\" = set"; then echo $ac_n "(cached) $ac_c" 1>&6 else @@ -3953,7 +3976,7 @@ fi # Extract the first word of "${ncn_tool_prefix}${ncn_progname}", so it can be a program name with args. set dummy ${ncn_tool_prefix}${ncn_progname}; ac_word=$2 echo $ac_n "checking for $ac_word""... $ac_c" 1>&6 -echo "configure:3957: checking for $ac_word" >&5 +echo "configure:3980: checking for $ac_word" >&5 if eval "test \"`echo '$''{'ac_cv_prog_LD'+set}'`\" = set"; then echo $ac_n "(cached) $ac_c" 1>&6 else @@ -3984,7 +4007,7 @@ fi # Extract the first word of "${ncn_progname}", so it can be a program name with args. set dummy ${ncn_progname}; ac_word=$2 echo $ac_n "checking for $ac_word""... $ac_c" 1>&6 -echo "configure:3988: checking for $ac_word" >&5 +echo "configure:4011: checking for $ac_word" >&5 if eval "test \"`echo '$''{'ac_cv_prog_LD'+set}'`\" = set"; then echo $ac_n "(cached) $ac_c" 1>&6 else @@ -4028,7 +4051,7 @@ fi # Extract the first word of "${ncn_tool_prefix}${ncn_progname}", so it can be a program name with args. set dummy ${ncn_tool_prefix}${ncn_progname}; ac_word=$2 echo $ac_n "checking for $ac_word""... $ac_c" 1>&6 -echo "configure:4032: checking for $ac_word" >&5 +echo "configure:4055: checking for $ac_word" >&5 if eval "test \"`echo '$''{'ac_cv_prog_LIPO'+set}'`\" = set"; then echo $ac_n "(cached) $ac_c" 1>&6 else @@ -4059,7 +4082,7 @@ fi # Extract the first word of "${ncn_progname}", so it can be a program name with args. set dummy ${ncn_progname}; ac_word=$2 echo $ac_n "checking for $ac_word""... $ac_c" 1>&6 -echo "configure:4063: checking for $ac_word" >&5 +echo "configure:4086: checking for $ac_word" >&5 if eval "test \"`echo '$''{'ac_cv_prog_LIPO'+set}'`\" = set"; then echo $ac_n "(cached) $ac_c" 1>&6 else @@ -4103,7 +4126,7 @@ fi # Extract the first word of "${ncn_tool_prefix}${ncn_progname}", so it can be a program name with args. set dummy ${ncn_tool_prefix}${ncn_progname}; ac_word=$2 echo $ac_n "checking for $ac_word""... $ac_c" 1>&6 -echo "configure:4107: checking for $ac_word" >&5 +echo "configure:4130: checking for $ac_word" >&5 if eval "test \"`echo '$''{'ac_cv_prog_NM'+set}'`\" = set"; then echo $ac_n "(cached) $ac_c" 1>&6 else @@ -4134,7 +4157,7 @@ fi # Extract the first word of "${ncn_progname}", so it can be a program name with args. set dummy ${ncn_progname}; ac_word=$2 echo $ac_n "checking for $ac_word""... $ac_c" 1>&6 -echo "configure:4138: checking for $ac_word" >&5 +echo "configure:4161: checking for $ac_word" >&5 if eval "test \"`echo '$''{'ac_cv_prog_NM'+set}'`\" = set"; then echo $ac_n "(cached) $ac_c" 1>&6 else @@ -4178,7 +4201,7 @@ fi # Extract the first word of "${ncn_tool_prefix}${ncn_progname}", so it can be a program name with args. set dummy ${ncn_tool_prefix}${ncn_progname}; ac_word=$2 echo $ac_n "checking for $ac_word""... $ac_c" 1>&6 -echo "configure:4182: checking for $ac_word" >&5 +echo "configure:4205: checking for $ac_word" >&5 if eval "test \"`echo '$''{'ac_cv_prog_RANLIB'+set}'`\" = set"; then echo $ac_n "(cached) $ac_c" 1>&6 else @@ -4209,7 +4232,7 @@ fi # Extract the first word of "${ncn_progname}", so it can be a program name with args. set dummy ${ncn_progname}; ac_word=$2 echo $ac_n "checking for $ac_word""... $ac_c" 1>&6 -echo "configure:4213: checking for $ac_word" >&5 +echo "configure:4236: checking for $ac_word" >&5 if eval "test \"`echo '$''{'ac_cv_prog_RANLIB'+set}'`\" = set"; then echo $ac_n "(cached) $ac_c" 1>&6 else @@ -4248,7 +4271,7 @@ fi # Extract the first word of "${ncn_tool_prefix}${ncn_progname}", so it can be a program name with args. set dummy ${ncn_tool_prefix}${ncn_progname}; ac_word=$2 echo $ac_n "checking for $ac_word""... $ac_c" 1>&6 -echo "configure:4252: checking for $ac_word" >&5 +echo "configure:4275: checking for $ac_word" >&5 if eval "test \"`echo '$''{'ac_cv_prog_STRIP'+set}'`\" = set"; then echo $ac_n "(cached) $ac_c" 1>&6 else @@ -4279,7 +4302,7 @@ fi # Extract the first word of "${ncn_progname}", so it can be a program name with args. set dummy ${ncn_progname}; ac_word=$2 echo $ac_n "checking for $ac_word""... $ac_c" 1>&6 -echo "configure:4283: checking for $ac_word" >&5 +echo "configure:4306: checking for $ac_word" >&5 if eval "test \"`echo '$''{'ac_cv_prog_STRIP'+set}'`\" = set"; then echo $ac_n "(cached) $ac_c" 1>&6 else @@ -4318,7 +4341,7 @@ fi # Extract the first word of "${ncn_tool_prefix}${ncn_progname}", so it can be a program name with args. set dummy ${ncn_tool_prefix}${ncn_progname}; ac_word=$2 echo $ac_n "checking for $ac_word""... $ac_c" 1>&6 -echo "configure:4322: checking for $ac_word" >&5 +echo "configure:4345: checking for $ac_word" >&5 if eval "test \"`echo '$''{'ac_cv_prog_WINDRES'+set}'`\" = set"; then echo $ac_n "(cached) $ac_c" 1>&6 else @@ -4349,7 +4372,7 @@ fi # Extract the first word of "${ncn_progname}", so it can be a program name with args. set dummy ${ncn_progname}; ac_word=$2 echo $ac_n "checking for $ac_word""... $ac_c" 1>&6 -echo "configure:4353: checking for $ac_word" >&5 +echo "configure:4376: checking for $ac_word" >&5 if eval "test \"`echo '$''{'ac_cv_prog_WINDRES'+set}'`\" = set"; then echo $ac_n "(cached) $ac_c" 1>&6 else @@ -4393,7 +4416,7 @@ fi # Extract the first word of "${ncn_tool_prefix}${ncn_progname}", so it can be a program name with args. set dummy ${ncn_tool_prefix}${ncn_progname}; ac_word=$2 echo $ac_n "checking for $ac_word""... $ac_c" 1>&6 -echo "configure:4397: checking for $ac_word" >&5 +echo "configure:4420: checking for $ac_word" >&5 if eval "test \"`echo '$''{'ac_cv_prog_OBJCOPY'+set}'`\" = set"; then echo $ac_n "(cached) $ac_c" 1>&6 else @@ -4424,7 +4447,7 @@ fi # Extract the first word of "${ncn_progname}", so it can be a program name with args. set dummy ${ncn_progname}; ac_word=$2 echo $ac_n "checking for $ac_word""... $ac_c" 1>&6 -echo "configure:4428: checking for $ac_word" >&5 +echo "configure:4451: checking for $ac_word" >&5 if eval "test \"`echo '$''{'ac_cv_prog_OBJCOPY'+set}'`\" = set"; then echo $ac_n "(cached) $ac_c" 1>&6 else @@ -4468,7 +4491,7 @@ fi # Extract the first word of "${ncn_tool_prefix}${ncn_progname}", so it can be a program name with args. set dummy ${ncn_tool_prefix}${ncn_progname}; ac_word=$2 echo $ac_n "checking for $ac_word""... $ac_c" 1>&6 -echo "configure:4472: checking for $ac_word" >&5 +echo "configure:4495: checking for $ac_word" >&5 if eval "test \"`echo '$''{'ac_cv_prog_OBJDUMP'+set}'`\" = set"; then echo $ac_n "(cached) $ac_c" 1>&6 else @@ -4499,7 +4522,7 @@ fi # Extract the first word of "${ncn_progname}", so it can be a program name with args. set dummy ${ncn_progname}; ac_word=$2 echo $ac_n "checking for $ac_word""... $ac_c" 1>&6 -echo "configure:4503: checking for $ac_word" >&5 +echo "configure:4526: checking for $ac_word" >&5 if eval "test \"`echo '$''{'ac_cv_prog_OBJDUMP'+set}'`\" = set"; then echo $ac_n "(cached) $ac_c" 1>&6 else @@ -4563,7 +4586,7 @@ fi if test -n "$with_build_time_tools"; then for ncn_progname in cc gcc; do echo $ac_n "checking for ${ncn_progname} in $with_build_time_tools""... $ac_c" 1>&6 -echo "configure:4567: checking for ${ncn_progname} in $with_build_time_tools" >&5 +echo "configure:4590: checking for ${ncn_progname} in $with_build_time_tools" >&5 if test -x $with_build_time_tools/CC_FOR_TARGET; then ac_cv_prog_CC_FOR_TARGET=$with_build_time_tools/CC_FOR_TARGET echo "$ac_t""yes" 1>&6 @@ -4580,7 +4603,7 @@ if test -z "$ac_cv_prog_CC_FOR_TARGET"; then # Extract the first word of "${ncn_target_tool_prefix}${ncn_progname}", so it can be a program name with args. set dummy ${ncn_target_tool_prefix}${ncn_progname}; ac_word=$2 echo $ac_n "checking for $ac_word""... $ac_c" 1>&6 -echo "configure:4584: checking for $ac_word" >&5 +echo "configure:4607: checking for $ac_word" >&5 if eval "test \"`echo '$''{'ac_cv_prog_CC_FOR_TARGET'+set}'`\" = set"; then echo $ac_n "(cached) $ac_c" 1>&6 else @@ -4611,7 +4634,7 @@ fi # Extract the first word of "${ncn_progname}", so it can be a program name with args. set dummy ${ncn_progname}; ac_word=$2 echo $ac_n "checking for $ac_word""... $ac_c" 1>&6 -echo "configure:4615: checking for $ac_word" >&5 +echo "configure:4638: checking for $ac_word" >&5 if eval "test \"`echo '$''{'ac_cv_prog_CC_FOR_TARGET'+set}'`\" = set"; then echo $ac_n "(cached) $ac_c" 1>&6 else @@ -4654,7 +4677,7 @@ fi if test -n "$with_build_time_tools"; then for ncn_progname in c++ g++ cxx gxx; do echo $ac_n "checking for ${ncn_progname} in $with_build_time_tools""... $ac_c" 1>&6 -echo "configure:4658: checking for ${ncn_progname} in $with_build_time_tools" >&5 +echo "configure:4681: checking for ${ncn_progname} in $with_build_time_tools" >&5 if test -x $with_build_time_tools/CXX_FOR_TARGET; then ac_cv_prog_CXX_FOR_TARGET=$with_build_time_tools/CXX_FOR_TARGET echo "$ac_t""yes" 1>&6 @@ -4671,7 +4694,7 @@ if test -z "$ac_cv_prog_CXX_FOR_TARGET"; then # Extract the first word of "${ncn_target_tool_prefix}${ncn_progname}", so it can be a program name with args. set dummy ${ncn_target_tool_prefix}${ncn_progname}; ac_word=$2 echo $ac_n "checking for $ac_word""... $ac_c" 1>&6 -echo "configure:4675: checking for $ac_word" >&5 +echo "configure:4698: checking for $ac_word" >&5 if eval "test \"`echo '$''{'ac_cv_prog_CXX_FOR_TARGET'+set}'`\" = set"; then echo $ac_n "(cached) $ac_c" 1>&6 else @@ -4702,7 +4725,7 @@ fi # Extract the first word of "${ncn_progname}", so it can be a program name with args. set dummy ${ncn_progname}; ac_word=$2 echo $ac_n "checking for $ac_word""... $ac_c" 1>&6 -echo "configure:4706: checking for $ac_word" >&5 +echo "configure:4729: checking for $ac_word" >&5 if eval "test \"`echo '$''{'ac_cv_prog_CXX_FOR_TARGET'+set}'`\" = set"; then echo $ac_n "(cached) $ac_c" 1>&6 else @@ -4745,7 +4768,7 @@ fi if test -n "$with_build_time_tools"; then for ncn_progname in gcc; do echo $ac_n "checking for ${ncn_progname} in $with_build_time_tools""... $ac_c" 1>&6 -echo "configure:4749: checking for ${ncn_progname} in $with_build_time_tools" >&5 +echo "configure:4772: checking for ${ncn_progname} in $with_build_time_tools" >&5 if test -x $with_build_time_tools/GCC_FOR_TARGET; then ac_cv_prog_GCC_FOR_TARGET=$with_build_time_tools/GCC_FOR_TARGET echo "$ac_t""yes" 1>&6 @@ -4762,7 +4785,7 @@ if test -z "$ac_cv_prog_GCC_FOR_TARGET"; then # Extract the first word of "${ncn_target_tool_prefix}${ncn_progname}", so it can be a program name with args. set dummy ${ncn_target_tool_prefix}${ncn_progname}; ac_word=$2 echo $ac_n "checking for $ac_word""... $ac_c" 1>&6 -echo "configure:4766: checking for $ac_word" >&5 +echo "configure:4789: checking for $ac_word" >&5 if eval "test \"`echo '$''{'ac_cv_prog_GCC_FOR_TARGET'+set}'`\" = set"; then echo $ac_n "(cached) $ac_c" 1>&6 else @@ -4793,7 +4816,7 @@ fi # Extract the first word of "${ncn_progname}", so it can be a program name with args. set dummy ${ncn_progname}; ac_word=$2 echo $ac_n "checking for $ac_word""... $ac_c" 1>&6 -echo "configure:4797: checking for $ac_word" >&5 +echo "configure:4820: checking for $ac_word" >&5 if eval "test \"`echo '$''{'ac_cv_prog_GCC_FOR_TARGET'+set}'`\" = set"; then echo $ac_n "(cached) $ac_c" 1>&6 else @@ -4831,7 +4854,7 @@ fi if test -n "$with_build_time_tools"; then for ncn_progname in gcj; do echo $ac_n "checking for ${ncn_progname} in $with_build_time_tools""... $ac_c" 1>&6 -echo "configure:4835: checking for ${ncn_progname} in $with_build_time_tools" >&5 +echo "configure:4858: checking for ${ncn_progname} in $with_build_time_tools" >&5 if test -x $with_build_time_tools/GCJ_FOR_TARGET; then ac_cv_prog_GCJ_FOR_TARGET=$with_build_time_tools/GCJ_FOR_TARGET echo "$ac_t""yes" 1>&6 @@ -4848,7 +4871,7 @@ if test -z "$ac_cv_prog_GCJ_FOR_TARGET"; then # Extract the first word of "${ncn_target_tool_prefix}${ncn_progname}", so it can be a program name with args. set dummy ${ncn_target_tool_prefix}${ncn_progname}; ac_word=$2 echo $ac_n "checking for $ac_word""... $ac_c" 1>&6 -echo "configure:4852: checking for $ac_word" >&5 +echo "configure:4875: checking for $ac_word" >&5 if eval "test \"`echo '$''{'ac_cv_prog_GCJ_FOR_TARGET'+set}'`\" = set"; then echo $ac_n "(cached) $ac_c" 1>&6 else @@ -4879,7 +4902,7 @@ fi # Extract the first word of "${ncn_progname}", so it can be a program name with args. set dummy ${ncn_progname}; ac_word=$2 echo $ac_n "checking for $ac_word""... $ac_c" 1>&6 -echo "configure:4883: checking for $ac_word" >&5 +echo "configure:4906: checking for $ac_word" >&5 if eval "test \"`echo '$''{'ac_cv_prog_GCJ_FOR_TARGET'+set}'`\" = set"; then echo $ac_n "(cached) $ac_c" 1>&6 else @@ -4922,7 +4945,7 @@ fi if test -n "$with_build_time_tools"; then for ncn_progname in gfortran; do echo $ac_n "checking for ${ncn_progname} in $with_build_time_tools""... $ac_c" 1>&6 -echo "configure:4926: checking for ${ncn_progname} in $with_build_time_tools" >&5 +echo "configure:4949: checking for ${ncn_progname} in $with_build_time_tools" >&5 if test -x $with_build_time_tools/GFORTRAN_FOR_TARGET; then ac_cv_prog_GFORTRAN_FOR_TARGET=$with_build_time_tools/GFORTRAN_FOR_TARGET echo "$ac_t""yes" 1>&6 @@ -4939,7 +4962,7 @@ if test -z "$ac_cv_prog_GFORTRAN_FOR_TARGET"; then # Extract the first word of "${ncn_target_tool_prefix}${ncn_progname}", so it can be a program name with args. set dummy ${ncn_target_tool_prefix}${ncn_progname}; ac_word=$2 echo $ac_n "checking for $ac_word""... $ac_c" 1>&6 -echo "configure:4943: checking for $ac_word" >&5 +echo "configure:4966: checking for $ac_word" >&5 if eval "test \"`echo '$''{'ac_cv_prog_GFORTRAN_FOR_TARGET'+set}'`\" = set"; then echo $ac_n "(cached) $ac_c" 1>&6 else @@ -4970,7 +4993,7 @@ fi # Extract the first word of "${ncn_progname}", so it can be a program name with args. set dummy ${ncn_progname}; ac_word=$2 echo $ac_n "checking for $ac_word""... $ac_c" 1>&6 -echo "configure:4974: checking for $ac_word" >&5 +echo "configure:4997: checking for $ac_word" >&5 if eval "test \"`echo '$''{'ac_cv_prog_GFORTRAN_FOR_TARGET'+set}'`\" = set"; then echo $ac_n "(cached) $ac_c" 1>&6 else @@ -5077,7 +5100,7 @@ rm conftest.c if test -z "$ac_cv_path_AR_FOR_TARGET" ; then if test -n "$with_build_time_tools"; then echo $ac_n "checking for ${ncn_target_tool_prefix}${ncn_progname} in $with_build_time_tools""... $ac_c" 1>&6 -echo "configure:5081: checking for ${ncn_target_tool_prefix}${ncn_progname} in $with_build_time_tools" >&5 +echo "configure:5104: checking for ${ncn_target_tool_prefix}${ncn_progname} in $with_build_time_tools" >&5 AR_FOR_TARGET=`cd $with_build_time_tools && pwd`/AR_FOR_TARGET ac_cv_path_AR_FOR_TARGET=$AR_FOR_TARGET echo "$ac_t""$ac_cv_path_AR_FOR_TARGET" 1>&6 @@ -5091,7 +5114,7 @@ if test -z "$ac_cv_path_AR_FOR_TARGET" ; then # Extract the first word of "ar", so it can be a program name with args. set dummy ar; ac_word=$2 echo $ac_n "checking for $ac_word""... $ac_c" 1>&6 -echo "configure:5095: checking for $ac_word" >&5 +echo "configure:5118: checking for $ac_word" >&5 if eval "test \"`echo '$''{'ac_cv_path_AR_FOR_TARGET'+set}'`\" = set"; then echo $ac_n "(cached) $ac_c" 1>&6 else @@ -5128,7 +5151,7 @@ if test -z "$ac_cv_path_AR_FOR_TARGET" ; then if test -n "$with_build_time_tools"; then for ncn_progname in ar; do echo $ac_n "checking for ${ncn_progname} in $with_build_time_tools""... $ac_c" 1>&6 -echo "configure:5132: checking for ${ncn_progname} in $with_build_time_tools" >&5 +echo "configure:5155: checking for ${ncn_progname} in $with_build_time_tools" >&5 if test -x $with_build_time_tools/AR_FOR_TARGET; then ac_cv_prog_AR_FOR_TARGET=$with_build_time_tools/AR_FOR_TARGET echo "$ac_t""yes" 1>&6 @@ -5145,7 +5168,7 @@ if test -z "$ac_cv_prog_AR_FOR_TARGET"; then # Extract the first word of "${ncn_target_tool_prefix}${ncn_progname}", so it can be a program name with args. set dummy ${ncn_target_tool_prefix}${ncn_progname}; ac_word=$2 echo $ac_n "checking for $ac_word""... $ac_c" 1>&6 -echo "configure:5149: checking for $ac_word" >&5 +echo "configure:5172: checking for $ac_word" >&5 if eval "test \"`echo '$''{'ac_cv_prog_AR_FOR_TARGET'+set}'`\" = set"; then echo $ac_n "(cached) $ac_c" 1>&6 else @@ -5176,7 +5199,7 @@ fi # Extract the first word of "${ncn_progname}", so it can be a program name with args. set dummy ${ncn_progname}; ac_word=$2 echo $ac_n "checking for $ac_word""... $ac_c" 1>&6 -echo "configure:5180: checking for $ac_word" >&5 +echo "configure:5203: checking for $ac_word" >&5 if eval "test \"`echo '$''{'ac_cv_prog_AR_FOR_TARGET'+set}'`\" = set"; then echo $ac_n "(cached) $ac_c" 1>&6 else @@ -5224,7 +5247,7 @@ fi if test -z "$ac_cv_path_AS_FOR_TARGET" ; then if test -n "$with_build_time_tools"; then echo $ac_n "checking for ${ncn_target_tool_prefix}${ncn_progname} in $with_build_time_tools""... $ac_c" 1>&6 -echo "configure:5228: checking for ${ncn_target_tool_prefix}${ncn_progname} in $with_build_time_tools" >&5 +echo "configure:5251: checking for ${ncn_target_tool_prefix}${ncn_progname} in $with_build_time_tools" >&5 AS_FOR_TARGET=`cd $with_build_time_tools && pwd`/AS_FOR_TARGET ac_cv_path_AS_FOR_TARGET=$AS_FOR_TARGET echo "$ac_t""$ac_cv_path_AS_FOR_TARGET" 1>&6 @@ -5238,7 +5261,7 @@ if test -z "$ac_cv_path_AS_FOR_TARGET" ; then # Extract the first word of "as", so it can be a program name with args. set dummy as; ac_word=$2 echo $ac_n "checking for $ac_word""... $ac_c" 1>&6 -echo "configure:5242: checking for $ac_word" >&5 +echo "configure:5265: checking for $ac_word" >&5 if eval "test \"`echo '$''{'ac_cv_path_AS_FOR_TARGET'+set}'`\" = set"; then echo $ac_n "(cached) $ac_c" 1>&6 else @@ -5275,7 +5298,7 @@ if test -z "$ac_cv_path_AS_FOR_TARGET" ; then if test -n "$with_build_time_tools"; then for ncn_progname in as; do echo $ac_n "checking for ${ncn_progname} in $with_build_time_tools""... $ac_c" 1>&6 -echo "configure:5279: checking for ${ncn_progname} in $with_build_time_tools" >&5 +echo "configure:5302: checking for ${ncn_progname} in $with_build_time_tools" >&5 if test -x $with_build_time_tools/AS_FOR_TARGET; then ac_cv_prog_AS_FOR_TARGET=$with_build_time_tools/AS_FOR_TARGET echo "$ac_t""yes" 1>&6 @@ -5292,7 +5315,7 @@ if test -z "$ac_cv_prog_AS_FOR_TARGET"; then # Extract the first word of "${ncn_target_tool_prefix}${ncn_progname}", so it can be a program name with args. set dummy ${ncn_target_tool_prefix}${ncn_progname}; ac_word=$2 echo $ac_n "checking for $ac_word""... $ac_c" 1>&6 -echo "configure:5296: checking for $ac_word" >&5 +echo "configure:5319: checking for $ac_word" >&5 if eval "test \"`echo '$''{'ac_cv_prog_AS_FOR_TARGET'+set}'`\" = set"; then echo $ac_n "(cached) $ac_c" 1>&6 else @@ -5323,7 +5346,7 @@ fi # Extract the first word of "${ncn_progname}", so it can be a program name with args. set dummy ${ncn_progname}; ac_word=$2 echo $ac_n "checking for $ac_word""... $ac_c" 1>&6 -echo "configure:5327: checking for $ac_word" >&5 +echo "configure:5350: checking for $ac_word" >&5 if eval "test \"`echo '$''{'ac_cv_prog_AS_FOR_TARGET'+set}'`\" = set"; then echo $ac_n "(cached) $ac_c" 1>&6 else @@ -5371,7 +5394,7 @@ fi if test -z "$ac_cv_path_DLLTOOL_FOR_TARGET" ; then if test -n "$with_build_time_tools"; then echo $ac_n "checking for ${ncn_target_tool_prefix}${ncn_progname} in $with_build_time_tools""... $ac_c" 1>&6 -echo "configure:5375: checking for ${ncn_target_tool_prefix}${ncn_progname} in $with_build_time_tools" >&5 +echo "configure:5398: checking for ${ncn_target_tool_prefix}${ncn_progname} in $with_build_time_tools" >&5 DLLTOOL_FOR_TARGET=`cd $with_build_time_tools && pwd`/DLLTOOL_FOR_TARGET ac_cv_path_DLLTOOL_FOR_TARGET=$DLLTOOL_FOR_TARGET echo "$ac_t""$ac_cv_path_DLLTOOL_FOR_TARGET" 1>&6 @@ -5385,7 +5408,7 @@ if test -z "$ac_cv_path_DLLTOOL_FOR_TARGET" ; then # Extract the first word of "dlltool", so it can be a program name with args. set dummy dlltool; ac_word=$2 echo $ac_n "checking for $ac_word""... $ac_c" 1>&6 -echo "configure:5389: checking for $ac_word" >&5 +echo "configure:5412: checking for $ac_word" >&5 if eval "test \"`echo '$''{'ac_cv_path_DLLTOOL_FOR_TARGET'+set}'`\" = set"; then echo $ac_n "(cached) $ac_c" 1>&6 else @@ -5422,7 +5445,7 @@ if test -z "$ac_cv_path_DLLTOOL_FOR_TARGET" ; then if test -n "$with_build_time_tools"; then for ncn_progname in dlltool; do echo $ac_n "checking for ${ncn_progname} in $with_build_time_tools""... $ac_c" 1>&6 -echo "configure:5426: checking for ${ncn_progname} in $with_build_time_tools" >&5 +echo "configure:5449: checking for ${ncn_progname} in $with_build_time_tools" >&5 if test -x $with_build_time_tools/DLLTOOL_FOR_TARGET; then ac_cv_prog_DLLTOOL_FOR_TARGET=$with_build_time_tools/DLLTOOL_FOR_TARGET echo "$ac_t""yes" 1>&6 @@ -5439,7 +5462,7 @@ if test -z "$ac_cv_prog_DLLTOOL_FOR_TARGET"; then # Extract the first word of "${ncn_target_tool_prefix}${ncn_progname}", so it can be a program name with args. set dummy ${ncn_target_tool_prefix}${ncn_progname}; ac_word=$2 echo $ac_n "checking for $ac_word""... $ac_c" 1>&6 -echo "configure:5443: checking for $ac_word" >&5 +echo "configure:5466: checking for $ac_word" >&5 if eval "test \"`echo '$''{'ac_cv_prog_DLLTOOL_FOR_TARGET'+set}'`\" = set"; then echo $ac_n "(cached) $ac_c" 1>&6 else @@ -5470,7 +5493,7 @@ fi # Extract the first word of "${ncn_progname}", so it can be a program name with args. set dummy ${ncn_progname}; ac_word=$2 echo $ac_n "checking for $ac_word""... $ac_c" 1>&6 -echo "configure:5474: checking for $ac_word" >&5 +echo "configure:5497: checking for $ac_word" >&5 if eval "test \"`echo '$''{'ac_cv_prog_DLLTOOL_FOR_TARGET'+set}'`\" = set"; then echo $ac_n "(cached) $ac_c" 1>&6 else @@ -5518,7 +5541,7 @@ fi if test -z "$ac_cv_path_LD_FOR_TARGET" ; then if test -n "$with_build_time_tools"; then echo $ac_n "checking for ${ncn_target_tool_prefix}${ncn_progname} in $with_build_time_tools""... $ac_c" 1>&6 -echo "configure:5522: checking for ${ncn_target_tool_prefix}${ncn_progname} in $with_build_time_tools" >&5 +echo "configure:5545: checking for ${ncn_target_tool_prefix}${ncn_progname} in $with_build_time_tools" >&5 LD_FOR_TARGET=`cd $with_build_time_tools && pwd`/LD_FOR_TARGET ac_cv_path_LD_FOR_TARGET=$LD_FOR_TARGET echo "$ac_t""$ac_cv_path_LD_FOR_TARGET" 1>&6 @@ -5532,7 +5555,7 @@ if test -z "$ac_cv_path_LD_FOR_TARGET" ; then # Extract the first word of "ld", so it can be a program name with args. set dummy ld; ac_word=$2 echo $ac_n "checking for $ac_word""... $ac_c" 1>&6 -echo "configure:5536: checking for $ac_word" >&5 +echo "configure:5559: checking for $ac_word" >&5 if eval "test \"`echo '$''{'ac_cv_path_LD_FOR_TARGET'+set}'`\" = set"; then echo $ac_n "(cached) $ac_c" 1>&6 else @@ -5569,7 +5592,7 @@ if test -z "$ac_cv_path_LD_FOR_TARGET" ; then if test -n "$with_build_time_tools"; then for ncn_progname in ld; do echo $ac_n "checking for ${ncn_progname} in $with_build_time_tools""... $ac_c" 1>&6 -echo "configure:5573: checking for ${ncn_progname} in $with_build_time_tools" >&5 +echo "configure:5596: checking for ${ncn_progname} in $with_build_time_tools" >&5 if test -x $with_build_time_tools/LD_FOR_TARGET; then ac_cv_prog_LD_FOR_TARGET=$with_build_time_tools/LD_FOR_TARGET echo "$ac_t""yes" 1>&6 @@ -5586,7 +5609,7 @@ if test -z "$ac_cv_prog_LD_FOR_TARGET"; then # Extract the first word of "${ncn_target_tool_prefix}${ncn_progname}", so it can be a program name with args. set dummy ${ncn_target_tool_prefix}${ncn_progname}; ac_word=$2 echo $ac_n "checking for $ac_word""... $ac_c" 1>&6 -echo "configure:5590: checking for $ac_word" >&5 +echo "configure:5613: checking for $ac_word" >&5 if eval "test \"`echo '$''{'ac_cv_prog_LD_FOR_TARGET'+set}'`\" = set"; then echo $ac_n "(cached) $ac_c" 1>&6 else @@ -5617,7 +5640,7 @@ fi # Extract the first word of "${ncn_progname}", so it can be a program name with args. set dummy ${ncn_progname}; ac_word=$2 echo $ac_n "checking for $ac_word""... $ac_c" 1>&6 -echo "configure:5621: checking for $ac_word" >&5 +echo "configure:5644: checking for $ac_word" >&5 if eval "test \"`echo '$''{'ac_cv_prog_LD_FOR_TARGET'+set}'`\" = set"; then echo $ac_n "(cached) $ac_c" 1>&6 else @@ -5665,7 +5688,7 @@ fi if test -z "$ac_cv_path_LIPO_FOR_TARGET" ; then if test -n "$with_build_time_tools"; then echo $ac_n "checking for ${ncn_target_tool_prefix}${ncn_progname} in $with_build_time_tools""... $ac_c" 1>&6 -echo "configure:5669: checking for ${ncn_target_tool_prefix}${ncn_progname} in $with_build_time_tools" >&5 +echo "configure:5692: checking for ${ncn_target_tool_prefix}${ncn_progname} in $with_build_time_tools" >&5 LIPO_FOR_TARGET=`cd $with_build_time_tools && pwd`/LIPO_FOR_TARGET ac_cv_path_LIPO_FOR_TARGET=$LIPO_FOR_TARGET echo "$ac_t""$ac_cv_path_LIPO_FOR_TARGET" 1>&6 @@ -5679,7 +5702,7 @@ if test -z "$ac_cv_path_LIPO_FOR_TARGET" ; then # Extract the first word of "lipo", so it can be a program name with args. set dummy lipo; ac_word=$2 echo $ac_n "checking for $ac_word""... $ac_c" 1>&6 -echo "configure:5683: checking for $ac_word" >&5 +echo "configure:5706: checking for $ac_word" >&5 if eval "test \"`echo '$''{'ac_cv_path_LIPO_FOR_TARGET'+set}'`\" = set"; then echo $ac_n "(cached) $ac_c" 1>&6 else @@ -5716,7 +5739,7 @@ if test -z "$ac_cv_path_LIPO_FOR_TARGET" ; then if test -n "$with_build_time_tools"; then for ncn_progname in lipo; do echo $ac_n "checking for ${ncn_progname} in $with_build_time_tools""... $ac_c" 1>&6 -echo "configure:5720: checking for ${ncn_progname} in $with_build_time_tools" >&5 +echo "configure:5743: checking for ${ncn_progname} in $with_build_time_tools" >&5 if test -x $with_build_time_tools/LIPO_FOR_TARGET; then ac_cv_prog_LIPO_FOR_TARGET=$with_build_time_tools/LIPO_FOR_TARGET echo "$ac_t""yes" 1>&6 @@ -5733,7 +5756,7 @@ if test -z "$ac_cv_prog_LIPO_FOR_TARGET"; then # Extract the first word of "${ncn_target_tool_prefix}${ncn_progname}", so it can be a program name with args. set dummy ${ncn_target_tool_prefix}${ncn_progname}; ac_word=$2 echo $ac_n "checking for $ac_word""... $ac_c" 1>&6 -echo "configure:5737: checking for $ac_word" >&5 +echo "configure:5760: checking for $ac_word" >&5 if eval "test \"`echo '$''{'ac_cv_prog_LIPO_FOR_TARGET'+set}'`\" = set"; then echo $ac_n "(cached) $ac_c" 1>&6 else @@ -5764,7 +5787,7 @@ fi # Extract the first word of "${ncn_progname}", so it can be a program name with args. set dummy ${ncn_progname}; ac_word=$2 echo $ac_n "checking for $ac_word""... $ac_c" 1>&6 -echo "configure:5768: checking for $ac_word" >&5 +echo "configure:5791: checking for $ac_word" >&5 if eval "test \"`echo '$''{'ac_cv_prog_LIPO_FOR_TARGET'+set}'`\" = set"; then echo $ac_n "(cached) $ac_c" 1>&6 else @@ -5812,7 +5835,7 @@ fi if test -z "$ac_cv_path_NM_FOR_TARGET" ; then if test -n "$with_build_time_tools"; then echo $ac_n "checking for ${ncn_target_tool_prefix}${ncn_progname} in $with_build_time_tools""... $ac_c" 1>&6 -echo "configure:5816: checking for ${ncn_target_tool_prefix}${ncn_progname} in $with_build_time_tools" >&5 +echo "configure:5839: checking for ${ncn_target_tool_prefix}${ncn_progname} in $with_build_time_tools" >&5 NM_FOR_TARGET=`cd $with_build_time_tools && pwd`/NM_FOR_TARGET ac_cv_path_NM_FOR_TARGET=$NM_FOR_TARGET echo "$ac_t""$ac_cv_path_NM_FOR_TARGET" 1>&6 @@ -5826,7 +5849,7 @@ if test -z "$ac_cv_path_NM_FOR_TARGET" ; then # Extract the first word of "nm", so it can be a program name with args. set dummy nm; ac_word=$2 echo $ac_n "checking for $ac_word""... $ac_c" 1>&6 -echo "configure:5830: checking for $ac_word" >&5 +echo "configure:5853: checking for $ac_word" >&5 if eval "test \"`echo '$''{'ac_cv_path_NM_FOR_TARGET'+set}'`\" = set"; then echo $ac_n "(cached) $ac_c" 1>&6 else @@ -5863,7 +5886,7 @@ if test -z "$ac_cv_path_NM_FOR_TARGET" ; then if test -n "$with_build_time_tools"; then for ncn_progname in nm; do echo $ac_n "checking for ${ncn_progname} in $with_build_time_tools""... $ac_c" 1>&6 -echo "configure:5867: checking for ${ncn_progname} in $with_build_time_tools" >&5 +echo "configure:5890: checking for ${ncn_progname} in $with_build_time_tools" >&5 if test -x $with_build_time_tools/NM_FOR_TARGET; then ac_cv_prog_NM_FOR_TARGET=$with_build_time_tools/NM_FOR_TARGET echo "$ac_t""yes" 1>&6 @@ -5880,7 +5903,7 @@ if test -z "$ac_cv_prog_NM_FOR_TARGET"; then # Extract the first word of "${ncn_target_tool_prefix}${ncn_progname}", so it can be a program name with args. set dummy ${ncn_target_tool_prefix}${ncn_progname}; ac_word=$2 echo $ac_n "checking for $ac_word""... $ac_c" 1>&6 -echo "configure:5884: checking for $ac_word" >&5 +echo "configure:5907: checking for $ac_word" >&5 if eval "test \"`echo '$''{'ac_cv_prog_NM_FOR_TARGET'+set}'`\" = set"; then echo $ac_n "(cached) $ac_c" 1>&6 else @@ -5911,7 +5934,7 @@ fi # Extract the first word of "${ncn_progname}", so it can be a program name with args. set dummy ${ncn_progname}; ac_word=$2 echo $ac_n "checking for $ac_word""... $ac_c" 1>&6 -echo "configure:5915: checking for $ac_word" >&5 +echo "configure:5938: checking for $ac_word" >&5 if eval "test \"`echo '$''{'ac_cv_prog_NM_FOR_TARGET'+set}'`\" = set"; then echo $ac_n "(cached) $ac_c" 1>&6 else @@ -5959,7 +5982,7 @@ fi if test -z "$ac_cv_path_OBJDUMP_FOR_TARGET" ; then if test -n "$with_build_time_tools"; then echo $ac_n "checking for ${ncn_target_tool_prefix}${ncn_progname} in $with_build_time_tools""... $ac_c" 1>&6 -echo "configure:5963: checking for ${ncn_target_tool_prefix}${ncn_progname} in $with_build_time_tools" >&5 +echo "configure:5986: checking for ${ncn_target_tool_prefix}${ncn_progname} in $with_build_time_tools" >&5 OBJDUMP_FOR_TARGET=`cd $with_build_time_tools && pwd`/OBJDUMP_FOR_TARGET ac_cv_path_OBJDUMP_FOR_TARGET=$OBJDUMP_FOR_TARGET echo "$ac_t""$ac_cv_path_OBJDUMP_FOR_TARGET" 1>&6 @@ -5973,7 +5996,7 @@ if test -z "$ac_cv_path_OBJDUMP_FOR_TARGET" ; then # Extract the first word of "objdump", so it can be a program name with args. set dummy objdump; ac_word=$2 echo $ac_n "checking for $ac_word""... $ac_c" 1>&6 -echo "configure:5977: checking for $ac_word" >&5 +echo "configure:6000: checking for $ac_word" >&5 if eval "test \"`echo '$''{'ac_cv_path_OBJDUMP_FOR_TARGET'+set}'`\" = set"; then echo $ac_n "(cached) $ac_c" 1>&6 else @@ -6010,7 +6033,7 @@ if test -z "$ac_cv_path_OBJDUMP_FOR_TARGET" ; then if test -n "$with_build_time_tools"; then for ncn_progname in objdump; do echo $ac_n "checking for ${ncn_progname} in $with_build_time_tools""... $ac_c" 1>&6 -echo "configure:6014: checking for ${ncn_progname} in $with_build_time_tools" >&5 +echo "configure:6037: checking for ${ncn_progname} in $with_build_time_tools" >&5 if test -x $with_build_time_tools/OBJDUMP_FOR_TARGET; then ac_cv_prog_OBJDUMP_FOR_TARGET=$with_build_time_tools/OBJDUMP_FOR_TARGET echo "$ac_t""yes" 1>&6 @@ -6027,7 +6050,7 @@ if test -z "$ac_cv_prog_OBJDUMP_FOR_TARGET"; then # Extract the first word of "${ncn_target_tool_prefix}${ncn_progname}", so it can be a program name with args. set dummy ${ncn_target_tool_prefix}${ncn_progname}; ac_word=$2 echo $ac_n "checking for $ac_word""... $ac_c" 1>&6 -echo "configure:6031: checking for $ac_word" >&5 +echo "configure:6054: checking for $ac_word" >&5 if eval "test \"`echo '$''{'ac_cv_prog_OBJDUMP_FOR_TARGET'+set}'`\" = set"; then echo $ac_n "(cached) $ac_c" 1>&6 else @@ -6058,7 +6081,7 @@ fi # Extract the first word of "${ncn_progname}", so it can be a program name with args. set dummy ${ncn_progname}; ac_word=$2 echo $ac_n "checking for $ac_word""... $ac_c" 1>&6 -echo "configure:6062: checking for $ac_word" >&5 +echo "configure:6085: checking for $ac_word" >&5 if eval "test \"`echo '$''{'ac_cv_prog_OBJDUMP_FOR_TARGET'+set}'`\" = set"; then echo $ac_n "(cached) $ac_c" 1>&6 else @@ -6106,7 +6129,7 @@ fi if test -z "$ac_cv_path_RANLIB_FOR_TARGET" ; then if test -n "$with_build_time_tools"; then echo $ac_n "checking for ${ncn_target_tool_prefix}${ncn_progname} in $with_build_time_tools""... $ac_c" 1>&6 -echo "configure:6110: checking for ${ncn_target_tool_prefix}${ncn_progname} in $with_build_time_tools" >&5 +echo "configure:6133: checking for ${ncn_target_tool_prefix}${ncn_progname} in $with_build_time_tools" >&5 RANLIB_FOR_TARGET=`cd $with_build_time_tools && pwd`/RANLIB_FOR_TARGET ac_cv_path_RANLIB_FOR_TARGET=$RANLIB_FOR_TARGET echo "$ac_t""$ac_cv_path_RANLIB_FOR_TARGET" 1>&6 @@ -6120,7 +6143,7 @@ if test -z "$ac_cv_path_RANLIB_FOR_TARGET" ; then # Extract the first word of "ranlib", so it can be a program name with args. set dummy ranlib; ac_word=$2 echo $ac_n "checking for $ac_word""... $ac_c" 1>&6 -echo "configure:6124: checking for $ac_word" >&5 +echo "configure:6147: checking for $ac_word" >&5 if eval "test \"`echo '$''{'ac_cv_path_RANLIB_FOR_TARGET'+set}'`\" = set"; then echo $ac_n "(cached) $ac_c" 1>&6 else @@ -6157,7 +6180,7 @@ if test -z "$ac_cv_path_RANLIB_FOR_TARGET" ; then if test -n "$with_build_time_tools"; then for ncn_progname in ranlib; do echo $ac_n "checking for ${ncn_progname} in $with_build_time_tools""... $ac_c" 1>&6 -echo "configure:6161: checking for ${ncn_progname} in $with_build_time_tools" >&5 +echo "configure:6184: checking for ${ncn_progname} in $with_build_time_tools" >&5 if test -x $with_build_time_tools/RANLIB_FOR_TARGET; then ac_cv_prog_RANLIB_FOR_TARGET=$with_build_time_tools/RANLIB_FOR_TARGET echo "$ac_t""yes" 1>&6 @@ -6174,7 +6197,7 @@ if test -z "$ac_cv_prog_RANLIB_FOR_TARGET"; then # Extract the first word of "${ncn_target_tool_prefix}${ncn_progname}", so it can be a program name with args. set dummy ${ncn_target_tool_prefix}${ncn_progname}; ac_word=$2 echo $ac_n "checking for $ac_word""... $ac_c" 1>&6 -echo "configure:6178: checking for $ac_word" >&5 +echo "configure:6201: checking for $ac_word" >&5 if eval "test \"`echo '$''{'ac_cv_prog_RANLIB_FOR_TARGET'+set}'`\" = set"; then echo $ac_n "(cached) $ac_c" 1>&6 else @@ -6205,7 +6228,7 @@ fi # Extract the first word of "${ncn_progname}", so it can be a program name with args. set dummy ${ncn_progname}; ac_word=$2 echo $ac_n "checking for $ac_word""... $ac_c" 1>&6 -echo "configure:6209: checking for $ac_word" >&5 +echo "configure:6232: checking for $ac_word" >&5 if eval "test \"`echo '$''{'ac_cv_prog_RANLIB_FOR_TARGET'+set}'`\" = set"; then echo $ac_n "(cached) $ac_c" 1>&6 else @@ -6253,7 +6276,7 @@ fi if test -z "$ac_cv_path_STRIP_FOR_TARGET" ; then if test -n "$with_build_time_tools"; then echo $ac_n "checking for ${ncn_target_tool_prefix}${ncn_progname} in $with_build_time_tools""... $ac_c" 1>&6 -echo "configure:6257: checking for ${ncn_target_tool_prefix}${ncn_progname} in $with_build_time_tools" >&5 +echo "configure:6280: checking for ${ncn_target_tool_prefix}${ncn_progname} in $with_build_time_tools" >&5 STRIP_FOR_TARGET=`cd $with_build_time_tools && pwd`/STRIP_FOR_TARGET ac_cv_path_STRIP_FOR_TARGET=$STRIP_FOR_TARGET echo "$ac_t""$ac_cv_path_STRIP_FOR_TARGET" 1>&6 @@ -6267,7 +6290,7 @@ if test -z "$ac_cv_path_STRIP_FOR_TARGET" ; then # Extract the first word of "strip", so it can be a program name with args. set dummy strip; ac_word=$2 echo $ac_n "checking for $ac_word""... $ac_c" 1>&6 -echo "configure:6271: checking for $ac_word" >&5 +echo "configure:6294: checking for $ac_word" >&5 if eval "test \"`echo '$''{'ac_cv_path_STRIP_FOR_TARGET'+set}'`\" = set"; then echo $ac_n "(cached) $ac_c" 1>&6 else @@ -6304,7 +6327,7 @@ if test -z "$ac_cv_path_STRIP_FOR_TARGET" ; then if test -n "$with_build_time_tools"; then for ncn_progname in strip; do echo $ac_n "checking for ${ncn_progname} in $with_build_time_tools""... $ac_c" 1>&6 -echo "configure:6308: checking for ${ncn_progname} in $with_build_time_tools" >&5 +echo "configure:6331: checking for ${ncn_progname} in $with_build_time_tools" >&5 if test -x $with_build_time_tools/STRIP_FOR_TARGET; then ac_cv_prog_STRIP_FOR_TARGET=$with_build_time_tools/STRIP_FOR_TARGET echo "$ac_t""yes" 1>&6 @@ -6321,7 +6344,7 @@ if test -z "$ac_cv_prog_STRIP_FOR_TARGET"; then # Extract the first word of "${ncn_target_tool_prefix}${ncn_progname}", so it can be a program name with args. set dummy ${ncn_target_tool_prefix}${ncn_progname}; ac_word=$2 echo $ac_n "checking for $ac_word""... $ac_c" 1>&6 -echo "configure:6325: checking for $ac_word" >&5 +echo "configure:6348: checking for $ac_word" >&5 if eval "test \"`echo '$''{'ac_cv_prog_STRIP_FOR_TARGET'+set}'`\" = set"; then echo $ac_n "(cached) $ac_c" 1>&6 else @@ -6352,7 +6375,7 @@ fi # Extract the first word of "${ncn_progname}", so it can be a program name with args. set dummy ${ncn_progname}; ac_word=$2 echo $ac_n "checking for $ac_word""... $ac_c" 1>&6 -echo "configure:6356: checking for $ac_word" >&5 +echo "configure:6379: checking for $ac_word" >&5 if eval "test \"`echo '$''{'ac_cv_prog_STRIP_FOR_TARGET'+set}'`\" = set"; then echo $ac_n "(cached) $ac_c" 1>&6 else @@ -6400,7 +6423,7 @@ fi if test -z "$ac_cv_path_WINDRES_FOR_TARGET" ; then if test -n "$with_build_time_tools"; then echo $ac_n "checking for ${ncn_target_tool_prefix}${ncn_progname} in $with_build_time_tools""... $ac_c" 1>&6 -echo "configure:6404: checking for ${ncn_target_tool_prefix}${ncn_progname} in $with_build_time_tools" >&5 +echo "configure:6427: checking for ${ncn_target_tool_prefix}${ncn_progname} in $with_build_time_tools" >&5 WINDRES_FOR_TARGET=`cd $with_build_time_tools && pwd`/WINDRES_FOR_TARGET ac_cv_path_WINDRES_FOR_TARGET=$WINDRES_FOR_TARGET echo "$ac_t""$ac_cv_path_WINDRES_FOR_TARGET" 1>&6 @@ -6414,7 +6437,7 @@ if test -z "$ac_cv_path_WINDRES_FOR_TARGET" ; then # Extract the first word of "windres", so it can be a program name with args. set dummy windres; ac_word=$2 echo $ac_n "checking for $ac_word""... $ac_c" 1>&6 -echo "configure:6418: checking for $ac_word" >&5 +echo "configure:6441: checking for $ac_word" >&5 if eval "test \"`echo '$''{'ac_cv_path_WINDRES_FOR_TARGET'+set}'`\" = set"; then echo $ac_n "(cached) $ac_c" 1>&6 else @@ -6451,7 +6474,7 @@ if test -z "$ac_cv_path_WINDRES_FOR_TARGET" ; then if test -n "$with_build_time_tools"; then for ncn_progname in windres; do echo $ac_n "checking for ${ncn_progname} in $with_build_time_tools""... $ac_c" 1>&6 -echo "configure:6455: checking for ${ncn_progname} in $with_build_time_tools" >&5 +echo "configure:6478: checking for ${ncn_progname} in $with_build_time_tools" >&5 if test -x $with_build_time_tools/WINDRES_FOR_TARGET; then ac_cv_prog_WINDRES_FOR_TARGET=$with_build_time_tools/WINDRES_FOR_TARGET echo "$ac_t""yes" 1>&6 @@ -6468,7 +6491,7 @@ if test -z "$ac_cv_prog_WINDRES_FOR_TARGET"; then # Extract the first word of "${ncn_target_tool_prefix}${ncn_progname}", so it can be a program name with args. set dummy ${ncn_target_tool_prefix}${ncn_progname}; ac_word=$2 echo $ac_n "checking for $ac_word""... $ac_c" 1>&6 -echo "configure:6472: checking for $ac_word" >&5 +echo "configure:6495: checking for $ac_word" >&5 if eval "test \"`echo '$''{'ac_cv_prog_WINDRES_FOR_TARGET'+set}'`\" = set"; then echo $ac_n "(cached) $ac_c" 1>&6 else @@ -6499,7 +6522,7 @@ fi # Extract the first word of "${ncn_progname}", so it can be a program name with args. set dummy ${ncn_progname}; ac_word=$2 echo $ac_n "checking for $ac_word""... $ac_c" 1>&6 -echo "configure:6503: checking for $ac_word" >&5 +echo "configure:6526: checking for $ac_word" >&5 if eval "test \"`echo '$''{'ac_cv_prog_WINDRES_FOR_TARGET'+set}'`\" = set"; then echo $ac_n "(cached) $ac_c" 1>&6 else @@ -6545,7 +6568,7 @@ fi RAW_CXX_FOR_TARGET="$CXX_FOR_TARGET" echo $ac_n "checking where to find the target ar""... $ac_c" 1>&6 -echo "configure:6549: checking where to find the target ar" >&5 +echo "configure:6572: checking where to find the target ar" >&5 if test "x${build}" != "x${host}" ; then if expr "x$AR_FOR_TARGET" : "x/" > /dev/null; then # We already found the complete path @@ -6578,7 +6601,7 @@ else fi fi echo $ac_n "checking where to find the target as""... $ac_c" 1>&6 -echo "configure:6582: checking where to find the target as" >&5 +echo "configure:6605: checking where to find the target as" >&5 if test "x${build}" != "x${host}" ; then if expr "x$AS_FOR_TARGET" : "x/" > /dev/null; then # We already found the complete path @@ -6611,7 +6634,7 @@ else fi fi echo $ac_n "checking where to find the target cc""... $ac_c" 1>&6 -echo "configure:6615: checking where to find the target cc" >&5 +echo "configure:6638: checking where to find the target cc" >&5 if test "x${build}" != "x${host}" ; then if expr "x$CC_FOR_TARGET" : "x/" > /dev/null; then # We already found the complete path @@ -6644,7 +6667,7 @@ else fi fi echo $ac_n "checking where to find the target c++""... $ac_c" 1>&6 -echo "configure:6648: checking where to find the target c++" >&5 +echo "configure:6671: checking where to find the target c++" >&5 if test "x${build}" != "x${host}" ; then if expr "x$CXX_FOR_TARGET" : "x/" > /dev/null; then # We already found the complete path @@ -6680,7 +6703,7 @@ else fi fi echo $ac_n "checking where to find the target c++ for libstdc++""... $ac_c" 1>&6 -echo "configure:6684: checking where to find the target c++ for libstdc++" >&5 +echo "configure:6707: checking where to find the target c++ for libstdc++" >&5 if test "x${build}" != "x${host}" ; then if expr "x$RAW_CXX_FOR_TARGET" : "x/" > /dev/null; then # We already found the complete path @@ -6716,7 +6739,7 @@ else fi fi echo $ac_n "checking where to find the target dlltool""... $ac_c" 1>&6 -echo "configure:6720: checking where to find the target dlltool" >&5 +echo "configure:6743: checking where to find the target dlltool" >&5 if test "x${build}" != "x${host}" ; then if expr "x$DLLTOOL_FOR_TARGET" : "x/" > /dev/null; then # We already found the complete path @@ -6749,7 +6772,7 @@ else fi fi echo $ac_n "checking where to find the target gcc""... $ac_c" 1>&6 -echo "configure:6753: checking where to find the target gcc" >&5 +echo "configure:6776: checking where to find the target gcc" >&5 if test "x${build}" != "x${host}" ; then if expr "x$GCC_FOR_TARGET" : "x/" > /dev/null; then # We already found the complete path @@ -6782,7 +6805,7 @@ else fi fi echo $ac_n "checking where to find the target gcj""... $ac_c" 1>&6 -echo "configure:6786: checking where to find the target gcj" >&5 +echo "configure:6809: checking where to find the target gcj" >&5 if test "x${build}" != "x${host}" ; then if expr "x$GCJ_FOR_TARGET" : "x/" > /dev/null; then # We already found the complete path @@ -6818,7 +6841,7 @@ else fi fi echo $ac_n "checking where to find the target gfortran""... $ac_c" 1>&6 -echo "configure:6822: checking where to find the target gfortran" >&5 +echo "configure:6845: checking where to find the target gfortran" >&5 if test "x${build}" != "x${host}" ; then if expr "x$GFORTRAN_FOR_TARGET" : "x/" > /dev/null; then # We already found the complete path @@ -6854,7 +6877,7 @@ else fi fi echo $ac_n "checking where to find the target ld""... $ac_c" 1>&6 -echo "configure:6858: checking where to find the target ld" >&5 +echo "configure:6881: checking where to find the target ld" >&5 if test "x${build}" != "x${host}" ; then if expr "x$LD_FOR_TARGET" : "x/" > /dev/null; then # We already found the complete path @@ -6887,7 +6910,7 @@ else fi fi echo $ac_n "checking where to find the target lipo""... $ac_c" 1>&6 -echo "configure:6891: checking where to find the target lipo" >&5 +echo "configure:6914: checking where to find the target lipo" >&5 if test "x${build}" != "x${host}" ; then if expr "x$LIPO_FOR_TARGET" : "x/" > /dev/null; then # We already found the complete path @@ -6910,7 +6933,7 @@ else fi fi echo $ac_n "checking where to find the target nm""... $ac_c" 1>&6 -echo "configure:6914: checking where to find the target nm" >&5 +echo "configure:6937: checking where to find the target nm" >&5 if test "x${build}" != "x${host}" ; then if expr "x$NM_FOR_TARGET" : "x/" > /dev/null; then # We already found the complete path @@ -6943,7 +6966,7 @@ else fi fi echo $ac_n "checking where to find the target objdump""... $ac_c" 1>&6 -echo "configure:6947: checking where to find the target objdump" >&5 +echo "configure:6970: checking where to find the target objdump" >&5 if test "x${build}" != "x${host}" ; then if expr "x$OBJDUMP_FOR_TARGET" : "x/" > /dev/null; then # We already found the complete path @@ -6976,7 +6999,7 @@ else fi fi echo $ac_n "checking where to find the target ranlib""... $ac_c" 1>&6 -echo "configure:6980: checking where to find the target ranlib" >&5 +echo "configure:7003: checking where to find the target ranlib" >&5 if test "x${build}" != "x${host}" ; then if expr "x$RANLIB_FOR_TARGET" : "x/" > /dev/null; then # We already found the complete path @@ -7009,7 +7032,7 @@ else fi fi echo $ac_n "checking where to find the target strip""... $ac_c" 1>&6 -echo "configure:7013: checking where to find the target strip" >&5 +echo "configure:7036: checking where to find the target strip" >&5 if test "x${build}" != "x${host}" ; then if expr "x$STRIP_FOR_TARGET" : "x/" > /dev/null; then # We already found the complete path @@ -7042,7 +7065,7 @@ else fi fi echo $ac_n "checking where to find the target windres""... $ac_c" 1>&6 -echo "configure:7046: checking where to find the target windres" >&5 +echo "configure:7069: checking where to find the target windres" >&5 if test "x${build}" != "x${host}" ; then if expr "x$WINDRES_FOR_TARGET" : "x/" > /dev/null; then # We already found the complete path @@ -7103,7 +7126,7 @@ fi echo $ac_n "checking whether to enable maintainer-specific portions of Makefiles""... $ac_c" 1>&6 -echo "configure:7107: checking whether to enable maintainer-specific portions of Makefiles" >&5 +echo "configure:7130: checking whether to enable maintainer-specific portions of Makefiles" >&5 # Check whether --enable-maintainer-mode or --disable-maintainer-mode was given. if test "${enable_maintainer_mode+set}" = set; then enableval="$enable_maintainer_mode" diff --git a/configure.in b/configure.in index eddb5d80a09..0eddff8fb2c 100644 --- a/configure.in +++ b/configure.in @@ -148,6 +148,7 @@ target_libraries="target-libiberty \ target-libstdc++-v3 \ target-libmudflap \ target-libssp \ + target-libgcc-math \ target-libgfortran \ ${libgcj} \ target-libobjc \ @@ -316,6 +317,21 @@ if test "${ENABLE_LIBSSP}" != "yes" ; then noconfigdirs="$noconfigdirs target-libssp" fi +# Set the default so we build libgcc-math for ix86 and x86_64 +AC_ARG_ENABLE(libgcc-math, +[ --enable-libgcc-math Builds libgcc-math directory],, +[ +case "${target}" in + i?86-* | x86_64-* ) + enable_libgcc_math=yes ;; + *) + enable_libgcc_math=no ;; +esac +]) +if test "${enable_libgcc_math}" != "yes"; then + noconfigdirs="$noconfigdirs target-libgcc-math" +fi + # Save it here so that, even in case of --enable-libgcj, if the Java # front-end isn't enabled, we still get libgcj disabled. libgcj_saved=$libgcj diff --git a/gcc/ChangeLog b/gcc/ChangeLog index 9dd204de106..58a53d82d6f 100644 --- a/gcc/ChangeLog +++ b/gcc/ChangeLog @@ -1,3 +1,8 @@ +2006-01-31 Richard Guenther + Paolo Bonzini + + * doc/install.texi (--disable-libgcc-math): Document. + 2006-01-30 Marcin Dalecki * expr.h (expand_normal): new inline function. diff --git a/gcc/doc/install.texi b/gcc/doc/install.texi index 0552cd54e69..b84590568d0 100644 --- a/gcc/doc/install.texi +++ b/gcc/doc/install.texi @@ -1086,6 +1086,10 @@ do a @samp{make -C gcc gnatlib_and_tools}. Specify that the run-time libraries for stack smashing protection should not be built. +@item --disable-libgcc-math +Specify that the run-time libraries for arch and gcc specific math +functions should not be built. + @item --with-dwarf2 Specify that the compiler should use DWARF 2 debugging information as the default. diff --git a/libgcc-math/ChangeLog b/libgcc-math/ChangeLog new file mode 100644 index 00000000000..b9f9a21231a --- /dev/null +++ b/libgcc-math/ChangeLog @@ -0,0 +1,20 @@ +2006-01-31 Richard Guenther + Paolo Bonzini + + * configure.ac: New file. + * Makefile.am: Likewise. + * configure: New generated file. + * Makefile.in: Likewise. + * aclocal.m4: Likewise. + * libtool-version: New file. + * include/ieee754.h: New file. + * include/libc-symbols.h: Likewise. + * include/math_private.h: Likewise. + * i386/Makefile.am: New file. + * i386/Makefile.in: New generated file. + * i386/sse2.h: New file. + * i386/endian.h: Likewise. + * i386/sse2.map: Linker script for SSE2 ABI math intrinsics. + * flt-32/: Import from glibc. + * dbl-64/: Likewise. + diff --git a/libgcc-math/Makefile.am b/libgcc-math/Makefile.am new file mode 100644 index 00000000000..a567defc1ec --- /dev/null +++ b/libgcc-math/Makefile.am @@ -0,0 +1,88 @@ +## Makefile for the toplevel directory of the libgcc-math library. +## +## Copyright (C) 2005 +## Free Software Foundation, Inc. +## + +AUTOMAKE_OPTIONS = 1.9.5 foreign +ACLOCAL_AMFLAGS = -I .. -I ../config +MAINT_CHARSET = latin1 + +SUBDIRS = @arch_subdirs@ + +# May be used by various substitution variables. +gcc_version := $(shell cat $(top_srcdir)/../gcc/BASE-VER) + +if LIBGCCM_USE_SYMVER +version_arg = -Wl,--version-script=gccm.map +version_dep = gccm.map +.PHONY: gccm.map +gccm.map: + rm -f gccm.map + for map in @arch_maps@; do \ + cat $(srcdir)/$$map >> gccm.map; \ + done +else +version_arg = +version_dep = +endif + + +if BUILD_LIBGCC_MATH +toolexeclib_LTLIBRARIES = libgcc-math.la + +libgcc_math_la_SOURCES = +libgcc_math_la_LIBADD = @arch_libraries@ +libgcc_math_la_DEPENDENCIES = $(libgcc_math_la_LIBADD) $(version_dep) +libgcc_math_la_LDFLAGS = -version-info `grep -v '^\#' $(srcdir)/libtool-version` \ + $(version_arg) -lm +endif + + +# XXX hack alert +# From libffi/Makefile.am + +# Work around what appears to be a GNU make bug handling MAKEFLAGS +# values defined in terms of make variables, as is the case for CC and +# friends when we are called from the top level Makefile. +AM_MAKEFLAGS = \ + "AR_FLAGS=$(AR_FLAGS)" \ + "CC_FOR_BUILD=$(CC_FOR_BUILD)" \ + "CFLAGS=$(CFLAGS)" \ + "CXXFLAGS=$(CXXFLAGS)" \ + "CFLAGS_FOR_BUILD=$(CFLAGS_FOR_BUILD)" \ + "CFLAGS_FOR_TARGET=$(CFLAGS_FOR_TARGET)" \ + "INSTALL=$(INSTALL)" \ + "INSTALL_DATA=$(INSTALL_DATA)" \ + "INSTALL_PROGRAM=$(INSTALL_PROGRAM)" \ + "INSTALL_SCRIPT=$(INSTALL_SCRIPT)" \ + "JC1FLAGS=$(JC1FLAGS)" \ + "LDFLAGS=$(LDFLAGS)" \ + "LIBCFLAGS=$(LIBCFLAGS)" \ + "LIBCFLAGS_FOR_TARGET=$(LIBCFLAGS_FOR_TARGET)" \ + "MAKE=$(MAKE)" \ + "MAKEINFO=$(MAKEINFO) $(MAKEINFOFLAGS)" \ + "PICFLAG=$(PICFLAG)" \ + "PICFLAG_FOR_TARGET=$(PICFLAG_FOR_TARGET)" \ + "SHELL=$(SHELL)" \ + "RUNTESTFLAGS=$(RUNTESTFLAGS)" \ + "exec_prefix=$(exec_prefix)" \ + "infodir=$(infodir)" \ + "libdir=$(libdir)" \ + "prefix=$(prefix)" \ + "includedir=$(includedir)" \ + "AR=$(AR)" \ + "AS=$(AS)" \ + "CC=$(CC)" \ + "CXX=$(CXX)" \ + "LD=$(LD)" \ + "LIBCFLAGS=$(LIBCFLAGS)" \ + "NM=$(NM)" \ + "PICFLAG=$(PICFLAG)" \ + "RANLIB=$(RANLIB)" \ + "DESTDIR=$(DESTDIR)" + +MAKEOVERRIDES= + +## ################################################################ + diff --git a/libgcc-math/Makefile.in b/libgcc-math/Makefile.in new file mode 100644 index 00000000000..b9a7ab6b368 --- /dev/null +++ b/libgcc-math/Makefile.in @@ -0,0 +1,760 @@ +# Makefile.in generated by automake 1.9.6 from Makefile.am. +# @configure_input@ + +# Copyright (C) 1994, 1995, 1996, 1997, 1998, 1999, 2000, 2001, 2002, +# 2003, 2004, 2005 Free Software Foundation, Inc. +# This Makefile.in is free software; the Free Software Foundation +# gives unlimited permission to copy and/or distribute it, +# with or without modifications, as long as this notice is preserved. + +# This program is distributed in the hope that it will be useful, +# but WITHOUT ANY WARRANTY, to the extent permitted by law; without +# even the implied warranty of MERCHANTABILITY or FITNESS FOR A +# PARTICULAR PURPOSE. + +@SET_MAKE@ + +srcdir = @srcdir@ +top_srcdir = @top_srcdir@ +VPATH = @srcdir@ +pkgdatadir = $(datadir)/@PACKAGE@ +pkglibdir = $(libdir)/@PACKAGE@ +pkgincludedir = $(includedir)/@PACKAGE@ +top_builddir = . +am__cd = CDPATH="$${ZSH_VERSION+.}$(PATH_SEPARATOR)" && cd +INSTALL = @INSTALL@ +install_sh_DATA = $(install_sh) -c -m 644 +install_sh_PROGRAM = $(install_sh) -c +install_sh_SCRIPT = $(install_sh) -c +INSTALL_HEADER = $(INSTALL_DATA) +transform = $(program_transform_name) +NORMAL_INSTALL = : +PRE_INSTALL = : +POST_INSTALL = : +NORMAL_UNINSTALL = : +PRE_UNINSTALL = : +POST_UNINSTALL = : +build_triplet = @build@ +host_triplet = @host@ +target_triplet = @target@ +@BUILD_LIBGCC_MATH_FALSE@libgcc_math_la_DEPENDENCIES = +DIST_COMMON = $(am__configure_deps) $(srcdir)/../config.guess \ + $(srcdir)/../config.sub $(srcdir)/../install-sh \ + $(srcdir)/../ltmain.sh $(srcdir)/../missing \ + $(srcdir)/../mkinstalldirs $(srcdir)/Makefile.am \ + $(srcdir)/Makefile.in $(top_srcdir)/configure ChangeLog +subdir = . +ACLOCAL_M4 = $(top_srcdir)/aclocal.m4 +am__aclocal_m4_deps = $(top_srcdir)/../config/depstand.m4 \ + $(top_srcdir)/../config/lead-dot.m4 \ + $(top_srcdir)/../libtool.m4 $(top_srcdir)/configure.ac +am__configure_deps = $(am__aclocal_m4_deps) $(CONFIGURE_DEPENDENCIES) \ + $(ACLOCAL_M4) +am__CONFIG_DISTCLEAN_FILES = config.status config.cache config.log \ + configure.lineno configure.status.lineno +mkinstalldirs = $(SHELL) $(top_srcdir)/../mkinstalldirs +CONFIG_CLEAN_FILES = +am__vpath_adj_setup = srcdirstrip=`echo "$(srcdir)" | sed 's|.|.|g'`; +am__vpath_adj = case $$p in \ + $(srcdir)/*) f=`echo "$$p" | sed "s|^$$srcdirstrip/||"`;; \ + *) f=$$p;; \ + esac; +am__strip_dir = `echo $$p | sed -e 's|^.*/||'`; +am__installdirs = "$(DESTDIR)$(toolexeclibdir)" +toolexeclibLTLIBRARIES_INSTALL = $(INSTALL) +LTLIBRARIES = $(toolexeclib_LTLIBRARIES) +am_libgcc_math_la_OBJECTS = +libgcc_math_la_OBJECTS = $(am_libgcc_math_la_OBJECTS) +@BUILD_LIBGCC_MATH_TRUE@am_libgcc_math_la_rpath = -rpath \ +@BUILD_LIBGCC_MATH_TRUE@ $(toolexeclibdir) +DEFAULT_INCLUDES = -I. -I$(srcdir) +COMPILE = $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) \ + $(CPPFLAGS) $(AM_CFLAGS) $(CFLAGS) +LTCOMPILE = $(LIBTOOL) --mode=compile $(CC) $(DEFS) \ + $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) \ + $(AM_CFLAGS) $(CFLAGS) +CCLD = $(CC) +LINK = $(LIBTOOL) --mode=link $(CCLD) $(AM_CFLAGS) $(CFLAGS) \ + $(AM_LDFLAGS) $(LDFLAGS) -o $@ +SOURCES = $(libgcc_math_la_SOURCES) +DIST_SOURCES = $(libgcc_math_la_SOURCES) +MULTISRCTOP = +MULTIBUILDTOP = +MULTIDIRS = +MULTISUBDIR = +MULTIDO = true +MULTICLEAN = true +RECURSIVE_TARGETS = all-recursive check-recursive dvi-recursive \ + html-recursive info-recursive install-data-recursive \ + install-exec-recursive install-info-recursive \ + install-recursive installcheck-recursive installdirs-recursive \ + pdf-recursive ps-recursive uninstall-info-recursive \ + uninstall-recursive +ETAGS = etags +CTAGS = ctags +DIST_SUBDIRS = $(SUBDIRS) +DISTFILES = $(DIST_COMMON) $(DIST_SOURCES) $(TEXINFOS) $(EXTRA_DIST) +distdir = $(PACKAGE)-$(VERSION) +top_distdir = $(distdir) +am__remove_distdir = \ + { test ! -d $(distdir) \ + || { find $(distdir) -type d ! -perm -200 -exec chmod u+w {} ';' \ + && rm -fr $(distdir); }; } +DIST_ARCHIVES = $(distdir).tar.gz +GZIP_ENV = --best +distuninstallcheck_listfiles = find . -type f -print +distcleancheck_listfiles = find . -type f -print +ACLOCAL = @ACLOCAL@ +AMDEP_FALSE = @AMDEP_FALSE@ +AMDEP_TRUE = @AMDEP_TRUE@ +AMTAR = @AMTAR@ +AUTOCONF = @AUTOCONF@ +AUTOHEADER = @AUTOHEADER@ +AUTOMAKE = @AUTOMAKE@ +AWK = @AWK@ +BUILD_LIBGCC_MATH_FALSE = @BUILD_LIBGCC_MATH_FALSE@ +BUILD_LIBGCC_MATH_TRUE = @BUILD_LIBGCC_MATH_TRUE@ +CC = @CC@ +CCAS = @CCAS@ +CCASFLAGS = @CCASFLAGS@ +CCDEPMODE = @CCDEPMODE@ +CFLAGS = @CFLAGS@ +CPP = @CPP@ +CPPFLAGS = @CPPFLAGS@ +CYGPATH_W = @CYGPATH_W@ +DEFS = @DEFS@ +DEPDIR = @DEPDIR@ +ECHO_C = @ECHO_C@ +ECHO_N = @ECHO_N@ +ECHO_T = @ECHO_T@ +EXEEXT = @EXEEXT@ +INSTALL_DATA = @INSTALL_DATA@ +INSTALL_PROGRAM = @INSTALL_PROGRAM@ +INSTALL_SCRIPT = @INSTALL_SCRIPT@ +INSTALL_STRIP_PROGRAM = @INSTALL_STRIP_PROGRAM@ +LIBGCCM_USE_SYMVER_FALSE = @LIBGCCM_USE_SYMVER_FALSE@ +LIBGCCM_USE_SYMVER_TRUE = @LIBGCCM_USE_SYMVER_TRUE@ +LIBOBJS = @LIBOBJS@ +LIBS = @LIBS@ +LIBTOOL = @LIBTOOL@ +LN_S = @LN_S@ +LTLIBOBJS = @LTLIBOBJS@ +MAINT = @MAINT@ +MAINTAINER_MODE_FALSE = @MAINTAINER_MODE_FALSE@ +MAINTAINER_MODE_TRUE = @MAINTAINER_MODE_TRUE@ +MAKEINFO = @MAKEINFO@ +OBJEXT = @OBJEXT@ +PACKAGE = @PACKAGE@ +PACKAGE_BUGREPORT = @PACKAGE_BUGREPORT@ +PACKAGE_NAME = @PACKAGE_NAME@ +PACKAGE_STRING = @PACKAGE_STRING@ +PACKAGE_TARNAME = @PACKAGE_TARNAME@ +PACKAGE_VERSION = @PACKAGE_VERSION@ +PATH_SEPARATOR = @PATH_SEPARATOR@ +RANLIB = @RANLIB@ +SET_MAKE = @SET_MAKE@ +SHELL = @SHELL@ +STRIP = @STRIP@ +TARGET_ILP32_FALSE = @TARGET_ILP32_FALSE@ +TARGET_ILP32_TRUE = @TARGET_ILP32_TRUE@ +VERSION = @VERSION@ +ac_ct_CC = @ac_ct_CC@ +ac_ct_RANLIB = @ac_ct_RANLIB@ +ac_ct_STRIP = @ac_ct_STRIP@ +am__fastdepCC_FALSE = @am__fastdepCC_FALSE@ +am__fastdepCC_TRUE = @am__fastdepCC_TRUE@ +am__include = @am__include@ +am__leading_dot = @am__leading_dot@ +am__quote = @am__quote@ +am__tar = @am__tar@ +am__untar = @am__untar@ +arch_libraries = @arch_libraries@ +arch_maps = @arch_maps@ +arch_subdirs = @arch_subdirs@ +bindir = @bindir@ +build = @build@ +build_alias = @build_alias@ +build_cpu = @build_cpu@ +build_os = @build_os@ +build_vendor = @build_vendor@ +datadir = @datadir@ +enable_shared = @enable_shared@ +enable_static = @enable_static@ +exec_prefix = @exec_prefix@ +host = @host@ +host_alias = @host_alias@ +host_cpu = @host_cpu@ +host_os = @host_os@ +host_vendor = @host_vendor@ +includedir = @includedir@ +infodir = @infodir@ +install_sh = @install_sh@ +libdir = @libdir@ +libexecdir = @libexecdir@ +localstatedir = @localstatedir@ +mandir = @mandir@ +mkdir_p = @mkdir_p@ +multi_basedir = @multi_basedir@ +oldincludedir = @oldincludedir@ +prefix = @prefix@ +program_transform_name = @program_transform_name@ +sbindir = @sbindir@ +sharedstatedir = @sharedstatedir@ +sysconfdir = @sysconfdir@ +target = @target@ +target_alias = @target_alias@ +target_cpu = @target_cpu@ +target_os = @target_os@ +target_vendor = @target_vendor@ +toolexecdir = @toolexecdir@ +toolexeclibdir = @toolexeclibdir@ +AUTOMAKE_OPTIONS = 1.9.5 foreign +ACLOCAL_AMFLAGS = -I .. -I ../config +MAINT_CHARSET = latin1 +SUBDIRS = @arch_subdirs@ + +# May be used by various substitution variables. +gcc_version := $(shell cat $(top_srcdir)/../gcc/BASE-VER) +@LIBGCCM_USE_SYMVER_FALSE@version_arg = +@LIBGCCM_USE_SYMVER_TRUE@version_arg = -Wl,--version-script=gccm.map +@LIBGCCM_USE_SYMVER_FALSE@version_dep = +@LIBGCCM_USE_SYMVER_TRUE@version_dep = gccm.map +@BUILD_LIBGCC_MATH_TRUE@toolexeclib_LTLIBRARIES = libgcc-math.la +@BUILD_LIBGCC_MATH_TRUE@libgcc_math_la_SOURCES = +@BUILD_LIBGCC_MATH_TRUE@libgcc_math_la_LIBADD = @arch_libraries@ +@BUILD_LIBGCC_MATH_TRUE@libgcc_math_la_DEPENDENCIES = $(libgcc_math_la_LIBADD) $(version_dep) +@BUILD_LIBGCC_MATH_TRUE@libgcc_math_la_LDFLAGS = -version-info `grep -v '^\#' $(srcdir)/libtool-version` \ +@BUILD_LIBGCC_MATH_TRUE@ $(version_arg) -lm + + +# XXX hack alert +# From libffi/Makefile.am + +# Work around what appears to be a GNU make bug handling MAKEFLAGS +# values defined in terms of make variables, as is the case for CC and +# friends when we are called from the top level Makefile. +AM_MAKEFLAGS = \ + "AR_FLAGS=$(AR_FLAGS)" \ + "CC_FOR_BUILD=$(CC_FOR_BUILD)" \ + "CFLAGS=$(CFLAGS)" \ + "CXXFLAGS=$(CXXFLAGS)" \ + "CFLAGS_FOR_BUILD=$(CFLAGS_FOR_BUILD)" \ + "CFLAGS_FOR_TARGET=$(CFLAGS_FOR_TARGET)" \ + "INSTALL=$(INSTALL)" \ + "INSTALL_DATA=$(INSTALL_DATA)" \ + "INSTALL_PROGRAM=$(INSTALL_PROGRAM)" \ + "INSTALL_SCRIPT=$(INSTALL_SCRIPT)" \ + "JC1FLAGS=$(JC1FLAGS)" \ + "LDFLAGS=$(LDFLAGS)" \ + "LIBCFLAGS=$(LIBCFLAGS)" \ + "LIBCFLAGS_FOR_TARGET=$(LIBCFLAGS_FOR_TARGET)" \ + "MAKE=$(MAKE)" \ + "MAKEINFO=$(MAKEINFO) $(MAKEINFOFLAGS)" \ + "PICFLAG=$(PICFLAG)" \ + "PICFLAG_FOR_TARGET=$(PICFLAG_FOR_TARGET)" \ + "SHELL=$(SHELL)" \ + "RUNTESTFLAGS=$(RUNTESTFLAGS)" \ + "exec_prefix=$(exec_prefix)" \ + "infodir=$(infodir)" \ + "libdir=$(libdir)" \ + "prefix=$(prefix)" \ + "includedir=$(includedir)" \ + "AR=$(AR)" \ + "AS=$(AS)" \ + "CC=$(CC)" \ + "CXX=$(CXX)" \ + "LD=$(LD)" \ + "LIBCFLAGS=$(LIBCFLAGS)" \ + "NM=$(NM)" \ + "PICFLAG=$(PICFLAG)" \ + "RANLIB=$(RANLIB)" \ + "DESTDIR=$(DESTDIR)" + +MAKEOVERRIDES = +all: all-recursive + +.SUFFIXES: +am--refresh: + @: +$(srcdir)/Makefile.in: @MAINTAINER_MODE_TRUE@ $(srcdir)/Makefile.am $(am__configure_deps) + @for dep in $?; do \ + case '$(am__configure_deps)' in \ + *$$dep*) \ + echo ' cd $(srcdir) && $(AUTOMAKE) --foreign '; \ + cd $(srcdir) && $(AUTOMAKE) --foreign \ + && exit 0; \ + exit 1;; \ + esac; \ + done; \ + echo ' cd $(top_srcdir) && $(AUTOMAKE) --foreign Makefile'; \ + cd $(top_srcdir) && \ + $(AUTOMAKE) --foreign Makefile +.PRECIOUS: Makefile +Makefile: $(srcdir)/Makefile.in $(top_builddir)/config.status + @case '$?' in \ + *config.status*) \ + echo ' $(SHELL) ./config.status'; \ + $(SHELL) ./config.status;; \ + *) \ + echo ' cd $(top_builddir) && $(SHELL) ./config.status $@ $(am__depfiles_maybe)'; \ + cd $(top_builddir) && $(SHELL) ./config.status $@ $(am__depfiles_maybe);; \ + esac; + +$(top_builddir)/config.status: $(top_srcdir)/configure $(CONFIG_STATUS_DEPENDENCIES) + $(SHELL) ./config.status --recheck + +$(top_srcdir)/configure: @MAINTAINER_MODE_TRUE@ $(am__configure_deps) + cd $(srcdir) && $(AUTOCONF) +$(ACLOCAL_M4): @MAINTAINER_MODE_TRUE@ $(am__aclocal_m4_deps) + cd $(srcdir) && $(ACLOCAL) $(ACLOCAL_AMFLAGS) +install-toolexeclibLTLIBRARIES: $(toolexeclib_LTLIBRARIES) + @$(NORMAL_INSTALL) + test -z "$(toolexeclibdir)" || $(mkdir_p) "$(DESTDIR)$(toolexeclibdir)" + @list='$(toolexeclib_LTLIBRARIES)'; for p in $$list; do \ + if test -f $$p; then \ + f=$(am__strip_dir) \ + echo " $(LIBTOOL) --mode=install $(toolexeclibLTLIBRARIES_INSTALL) $(INSTALL_STRIP_FLAG) '$$p' '$(DESTDIR)$(toolexeclibdir)/$$f'"; \ + $(LIBTOOL) --mode=install $(toolexeclibLTLIBRARIES_INSTALL) $(INSTALL_STRIP_FLAG) "$$p" "$(DESTDIR)$(toolexeclibdir)/$$f"; \ + else :; fi; \ + done + +uninstall-toolexeclibLTLIBRARIES: + @$(NORMAL_UNINSTALL) + @set -x; list='$(toolexeclib_LTLIBRARIES)'; for p in $$list; do \ + p=$(am__strip_dir) \ + echo " $(LIBTOOL) --mode=uninstall rm -f '$(DESTDIR)$(toolexeclibdir)/$$p'"; \ + $(LIBTOOL) --mode=uninstall rm -f "$(DESTDIR)$(toolexeclibdir)/$$p"; \ + done + +clean-toolexeclibLTLIBRARIES: + -test -z "$(toolexeclib_LTLIBRARIES)" || rm -f $(toolexeclib_LTLIBRARIES) + @list='$(toolexeclib_LTLIBRARIES)'; for p in $$list; do \ + dir="`echo $$p | sed -e 's|/[^/]*$$||'`"; \ + test "$$dir" != "$$p" || dir=.; \ + echo "rm -f \"$${dir}/so_locations\""; \ + rm -f "$${dir}/so_locations"; \ + done +libgcc-math.la: $(libgcc_math_la_OBJECTS) $(libgcc_math_la_DEPENDENCIES) + $(LINK) $(am_libgcc_math_la_rpath) $(libgcc_math_la_LDFLAGS) $(libgcc_math_la_OBJECTS) $(libgcc_math_la_LIBADD) $(LIBS) + +mostlyclean-compile: + -rm -f *.$(OBJEXT) + +distclean-compile: + -rm -f *.tab.c + +mostlyclean-libtool: + -rm -f *.lo + +clean-libtool: + -rm -rf .libs _libs + +distclean-libtool: + -rm -f libtool + +# GNU Make needs to see an explicit $(MAKE) variable in the command it +# runs to enable its job server during parallel builds. Hence the +# comments below. +all-multi: + $(MULTIDO) $(AM_MAKEFLAGS) DO=all multi-do # $(MAKE) +install-multi: + $(MULTIDO) $(AM_MAKEFLAGS) DO=install multi-do # $(MAKE) + +mostlyclean-multi: + $(MULTICLEAN) $(AM_MAKEFLAGS) DO=mostlyclean multi-clean # $(MAKE) +clean-multi: + $(MULTICLEAN) $(AM_MAKEFLAGS) DO=clean multi-clean # $(MAKE) +distclean-multi: + $(MULTICLEAN) $(AM_MAKEFLAGS) DO=distclean multi-clean # $(MAKE) +maintainer-clean-multi: + $(MULTICLEAN) $(AM_MAKEFLAGS) DO=maintainer-clean multi-clean # $(MAKE) +uninstall-info-am: + +# This directory's subdirectories are mostly independent; you can cd +# into them and run `make' without going through this Makefile. +# To change the values of `make' variables: instead of editing Makefiles, +# (1) if the variable is set in `config.status', edit `config.status' +# (which will cause the Makefiles to be regenerated when you run `make'); +# (2) otherwise, pass the desired values on the `make' command line. +$(RECURSIVE_TARGETS): + @failcom='exit 1'; \ + for f in x $$MAKEFLAGS; do \ + case $$f in \ + *=* | --[!k]*);; \ + *k*) failcom='fail=yes';; \ + esac; \ + done; \ + dot_seen=no; \ + target=`echo $@ | sed s/-recursive//`; \ + list='$(SUBDIRS)'; for subdir in $$list; do \ + echo "Making $$target in $$subdir"; \ + if test "$$subdir" = "."; then \ + dot_seen=yes; \ + local_target="$$target-am"; \ + else \ + local_target="$$target"; \ + fi; \ + (cd $$subdir && $(MAKE) $(AM_MAKEFLAGS) $$local_target) \ + || eval $$failcom; \ + done; \ + if test "$$dot_seen" = "no"; then \ + $(MAKE) $(AM_MAKEFLAGS) "$$target-am" || exit 1; \ + fi; test -z "$$fail" + +mostlyclean-recursive clean-recursive distclean-recursive \ +maintainer-clean-recursive: + @failcom='exit 1'; \ + for f in x $$MAKEFLAGS; do \ + case $$f in \ + *=* | --[!k]*);; \ + *k*) failcom='fail=yes';; \ + esac; \ + done; \ + dot_seen=no; \ + case "$@" in \ + distclean-* | maintainer-clean-*) list='$(DIST_SUBDIRS)' ;; \ + *) list='$(SUBDIRS)' ;; \ + esac; \ + rev=''; for subdir in $$list; do \ + if test "$$subdir" = "."; then :; else \ + rev="$$subdir $$rev"; \ + fi; \ + done; \ + rev="$$rev ."; \ + target=`echo $@ | sed s/-recursive//`; \ + for subdir in $$rev; do \ + echo "Making $$target in $$subdir"; \ + if test "$$subdir" = "."; then \ + local_target="$$target-am"; \ + else \ + local_target="$$target"; \ + fi; \ + (cd $$subdir && $(MAKE) $(AM_MAKEFLAGS) $$local_target) \ + || eval $$failcom; \ + done && test -z "$$fail" +tags-recursive: + list='$(SUBDIRS)'; for subdir in $$list; do \ + test "$$subdir" = . || (cd $$subdir && $(MAKE) $(AM_MAKEFLAGS) tags); \ + done +ctags-recursive: + list='$(SUBDIRS)'; for subdir in $$list; do \ + test "$$subdir" = . || (cd $$subdir && $(MAKE) $(AM_MAKEFLAGS) ctags); \ + done + +ID: $(HEADERS) $(SOURCES) $(LISP) $(TAGS_FILES) + list='$(SOURCES) $(HEADERS) $(LISP) $(TAGS_FILES)'; \ + unique=`for i in $$list; do \ + if test -f "$$i"; then echo $$i; else echo $(srcdir)/$$i; fi; \ + done | \ + $(AWK) ' { files[$$0] = 1; } \ + END { for (i in files) print i; }'`; \ + mkid -fID $$unique +tags: TAGS + +TAGS: tags-recursive $(HEADERS) $(SOURCES) $(TAGS_DEPENDENCIES) \ + $(TAGS_FILES) $(LISP) + tags=; \ + here=`pwd`; \ + if ($(ETAGS) --etags-include --version) >/dev/null 2>&1; then \ + include_option=--etags-include; \ + empty_fix=.; \ + else \ + include_option=--include; \ + empty_fix=; \ + fi; \ + list='$(SUBDIRS)'; for subdir in $$list; do \ + if test "$$subdir" = .; then :; else \ + test ! -f $$subdir/TAGS || \ + tags="$$tags $$include_option=$$here/$$subdir/TAGS"; \ + fi; \ + done; \ + list='$(SOURCES) $(HEADERS) $(LISP) $(TAGS_FILES)'; \ + unique=`for i in $$list; do \ + if test -f "$$i"; then echo $$i; else echo $(srcdir)/$$i; fi; \ + done | \ + $(AWK) ' { files[$$0] = 1; } \ + END { for (i in files) print i; }'`; \ + if test -z "$(ETAGS_ARGS)$$tags$$unique"; then :; else \ + test -n "$$unique" || unique=$$empty_fix; \ + $(ETAGS) $(ETAGSFLAGS) $(AM_ETAGSFLAGS) $(ETAGS_ARGS) \ + $$tags $$unique; \ + fi +ctags: CTAGS +CTAGS: ctags-recursive $(HEADERS) $(SOURCES) $(TAGS_DEPENDENCIES) \ + $(TAGS_FILES) $(LISP) + tags=; \ + here=`pwd`; \ + list='$(SOURCES) $(HEADERS) $(LISP) $(TAGS_FILES)'; \ + unique=`for i in $$list; do \ + if test -f "$$i"; then echo $$i; else echo $(srcdir)/$$i; fi; \ + done | \ + $(AWK) ' { files[$$0] = 1; } \ + END { for (i in files) print i; }'`; \ + test -z "$(CTAGS_ARGS)$$tags$$unique" \ + || $(CTAGS) $(CTAGSFLAGS) $(AM_CTAGSFLAGS) $(CTAGS_ARGS) \ + $$tags $$unique + +GTAGS: + here=`$(am__cd) $(top_builddir) && pwd` \ + && cd $(top_srcdir) \ + && gtags -i $(GTAGS_ARGS) $$here + +distclean-tags: + -rm -f TAGS ID GTAGS GRTAGS GSYMS GPATH tags + +distdir: $(DISTFILES) + $(am__remove_distdir) + mkdir $(distdir) + $(mkdir_p) $(distdir)/.. $(distdir)/../config + @srcdirstrip=`echo "$(srcdir)" | sed 's|.|.|g'`; \ + topsrcdirstrip=`echo "$(top_srcdir)" | sed 's|.|.|g'`; \ + list='$(DISTFILES)'; for file in $$list; do \ + case $$file in \ + $(srcdir)/*) file=`echo "$$file" | sed "s|^$$srcdirstrip/||"`;; \ + $(top_srcdir)/*) file=`echo "$$file" | sed "s|^$$topsrcdirstrip/|$(top_builddir)/|"`;; \ + esac; \ + if test -f $$file || test -d $$file; then d=.; else d=$(srcdir); fi; \ + dir=`echo "$$file" | sed -e 's,/[^/]*$$,,'`; \ + if test "$$dir" != "$$file" && test "$$dir" != "."; then \ + dir="/$$dir"; \ + $(mkdir_p) "$(distdir)$$dir"; \ + else \ + dir=''; \ + fi; \ + if test -d $$d/$$file; then \ + if test -d $(srcdir)/$$file && test $$d != $(srcdir); then \ + cp -pR $(srcdir)/$$file $(distdir)$$dir || exit 1; \ + fi; \ + cp -pR $$d/$$file $(distdir)$$dir || exit 1; \ + else \ + test -f $(distdir)/$$file \ + || cp -p $$d/$$file $(distdir)/$$file \ + || exit 1; \ + fi; \ + done + list='$(DIST_SUBDIRS)'; for subdir in $$list; do \ + if test "$$subdir" = .; then :; else \ + test -d "$(distdir)/$$subdir" \ + || $(mkdir_p) "$(distdir)/$$subdir" \ + || exit 1; \ + distdir=`$(am__cd) $(distdir) && pwd`; \ + top_distdir=`$(am__cd) $(top_distdir) && pwd`; \ + (cd $$subdir && \ + $(MAKE) $(AM_MAKEFLAGS) \ + top_distdir="$$top_distdir" \ + distdir="$$distdir/$$subdir" \ + distdir) \ + || exit 1; \ + fi; \ + done + -find $(distdir) -type d ! -perm -777 -exec chmod a+rwx {} \; -o \ + ! -type d ! -perm -444 -links 1 -exec chmod a+r {} \; -o \ + ! -type d ! -perm -400 -exec chmod a+r {} \; -o \ + ! -type d ! -perm -444 -exec $(SHELL) $(install_sh) -c -m a+r {} {} \; \ + || chmod -R a+r $(distdir) +dist-gzip: distdir + tardir=$(distdir) && $(am__tar) | GZIP=$(GZIP_ENV) gzip -c >$(distdir).tar.gz + $(am__remove_distdir) + +dist-bzip2: distdir + tardir=$(distdir) && $(am__tar) | bzip2 -9 -c >$(distdir).tar.bz2 + $(am__remove_distdir) + +dist-tarZ: distdir + tardir=$(distdir) && $(am__tar) | compress -c >$(distdir).tar.Z + $(am__remove_distdir) + +dist-shar: distdir + shar $(distdir) | GZIP=$(GZIP_ENV) gzip -c >$(distdir).shar.gz + $(am__remove_distdir) + +dist-zip: distdir + -rm -f $(distdir).zip + zip -rq $(distdir).zip $(distdir) + $(am__remove_distdir) + +dist dist-all: distdir + tardir=$(distdir) && $(am__tar) | GZIP=$(GZIP_ENV) gzip -c >$(distdir).tar.gz + $(am__remove_distdir) + +# This target untars the dist file and tries a VPATH configuration. Then +# it guarantees that the distribution is self-contained by making another +# tarfile. +distcheck: dist + case '$(DIST_ARCHIVES)' in \ + *.tar.gz*) \ + GZIP=$(GZIP_ENV) gunzip -c $(distdir).tar.gz | $(am__untar) ;;\ + *.tar.bz2*) \ + bunzip2 -c $(distdir).tar.bz2 | $(am__untar) ;;\ + *.tar.Z*) \ + uncompress -c $(distdir).tar.Z | $(am__untar) ;;\ + *.shar.gz*) \ + GZIP=$(GZIP_ENV) gunzip -c $(distdir).shar.gz | unshar ;;\ + *.zip*) \ + unzip $(distdir).zip ;;\ + esac + chmod -R a-w $(distdir); chmod a+w $(distdir) + mkdir $(distdir)/_build + mkdir $(distdir)/_inst + chmod a-w $(distdir) + dc_install_base=`$(am__cd) $(distdir)/_inst && pwd | sed -e 's,^[^:\\/]:[\\/],/,'` \ + && dc_destdir="$${TMPDIR-/tmp}/am-dc-$$$$/" \ + && cd $(distdir)/_build \ + && ../configure --srcdir=.. --prefix="$$dc_install_base" \ + $(DISTCHECK_CONFIGURE_FLAGS) \ + && $(MAKE) $(AM_MAKEFLAGS) \ + && $(MAKE) $(AM_MAKEFLAGS) dvi \ + && $(MAKE) $(AM_MAKEFLAGS) check \ + && $(MAKE) $(AM_MAKEFLAGS) install \ + && $(MAKE) $(AM_MAKEFLAGS) installcheck \ + && $(MAKE) $(AM_MAKEFLAGS) uninstall \ + && $(MAKE) $(AM_MAKEFLAGS) distuninstallcheck_dir="$$dc_install_base" \ + distuninstallcheck \ + && chmod -R a-w "$$dc_install_base" \ + && ({ \ + (cd ../.. && umask 077 && mkdir "$$dc_destdir") \ + && $(MAKE) $(AM_MAKEFLAGS) DESTDIR="$$dc_destdir" install \ + && $(MAKE) $(AM_MAKEFLAGS) DESTDIR="$$dc_destdir" uninstall \ + && $(MAKE) $(AM_MAKEFLAGS) DESTDIR="$$dc_destdir" \ + distuninstallcheck_dir="$$dc_destdir" distuninstallcheck; \ + } || { rm -rf "$$dc_destdir"; exit 1; }) \ + && rm -rf "$$dc_destdir" \ + && $(MAKE) $(AM_MAKEFLAGS) dist \ + && rm -rf $(DIST_ARCHIVES) \ + && $(MAKE) $(AM_MAKEFLAGS) distcleancheck + $(am__remove_distdir) + @(echo "$(distdir) archives ready for distribution: "; \ + list='$(DIST_ARCHIVES)'; for i in $$list; do echo $$i; done) | \ + sed -e '1{h;s/./=/g;p;x;}' -e '$${p;x;}' +distuninstallcheck: + @cd $(distuninstallcheck_dir) \ + && test `$(distuninstallcheck_listfiles) | wc -l` -le 1 \ + || { echo "ERROR: files left after uninstall:" ; \ + if test -n "$(DESTDIR)"; then \ + echo " (check DESTDIR support)"; \ + fi ; \ + $(distuninstallcheck_listfiles) ; \ + exit 1; } >&2 +distcleancheck: distclean + @if test '$(srcdir)' = . ; then \ + echo "ERROR: distcleancheck can only run from a VPATH build" ; \ + exit 1 ; \ + fi + @test `$(distcleancheck_listfiles) | wc -l` -eq 0 \ + || { echo "ERROR: files left in build directory after distclean:" ; \ + $(distcleancheck_listfiles) ; \ + exit 1; } >&2 +check-am: all-am +check: check-recursive +all-am: Makefile $(LTLIBRARIES) all-multi +installdirs: installdirs-recursive +installdirs-am: + for dir in "$(DESTDIR)$(toolexeclibdir)"; do \ + test -z "$$dir" || $(mkdir_p) "$$dir"; \ + done +install: install-recursive +install-exec: install-exec-recursive +install-data: install-data-recursive +uninstall: uninstall-recursive + +install-am: all-am + @$(MAKE) $(AM_MAKEFLAGS) install-exec-am install-data-am + +installcheck: installcheck-recursive +install-strip: + $(MAKE) $(AM_MAKEFLAGS) INSTALL_PROGRAM="$(INSTALL_STRIP_PROGRAM)" \ + install_sh_PROGRAM="$(INSTALL_STRIP_PROGRAM)" INSTALL_STRIP_FLAG=-s \ + `test -z '$(STRIP)' || \ + echo "INSTALL_PROGRAM_ENV=STRIPPROG='$(STRIP)'"` install +mostlyclean-generic: + +clean-generic: + +distclean-generic: + -test -z "$(CONFIG_CLEAN_FILES)" || rm -f $(CONFIG_CLEAN_FILES) + +maintainer-clean-generic: + @echo "This command is intended for maintainers to use" + @echo "it deletes files that may require special tools to rebuild." +clean: clean-multi clean-recursive + +clean-am: clean-generic clean-libtool clean-toolexeclibLTLIBRARIES \ + mostlyclean-am + +distclean: distclean-multi distclean-recursive + -rm -f $(am__CONFIG_DISTCLEAN_FILES) + -rm -f Makefile +distclean-am: clean-am distclean-compile distclean-generic \ + distclean-libtool distclean-tags + +dvi: dvi-recursive + +dvi-am: + +html: html-recursive + +info: info-recursive + +info-am: + +install-data-am: + +install-exec-am: install-multi install-toolexeclibLTLIBRARIES + +install-info: install-info-recursive + +install-man: + +installcheck-am: + +maintainer-clean: maintainer-clean-multi maintainer-clean-recursive + -rm -f $(am__CONFIG_DISTCLEAN_FILES) + -rm -rf $(top_srcdir)/autom4te.cache + -rm -f Makefile +maintainer-clean-am: distclean-am maintainer-clean-generic + +mostlyclean: mostlyclean-multi mostlyclean-recursive + +mostlyclean-am: mostlyclean-compile mostlyclean-generic \ + mostlyclean-libtool + +pdf: pdf-recursive + +pdf-am: + +ps: ps-recursive + +ps-am: + +uninstall-am: uninstall-info-am uninstall-toolexeclibLTLIBRARIES + +uninstall-info: uninstall-info-recursive + +.PHONY: $(RECURSIVE_TARGETS) CTAGS GTAGS all all-am all-multi \ + am--refresh check check-am clean clean-generic clean-libtool \ + clean-multi clean-recursive clean-toolexeclibLTLIBRARIES ctags \ + ctags-recursive dist dist-all dist-bzip2 dist-gzip dist-shar \ + dist-tarZ dist-zip distcheck distclean distclean-compile \ + distclean-generic distclean-libtool distclean-multi \ + distclean-recursive distclean-tags distcleancheck distdir \ + distuninstallcheck dvi dvi-am html html-am info info-am \ + install install-am install-data install-data-am install-exec \ + install-exec-am install-info install-info-am install-man \ + install-multi install-strip install-toolexeclibLTLIBRARIES \ + installcheck installcheck-am installdirs installdirs-am \ + maintainer-clean maintainer-clean-generic \ + maintainer-clean-multi maintainer-clean-recursive mostlyclean \ + mostlyclean-compile mostlyclean-generic mostlyclean-libtool \ + mostlyclean-multi mostlyclean-recursive pdf pdf-am ps ps-am \ + tags tags-recursive uninstall uninstall-am uninstall-info-am \ + uninstall-toolexeclibLTLIBRARIES + +@LIBGCCM_USE_SYMVER_TRUE@.PHONY: gccm.map +@LIBGCCM_USE_SYMVER_TRUE@gccm.map: +@LIBGCCM_USE_SYMVER_TRUE@ rm -f gccm.map +@LIBGCCM_USE_SYMVER_TRUE@ for map in @arch_maps@; do \ +@LIBGCCM_USE_SYMVER_TRUE@ cat $(srcdir)/$$map >> gccm.map; \ +@LIBGCCM_USE_SYMVER_TRUE@ done +# Tell versions [3.59,3.63) of GNU make to not export all variables. +# Otherwise a system limit (for SysV at least) may be exceeded. +.NOEXPORT: diff --git a/libgcc-math/aclocal.m4 b/libgcc-math/aclocal.m4 new file mode 100644 index 00000000000..3b9f478fe5e --- /dev/null +++ b/libgcc-math/aclocal.m4 @@ -0,0 +1,940 @@ +# generated automatically by aclocal 1.9.6 -*- Autoconf -*- + +# Copyright (C) 1996, 1997, 1998, 1999, 2000, 2001, 2002, 2003, 2004, +# 2005 Free Software Foundation, Inc. +# This file is free software; the Free Software Foundation +# gives unlimited permission to copy and/or distribute it, +# with or without modifications, as long as this notice is preserved. + +# This program is distributed in the hope that it will be useful, +# but WITHOUT ANY WARRANTY, to the extent permitted by law; without +# even the implied warranty of MERCHANTABILITY or FITNESS FOR A +# PARTICULAR PURPOSE. + +# Copyright (C) 2002, 2003, 2005 Free Software Foundation, Inc. +# +# This file is free software; the Free Software Foundation +# gives unlimited permission to copy and/or distribute it, +# with or without modifications, as long as this notice is preserved. + +# AM_AUTOMAKE_VERSION(VERSION) +# ---------------------------- +# Automake X.Y traces this macro to ensure aclocal.m4 has been +# generated from the m4 files accompanying Automake X.Y. +AC_DEFUN([AM_AUTOMAKE_VERSION], [am__api_version="1.9"]) + +# AM_SET_CURRENT_AUTOMAKE_VERSION +# ------------------------------- +# Call AM_AUTOMAKE_VERSION so it can be traced. +# This function is AC_REQUIREd by AC_INIT_AUTOMAKE. +AC_DEFUN([AM_SET_CURRENT_AUTOMAKE_VERSION], + [AM_AUTOMAKE_VERSION([1.9.6])]) + +# Figure out how to run the assembler. -*- Autoconf -*- + +# Copyright (C) 2001, 2003, 2004, 2005 Free Software Foundation, Inc. +# +# This file is free software; the Free Software Foundation +# gives unlimited permission to copy and/or distribute it, +# with or without modifications, as long as this notice is preserved. + +# serial 4 + +# AM_PROG_AS +# ---------- +AC_DEFUN([AM_PROG_AS], +[# By default we simply use the C compiler to build assembly code. +AC_REQUIRE([AC_PROG_CC]) +test "${CCAS+set}" = set || CCAS=$CC +test "${CCASFLAGS+set}" = set || CCASFLAGS=$CFLAGS +AC_ARG_VAR([CCAS], [assembler compiler command (defaults to CC)]) +AC_ARG_VAR([CCASFLAGS], [assembler compiler flags (defaults to CFLAGS)]) +]) + +# AM_AUX_DIR_EXPAND -*- Autoconf -*- + +# Copyright (C) 2001, 2003, 2005 Free Software Foundation, Inc. +# +# This file is free software; the Free Software Foundation +# gives unlimited permission to copy and/or distribute it, +# with or without modifications, as long as this notice is preserved. + +# For projects using AC_CONFIG_AUX_DIR([foo]), Autoconf sets +# $ac_aux_dir to `$srcdir/foo'. In other projects, it is set to +# `$srcdir', `$srcdir/..', or `$srcdir/../..'. +# +# Of course, Automake must honor this variable whenever it calls a +# tool from the auxiliary directory. The problem is that $srcdir (and +# therefore $ac_aux_dir as well) can be either absolute or relative, +# depending on how configure is run. This is pretty annoying, since +# it makes $ac_aux_dir quite unusable in subdirectories: in the top +# source directory, any form will work fine, but in subdirectories a +# relative path needs to be adjusted first. +# +# $ac_aux_dir/missing +# fails when called from a subdirectory if $ac_aux_dir is relative +# $top_srcdir/$ac_aux_dir/missing +# fails if $ac_aux_dir is absolute, +# fails when called from a subdirectory in a VPATH build with +# a relative $ac_aux_dir +# +# The reason of the latter failure is that $top_srcdir and $ac_aux_dir +# are both prefixed by $srcdir. In an in-source build this is usually +# harmless because $srcdir is `.', but things will broke when you +# start a VPATH build or use an absolute $srcdir. +# +# So we could use something similar to $top_srcdir/$ac_aux_dir/missing, +# iff we strip the leading $srcdir from $ac_aux_dir. That would be: +# am_aux_dir='\$(top_srcdir)/'`expr "$ac_aux_dir" : "$srcdir//*\(.*\)"` +# and then we would define $MISSING as +# MISSING="\${SHELL} $am_aux_dir/missing" +# This will work as long as MISSING is not called from configure, because +# unfortunately $(top_srcdir) has no meaning in configure. +# However there are other variables, like CC, which are often used in +# configure, and could therefore not use this "fixed" $ac_aux_dir. +# +# Another solution, used here, is to always expand $ac_aux_dir to an +# absolute PATH. The drawback is that using absolute paths prevent a +# configured tree to be moved without reconfiguration. + +AC_DEFUN([AM_AUX_DIR_EXPAND], +[dnl Rely on autoconf to set up CDPATH properly. +AC_PREREQ([2.50])dnl +# expand $ac_aux_dir to an absolute path +am_aux_dir=`cd $ac_aux_dir && pwd` +]) + +# AM_CONDITIONAL -*- Autoconf -*- + +# Copyright (C) 1997, 2000, 2001, 2003, 2004, 2005 +# Free Software Foundation, Inc. +# +# This file is free software; the Free Software Foundation +# gives unlimited permission to copy and/or distribute it, +# with or without modifications, as long as this notice is preserved. + +# serial 7 + +# AM_CONDITIONAL(NAME, SHELL-CONDITION) +# ------------------------------------- +# Define a conditional. +AC_DEFUN([AM_CONDITIONAL], +[AC_PREREQ(2.52)dnl + ifelse([$1], [TRUE], [AC_FATAL([$0: invalid condition: $1])], + [$1], [FALSE], [AC_FATAL([$0: invalid condition: $1])])dnl +AC_SUBST([$1_TRUE]) +AC_SUBST([$1_FALSE]) +if $2; then + $1_TRUE= + $1_FALSE='#' +else + $1_TRUE='#' + $1_FALSE= +fi +AC_CONFIG_COMMANDS_PRE( +[if test -z "${$1_TRUE}" && test -z "${$1_FALSE}"; then + AC_MSG_ERROR([[conditional "$1" was never defined. +Usually this means the macro was only invoked conditionally.]]) +fi])]) + + +# Copyright (C) 1999, 2000, 2001, 2002, 2003, 2004, 2005 +# Free Software Foundation, Inc. +# +# This file is free software; the Free Software Foundation +# gives unlimited permission to copy and/or distribute it, +# with or without modifications, as long as this notice is preserved. + +# serial 8 + +# There are a few dirty hacks below to avoid letting `AC_PROG_CC' be +# written in clear, in which case automake, when reading aclocal.m4, +# will think it sees a *use*, and therefore will trigger all it's +# C support machinery. Also note that it means that autoscan, seeing +# CC etc. in the Makefile, will ask for an AC_PROG_CC use... + + +# _AM_DEPENDENCIES(NAME) +# ---------------------- +# See how the compiler implements dependency checking. +# NAME is "CC", "CXX", "GCJ", or "OBJC". +# We try a few techniques and use that to set a single cache variable. +# +# We don't AC_REQUIRE the corresponding AC_PROG_CC since the latter was +# modified to invoke _AM_DEPENDENCIES(CC); we would have a circular +# dependency, and given that the user is not expected to run this macro, +# just rely on AC_PROG_CC. +AC_DEFUN([_AM_DEPENDENCIES], +[AC_REQUIRE([AM_SET_DEPDIR])dnl +AC_REQUIRE([AM_OUTPUT_DEPENDENCY_COMMANDS])dnl +AC_REQUIRE([AM_MAKE_INCLUDE])dnl +AC_REQUIRE([AM_DEP_TRACK])dnl + +ifelse([$1], CC, [depcc="$CC" am_compiler_list=], + [$1], CXX, [depcc="$CXX" am_compiler_list=], + [$1], OBJC, [depcc="$OBJC" am_compiler_list='gcc3 gcc'], + [$1], GCJ, [depcc="$GCJ" am_compiler_list='gcc3 gcc'], + [depcc="$$1" am_compiler_list=]) + +AC_CACHE_CHECK([dependency style of $depcc], + [am_cv_$1_dependencies_compiler_type], +[if test -z "$AMDEP_TRUE" && test -f "$am_depcomp"; then + # We make a subdir and do the tests there. Otherwise we can end up + # making bogus files that we don't know about and never remove. For + # instance it was reported that on HP-UX the gcc test will end up + # making a dummy file named `D' -- because `-MD' means `put the output + # in D'. + mkdir conftest.dir + # Copy depcomp to subdir because otherwise we won't find it if we're + # using a relative directory. + cp "$am_depcomp" conftest.dir + cd conftest.dir + # We will build objects and dependencies in a subdirectory because + # it helps to detect inapplicable dependency modes. For instance + # both Tru64's cc and ICC support -MD to output dependencies as a + # side effect of compilation, but ICC will put the dependencies in + # the current directory while Tru64 will put them in the object + # directory. + mkdir sub + + am_cv_$1_dependencies_compiler_type=none + if test "$am_compiler_list" = ""; then + am_compiler_list=`sed -n ['s/^#*\([a-zA-Z0-9]*\))$/\1/p'] < ./depcomp` + fi + for depmode in $am_compiler_list; do + # Setup a source with many dependencies, because some compilers + # like to wrap large dependency lists on column 80 (with \), and + # we should not choose a depcomp mode which is confused by this. + # + # We need to recreate these files for each test, as the compiler may + # overwrite some of them when testing with obscure command lines. + # This happens at least with the AIX C compiler. + : > sub/conftest.c + for i in 1 2 3 4 5 6; do + echo '#include "conftst'$i'.h"' >> sub/conftest.c + # Using `: > sub/conftst$i.h' creates only sub/conftst1.h with + # Solaris 8's {/usr,}/bin/sh. + touch sub/conftst$i.h + done + echo "${am__include} ${am__quote}sub/conftest.Po${am__quote}" > confmf + + case $depmode in + nosideeffect) + # after this tag, mechanisms are not by side-effect, so they'll + # only be used when explicitly requested + if test "x$enable_dependency_tracking" = xyes; then + continue + else + break + fi + ;; + none) break ;; + esac + # We check with `-c' and `-o' for the sake of the "dashmstdout" + # mode. It turns out that the SunPro C++ compiler does not properly + # handle `-M -o', and we need to detect this. + if depmode=$depmode \ + source=sub/conftest.c object=sub/conftest.${OBJEXT-o} \ + depfile=sub/conftest.Po tmpdepfile=sub/conftest.TPo \ + $SHELL ./depcomp $depcc -c -o sub/conftest.${OBJEXT-o} sub/conftest.c \ + >/dev/null 2>conftest.err && + grep sub/conftst6.h sub/conftest.Po > /dev/null 2>&1 && + grep sub/conftest.${OBJEXT-o} sub/conftest.Po > /dev/null 2>&1 && + ${MAKE-make} -s -f confmf > /dev/null 2>&1; then + # icc doesn't choke on unknown options, it will just issue warnings + # or remarks (even with -Werror). So we grep stderr for any message + # that says an option was ignored or not supported. + # When given -MP, icc 7.0 and 7.1 complain thusly: + # icc: Command line warning: ignoring option '-M'; no argument required + # The diagnosis changed in icc 8.0: + # icc: Command line remark: option '-MP' not supported + if (grep 'ignoring option' conftest.err || + grep 'not supported' conftest.err) >/dev/null 2>&1; then :; else + am_cv_$1_dependencies_compiler_type=$depmode + break + fi + fi + done + + cd .. + rm -rf conftest.dir +else + am_cv_$1_dependencies_compiler_type=none +fi +]) +AC_SUBST([$1DEPMODE], [depmode=$am_cv_$1_dependencies_compiler_type]) +AM_CONDITIONAL([am__fastdep$1], [ + test "x$enable_dependency_tracking" != xno \ + && test "$am_cv_$1_dependencies_compiler_type" = gcc3]) +]) + + +# AM_SET_DEPDIR +# ------------- +# Choose a directory name for dependency files. +# This macro is AC_REQUIREd in _AM_DEPENDENCIES +AC_DEFUN([AM_SET_DEPDIR], +[AC_REQUIRE([AM_SET_LEADING_DOT])dnl +AC_SUBST([DEPDIR], ["${am__leading_dot}deps"])dnl +]) + + +# AM_DEP_TRACK +# ------------ +AC_DEFUN([AM_DEP_TRACK], +[AC_ARG_ENABLE(dependency-tracking, +[ --disable-dependency-tracking speeds up one-time build + --enable-dependency-tracking do not reject slow dependency extractors]) +if test "x$enable_dependency_tracking" != xno; then + am_depcomp="$ac_aux_dir/depcomp" + AMDEPBACKSLASH='\' +fi +AM_CONDITIONAL([AMDEP], [test "x$enable_dependency_tracking" != xno]) +AC_SUBST([AMDEPBACKSLASH]) +]) + +# Generate code to set up dependency tracking. -*- Autoconf -*- + +# Copyright (C) 1999, 2000, 2001, 2002, 2003, 2004, 2005 +# Free Software Foundation, Inc. +# +# This file is free software; the Free Software Foundation +# gives unlimited permission to copy and/or distribute it, +# with or without modifications, as long as this notice is preserved. + +#serial 3 + +# _AM_OUTPUT_DEPENDENCY_COMMANDS +# ------------------------------ +AC_DEFUN([_AM_OUTPUT_DEPENDENCY_COMMANDS], +[for mf in $CONFIG_FILES; do + # Strip MF so we end up with the name of the file. + mf=`echo "$mf" | sed -e 's/:.*$//'` + # Check whether this is an Automake generated Makefile or not. + # We used to match only the files named `Makefile.in', but + # some people rename them; so instead we look at the file content. + # Grep'ing the first line is not enough: some people post-process + # each Makefile.in and add a new line on top of each file to say so. + # So let's grep whole file. + if grep '^#.*generated by automake' $mf > /dev/null 2>&1; then + dirpart=`AS_DIRNAME("$mf")` + else + continue + fi + # Extract the definition of DEPDIR, am__include, and am__quote + # from the Makefile without running `make'. + DEPDIR=`sed -n 's/^DEPDIR = //p' < "$mf"` + test -z "$DEPDIR" && continue + am__include=`sed -n 's/^am__include = //p' < "$mf"` + test -z "am__include" && continue + am__quote=`sed -n 's/^am__quote = //p' < "$mf"` + # When using ansi2knr, U may be empty or an underscore; expand it + U=`sed -n 's/^U = //p' < "$mf"` + # Find all dependency output files, they are included files with + # $(DEPDIR) in their names. We invoke sed twice because it is the + # simplest approach to changing $(DEPDIR) to its actual value in the + # expansion. + for file in `sed -n " + s/^$am__include $am__quote\(.*(DEPDIR).*\)$am__quote"'$/\1/p' <"$mf" | \ + sed -e 's/\$(DEPDIR)/'"$DEPDIR"'/g' -e 's/\$U/'"$U"'/g'`; do + # Make sure the directory exists. + test -f "$dirpart/$file" && continue + fdir=`AS_DIRNAME(["$file"])` + AS_MKDIR_P([$dirpart/$fdir]) + # echo "creating $dirpart/$file" + echo '# dummy' > "$dirpart/$file" + done +done +])# _AM_OUTPUT_DEPENDENCY_COMMANDS + + +# AM_OUTPUT_DEPENDENCY_COMMANDS +# ----------------------------- +# This macro should only be invoked once -- use via AC_REQUIRE. +# +# This code is only required when automatic dependency tracking +# is enabled. FIXME. This creates each `.P' file that we will +# need in order to bootstrap the dependency handling code. +AC_DEFUN([AM_OUTPUT_DEPENDENCY_COMMANDS], +[AC_CONFIG_COMMANDS([depfiles], + [test x"$AMDEP_TRUE" != x"" || _AM_OUTPUT_DEPENDENCY_COMMANDS], + [AMDEP_TRUE="$AMDEP_TRUE" ac_aux_dir="$ac_aux_dir"]) +]) + +# Do all the work for Automake. -*- Autoconf -*- + +# Copyright (C) 1996, 1997, 1998, 1999, 2000, 2001, 2002, 2003, 2004, 2005 +# Free Software Foundation, Inc. +# +# This file is free software; the Free Software Foundation +# gives unlimited permission to copy and/or distribute it, +# with or without modifications, as long as this notice is preserved. + +# serial 12 + +# This macro actually does too much. Some checks are only needed if +# your package does certain things. But this isn't really a big deal. + +# AM_INIT_AUTOMAKE(PACKAGE, VERSION, [NO-DEFINE]) +# AM_INIT_AUTOMAKE([OPTIONS]) +# ----------------------------------------------- +# The call with PACKAGE and VERSION arguments is the old style +# call (pre autoconf-2.50), which is being phased out. PACKAGE +# and VERSION should now be passed to AC_INIT and removed from +# the call to AM_INIT_AUTOMAKE. +# We support both call styles for the transition. After +# the next Automake release, Autoconf can make the AC_INIT +# arguments mandatory, and then we can depend on a new Autoconf +# release and drop the old call support. +AC_DEFUN([AM_INIT_AUTOMAKE], +[AC_PREREQ([2.58])dnl +dnl Autoconf wants to disallow AM_ names. We explicitly allow +dnl the ones we care about. +m4_pattern_allow([^AM_[A-Z]+FLAGS$])dnl +AC_REQUIRE([AM_SET_CURRENT_AUTOMAKE_VERSION])dnl +AC_REQUIRE([AC_PROG_INSTALL])dnl +# test to see if srcdir already configured +if test "`cd $srcdir && pwd`" != "`pwd`" && + test -f $srcdir/config.status; then + AC_MSG_ERROR([source directory already configured; run "make distclean" there first]) +fi + +# test whether we have cygpath +if test -z "$CYGPATH_W"; then + if (cygpath --version) >/dev/null 2>/dev/null; then + CYGPATH_W='cygpath -w' + else + CYGPATH_W=echo + fi +fi +AC_SUBST([CYGPATH_W]) + +# Define the identity of the package. +dnl Distinguish between old-style and new-style calls. +m4_ifval([$2], +[m4_ifval([$3], [_AM_SET_OPTION([no-define])])dnl + AC_SUBST([PACKAGE], [$1])dnl + AC_SUBST([VERSION], [$2])], +[_AM_SET_OPTIONS([$1])dnl + AC_SUBST([PACKAGE], ['AC_PACKAGE_TARNAME'])dnl + AC_SUBST([VERSION], ['AC_PACKAGE_VERSION'])])dnl + +_AM_IF_OPTION([no-define],, +[AC_DEFINE_UNQUOTED(PACKAGE, "$PACKAGE", [Name of package]) + AC_DEFINE_UNQUOTED(VERSION, "$VERSION", [Version number of package])])dnl + +# Some tools Automake needs. +AC_REQUIRE([AM_SANITY_CHECK])dnl +AC_REQUIRE([AC_ARG_PROGRAM])dnl +AM_MISSING_PROG(ACLOCAL, aclocal-${am__api_version}) +AM_MISSING_PROG(AUTOCONF, autoconf) +AM_MISSING_PROG(AUTOMAKE, automake-${am__api_version}) +AM_MISSING_PROG(AUTOHEADER, autoheader) +AM_MISSING_PROG(MAKEINFO, makeinfo) +AM_PROG_INSTALL_SH +AM_PROG_INSTALL_STRIP +AC_REQUIRE([AM_PROG_MKDIR_P])dnl +# We need awk for the "check" target. The system "awk" is bad on +# some platforms. +AC_REQUIRE([AC_PROG_AWK])dnl +AC_REQUIRE([AC_PROG_MAKE_SET])dnl +AC_REQUIRE([AM_SET_LEADING_DOT])dnl +_AM_IF_OPTION([tar-ustar], [_AM_PROG_TAR([ustar])], + [_AM_IF_OPTION([tar-pax], [_AM_PROG_TAR([pax])], + [_AM_PROG_TAR([v7])])]) +_AM_IF_OPTION([no-dependencies],, +[AC_PROVIDE_IFELSE([AC_PROG_CC], + [_AM_DEPENDENCIES(CC)], + [define([AC_PROG_CC], + defn([AC_PROG_CC])[_AM_DEPENDENCIES(CC)])])dnl +AC_PROVIDE_IFELSE([AC_PROG_CXX], + [_AM_DEPENDENCIES(CXX)], + [define([AC_PROG_CXX], + defn([AC_PROG_CXX])[_AM_DEPENDENCIES(CXX)])])dnl +]) +]) + + +# When config.status generates a header, we must update the stamp-h file. +# This file resides in the same directory as the config header +# that is generated. The stamp files are numbered to have different names. + +# Autoconf calls _AC_AM_CONFIG_HEADER_HOOK (when defined) in the +# loop where config.status creates the headers, so we can generate +# our stamp files there. +AC_DEFUN([_AC_AM_CONFIG_HEADER_HOOK], +[# Compute $1's index in $config_headers. +_am_stamp_count=1 +for _am_header in $config_headers :; do + case $_am_header in + $1 | $1:* ) + break ;; + * ) + _am_stamp_count=`expr $_am_stamp_count + 1` ;; + esac +done +echo "timestamp for $1" >`AS_DIRNAME([$1])`/stamp-h[]$_am_stamp_count]) + +# Copyright (C) 2001, 2003, 2005 Free Software Foundation, Inc. +# +# This file is free software; the Free Software Foundation +# gives unlimited permission to copy and/or distribute it, +# with or without modifications, as long as this notice is preserved. + +# AM_PROG_INSTALL_SH +# ------------------ +# Define $install_sh. +AC_DEFUN([AM_PROG_INSTALL_SH], +[AC_REQUIRE([AM_AUX_DIR_EXPAND])dnl +install_sh=${install_sh-"$am_aux_dir/install-sh"} +AC_SUBST(install_sh)]) + +# Add --enable-maintainer-mode option to configure. -*- Autoconf -*- +# From Jim Meyering + +# Copyright (C) 1996, 1998, 2000, 2001, 2002, 2003, 2004, 2005 +# Free Software Foundation, Inc. +# +# This file is free software; the Free Software Foundation +# gives unlimited permission to copy and/or distribute it, +# with or without modifications, as long as this notice is preserved. + +# serial 4 + +AC_DEFUN([AM_MAINTAINER_MODE], +[AC_MSG_CHECKING([whether to enable maintainer-specific portions of Makefiles]) + dnl maintainer-mode is disabled by default + AC_ARG_ENABLE(maintainer-mode, +[ --enable-maintainer-mode enable make rules and dependencies not useful + (and sometimes confusing) to the casual installer], + USE_MAINTAINER_MODE=$enableval, + USE_MAINTAINER_MODE=no) + AC_MSG_RESULT([$USE_MAINTAINER_MODE]) + AM_CONDITIONAL(MAINTAINER_MODE, [test $USE_MAINTAINER_MODE = yes]) + MAINT=$MAINTAINER_MODE_TRUE + AC_SUBST(MAINT)dnl +] +) + +AU_DEFUN([jm_MAINTAINER_MODE], [AM_MAINTAINER_MODE]) + +# Check to see how 'make' treats includes. -*- Autoconf -*- + +# Copyright (C) 2001, 2002, 2003, 2005 Free Software Foundation, Inc. +# +# This file is free software; the Free Software Foundation +# gives unlimited permission to copy and/or distribute it, +# with or without modifications, as long as this notice is preserved. + +# serial 3 + +# AM_MAKE_INCLUDE() +# ----------------- +# Check to see how make treats includes. +AC_DEFUN([AM_MAKE_INCLUDE], +[am_make=${MAKE-make} +cat > confinc << 'END' +am__doit: + @echo done +.PHONY: am__doit +END +# If we don't find an include directive, just comment out the code. +AC_MSG_CHECKING([for style of include used by $am_make]) +am__include="#" +am__quote= +_am_result=none +# First try GNU make style include. +echo "include confinc" > confmf +# We grep out `Entering directory' and `Leaving directory' +# messages which can occur if `w' ends up in MAKEFLAGS. +# In particular we don't look at `^make:' because GNU make might +# be invoked under some other name (usually "gmake"), in which +# case it prints its new name instead of `make'. +if test "`$am_make -s -f confmf 2> /dev/null | grep -v 'ing directory'`" = "done"; then + am__include=include + am__quote= + _am_result=GNU +fi +# Now try BSD make style include. +if test "$am__include" = "#"; then + echo '.include "confinc"' > confmf + if test "`$am_make -s -f confmf 2> /dev/null`" = "done"; then + am__include=.include + am__quote="\"" + _am_result=BSD + fi +fi +AC_SUBST([am__include]) +AC_SUBST([am__quote]) +AC_MSG_RESULT([$_am_result]) +rm -f confinc confmf +]) + +# Fake the existence of programs that GNU maintainers use. -*- Autoconf -*- + +# Copyright (C) 1997, 1999, 2000, 2001, 2003, 2005 +# Free Software Foundation, Inc. +# +# This file is free software; the Free Software Foundation +# gives unlimited permission to copy and/or distribute it, +# with or without modifications, as long as this notice is preserved. + +# serial 4 + +# AM_MISSING_PROG(NAME, PROGRAM) +# ------------------------------ +AC_DEFUN([AM_MISSING_PROG], +[AC_REQUIRE([AM_MISSING_HAS_RUN]) +$1=${$1-"${am_missing_run}$2"} +AC_SUBST($1)]) + + +# AM_MISSING_HAS_RUN +# ------------------ +# Define MISSING if not defined so far and test if it supports --run. +# If it does, set am_missing_run to use it, otherwise, to nothing. +AC_DEFUN([AM_MISSING_HAS_RUN], +[AC_REQUIRE([AM_AUX_DIR_EXPAND])dnl +test x"${MISSING+set}" = xset || MISSING="\${SHELL} $am_aux_dir/missing" +# Use eval to expand $SHELL +if eval "$MISSING --run true"; then + am_missing_run="$MISSING --run " +else + am_missing_run= + AC_MSG_WARN([`missing' script is too old or missing]) +fi +]) + +# Copyright (C) 2003, 2004, 2005 Free Software Foundation, Inc. +# +# This file is free software; the Free Software Foundation +# gives unlimited permission to copy and/or distribute it, +# with or without modifications, as long as this notice is preserved. + +# AM_PROG_MKDIR_P +# --------------- +# Check whether `mkdir -p' is supported, fallback to mkinstalldirs otherwise. +# +# Automake 1.8 used `mkdir -m 0755 -p --' to ensure that directories +# created by `make install' are always world readable, even if the +# installer happens to have an overly restrictive umask (e.g. 077). +# This was a mistake. There are at least two reasons why we must not +# use `-m 0755': +# - it causes special bits like SGID to be ignored, +# - it may be too restrictive (some setups expect 775 directories). +# +# Do not use -m 0755 and let people choose whatever they expect by +# setting umask. +# +# We cannot accept any implementation of `mkdir' that recognizes `-p'. +# Some implementations (such as Solaris 8's) are not thread-safe: if a +# parallel make tries to run `mkdir -p a/b' and `mkdir -p a/c' +# concurrently, both version can detect that a/ is missing, but only +# one can create it and the other will error out. Consequently we +# restrict ourselves to GNU make (using the --version option ensures +# this.) +AC_DEFUN([AM_PROG_MKDIR_P], +[if mkdir -p --version . >/dev/null 2>&1 && test ! -d ./--version; then + # We used to keeping the `.' as first argument, in order to + # allow $(mkdir_p) to be used without argument. As in + # $(mkdir_p) $(somedir) + # where $(somedir) is conditionally defined. However this is wrong + # for two reasons: + # 1. if the package is installed by a user who cannot write `.' + # make install will fail, + # 2. the above comment should most certainly read + # $(mkdir_p) $(DESTDIR)$(somedir) + # so it does not work when $(somedir) is undefined and + # $(DESTDIR) is not. + # To support the latter case, we have to write + # test -z "$(somedir)" || $(mkdir_p) $(DESTDIR)$(somedir), + # so the `.' trick is pointless. + mkdir_p='mkdir -p --' +else + # On NextStep and OpenStep, the `mkdir' command does not + # recognize any option. It will interpret all options as + # directories to create, and then abort because `.' already + # exists. + for d in ./-p ./--version; + do + test -d $d && rmdir $d + done + # $(mkinstalldirs) is defined by Automake if mkinstalldirs exists. + if test -f "$ac_aux_dir/mkinstalldirs"; then + mkdir_p='$(mkinstalldirs)' + else + mkdir_p='$(install_sh) -d' + fi +fi +AC_SUBST([mkdir_p])]) + +# Copyright (C) 1998, 1999, 2000, 2001, 2003, 2004, 2005 +# Free Software Foundation, Inc. +# +# This file is free software; the Free Software Foundation +# gives unlimited permission to copy and/or distribute it, +# with or without modifications, as long as this notice is preserved. + +# serial 5 + +# AM_ENABLE_MULTILIB([MAKEFILE], [REL-TO-TOP-SRCDIR]) +# --------------------------------------------------- +# Add --enable-multilib to configure. +AC_DEFUN([AM_ENABLE_MULTILIB], +[# Default to --enable-multilib +AC_ARG_ENABLE(multilib, +[ --enable-multilib build many library versions (default)], +[case "$enableval" in + yes) multilib=yes ;; + no) multilib=no ;; + *) AC_MSG_ERROR([bad value $enableval for multilib option]) ;; + esac], + [multilib=yes]) + +# We may get other options which we leave undocumented: +# --with-target-subdir, --with-multisrctop, --with-multisubdir +# See config-ml.in if you want the gory details. + +if test "$srcdir" = "."; then + if test "$with_target_subdir" != "."; then + multi_basedir="$srcdir/$with_multisrctop../$2" + else + multi_basedir="$srcdir/$with_multisrctop$2" + fi +else + multi_basedir="$srcdir/$2" +fi +AC_SUBST(multi_basedir) + +AC_OUTPUT_COMMANDS([ +# Only add multilib support code if we just rebuilt the top-level +# Makefile. +case " $CONFIG_FILES " in + *" ]m4_default([$1],Makefile)[ "*) + ac_file=]m4_default([$1],Makefile)[ . ${multi_basedir}/config-ml.in + ;; +esac], + [ +srcdir="$srcdir" +host="$host" +target="$target" +with_multisubdir="$with_multisubdir" +with_multisrctop="$with_multisrctop" +with_target_subdir="$with_target_subdir" +ac_configure_args="${multilib_arg} ${ac_configure_args}" +multi_basedir="$multi_basedir" +CONFIG_SHELL=${CONFIG_SHELL-/bin/sh} +CC="$CC"])])dnl + +# Helper functions for option handling. -*- Autoconf -*- + +# Copyright (C) 2001, 2002, 2003, 2005 Free Software Foundation, Inc. +# +# This file is free software; the Free Software Foundation +# gives unlimited permission to copy and/or distribute it, +# with or without modifications, as long as this notice is preserved. + +# serial 3 + +# _AM_MANGLE_OPTION(NAME) +# ----------------------- +AC_DEFUN([_AM_MANGLE_OPTION], +[[_AM_OPTION_]m4_bpatsubst($1, [[^a-zA-Z0-9_]], [_])]) + +# _AM_SET_OPTION(NAME) +# ------------------------------ +# Set option NAME. Presently that only means defining a flag for this option. +AC_DEFUN([_AM_SET_OPTION], +[m4_define(_AM_MANGLE_OPTION([$1]), 1)]) + +# _AM_SET_OPTIONS(OPTIONS) +# ---------------------------------- +# OPTIONS is a space-separated list of Automake options. +AC_DEFUN([_AM_SET_OPTIONS], +[AC_FOREACH([_AM_Option], [$1], [_AM_SET_OPTION(_AM_Option)])]) + +# _AM_IF_OPTION(OPTION, IF-SET, [IF-NOT-SET]) +# ------------------------------------------- +# Execute IF-SET if OPTION is set, IF-NOT-SET otherwise. +AC_DEFUN([_AM_IF_OPTION], +[m4_ifset(_AM_MANGLE_OPTION([$1]), [$2], [$3])]) + +# Check to make sure that the build environment is sane. -*- Autoconf -*- + +# Copyright (C) 1996, 1997, 2000, 2001, 2003, 2005 +# Free Software Foundation, Inc. +# +# This file is free software; the Free Software Foundation +# gives unlimited permission to copy and/or distribute it, +# with or without modifications, as long as this notice is preserved. + +# serial 4 + +# AM_SANITY_CHECK +# --------------- +AC_DEFUN([AM_SANITY_CHECK], +[AC_MSG_CHECKING([whether build environment is sane]) +# Just in case +sleep 1 +echo timestamp > conftest.file +# Do `set' in a subshell so we don't clobber the current shell's +# arguments. Must try -L first in case configure is actually a +# symlink; some systems play weird games with the mod time of symlinks +# (eg FreeBSD returns the mod time of the symlink's containing +# directory). +if ( + set X `ls -Lt $srcdir/configure conftest.file 2> /dev/null` + if test "$[*]" = "X"; then + # -L didn't work. + set X `ls -t $srcdir/configure conftest.file` + fi + rm -f conftest.file + if test "$[*]" != "X $srcdir/configure conftest.file" \ + && test "$[*]" != "X conftest.file $srcdir/configure"; then + + # If neither matched, then we have a broken ls. This can happen + # if, for instance, CONFIG_SHELL is bash and it inherits a + # broken ls alias from the environment. This has actually + # happened. Such a system could not be considered "sane". + AC_MSG_ERROR([ls -t appears to fail. Make sure there is not a broken +alias in your environment]) + fi + + test "$[2]" = conftest.file + ) +then + # Ok. + : +else + AC_MSG_ERROR([newly created file is older than distributed files! +Check your system clock]) +fi +AC_MSG_RESULT(yes)]) + +# Copyright (C) 2001, 2003, 2005 Free Software Foundation, Inc. +# +# This file is free software; the Free Software Foundation +# gives unlimited permission to copy and/or distribute it, +# with or without modifications, as long as this notice is preserved. + +# AM_PROG_INSTALL_STRIP +# --------------------- +# One issue with vendor `install' (even GNU) is that you can't +# specify the program used to strip binaries. This is especially +# annoying in cross-compiling environments, where the build's strip +# is unlikely to handle the host's binaries. +# Fortunately install-sh will honor a STRIPPROG variable, so we +# always use install-sh in `make install-strip', and initialize +# STRIPPROG with the value of the STRIP variable (set by the user). +AC_DEFUN([AM_PROG_INSTALL_STRIP], +[AC_REQUIRE([AM_PROG_INSTALL_SH])dnl +# Installed binaries are usually stripped using `strip' when the user +# run `make install-strip'. However `strip' might not be the right +# tool to use in cross-compilation environments, therefore Automake +# will honor the `STRIP' environment variable to overrule this program. +dnl Don't test for $cross_compiling = yes, because it might be `maybe'. +if test "$cross_compiling" != no; then + AC_CHECK_TOOL([STRIP], [strip], :) +fi +INSTALL_STRIP_PROGRAM="\${SHELL} \$(install_sh) -c -s" +AC_SUBST([INSTALL_STRIP_PROGRAM])]) + +# Check how to create a tarball. -*- Autoconf -*- + +# Copyright (C) 2004, 2005 Free Software Foundation, Inc. +# +# This file is free software; the Free Software Foundation +# gives unlimited permission to copy and/or distribute it, +# with or without modifications, as long as this notice is preserved. + +# serial 2 + +# _AM_PROG_TAR(FORMAT) +# -------------------- +# Check how to create a tarball in format FORMAT. +# FORMAT should be one of `v7', `ustar', or `pax'. +# +# Substitute a variable $(am__tar) that is a command +# writing to stdout a FORMAT-tarball containing the directory +# $tardir. +# tardir=directory && $(am__tar) > result.tar +# +# Substitute a variable $(am__untar) that extract such +# a tarball read from stdin. +# $(am__untar) < result.tar +AC_DEFUN([_AM_PROG_TAR], +[# Always define AMTAR for backward compatibility. +AM_MISSING_PROG([AMTAR], [tar]) +m4_if([$1], [v7], + [am__tar='${AMTAR} chof - "$$tardir"'; am__untar='${AMTAR} xf -'], + [m4_case([$1], [ustar],, [pax],, + [m4_fatal([Unknown tar format])]) +AC_MSG_CHECKING([how to create a $1 tar archive]) +# Loop over all known methods to create a tar archive until one works. +_am_tools='gnutar m4_if([$1], [ustar], [plaintar]) pax cpio none' +_am_tools=${am_cv_prog_tar_$1-$_am_tools} +# Do not fold the above two line into one, because Tru64 sh and +# Solaris sh will not grok spaces in the rhs of `-'. +for _am_tool in $_am_tools +do + case $_am_tool in + gnutar) + for _am_tar in tar gnutar gtar; + do + AM_RUN_LOG([$_am_tar --version]) && break + done + am__tar="$_am_tar --format=m4_if([$1], [pax], [posix], [$1]) -chf - "'"$$tardir"' + am__tar_="$_am_tar --format=m4_if([$1], [pax], [posix], [$1]) -chf - "'"$tardir"' + am__untar="$_am_tar -xf -" + ;; + plaintar) + # Must skip GNU tar: if it does not support --format= it doesn't create + # ustar tarball either. + (tar --version) >/dev/null 2>&1 && continue + am__tar='tar chf - "$$tardir"' + am__tar_='tar chf - "$tardir"' + am__untar='tar xf -' + ;; + pax) + am__tar='pax -L -x $1 -w "$$tardir"' + am__tar_='pax -L -x $1 -w "$tardir"' + am__untar='pax -r' + ;; + cpio) + am__tar='find "$$tardir" -print | cpio -o -H $1 -L' + am__tar_='find "$tardir" -print | cpio -o -H $1 -L' + am__untar='cpio -i -H $1 -d' + ;; + none) + am__tar=false + am__tar_=false + am__untar=false + ;; + esac + + # If the value was cached, stop now. We just wanted to have am__tar + # and am__untar set. + test -n "${am_cv_prog_tar_$1}" && break + + # tar/untar a dummy directory, and stop if the command works + rm -rf conftest.dir + mkdir conftest.dir + echo GrepMe > conftest.dir/file + AM_RUN_LOG([tardir=conftest.dir && eval $am__tar_ >conftest.tar]) + rm -rf conftest.dir + if test -s conftest.tar; then + AM_RUN_LOG([$am__untar /dev/null 2>&1 && break + fi +done +rm -rf conftest.dir + +AC_CACHE_VAL([am_cv_prog_tar_$1], [am_cv_prog_tar_$1=$_am_tool]) +AC_MSG_RESULT([$am_cv_prog_tar_$1])]) +AC_SUBST([am__tar]) +AC_SUBST([am__untar]) +]) # _AM_PROG_TAR + +m4_include([../config/depstand.m4]) +m4_include([../config/lead-dot.m4]) +m4_include([../libtool.m4]) diff --git a/libgcc-math/configure b/libgcc-math/configure new file mode 100755 index 00000000000..1480acf9222 --- /dev/null +++ b/libgcc-math/configure @@ -0,0 +1,5861 @@ +#! /bin/sh +# Guess values for system-dependent variables and create Makefiles. +# Generated by GNU Autoconf 2.59 for libgcc-math 1.0. +# +# Copyright (C) 2003 Free Software Foundation, Inc. +# This configure script is free software; the Free Software Foundation +# gives unlimited permission to copy, distribute and modify it. +## --------------------- ## +## M4sh Initialization. ## +## --------------------- ## + +# Be Bourne compatible +if test -n "${ZSH_VERSION+set}" && (emulate sh) >/dev/null 2>&1; then + emulate sh + NULLCMD=: + # Zsh 3.x and 4.x performs word splitting on ${1+"$@"}, which + # is contrary to our usage. Disable this feature. + alias -g '${1+"$@"}'='"$@"' +elif test -n "${BASH_VERSION+set}" && (set -o posix) >/dev/null 2>&1; then + set -o posix +fi +DUALCASE=1; export DUALCASE # for MKS sh + +# Support unset when possible. +if ( (MAIL=60; unset MAIL) || exit) >/dev/null 2>&1; then + as_unset=unset +else + as_unset=false +fi + + +# Work around bugs in pre-3.0 UWIN ksh. +$as_unset ENV MAIL MAILPATH +PS1='$ ' +PS2='> ' +PS4='+ ' + +# NLS nuisances. +for as_var in \ + LANG LANGUAGE LC_ADDRESS LC_ALL LC_COLLATE LC_CTYPE LC_IDENTIFICATION \ + LC_MEASUREMENT LC_MESSAGES LC_MONETARY LC_NAME LC_NUMERIC LC_PAPER \ + LC_TELEPHONE LC_TIME +do + if (set +x; test -z "`(eval $as_var=C; export $as_var) 2>&1`"); then + eval $as_var=C; export $as_var + else + $as_unset $as_var + fi +done + +# Required to use basename. +if expr a : '\(a\)' >/dev/null 2>&1; then + as_expr=expr +else + as_expr=false +fi + +if (basename /) >/dev/null 2>&1 && test "X`basename / 2>&1`" = "X/"; then + as_basename=basename +else + as_basename=false +fi + + +# Name of the executable. +as_me=`$as_basename "$0" || +$as_expr X/"$0" : '.*/\([^/][^/]*\)/*$' \| \ + X"$0" : 'X\(//\)$' \| \ + X"$0" : 'X\(/\)$' \| \ + . : '\(.\)' 2>/dev/null || +echo X/"$0" | + sed '/^.*\/\([^/][^/]*\)\/*$/{ s//\1/; q; } + /^X\/\(\/\/\)$/{ s//\1/; q; } + /^X\/\(\/\).*/{ s//\1/; q; } + s/.*/./; q'` + + +# PATH needs CR, and LINENO needs CR and PATH. +# Avoid depending upon Character Ranges. +as_cr_letters='abcdefghijklmnopqrstuvwxyz' +as_cr_LETTERS='ABCDEFGHIJKLMNOPQRSTUVWXYZ' +as_cr_Letters=$as_cr_letters$as_cr_LETTERS +as_cr_digits='0123456789' +as_cr_alnum=$as_cr_Letters$as_cr_digits + +# The user is always right. +if test "${PATH_SEPARATOR+set}" != set; then + echo "#! /bin/sh" >conf$$.sh + echo "exit 0" >>conf$$.sh + chmod +x conf$$.sh + if (PATH="/nonexistent;."; conf$$.sh) >/dev/null 2>&1; then + PATH_SEPARATOR=';' + else + PATH_SEPARATOR=: + fi + rm -f conf$$.sh +fi + + + as_lineno_1=$LINENO + as_lineno_2=$LINENO + as_lineno_3=`(expr $as_lineno_1 + 1) 2>/dev/null` + test "x$as_lineno_1" != "x$as_lineno_2" && + test "x$as_lineno_3" = "x$as_lineno_2" || { + # Find who we are. Look in the path if we contain no path at all + # relative or not. + case $0 in + *[\\/]* ) as_myself=$0 ;; + *) as_save_IFS=$IFS; IFS=$PATH_SEPARATOR +for as_dir in $PATH +do + IFS=$as_save_IFS + test -z "$as_dir" && as_dir=. + test -r "$as_dir/$0" && as_myself=$as_dir/$0 && break +done + + ;; + esac + # We did not find ourselves, most probably we were run as `sh COMMAND' + # in which case we are not to be found in the path. + if test "x$as_myself" = x; then + as_myself=$0 + fi + if test ! -f "$as_myself"; then + { echo "$as_me: error: cannot find myself; rerun with an absolute path" >&2 + { (exit 1); exit 1; }; } + fi + case $CONFIG_SHELL in + '') + as_save_IFS=$IFS; IFS=$PATH_SEPARATOR +for as_dir in /bin$PATH_SEPARATOR/usr/bin$PATH_SEPARATOR$PATH +do + IFS=$as_save_IFS + test -z "$as_dir" && as_dir=. + for as_base in sh bash ksh sh5; do + case $as_dir in + /*) + if ("$as_dir/$as_base" -c ' + as_lineno_1=$LINENO + as_lineno_2=$LINENO + as_lineno_3=`(expr $as_lineno_1 + 1) 2>/dev/null` + test "x$as_lineno_1" != "x$as_lineno_2" && + test "x$as_lineno_3" = "x$as_lineno_2" ') 2>/dev/null; then + $as_unset BASH_ENV || test "${BASH_ENV+set}" != set || { BASH_ENV=; export BASH_ENV; } + $as_unset ENV || test "${ENV+set}" != set || { ENV=; export ENV; } + CONFIG_SHELL=$as_dir/$as_base + export CONFIG_SHELL + exec "$CONFIG_SHELL" "$0" ${1+"$@"} + fi;; + esac + done +done +;; + esac + + # Create $as_me.lineno as a copy of $as_myself, but with $LINENO + # uniformly replaced by the line number. The first 'sed' inserts a + # line-number line before each line; the second 'sed' does the real + # work. The second script uses 'N' to pair each line-number line + # with the numbered line, and appends trailing '-' during + # substitution so that $LINENO is not a special case at line end. + # (Raja R Harinath suggested sed '=', and Paul Eggert wrote the + # second 'sed' script. Blame Lee E. McMahon for sed's syntax. :-) + sed '=' <$as_myself | + sed ' + N + s,$,-, + : loop + s,^\(['$as_cr_digits']*\)\(.*\)[$]LINENO\([^'$as_cr_alnum'_]\),\1\2\1\3, + t loop + s,-$,, + s,^['$as_cr_digits']*\n,, + ' >$as_me.lineno && + chmod +x $as_me.lineno || + { echo "$as_me: error: cannot create $as_me.lineno; rerun with a POSIX shell" >&2 + { (exit 1); exit 1; }; } + + # Don't try to exec as it changes $[0], causing all sort of problems + # (the dirname of $[0] is not the place where we might find the + # original and so on. Autoconf is especially sensible to this). + . ./$as_me.lineno + # Exit status is that of the last command. + exit +} + + +case `echo "testing\c"; echo 1,2,3`,`echo -n testing; echo 1,2,3` in + *c*,-n*) ECHO_N= ECHO_C=' +' ECHO_T=' ' ;; + *c*,* ) ECHO_N=-n ECHO_C= ECHO_T= ;; + *) ECHO_N= ECHO_C='\c' ECHO_T= ;; +esac + +if expr a : '\(a\)' >/dev/null 2>&1; then + as_expr=expr +else + as_expr=false +fi + +rm -f conf$$ conf$$.exe conf$$.file +echo >conf$$.file +if ln -s conf$$.file conf$$ 2>/dev/null; then + # We could just check for DJGPP; but this test a) works b) is more generic + # and c) will remain valid once DJGPP supports symlinks (DJGPP 2.04). + if test -f conf$$.exe; then + # Don't use ln at all; we don't have any links + as_ln_s='cp -p' + else + as_ln_s='ln -s' + fi +elif ln conf$$.file conf$$ 2>/dev/null; then + as_ln_s=ln +else + as_ln_s='cp -p' +fi +rm -f conf$$ conf$$.exe conf$$.file + +if mkdir -p . 2>/dev/null; then + as_mkdir_p=: +else + test -d ./-p && rmdir ./-p + as_mkdir_p=false +fi + +as_executable_p="test -f" + +# Sed expression to map a string onto a valid CPP name. +as_tr_cpp="eval sed 'y%*$as_cr_letters%P$as_cr_LETTERS%;s%[^_$as_cr_alnum]%_%g'" + +# Sed expression to map a string onto a valid variable name. +as_tr_sh="eval sed 'y%*+%pp%;s%[^_$as_cr_alnum]%_%g'" + + +# IFS +# We need space, tab and new line, in precisely that order. +as_nl=' +' +IFS=" $as_nl" + +# CDPATH. +$as_unset CDPATH + + +# Name of the host. +# hostname on some systems (SVR3.2, Linux) returns a bogus exit status, +# so uname gets run too. +ac_hostname=`(hostname || uname -n) 2>/dev/null | sed 1q` + +exec 6>&1 + +# +# Initializations. +# +ac_default_prefix=/usr/local +ac_config_libobj_dir=. +cross_compiling=no +subdirs= +MFLAGS= +MAKEFLAGS= +SHELL=${CONFIG_SHELL-/bin/sh} + +# Maximum number of lines to put in a shell here document. +# This variable seems obsolete. It should probably be removed, and +# only ac_max_sed_lines should be used. +: ${ac_max_here_lines=38} + +# Identity of this package. +PACKAGE_NAME='libgcc-math' +PACKAGE_TARNAME='libgcc-math' +PACKAGE_VERSION='1.0' +PACKAGE_STRING='libgcc-math 1.0' +PACKAGE_BUGREPORT='' + +ac_unique_file="configure.ac" +ac_subst_vars='SHELL PATH_SEPARATOR PACKAGE_NAME PACKAGE_TARNAME PACKAGE_VERSION PACKAGE_STRING PACKAGE_BUGREPORT exec_prefix prefix program_transform_name bindir sbindir libexecdir datadir sysconfdir sharedstatedir localstatedir libdir includedir oldincludedir infodir mandir build_alias host_alias target_alias DEFS ECHO_C ECHO_N ECHO_T LIBS build build_cpu build_vendor build_os host host_cpu host_vendor host_os target target_cpu target_vendor target_os INSTALL_PROGRAM INSTALL_SCRIPT INSTALL_DATA CYGPATH_W PACKAGE VERSION ACLOCAL AUTOCONF AUTOMAKE AUTOHEADER MAKEINFO install_sh STRIP ac_ct_STRIP INSTALL_STRIP_PROGRAM mkdir_p AWK SET_MAKE am__leading_dot AMTAR am__tar am__untar MAINTAINER_MODE_TRUE MAINTAINER_MODE_FALSE MAINT multi_basedir CC ac_ct_CC EXEEXT OBJEXT DEPDIR am__include am__quote AMDEP_TRUE AMDEP_FALSE AMDEPBACKSLASH CCDEPMODE am__fastdepCC_TRUE am__fastdepCC_FALSE CFLAGS CPP CPPFLAGS CCAS CCASFLAGS LIBGCCM_USE_SYMVER_TRUE LIBGCCM_USE_SYMVER_FALSE TARGET_ILP32_TRUE TARGET_ILP32_FALSE LN_S RANLIB ac_ct_RANLIB LIBTOOL enable_shared enable_static toolexecdir toolexeclibdir arch_subdirs arch_libraries arch_maps BUILD_LIBGCC_MATH_TRUE BUILD_LIBGCC_MATH_FALSE LIBOBJS LTLIBOBJS' +ac_subst_files='' + +# Initialize some variables set by options. +ac_init_help= +ac_init_version=false +# The variables have the same names as the options, with +# dashes changed to underlines. +cache_file=/dev/null +exec_prefix=NONE +no_create= +no_recursion= +prefix=NONE +program_prefix=NONE +program_suffix=NONE +program_transform_name=s,x,x, +silent= +site= +srcdir= +verbose= +x_includes=NONE +x_libraries=NONE + +# Installation directory options. +# These are left unexpanded so users can "make install exec_prefix=/foo" +# and all the variables that are supposed to be based on exec_prefix +# by default will actually change. +# Use braces instead of parens because sh, perl, etc. also accept them. +bindir='${exec_prefix}/bin' +sbindir='${exec_prefix}/sbin' +libexecdir='${exec_prefix}/libexec' +datadir='${prefix}/share' +sysconfdir='${prefix}/etc' +sharedstatedir='${prefix}/com' +localstatedir='${prefix}/var' +libdir='${exec_prefix}/lib' +includedir='${prefix}/include' +oldincludedir='/usr/include' +infodir='${prefix}/info' +mandir='${prefix}/man' + +ac_prev= +for ac_option +do + # If the previous option needs an argument, assign it. + if test -n "$ac_prev"; then + eval "$ac_prev=\$ac_option" + ac_prev= + continue + fi + + ac_optarg=`expr "x$ac_option" : 'x[^=]*=\(.*\)'` + + # Accept the important Cygnus configure options, so we can diagnose typos. + + case $ac_option in + + -bindir | --bindir | --bindi | --bind | --bin | --bi) + ac_prev=bindir ;; + -bindir=* | --bindir=* | --bindi=* | --bind=* | --bin=* | --bi=*) + bindir=$ac_optarg ;; + + -build | --build | --buil | --bui | --bu) + ac_prev=build_alias ;; + -build=* | --build=* | --buil=* | --bui=* | --bu=*) + build_alias=$ac_optarg ;; + + -cache-file | --cache-file | --cache-fil | --cache-fi \ + | --cache-f | --cache- | --cache | --cach | --cac | --ca | --c) + ac_prev=cache_file ;; + -cache-file=* | --cache-file=* | --cache-fil=* | --cache-fi=* \ + | --cache-f=* | --cache-=* | --cache=* | --cach=* | --cac=* | --ca=* | --c=*) + cache_file=$ac_optarg ;; + + --config-cache | -C) + cache_file=config.cache ;; + + -datadir | --datadir | --datadi | --datad | --data | --dat | --da) + ac_prev=datadir ;; + -datadir=* | --datadir=* | --datadi=* | --datad=* | --data=* | --dat=* \ + | --da=*) + datadir=$ac_optarg ;; + + -disable-* | --disable-*) + ac_feature=`expr "x$ac_option" : 'x-*disable-\(.*\)'` + # Reject names that are not valid shell variable names. + expr "x$ac_feature" : ".*[^-_$as_cr_alnum]" >/dev/null && + { echo "$as_me: error: invalid feature name: $ac_feature" >&2 + { (exit 1); exit 1; }; } + ac_feature=`echo $ac_feature | sed 's/-/_/g'` + eval "enable_$ac_feature=no" ;; + + -enable-* | --enable-*) + ac_feature=`expr "x$ac_option" : 'x-*enable-\([^=]*\)'` + # Reject names that are not valid shell variable names. + expr "x$ac_feature" : ".*[^-_$as_cr_alnum]" >/dev/null && + { echo "$as_me: error: invalid feature name: $ac_feature" >&2 + { (exit 1); exit 1; }; } + ac_feature=`echo $ac_feature | sed 's/-/_/g'` + case $ac_option in + *=*) ac_optarg=`echo "$ac_optarg" | sed "s/'/'\\\\\\\\''/g"`;; + *) ac_optarg=yes ;; + esac + eval "enable_$ac_feature='$ac_optarg'" ;; + + -exec-prefix | --exec_prefix | --exec-prefix | --exec-prefi \ + | --exec-pref | --exec-pre | --exec-pr | --exec-p | --exec- \ + | --exec | --exe | --ex) + ac_prev=exec_prefix ;; + -exec-prefix=* | --exec_prefix=* | --exec-prefix=* | --exec-prefi=* \ + | --exec-pref=* | --exec-pre=* | --exec-pr=* | --exec-p=* | --exec-=* \ + | --exec=* | --exe=* | --ex=*) + exec_prefix=$ac_optarg ;; + + -gas | --gas | --ga | --g) + # Obsolete; use --with-gas. + with_gas=yes ;; + + -help | --help | --hel | --he | -h) + ac_init_help=long ;; + -help=r* | --help=r* | --hel=r* | --he=r* | -hr*) + ac_init_help=recursive ;; + -help=s* | --help=s* | --hel=s* | --he=s* | -hs*) + ac_init_help=short ;; + + -host | --host | --hos | --ho) + ac_prev=host_alias ;; + -host=* | --host=* | --hos=* | --ho=*) + host_alias=$ac_optarg ;; + + -includedir | --includedir | --includedi | --included | --include \ + | --includ | --inclu | --incl | --inc) + ac_prev=includedir ;; + -includedir=* | --includedir=* | --includedi=* | --included=* | --include=* \ + | --includ=* | --inclu=* | --incl=* | --inc=*) + includedir=$ac_optarg ;; + + -infodir | --infodir | --infodi | --infod | --info | --inf) + ac_prev=infodir ;; + -infodir=* | --infodir=* | --infodi=* | --infod=* | --info=* | --inf=*) + infodir=$ac_optarg ;; + + -libdir | --libdir | --libdi | --libd) + ac_prev=libdir ;; + -libdir=* | --libdir=* | --libdi=* | --libd=*) + libdir=$ac_optarg ;; + + -libexecdir | --libexecdir | --libexecdi | --libexecd | --libexec \ + | --libexe | --libex | --libe) + ac_prev=libexecdir ;; + -libexecdir=* | --libexecdir=* | --libexecdi=* | --libexecd=* | --libexec=* \ + | --libexe=* | --libex=* | --libe=*) + libexecdir=$ac_optarg ;; + + -localstatedir | --localstatedir | --localstatedi | --localstated \ + | --localstate | --localstat | --localsta | --localst \ + | --locals | --local | --loca | --loc | --lo) + ac_prev=localstatedir ;; + -localstatedir=* | --localstatedir=* | --localstatedi=* | --localstated=* \ + | --localstate=* | --localstat=* | --localsta=* | --localst=* \ + | --locals=* | --local=* | --loca=* | --loc=* | --lo=*) + localstatedir=$ac_optarg ;; + + -mandir | --mandir | --mandi | --mand | --man | --ma | --m) + ac_prev=mandir ;; + -mandir=* | --mandir=* | --mandi=* | --mand=* | --man=* | --ma=* | --m=*) + mandir=$ac_optarg ;; + + -nfp | --nfp | --nf) + # Obsolete; use --without-fp. + with_fp=no ;; + + -no-create | --no-create | --no-creat | --no-crea | --no-cre \ + | --no-cr | --no-c | -n) + no_create=yes ;; + + -no-recursion | --no-recursion | --no-recursio | --no-recursi \ + | --no-recurs | --no-recur | --no-recu | --no-rec | --no-re | --no-r) + no_recursion=yes ;; + + -oldincludedir | --oldincludedir | --oldincludedi | --oldincluded \ + | --oldinclude | --oldinclud | --oldinclu | --oldincl | --oldinc \ + | --oldin | --oldi | --old | --ol | --o) + ac_prev=oldincludedir ;; + -oldincludedir=* | --oldincludedir=* | --oldincludedi=* | --oldincluded=* \ + | --oldinclude=* | --oldinclud=* | --oldinclu=* | --oldincl=* | --oldinc=* \ + | --oldin=* | --oldi=* | --old=* | --ol=* | --o=*) + oldincludedir=$ac_optarg ;; + + -prefix | --prefix | --prefi | --pref | --pre | --pr | --p) + ac_prev=prefix ;; + -prefix=* | --prefix=* | --prefi=* | --pref=* | --pre=* | --pr=* | --p=*) + prefix=$ac_optarg ;; + + -program-prefix | --program-prefix | --program-prefi | --program-pref \ + | --program-pre | --program-pr | --program-p) + ac_prev=program_prefix ;; + -program-prefix=* | --program-prefix=* | --program-prefi=* \ + | --program-pref=* | --program-pre=* | --program-pr=* | --program-p=*) + program_prefix=$ac_optarg ;; + + -program-suffix | --program-suffix | --program-suffi | --program-suff \ + | --program-suf | --program-su | --program-s) + ac_prev=program_suffix ;; + -program-suffix=* | --program-suffix=* | --program-suffi=* \ + | --program-suff=* | --program-suf=* | --program-su=* | --program-s=*) + program_suffix=$ac_optarg ;; + + -program-transform-name | --program-transform-name \ + | --program-transform-nam | --program-transform-na \ + | --program-transform-n | --program-transform- \ + | --program-transform | --program-transfor \ + | --program-transfo | --program-transf \ + | --program-trans | --program-tran \ + | --progr-tra | --program-tr | --program-t) + ac_prev=program_transform_name ;; + -program-transform-name=* | --program-transform-name=* \ + | --program-transform-nam=* | --program-transform-na=* \ + | --program-transform-n=* | --program-transform-=* \ + | --program-transform=* | --program-transfor=* \ + | --program-transfo=* | --program-transf=* \ + | --program-trans=* | --program-tran=* \ + | --progr-tra=* | --program-tr=* | --program-t=*) + program_transform_name=$ac_optarg ;; + + -q | -quiet | --quiet | --quie | --qui | --qu | --q \ + | -silent | --silent | --silen | --sile | --sil) + silent=yes ;; + + -sbindir | --sbindir | --sbindi | --sbind | --sbin | --sbi | --sb) + ac_prev=sbindir ;; + -sbindir=* | --sbindir=* | --sbindi=* | --sbind=* | --sbin=* \ + | --sbi=* | --sb=*) + sbindir=$ac_optarg ;; + + -sharedstatedir | --sharedstatedir | --sharedstatedi \ + | --sharedstated | --sharedstate | --sharedstat | --sharedsta \ + | --sharedst | --shareds | --shared | --share | --shar \ + | --sha | --sh) + ac_prev=sharedstatedir ;; + -sharedstatedir=* | --sharedstatedir=* | --sharedstatedi=* \ + | --sharedstated=* | --sharedstate=* | --sharedstat=* | --sharedsta=* \ + | --sharedst=* | --shareds=* | --shared=* | --share=* | --shar=* \ + | --sha=* | --sh=*) + sharedstatedir=$ac_optarg ;; + + -site | --site | --sit) + ac_prev=site ;; + -site=* | --site=* | --sit=*) + site=$ac_optarg ;; + + -srcdir | --srcdir | --srcdi | --srcd | --src | --sr) + ac_prev=srcdir ;; + -srcdir=* | --srcdir=* | --srcdi=* | --srcd=* | --src=* | --sr=*) + srcdir=$ac_optarg ;; + + -sysconfdir | --sysconfdir | --sysconfdi | --sysconfd | --sysconf \ + | --syscon | --sysco | --sysc | --sys | --sy) + ac_prev=sysconfdir ;; + -sysconfdir=* | --sysconfdir=* | --sysconfdi=* | --sysconfd=* | --sysconf=* \ + | --syscon=* | --sysco=* | --sysc=* | --sys=* | --sy=*) + sysconfdir=$ac_optarg ;; + + -target | --target | --targe | --targ | --tar | --ta | --t) + ac_prev=target_alias ;; + -target=* | --target=* | --targe=* | --targ=* | --tar=* | --ta=* | --t=*) + target_alias=$ac_optarg ;; + + -v | -verbose | --verbose | --verbos | --verbo | --verb) + verbose=yes ;; + + -version | --version | --versio | --versi | --vers | -V) + ac_init_version=: ;; + + -with-* | --with-*) + ac_package=`expr "x$ac_option" : 'x-*with-\([^=]*\)'` + # Reject names that are not valid shell variable names. + expr "x$ac_package" : ".*[^-_$as_cr_alnum]" >/dev/null && + { echo "$as_me: error: invalid package name: $ac_package" >&2 + { (exit 1); exit 1; }; } + ac_package=`echo $ac_package| sed 's/-/_/g'` + case $ac_option in + *=*) ac_optarg=`echo "$ac_optarg" | sed "s/'/'\\\\\\\\''/g"`;; + *) ac_optarg=yes ;; + esac + eval "with_$ac_package='$ac_optarg'" ;; + + -without-* | --without-*) + ac_package=`expr "x$ac_option" : 'x-*without-\(.*\)'` + # Reject names that are not valid shell variable names. + expr "x$ac_package" : ".*[^-_$as_cr_alnum]" >/dev/null && + { echo "$as_me: error: invalid package name: $ac_package" >&2 + { (exit 1); exit 1; }; } + ac_package=`echo $ac_package | sed 's/-/_/g'` + eval "with_$ac_package=no" ;; + + --x) + # Obsolete; use --with-x. + with_x=yes ;; + + -x-includes | --x-includes | --x-include | --x-includ | --x-inclu \ + | --x-incl | --x-inc | --x-in | --x-i) + ac_prev=x_includes ;; + -x-includes=* | --x-includes=* | --x-include=* | --x-includ=* | --x-inclu=* \ + | --x-incl=* | --x-inc=* | --x-in=* | --x-i=*) + x_includes=$ac_optarg ;; + + -x-libraries | --x-libraries | --x-librarie | --x-librari \ + | --x-librar | --x-libra | --x-libr | --x-lib | --x-li | --x-l) + ac_prev=x_libraries ;; + -x-libraries=* | --x-libraries=* | --x-librarie=* | --x-librari=* \ + | --x-librar=* | --x-libra=* | --x-libr=* | --x-lib=* | --x-li=* | --x-l=*) + x_libraries=$ac_optarg ;; + + -*) { echo "$as_me: error: unrecognized option: $ac_option +Try \`$0 --help' for more information." >&2 + { (exit 1); exit 1; }; } + ;; + + *=*) + ac_envvar=`expr "x$ac_option" : 'x\([^=]*\)='` + # Reject names that are not valid shell variable names. + expr "x$ac_envvar" : ".*[^_$as_cr_alnum]" >/dev/null && + { echo "$as_me: error: invalid variable name: $ac_envvar" >&2 + { (exit 1); exit 1; }; } + ac_optarg=`echo "$ac_optarg" | sed "s/'/'\\\\\\\\''/g"` + eval "$ac_envvar='$ac_optarg'" + export $ac_envvar ;; + + *) + # FIXME: should be removed in autoconf 3.0. + echo "$as_me: WARNING: you should use --build, --host, --target" >&2 + expr "x$ac_option" : ".*[^-._$as_cr_alnum]" >/dev/null && + echo "$as_me: WARNING: invalid host type: $ac_option" >&2 + : ${build_alias=$ac_option} ${host_alias=$ac_option} ${target_alias=$ac_option} + ;; + + esac +done + +if test -n "$ac_prev"; then + ac_option=--`echo $ac_prev | sed 's/_/-/g'` + { echo "$as_me: error: missing argument to $ac_option" >&2 + { (exit 1); exit 1; }; } +fi + +# Be sure to have absolute paths. +for ac_var in exec_prefix prefix +do + eval ac_val=$`echo $ac_var` + case $ac_val in + [\\/$]* | ?:[\\/]* | NONE | '' ) ;; + *) { echo "$as_me: error: expected an absolute directory name for --$ac_var: $ac_val" >&2 + { (exit 1); exit 1; }; };; + esac +done + +# Be sure to have absolute paths. +for ac_var in bindir sbindir libexecdir datadir sysconfdir sharedstatedir \ + localstatedir libdir includedir oldincludedir infodir mandir +do + eval ac_val=$`echo $ac_var` + case $ac_val in + [\\/$]* | ?:[\\/]* ) ;; + *) { echo "$as_me: error: expected an absolute directory name for --$ac_var: $ac_val" >&2 + { (exit 1); exit 1; }; };; + esac +done + +# There might be people who depend on the old broken behavior: `$host' +# used to hold the argument of --host etc. +# FIXME: To remove some day. +build=$build_alias +host=$host_alias +target=$target_alias + +# FIXME: To remove some day. +if test "x$host_alias" != x; then + if test "x$build_alias" = x; then + cross_compiling=maybe + echo "$as_me: WARNING: If you wanted to set the --build type, don't use --host. + If a cross compiler is detected then cross compile mode will be used." >&2 + elif test "x$build_alias" != "x$host_alias"; then + cross_compiling=yes + fi +fi + +ac_tool_prefix= +test -n "$host_alias" && ac_tool_prefix=$host_alias- + +test "$silent" = yes && exec 6>/dev/null + + +# Find the source files, if location was not specified. +if test -z "$srcdir"; then + ac_srcdir_defaulted=yes + # Try the directory containing this script, then its parent. + ac_confdir=`(dirname "$0") 2>/dev/null || +$as_expr X"$0" : 'X\(.*[^/]\)//*[^/][^/]*/*$' \| \ + X"$0" : 'X\(//\)[^/]' \| \ + X"$0" : 'X\(//\)$' \| \ + X"$0" : 'X\(/\)' \| \ + . : '\(.\)' 2>/dev/null || +echo X"$0" | + sed '/^X\(.*[^/]\)\/\/*[^/][^/]*\/*$/{ s//\1/; q; } + /^X\(\/\/\)[^/].*/{ s//\1/; q; } + /^X\(\/\/\)$/{ s//\1/; q; } + /^X\(\/\).*/{ s//\1/; q; } + s/.*/./; q'` + srcdir=$ac_confdir + if test ! -r $srcdir/$ac_unique_file; then + srcdir=.. + fi +else + ac_srcdir_defaulted=no +fi +if test ! -r $srcdir/$ac_unique_file; then + if test "$ac_srcdir_defaulted" = yes; then + { echo "$as_me: error: cannot find sources ($ac_unique_file) in $ac_confdir or .." >&2 + { (exit 1); exit 1; }; } + else + { echo "$as_me: error: cannot find sources ($ac_unique_file) in $srcdir" >&2 + { (exit 1); exit 1; }; } + fi +fi +(cd $srcdir && test -r ./$ac_unique_file) 2>/dev/null || + { echo "$as_me: error: sources are in $srcdir, but \`cd $srcdir' does not work" >&2 + { (exit 1); exit 1; }; } +srcdir=`echo "$srcdir" | sed 's%\([^\\/]\)[\\/]*$%\1%'` +ac_env_build_alias_set=${build_alias+set} +ac_env_build_alias_value=$build_alias +ac_cv_env_build_alias_set=${build_alias+set} +ac_cv_env_build_alias_value=$build_alias +ac_env_host_alias_set=${host_alias+set} +ac_env_host_alias_value=$host_alias +ac_cv_env_host_alias_set=${host_alias+set} +ac_cv_env_host_alias_value=$host_alias +ac_env_target_alias_set=${target_alias+set} +ac_env_target_alias_value=$target_alias +ac_cv_env_target_alias_set=${target_alias+set} +ac_cv_env_target_alias_value=$target_alias +ac_env_CPP_set=${CPP+set} +ac_env_CPP_value=$CPP +ac_cv_env_CPP_set=${CPP+set} +ac_cv_env_CPP_value=$CPP +ac_env_CPPFLAGS_set=${CPPFLAGS+set} +ac_env_CPPFLAGS_value=$CPPFLAGS +ac_cv_env_CPPFLAGS_set=${CPPFLAGS+set} +ac_cv_env_CPPFLAGS_value=$CPPFLAGS +ac_env_CCAS_set=${CCAS+set} +ac_env_CCAS_value=$CCAS +ac_cv_env_CCAS_set=${CCAS+set} +ac_cv_env_CCAS_value=$CCAS +ac_env_CCASFLAGS_set=${CCASFLAGS+set} +ac_env_CCASFLAGS_value=$CCASFLAGS +ac_cv_env_CCASFLAGS_set=${CCASFLAGS+set} +ac_cv_env_CCASFLAGS_value=$CCASFLAGS + +# +# Report the --help message. +# +if test "$ac_init_help" = "long"; then + # Omit some internal or obsolete options to make the list less imposing. + # This message is too long to be a string in the A/UX 3.1 sh. + cat <<_ACEOF +\`configure' configures libgcc-math 1.0 to adapt to many kinds of systems. + +Usage: $0 [OPTION]... [VAR=VALUE]... + +To assign environment variables (e.g., CC, CFLAGS...), specify them as +VAR=VALUE. See below for descriptions of some of the useful variables. + +Defaults for the options are specified in brackets. + +Configuration: + -h, --help display this help and exit + --help=short display options specific to this package + --help=recursive display the short help of all the included packages + -V, --version display version information and exit + -q, --quiet, --silent do not print \`checking...' messages + --cache-file=FILE cache test results in FILE [disabled] + -C, --config-cache alias for \`--cache-file=config.cache' + -n, --no-create do not create output files + --srcdir=DIR find the sources in DIR [configure dir or \`..'] + +_ACEOF + + cat <<_ACEOF +Installation directories: + --prefix=PREFIX install architecture-independent files in PREFIX + [$ac_default_prefix] + --exec-prefix=EPREFIX install architecture-dependent files in EPREFIX + [PREFIX] + +By default, \`make install' will install all the files in +\`$ac_default_prefix/bin', \`$ac_default_prefix/lib' etc. You can specify +an installation prefix other than \`$ac_default_prefix' using \`--prefix', +for instance \`--prefix=\$HOME'. + +For better control, use the options below. + +Fine tuning of the installation directories: + --bindir=DIR user executables [EPREFIX/bin] + --sbindir=DIR system admin executables [EPREFIX/sbin] + --libexecdir=DIR program executables [EPREFIX/libexec] + --datadir=DIR read-only architecture-independent data [PREFIX/share] + --sysconfdir=DIR read-only single-machine data [PREFIX/etc] + --sharedstatedir=DIR modifiable architecture-independent data [PREFIX/com] + --localstatedir=DIR modifiable single-machine data [PREFIX/var] + --libdir=DIR object code libraries [EPREFIX/lib] + --includedir=DIR C header files [PREFIX/include] + --oldincludedir=DIR C header files for non-gcc [/usr/include] + --infodir=DIR info documentation [PREFIX/info] + --mandir=DIR man documentation [PREFIX/man] +_ACEOF + + cat <<\_ACEOF + +Program names: + --program-prefix=PREFIX prepend PREFIX to installed program names + --program-suffix=SUFFIX append SUFFIX to installed program names + --program-transform-name=PROGRAM run sed PROGRAM on installed program names + +System types: + --build=BUILD configure for building on BUILD [guessed] + --host=HOST cross-compile to build programs to run on HOST [BUILD] + --target=TARGET configure for building compilers for TARGET [HOST] +_ACEOF +fi + +if test -n "$ac_init_help"; then + case $ac_init_help in + short | recursive ) echo "Configuration of libgcc-math 1.0:";; + esac + cat <<\_ACEOF + +Optional Features: + --disable-FEATURE do not include FEATURE (same as --enable-FEATURE=no) + --enable-FEATURE[=ARG] include FEATURE [ARG=yes] + --enable-version-specific-runtime-libs Specify that runtime libraries should be installed in a compiler-specific directory + --enable-maintainer-mode enable make rules and dependencies not useful + (and sometimes confusing) to the casual installer + --enable-multilib build many library versions (default) + --disable-dependency-tracking speeds up one-time build + --enable-dependency-tracking do not reject slow dependency extractors + --enable-shared=PKGS build shared libraries default=yes + --enable-static=PKGS build static libraries default=yes + --enable-fast-install=PKGS optimize for fast installation default=yes + --disable-libtool-lock avoid locking (might break parallel builds) + +Optional Packages: + --with-PACKAGE[=ARG] use PACKAGE [ARG=yes] + --without-PACKAGE do not use PACKAGE (same as --with-PACKAGE=no) + --with-gnu-ld assume the C compiler uses GNU ld default=no + --with-pic try to use only PIC/non-PIC objects default=use both + +Some influential environment variables: + CC C compiler command + CFLAGS C compiler flags + LDFLAGS linker flags, e.g. -L if you have libraries in a + nonstandard directory + CPPFLAGS C/C++ preprocessor flags, e.g. -I if you have + headers in a nonstandard directory + CPP C preprocessor + CCAS assembler compiler command (defaults to CC) + CCASFLAGS assembler compiler flags (defaults to CFLAGS) + +Use these variables to override the choices made by `configure' or to help +it to find libraries and programs with nonstandard names/locations. + +_ACEOF +fi + +if test "$ac_init_help" = "recursive"; then + # If there are subdirs, report their specific --help. + ac_popdir=`pwd` + for ac_dir in : $ac_subdirs_all; do test "x$ac_dir" = x: && continue + test -d $ac_dir || continue + ac_builddir=. + +if test "$ac_dir" != .; then + ac_dir_suffix=/`echo "$ac_dir" | sed 's,^\.[\\/],,'` + # A "../" for each directory in $ac_dir_suffix. + ac_top_builddir=`echo "$ac_dir_suffix" | sed 's,/[^\\/]*,../,g'` +else + ac_dir_suffix= ac_top_builddir= +fi + +case $srcdir in + .) # No --srcdir option. We are building in place. + ac_srcdir=. + if test -z "$ac_top_builddir"; then + ac_top_srcdir=. + else + ac_top_srcdir=`echo $ac_top_builddir | sed 's,/$,,'` + fi ;; + [\\/]* | ?:[\\/]* ) # Absolute path. + ac_srcdir=$srcdir$ac_dir_suffix; + ac_top_srcdir=$srcdir ;; + *) # Relative path. + ac_srcdir=$ac_top_builddir$srcdir$ac_dir_suffix + ac_top_srcdir=$ac_top_builddir$srcdir ;; +esac + +# Do not use `cd foo && pwd` to compute absolute paths, because +# the directories may not exist. +case `pwd` in +.) ac_abs_builddir="$ac_dir";; +*) + case "$ac_dir" in + .) ac_abs_builddir=`pwd`;; + [\\/]* | ?:[\\/]* ) ac_abs_builddir="$ac_dir";; + *) ac_abs_builddir=`pwd`/"$ac_dir";; + esac;; +esac +case $ac_abs_builddir in +.) ac_abs_top_builddir=${ac_top_builddir}.;; +*) + case ${ac_top_builddir}. in + .) ac_abs_top_builddir=$ac_abs_builddir;; + [\\/]* | ?:[\\/]* ) ac_abs_top_builddir=${ac_top_builddir}.;; + *) ac_abs_top_builddir=$ac_abs_builddir/${ac_top_builddir}.;; + esac;; +esac +case $ac_abs_builddir in +.) ac_abs_srcdir=$ac_srcdir;; +*) + case $ac_srcdir in + .) ac_abs_srcdir=$ac_abs_builddir;; + [\\/]* | ?:[\\/]* ) ac_abs_srcdir=$ac_srcdir;; + *) ac_abs_srcdir=$ac_abs_builddir/$ac_srcdir;; + esac;; +esac +case $ac_abs_builddir in +.) ac_abs_top_srcdir=$ac_top_srcdir;; +*) + case $ac_top_srcdir in + .) ac_abs_top_srcdir=$ac_abs_builddir;; + [\\/]* | ?:[\\/]* ) ac_abs_top_srcdir=$ac_top_srcdir;; + *) ac_abs_top_srcdir=$ac_abs_builddir/$ac_top_srcdir;; + esac;; +esac + + cd $ac_dir + # Check for guested configure; otherwise get Cygnus style configure. + if test -f $ac_srcdir/configure.gnu; then + echo + $SHELL $ac_srcdir/configure.gnu --help=recursive + elif test -f $ac_srcdir/configure; then + echo + $SHELL $ac_srcdir/configure --help=recursive + elif test -f $ac_srcdir/configure.ac || + test -f $ac_srcdir/configure.in; then + echo + $ac_configure --help + else + echo "$as_me: WARNING: no configuration information is in $ac_dir" >&2 + fi + cd $ac_popdir + done +fi + +test -n "$ac_init_help" && exit 0 +if $ac_init_version; then + cat <<\_ACEOF +libgcc-math configure 1.0 +generated by GNU Autoconf 2.59 + +Copyright (C) 2003 Free Software Foundation, Inc. +This configure script is free software; the Free Software Foundation +gives unlimited permission to copy, distribute and modify it. +_ACEOF + exit 0 +fi +exec 5>config.log +cat >&5 <<_ACEOF +This file contains any messages produced by compilers while +running configure, to aid debugging if configure makes a mistake. + +It was created by libgcc-math $as_me 1.0, which was +generated by GNU Autoconf 2.59. Invocation command line was + + $ $0 $@ + +_ACEOF +{ +cat <<_ASUNAME +## --------- ## +## Platform. ## +## --------- ## + +hostname = `(hostname || uname -n) 2>/dev/null | sed 1q` +uname -m = `(uname -m) 2>/dev/null || echo unknown` +uname -r = `(uname -r) 2>/dev/null || echo unknown` +uname -s = `(uname -s) 2>/dev/null || echo unknown` +uname -v = `(uname -v) 2>/dev/null || echo unknown` + +/usr/bin/uname -p = `(/usr/bin/uname -p) 2>/dev/null || echo unknown` +/bin/uname -X = `(/bin/uname -X) 2>/dev/null || echo unknown` + +/bin/arch = `(/bin/arch) 2>/dev/null || echo unknown` +/usr/bin/arch -k = `(/usr/bin/arch -k) 2>/dev/null || echo unknown` +/usr/convex/getsysinfo = `(/usr/convex/getsysinfo) 2>/dev/null || echo unknown` +hostinfo = `(hostinfo) 2>/dev/null || echo unknown` +/bin/machine = `(/bin/machine) 2>/dev/null || echo unknown` +/usr/bin/oslevel = `(/usr/bin/oslevel) 2>/dev/null || echo unknown` +/bin/universe = `(/bin/universe) 2>/dev/null || echo unknown` + +_ASUNAME + +as_save_IFS=$IFS; IFS=$PATH_SEPARATOR +for as_dir in $PATH +do + IFS=$as_save_IFS + test -z "$as_dir" && as_dir=. + echo "PATH: $as_dir" +done + +} >&5 + +cat >&5 <<_ACEOF + + +## ----------- ## +## Core tests. ## +## ----------- ## + +_ACEOF + + +# Keep a trace of the command line. +# Strip out --no-create and --no-recursion so they do not pile up. +# Strip out --silent because we don't want to record it for future runs. +# Also quote any args containing shell meta-characters. +# Make two passes to allow for proper duplicate-argument suppression. +ac_configure_args= +ac_configure_args0= +ac_configure_args1= +ac_sep= +ac_must_keep_next=false +for ac_pass in 1 2 +do + for ac_arg + do + case $ac_arg in + -no-create | --no-c* | -n | -no-recursion | --no-r*) continue ;; + -q | -quiet | --quiet | --quie | --qui | --qu | --q \ + | -silent | --silent | --silen | --sile | --sil) + continue ;; + *" "*|*" "*|*[\[\]\~\#\$\^\&\*\(\)\{\}\\\|\;\<\>\?\"\']*) + ac_arg=`echo "$ac_arg" | sed "s/'/'\\\\\\\\''/g"` ;; + esac + case $ac_pass in + 1) ac_configure_args0="$ac_configure_args0 '$ac_arg'" ;; + 2) + ac_configure_args1="$ac_configure_args1 '$ac_arg'" + if test $ac_must_keep_next = true; then + ac_must_keep_next=false # Got value, back to normal. + else + case $ac_arg in + *=* | --config-cache | -C | -disable-* | --disable-* \ + | -enable-* | --enable-* | -gas | --g* | -nfp | --nf* \ + | -q | -quiet | --q* | -silent | --sil* | -v | -verb* \ + | -with-* | --with-* | -without-* | --without-* | --x) + case "$ac_configure_args0 " in + "$ac_configure_args1"*" '$ac_arg' "* ) continue ;; + esac + ;; + -* ) ac_must_keep_next=true ;; + esac + fi + ac_configure_args="$ac_configure_args$ac_sep'$ac_arg'" + # Get rid of the leading space. + ac_sep=" " + ;; + esac + done +done +$as_unset ac_configure_args0 || test "${ac_configure_args0+set}" != set || { ac_configure_args0=; export ac_configure_args0; } +$as_unset ac_configure_args1 || test "${ac_configure_args1+set}" != set || { ac_configure_args1=; export ac_configure_args1; } + +# When interrupted or exit'd, cleanup temporary files, and complete +# config.log. We remove comments because anyway the quotes in there +# would cause problems or look ugly. +# WARNING: Be sure not to use single quotes in there, as some shells, +# such as our DU 5.0 friend, will then `close' the trap. +trap 'exit_status=$? + # Save into config.log some information that might help in debugging. + { + echo + + cat <<\_ASBOX +## ---------------- ## +## Cache variables. ## +## ---------------- ## +_ASBOX + echo + # The following way of writing the cache mishandles newlines in values, +{ + (set) 2>&1 | + case `(ac_space='"'"' '"'"'; set | grep ac_space) 2>&1` in + *ac_space=\ *) + sed -n \ + "s/'"'"'/'"'"'\\\\'"'"''"'"'/g; + s/^\\([_$as_cr_alnum]*_cv_[_$as_cr_alnum]*\\)=\\(.*\\)/\\1='"'"'\\2'"'"'/p" + ;; + *) + sed -n \ + "s/^\\([_$as_cr_alnum]*_cv_[_$as_cr_alnum]*\\)=\\(.*\\)/\\1=\\2/p" + ;; + esac; +} + echo + + cat <<\_ASBOX +## ----------------- ## +## Output variables. ## +## ----------------- ## +_ASBOX + echo + for ac_var in $ac_subst_vars + do + eval ac_val=$`echo $ac_var` + echo "$ac_var='"'"'$ac_val'"'"'" + done | sort + echo + + if test -n "$ac_subst_files"; then + cat <<\_ASBOX +## ------------- ## +## Output files. ## +## ------------- ## +_ASBOX + echo + for ac_var in $ac_subst_files + do + eval ac_val=$`echo $ac_var` + echo "$ac_var='"'"'$ac_val'"'"'" + done | sort + echo + fi + + if test -s confdefs.h; then + cat <<\_ASBOX +## ----------- ## +## confdefs.h. ## +## ----------- ## +_ASBOX + echo + sed "/^$/d" confdefs.h | sort + echo + fi + test "$ac_signal" != 0 && + echo "$as_me: caught signal $ac_signal" + echo "$as_me: exit $exit_status" + } >&5 + rm -f core *.core && + rm -rf conftest* confdefs* conf$$* $ac_clean_files && + exit $exit_status + ' 0 +for ac_signal in 1 2 13 15; do + trap 'ac_signal='$ac_signal'; { (exit 1); exit 1; }' $ac_signal +done +ac_signal=0 + +# confdefs.h avoids OS command line length limits that DEFS can exceed. +rm -rf conftest* confdefs.h +# AIX cpp loses on an empty file, so make sure it contains at least a newline. +echo >confdefs.h + +# Predefined preprocessor variables. + +cat >>confdefs.h <<_ACEOF +#define PACKAGE_NAME "$PACKAGE_NAME" +_ACEOF + + +cat >>confdefs.h <<_ACEOF +#define PACKAGE_TARNAME "$PACKAGE_TARNAME" +_ACEOF + + +cat >>confdefs.h <<_ACEOF +#define PACKAGE_VERSION "$PACKAGE_VERSION" +_ACEOF + + +cat >>confdefs.h <<_ACEOF +#define PACKAGE_STRING "$PACKAGE_STRING" +_ACEOF + + +cat >>confdefs.h <<_ACEOF +#define PACKAGE_BUGREPORT "$PACKAGE_BUGREPORT" +_ACEOF + + +# Let the site file select an alternate cache file if it wants to. +# Prefer explicitly selected file to automatically selected ones. +if test -z "$CONFIG_SITE"; then + if test "x$prefix" != xNONE; then + CONFIG_SITE="$prefix/share/config.site $prefix/etc/config.site" + else + CONFIG_SITE="$ac_default_prefix/share/config.site $ac_default_prefix/etc/config.site" + fi +fi +for ac_site_file in $CONFIG_SITE; do + if test -r "$ac_site_file"; then + { echo "$as_me:$LINENO: loading site script $ac_site_file" >&5 +echo "$as_me: loading site script $ac_site_file" >&6;} + sed 's/^/| /' "$ac_site_file" >&5 + . "$ac_site_file" + fi +done + +if test -r "$cache_file"; then + # Some versions of bash will fail to source /dev/null (special + # files actually), so we avoid doing that. + if test -f "$cache_file"; then + { echo "$as_me:$LINENO: loading cache $cache_file" >&5 +echo "$as_me: loading cache $cache_file" >&6;} + case $cache_file in + [\\/]* | ?:[\\/]* ) . $cache_file;; + *) . ./$cache_file;; + esac + fi +else + { echo "$as_me:$LINENO: creating cache $cache_file" >&5 +echo "$as_me: creating cache $cache_file" >&6;} + >$cache_file +fi + +# Check that the precious variables saved in the cache have kept the same +# value. +ac_cache_corrupted=false +for ac_var in `(set) 2>&1 | + sed -n 's/^ac_env_\([a-zA-Z_0-9]*\)_set=.*/\1/p'`; do + eval ac_old_set=\$ac_cv_env_${ac_var}_set + eval ac_new_set=\$ac_env_${ac_var}_set + eval ac_old_val="\$ac_cv_env_${ac_var}_value" + eval ac_new_val="\$ac_env_${ac_var}_value" + case $ac_old_set,$ac_new_set in + set,) + { echo "$as_me:$LINENO: error: \`$ac_var' was set to \`$ac_old_val' in the previous run" >&5 +echo "$as_me: error: \`$ac_var' was set to \`$ac_old_val' in the previous run" >&2;} + ac_cache_corrupted=: ;; + ,set) + { echo "$as_me:$LINENO: error: \`$ac_var' was not set in the previous run" >&5 +echo "$as_me: error: \`$ac_var' was not set in the previous run" >&2;} + ac_cache_corrupted=: ;; + ,);; + *) + if test "x$ac_old_val" != "x$ac_new_val"; then + { echo "$as_me:$LINENO: error: \`$ac_var' has changed since the previous run:" >&5 +echo "$as_me: error: \`$ac_var' has changed since the previous run:" >&2;} + { echo "$as_me:$LINENO: former value: $ac_old_val" >&5 +echo "$as_me: former value: $ac_old_val" >&2;} + { echo "$as_me:$LINENO: current value: $ac_new_val" >&5 +echo "$as_me: current value: $ac_new_val" >&2;} + ac_cache_corrupted=: + fi;; + esac + # Pass precious variables to config.status. + if test "$ac_new_set" = set; then + case $ac_new_val in + *" "*|*" "*|*[\[\]\~\#\$\^\&\*\(\)\{\}\\\|\;\<\>\?\"\']*) + ac_arg=$ac_var=`echo "$ac_new_val" | sed "s/'/'\\\\\\\\''/g"` ;; + *) ac_arg=$ac_var=$ac_new_val ;; + esac + case " $ac_configure_args " in + *" '$ac_arg' "*) ;; # Avoid dups. Use of quotes ensures accuracy. + *) ac_configure_args="$ac_configure_args '$ac_arg'" ;; + esac + fi +done +if $ac_cache_corrupted; then + { echo "$as_me:$LINENO: error: changes in the environment can compromise the build" >&5 +echo "$as_me: error: changes in the environment can compromise the build" >&2;} + { { echo "$as_me:$LINENO: error: run \`make distclean' and/or \`rm $cache_file' and start over" >&5 +echo "$as_me: error: run \`make distclean' and/or \`rm $cache_file' and start over" >&2;} + { (exit 1); exit 1; }; } +fi + +ac_ext=c +ac_cpp='$CPP $CPPFLAGS' +ac_compile='$CC -c $CFLAGS $CPPFLAGS conftest.$ac_ext >&5' +ac_link='$CC -o conftest$ac_exeext $CFLAGS $CPPFLAGS $LDFLAGS conftest.$ac_ext $LIBS >&5' +ac_compiler_gnu=$ac_cv_c_compiler_gnu + + + + + + + + + + + + + + + + + + + + + + + + + + + + +ac_aux_dir= +for ac_dir in $srcdir $srcdir/.. $srcdir/../..; do + if test -f $ac_dir/install-sh; then + ac_aux_dir=$ac_dir + ac_install_sh="$ac_aux_dir/install-sh -c" + break + elif test -f $ac_dir/install.sh; then + ac_aux_dir=$ac_dir + ac_install_sh="$ac_aux_dir/install.sh -c" + break + elif test -f $ac_dir/shtool; then + ac_aux_dir=$ac_dir + ac_install_sh="$ac_aux_dir/shtool install -c" + break + fi +done +if test -z "$ac_aux_dir"; then + { { echo "$as_me:$LINENO: error: cannot find install-sh or install.sh in $srcdir $srcdir/.. $srcdir/../.." >&5 +echo "$as_me: error: cannot find install-sh or install.sh in $srcdir $srcdir/.. $srcdir/../.." >&2;} + { (exit 1); exit 1; }; } +fi +ac_config_guess="$SHELL $ac_aux_dir/config.guess" +ac_config_sub="$SHELL $ac_aux_dir/config.sub" +ac_configure="$SHELL $ac_aux_dir/configure" # This should be Cygnus configure. + +# Make sure we can run config.sub. +$ac_config_sub sun4 >/dev/null 2>&1 || + { { echo "$as_me:$LINENO: error: cannot run $ac_config_sub" >&5 +echo "$as_me: error: cannot run $ac_config_sub" >&2;} + { (exit 1); exit 1; }; } + +echo "$as_me:$LINENO: checking build system type" >&5 +echo $ECHO_N "checking build system type... $ECHO_C" >&6 +if test "${ac_cv_build+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + ac_cv_build_alias=$build_alias +test -z "$ac_cv_build_alias" && + ac_cv_build_alias=`$ac_config_guess` +test -z "$ac_cv_build_alias" && + { { echo "$as_me:$LINENO: error: cannot guess build type; you must specify one" >&5 +echo "$as_me: error: cannot guess build type; you must specify one" >&2;} + { (exit 1); exit 1; }; } +ac_cv_build=`$ac_config_sub $ac_cv_build_alias` || + { { echo "$as_me:$LINENO: error: $ac_config_sub $ac_cv_build_alias failed" >&5 +echo "$as_me: error: $ac_config_sub $ac_cv_build_alias failed" >&2;} + { (exit 1); exit 1; }; } + +fi +echo "$as_me:$LINENO: result: $ac_cv_build" >&5 +echo "${ECHO_T}$ac_cv_build" >&6 +build=$ac_cv_build +build_cpu=`echo $ac_cv_build | sed 's/^\([^-]*\)-\([^-]*\)-\(.*\)$/\1/'` +build_vendor=`echo $ac_cv_build | sed 's/^\([^-]*\)-\([^-]*\)-\(.*\)$/\2/'` +build_os=`echo $ac_cv_build | sed 's/^\([^-]*\)-\([^-]*\)-\(.*\)$/\3/'` + + +echo "$as_me:$LINENO: checking host system type" >&5 +echo $ECHO_N "checking host system type... $ECHO_C" >&6 +if test "${ac_cv_host+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + ac_cv_host_alias=$host_alias +test -z "$ac_cv_host_alias" && + ac_cv_host_alias=$ac_cv_build_alias +ac_cv_host=`$ac_config_sub $ac_cv_host_alias` || + { { echo "$as_me:$LINENO: error: $ac_config_sub $ac_cv_host_alias failed" >&5 +echo "$as_me: error: $ac_config_sub $ac_cv_host_alias failed" >&2;} + { (exit 1); exit 1; }; } + +fi +echo "$as_me:$LINENO: result: $ac_cv_host" >&5 +echo "${ECHO_T}$ac_cv_host" >&6 +host=$ac_cv_host +host_cpu=`echo $ac_cv_host | sed 's/^\([^-]*\)-\([^-]*\)-\(.*\)$/\1/'` +host_vendor=`echo $ac_cv_host | sed 's/^\([^-]*\)-\([^-]*\)-\(.*\)$/\2/'` +host_os=`echo $ac_cv_host | sed 's/^\([^-]*\)-\([^-]*\)-\(.*\)$/\3/'` + + +echo "$as_me:$LINENO: checking target system type" >&5 +echo $ECHO_N "checking target system type... $ECHO_C" >&6 +if test "${ac_cv_target+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + ac_cv_target_alias=$target_alias +test "x$ac_cv_target_alias" = "x" && + ac_cv_target_alias=$ac_cv_host_alias +ac_cv_target=`$ac_config_sub $ac_cv_target_alias` || + { { echo "$as_me:$LINENO: error: $ac_config_sub $ac_cv_target_alias failed" >&5 +echo "$as_me: error: $ac_config_sub $ac_cv_target_alias failed" >&2;} + { (exit 1); exit 1; }; } + +fi +echo "$as_me:$LINENO: result: $ac_cv_target" >&5 +echo "${ECHO_T}$ac_cv_target" >&6 +target=$ac_cv_target +target_cpu=`echo $ac_cv_target | sed 's/^\([^-]*\)-\([^-]*\)-\(.*\)$/\1/'` +target_vendor=`echo $ac_cv_target | sed 's/^\([^-]*\)-\([^-]*\)-\(.*\)$/\2/'` +target_os=`echo $ac_cv_target | sed 's/^\([^-]*\)-\([^-]*\)-\(.*\)$/\3/'` + + +# The aliases save the names the user supplied, while $host etc. +# will get canonicalized. +test -n "$target_alias" && + test "$program_prefix$program_suffix$program_transform_name" = \ + NONENONEs,x,x, && + program_prefix=${target_alias}- + +am__api_version="1.9" +# Find a good install program. We prefer a C program (faster), +# so one script is as good as another. But avoid the broken or +# incompatible versions: +# SysV /etc/install, /usr/sbin/install +# SunOS /usr/etc/install +# IRIX /sbin/install +# AIX /bin/install +# AmigaOS /C/install, which installs bootblocks on floppy discs +# AIX 4 /usr/bin/installbsd, which doesn't work without a -g flag +# AFS /usr/afsws/bin/install, which mishandles nonexistent args +# SVR4 /usr/ucb/install, which tries to use the nonexistent group "staff" +# OS/2's system install, which has a completely different semantic +# ./install, which can be erroneously created by make from ./install.sh. +echo "$as_me:$LINENO: checking for a BSD-compatible install" >&5 +echo $ECHO_N "checking for a BSD-compatible install... $ECHO_C" >&6 +if test -z "$INSTALL"; then +if test "${ac_cv_path_install+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + as_save_IFS=$IFS; IFS=$PATH_SEPARATOR +for as_dir in $PATH +do + IFS=$as_save_IFS + test -z "$as_dir" && as_dir=. + # Account for people who put trailing slashes in PATH elements. +case $as_dir/ in + ./ | .// | /cC/* | \ + /etc/* | /usr/sbin/* | /usr/etc/* | /sbin/* | /usr/afsws/bin/* | \ + ?:\\/os2\\/install\\/* | ?:\\/OS2\\/INSTALL\\/* | \ + /usr/ucb/* ) ;; + *) + # OSF1 and SCO ODT 3.0 have their own names for install. + # Don't use installbsd from OSF since it installs stuff as root + # by default. + for ac_prog in ginstall scoinst install; do + for ac_exec_ext in '' $ac_executable_extensions; do + if $as_executable_p "$as_dir/$ac_prog$ac_exec_ext"; then + if test $ac_prog = install && + grep dspmsg "$as_dir/$ac_prog$ac_exec_ext" >/dev/null 2>&1; then + # AIX install. It has an incompatible calling convention. + : + elif test $ac_prog = install && + grep pwplus "$as_dir/$ac_prog$ac_exec_ext" >/dev/null 2>&1; then + # program-specific install script used by HP pwplus--don't use. + : + else + ac_cv_path_install="$as_dir/$ac_prog$ac_exec_ext -c" + break 3 + fi + fi + done + done + ;; +esac +done + + +fi + if test "${ac_cv_path_install+set}" = set; then + INSTALL=$ac_cv_path_install + else + # As a last resort, use the slow shell script. We don't cache a + # path for INSTALL within a source directory, because that will + # break other packages using the cache if that directory is + # removed, or if the path is relative. + INSTALL=$ac_install_sh + fi +fi +echo "$as_me:$LINENO: result: $INSTALL" >&5 +echo "${ECHO_T}$INSTALL" >&6 + +# Use test -z because SunOS4 sh mishandles braces in ${var-val}. +# It thinks the first close brace ends the variable substitution. +test -z "$INSTALL_PROGRAM" && INSTALL_PROGRAM='${INSTALL}' + +test -z "$INSTALL_SCRIPT" && INSTALL_SCRIPT='${INSTALL}' + +test -z "$INSTALL_DATA" && INSTALL_DATA='${INSTALL} -m 644' + +echo "$as_me:$LINENO: checking whether build environment is sane" >&5 +echo $ECHO_N "checking whether build environment is sane... $ECHO_C" >&6 +# Just in case +sleep 1 +echo timestamp > conftest.file +# Do `set' in a subshell so we don't clobber the current shell's +# arguments. Must try -L first in case configure is actually a +# symlink; some systems play weird games with the mod time of symlinks +# (eg FreeBSD returns the mod time of the symlink's containing +# directory). +if ( + set X `ls -Lt $srcdir/configure conftest.file 2> /dev/null` + if test "$*" = "X"; then + # -L didn't work. + set X `ls -t $srcdir/configure conftest.file` + fi + rm -f conftest.file + if test "$*" != "X $srcdir/configure conftest.file" \ + && test "$*" != "X conftest.file $srcdir/configure"; then + + # If neither matched, then we have a broken ls. This can happen + # if, for instance, CONFIG_SHELL is bash and it inherits a + # broken ls alias from the environment. This has actually + # happened. Such a system could not be considered "sane". + { { echo "$as_me:$LINENO: error: ls -t appears to fail. Make sure there is not a broken +alias in your environment" >&5 +echo "$as_me: error: ls -t appears to fail. Make sure there is not a broken +alias in your environment" >&2;} + { (exit 1); exit 1; }; } + fi + + test "$2" = conftest.file + ) +then + # Ok. + : +else + { { echo "$as_me:$LINENO: error: newly created file is older than distributed files! +Check your system clock" >&5 +echo "$as_me: error: newly created file is older than distributed files! +Check your system clock" >&2;} + { (exit 1); exit 1; }; } +fi +echo "$as_me:$LINENO: result: yes" >&5 +echo "${ECHO_T}yes" >&6 +test "$program_prefix" != NONE && + program_transform_name="s,^,$program_prefix,;$program_transform_name" +# Use a double $ so make ignores it. +test "$program_suffix" != NONE && + program_transform_name="s,\$,$program_suffix,;$program_transform_name" +# Double any \ or $. echo might interpret backslashes. +# By default was `s,x,x', remove it if useless. +cat <<\_ACEOF >conftest.sed +s/[\\$]/&&/g;s/;s,x,x,$// +_ACEOF +program_transform_name=`echo $program_transform_name | sed -f conftest.sed` +rm conftest.sed + +# expand $ac_aux_dir to an absolute path +am_aux_dir=`cd $ac_aux_dir && pwd` + +test x"${MISSING+set}" = xset || MISSING="\${SHELL} $am_aux_dir/missing" +# Use eval to expand $SHELL +if eval "$MISSING --run true"; then + am_missing_run="$MISSING --run " +else + am_missing_run= + { echo "$as_me:$LINENO: WARNING: \`missing' script is too old or missing" >&5 +echo "$as_me: WARNING: \`missing' script is too old or missing" >&2;} +fi + +if mkdir -p --version . >/dev/null 2>&1 && test ! -d ./--version; then + # We used to keeping the `.' as first argument, in order to + # allow $(mkdir_p) to be used without argument. As in + # $(mkdir_p) $(somedir) + # where $(somedir) is conditionally defined. However this is wrong + # for two reasons: + # 1. if the package is installed by a user who cannot write `.' + # make install will fail, + # 2. the above comment should most certainly read + # $(mkdir_p) $(DESTDIR)$(somedir) + # so it does not work when $(somedir) is undefined and + # $(DESTDIR) is not. + # To support the latter case, we have to write + # test -z "$(somedir)" || $(mkdir_p) $(DESTDIR)$(somedir), + # so the `.' trick is pointless. + mkdir_p='mkdir -p --' +else + # On NextStep and OpenStep, the `mkdir' command does not + # recognize any option. It will interpret all options as + # directories to create, and then abort because `.' already + # exists. + for d in ./-p ./--version; + do + test -d $d && rmdir $d + done + # $(mkinstalldirs) is defined by Automake if mkinstalldirs exists. + if test -f "$ac_aux_dir/mkinstalldirs"; then + mkdir_p='$(mkinstalldirs)' + else + mkdir_p='$(install_sh) -d' + fi +fi + +for ac_prog in gawk mawk nawk awk +do + # Extract the first word of "$ac_prog", so it can be a program name with args. +set dummy $ac_prog; ac_word=$2 +echo "$as_me:$LINENO: checking for $ac_word" >&5 +echo $ECHO_N "checking for $ac_word... $ECHO_C" >&6 +if test "${ac_cv_prog_AWK+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + if test -n "$AWK"; then + ac_cv_prog_AWK="$AWK" # Let the user override the test. +else +as_save_IFS=$IFS; IFS=$PATH_SEPARATOR +for as_dir in $PATH +do + IFS=$as_save_IFS + test -z "$as_dir" && as_dir=. + for ac_exec_ext in '' $ac_executable_extensions; do + if $as_executable_p "$as_dir/$ac_word$ac_exec_ext"; then + ac_cv_prog_AWK="$ac_prog" + echo "$as_me:$LINENO: found $as_dir/$ac_word$ac_exec_ext" >&5 + break 2 + fi +done +done + +fi +fi +AWK=$ac_cv_prog_AWK +if test -n "$AWK"; then + echo "$as_me:$LINENO: result: $AWK" >&5 +echo "${ECHO_T}$AWK" >&6 +else + echo "$as_me:$LINENO: result: no" >&5 +echo "${ECHO_T}no" >&6 +fi + + test -n "$AWK" && break +done + +echo "$as_me:$LINENO: checking whether ${MAKE-make} sets \$(MAKE)" >&5 +echo $ECHO_N "checking whether ${MAKE-make} sets \$(MAKE)... $ECHO_C" >&6 +set dummy ${MAKE-make}; ac_make=`echo "$2" | sed 'y,:./+-,___p_,'` +if eval "test \"\${ac_cv_prog_make_${ac_make}_set+set}\" = set"; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + cat >conftest.make <<\_ACEOF +all: + @echo 'ac_maketemp="$(MAKE)"' +_ACEOF +# GNU make sometimes prints "make[1]: Entering...", which would confuse us. +eval `${MAKE-make} -f conftest.make 2>/dev/null | grep temp=` +if test -n "$ac_maketemp"; then + eval ac_cv_prog_make_${ac_make}_set=yes +else + eval ac_cv_prog_make_${ac_make}_set=no +fi +rm -f conftest.make +fi +if eval "test \"`echo '$ac_cv_prog_make_'${ac_make}_set`\" = yes"; then + echo "$as_me:$LINENO: result: yes" >&5 +echo "${ECHO_T}yes" >&6 + SET_MAKE= +else + echo "$as_me:$LINENO: result: no" >&5 +echo "${ECHO_T}no" >&6 + SET_MAKE="MAKE=${MAKE-make}" +fi + +rm -rf .tst 2>/dev/null +mkdir .tst 2>/dev/null +if test -d .tst; then + am__leading_dot=. +else + am__leading_dot=_ +fi +rmdir .tst 2>/dev/null + +# test to see if srcdir already configured +if test "`cd $srcdir && pwd`" != "`pwd`" && + test -f $srcdir/config.status; then + { { echo "$as_me:$LINENO: error: source directory already configured; run \"make distclean\" there first" >&5 +echo "$as_me: error: source directory already configured; run \"make distclean\" there first" >&2;} + { (exit 1); exit 1; }; } +fi + +# test whether we have cygpath +if test -z "$CYGPATH_W"; then + if (cygpath --version) >/dev/null 2>/dev/null; then + CYGPATH_W='cygpath -w' + else + CYGPATH_W=echo + fi +fi + + +# Define the identity of the package. + PACKAGE='libgcc-math' + VERSION='1.0' + + +cat >>confdefs.h <<_ACEOF +#define PACKAGE "$PACKAGE" +_ACEOF + + +cat >>confdefs.h <<_ACEOF +#define VERSION "$VERSION" +_ACEOF + +# Some tools Automake needs. + +ACLOCAL=${ACLOCAL-"${am_missing_run}aclocal-${am__api_version}"} + + +AUTOCONF=${AUTOCONF-"${am_missing_run}autoconf"} + + +AUTOMAKE=${AUTOMAKE-"${am_missing_run}automake-${am__api_version}"} + + +AUTOHEADER=${AUTOHEADER-"${am_missing_run}autoheader"} + + +MAKEINFO=${MAKEINFO-"${am_missing_run}makeinfo"} + +install_sh=${install_sh-"$am_aux_dir/install-sh"} + +# Installed binaries are usually stripped using `strip' when the user +# run `make install-strip'. However `strip' might not be the right +# tool to use in cross-compilation environments, therefore Automake +# will honor the `STRIP' environment variable to overrule this program. +if test "$cross_compiling" != no; then + if test -n "$ac_tool_prefix"; then + # Extract the first word of "${ac_tool_prefix}strip", so it can be a program name with args. +set dummy ${ac_tool_prefix}strip; ac_word=$2 +echo "$as_me:$LINENO: checking for $ac_word" >&5 +echo $ECHO_N "checking for $ac_word... $ECHO_C" >&6 +if test "${ac_cv_prog_STRIP+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + if test -n "$STRIP"; then + ac_cv_prog_STRIP="$STRIP" # Let the user override the test. +else +as_save_IFS=$IFS; IFS=$PATH_SEPARATOR +for as_dir in $PATH +do + IFS=$as_save_IFS + test -z "$as_dir" && as_dir=. + for ac_exec_ext in '' $ac_executable_extensions; do + if $as_executable_p "$as_dir/$ac_word$ac_exec_ext"; then + ac_cv_prog_STRIP="${ac_tool_prefix}strip" + echo "$as_me:$LINENO: found $as_dir/$ac_word$ac_exec_ext" >&5 + break 2 + fi +done +done + +fi +fi +STRIP=$ac_cv_prog_STRIP +if test -n "$STRIP"; then + echo "$as_me:$LINENO: result: $STRIP" >&5 +echo "${ECHO_T}$STRIP" >&6 +else + echo "$as_me:$LINENO: result: no" >&5 +echo "${ECHO_T}no" >&6 +fi + +fi +if test -z "$ac_cv_prog_STRIP"; then + ac_ct_STRIP=$STRIP + # Extract the first word of "strip", so it can be a program name with args. +set dummy strip; ac_word=$2 +echo "$as_me:$LINENO: checking for $ac_word" >&5 +echo $ECHO_N "checking for $ac_word... $ECHO_C" >&6 +if test "${ac_cv_prog_ac_ct_STRIP+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + if test -n "$ac_ct_STRIP"; then + ac_cv_prog_ac_ct_STRIP="$ac_ct_STRIP" # Let the user override the test. +else +as_save_IFS=$IFS; IFS=$PATH_SEPARATOR +for as_dir in $PATH +do + IFS=$as_save_IFS + test -z "$as_dir" && as_dir=. + for ac_exec_ext in '' $ac_executable_extensions; do + if $as_executable_p "$as_dir/$ac_word$ac_exec_ext"; then + ac_cv_prog_ac_ct_STRIP="strip" + echo "$as_me:$LINENO: found $as_dir/$ac_word$ac_exec_ext" >&5 + break 2 + fi +done +done + + test -z "$ac_cv_prog_ac_ct_STRIP" && ac_cv_prog_ac_ct_STRIP=":" +fi +fi +ac_ct_STRIP=$ac_cv_prog_ac_ct_STRIP +if test -n "$ac_ct_STRIP"; then + echo "$as_me:$LINENO: result: $ac_ct_STRIP" >&5 +echo "${ECHO_T}$ac_ct_STRIP" >&6 +else + echo "$as_me:$LINENO: result: no" >&5 +echo "${ECHO_T}no" >&6 +fi + + STRIP=$ac_ct_STRIP +else + STRIP="$ac_cv_prog_STRIP" +fi + +fi +INSTALL_STRIP_PROGRAM="\${SHELL} \$(install_sh) -c -s" + +# We need awk for the "check" target. The system "awk" is bad on +# some platforms. +# Always define AMTAR for backward compatibility. + +AMTAR=${AMTAR-"${am_missing_run}tar"} + +am__tar='${AMTAR} chof - "$$tardir"'; am__untar='${AMTAR} xf -' + + + + + + +echo "$as_me:$LINENO: checking for --enable-version-specific-runtime-libs" >&5 +echo $ECHO_N "checking for --enable-version-specific-runtime-libs... $ECHO_C" >&6 +# Check whether --enable-version-specific-runtime-libs or --disable-version-specific-runtime-libs was given. +if test "${enable_version_specific_runtime_libs+set}" = set; then + enableval="$enable_version_specific_runtime_libs" + case "$enableval" in + yes) version_specific_libs=yes ;; + no) version_specific_libs=no ;; + *) { { echo "$as_me:$LINENO: error: Unknown argument to enable/disable version-specific libs" >&5 +echo "$as_me: error: Unknown argument to enable/disable version-specific libs" >&2;} + { (exit 1); exit 1; }; };; + esac +else + version_specific_libs=no +fi; +echo "$as_me:$LINENO: result: $version_specific_libs" >&5 +echo "${ECHO_T}$version_specific_libs" >&6 + +echo "$as_me:$LINENO: checking whether to enable maintainer-specific portions of Makefiles" >&5 +echo $ECHO_N "checking whether to enable maintainer-specific portions of Makefiles... $ECHO_C" >&6 + # Check whether --enable-maintainer-mode or --disable-maintainer-mode was given. +if test "${enable_maintainer_mode+set}" = set; then + enableval="$enable_maintainer_mode" + USE_MAINTAINER_MODE=$enableval +else + USE_MAINTAINER_MODE=no +fi; + echo "$as_me:$LINENO: result: $USE_MAINTAINER_MODE" >&5 +echo "${ECHO_T}$USE_MAINTAINER_MODE" >&6 + + +if test $USE_MAINTAINER_MODE = yes; then + MAINTAINER_MODE_TRUE= + MAINTAINER_MODE_FALSE='#' +else + MAINTAINER_MODE_TRUE='#' + MAINTAINER_MODE_FALSE= +fi + + MAINT=$MAINTAINER_MODE_TRUE + + + + +# Default to --enable-multilib +# Check whether --enable-multilib or --disable-multilib was given. +if test "${enable_multilib+set}" = set; then + enableval="$enable_multilib" + case "$enableval" in + yes) multilib=yes ;; + no) multilib=no ;; + *) { { echo "$as_me:$LINENO: error: bad value $enableval for multilib option" >&5 +echo "$as_me: error: bad value $enableval for multilib option" >&2;} + { (exit 1); exit 1; }; } ;; + esac +else + multilib=yes +fi; + +# We may get other options which we leave undocumented: +# --with-target-subdir, --with-multisrctop, --with-multisubdir +# See config-ml.in if you want the gory details. + +if test "$srcdir" = "."; then + if test "$with_target_subdir" != "."; then + multi_basedir="$srcdir/$with_multisrctop../.." + else + multi_basedir="$srcdir/$with_multisrctop.." + fi +else + multi_basedir="$srcdir/.." +fi + + + ac_config_commands="$ac_config_commands default-1" + + +target_alias=${target_alias-$host_alias} + + +ac_ext=c +ac_cpp='$CPP $CPPFLAGS' +ac_compile='$CC -c $CFLAGS $CPPFLAGS conftest.$ac_ext >&5' +ac_link='$CC -o conftest$ac_exeext $CFLAGS $CPPFLAGS $LDFLAGS conftest.$ac_ext $LIBS >&5' +ac_compiler_gnu=$ac_cv_c_compiler_gnu + +# The same as in boehm-gc and libstdc++. Have to borrow it from there. +# We must force CC to /not/ be precious variables; otherwise +# the wrong, non-multilib-adjusted value will be used in multilibs. +# As a side effect, we have to subst CFLAGS ourselves. + + + +ac_ext=c +ac_cpp='$CPP $CPPFLAGS' +ac_compile='$CC -c $CFLAGS $CPPFLAGS conftest.$ac_ext >&5' +ac_link='$CC -o conftest$ac_exeext $CFLAGS $CPPFLAGS $LDFLAGS conftest.$ac_ext $LIBS >&5' +ac_compiler_gnu=$ac_cv_c_compiler_gnu +if test -n "$ac_tool_prefix"; then + # Extract the first word of "${ac_tool_prefix}gcc", so it can be a program name with args. +set dummy ${ac_tool_prefix}gcc; ac_word=$2 +echo "$as_me:$LINENO: checking for $ac_word" >&5 +echo $ECHO_N "checking for $ac_word... $ECHO_C" >&6 +if test "${ac_cv_prog_CC+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + if test -n "$CC"; then + ac_cv_prog_CC="$CC" # Let the user override the test. +else +as_save_IFS=$IFS; IFS=$PATH_SEPARATOR +for as_dir in $PATH +do + IFS=$as_save_IFS + test -z "$as_dir" && as_dir=. + for ac_exec_ext in '' $ac_executable_extensions; do + if $as_executable_p "$as_dir/$ac_word$ac_exec_ext"; then + ac_cv_prog_CC="${ac_tool_prefix}gcc" + echo "$as_me:$LINENO: found $as_dir/$ac_word$ac_exec_ext" >&5 + break 2 + fi +done +done + +fi +fi +CC=$ac_cv_prog_CC +if test -n "$CC"; then + echo "$as_me:$LINENO: result: $CC" >&5 +echo "${ECHO_T}$CC" >&6 +else + echo "$as_me:$LINENO: result: no" >&5 +echo "${ECHO_T}no" >&6 +fi + +fi +if test -z "$ac_cv_prog_CC"; then + ac_ct_CC=$CC + # Extract the first word of "gcc", so it can be a program name with args. +set dummy gcc; ac_word=$2 +echo "$as_me:$LINENO: checking for $ac_word" >&5 +echo $ECHO_N "checking for $ac_word... $ECHO_C" >&6 +if test "${ac_cv_prog_ac_ct_CC+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + if test -n "$ac_ct_CC"; then + ac_cv_prog_ac_ct_CC="$ac_ct_CC" # Let the user override the test. +else +as_save_IFS=$IFS; IFS=$PATH_SEPARATOR +for as_dir in $PATH +do + IFS=$as_save_IFS + test -z "$as_dir" && as_dir=. + for ac_exec_ext in '' $ac_executable_extensions; do + if $as_executable_p "$as_dir/$ac_word$ac_exec_ext"; then + ac_cv_prog_ac_ct_CC="gcc" + echo "$as_me:$LINENO: found $as_dir/$ac_word$ac_exec_ext" >&5 + break 2 + fi +done +done + +fi +fi +ac_ct_CC=$ac_cv_prog_ac_ct_CC +if test -n "$ac_ct_CC"; then + echo "$as_me:$LINENO: result: $ac_ct_CC" >&5 +echo "${ECHO_T}$ac_ct_CC" >&6 +else + echo "$as_me:$LINENO: result: no" >&5 +echo "${ECHO_T}no" >&6 +fi + + CC=$ac_ct_CC +else + CC="$ac_cv_prog_CC" +fi + +if test -z "$CC"; then + if test -n "$ac_tool_prefix"; then + # Extract the first word of "${ac_tool_prefix}cc", so it can be a program name with args. +set dummy ${ac_tool_prefix}cc; ac_word=$2 +echo "$as_me:$LINENO: checking for $ac_word" >&5 +echo $ECHO_N "checking for $ac_word... $ECHO_C" >&6 +if test "${ac_cv_prog_CC+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + if test -n "$CC"; then + ac_cv_prog_CC="$CC" # Let the user override the test. +else +as_save_IFS=$IFS; IFS=$PATH_SEPARATOR +for as_dir in $PATH +do + IFS=$as_save_IFS + test -z "$as_dir" && as_dir=. + for ac_exec_ext in '' $ac_executable_extensions; do + if $as_executable_p "$as_dir/$ac_word$ac_exec_ext"; then + ac_cv_prog_CC="${ac_tool_prefix}cc" + echo "$as_me:$LINENO: found $as_dir/$ac_word$ac_exec_ext" >&5 + break 2 + fi +done +done + +fi +fi +CC=$ac_cv_prog_CC +if test -n "$CC"; then + echo "$as_me:$LINENO: result: $CC" >&5 +echo "${ECHO_T}$CC" >&6 +else + echo "$as_me:$LINENO: result: no" >&5 +echo "${ECHO_T}no" >&6 +fi + +fi +if test -z "$ac_cv_prog_CC"; then + ac_ct_CC=$CC + # Extract the first word of "cc", so it can be a program name with args. +set dummy cc; ac_word=$2 +echo "$as_me:$LINENO: checking for $ac_word" >&5 +echo $ECHO_N "checking for $ac_word... $ECHO_C" >&6 +if test "${ac_cv_prog_ac_ct_CC+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + if test -n "$ac_ct_CC"; then + ac_cv_prog_ac_ct_CC="$ac_ct_CC" # Let the user override the test. +else +as_save_IFS=$IFS; IFS=$PATH_SEPARATOR +for as_dir in $PATH +do + IFS=$as_save_IFS + test -z "$as_dir" && as_dir=. + for ac_exec_ext in '' $ac_executable_extensions; do + if $as_executable_p "$as_dir/$ac_word$ac_exec_ext"; then + ac_cv_prog_ac_ct_CC="cc" + echo "$as_me:$LINENO: found $as_dir/$ac_word$ac_exec_ext" >&5 + break 2 + fi +done +done + +fi +fi +ac_ct_CC=$ac_cv_prog_ac_ct_CC +if test -n "$ac_ct_CC"; then + echo "$as_me:$LINENO: result: $ac_ct_CC" >&5 +echo "${ECHO_T}$ac_ct_CC" >&6 +else + echo "$as_me:$LINENO: result: no" >&5 +echo "${ECHO_T}no" >&6 +fi + + CC=$ac_ct_CC +else + CC="$ac_cv_prog_CC" +fi + +fi +if test -z "$CC"; then + # Extract the first word of "cc", so it can be a program name with args. +set dummy cc; ac_word=$2 +echo "$as_me:$LINENO: checking for $ac_word" >&5 +echo $ECHO_N "checking for $ac_word... $ECHO_C" >&6 +if test "${ac_cv_prog_CC+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + if test -n "$CC"; then + ac_cv_prog_CC="$CC" # Let the user override the test. +else + ac_prog_rejected=no +as_save_IFS=$IFS; IFS=$PATH_SEPARATOR +for as_dir in $PATH +do + IFS=$as_save_IFS + test -z "$as_dir" && as_dir=. + for ac_exec_ext in '' $ac_executable_extensions; do + if $as_executable_p "$as_dir/$ac_word$ac_exec_ext"; then + if test "$as_dir/$ac_word$ac_exec_ext" = "/usr/ucb/cc"; then + ac_prog_rejected=yes + continue + fi + ac_cv_prog_CC="cc" + echo "$as_me:$LINENO: found $as_dir/$ac_word$ac_exec_ext" >&5 + break 2 + fi +done +done + +if test $ac_prog_rejected = yes; then + # We found a bogon in the path, so make sure we never use it. + set dummy $ac_cv_prog_CC + shift + if test $# != 0; then + # We chose a different compiler from the bogus one. + # However, it has the same basename, so the bogon will be chosen + # first if we set CC to just the basename; use the full file name. + shift + ac_cv_prog_CC="$as_dir/$ac_word${1+' '}$@" + fi +fi +fi +fi +CC=$ac_cv_prog_CC +if test -n "$CC"; then + echo "$as_me:$LINENO: result: $CC" >&5 +echo "${ECHO_T}$CC" >&6 +else + echo "$as_me:$LINENO: result: no" >&5 +echo "${ECHO_T}no" >&6 +fi + +fi +if test -z "$CC"; then + if test -n "$ac_tool_prefix"; then + for ac_prog in cl + do + # Extract the first word of "$ac_tool_prefix$ac_prog", so it can be a program name with args. +set dummy $ac_tool_prefix$ac_prog; ac_word=$2 +echo "$as_me:$LINENO: checking for $ac_word" >&5 +echo $ECHO_N "checking for $ac_word... $ECHO_C" >&6 +if test "${ac_cv_prog_CC+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + if test -n "$CC"; then + ac_cv_prog_CC="$CC" # Let the user override the test. +else +as_save_IFS=$IFS; IFS=$PATH_SEPARATOR +for as_dir in $PATH +do + IFS=$as_save_IFS + test -z "$as_dir" && as_dir=. + for ac_exec_ext in '' $ac_executable_extensions; do + if $as_executable_p "$as_dir/$ac_word$ac_exec_ext"; then + ac_cv_prog_CC="$ac_tool_prefix$ac_prog" + echo "$as_me:$LINENO: found $as_dir/$ac_word$ac_exec_ext" >&5 + break 2 + fi +done +done + +fi +fi +CC=$ac_cv_prog_CC +if test -n "$CC"; then + echo "$as_me:$LINENO: result: $CC" >&5 +echo "${ECHO_T}$CC" >&6 +else + echo "$as_me:$LINENO: result: no" >&5 +echo "${ECHO_T}no" >&6 +fi + + test -n "$CC" && break + done +fi +if test -z "$CC"; then + ac_ct_CC=$CC + for ac_prog in cl +do + # Extract the first word of "$ac_prog", so it can be a program name with args. +set dummy $ac_prog; ac_word=$2 +echo "$as_me:$LINENO: checking for $ac_word" >&5 +echo $ECHO_N "checking for $ac_word... $ECHO_C" >&6 +if test "${ac_cv_prog_ac_ct_CC+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + if test -n "$ac_ct_CC"; then + ac_cv_prog_ac_ct_CC="$ac_ct_CC" # Let the user override the test. +else +as_save_IFS=$IFS; IFS=$PATH_SEPARATOR +for as_dir in $PATH +do + IFS=$as_save_IFS + test -z "$as_dir" && as_dir=. + for ac_exec_ext in '' $ac_executable_extensions; do + if $as_executable_p "$as_dir/$ac_word$ac_exec_ext"; then + ac_cv_prog_ac_ct_CC="$ac_prog" + echo "$as_me:$LINENO: found $as_dir/$ac_word$ac_exec_ext" >&5 + break 2 + fi +done +done + +fi +fi +ac_ct_CC=$ac_cv_prog_ac_ct_CC +if test -n "$ac_ct_CC"; then + echo "$as_me:$LINENO: result: $ac_ct_CC" >&5 +echo "${ECHO_T}$ac_ct_CC" >&6 +else + echo "$as_me:$LINENO: result: no" >&5 +echo "${ECHO_T}no" >&6 +fi + + test -n "$ac_ct_CC" && break +done + + CC=$ac_ct_CC +fi + +fi + + +test -z "$CC" && { { echo "$as_me:$LINENO: error: no acceptable C compiler found in \$PATH +See \`config.log' for more details." >&5 +echo "$as_me: error: no acceptable C compiler found in \$PATH +See \`config.log' for more details." >&2;} + { (exit 1); exit 1; }; } + +# Provide some information about the compiler. +echo "$as_me:$LINENO:" \ + "checking for C compiler version" >&5 +ac_compiler=`set X $ac_compile; echo $2` +{ (eval echo "$as_me:$LINENO: \"$ac_compiler --version &5\"") >&5 + (eval $ac_compiler --version &5) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } +{ (eval echo "$as_me:$LINENO: \"$ac_compiler -v &5\"") >&5 + (eval $ac_compiler -v &5) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } +{ (eval echo "$as_me:$LINENO: \"$ac_compiler -V &5\"") >&5 + (eval $ac_compiler -V &5) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } + +cat >conftest.$ac_ext <<_ACEOF +/* confdefs.h. */ +_ACEOF +cat confdefs.h >>conftest.$ac_ext +cat >>conftest.$ac_ext <<_ACEOF +/* end confdefs.h. */ + +int +main () +{ + + ; + return 0; +} +_ACEOF +ac_clean_files_save=$ac_clean_files +ac_clean_files="$ac_clean_files a.out a.exe b.out" +# Try to create an executable without -o first, disregard a.out. +# It will help us diagnose broken compilers, and finding out an intuition +# of exeext. +echo "$as_me:$LINENO: checking for C compiler default output file name" >&5 +echo $ECHO_N "checking for C compiler default output file name... $ECHO_C" >&6 +ac_link_default=`echo "$ac_link" | sed 's/ -o *conftest[^ ]*//'` +if { (eval echo "$as_me:$LINENO: \"$ac_link_default\"") >&5 + (eval $ac_link_default) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; then + # Find the output, starting from the most likely. This scheme is +# not robust to junk in `.', hence go to wildcards (a.*) only as a last +# resort. + +# Be careful to initialize this variable, since it used to be cached. +# Otherwise an old cache value of `no' led to `EXEEXT = no' in a Makefile. +ac_cv_exeext= +# b.out is created by i960 compilers. +for ac_file in a_out.exe a.exe conftest.exe a.out conftest a.* conftest.* b.out +do + test -f "$ac_file" || continue + case $ac_file in + *.$ac_ext | *.xcoff | *.tds | *.d | *.pdb | *.xSYM | *.bb | *.bbg | *.o | *.obj ) + ;; + conftest.$ac_ext ) + # This is the source file. + ;; + [ab].out ) + # We found the default executable, but exeext='' is most + # certainly right. + break;; + *.* ) + ac_cv_exeext=`expr "$ac_file" : '[^.]*\(\..*\)'` + # FIXME: I believe we export ac_cv_exeext for Libtool, + # but it would be cool to find out if it's true. Does anybody + # maintain Libtool? --akim. + export ac_cv_exeext + break;; + * ) + break;; + esac +done +else + echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 + +{ { echo "$as_me:$LINENO: error: C compiler cannot create executables +See \`config.log' for more details." >&5 +echo "$as_me: error: C compiler cannot create executables +See \`config.log' for more details." >&2;} + { (exit 77); exit 77; }; } +fi + +ac_exeext=$ac_cv_exeext +echo "$as_me:$LINENO: result: $ac_file" >&5 +echo "${ECHO_T}$ac_file" >&6 + +# Check the compiler produces executables we can run. If not, either +# the compiler is broken, or we cross compile. +echo "$as_me:$LINENO: checking whether the C compiler works" >&5 +echo $ECHO_N "checking whether the C compiler works... $ECHO_C" >&6 +# FIXME: These cross compiler hacks should be removed for Autoconf 3.0 +# If not cross compiling, check that we can run a simple program. +if test "$cross_compiling" != yes; then + if { ac_try='./$ac_file' + { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5 + (eval $ac_try) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; }; then + cross_compiling=no + else + if test "$cross_compiling" = maybe; then + cross_compiling=yes + else + { { echo "$as_me:$LINENO: error: cannot run C compiled programs. +If you meant to cross compile, use \`--host'. +See \`config.log' for more details." >&5 +echo "$as_me: error: cannot run C compiled programs. +If you meant to cross compile, use \`--host'. +See \`config.log' for more details." >&2;} + { (exit 1); exit 1; }; } + fi + fi +fi +echo "$as_me:$LINENO: result: yes" >&5 +echo "${ECHO_T}yes" >&6 + +rm -f a.out a.exe conftest$ac_cv_exeext b.out +ac_clean_files=$ac_clean_files_save +# Check the compiler produces executables we can run. If not, either +# the compiler is broken, or we cross compile. +echo "$as_me:$LINENO: checking whether we are cross compiling" >&5 +echo $ECHO_N "checking whether we are cross compiling... $ECHO_C" >&6 +echo "$as_me:$LINENO: result: $cross_compiling" >&5 +echo "${ECHO_T}$cross_compiling" >&6 + +echo "$as_me:$LINENO: checking for suffix of executables" >&5 +echo $ECHO_N "checking for suffix of executables... $ECHO_C" >&6 +if { (eval echo "$as_me:$LINENO: \"$ac_link\"") >&5 + (eval $ac_link) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; then + # If both `conftest.exe' and `conftest' are `present' (well, observable) +# catch `conftest.exe'. For instance with Cygwin, `ls conftest' will +# work properly (i.e., refer to `conftest.exe'), while it won't with +# `rm'. +for ac_file in conftest.exe conftest conftest.*; do + test -f "$ac_file" || continue + case $ac_file in + *.$ac_ext | *.xcoff | *.tds | *.d | *.pdb | *.xSYM | *.bb | *.bbg | *.o | *.obj ) ;; + *.* ) ac_cv_exeext=`expr "$ac_file" : '[^.]*\(\..*\)'` + export ac_cv_exeext + break;; + * ) break;; + esac +done +else + { { echo "$as_me:$LINENO: error: cannot compute suffix of executables: cannot compile and link +See \`config.log' for more details." >&5 +echo "$as_me: error: cannot compute suffix of executables: cannot compile and link +See \`config.log' for more details." >&2;} + { (exit 1); exit 1; }; } +fi + +rm -f conftest$ac_cv_exeext +echo "$as_me:$LINENO: result: $ac_cv_exeext" >&5 +echo "${ECHO_T}$ac_cv_exeext" >&6 + +rm -f conftest.$ac_ext +EXEEXT=$ac_cv_exeext +ac_exeext=$EXEEXT +echo "$as_me:$LINENO: checking for suffix of object files" >&5 +echo $ECHO_N "checking for suffix of object files... $ECHO_C" >&6 +if test "${ac_cv_objext+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + cat >conftest.$ac_ext <<_ACEOF +/* confdefs.h. */ +_ACEOF +cat confdefs.h >>conftest.$ac_ext +cat >>conftest.$ac_ext <<_ACEOF +/* end confdefs.h. */ + +int +main () +{ + + ; + return 0; +} +_ACEOF +rm -f conftest.o conftest.obj +if { (eval echo "$as_me:$LINENO: \"$ac_compile\"") >&5 + (eval $ac_compile) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; then + for ac_file in `(ls conftest.o conftest.obj; ls conftest.*) 2>/dev/null`; do + case $ac_file in + *.$ac_ext | *.xcoff | *.tds | *.d | *.pdb | *.xSYM | *.bb | *.bbg ) ;; + *) ac_cv_objext=`expr "$ac_file" : '.*\.\(.*\)'` + break;; + esac +done +else + echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 + +{ { echo "$as_me:$LINENO: error: cannot compute suffix of object files: cannot compile +See \`config.log' for more details." >&5 +echo "$as_me: error: cannot compute suffix of object files: cannot compile +See \`config.log' for more details." >&2;} + { (exit 1); exit 1; }; } +fi + +rm -f conftest.$ac_cv_objext conftest.$ac_ext +fi +echo "$as_me:$LINENO: result: $ac_cv_objext" >&5 +echo "${ECHO_T}$ac_cv_objext" >&6 +OBJEXT=$ac_cv_objext +ac_objext=$OBJEXT +echo "$as_me:$LINENO: checking whether we are using the GNU C compiler" >&5 +echo $ECHO_N "checking whether we are using the GNU C compiler... $ECHO_C" >&6 +if test "${ac_cv_c_compiler_gnu+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + cat >conftest.$ac_ext <<_ACEOF +/* confdefs.h. */ +_ACEOF +cat confdefs.h >>conftest.$ac_ext +cat >>conftest.$ac_ext <<_ACEOF +/* end confdefs.h. */ + +int +main () +{ +#ifndef __GNUC__ + choke me +#endif + + ; + return 0; +} +_ACEOF +rm -f conftest.$ac_objext +if { (eval echo "$as_me:$LINENO: \"$ac_compile\"") >&5 + (eval $ac_compile) 2>conftest.er1 + ac_status=$? + grep -v '^ *+' conftest.er1 >conftest.err + rm -f conftest.er1 + cat conftest.err >&5 + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } && + { ac_try='test -z "$ac_c_werror_flag" + || test ! -s conftest.err' + { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5 + (eval $ac_try) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; } && + { ac_try='test -s conftest.$ac_objext' + { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5 + (eval $ac_try) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; }; then + ac_compiler_gnu=yes +else + echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 + +ac_compiler_gnu=no +fi +rm -f conftest.err conftest.$ac_objext conftest.$ac_ext +ac_cv_c_compiler_gnu=$ac_compiler_gnu + +fi +echo "$as_me:$LINENO: result: $ac_cv_c_compiler_gnu" >&5 +echo "${ECHO_T}$ac_cv_c_compiler_gnu" >&6 +GCC=`test $ac_compiler_gnu = yes && echo yes` +ac_test_CFLAGS=${CFLAGS+set} +ac_save_CFLAGS=$CFLAGS +CFLAGS="-g" +echo "$as_me:$LINENO: checking whether $CC accepts -g" >&5 +echo $ECHO_N "checking whether $CC accepts -g... $ECHO_C" >&6 +if test "${ac_cv_prog_cc_g+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + cat >conftest.$ac_ext <<_ACEOF +/* confdefs.h. */ +_ACEOF +cat confdefs.h >>conftest.$ac_ext +cat >>conftest.$ac_ext <<_ACEOF +/* end confdefs.h. */ + +int +main () +{ + + ; + return 0; +} +_ACEOF +rm -f conftest.$ac_objext +if { (eval echo "$as_me:$LINENO: \"$ac_compile\"") >&5 + (eval $ac_compile) 2>conftest.er1 + ac_status=$? + grep -v '^ *+' conftest.er1 >conftest.err + rm -f conftest.er1 + cat conftest.err >&5 + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } && + { ac_try='test -z "$ac_c_werror_flag" + || test ! -s conftest.err' + { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5 + (eval $ac_try) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; } && + { ac_try='test -s conftest.$ac_objext' + { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5 + (eval $ac_try) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; }; then + ac_cv_prog_cc_g=yes +else + echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 + +ac_cv_prog_cc_g=no +fi +rm -f conftest.err conftest.$ac_objext conftest.$ac_ext +fi +echo "$as_me:$LINENO: result: $ac_cv_prog_cc_g" >&5 +echo "${ECHO_T}$ac_cv_prog_cc_g" >&6 +if test "$ac_test_CFLAGS" = set; then + CFLAGS=$ac_save_CFLAGS +elif test $ac_cv_prog_cc_g = yes; then + if test "$GCC" = yes; then + CFLAGS="-g -O2" + else + CFLAGS="-g" + fi +else + if test "$GCC" = yes; then + CFLAGS="-O2" + else + CFLAGS= + fi +fi +echo "$as_me:$LINENO: checking for $CC option to accept ANSI C" >&5 +echo $ECHO_N "checking for $CC option to accept ANSI C... $ECHO_C" >&6 +if test "${ac_cv_prog_cc_stdc+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + ac_cv_prog_cc_stdc=no +ac_save_CC=$CC +cat >conftest.$ac_ext <<_ACEOF +/* confdefs.h. */ +_ACEOF +cat confdefs.h >>conftest.$ac_ext +cat >>conftest.$ac_ext <<_ACEOF +/* end confdefs.h. */ +#include +#include +#include +#include +/* Most of the following tests are stolen from RCS 5.7's src/conf.sh. */ +struct buf { int x; }; +FILE * (*rcsopen) (struct buf *, struct stat *, int); +static char *e (p, i) + char **p; + int i; +{ + return p[i]; +} +static char *f (char * (*g) (char **, int), char **p, ...) +{ + char *s; + va_list v; + va_start (v,p); + s = g (p, va_arg (v,int)); + va_end (v); + return s; +} + +/* OSF 4.0 Compaq cc is some sort of almost-ANSI by default. It has + function prototypes and stuff, but not '\xHH' hex character constants. + These don't provoke an error unfortunately, instead are silently treated + as 'x'. The following induces an error, until -std1 is added to get + proper ANSI mode. Curiously '\x00'!='x' always comes out true, for an + array size at least. It's necessary to write '\x00'==0 to get something + that's true only with -std1. */ +int osf4_cc_array ['\x00' == 0 ? 1 : -1]; + +int test (int i, double x); +struct s1 {int (*f) (int a);}; +struct s2 {int (*f) (double a);}; +int pairnames (int, char **, FILE *(*)(struct buf *, struct stat *, int), int, int); +int argc; +char **argv; +int +main () +{ +return f (e, argv, 0) != argv[0] || f (e, argv, 1) != argv[1]; + ; + return 0; +} +_ACEOF +# Don't try gcc -ansi; that turns off useful extensions and +# breaks some systems' header files. +# AIX -qlanglvl=ansi +# Ultrix and OSF/1 -std1 +# HP-UX 10.20 and later -Ae +# HP-UX older versions -Aa -D_HPUX_SOURCE +# SVR4 -Xc -D__EXTENSIONS__ +for ac_arg in "" -qlanglvl=ansi -std1 -Ae "-Aa -D_HPUX_SOURCE" "-Xc -D__EXTENSIONS__" +do + CC="$ac_save_CC $ac_arg" + rm -f conftest.$ac_objext +if { (eval echo "$as_me:$LINENO: \"$ac_compile\"") >&5 + (eval $ac_compile) 2>conftest.er1 + ac_status=$? + grep -v '^ *+' conftest.er1 >conftest.err + rm -f conftest.er1 + cat conftest.err >&5 + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } && + { ac_try='test -z "$ac_c_werror_flag" + || test ! -s conftest.err' + { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5 + (eval $ac_try) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; } && + { ac_try='test -s conftest.$ac_objext' + { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5 + (eval $ac_try) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; }; then + ac_cv_prog_cc_stdc=$ac_arg +break +else + echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 + +fi +rm -f conftest.err conftest.$ac_objext +done +rm -f conftest.$ac_ext conftest.$ac_objext +CC=$ac_save_CC + +fi + +case "x$ac_cv_prog_cc_stdc" in + x|xno) + echo "$as_me:$LINENO: result: none needed" >&5 +echo "${ECHO_T}none needed" >&6 ;; + *) + echo "$as_me:$LINENO: result: $ac_cv_prog_cc_stdc" >&5 +echo "${ECHO_T}$ac_cv_prog_cc_stdc" >&6 + CC="$CC $ac_cv_prog_cc_stdc" ;; +esac + +# Some people use a C++ compiler to compile C. Since we use `exit', +# in C++ we need to declare it. In case someone uses the same compiler +# for both compiling C and C++ we need to have the C++ compiler decide +# the declaration of exit, since it's the most demanding environment. +cat >conftest.$ac_ext <<_ACEOF +#ifndef __cplusplus + choke me +#endif +_ACEOF +rm -f conftest.$ac_objext +if { (eval echo "$as_me:$LINENO: \"$ac_compile\"") >&5 + (eval $ac_compile) 2>conftest.er1 + ac_status=$? + grep -v '^ *+' conftest.er1 >conftest.err + rm -f conftest.er1 + cat conftest.err >&5 + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } && + { ac_try='test -z "$ac_c_werror_flag" + || test ! -s conftest.err' + { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5 + (eval $ac_try) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; } && + { ac_try='test -s conftest.$ac_objext' + { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5 + (eval $ac_try) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; }; then + for ac_declaration in \ + '' \ + 'extern "C" void std::exit (int) throw (); using std::exit;' \ + 'extern "C" void std::exit (int); using std::exit;' \ + 'extern "C" void exit (int) throw ();' \ + 'extern "C" void exit (int);' \ + 'void exit (int);' +do + cat >conftest.$ac_ext <<_ACEOF +/* confdefs.h. */ +_ACEOF +cat confdefs.h >>conftest.$ac_ext +cat >>conftest.$ac_ext <<_ACEOF +/* end confdefs.h. */ +$ac_declaration +#include +int +main () +{ +exit (42); + ; + return 0; +} +_ACEOF +rm -f conftest.$ac_objext +if { (eval echo "$as_me:$LINENO: \"$ac_compile\"") >&5 + (eval $ac_compile) 2>conftest.er1 + ac_status=$? + grep -v '^ *+' conftest.er1 >conftest.err + rm -f conftest.er1 + cat conftest.err >&5 + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } && + { ac_try='test -z "$ac_c_werror_flag" + || test ! -s conftest.err' + { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5 + (eval $ac_try) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; } && + { ac_try='test -s conftest.$ac_objext' + { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5 + (eval $ac_try) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; }; then + : +else + echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 + +continue +fi +rm -f conftest.err conftest.$ac_objext conftest.$ac_ext + cat >conftest.$ac_ext <<_ACEOF +/* confdefs.h. */ +_ACEOF +cat confdefs.h >>conftest.$ac_ext +cat >>conftest.$ac_ext <<_ACEOF +/* end confdefs.h. */ +$ac_declaration +int +main () +{ +exit (42); + ; + return 0; +} +_ACEOF +rm -f conftest.$ac_objext +if { (eval echo "$as_me:$LINENO: \"$ac_compile\"") >&5 + (eval $ac_compile) 2>conftest.er1 + ac_status=$? + grep -v '^ *+' conftest.er1 >conftest.err + rm -f conftest.er1 + cat conftest.err >&5 + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } && + { ac_try='test -z "$ac_c_werror_flag" + || test ! -s conftest.err' + { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5 + (eval $ac_try) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; } && + { ac_try='test -s conftest.$ac_objext' + { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5 + (eval $ac_try) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; }; then + break +else + echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 + +fi +rm -f conftest.err conftest.$ac_objext conftest.$ac_ext +done +rm -f conftest* +if test -n "$ac_declaration"; then + echo '#ifdef __cplusplus' >>confdefs.h + echo $ac_declaration >>confdefs.h + echo '#endif' >>confdefs.h +fi + +else + echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 + +fi +rm -f conftest.err conftest.$ac_objext conftest.$ac_ext +ac_ext=c +ac_cpp='$CPP $CPPFLAGS' +ac_compile='$CC -c $CFLAGS $CPPFLAGS conftest.$ac_ext >&5' +ac_link='$CC -o conftest$ac_exeext $CFLAGS $CPPFLAGS $LDFLAGS conftest.$ac_ext $LIBS >&5' +ac_compiler_gnu=$ac_cv_c_compiler_gnu +DEPDIR="${am__leading_dot}deps" + + ac_config_commands="$ac_config_commands depfiles" + + +am_make=${MAKE-make} +cat > confinc << 'END' +am__doit: + @echo done +.PHONY: am__doit +END +# If we don't find an include directive, just comment out the code. +echo "$as_me:$LINENO: checking for style of include used by $am_make" >&5 +echo $ECHO_N "checking for style of include used by $am_make... $ECHO_C" >&6 +am__include="#" +am__quote= +_am_result=none +# First try GNU make style include. +echo "include confinc" > confmf +# We grep out `Entering directory' and `Leaving directory' +# messages which can occur if `w' ends up in MAKEFLAGS. +# In particular we don't look at `^make:' because GNU make might +# be invoked under some other name (usually "gmake"), in which +# case it prints its new name instead of `make'. +if test "`$am_make -s -f confmf 2> /dev/null | grep -v 'ing directory'`" = "done"; then + am__include=include + am__quote= + _am_result=GNU +fi +# Now try BSD make style include. +if test "$am__include" = "#"; then + echo '.include "confinc"' > confmf + if test "`$am_make -s -f confmf 2> /dev/null`" = "done"; then + am__include=.include + am__quote="\"" + _am_result=BSD + fi +fi + + +echo "$as_me:$LINENO: result: $_am_result" >&5 +echo "${ECHO_T}$_am_result" >&6 +rm -f confinc confmf + +# Check whether --enable-dependency-tracking or --disable-dependency-tracking was given. +if test "${enable_dependency_tracking+set}" = set; then + enableval="$enable_dependency_tracking" + +fi; +if test "x$enable_dependency_tracking" != xno; then + am_depcomp="$ac_aux_dir/depcomp" + AMDEPBACKSLASH='\' +fi + + +if test "x$enable_dependency_tracking" != xno; then + AMDEP_TRUE= + AMDEP_FALSE='#' +else + AMDEP_TRUE='#' + AMDEP_FALSE= +fi + + + + +depcc="$CC" am_compiler_list= + +echo "$as_me:$LINENO: checking dependency style of $depcc" >&5 +echo $ECHO_N "checking dependency style of $depcc... $ECHO_C" >&6 +if test "${am_cv_CC_dependencies_compiler_type+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + if test -z "$AMDEP_TRUE" && test -f "$am_depcomp"; then + # We make a subdir and do the tests there. Otherwise we can end up + # making bogus files that we don't know about and never remove. For + # instance it was reported that on HP-UX the gcc test will end up + # making a dummy file named `D' -- because `-MD' means `put the output + # in D'. + mkdir conftest.dir + # Copy depcomp to subdir because otherwise we won't find it if we're + # using a relative directory. + cp "$am_depcomp" conftest.dir + cd conftest.dir + # We will build objects and dependencies in a subdirectory because + # it helps to detect inapplicable dependency modes. For instance + # both Tru64's cc and ICC support -MD to output dependencies as a + # side effect of compilation, but ICC will put the dependencies in + # the current directory while Tru64 will put them in the object + # directory. + mkdir sub + + am_cv_CC_dependencies_compiler_type=none + if test "$am_compiler_list" = ""; then + am_compiler_list=`sed -n 's/^#*\([a-zA-Z0-9]*\))$/\1/p' < ./depcomp` + fi + for depmode in $am_compiler_list; do + # Setup a source with many dependencies, because some compilers + # like to wrap large dependency lists on column 80 (with \), and + # we should not choose a depcomp mode which is confused by this. + # + # We need to recreate these files for each test, as the compiler may + # overwrite some of them when testing with obscure command lines. + # This happens at least with the AIX C compiler. + : > sub/conftest.c + for i in 1 2 3 4 5 6; do + echo '#include "conftst'$i'.h"' >> sub/conftest.c + # Using `: > sub/conftst$i.h' creates only sub/conftst1.h with + # Solaris 8's {/usr,}/bin/sh. + touch sub/conftst$i.h + done + echo "${am__include} ${am__quote}sub/conftest.Po${am__quote}" > confmf + + case $depmode in + nosideeffect) + # after this tag, mechanisms are not by side-effect, so they'll + # only be used when explicitly requested + if test "x$enable_dependency_tracking" = xyes; then + continue + else + break + fi + ;; + none) break ;; + esac + # We check with `-c' and `-o' for the sake of the "dashmstdout" + # mode. It turns out that the SunPro C++ compiler does not properly + # handle `-M -o', and we need to detect this. + if depmode=$depmode \ + source=sub/conftest.c object=sub/conftest.${OBJEXT-o} \ + depfile=sub/conftest.Po tmpdepfile=sub/conftest.TPo \ + $SHELL ./depcomp $depcc -c -o sub/conftest.${OBJEXT-o} sub/conftest.c \ + >/dev/null 2>conftest.err && + grep sub/conftst6.h sub/conftest.Po > /dev/null 2>&1 && + grep sub/conftest.${OBJEXT-o} sub/conftest.Po > /dev/null 2>&1 && + ${MAKE-make} -s -f confmf > /dev/null 2>&1; then + # icc doesn't choke on unknown options, it will just issue warnings + # or remarks (even with -Werror). So we grep stderr for any message + # that says an option was ignored or not supported. + # When given -MP, icc 7.0 and 7.1 complain thusly: + # icc: Command line warning: ignoring option '-M'; no argument required + # The diagnosis changed in icc 8.0: + # icc: Command line remark: option '-MP' not supported + if (grep 'ignoring option' conftest.err || + grep 'not supported' conftest.err) >/dev/null 2>&1; then :; else + am_cv_CC_dependencies_compiler_type=$depmode + break + fi + fi + done + + cd .. + rm -rf conftest.dir +else + am_cv_CC_dependencies_compiler_type=none +fi + +fi +echo "$as_me:$LINENO: result: $am_cv_CC_dependencies_compiler_type" >&5 +echo "${ECHO_T}$am_cv_CC_dependencies_compiler_type" >&6 +CCDEPMODE=depmode=$am_cv_CC_dependencies_compiler_type + + + +if + test "x$enable_dependency_tracking" != xno \ + && test "$am_cv_CC_dependencies_compiler_type" = gcc3; then + am__fastdepCC_TRUE= + am__fastdepCC_FALSE='#' +else + am__fastdepCC_TRUE='#' + am__fastdepCC_FALSE= +fi + + + + + + +if test "x$GCC" != "xyes"; then + { { echo "$as_me:$LINENO: error: libgcc-math must be built with GCC" >&5 +echo "$as_me: error: libgcc-math must be built with GCC" >&2;} + { (exit 1); exit 1; }; } +fi +ac_ext=c +ac_cpp='$CPP $CPPFLAGS' +ac_compile='$CC -c $CFLAGS $CPPFLAGS conftest.$ac_ext >&5' +ac_link='$CC -o conftest$ac_exeext $CFLAGS $CPPFLAGS $LDFLAGS conftest.$ac_ext $LIBS >&5' +ac_compiler_gnu=$ac_cv_c_compiler_gnu +echo "$as_me:$LINENO: checking how to run the C preprocessor" >&5 +echo $ECHO_N "checking how to run the C preprocessor... $ECHO_C" >&6 +# On Suns, sometimes $CPP names a directory. +if test -n "$CPP" && test -d "$CPP"; then + CPP= +fi +if test -z "$CPP"; then + if test "${ac_cv_prog_CPP+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + # Double quotes because CPP needs to be expanded + for CPP in "$CC -E" "$CC -E -traditional-cpp" "/lib/cpp" + do + ac_preproc_ok=false +for ac_c_preproc_warn_flag in '' yes +do + # Use a header file that comes with gcc, so configuring glibc + # with a fresh cross-compiler works. + # Prefer to if __STDC__ is defined, since + # exists even on freestanding compilers. + # On the NeXT, cc -E runs the code through the compiler's parser, + # not just through cpp. "Syntax error" is here to catch this case. + cat >conftest.$ac_ext <<_ACEOF +/* confdefs.h. */ +_ACEOF +cat confdefs.h >>conftest.$ac_ext +cat >>conftest.$ac_ext <<_ACEOF +/* end confdefs.h. */ +#ifdef __STDC__ +# include +#else +# include +#endif + Syntax error +_ACEOF +if { (eval echo "$as_me:$LINENO: \"$ac_cpp conftest.$ac_ext\"") >&5 + (eval $ac_cpp conftest.$ac_ext) 2>conftest.er1 + ac_status=$? + grep -v '^ *+' conftest.er1 >conftest.err + rm -f conftest.er1 + cat conftest.err >&5 + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } >/dev/null; then + if test -s conftest.err; then + ac_cpp_err=$ac_c_preproc_warn_flag + ac_cpp_err=$ac_cpp_err$ac_c_werror_flag + else + ac_cpp_err= + fi +else + ac_cpp_err=yes +fi +if test -z "$ac_cpp_err"; then + : +else + echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 + + # Broken: fails on valid input. +continue +fi +rm -f conftest.err conftest.$ac_ext + + # OK, works on sane cases. Now check whether non-existent headers + # can be detected and how. + cat >conftest.$ac_ext <<_ACEOF +/* confdefs.h. */ +_ACEOF +cat confdefs.h >>conftest.$ac_ext +cat >>conftest.$ac_ext <<_ACEOF +/* end confdefs.h. */ +#include +_ACEOF +if { (eval echo "$as_me:$LINENO: \"$ac_cpp conftest.$ac_ext\"") >&5 + (eval $ac_cpp conftest.$ac_ext) 2>conftest.er1 + ac_status=$? + grep -v '^ *+' conftest.er1 >conftest.err + rm -f conftest.er1 + cat conftest.err >&5 + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } >/dev/null; then + if test -s conftest.err; then + ac_cpp_err=$ac_c_preproc_warn_flag + ac_cpp_err=$ac_cpp_err$ac_c_werror_flag + else + ac_cpp_err= + fi +else + ac_cpp_err=yes +fi +if test -z "$ac_cpp_err"; then + # Broken: success on invalid input. +continue +else + echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 + + # Passes both tests. +ac_preproc_ok=: +break +fi +rm -f conftest.err conftest.$ac_ext + +done +# Because of `break', _AC_PREPROC_IFELSE's cleaning code was skipped. +rm -f conftest.err conftest.$ac_ext +if $ac_preproc_ok; then + break +fi + + done + ac_cv_prog_CPP=$CPP + +fi + CPP=$ac_cv_prog_CPP +else + ac_cv_prog_CPP=$CPP +fi +echo "$as_me:$LINENO: result: $CPP" >&5 +echo "${ECHO_T}$CPP" >&6 +ac_preproc_ok=false +for ac_c_preproc_warn_flag in '' yes +do + # Use a header file that comes with gcc, so configuring glibc + # with a fresh cross-compiler works. + # Prefer to if __STDC__ is defined, since + # exists even on freestanding compilers. + # On the NeXT, cc -E runs the code through the compiler's parser, + # not just through cpp. "Syntax error" is here to catch this case. + cat >conftest.$ac_ext <<_ACEOF +/* confdefs.h. */ +_ACEOF +cat confdefs.h >>conftest.$ac_ext +cat >>conftest.$ac_ext <<_ACEOF +/* end confdefs.h. */ +#ifdef __STDC__ +# include +#else +# include +#endif + Syntax error +_ACEOF +if { (eval echo "$as_me:$LINENO: \"$ac_cpp conftest.$ac_ext\"") >&5 + (eval $ac_cpp conftest.$ac_ext) 2>conftest.er1 + ac_status=$? + grep -v '^ *+' conftest.er1 >conftest.err + rm -f conftest.er1 + cat conftest.err >&5 + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } >/dev/null; then + if test -s conftest.err; then + ac_cpp_err=$ac_c_preproc_warn_flag + ac_cpp_err=$ac_cpp_err$ac_c_werror_flag + else + ac_cpp_err= + fi +else + ac_cpp_err=yes +fi +if test -z "$ac_cpp_err"; then + : +else + echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 + + # Broken: fails on valid input. +continue +fi +rm -f conftest.err conftest.$ac_ext + + # OK, works on sane cases. Now check whether non-existent headers + # can be detected and how. + cat >conftest.$ac_ext <<_ACEOF +/* confdefs.h. */ +_ACEOF +cat confdefs.h >>conftest.$ac_ext +cat >>conftest.$ac_ext <<_ACEOF +/* end confdefs.h. */ +#include +_ACEOF +if { (eval echo "$as_me:$LINENO: \"$ac_cpp conftest.$ac_ext\"") >&5 + (eval $ac_cpp conftest.$ac_ext) 2>conftest.er1 + ac_status=$? + grep -v '^ *+' conftest.er1 >conftest.err + rm -f conftest.er1 + cat conftest.err >&5 + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } >/dev/null; then + if test -s conftest.err; then + ac_cpp_err=$ac_c_preproc_warn_flag + ac_cpp_err=$ac_cpp_err$ac_c_werror_flag + else + ac_cpp_err= + fi +else + ac_cpp_err=yes +fi +if test -z "$ac_cpp_err"; then + # Broken: success on invalid input. +continue +else + echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 + + # Passes both tests. +ac_preproc_ok=: +break +fi +rm -f conftest.err conftest.$ac_ext + +done +# Because of `break', _AC_PREPROC_IFELSE's cleaning code was skipped. +rm -f conftest.err conftest.$ac_ext +if $ac_preproc_ok; then + : +else + { { echo "$as_me:$LINENO: error: C preprocessor \"$CPP\" fails sanity check +See \`config.log' for more details." >&5 +echo "$as_me: error: C preprocessor \"$CPP\" fails sanity check +See \`config.log' for more details." >&2;} + { (exit 1); exit 1; }; } +fi + +ac_ext=c +ac_cpp='$CPP $CPPFLAGS' +ac_compile='$CC -c $CFLAGS $CPPFLAGS conftest.$ac_ext >&5' +ac_link='$CC -o conftest$ac_exeext $CFLAGS $CPPFLAGS $LDFLAGS conftest.$ac_ext $LIBS >&5' +ac_compiler_gnu=$ac_cv_c_compiler_gnu + +# By default we simply use the C compiler to build assembly code. + +test "${CCAS+set}" = set || CCAS=$CC +test "${CCASFLAGS+set}" = set || CCASFLAGS=$CFLAGS + + + + +echo "$as_me:$LINENO: checking whether hidden visibility is supported" >&5 +echo $ECHO_N "checking whether hidden visibility is supported... $ECHO_C" >&6 + +cat >conftest.$ac_ext <<_ACEOF +/* confdefs.h. */ +_ACEOF +cat confdefs.h >>conftest.$ac_ext +cat >>conftest.$ac_ext <<_ACEOF +/* end confdefs.h. */ + +void __attribute__((visibility ("hidden"))) bar (void) {} +int +main () +{ + + ; + return 0; +} +_ACEOF +rm -f conftest.$ac_objext +if { (eval echo "$as_me:$LINENO: \"$ac_compile\"") >&5 + (eval $ac_compile) 2>conftest.er1 + ac_status=$? + grep -v '^ *+' conftest.er1 >conftest.err + rm -f conftest.er1 + cat conftest.err >&5 + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } && + { ac_try='test -z "$ac_c_werror_flag" + || test ! -s conftest.err' + { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5 + (eval $ac_try) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; } && + { ac_try='test -s conftest.$ac_objext' + { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5 + (eval $ac_try) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; }; then + gccm_hidden=yes +else + echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 + +gccm_hidden=no +fi +rm -f conftest.err conftest.$ac_objext conftest.$ac_ext +echo "$as_me:$LINENO: result: $gccm_hidden" >&5 +echo "${ECHO_T}$gccm_hidden" >&6 +if test x$gccm_hidden = xyes; then + +cat >>confdefs.h <<\_ACEOF +#define HAVE_HIDDEN_VISIBILITY 1 +_ACEOF + +fi + +echo "$as_me:$LINENO: checking whether symbol versioning is supported" >&5 +echo $ECHO_N "checking whether symbol versioning is supported... $ECHO_C" >&6 +cat > conftest.map <conftest.$ac_ext <<_ACEOF +/* confdefs.h. */ +_ACEOF +cat confdefs.h >>conftest.$ac_ext +cat >>conftest.$ac_ext <<_ACEOF +/* end confdefs.h. */ +int foo; +int +main () +{ + + ; + return 0; +} +_ACEOF +rm -f conftest.$ac_objext conftest$ac_exeext +if { (eval echo "$as_me:$LINENO: \"$ac_link\"") >&5 + (eval $ac_link) 2>conftest.er1 + ac_status=$? + grep -v '^ *+' conftest.er1 >conftest.err + rm -f conftest.er1 + cat conftest.err >&5 + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } && + { ac_try='test -z "$ac_c_werror_flag" + || test ! -s conftest.err' + { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5 + (eval $ac_try) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; } && + { ac_try='test -s conftest$ac_exeext' + { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5 + (eval $ac_try) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; }; then + gccm_use_symver=yes +else + echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 + +gccm_use_symver=no +fi +rm -f conftest.err conftest.$ac_objext \ + conftest$ac_exeext conftest.$ac_ext +LDFLAGS="$save_LDFLAGS" +echo "$as_me:$LINENO: result: $gccm_use_symver" >&5 +echo "${ECHO_T}$gccm_use_symver" >&6 + + +if test "x$gccm_use_symver" = xyes; then + LIBGCCM_USE_SYMVER_TRUE= + LIBGCCM_USE_SYMVER_FALSE='#' +else + LIBGCCM_USE_SYMVER_TRUE='#' + LIBGCCM_USE_SYMVER_FALSE= +fi + + +echo "$as_me:$LINENO: checking whether we are a 32bit target" >&5 +echo $ECHO_N "checking whether we are a 32bit target... $ECHO_C" >&6 +save_CFLAGS="$CFLAGS" +CFLAGS="-O2" +cat >conftest.$ac_ext <<_ACEOF +/* confdefs.h. */ +_ACEOF +cat confdefs.h >>conftest.$ac_ext +cat >>conftest.$ac_ext <<_ACEOF +/* end confdefs.h. */ + +int +main () +{ + +if (sizeof(int) == 4 && sizeof(long) == 4 && sizeof(void *) == 4) + ; +else + undefined_function (); + + ; + return 0; +} +_ACEOF +rm -f conftest.$ac_objext conftest$ac_exeext +if { (eval echo "$as_me:$LINENO: \"$ac_link\"") >&5 + (eval $ac_link) 2>conftest.er1 + ac_status=$? + grep -v '^ *+' conftest.er1 >conftest.err + rm -f conftest.er1 + cat conftest.err >&5 + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } && + { ac_try='test -z "$ac_c_werror_flag" + || test ! -s conftest.err' + { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5 + (eval $ac_try) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; } && + { ac_try='test -s conftest$ac_exeext' + { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5 + (eval $ac_try) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; }; then + target_ilp32=yes +else + echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 + +target_ilp32=no +fi +rm -f conftest.err conftest.$ac_objext \ + conftest$ac_exeext conftest.$ac_ext +CFLAGS="$save_CFLAGS" + + +if test "x$target_ilp32" = xyes; then + TARGET_ILP32_TRUE= + TARGET_ILP32_FALSE='#' +else + TARGET_ILP32_TRUE='#' + TARGET_ILP32_FALSE= +fi + + + +# Check whether --enable-shared or --disable-shared was given. +if test "${enable_shared+set}" = set; then + enableval="$enable_shared" + p=${PACKAGE-default} +case $enableval in +yes) enable_shared=yes ;; +no) enable_shared=no ;; +*) + enable_shared=no + # Look at the argument we got. We use all the common list separators. + IFS="${IFS= }"; ac_save_ifs="$IFS"; IFS="${IFS}:," + for pkg in $enableval; do + if test "X$pkg" = "X$p"; then + enable_shared=yes + fi + done + IFS="$ac_save_ifs" + ;; +esac +else + enable_shared=yes +fi; +# Check whether --enable-static or --disable-static was given. +if test "${enable_static+set}" = set; then + enableval="$enable_static" + p=${PACKAGE-default} +case $enableval in +yes) enable_static=yes ;; +no) enable_static=no ;; +*) + enable_static=no + # Look at the argument we got. We use all the common list separators. + IFS="${IFS= }"; ac_save_ifs="$IFS"; IFS="${IFS}:," + for pkg in $enableval; do + if test "X$pkg" = "X$p"; then + enable_static=yes + fi + done + IFS="$ac_save_ifs" + ;; +esac +else + enable_static=yes +fi; +# Check whether --enable-fast-install or --disable-fast-install was given. +if test "${enable_fast_install+set}" = set; then + enableval="$enable_fast_install" + p=${PACKAGE-default} +case $enableval in +yes) enable_fast_install=yes ;; +no) enable_fast_install=no ;; +*) + enable_fast_install=no + # Look at the argument we got. We use all the common list separators. + IFS="${IFS= }"; ac_save_ifs="$IFS"; IFS="${IFS}:," + for pkg in $enableval; do + if test "X$pkg" = "X$p"; then + enable_fast_install=yes + fi + done + IFS="$ac_save_ifs" + ;; +esac +else + enable_fast_install=yes +fi; + +# Check whether --with-gnu-ld or --without-gnu-ld was given. +if test "${with_gnu_ld+set}" = set; then + withval="$with_gnu_ld" + test "$withval" = no || with_gnu_ld=yes +else + with_gnu_ld=no +fi; +ac_prog=ld +if test "$GCC" = yes; then + # Check if gcc -print-prog-name=ld gives a path. + echo "$as_me:$LINENO: checking for ld used by GCC" >&5 +echo $ECHO_N "checking for ld used by GCC... $ECHO_C" >&6 + case $host in + *-*-mingw*) + # gcc leaves a trailing carriage return which upsets mingw + ac_prog=`($CC -print-prog-name=ld) 2>&5 | tr -d '\015'` ;; + *) + ac_prog=`($CC -print-prog-name=ld) 2>&5` ;; + esac + case $ac_prog in + # Accept absolute paths. + [\\/]* | [A-Za-z]:[\\/]*) + re_direlt='/[^/][^/]*/\.\./' + # Canonicalize the path of ld + ac_prog=`echo $ac_prog| sed 's%\\\\%/%g'` + while echo $ac_prog | grep "$re_direlt" > /dev/null 2>&1; do + ac_prog=`echo $ac_prog| sed "s%$re_direlt%/%"` + done + test -z "$LD" && LD="$ac_prog" + ;; + "") + # If it fails, then pretend we aren't using GCC. + ac_prog=ld + ;; + *) + # If it is relative, then search for the first ld in PATH. + with_gnu_ld=unknown + ;; + esac +elif test "$with_gnu_ld" = yes; then + echo "$as_me:$LINENO: checking for GNU ld" >&5 +echo $ECHO_N "checking for GNU ld... $ECHO_C" >&6 +else + echo "$as_me:$LINENO: checking for non-GNU ld" >&5 +echo $ECHO_N "checking for non-GNU ld... $ECHO_C" >&6 +fi +if test "${lt_cv_path_LD+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + if test -z "$LD"; then + IFS="${IFS= }"; ac_save_ifs="$IFS"; IFS="${IFS}${PATH_SEPARATOR-:}" + for ac_dir in $PATH; do + test -z "$ac_dir" && ac_dir=. + if test -f "$ac_dir/$ac_prog" || test -f "$ac_dir/$ac_prog$ac_exeext"; then + lt_cv_path_LD="$ac_dir/$ac_prog" + # Check to see if the program is GNU ld. I'd rather use --version, + # but apparently some GNU ld's only accept -v. + # Break only if it was the GNU/non-GNU ld that we prefer. + if "$lt_cv_path_LD" -v 2>&1 < /dev/null | egrep '(GNU|with BFD)' > /dev/null; then + test "$with_gnu_ld" != no && break + else + test "$with_gnu_ld" != yes && break + fi + fi + done + IFS="$ac_save_ifs" +else + lt_cv_path_LD="$LD" # Let the user override the test with a path. +fi +fi + +LD="$lt_cv_path_LD" +if test -n "$LD"; then + echo "$as_me:$LINENO: result: $LD" >&5 +echo "${ECHO_T}$LD" >&6 +else + echo "$as_me:$LINENO: result: no" >&5 +echo "${ECHO_T}no" >&6 +fi +test -z "$LD" && { { echo "$as_me:$LINENO: error: no acceptable ld found in \$PATH" >&5 +echo "$as_me: error: no acceptable ld found in \$PATH" >&2;} + { (exit 1); exit 1; }; } +echo "$as_me:$LINENO: checking if the linker ($LD) is GNU ld" >&5 +echo $ECHO_N "checking if the linker ($LD) is GNU ld... $ECHO_C" >&6 +if test "${lt_cv_prog_gnu_ld+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + # I'd rather use --version here, but apparently some GNU ld's only accept -v. +if $LD -v 2>&1 &5; then + lt_cv_prog_gnu_ld=yes +else + lt_cv_prog_gnu_ld=no +fi +fi +echo "$as_me:$LINENO: result: $lt_cv_prog_gnu_ld" >&5 +echo "${ECHO_T}$lt_cv_prog_gnu_ld" >&6 +with_gnu_ld=$lt_cv_prog_gnu_ld + + +echo "$as_me:$LINENO: checking for $LD option to reload object files" >&5 +echo $ECHO_N "checking for $LD option to reload object files... $ECHO_C" >&6 +if test "${lt_cv_ld_reload_flag+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + lt_cv_ld_reload_flag='-r' +fi +echo "$as_me:$LINENO: result: $lt_cv_ld_reload_flag" >&5 +echo "${ECHO_T}$lt_cv_ld_reload_flag" >&6 +reload_flag=$lt_cv_ld_reload_flag +test -n "$reload_flag" && reload_flag=" $reload_flag" + +echo "$as_me:$LINENO: checking for BSD-compatible nm" >&5 +echo $ECHO_N "checking for BSD-compatible nm... $ECHO_C" >&6 +if test "${lt_cv_path_NM+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + if test -n "$NM"; then + # Let the user override the test. + lt_cv_path_NM="$NM" +else + IFS="${IFS= }"; ac_save_ifs="$IFS"; IFS="${IFS}${PATH_SEPARATOR-:}" + for ac_dir in $PATH /usr/ccs/bin /usr/ucb /bin; do + test -z "$ac_dir" && ac_dir=. + tmp_nm=$ac_dir/${ac_tool_prefix}nm + if test -f $tmp_nm || test -f $tmp_nm$ac_exeext ; then + # Check to see if the nm accepts a BSD-compat flag. + # Adding the `sed 1q' prevents false positives on HP-UX, which says: + # nm: unknown option "B" ignored + # Tru64's nm complains that /dev/null is an invalid object file + if ($tmp_nm -B /dev/null 2>&1 | sed '1q'; exit 0) | egrep '(/dev/null|Invalid file or object type)' >/dev/null; then + lt_cv_path_NM="$tmp_nm -B" + break + elif ($tmp_nm -p /dev/null 2>&1 | sed '1q'; exit 0) | egrep /dev/null >/dev/null; then + lt_cv_path_NM="$tmp_nm -p" + break + else + lt_cv_path_NM=${lt_cv_path_NM="$tmp_nm"} # keep the first match, but + continue # so that we can try to find one that supports BSD flags + fi + fi + done + IFS="$ac_save_ifs" + test -z "$lt_cv_path_NM" && lt_cv_path_NM=nm +fi +fi + +NM="$lt_cv_path_NM" +echo "$as_me:$LINENO: result: $NM" >&5 +echo "${ECHO_T}$NM" >&6 + +echo "$as_me:$LINENO: checking whether ln -s works" >&5 +echo $ECHO_N "checking whether ln -s works... $ECHO_C" >&6 +LN_S=$as_ln_s +if test "$LN_S" = "ln -s"; then + echo "$as_me:$LINENO: result: yes" >&5 +echo "${ECHO_T}yes" >&6 +else + echo "$as_me:$LINENO: result: no, using $LN_S" >&5 +echo "${ECHO_T}no, using $LN_S" >&6 +fi + +echo "$as_me:$LINENO: checking how to recognise dependant libraries" >&5 +echo $ECHO_N "checking how to recognise dependant libraries... $ECHO_C" >&6 +if test "${lt_cv_deplibs_check_method+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + lt_cv_file_magic_cmd='$MAGIC_CMD' +lt_cv_file_magic_test_file= +lt_cv_deplibs_check_method='unknown' +# Need to set the preceding variable on all platforms that support +# interlibrary dependencies. +# 'none' -- dependencies not supported. +# `unknown' -- same as none, but documents that we really don't know. +# 'pass_all' -- all dependencies passed with no checks. +# 'test_compile' -- check by making test program. +# 'file_magic [regex]' -- check by looking for files in library path +# which responds to the $file_magic_cmd with a given egrep regex. +# If you have `file' or equivalent on your system and you're not sure +# whether `pass_all' will *always* work, you probably want this one. + +case $host_os in +aix*) + lt_cv_deplibs_check_method=pass_all + ;; + +beos*) + lt_cv_deplibs_check_method=pass_all + ;; + +bsdi4*) + lt_cv_deplibs_check_method='file_magic ELF [0-9][0-9]*-bit [ML]SB (shared object|dynamic lib)' + lt_cv_file_magic_cmd='/usr/bin/file -L' + lt_cv_file_magic_test_file=/shlib/libc.so + ;; + +cygwin* | mingw* |pw32*) + lt_cv_deplibs_check_method='file_magic file format pei*-i386(.*architecture: i386)?' + lt_cv_file_magic_cmd='$OBJDUMP -f' + ;; + +darwin* | rhapsody*) + # this will be overwritten by pass_all, but leave it in just in case + lt_cv_deplibs_check_method='file_magic Mach-O dynamically linked shared library' + lt_cv_file_magic_cmd='/usr/bin/file -L' + case "$host_os" in + rhapsody* | darwin1.012) + lt_cv_file_magic_test_file='/System/Library/Frameworks/System.framework/System' + ;; + *) # Darwin 1.3 on + lt_cv_file_magic_test_file='/usr/lib/libSystem.dylib' + ;; + esac + lt_cv_deplibs_check_method=pass_all + ;; + +freebsd* | kfreebsd*-gnu) + if echo __ELF__ | $CC -E - | grep __ELF__ > /dev/null; then + case $host_cpu in + i*86 ) + # Not sure whether the presence of OpenBSD here was a mistake. + # Let's accept both of them until this is cleared up. + lt_cv_deplibs_check_method='file_magic (FreeBSD|OpenBSD)/i[3-9]86 (compact )?demand paged shared library' + lt_cv_file_magic_cmd=/usr/bin/file + lt_cv_file_magic_test_file=`echo /usr/lib/libc.so.*` + ;; + esac + else + lt_cv_deplibs_check_method=pass_all + fi + ;; + +gnu*) + lt_cv_deplibs_check_method=pass_all + ;; + +hpux10.20*|hpux11*) + case $host_cpu in + hppa*) + lt_cv_deplibs_check_method='file_magic (s[0-9][0-9][0-9]|PA-RISC[0-9].[0-9]) shared library' + lt_cv_file_magic_cmd=/usr/bin/file + lt_cv_file_magic_test_file=/usr/lib/libc.sl + ;; + ia64*) + lt_cv_deplibs_check_method='file_magic (s[0-9][0-9][0-9]|ELF-[0-9][0-9]) shared object file - IA64' + lt_cv_file_magic_cmd=/usr/bin/file + lt_cv_file_magic_test_file=/usr/lib/hpux32/libc.so + ;; + esac + ;; + +irix5* | irix6*) + case $host_os in + irix5*) + # this will be overridden with pass_all, but let us keep it just in case + lt_cv_deplibs_check_method="file_magic ELF 32-bit MSB dynamic lib MIPS - version 1" + ;; + *) + case $LD in + *-32|*"-32 ") libmagic=32-bit;; + *-n32|*"-n32 ") libmagic=N32;; + *-64|*"-64 ") libmagic=64-bit;; + *) libmagic=never-match;; + esac + # this will be overridden with pass_all, but let us keep it just in case + lt_cv_deplibs_check_method="file_magic ELF ${libmagic} MSB mips-[1234] dynamic lib MIPS - version 1" + ;; + esac + lt_cv_file_magic_test_file=`echo /lib${libsuff}/libc.so*` + lt_cv_deplibs_check_method=pass_all + ;; + +# This must be Linux ELF. +linux-gnu*) + lt_cv_deplibs_check_method=pass_all + ;; + +netbsd* | knetbsd*-gnu) + if echo __ELF__ | $CC -E - | grep __ELF__ > /dev/null; then + lt_cv_deplibs_check_method='match_pattern /lib[^/\.]+\.so\.[0-9]+\.[0-9]+$' + else + lt_cv_deplibs_check_method='match_pattern /lib[^/\.]+\.so$' + fi + ;; + +newsos6) + lt_cv_deplibs_check_method='file_magic ELF [0-9][0-9]*-bit [ML]SB (executable|dynamic lib)' + lt_cv_file_magic_cmd=/usr/bin/file + lt_cv_file_magic_test_file=/usr/lib/libnls.so + ;; + +osf3* | osf4* | osf5*) + # this will be overridden with pass_all, but let us keep it just in case + lt_cv_deplibs_check_method='file_magic COFF format alpha shared library' + lt_cv_file_magic_test_file=/shlib/libc.so + lt_cv_deplibs_check_method=pass_all + ;; + +sco3.2v5*) + lt_cv_deplibs_check_method=pass_all + ;; + +solaris*) + lt_cv_deplibs_check_method=pass_all + lt_cv_file_magic_test_file=/lib/libc.so + ;; + +sysv5uw[78]* | sysv4*uw2*) + lt_cv_deplibs_check_method=pass_all + ;; + +sysv4 | sysv4.2uw2* | sysv4.3* | sysv5*) + case $host_vendor in + ncr) + lt_cv_deplibs_check_method=pass_all + ;; + motorola) + lt_cv_deplibs_check_method='file_magic ELF [0-9][0-9]*-bit [ML]SB (shared object|dynamic lib) M[0-9][0-9]* Version [0-9]' + lt_cv_file_magic_test_file=`echo /usr/lib/libc.so*` + ;; + esac + ;; +esac + +fi +echo "$as_me:$LINENO: result: $lt_cv_deplibs_check_method" >&5 +echo "${ECHO_T}$lt_cv_deplibs_check_method" >&6 +file_magic_cmd=$lt_cv_file_magic_cmd +deplibs_check_method=$lt_cv_deplibs_check_method + + + +# Autoconf 2.13's AC_OBJEXT and AC_EXEEXT macros only works for C compilers! + +# find the maximum length of command line arguments +echo "$as_me:$LINENO: checking the maximum length of command line arguments" >&5 +echo $ECHO_N "checking the maximum length of command line arguments... $ECHO_C" >&6 +if test "${lt_cv_sys_max_cmd_len+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + i=0 + teststring="ABCD" + + case $build_os in + msdosdjgpp*) + # On DJGPP, this test can blow up pretty badly due to problems in libc + # (any single argument exceeding 2000 bytes causes a buffer overrun + # during glob expansion). Even if it were fixed, the result of this + # check would be larger than it should be. + lt_cv_sys_max_cmd_len=12288; # 12K is about right + ;; + + cygwin* | mingw*) + # On Win9x/ME, this test blows up -- it succeeds, but takes + # about 5 minutes as the teststring grows exponentially. + # Worse, since 9x/ME are not pre-emptively multitasking, + # you end up with a "frozen" computer, even though with patience + # the test eventually succeeds (with a max line length of 256k). + # Instead, let's just punt: use the minimum linelength reported by + # all of the supported platforms: 8192 (on NT/2K/XP). + lt_cv_sys_max_cmd_len=8192; + ;; + + amigaos*) + # On AmigaOS with pdksh, this test takes hours, literally. + # So we just punt and use a minimum line length of 8192. + lt_cv_sys_max_cmd_len=8192; + ;; + + netbsd* | freebsd* | openbsd* | darwin* | dragonfly*) + # This has been around since 386BSD, at least. Likely further. + if test -x /sbin/sysctl; then + lt_cv_sys_max_cmd_len=`/sbin/sysctl -n kern.argmax` + elif test -x /usr/sbin/sysctl; then + lt_cv_sys_max_cmd_len=`/usr/sbin/sysctl -n kern.argmax` + else + lt_cv_sys_max_cmd_len=65536 # usable default for *BSD + fi + # And add a safety zone + lt_cv_sys_max_cmd_len=`expr $lt_cv_sys_max_cmd_len \/ 4` + lt_cv_sys_max_cmd_len=`expr $lt_cv_sys_max_cmd_len \* 3` + ;; + esac + +fi + +if test -n "$lt_cv_sys_max_cmd_len" ; then + echo "$as_me:$LINENO: result: $lt_cv_sys_max_cmd_len" >&5 +echo "${ECHO_T}$lt_cv_sys_max_cmd_len" >&6 +else + echo "$as_me:$LINENO: result: none" >&5 +echo "${ECHO_T}none" >&6 +fi + + +# Only perform the check for file, if the check method requires it +case $deplibs_check_method in +file_magic*) + if test "$file_magic_cmd" = '$MAGIC_CMD'; then + echo "$as_me:$LINENO: checking for ${ac_tool_prefix}file" >&5 +echo $ECHO_N "checking for ${ac_tool_prefix}file... $ECHO_C" >&6 +if test "${lt_cv_path_MAGIC_CMD+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + case $MAGIC_CMD in + /*) + lt_cv_path_MAGIC_CMD="$MAGIC_CMD" # Let the user override the test with a path. + ;; + ?:/*) + lt_cv_path_MAGIC_CMD="$MAGIC_CMD" # Let the user override the test with a dos path. + ;; + *) + ac_save_MAGIC_CMD="$MAGIC_CMD" + IFS="${IFS= }"; ac_save_ifs="$IFS"; IFS=":" + ac_dummy="/usr/bin:$PATH" + for ac_dir in $ac_dummy; do + test -z "$ac_dir" && ac_dir=. + if test -f $ac_dir/${ac_tool_prefix}file; then + lt_cv_path_MAGIC_CMD="$ac_dir/${ac_tool_prefix}file" + if test -n "$file_magic_test_file"; then + case $deplibs_check_method in + "file_magic "*) + file_magic_regex="`expr \"$deplibs_check_method\" : \"file_magic \(.*\)\"`" + MAGIC_CMD="$lt_cv_path_MAGIC_CMD" + if eval $file_magic_cmd \$file_magic_test_file 2> /dev/null | + egrep "$file_magic_regex" > /dev/null; then + : + else + cat <&2 + +*** Warning: the command libtool uses to detect shared libraries, +*** $file_magic_cmd, produces output that libtool cannot recognize. +*** The result is that libtool may fail to recognize shared libraries +*** as such. This will affect the creation of libtool libraries that +*** depend on shared libraries, but programs linked with such libtool +*** libraries will work regardless of this problem. Nevertheless, you +*** may want to report the problem to your system manager and/or to +*** bug-libtool@gnu.org + +EOF + fi ;; + esac + fi + break + fi + done + IFS="$ac_save_ifs" + MAGIC_CMD="$ac_save_MAGIC_CMD" + ;; +esac +fi + +MAGIC_CMD="$lt_cv_path_MAGIC_CMD" +if test -n "$MAGIC_CMD"; then + echo "$as_me:$LINENO: result: $MAGIC_CMD" >&5 +echo "${ECHO_T}$MAGIC_CMD" >&6 +else + echo "$as_me:$LINENO: result: no" >&5 +echo "${ECHO_T}no" >&6 +fi + +if test -z "$lt_cv_path_MAGIC_CMD"; then + if test -n "$ac_tool_prefix"; then + echo "$as_me:$LINENO: checking for file" >&5 +echo $ECHO_N "checking for file... $ECHO_C" >&6 +if test "${lt_cv_path_MAGIC_CMD+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + case $MAGIC_CMD in + /*) + lt_cv_path_MAGIC_CMD="$MAGIC_CMD" # Let the user override the test with a path. + ;; + ?:/*) + lt_cv_path_MAGIC_CMD="$MAGIC_CMD" # Let the user override the test with a dos path. + ;; + *) + ac_save_MAGIC_CMD="$MAGIC_CMD" + IFS="${IFS= }"; ac_save_ifs="$IFS"; IFS=":" + ac_dummy="/usr/bin:$PATH" + for ac_dir in $ac_dummy; do + test -z "$ac_dir" && ac_dir=. + if test -f $ac_dir/file; then + lt_cv_path_MAGIC_CMD="$ac_dir/file" + if test -n "$file_magic_test_file"; then + case $deplibs_check_method in + "file_magic "*) + file_magic_regex="`expr \"$deplibs_check_method\" : \"file_magic \(.*\)\"`" + MAGIC_CMD="$lt_cv_path_MAGIC_CMD" + if eval $file_magic_cmd \$file_magic_test_file 2> /dev/null | + egrep "$file_magic_regex" > /dev/null; then + : + else + cat <&2 + +*** Warning: the command libtool uses to detect shared libraries, +*** $file_magic_cmd, produces output that libtool cannot recognize. +*** The result is that libtool may fail to recognize shared libraries +*** as such. This will affect the creation of libtool libraries that +*** depend on shared libraries, but programs linked with such libtool +*** libraries will work regardless of this problem. Nevertheless, you +*** may want to report the problem to your system manager and/or to +*** bug-libtool@gnu.org + +EOF + fi ;; + esac + fi + break + fi + done + IFS="$ac_save_ifs" + MAGIC_CMD="$ac_save_MAGIC_CMD" + ;; +esac +fi + +MAGIC_CMD="$lt_cv_path_MAGIC_CMD" +if test -n "$MAGIC_CMD"; then + echo "$as_me:$LINENO: result: $MAGIC_CMD" >&5 +echo "${ECHO_T}$MAGIC_CMD" >&6 +else + echo "$as_me:$LINENO: result: no" >&5 +echo "${ECHO_T}no" >&6 +fi + + else + MAGIC_CMD=: + fi +fi + + fi + ;; +esac + +if test -n "$ac_tool_prefix"; then + # Extract the first word of "${ac_tool_prefix}ranlib", so it can be a program name with args. +set dummy ${ac_tool_prefix}ranlib; ac_word=$2 +echo "$as_me:$LINENO: checking for $ac_word" >&5 +echo $ECHO_N "checking for $ac_word... $ECHO_C" >&6 +if test "${ac_cv_prog_RANLIB+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + if test -n "$RANLIB"; then + ac_cv_prog_RANLIB="$RANLIB" # Let the user override the test. +else +as_save_IFS=$IFS; IFS=$PATH_SEPARATOR +for as_dir in $PATH +do + IFS=$as_save_IFS + test -z "$as_dir" && as_dir=. + for ac_exec_ext in '' $ac_executable_extensions; do + if $as_executable_p "$as_dir/$ac_word$ac_exec_ext"; then + ac_cv_prog_RANLIB="${ac_tool_prefix}ranlib" + echo "$as_me:$LINENO: found $as_dir/$ac_word$ac_exec_ext" >&5 + break 2 + fi +done +done + +fi +fi +RANLIB=$ac_cv_prog_RANLIB +if test -n "$RANLIB"; then + echo "$as_me:$LINENO: result: $RANLIB" >&5 +echo "${ECHO_T}$RANLIB" >&6 +else + echo "$as_me:$LINENO: result: no" >&5 +echo "${ECHO_T}no" >&6 +fi + +fi +if test -z "$ac_cv_prog_RANLIB"; then + ac_ct_RANLIB=$RANLIB + # Extract the first word of "ranlib", so it can be a program name with args. +set dummy ranlib; ac_word=$2 +echo "$as_me:$LINENO: checking for $ac_word" >&5 +echo $ECHO_N "checking for $ac_word... $ECHO_C" >&6 +if test "${ac_cv_prog_ac_ct_RANLIB+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + if test -n "$ac_ct_RANLIB"; then + ac_cv_prog_ac_ct_RANLIB="$ac_ct_RANLIB" # Let the user override the test. +else +as_save_IFS=$IFS; IFS=$PATH_SEPARATOR +for as_dir in $PATH +do + IFS=$as_save_IFS + test -z "$as_dir" && as_dir=. + for ac_exec_ext in '' $ac_executable_extensions; do + if $as_executable_p "$as_dir/$ac_word$ac_exec_ext"; then + ac_cv_prog_ac_ct_RANLIB="ranlib" + echo "$as_me:$LINENO: found $as_dir/$ac_word$ac_exec_ext" >&5 + break 2 + fi +done +done + + test -z "$ac_cv_prog_ac_ct_RANLIB" && ac_cv_prog_ac_ct_RANLIB=":" +fi +fi +ac_ct_RANLIB=$ac_cv_prog_ac_ct_RANLIB +if test -n "$ac_ct_RANLIB"; then + echo "$as_me:$LINENO: result: $ac_ct_RANLIB" >&5 +echo "${ECHO_T}$ac_ct_RANLIB" >&6 +else + echo "$as_me:$LINENO: result: no" >&5 +echo "${ECHO_T}no" >&6 +fi + + RANLIB=$ac_ct_RANLIB +else + RANLIB="$ac_cv_prog_RANLIB" +fi + +if test -n "$ac_tool_prefix"; then + # Extract the first word of "${ac_tool_prefix}strip", so it can be a program name with args. +set dummy ${ac_tool_prefix}strip; ac_word=$2 +echo "$as_me:$LINENO: checking for $ac_word" >&5 +echo $ECHO_N "checking for $ac_word... $ECHO_C" >&6 +if test "${ac_cv_prog_STRIP+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + if test -n "$STRIP"; then + ac_cv_prog_STRIP="$STRIP" # Let the user override the test. +else +as_save_IFS=$IFS; IFS=$PATH_SEPARATOR +for as_dir in $PATH +do + IFS=$as_save_IFS + test -z "$as_dir" && as_dir=. + for ac_exec_ext in '' $ac_executable_extensions; do + if $as_executable_p "$as_dir/$ac_word$ac_exec_ext"; then + ac_cv_prog_STRIP="${ac_tool_prefix}strip" + echo "$as_me:$LINENO: found $as_dir/$ac_word$ac_exec_ext" >&5 + break 2 + fi +done +done + +fi +fi +STRIP=$ac_cv_prog_STRIP +if test -n "$STRIP"; then + echo "$as_me:$LINENO: result: $STRIP" >&5 +echo "${ECHO_T}$STRIP" >&6 +else + echo "$as_me:$LINENO: result: no" >&5 +echo "${ECHO_T}no" >&6 +fi + +fi +if test -z "$ac_cv_prog_STRIP"; then + ac_ct_STRIP=$STRIP + # Extract the first word of "strip", so it can be a program name with args. +set dummy strip; ac_word=$2 +echo "$as_me:$LINENO: checking for $ac_word" >&5 +echo $ECHO_N "checking for $ac_word... $ECHO_C" >&6 +if test "${ac_cv_prog_ac_ct_STRIP+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + if test -n "$ac_ct_STRIP"; then + ac_cv_prog_ac_ct_STRIP="$ac_ct_STRIP" # Let the user override the test. +else +as_save_IFS=$IFS; IFS=$PATH_SEPARATOR +for as_dir in $PATH +do + IFS=$as_save_IFS + test -z "$as_dir" && as_dir=. + for ac_exec_ext in '' $ac_executable_extensions; do + if $as_executable_p "$as_dir/$ac_word$ac_exec_ext"; then + ac_cv_prog_ac_ct_STRIP="strip" + echo "$as_me:$LINENO: found $as_dir/$ac_word$ac_exec_ext" >&5 + break 2 + fi +done +done + + test -z "$ac_cv_prog_ac_ct_STRIP" && ac_cv_prog_ac_ct_STRIP=":" +fi +fi +ac_ct_STRIP=$ac_cv_prog_ac_ct_STRIP +if test -n "$ac_ct_STRIP"; then + echo "$as_me:$LINENO: result: $ac_ct_STRIP" >&5 +echo "${ECHO_T}$ac_ct_STRIP" >&6 +else + echo "$as_me:$LINENO: result: no" >&5 +echo "${ECHO_T}no" >&6 +fi + + STRIP=$ac_ct_STRIP +else + STRIP="$ac_cv_prog_STRIP" +fi + + +# Check for any special flags to pass to ltconfig. +libtool_flags="--cache-file=$cache_file" +test "$enable_shared" = no && libtool_flags="$libtool_flags --disable-shared" +test "$enable_static" = no && libtool_flags="$libtool_flags --disable-static" +test "$enable_fast_install" = no && libtool_flags="$libtool_flags --disable-fast-install" +test "$GCC" = yes && libtool_flags="$libtool_flags --with-gcc" +test "$lt_cv_prog_gnu_ld" = yes && libtool_flags="$libtool_flags --with-gnu-ld" + + +# Check whether --enable-libtool-lock or --disable-libtool-lock was given. +if test "${enable_libtool_lock+set}" = set; then + enableval="$enable_libtool_lock" + +fi; +test "x$enable_libtool_lock" = xno && libtool_flags="$libtool_flags --disable-lock" +test x"$silent" = xyes && libtool_flags="$libtool_flags --silent" + + +# Check whether --with-pic or --without-pic was given. +if test "${with_pic+set}" = set; then + withval="$with_pic" + pic_mode="$withval" +else + pic_mode=default +fi; +test x"$pic_mode" = xyes && libtool_flags="$libtool_flags --prefer-pic" +test x"$pic_mode" = xno && libtool_flags="$libtool_flags --prefer-non-pic" + +# Some flags need to be propagated to the compiler or linker for good +# libtool support. +case $host in +*-*-irix6*) + # Find out which ABI we are using. + echo '#line 4250 "configure"' > conftest.$ac_ext + if { (eval echo "$as_me:$LINENO: \"$ac_compile\"") >&5 + (eval $ac_compile) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; then + if test "$lt_cv_prog_gnu_ld" = yes; then + case `/usr/bin/file conftest.$ac_objext` in + *32-bit*) + LD="${LD-ld} -melf32bsmip" + ;; + *N32*) + LD="${LD-ld} -melf32bmipn32" + ;; + *64-bit*) + LD="${LD-ld} -melf64bmip" + ;; + esac + else + case `/usr/bin/file conftest.$ac_objext` in + *32-bit*) + LD="${LD-ld} -32" + ;; + *N32*) + LD="${LD-ld} -n32" + ;; + *64-bit*) + LD="${LD-ld} -64" + ;; + esac + fi + fi + rm -rf conftest* + ;; + +ia64-*-hpux*) + # Find out which ABI we are using. + echo 'int i;' > conftest.$ac_ext + if { (eval echo "$as_me:$LINENO: \"$ac_compile\"") >&5 + (eval $ac_compile) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; then + case "`/usr/bin/file conftest.o`" in + *ELF-32*) + HPUX_IA64_MODE="32" + ;; + *ELF-64*) + HPUX_IA64_MODE="64" + ;; + esac + fi + rm -rf conftest* + ;; + +x86_64-*linux*|ppc*-*linux*|powerpc*-*linux*|s390*-*linux*|sparc*-*linux*) + # Find out which ABI we are using. + echo 'int i;' > conftest.$ac_ext + if { (eval echo "$as_me:$LINENO: \"$ac_compile\"") >&5 + (eval $ac_compile) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; then + case "`/usr/bin/file conftest.o`" in + *32-bit*) + case $host in + x86_64-*linux*) + LD="${LD-ld} -m elf_i386" + ;; + ppc64-*linux*|powerpc64-*linux*) + LD="${LD-ld} -m elf32ppclinux" + ;; + s390x-*linux*) + LD="${LD-ld} -m elf_s390" + ;; + sparc64-*linux*) + LD="${LD-ld} -m elf32_sparc" + ;; + esac + ;; + *64-bit*) + case $host in + x86_64-*linux*) + LD="${LD-ld} -m elf_x86_64" + ;; + ppc*-*linux*|powerpc*-*linux*) + LD="${LD-ld} -m elf64ppc" + ;; + s390*-*linux*) + LD="${LD-ld} -m elf64_s390" + ;; + sparc*-*linux*) + LD="${LD-ld} -m elf64_sparc" + ;; + esac + ;; + esac + fi + rm -rf conftest* + ;; + +*-*-sco3.2v5*) + # On SCO OpenServer 5, we need -belf to get full-featured binaries. + SAVE_CFLAGS="$CFLAGS" + CFLAGS="$CFLAGS -belf" + echo "$as_me:$LINENO: checking whether the C compiler needs -belf" >&5 +echo $ECHO_N "checking whether the C compiler needs -belf... $ECHO_C" >&6 +if test "${lt_cv_cc_needs_belf+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + + + ac_ext=c +ac_cpp='$CPP $CPPFLAGS' +ac_compile='$CC -c $CFLAGS $CPPFLAGS conftest.$ac_ext >&5' +ac_link='$CC -o conftest$ac_exeext $CFLAGS $CPPFLAGS $LDFLAGS conftest.$ac_ext $LIBS >&5' +ac_compiler_gnu=$ac_cv_c_compiler_gnu + + cat >conftest.$ac_ext <<_ACEOF +/* confdefs.h. */ +_ACEOF +cat confdefs.h >>conftest.$ac_ext +cat >>conftest.$ac_ext <<_ACEOF +/* end confdefs.h. */ + +int +main () +{ + + ; + return 0; +} +_ACEOF +rm -f conftest.$ac_objext conftest$ac_exeext +if { (eval echo "$as_me:$LINENO: \"$ac_link\"") >&5 + (eval $ac_link) 2>conftest.er1 + ac_status=$? + grep -v '^ *+' conftest.er1 >conftest.err + rm -f conftest.er1 + cat conftest.err >&5 + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } && + { ac_try='test -z "$ac_c_werror_flag" + || test ! -s conftest.err' + { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5 + (eval $ac_try) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; } && + { ac_try='test -s conftest$ac_exeext' + { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5 + (eval $ac_try) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; }; then + lt_cv_cc_needs_belf=yes +else + echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 + +lt_cv_cc_needs_belf=no +fi +rm -f conftest.err conftest.$ac_objext \ + conftest$ac_exeext conftest.$ac_ext + ac_ext=c +ac_cpp='$CPP $CPPFLAGS' +ac_compile='$CC -c $CFLAGS $CPPFLAGS conftest.$ac_ext >&5' +ac_link='$CC -o conftest$ac_exeext $CFLAGS $CPPFLAGS $LDFLAGS conftest.$ac_ext $LIBS >&5' +ac_compiler_gnu=$ac_cv_c_compiler_gnu + +fi +echo "$as_me:$LINENO: result: $lt_cv_cc_needs_belf" >&5 +echo "${ECHO_T}$lt_cv_cc_needs_belf" >&6 + if test x"$lt_cv_cc_needs_belf" != x"yes"; then + # this is probably gcc 2.8.0, egcs 1.0 or newer; no need for -belf + CFLAGS="$SAVE_CFLAGS" + fi + ;; + + +esac + + +# Save cache, so that ltconfig can load it +cat >confcache <<\_ACEOF +# This file is a shell script that caches the results of configure +# tests run on this system so they can be shared between configure +# scripts and configure runs, see configure's option --config-cache. +# It is not useful on other systems. If it contains results you don't +# want to keep, you may remove or edit it. +# +# config.status only pays attention to the cache file if you give it +# the --recheck option to rerun configure. +# +# `ac_cv_env_foo' variables (set or unset) will be overridden when +# loading this file, other *unset* `ac_cv_foo' will be assigned the +# following values. + +_ACEOF + +# The following way of writing the cache mishandles newlines in values, +# but we know of no workaround that is simple, portable, and efficient. +# So, don't put newlines in cache variables' values. +# Ultrix sh set writes to stderr and can't be redirected directly, +# and sets the high bit in the cache file unless we assign to the vars. +{ + (set) 2>&1 | + case `(ac_space=' '; set | grep ac_space) 2>&1` in + *ac_space=\ *) + # `set' does not quote correctly, so add quotes (double-quote + # substitution turns \\\\ into \\, and sed turns \\ into \). + sed -n \ + "s/'/'\\\\''/g; + s/^\\([_$as_cr_alnum]*_cv_[_$as_cr_alnum]*\\)=\\(.*\\)/\\1='\\2'/p" + ;; + *) + # `set' quotes correctly as required by POSIX, so do not add quotes. + sed -n \ + "s/^\\([_$as_cr_alnum]*_cv_[_$as_cr_alnum]*\\)=\\(.*\\)/\\1=\\2/p" + ;; + esac; +} | + sed ' + t clear + : clear + s/^\([^=]*\)=\(.*[{}].*\)$/test "${\1+set}" = set || &/ + t end + /^ac_cv_env/!s/^\([^=]*\)=\(.*\)$/\1=${\1=\2}/ + : end' >>confcache +if diff $cache_file confcache >/dev/null 2>&1; then :; else + if test -w $cache_file; then + test "x$cache_file" != "x/dev/null" && echo "updating cache $cache_file" + cat confcache >$cache_file + else + echo "not updating unwritable cache $cache_file" + fi +fi +rm -f confcache + +# Actually configure libtool. ac_aux_dir is where install-sh is found. +AR="$AR" LTCC="$CC" CC="$CC" CFLAGS="$CFLAGS" CPPFLAGS="$CPPFLAGS" \ +MAGIC_CMD="$MAGIC_CMD" LD="$LD" LDFLAGS="$LDFLAGS" LIBS="$LIBS" \ +LN_S="$LN_S" NM="$NM" RANLIB="$RANLIB" STRIP="$STRIP" \ +AS="$AS" DLLTOOL="$DLLTOOL" OBJDUMP="$OBJDUMP" \ +objext="$OBJEXT" exeext="$EXEEXT" reload_flag="$reload_flag" \ +deplibs_check_method="$deplibs_check_method" file_magic_cmd="$file_magic_cmd" \ +${CONFIG_SHELL-/bin/sh} $ac_aux_dir/ltconfig --no-reexec \ +$libtool_flags --no-verify --build="$build" $ac_aux_dir/ltmain.sh $host \ +|| { { echo "$as_me:$LINENO: error: libtool configure failed" >&5 +echo "$as_me: error: libtool configure failed" >&2;} + { (exit 1); exit 1; }; } + +# Reload cache, that may have been modified by ltconfig +if test -r "$cache_file"; then + # Some versions of bash will fail to source /dev/null (special + # files actually), so we avoid doing that. + if test -f "$cache_file"; then + { echo "$as_me:$LINENO: loading cache $cache_file" >&5 +echo "$as_me: loading cache $cache_file" >&6;} + case $cache_file in + [\\/]* | ?:[\\/]* ) . $cache_file;; + *) . ./$cache_file;; + esac + fi +else + { echo "$as_me:$LINENO: creating cache $cache_file" >&5 +echo "$as_me: creating cache $cache_file" >&6;} + >$cache_file +fi + + +# This can be used to rebuild libtool when needed +LIBTOOL_DEPS="$ac_aux_dir/ltconfig $ac_aux_dir/ltmain.sh $ac_aux_dir/ltcf-c.sh" + +# Always use our own libtool. +LIBTOOL='$(SHELL) $(top_builddir)/libtool' + +# Redirect the config.log output again, so that the ltconfig log is not +# clobbered by the next message. +exec 5>>./config.log + + + + + + + + + +# Calculate toolexeclibdir +# Also toolexecdir, though it's only used in toolexeclibdir +case ${version_specific_libs} in + yes) + # Need the gcc compiler version to know where to install libraries + # and header files if --enable-version-specific-runtime-libs option + # is selected. + toolexecdir='$(libdir)/gcc/$(target_alias)' + toolexeclibdir='$(toolexecdir)/$(gcc_version)$(MULTISUBDIR)' + ;; + no) + if test -n "$with_cross_host" && + test x"$with_cross_host" != x"no"; then + # Install a library built with a cross compiler in tooldir, not libdir. + toolexecdir='$(exec_prefix)/$(target_alias)' + toolexeclibdir='$(toolexecdir)/lib' + else + toolexecdir='$(libdir)/gcc-lib/$(target_alias)' + toolexeclibdir='$(libdir)' + fi + multi_os_directory=`$CC -print-multi-os-directory` + case $multi_os_directory in + .) ;; # Avoid trailing /. + *) toolexeclibdir=$toolexeclibdir/$multi_os_directory ;; + esac + ;; +esac + + + +if test ${multilib} = yes; then + multilib_arg="--enable-multilib" +else + multilib_arg= +fi + + +# Now check which parts we include in the library. + +arch_subdirs= +case "${target}" in + i?86-* | x86_64-* ) +# Handle multilib cases + if test "x$target_ilp32" = xyes; then + arch_subdirs="i386" + arch_libraries="i386/libsse2.la" + arch_maps="i386/sse2.map" + fi ;; + *) + ;; +esac + + + + + +if test "x$arch_subdirs" != x; then + BUILD_LIBGCC_MATH_TRUE= + BUILD_LIBGCC_MATH_FALSE='#' +else + BUILD_LIBGCC_MATH_TRUE='#' + BUILD_LIBGCC_MATH_FALSE= +fi + + + + ac_config_files="$ac_config_files Makefile i386/Makefile" + +cat >confcache <<\_ACEOF +# This file is a shell script that caches the results of configure +# tests run on this system so they can be shared between configure +# scripts and configure runs, see configure's option --config-cache. +# It is not useful on other systems. If it contains results you don't +# want to keep, you may remove or edit it. +# +# config.status only pays attention to the cache file if you give it +# the --recheck option to rerun configure. +# +# `ac_cv_env_foo' variables (set or unset) will be overridden when +# loading this file, other *unset* `ac_cv_foo' will be assigned the +# following values. + +_ACEOF + +# The following way of writing the cache mishandles newlines in values, +# but we know of no workaround that is simple, portable, and efficient. +# So, don't put newlines in cache variables' values. +# Ultrix sh set writes to stderr and can't be redirected directly, +# and sets the high bit in the cache file unless we assign to the vars. +{ + (set) 2>&1 | + case `(ac_space=' '; set | grep ac_space) 2>&1` in + *ac_space=\ *) + # `set' does not quote correctly, so add quotes (double-quote + # substitution turns \\\\ into \\, and sed turns \\ into \). + sed -n \ + "s/'/'\\\\''/g; + s/^\\([_$as_cr_alnum]*_cv_[_$as_cr_alnum]*\\)=\\(.*\\)/\\1='\\2'/p" + ;; + *) + # `set' quotes correctly as required by POSIX, so do not add quotes. + sed -n \ + "s/^\\([_$as_cr_alnum]*_cv_[_$as_cr_alnum]*\\)=\\(.*\\)/\\1=\\2/p" + ;; + esac; +} | + sed ' + t clear + : clear + s/^\([^=]*\)=\(.*[{}].*\)$/test "${\1+set}" = set || &/ + t end + /^ac_cv_env/!s/^\([^=]*\)=\(.*\)$/\1=${\1=\2}/ + : end' >>confcache +if diff $cache_file confcache >/dev/null 2>&1; then :; else + if test -w $cache_file; then + test "x$cache_file" != "x/dev/null" && echo "updating cache $cache_file" + cat confcache >$cache_file + else + echo "not updating unwritable cache $cache_file" + fi +fi +rm -f confcache + +test "x$prefix" = xNONE && prefix=$ac_default_prefix +# Let make expand exec_prefix. +test "x$exec_prefix" = xNONE && exec_prefix='${prefix}' + +# VPATH may cause trouble with some makes, so we remove $(srcdir), +# ${srcdir} and @srcdir@ from VPATH if srcdir is ".", strip leading and +# trailing colons and then remove the whole line if VPATH becomes empty +# (actually we leave an empty line to preserve line numbers). +if test "x$srcdir" = x.; then + ac_vpsub='/^[ ]*VPATH[ ]*=/{ +s/:*\$(srcdir):*/:/; +s/:*\${srcdir}:*/:/; +s/:*@srcdir@:*/:/; +s/^\([^=]*=[ ]*\):*/\1/; +s/:*$//; +s/^[^=]*=[ ]*$//; +}' +fi + +# Transform confdefs.h into DEFS. +# Protect against shell expansion while executing Makefile rules. +# Protect against Makefile macro expansion. +# +# If the first sed substitution is executed (which looks for macros that +# take arguments), then we branch to the quote section. Otherwise, +# look for a macro that doesn't take arguments. +cat >confdef2opt.sed <<\_ACEOF +t clear +: clear +s,^[ ]*#[ ]*define[ ][ ]*\([^ (][^ (]*([^)]*)\)[ ]*\(.*\),-D\1=\2,g +t quote +s,^[ ]*#[ ]*define[ ][ ]*\([^ ][^ ]*\)[ ]*\(.*\),-D\1=\2,g +t quote +d +: quote +s,[ `~#$^&*(){}\\|;'"<>?],\\&,g +s,\[,\\&,g +s,\],\\&,g +s,\$,$$,g +p +_ACEOF +# We use echo to avoid assuming a particular line-breaking character. +# The extra dot is to prevent the shell from consuming trailing +# line-breaks from the sub-command output. A line-break within +# single-quotes doesn't work because, if this script is created in a +# platform that uses two characters for line-breaks (e.g., DOS), tr +# would break. +ac_LF_and_DOT=`echo; echo .` +DEFS=`sed -n -f confdef2opt.sed confdefs.h | tr "$ac_LF_and_DOT" ' .'` +rm -f confdef2opt.sed + + +ac_libobjs= +ac_ltlibobjs= +for ac_i in : $LIBOBJS; do test "x$ac_i" = x: && continue + # 1. Remove the extension, and $U if already installed. + ac_i=`echo "$ac_i" | + sed 's/\$U\././;s/\.o$//;s/\.obj$//'` + # 2. Add them. + ac_libobjs="$ac_libobjs $ac_i\$U.$ac_objext" + ac_ltlibobjs="$ac_ltlibobjs $ac_i"'$U.lo' +done +LIBOBJS=$ac_libobjs + +LTLIBOBJS=$ac_ltlibobjs + + +if test -z "${MAINTAINER_MODE_TRUE}" && test -z "${MAINTAINER_MODE_FALSE}"; then + { { echo "$as_me:$LINENO: error: conditional \"MAINTAINER_MODE\" was never defined. +Usually this means the macro was only invoked conditionally." >&5 +echo "$as_me: error: conditional \"MAINTAINER_MODE\" was never defined. +Usually this means the macro was only invoked conditionally." >&2;} + { (exit 1); exit 1; }; } +fi +if test -z "${AMDEP_TRUE}" && test -z "${AMDEP_FALSE}"; then + { { echo "$as_me:$LINENO: error: conditional \"AMDEP\" was never defined. +Usually this means the macro was only invoked conditionally." >&5 +echo "$as_me: error: conditional \"AMDEP\" was never defined. +Usually this means the macro was only invoked conditionally." >&2;} + { (exit 1); exit 1; }; } +fi +if test -z "${am__fastdepCC_TRUE}" && test -z "${am__fastdepCC_FALSE}"; then + { { echo "$as_me:$LINENO: error: conditional \"am__fastdepCC\" was never defined. +Usually this means the macro was only invoked conditionally." >&5 +echo "$as_me: error: conditional \"am__fastdepCC\" was never defined. +Usually this means the macro was only invoked conditionally." >&2;} + { (exit 1); exit 1; }; } +fi +if test -z "${LIBGCCM_USE_SYMVER_TRUE}" && test -z "${LIBGCCM_USE_SYMVER_FALSE}"; then + { { echo "$as_me:$LINENO: error: conditional \"LIBGCCM_USE_SYMVER\" was never defined. +Usually this means the macro was only invoked conditionally." >&5 +echo "$as_me: error: conditional \"LIBGCCM_USE_SYMVER\" was never defined. +Usually this means the macro was only invoked conditionally." >&2;} + { (exit 1); exit 1; }; } +fi +if test -z "${TARGET_ILP32_TRUE}" && test -z "${TARGET_ILP32_FALSE}"; then + { { echo "$as_me:$LINENO: error: conditional \"TARGET_ILP32\" was never defined. +Usually this means the macro was only invoked conditionally." >&5 +echo "$as_me: error: conditional \"TARGET_ILP32\" was never defined. +Usually this means the macro was only invoked conditionally." >&2;} + { (exit 1); exit 1; }; } +fi +if test -z "${BUILD_LIBGCC_MATH_TRUE}" && test -z "${BUILD_LIBGCC_MATH_FALSE}"; then + { { echo "$as_me:$LINENO: error: conditional \"BUILD_LIBGCC_MATH\" was never defined. +Usually this means the macro was only invoked conditionally." >&5 +echo "$as_me: error: conditional \"BUILD_LIBGCC_MATH\" was never defined. +Usually this means the macro was only invoked conditionally." >&2;} + { (exit 1); exit 1; }; } +fi + +: ${CONFIG_STATUS=./config.status} +ac_clean_files_save=$ac_clean_files +ac_clean_files="$ac_clean_files $CONFIG_STATUS" +{ echo "$as_me:$LINENO: creating $CONFIG_STATUS" >&5 +echo "$as_me: creating $CONFIG_STATUS" >&6;} +cat >$CONFIG_STATUS <<_ACEOF +#! $SHELL +# Generated by $as_me. +# Run this file to recreate the current configuration. +# Compiler output produced by configure, useful for debugging +# configure, is in config.log if it exists. + +debug=false +ac_cs_recheck=false +ac_cs_silent=false +SHELL=\${CONFIG_SHELL-$SHELL} +_ACEOF + +cat >>$CONFIG_STATUS <<\_ACEOF +## --------------------- ## +## M4sh Initialization. ## +## --------------------- ## + +# Be Bourne compatible +if test -n "${ZSH_VERSION+set}" && (emulate sh) >/dev/null 2>&1; then + emulate sh + NULLCMD=: + # Zsh 3.x and 4.x performs word splitting on ${1+"$@"}, which + # is contrary to our usage. Disable this feature. + alias -g '${1+"$@"}'='"$@"' +elif test -n "${BASH_VERSION+set}" && (set -o posix) >/dev/null 2>&1; then + set -o posix +fi +DUALCASE=1; export DUALCASE # for MKS sh + +# Support unset when possible. +if ( (MAIL=60; unset MAIL) || exit) >/dev/null 2>&1; then + as_unset=unset +else + as_unset=false +fi + + +# Work around bugs in pre-3.0 UWIN ksh. +$as_unset ENV MAIL MAILPATH +PS1='$ ' +PS2='> ' +PS4='+ ' + +# NLS nuisances. +for as_var in \ + LANG LANGUAGE LC_ADDRESS LC_ALL LC_COLLATE LC_CTYPE LC_IDENTIFICATION \ + LC_MEASUREMENT LC_MESSAGES LC_MONETARY LC_NAME LC_NUMERIC LC_PAPER \ + LC_TELEPHONE LC_TIME +do + if (set +x; test -z "`(eval $as_var=C; export $as_var) 2>&1`"); then + eval $as_var=C; export $as_var + else + $as_unset $as_var + fi +done + +# Required to use basename. +if expr a : '\(a\)' >/dev/null 2>&1; then + as_expr=expr +else + as_expr=false +fi + +if (basename /) >/dev/null 2>&1 && test "X`basename / 2>&1`" = "X/"; then + as_basename=basename +else + as_basename=false +fi + + +# Name of the executable. +as_me=`$as_basename "$0" || +$as_expr X/"$0" : '.*/\([^/][^/]*\)/*$' \| \ + X"$0" : 'X\(//\)$' \| \ + X"$0" : 'X\(/\)$' \| \ + . : '\(.\)' 2>/dev/null || +echo X/"$0" | + sed '/^.*\/\([^/][^/]*\)\/*$/{ s//\1/; q; } + /^X\/\(\/\/\)$/{ s//\1/; q; } + /^X\/\(\/\).*/{ s//\1/; q; } + s/.*/./; q'` + + +# PATH needs CR, and LINENO needs CR and PATH. +# Avoid depending upon Character Ranges. +as_cr_letters='abcdefghijklmnopqrstuvwxyz' +as_cr_LETTERS='ABCDEFGHIJKLMNOPQRSTUVWXYZ' +as_cr_Letters=$as_cr_letters$as_cr_LETTERS +as_cr_digits='0123456789' +as_cr_alnum=$as_cr_Letters$as_cr_digits + +# The user is always right. +if test "${PATH_SEPARATOR+set}" != set; then + echo "#! /bin/sh" >conf$$.sh + echo "exit 0" >>conf$$.sh + chmod +x conf$$.sh + if (PATH="/nonexistent;."; conf$$.sh) >/dev/null 2>&1; then + PATH_SEPARATOR=';' + else + PATH_SEPARATOR=: + fi + rm -f conf$$.sh +fi + + + as_lineno_1=$LINENO + as_lineno_2=$LINENO + as_lineno_3=`(expr $as_lineno_1 + 1) 2>/dev/null` + test "x$as_lineno_1" != "x$as_lineno_2" && + test "x$as_lineno_3" = "x$as_lineno_2" || { + # Find who we are. Look in the path if we contain no path at all + # relative or not. + case $0 in + *[\\/]* ) as_myself=$0 ;; + *) as_save_IFS=$IFS; IFS=$PATH_SEPARATOR +for as_dir in $PATH +do + IFS=$as_save_IFS + test -z "$as_dir" && as_dir=. + test -r "$as_dir/$0" && as_myself=$as_dir/$0 && break +done + + ;; + esac + # We did not find ourselves, most probably we were run as `sh COMMAND' + # in which case we are not to be found in the path. + if test "x$as_myself" = x; then + as_myself=$0 + fi + if test ! -f "$as_myself"; then + { { echo "$as_me:$LINENO: error: cannot find myself; rerun with an absolute path" >&5 +echo "$as_me: error: cannot find myself; rerun with an absolute path" >&2;} + { (exit 1); exit 1; }; } + fi + case $CONFIG_SHELL in + '') + as_save_IFS=$IFS; IFS=$PATH_SEPARATOR +for as_dir in /bin$PATH_SEPARATOR/usr/bin$PATH_SEPARATOR$PATH +do + IFS=$as_save_IFS + test -z "$as_dir" && as_dir=. + for as_base in sh bash ksh sh5; do + case $as_dir in + /*) + if ("$as_dir/$as_base" -c ' + as_lineno_1=$LINENO + as_lineno_2=$LINENO + as_lineno_3=`(expr $as_lineno_1 + 1) 2>/dev/null` + test "x$as_lineno_1" != "x$as_lineno_2" && + test "x$as_lineno_3" = "x$as_lineno_2" ') 2>/dev/null; then + $as_unset BASH_ENV || test "${BASH_ENV+set}" != set || { BASH_ENV=; export BASH_ENV; } + $as_unset ENV || test "${ENV+set}" != set || { ENV=; export ENV; } + CONFIG_SHELL=$as_dir/$as_base + export CONFIG_SHELL + exec "$CONFIG_SHELL" "$0" ${1+"$@"} + fi;; + esac + done +done +;; + esac + + # Create $as_me.lineno as a copy of $as_myself, but with $LINENO + # uniformly replaced by the line number. The first 'sed' inserts a + # line-number line before each line; the second 'sed' does the real + # work. The second script uses 'N' to pair each line-number line + # with the numbered line, and appends trailing '-' during + # substitution so that $LINENO is not a special case at line end. + # (Raja R Harinath suggested sed '=', and Paul Eggert wrote the + # second 'sed' script. Blame Lee E. McMahon for sed's syntax. :-) + sed '=' <$as_myself | + sed ' + N + s,$,-, + : loop + s,^\(['$as_cr_digits']*\)\(.*\)[$]LINENO\([^'$as_cr_alnum'_]\),\1\2\1\3, + t loop + s,-$,, + s,^['$as_cr_digits']*\n,, + ' >$as_me.lineno && + chmod +x $as_me.lineno || + { { echo "$as_me:$LINENO: error: cannot create $as_me.lineno; rerun with a POSIX shell" >&5 +echo "$as_me: error: cannot create $as_me.lineno; rerun with a POSIX shell" >&2;} + { (exit 1); exit 1; }; } + + # Don't try to exec as it changes $[0], causing all sort of problems + # (the dirname of $[0] is not the place where we might find the + # original and so on. Autoconf is especially sensible to this). + . ./$as_me.lineno + # Exit status is that of the last command. + exit +} + + +case `echo "testing\c"; echo 1,2,3`,`echo -n testing; echo 1,2,3` in + *c*,-n*) ECHO_N= ECHO_C=' +' ECHO_T=' ' ;; + *c*,* ) ECHO_N=-n ECHO_C= ECHO_T= ;; + *) ECHO_N= ECHO_C='\c' ECHO_T= ;; +esac + +if expr a : '\(a\)' >/dev/null 2>&1; then + as_expr=expr +else + as_expr=false +fi + +rm -f conf$$ conf$$.exe conf$$.file +echo >conf$$.file +if ln -s conf$$.file conf$$ 2>/dev/null; then + # We could just check for DJGPP; but this test a) works b) is more generic + # and c) will remain valid once DJGPP supports symlinks (DJGPP 2.04). + if test -f conf$$.exe; then + # Don't use ln at all; we don't have any links + as_ln_s='cp -p' + else + as_ln_s='ln -s' + fi +elif ln conf$$.file conf$$ 2>/dev/null; then + as_ln_s=ln +else + as_ln_s='cp -p' +fi +rm -f conf$$ conf$$.exe conf$$.file + +if mkdir -p . 2>/dev/null; then + as_mkdir_p=: +else + test -d ./-p && rmdir ./-p + as_mkdir_p=false +fi + +as_executable_p="test -f" + +# Sed expression to map a string onto a valid CPP name. +as_tr_cpp="eval sed 'y%*$as_cr_letters%P$as_cr_LETTERS%;s%[^_$as_cr_alnum]%_%g'" + +# Sed expression to map a string onto a valid variable name. +as_tr_sh="eval sed 'y%*+%pp%;s%[^_$as_cr_alnum]%_%g'" + + +# IFS +# We need space, tab and new line, in precisely that order. +as_nl=' +' +IFS=" $as_nl" + +# CDPATH. +$as_unset CDPATH + +exec 6>&1 + +# Open the log real soon, to keep \$[0] and so on meaningful, and to +# report actual input values of CONFIG_FILES etc. instead of their +# values after options handling. Logging --version etc. is OK. +exec 5>>config.log +{ + echo + sed 'h;s/./-/g;s/^.../## /;s/...$/ ##/;p;x;p;x' <<_ASBOX +## Running $as_me. ## +_ASBOX +} >&5 +cat >&5 <<_CSEOF + +This file was extended by libgcc-math $as_me 1.0, which was +generated by GNU Autoconf 2.59. Invocation command line was + + CONFIG_FILES = $CONFIG_FILES + CONFIG_HEADERS = $CONFIG_HEADERS + CONFIG_LINKS = $CONFIG_LINKS + CONFIG_COMMANDS = $CONFIG_COMMANDS + $ $0 $@ + +_CSEOF +echo "on `(hostname || uname -n) 2>/dev/null | sed 1q`" >&5 +echo >&5 +_ACEOF + +# Files that config.status was made for. +if test -n "$ac_config_files"; then + echo "config_files=\"$ac_config_files\"" >>$CONFIG_STATUS +fi + +if test -n "$ac_config_headers"; then + echo "config_headers=\"$ac_config_headers\"" >>$CONFIG_STATUS +fi + +if test -n "$ac_config_links"; then + echo "config_links=\"$ac_config_links\"" >>$CONFIG_STATUS +fi + +if test -n "$ac_config_commands"; then + echo "config_commands=\"$ac_config_commands\"" >>$CONFIG_STATUS +fi + +cat >>$CONFIG_STATUS <<\_ACEOF + +ac_cs_usage="\ +\`$as_me' instantiates files from templates according to the +current configuration. + +Usage: $0 [OPTIONS] [FILE]... + + -h, --help print this help, then exit + -V, --version print version number, then exit + -q, --quiet do not print progress messages + -d, --debug don't remove temporary files + --recheck update $as_me by reconfiguring in the same conditions + --file=FILE[:TEMPLATE] + instantiate the configuration file FILE + +Configuration files: +$config_files + +Configuration commands: +$config_commands + +Report bugs to ." +_ACEOF + +cat >>$CONFIG_STATUS <<_ACEOF +ac_cs_version="\\ +libgcc-math config.status 1.0 +configured by $0, generated by GNU Autoconf 2.59, + with options \\"`echo "$ac_configure_args" | sed 's/[\\""\`\$]/\\\\&/g'`\\" + +Copyright (C) 2003 Free Software Foundation, Inc. +This config.status script is free software; the Free Software Foundation +gives unlimited permission to copy, distribute and modify it." +srcdir=$srcdir +INSTALL="$INSTALL" +_ACEOF + +cat >>$CONFIG_STATUS <<\_ACEOF +# If no file are specified by the user, then we need to provide default +# value. By we need to know if files were specified by the user. +ac_need_defaults=: +while test $# != 0 +do + case $1 in + --*=*) + ac_option=`expr "x$1" : 'x\([^=]*\)='` + ac_optarg=`expr "x$1" : 'x[^=]*=\(.*\)'` + ac_shift=: + ;; + -*) + ac_option=$1 + ac_optarg=$2 + ac_shift=shift + ;; + *) # This is not an option, so the user has probably given explicit + # arguments. + ac_option=$1 + ac_need_defaults=false;; + esac + + case $ac_option in + # Handling of the options. +_ACEOF +cat >>$CONFIG_STATUS <<\_ACEOF + -recheck | --recheck | --rechec | --reche | --rech | --rec | --re | --r) + ac_cs_recheck=: ;; + --version | --vers* | -V ) + echo "$ac_cs_version"; exit 0 ;; + --he | --h) + # Conflict between --help and --header + { { echo "$as_me:$LINENO: error: ambiguous option: $1 +Try \`$0 --help' for more information." >&5 +echo "$as_me: error: ambiguous option: $1 +Try \`$0 --help' for more information." >&2;} + { (exit 1); exit 1; }; };; + --help | --hel | -h ) + echo "$ac_cs_usage"; exit 0 ;; + --debug | --d* | -d ) + debug=: ;; + --file | --fil | --fi | --f ) + $ac_shift + CONFIG_FILES="$CONFIG_FILES $ac_optarg" + ac_need_defaults=false;; + --header | --heade | --head | --hea ) + $ac_shift + CONFIG_HEADERS="$CONFIG_HEADERS $ac_optarg" + ac_need_defaults=false;; + -q | -quiet | --quiet | --quie | --qui | --qu | --q \ + | -silent | --silent | --silen | --sile | --sil | --si | --s) + ac_cs_silent=: ;; + + # This is an error. + -*) { { echo "$as_me:$LINENO: error: unrecognized option: $1 +Try \`$0 --help' for more information." >&5 +echo "$as_me: error: unrecognized option: $1 +Try \`$0 --help' for more information." >&2;} + { (exit 1); exit 1; }; } ;; + + *) ac_config_targets="$ac_config_targets $1" ;; + + esac + shift +done + +ac_configure_extra_args= + +if $ac_cs_silent; then + exec 6>/dev/null + ac_configure_extra_args="$ac_configure_extra_args --silent" +fi + +_ACEOF +cat >>$CONFIG_STATUS <<_ACEOF +if \$ac_cs_recheck; then + echo "running $SHELL $0 " $ac_configure_args \$ac_configure_extra_args " --no-create --no-recursion" >&6 + exec $SHELL $0 $ac_configure_args \$ac_configure_extra_args --no-create --no-recursion +fi + +_ACEOF + +cat >>$CONFIG_STATUS <<_ACEOF +# +# INIT-COMMANDS section. +# + + +srcdir="$srcdir" +host="$host" +target="$target" +with_multisubdir="$with_multisubdir" +with_multisrctop="$with_multisrctop" +with_target_subdir="$with_target_subdir" +ac_configure_args="${multilib_arg} ${ac_configure_args}" +multi_basedir="$multi_basedir" +CONFIG_SHELL=${CONFIG_SHELL-/bin/sh} +CC="$CC" +AMDEP_TRUE="$AMDEP_TRUE" ac_aux_dir="$ac_aux_dir" + +_ACEOF + + + +cat >>$CONFIG_STATUS <<\_ACEOF +for ac_config_target in $ac_config_targets +do + case "$ac_config_target" in + # Handling of arguments. + "Makefile" ) CONFIG_FILES="$CONFIG_FILES Makefile" ;; + "i386/Makefile" ) CONFIG_FILES="$CONFIG_FILES i386/Makefile" ;; + "default-1" ) CONFIG_COMMANDS="$CONFIG_COMMANDS default-1" ;; + "depfiles" ) CONFIG_COMMANDS="$CONFIG_COMMANDS depfiles" ;; + *) { { echo "$as_me:$LINENO: error: invalid argument: $ac_config_target" >&5 +echo "$as_me: error: invalid argument: $ac_config_target" >&2;} + { (exit 1); exit 1; }; };; + esac +done + +# If the user did not use the arguments to specify the items to instantiate, +# then the envvar interface is used. Set only those that are not. +# We use the long form for the default assignment because of an extremely +# bizarre bug on SunOS 4.1.3. +if $ac_need_defaults; then + test "${CONFIG_FILES+set}" = set || CONFIG_FILES=$config_files + test "${CONFIG_COMMANDS+set}" = set || CONFIG_COMMANDS=$config_commands +fi + +# Have a temporary directory for convenience. Make it in the build tree +# simply because there is no reason to put it here, and in addition, +# creating and moving files from /tmp can sometimes cause problems. +# Create a temporary directory, and hook for its removal unless debugging. +$debug || +{ + trap 'exit_status=$?; rm -rf $tmp && exit $exit_status' 0 + trap '{ (exit 1); exit 1; }' 1 2 13 15 +} + +# Create a (secure) tmp directory for tmp files. + +{ + tmp=`(umask 077 && mktemp -d -q "./confstatXXXXXX") 2>/dev/null` && + test -n "$tmp" && test -d "$tmp" +} || +{ + tmp=./confstat$$-$RANDOM + (umask 077 && mkdir $tmp) +} || +{ + echo "$me: cannot create a temporary directory in ." >&2 + { (exit 1); exit 1; } +} + +_ACEOF + +cat >>$CONFIG_STATUS <<_ACEOF + +# +# CONFIG_FILES section. +# + +# No need to generate the scripts if there are no CONFIG_FILES. +# This happens for instance when ./config.status config.h +if test -n "\$CONFIG_FILES"; then + # Protect against being on the right side of a sed subst in config.status. + sed 's/,@/@@/; s/@,/@@/; s/,;t t\$/@;t t/; /@;t t\$/s/[\\\\&,]/\\\\&/g; + s/@@/,@/; s/@@/@,/; s/@;t t\$/,;t t/' >\$tmp/subs.sed <<\\CEOF +s,@SHELL@,$SHELL,;t t +s,@PATH_SEPARATOR@,$PATH_SEPARATOR,;t t +s,@PACKAGE_NAME@,$PACKAGE_NAME,;t t +s,@PACKAGE_TARNAME@,$PACKAGE_TARNAME,;t t +s,@PACKAGE_VERSION@,$PACKAGE_VERSION,;t t +s,@PACKAGE_STRING@,$PACKAGE_STRING,;t t +s,@PACKAGE_BUGREPORT@,$PACKAGE_BUGREPORT,;t t +s,@exec_prefix@,$exec_prefix,;t t +s,@prefix@,$prefix,;t t +s,@program_transform_name@,$program_transform_name,;t t +s,@bindir@,$bindir,;t t +s,@sbindir@,$sbindir,;t t +s,@libexecdir@,$libexecdir,;t t +s,@datadir@,$datadir,;t t +s,@sysconfdir@,$sysconfdir,;t t +s,@sharedstatedir@,$sharedstatedir,;t t +s,@localstatedir@,$localstatedir,;t t +s,@libdir@,$libdir,;t t +s,@includedir@,$includedir,;t t +s,@oldincludedir@,$oldincludedir,;t t +s,@infodir@,$infodir,;t t +s,@mandir@,$mandir,;t t +s,@build_alias@,$build_alias,;t t +s,@host_alias@,$host_alias,;t t +s,@target_alias@,$target_alias,;t t +s,@DEFS@,$DEFS,;t t +s,@ECHO_C@,$ECHO_C,;t t +s,@ECHO_N@,$ECHO_N,;t t +s,@ECHO_T@,$ECHO_T,;t t +s,@LIBS@,$LIBS,;t t +s,@build@,$build,;t t +s,@build_cpu@,$build_cpu,;t t +s,@build_vendor@,$build_vendor,;t t +s,@build_os@,$build_os,;t t +s,@host@,$host,;t t +s,@host_cpu@,$host_cpu,;t t +s,@host_vendor@,$host_vendor,;t t +s,@host_os@,$host_os,;t t +s,@target@,$target,;t t +s,@target_cpu@,$target_cpu,;t t +s,@target_vendor@,$target_vendor,;t t +s,@target_os@,$target_os,;t t +s,@INSTALL_PROGRAM@,$INSTALL_PROGRAM,;t t +s,@INSTALL_SCRIPT@,$INSTALL_SCRIPT,;t t +s,@INSTALL_DATA@,$INSTALL_DATA,;t t +s,@CYGPATH_W@,$CYGPATH_W,;t t +s,@PACKAGE@,$PACKAGE,;t t +s,@VERSION@,$VERSION,;t t +s,@ACLOCAL@,$ACLOCAL,;t t +s,@AUTOCONF@,$AUTOCONF,;t t +s,@AUTOMAKE@,$AUTOMAKE,;t t +s,@AUTOHEADER@,$AUTOHEADER,;t t +s,@MAKEINFO@,$MAKEINFO,;t t +s,@install_sh@,$install_sh,;t t +s,@STRIP@,$STRIP,;t t +s,@ac_ct_STRIP@,$ac_ct_STRIP,;t t +s,@INSTALL_STRIP_PROGRAM@,$INSTALL_STRIP_PROGRAM,;t t +s,@mkdir_p@,$mkdir_p,;t t +s,@AWK@,$AWK,;t t +s,@SET_MAKE@,$SET_MAKE,;t t +s,@am__leading_dot@,$am__leading_dot,;t t +s,@AMTAR@,$AMTAR,;t t +s,@am__tar@,$am__tar,;t t +s,@am__untar@,$am__untar,;t t +s,@MAINTAINER_MODE_TRUE@,$MAINTAINER_MODE_TRUE,;t t +s,@MAINTAINER_MODE_FALSE@,$MAINTAINER_MODE_FALSE,;t t +s,@MAINT@,$MAINT,;t t +s,@multi_basedir@,$multi_basedir,;t t +s,@CC@,$CC,;t t +s,@ac_ct_CC@,$ac_ct_CC,;t t +s,@EXEEXT@,$EXEEXT,;t t +s,@OBJEXT@,$OBJEXT,;t t +s,@DEPDIR@,$DEPDIR,;t t +s,@am__include@,$am__include,;t t +s,@am__quote@,$am__quote,;t t +s,@AMDEP_TRUE@,$AMDEP_TRUE,;t t +s,@AMDEP_FALSE@,$AMDEP_FALSE,;t t +s,@AMDEPBACKSLASH@,$AMDEPBACKSLASH,;t t +s,@CCDEPMODE@,$CCDEPMODE,;t t +s,@am__fastdepCC_TRUE@,$am__fastdepCC_TRUE,;t t +s,@am__fastdepCC_FALSE@,$am__fastdepCC_FALSE,;t t +s,@CFLAGS@,$CFLAGS,;t t +s,@CPP@,$CPP,;t t +s,@CPPFLAGS@,$CPPFLAGS,;t t +s,@CCAS@,$CCAS,;t t +s,@CCASFLAGS@,$CCASFLAGS,;t t +s,@LIBGCCM_USE_SYMVER_TRUE@,$LIBGCCM_USE_SYMVER_TRUE,;t t +s,@LIBGCCM_USE_SYMVER_FALSE@,$LIBGCCM_USE_SYMVER_FALSE,;t t +s,@TARGET_ILP32_TRUE@,$TARGET_ILP32_TRUE,;t t +s,@TARGET_ILP32_FALSE@,$TARGET_ILP32_FALSE,;t t +s,@LN_S@,$LN_S,;t t +s,@RANLIB@,$RANLIB,;t t +s,@ac_ct_RANLIB@,$ac_ct_RANLIB,;t t +s,@LIBTOOL@,$LIBTOOL,;t t +s,@enable_shared@,$enable_shared,;t t +s,@enable_static@,$enable_static,;t t +s,@toolexecdir@,$toolexecdir,;t t +s,@toolexeclibdir@,$toolexeclibdir,;t t +s,@arch_subdirs@,$arch_subdirs,;t t +s,@arch_libraries@,$arch_libraries,;t t +s,@arch_maps@,$arch_maps,;t t +s,@BUILD_LIBGCC_MATH_TRUE@,$BUILD_LIBGCC_MATH_TRUE,;t t +s,@BUILD_LIBGCC_MATH_FALSE@,$BUILD_LIBGCC_MATH_FALSE,;t t +s,@LIBOBJS@,$LIBOBJS,;t t +s,@LTLIBOBJS@,$LTLIBOBJS,;t t +CEOF + +_ACEOF + + cat >>$CONFIG_STATUS <<\_ACEOF + # Split the substitutions into bite-sized pieces for seds with + # small command number limits, like on Digital OSF/1 and HP-UX. + ac_max_sed_lines=48 + ac_sed_frag=1 # Number of current file. + ac_beg=1 # First line for current file. + ac_end=$ac_max_sed_lines # Line after last line for current file. + ac_more_lines=: + ac_sed_cmds= + while $ac_more_lines; do + if test $ac_beg -gt 1; then + sed "1,${ac_beg}d; ${ac_end}q" $tmp/subs.sed >$tmp/subs.frag + else + sed "${ac_end}q" $tmp/subs.sed >$tmp/subs.frag + fi + if test ! -s $tmp/subs.frag; then + ac_more_lines=false + else + # The purpose of the label and of the branching condition is to + # speed up the sed processing (if there are no `@' at all, there + # is no need to browse any of the substitutions). + # These are the two extra sed commands mentioned above. + (echo ':t + /@[a-zA-Z_][a-zA-Z_0-9]*@/!b' && cat $tmp/subs.frag) >$tmp/subs-$ac_sed_frag.sed + if test -z "$ac_sed_cmds"; then + ac_sed_cmds="sed -f $tmp/subs-$ac_sed_frag.sed" + else + ac_sed_cmds="$ac_sed_cmds | sed -f $tmp/subs-$ac_sed_frag.sed" + fi + ac_sed_frag=`expr $ac_sed_frag + 1` + ac_beg=$ac_end + ac_end=`expr $ac_end + $ac_max_sed_lines` + fi + done + if test -z "$ac_sed_cmds"; then + ac_sed_cmds=cat + fi +fi # test -n "$CONFIG_FILES" + +_ACEOF +cat >>$CONFIG_STATUS <<\_ACEOF +for ac_file in : $CONFIG_FILES; do test "x$ac_file" = x: && continue + # Support "outfile[:infile[:infile...]]", defaulting infile="outfile.in". + case $ac_file in + - | *:- | *:-:* ) # input from stdin + cat >$tmp/stdin + ac_file_in=`echo "$ac_file" | sed 's,[^:]*:,,'` + ac_file=`echo "$ac_file" | sed 's,:.*,,'` ;; + *:* ) ac_file_in=`echo "$ac_file" | sed 's,[^:]*:,,'` + ac_file=`echo "$ac_file" | sed 's,:.*,,'` ;; + * ) ac_file_in=$ac_file.in ;; + esac + + # Compute @srcdir@, @top_srcdir@, and @INSTALL@ for subdirectories. + ac_dir=`(dirname "$ac_file") 2>/dev/null || +$as_expr X"$ac_file" : 'X\(.*[^/]\)//*[^/][^/]*/*$' \| \ + X"$ac_file" : 'X\(//\)[^/]' \| \ + X"$ac_file" : 'X\(//\)$' \| \ + X"$ac_file" : 'X\(/\)' \| \ + . : '\(.\)' 2>/dev/null || +echo X"$ac_file" | + sed '/^X\(.*[^/]\)\/\/*[^/][^/]*\/*$/{ s//\1/; q; } + /^X\(\/\/\)[^/].*/{ s//\1/; q; } + /^X\(\/\/\)$/{ s//\1/; q; } + /^X\(\/\).*/{ s//\1/; q; } + s/.*/./; q'` + { if $as_mkdir_p; then + mkdir -p "$ac_dir" + else + as_dir="$ac_dir" + as_dirs= + while test ! -d "$as_dir"; do + as_dirs="$as_dir $as_dirs" + as_dir=`(dirname "$as_dir") 2>/dev/null || +$as_expr X"$as_dir" : 'X\(.*[^/]\)//*[^/][^/]*/*$' \| \ + X"$as_dir" : 'X\(//\)[^/]' \| \ + X"$as_dir" : 'X\(//\)$' \| \ + X"$as_dir" : 'X\(/\)' \| \ + . : '\(.\)' 2>/dev/null || +echo X"$as_dir" | + sed '/^X\(.*[^/]\)\/\/*[^/][^/]*\/*$/{ s//\1/; q; } + /^X\(\/\/\)[^/].*/{ s//\1/; q; } + /^X\(\/\/\)$/{ s//\1/; q; } + /^X\(\/\).*/{ s//\1/; q; } + s/.*/./; q'` + done + test ! -n "$as_dirs" || mkdir $as_dirs + fi || { { echo "$as_me:$LINENO: error: cannot create directory \"$ac_dir\"" >&5 +echo "$as_me: error: cannot create directory \"$ac_dir\"" >&2;} + { (exit 1); exit 1; }; }; } + + ac_builddir=. + +if test "$ac_dir" != .; then + ac_dir_suffix=/`echo "$ac_dir" | sed 's,^\.[\\/],,'` + # A "../" for each directory in $ac_dir_suffix. + ac_top_builddir=`echo "$ac_dir_suffix" | sed 's,/[^\\/]*,../,g'` +else + ac_dir_suffix= ac_top_builddir= +fi + +case $srcdir in + .) # No --srcdir option. We are building in place. + ac_srcdir=. + if test -z "$ac_top_builddir"; then + ac_top_srcdir=. + else + ac_top_srcdir=`echo $ac_top_builddir | sed 's,/$,,'` + fi ;; + [\\/]* | ?:[\\/]* ) # Absolute path. + ac_srcdir=$srcdir$ac_dir_suffix; + ac_top_srcdir=$srcdir ;; + *) # Relative path. + ac_srcdir=$ac_top_builddir$srcdir$ac_dir_suffix + ac_top_srcdir=$ac_top_builddir$srcdir ;; +esac + +# Do not use `cd foo && pwd` to compute absolute paths, because +# the directories may not exist. +case `pwd` in +.) ac_abs_builddir="$ac_dir";; +*) + case "$ac_dir" in + .) ac_abs_builddir=`pwd`;; + [\\/]* | ?:[\\/]* ) ac_abs_builddir="$ac_dir";; + *) ac_abs_builddir=`pwd`/"$ac_dir";; + esac;; +esac +case $ac_abs_builddir in +.) ac_abs_top_builddir=${ac_top_builddir}.;; +*) + case ${ac_top_builddir}. in + .) ac_abs_top_builddir=$ac_abs_builddir;; + [\\/]* | ?:[\\/]* ) ac_abs_top_builddir=${ac_top_builddir}.;; + *) ac_abs_top_builddir=$ac_abs_builddir/${ac_top_builddir}.;; + esac;; +esac +case $ac_abs_builddir in +.) ac_abs_srcdir=$ac_srcdir;; +*) + case $ac_srcdir in + .) ac_abs_srcdir=$ac_abs_builddir;; + [\\/]* | ?:[\\/]* ) ac_abs_srcdir=$ac_srcdir;; + *) ac_abs_srcdir=$ac_abs_builddir/$ac_srcdir;; + esac;; +esac +case $ac_abs_builddir in +.) ac_abs_top_srcdir=$ac_top_srcdir;; +*) + case $ac_top_srcdir in + .) ac_abs_top_srcdir=$ac_abs_builddir;; + [\\/]* | ?:[\\/]* ) ac_abs_top_srcdir=$ac_top_srcdir;; + *) ac_abs_top_srcdir=$ac_abs_builddir/$ac_top_srcdir;; + esac;; +esac + + + case $INSTALL in + [\\/$]* | ?:[\\/]* ) ac_INSTALL=$INSTALL ;; + *) ac_INSTALL=$ac_top_builddir$INSTALL ;; + esac + + if test x"$ac_file" != x-; then + { echo "$as_me:$LINENO: creating $ac_file" >&5 +echo "$as_me: creating $ac_file" >&6;} + rm -f "$ac_file" + fi + # Let's still pretend it is `configure' which instantiates (i.e., don't + # use $as_me), people would be surprised to read: + # /* config.h. Generated by config.status. */ + if test x"$ac_file" = x-; then + configure_input= + else + configure_input="$ac_file. " + fi + configure_input=$configure_input"Generated from `echo $ac_file_in | + sed 's,.*/,,'` by configure." + + # First look for the input files in the build tree, otherwise in the + # src tree. + ac_file_inputs=`IFS=: + for f in $ac_file_in; do + case $f in + -) echo $tmp/stdin ;; + [\\/$]*) + # Absolute (can't be DOS-style, as IFS=:) + test -f "$f" || { { echo "$as_me:$LINENO: error: cannot find input file: $f" >&5 +echo "$as_me: error: cannot find input file: $f" >&2;} + { (exit 1); exit 1; }; } + echo "$f";; + *) # Relative + if test -f "$f"; then + # Build tree + echo "$f" + elif test -f "$srcdir/$f"; then + # Source tree + echo "$srcdir/$f" + else + # /dev/null tree + { { echo "$as_me:$LINENO: error: cannot find input file: $f" >&5 +echo "$as_me: error: cannot find input file: $f" >&2;} + { (exit 1); exit 1; }; } + fi;; + esac + done` || { (exit 1); exit 1; } +_ACEOF +cat >>$CONFIG_STATUS <<_ACEOF + sed "$ac_vpsub +$extrasub +_ACEOF +cat >>$CONFIG_STATUS <<\_ACEOF +:t +/@[a-zA-Z_][a-zA-Z_0-9]*@/!b +s,@configure_input@,$configure_input,;t t +s,@srcdir@,$ac_srcdir,;t t +s,@abs_srcdir@,$ac_abs_srcdir,;t t +s,@top_srcdir@,$ac_top_srcdir,;t t +s,@abs_top_srcdir@,$ac_abs_top_srcdir,;t t +s,@builddir@,$ac_builddir,;t t +s,@abs_builddir@,$ac_abs_builddir,;t t +s,@top_builddir@,$ac_top_builddir,;t t +s,@abs_top_builddir@,$ac_abs_top_builddir,;t t +s,@INSTALL@,$ac_INSTALL,;t t +" $ac_file_inputs | (eval "$ac_sed_cmds") >$tmp/out + rm -f $tmp/stdin + if test x"$ac_file" != x-; then + mv $tmp/out $ac_file + else + cat $tmp/out + rm -f $tmp/out + fi + +done +_ACEOF +cat >>$CONFIG_STATUS <<\_ACEOF + +# +# CONFIG_COMMANDS section. +# +for ac_file in : $CONFIG_COMMANDS; do test "x$ac_file" = x: && continue + ac_dest=`echo "$ac_file" | sed 's,:.*,,'` + ac_source=`echo "$ac_file" | sed 's,[^:]*:,,'` + ac_dir=`(dirname "$ac_dest") 2>/dev/null || +$as_expr X"$ac_dest" : 'X\(.*[^/]\)//*[^/][^/]*/*$' \| \ + X"$ac_dest" : 'X\(//\)[^/]' \| \ + X"$ac_dest" : 'X\(//\)$' \| \ + X"$ac_dest" : 'X\(/\)' \| \ + . : '\(.\)' 2>/dev/null || +echo X"$ac_dest" | + sed '/^X\(.*[^/]\)\/\/*[^/][^/]*\/*$/{ s//\1/; q; } + /^X\(\/\/\)[^/].*/{ s//\1/; q; } + /^X\(\/\/\)$/{ s//\1/; q; } + /^X\(\/\).*/{ s//\1/; q; } + s/.*/./; q'` + { if $as_mkdir_p; then + mkdir -p "$ac_dir" + else + as_dir="$ac_dir" + as_dirs= + while test ! -d "$as_dir"; do + as_dirs="$as_dir $as_dirs" + as_dir=`(dirname "$as_dir") 2>/dev/null || +$as_expr X"$as_dir" : 'X\(.*[^/]\)//*[^/][^/]*/*$' \| \ + X"$as_dir" : 'X\(//\)[^/]' \| \ + X"$as_dir" : 'X\(//\)$' \| \ + X"$as_dir" : 'X\(/\)' \| \ + . : '\(.\)' 2>/dev/null || +echo X"$as_dir" | + sed '/^X\(.*[^/]\)\/\/*[^/][^/]*\/*$/{ s//\1/; q; } + /^X\(\/\/\)[^/].*/{ s//\1/; q; } + /^X\(\/\/\)$/{ s//\1/; q; } + /^X\(\/\).*/{ s//\1/; q; } + s/.*/./; q'` + done + test ! -n "$as_dirs" || mkdir $as_dirs + fi || { { echo "$as_me:$LINENO: error: cannot create directory \"$ac_dir\"" >&5 +echo "$as_me: error: cannot create directory \"$ac_dir\"" >&2;} + { (exit 1); exit 1; }; }; } + + ac_builddir=. + +if test "$ac_dir" != .; then + ac_dir_suffix=/`echo "$ac_dir" | sed 's,^\.[\\/],,'` + # A "../" for each directory in $ac_dir_suffix. + ac_top_builddir=`echo "$ac_dir_suffix" | sed 's,/[^\\/]*,../,g'` +else + ac_dir_suffix= ac_top_builddir= +fi + +case $srcdir in + .) # No --srcdir option. We are building in place. + ac_srcdir=. + if test -z "$ac_top_builddir"; then + ac_top_srcdir=. + else + ac_top_srcdir=`echo $ac_top_builddir | sed 's,/$,,'` + fi ;; + [\\/]* | ?:[\\/]* ) # Absolute path. + ac_srcdir=$srcdir$ac_dir_suffix; + ac_top_srcdir=$srcdir ;; + *) # Relative path. + ac_srcdir=$ac_top_builddir$srcdir$ac_dir_suffix + ac_top_srcdir=$ac_top_builddir$srcdir ;; +esac + +# Do not use `cd foo && pwd` to compute absolute paths, because +# the directories may not exist. +case `pwd` in +.) ac_abs_builddir="$ac_dir";; +*) + case "$ac_dir" in + .) ac_abs_builddir=`pwd`;; + [\\/]* | ?:[\\/]* ) ac_abs_builddir="$ac_dir";; + *) ac_abs_builddir=`pwd`/"$ac_dir";; + esac;; +esac +case $ac_abs_builddir in +.) ac_abs_top_builddir=${ac_top_builddir}.;; +*) + case ${ac_top_builddir}. in + .) ac_abs_top_builddir=$ac_abs_builddir;; + [\\/]* | ?:[\\/]* ) ac_abs_top_builddir=${ac_top_builddir}.;; + *) ac_abs_top_builddir=$ac_abs_builddir/${ac_top_builddir}.;; + esac;; +esac +case $ac_abs_builddir in +.) ac_abs_srcdir=$ac_srcdir;; +*) + case $ac_srcdir in + .) ac_abs_srcdir=$ac_abs_builddir;; + [\\/]* | ?:[\\/]* ) ac_abs_srcdir=$ac_srcdir;; + *) ac_abs_srcdir=$ac_abs_builddir/$ac_srcdir;; + esac;; +esac +case $ac_abs_builddir in +.) ac_abs_top_srcdir=$ac_top_srcdir;; +*) + case $ac_top_srcdir in + .) ac_abs_top_srcdir=$ac_abs_builddir;; + [\\/]* | ?:[\\/]* ) ac_abs_top_srcdir=$ac_top_srcdir;; + *) ac_abs_top_srcdir=$ac_abs_builddir/$ac_top_srcdir;; + esac;; +esac + + + { echo "$as_me:$LINENO: executing $ac_dest commands" >&5 +echo "$as_me: executing $ac_dest commands" >&6;} + case $ac_dest in + default-1 ) +# Only add multilib support code if we just rebuilt the top-level +# Makefile. +case " $CONFIG_FILES " in + *" Makefile "*) + ac_file=Makefile . ${multi_basedir}/config-ml.in + ;; +esac ;; + depfiles ) test x"$AMDEP_TRUE" != x"" || for mf in $CONFIG_FILES; do + # Strip MF so we end up with the name of the file. + mf=`echo "$mf" | sed -e 's/:.*$//'` + # Check whether this is an Automake generated Makefile or not. + # We used to match only the files named `Makefile.in', but + # some people rename them; so instead we look at the file content. + # Grep'ing the first line is not enough: some people post-process + # each Makefile.in and add a new line on top of each file to say so. + # So let's grep whole file. + if grep '^#.*generated by automake' $mf > /dev/null 2>&1; then + dirpart=`(dirname "$mf") 2>/dev/null || +$as_expr X"$mf" : 'X\(.*[^/]\)//*[^/][^/]*/*$' \| \ + X"$mf" : 'X\(//\)[^/]' \| \ + X"$mf" : 'X\(//\)$' \| \ + X"$mf" : 'X\(/\)' \| \ + . : '\(.\)' 2>/dev/null || +echo X"$mf" | + sed '/^X\(.*[^/]\)\/\/*[^/][^/]*\/*$/{ s//\1/; q; } + /^X\(\/\/\)[^/].*/{ s//\1/; q; } + /^X\(\/\/\)$/{ s//\1/; q; } + /^X\(\/\).*/{ s//\1/; q; } + s/.*/./; q'` + else + continue + fi + # Extract the definition of DEPDIR, am__include, and am__quote + # from the Makefile without running `make'. + DEPDIR=`sed -n 's/^DEPDIR = //p' < "$mf"` + test -z "$DEPDIR" && continue + am__include=`sed -n 's/^am__include = //p' < "$mf"` + test -z "am__include" && continue + am__quote=`sed -n 's/^am__quote = //p' < "$mf"` + # When using ansi2knr, U may be empty or an underscore; expand it + U=`sed -n 's/^U = //p' < "$mf"` + # Find all dependency output files, they are included files with + # $(DEPDIR) in their names. We invoke sed twice because it is the + # simplest approach to changing $(DEPDIR) to its actual value in the + # expansion. + for file in `sed -n " + s/^$am__include $am__quote\(.*(DEPDIR).*\)$am__quote"'$/\1/p' <"$mf" | \ + sed -e 's/\$(DEPDIR)/'"$DEPDIR"'/g' -e 's/\$U/'"$U"'/g'`; do + # Make sure the directory exists. + test -f "$dirpart/$file" && continue + fdir=`(dirname "$file") 2>/dev/null || +$as_expr X"$file" : 'X\(.*[^/]\)//*[^/][^/]*/*$' \| \ + X"$file" : 'X\(//\)[^/]' \| \ + X"$file" : 'X\(//\)$' \| \ + X"$file" : 'X\(/\)' \| \ + . : '\(.\)' 2>/dev/null || +echo X"$file" | + sed '/^X\(.*[^/]\)\/\/*[^/][^/]*\/*$/{ s//\1/; q; } + /^X\(\/\/\)[^/].*/{ s//\1/; q; } + /^X\(\/\/\)$/{ s//\1/; q; } + /^X\(\/\).*/{ s//\1/; q; } + s/.*/./; q'` + { if $as_mkdir_p; then + mkdir -p $dirpart/$fdir + else + as_dir=$dirpart/$fdir + as_dirs= + while test ! -d "$as_dir"; do + as_dirs="$as_dir $as_dirs" + as_dir=`(dirname "$as_dir") 2>/dev/null || +$as_expr X"$as_dir" : 'X\(.*[^/]\)//*[^/][^/]*/*$' \| \ + X"$as_dir" : 'X\(//\)[^/]' \| \ + X"$as_dir" : 'X\(//\)$' \| \ + X"$as_dir" : 'X\(/\)' \| \ + . : '\(.\)' 2>/dev/null || +echo X"$as_dir" | + sed '/^X\(.*[^/]\)\/\/*[^/][^/]*\/*$/{ s//\1/; q; } + /^X\(\/\/\)[^/].*/{ s//\1/; q; } + /^X\(\/\/\)$/{ s//\1/; q; } + /^X\(\/\).*/{ s//\1/; q; } + s/.*/./; q'` + done + test ! -n "$as_dirs" || mkdir $as_dirs + fi || { { echo "$as_me:$LINENO: error: cannot create directory $dirpart/$fdir" >&5 +echo "$as_me: error: cannot create directory $dirpart/$fdir" >&2;} + { (exit 1); exit 1; }; }; } + + # echo "creating $dirpart/$file" + echo '# dummy' > "$dirpart/$file" + done +done + ;; + esac +done +_ACEOF + +cat >>$CONFIG_STATUS <<\_ACEOF + +{ (exit 0); exit 0; } +_ACEOF +chmod +x $CONFIG_STATUS +ac_clean_files=$ac_clean_files_save + + +# configure is writing to config.log, and then calls config.status. +# config.status does its own redirection, appending to config.log. +# Unfortunately, on DOS this fails, as config.log is still kept open +# by configure, so config.status won't be able to write to it; its +# output is simply discarded. So we exec the FD to /dev/null, +# effectively closing config.log, so it can be properly (re)opened and +# appended to by config.status. When coming back to configure, we +# need to make the FD available again. +if test "$no_create" != yes; then + ac_cs_success=: + ac_config_status_args= + test "$silent" = yes && + ac_config_status_args="$ac_config_status_args --quiet" + exec 5>/dev/null + $SHELL $CONFIG_STATUS $ac_config_status_args || ac_cs_success=false + exec 5>>config.log + # Use ||, not &&, to avoid exiting from the if with $? = 1, which + # would make configure fail if this is the last instruction. + $ac_cs_success || { (exit 1); exit 1; } +fi + diff --git a/libgcc-math/configure.ac b/libgcc-math/configure.ac new file mode 100644 index 00000000000..392855255d1 --- /dev/null +++ b/libgcc-math/configure.ac @@ -0,0 +1,148 @@ +# Process this file with autoconf to produce a configure script, like so: +# aclocal && autoconf && autoheader && automake + +AC_PREREQ(2.59) +AC_INIT(libgcc-math, 1.0) +AC_CONFIG_SRCDIR(configure.ac) +AC_CANONICAL_SYSTEM + +AM_INIT_AUTOMAKE + +AC_MSG_CHECKING([for --enable-version-specific-runtime-libs]) +AC_ARG_ENABLE(version-specific-runtime-libs, +[ --enable-version-specific-runtime-libs Specify that runtime libraries should be installed in a compiler-specific directory ], +[case "$enableval" in + yes) version_specific_libs=yes ;; + no) version_specific_libs=no ;; + *) AC_MSG_ERROR([Unknown argument to enable/disable version-specific libs]);; + esac], +[version_specific_libs=no]) +AC_MSG_RESULT($version_specific_libs) + +AM_MAINTAINER_MODE +AC_EXEEXT + +AM_ENABLE_MULTILIB(, ..) + +target_alias=${target_alias-$host_alias} +AC_SUBST(target_alias) + +AC_LANG_C +# The same as in boehm-gc and libstdc++. Have to borrow it from there. +# We must force CC to /not/ be precious variables; otherwise +# the wrong, non-multilib-adjusted value will be used in multilibs. +# As a side effect, we have to subst CFLAGS ourselves. + +m4_rename([_AC_ARG_VAR_PRECIOUS],[real_PRECIOUS]) +m4_define([_AC_ARG_VAR_PRECIOUS],[]) +AC_PROG_CC +m4_rename([real_PRECIOUS],[_AC_ARG_VAR_PRECIOUS]) + +AC_SUBST(CFLAGS) + +if test "x$GCC" != "xyes"; then + AC_MSG_ERROR([libgcc-math must be built with GCC]) +fi +AC_PROG_CPP +AM_PROG_AS + +AC_MSG_CHECKING([whether hidden visibility is supported]) +AC_TRY_COMPILE([ +void __attribute__((visibility ("hidden"))) bar (void) {}],, +[gccm_hidden=yes],[gccm_hidden=no]) +AC_MSG_RESULT($gccm_hidden) +if test x$gccm_hidden = xyes; then + AC_DEFINE([HAVE_HIDDEN_VISIBILITY],[1],[__attribute__((visibility ("hidden"))) supported]) +fi + +AC_MSG_CHECKING([whether symbol versioning is supported]) +cat > conftest.map <>20)&2047; + k = (k-450)/24; + if (k<0) + k=0; + gor.x = t576.x; + gor.i[HIGH_HALF] -= ((k*24)<<20); + for (i=0;i<6;i++) + { r[i] = x1*toverp[k+i]*gor.x; gor.x *= tm24.x; } + for (i=0;i<3;i++) { + s=(r[i]+big.x)-big.x; + sum+=s; + r[i]-=s; + } + t=0; + for (i=0;i<6;i++) + t+=r[5-i]; + bb=(((((r[0]-t)+r[1])+r[2])+r[3])+r[4])+r[5]; + s=(t+big.x)-big.x; + sum+=s; + t-=s; + b=t+bb; + bb=(t-b)+bb; + s=(sum+big1.x)-big1.x; + sum-=s; + b1=b; + bb1=bb; + sum1=sum; + sum=0; + + u.x = x2; + k = (u.i[HIGH_HALF]>>20)&2047; + k = (k-450)/24; + if (k<0) + k=0; + gor.x = t576.x; + gor.i[HIGH_HALF] -= ((k*24)<<20); + for (i=0;i<6;i++) + { r[i] = x2*toverp[k+i]*gor.x; gor.x *= tm24.x; } + for (i=0;i<3;i++) { + s=(r[i]+big.x)-big.x; + sum+=s; + r[i]-=s; + } + t=0; + for (i=0;i<6;i++) + t+=r[5-i]; + bb=(((((r[0]-t)+r[1])+r[2])+r[3])+r[4])+r[5]; + s=(t+big.x)-big.x; + sum+=s; + t-=s; + b=t+bb; + bb=(t-b)+bb; + s=(sum+big1.x)-big1.x; + sum-=s; + + b2=b; + bb2=bb; + sum2=sum; + + sum=sum1+sum2; + b=b1+b2; + bb = (ABS(b1)>ABS(b2))? (b1-b)+b2 : (b2-b)+b1; + if (b > 0.5) + {b-=1.0; sum+=1.0;} + else if (b < -0.5) + {b+=1.0; sum-=1.0;} + s=b+(bb+bb1+bb2); + t=((b-s)+bb)+(bb1+bb2); + b=s*split; + t1=b-(b-s); + t2=s-t1; + b=s*hp0.x; + bb=(((t1*mp1.x-b)+t1*mp2.x)+t2*mp1.x)+(t2*mp2.x+s*hp1.x+t*hp0.x); + s=b+bb; + t=(b-s)+bb; + *a=s; + *aa=t; + return ((int) sum)&3; /* return quater of unit circle */ +} diff --git a/libgcc-math/dbl-64/branred.h b/libgcc-math/dbl-64/branred.h new file mode 100644 index 00000000000..48f8976640f --- /dev/null +++ b/libgcc-math/dbl-64/branred.h @@ -0,0 +1,80 @@ +/* + * IBM Accurate Mathematical Library + * Written by International Business Machines Corp. + * Copyright (C) 2001 Free Software Foundation, Inc. + * + * This program is free software; you can redistribute it and/or modify + * it under the terms of the GNU Lesser General Public License as published by + * the Free Software Foundation; either version 2.1 of the License, or + * (at your option) any later version. + * + * This program is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU Lesser General Public License for more details. + * + * You should have received a copy of the GNU Lesser General Public License + * along with this program; if not, write to the Free Software + * Foundation, Inc., 59 Temple Place - Suite 330, Boston, MA 02111-1307, USA. + */ +/************************************************************************/ +/* MODULE_NAME: branred.h */ +/* */ +/* */ +/* common data and variables definition for BIG or LITTLE ENDIAN */ +/************************************************************************/ + +#ifndef BRANRED_H +#define BRANRED_H + + +#ifdef BIG_ENDI +static const mynumber + +/**/ t576 = {{0x63f00000, 0x00000000}}, /* 2 ^ 576 */ +/**/ tm600 = {{0x1a700000, 0x00000000}}, /* 2 ^- 600 */ +/**/ tm24 = {{0x3e700000, 0x00000000}}, /* 2 ^- 24 */ +/**/ big = {{0x43380000, 0x00000000}}, /* 6755399441055744 */ +/**/ big1 = {{0x43580000, 0x00000000}}, /* 27021597764222976 */ +/**/ hp0 = {{0x3FF921FB, 0x54442D18}} ,/* 1.5707963267948966 */ +/**/ hp1 = {{0x3C91A626, 0x33145C07}} ,/* 6.123233995736766e-17 */ +/**/ mp1 = {{0x3FF921FB, 0x58000000}}, /* 1.5707963407039642 */ +/**/ mp2 = {{0xBE4DDE97, 0x40000000}}; /*-1.3909067675399456e-08 */ + +#else +#ifdef LITTLE_ENDI +static const mynumber + +/**/ t576 = {{0x00000000, 0x63f00000}}, /* 2 ^ 576 */ +/**/ tm600 = {{0x00000000, 0x1a700000}}, /* 2 ^- 600 */ +/**/ tm24 = {{0x00000000, 0x3e700000}}, /* 2 ^- 24 */ +/**/ big = {{0x00000000, 0x43380000}}, /* 6755399441055744 */ +/**/ big1 = {{0x00000000, 0x43580000}}, /* 27021597764222976 */ +/**/ hp0 = {{0x54442D18, 0x3FF921FB}}, /* 1.5707963267948966 */ +/**/ hp1 = {{0x33145C07, 0x3C91A626}}, /* 6.123233995736766e-17 */ +/**/ mp1 = {{0x58000000, 0x3FF921FB}}, /* 1.5707963407039642 */ +/**/ mp2 = {{0x40000000, 0xBE4DDE97}}; /*-1.3909067675399456e-08 */ + +#endif +#endif + +static const double toverp[75] = { /* 2/ PI base 24*/ + 10680707.0, 7228996.0, 1387004.0, 2578385.0, 16069853.0, + 12639074.0, 9804092.0, 4427841.0, 16666979.0, 11263675.0, + 12935607.0, 2387514.0, 4345298.0, 14681673.0, 3074569.0, + 13734428.0, 16653803.0, 1880361.0, 10960616.0, 8533493.0, + 3062596.0, 8710556.0, 7349940.0, 6258241.0, 3772886.0, + 3769171.0, 3798172.0, 8675211.0, 12450088.0, 3874808.0, + 9961438.0, 366607.0, 15675153.0, 9132554.0, 7151469.0, + 3571407.0, 2607881.0, 12013382.0, 4155038.0, 6285869.0, + 7677882.0, 13102053.0, 15825725.0, 473591.0, 9065106.0, + 15363067.0, 6271263.0, 9264392.0, 5636912.0, 4652155.0, + 7056368.0, 13614112.0, 10155062.0, 1944035.0, 9527646.0, + 15080200.0, 6658437.0, 6231200.0, 6832269.0, 16767104.0, + 5075751.0, 3212806.0, 1398474.0, 7579849.0, 6349435.0, + 12618859.0, 4703257.0, 12806093.0, 14477321.0, 2786137.0, + 12875403.0, 9837734.0, 14528324.0, 13719321.0, 343717.0 }; + +static const double split = 134217729.0; + +#endif diff --git a/libgcc-math/dbl-64/dla.h b/libgcc-math/dbl-64/dla.h new file mode 100644 index 00000000000..bf73fa902e2 --- /dev/null +++ b/libgcc-math/dbl-64/dla.h @@ -0,0 +1,174 @@ +/* + * IBM Accurate Mathematical Library + * Written by International Business Machines Corp. + * Copyright (C) 2001 Free Software Foundation, Inc. + * + * This program is free software; you can redistribute it and/or modify + * it under the terms of the GNU Lesser General Public License as published by + * the Free Software Foundation; either version 2.1 of the License, or + * (at your option) any later version. + * + * This program is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU Lesser General Public License for more details. + * + * You should have received a copy of the GNU Lesser General Public License + * along with this program; if not, write to the Free Software + * Foundation, Inc., 59 Temple Place - Suite 330, Boston, MA 02111-1307, USA. + */ + +/***********************************************************************/ +/*MODULE_NAME: dla.h */ +/* */ +/* This file holds C language macros for 'Double Length Floating Point */ +/* Arithmetic'. The macros are based on the paper: */ +/* T.J.Dekker, "A floating-point Technique for extending the */ +/* Available Precision", Number. Math. 18, 224-242 (1971). */ +/* A Double-Length number is defined by a pair (r,s), of IEEE double */ +/* precision floating point numbers that satisfy, */ +/* */ +/* abs(s) <= abs(r+s)*2**(-53)/(1+2**(-53)). */ +/* */ +/* The computer arithmetic assumed is IEEE double precision in */ +/* round to nearest mode. All variables in the macros must be of type */ +/* IEEE double. */ +/***********************************************************************/ + +/* CN = 1+2**27 = '41a0000002000000' IEEE double format */ +#define CN 134217729.0 + + +/* Exact addition of two single-length floating point numbers, Dekker. */ +/* The macro produces a double-length number (z,zz) that satisfies */ +/* z+zz = x+y exactly. */ + +#define EADD(x,y,z,zz) \ + z=(x)+(y); zz=(ABS(x)>ABS(y)) ? (((x)-(z))+(y)) : (((y)-(z))+(x)); + + +/* Exact subtraction of two single-length floating point numbers, Dekker. */ +/* The macro produces a double-length number (z,zz) that satisfies */ +/* z+zz = x-y exactly. */ + +#define ESUB(x,y,z,zz) \ + z=(x)-(y); zz=(ABS(x)>ABS(y)) ? (((x)-(z))-(y)) : ((x)-((y)+(z))); + + +/* Exact multiplication of two single-length floating point numbers, */ +/* Veltkamp. The macro produces a double-length number (z,zz) that */ +/* satisfies z+zz = x*y exactly. p,hx,tx,hy,ty are temporary */ +/* storage variables of type double. */ + +#define EMULV(x,y,z,zz,p,hx,tx,hy,ty) \ + p=CN*(x); hx=((x)-p)+p; tx=(x)-hx; \ + p=CN*(y); hy=((y)-p)+p; ty=(y)-hy; \ + z=(x)*(y); zz=(((hx*hy-z)+hx*ty)+tx*hy)+tx*ty; + + +/* Exact multiplication of two single-length floating point numbers, Dekker. */ +/* The macro produces a nearly double-length number (z,zz) (see Dekker) */ +/* that satisfies z+zz = x*y exactly. p,hx,tx,hy,ty,q are temporary */ +/* storage variables of type double. */ + +#define MUL12(x,y,z,zz,p,hx,tx,hy,ty,q) \ + p=CN*(x); hx=((x)-p)+p; tx=(x)-hx; \ + p=CN*(y); hy=((y)-p)+p; ty=(y)-hy; \ + p=hx*hy; q=hx*ty+tx*hy; z=p+q; zz=((p-z)+q)+tx*ty; + + +/* Double-length addition, Dekker. The macro produces a double-length */ +/* number (z,zz) which satisfies approximately z+zz = x+xx + y+yy. */ +/* An error bound: (abs(x+xx)+abs(y+yy))*4.94e-32. (x,xx), (y,yy) */ +/* are assumed to be double-length numbers. r,s are temporary */ +/* storage variables of type double. */ + +#define ADD2(x,xx,y,yy,z,zz,r,s) \ + r=(x)+(y); s=(ABS(x)>ABS(y)) ? \ + (((((x)-r)+(y))+(yy))+(xx)) : \ + (((((y)-r)+(x))+(xx))+(yy)); \ + z=r+s; zz=(r-z)+s; + + +/* Double-length subtraction, Dekker. The macro produces a double-length */ +/* number (z,zz) which satisfies approximately z+zz = x+xx - (y+yy). */ +/* An error bound: (abs(x+xx)+abs(y+yy))*4.94e-32. (x,xx), (y,yy) */ +/* are assumed to be double-length numbers. r,s are temporary */ +/* storage variables of type double. */ + +#define SUB2(x,xx,y,yy,z,zz,r,s) \ + r=(x)-(y); s=(ABS(x)>ABS(y)) ? \ + (((((x)-r)-(y))-(yy))+(xx)) : \ + ((((x)-((y)+r))+(xx))-(yy)); \ + z=r+s; zz=(r-z)+s; + + +/* Double-length multiplication, Dekker. The macro produces a double-length */ +/* number (z,zz) which satisfies approximately z+zz = (x+xx)*(y+yy). */ +/* An error bound: abs((x+xx)*(y+yy))*1.24e-31. (x,xx), (y,yy) */ +/* are assumed to be double-length numbers. p,hx,tx,hy,ty,q,c,cc are */ +/* temporary storage variables of type double. */ + +#define MUL2(x,xx,y,yy,z,zz,p,hx,tx,hy,ty,q,c,cc) \ + MUL12(x,y,c,cc,p,hx,tx,hy,ty,q) \ + cc=((x)*(yy)+(xx)*(y))+cc; z=c+cc; zz=(c-z)+cc; + + +/* Double-length division, Dekker. The macro produces a double-length */ +/* number (z,zz) which satisfies approximately z+zz = (x+xx)/(y+yy). */ +/* An error bound: abs((x+xx)/(y+yy))*1.50e-31. (x,xx), (y,yy) */ +/* are assumed to be double-length numbers. p,hx,tx,hy,ty,q,c,cc,u,uu */ +/* are temporary storage variables of type double. */ + +#define DIV2(x,xx,y,yy,z,zz,p,hx,tx,hy,ty,q,c,cc,u,uu) \ + c=(x)/(y); MUL12(c,y,u,uu,p,hx,tx,hy,ty,q) \ + cc=(((((x)-u)-uu)+(xx))-c*(yy))/(y); z=c+cc; zz=(c-z)+cc; + + +/* Double-length addition, slower but more accurate than ADD2. */ +/* The macro produces a double-length */ +/* number (z,zz) which satisfies approximately z+zz = (x+xx)+(y+yy). */ +/* An error bound: abs(x+xx + y+yy)*1.50e-31. (x,xx), (y,yy) */ +/* are assumed to be double-length numbers. r,rr,s,ss,u,uu,w */ +/* are temporary storage variables of type double. */ + +#define ADD2A(x,xx,y,yy,z,zz,r,rr,s,ss,u,uu,w) \ + r=(x)+(y); \ + if (ABS(x)>ABS(y)) { rr=((x)-r)+(y); s=(rr+(yy))+(xx); } \ + else { rr=((y)-r)+(x); s=(rr+(xx))+(yy); } \ + if (rr!=0.0) { \ + z=r+s; zz=(r-z)+s; } \ + else { \ + ss=(ABS(xx)>ABS(yy)) ? (((xx)-s)+(yy)) : (((yy)-s)+(xx)); \ + u=r+s; \ + uu=(ABS(r)>ABS(s)) ? ((r-u)+s) : ((s-u)+r) ; \ + w=uu+ss; z=u+w; \ + zz=(ABS(u)>ABS(w)) ? ((u-z)+w) : ((w-z)+u) ; } + + +/* Double-length subtraction, slower but more accurate than SUB2. */ +/* The macro produces a double-length */ +/* number (z,zz) which satisfies approximately z+zz = (x+xx)-(y+yy). */ +/* An error bound: abs(x+xx - (y+yy))*1.50e-31. (x,xx), (y,yy) */ +/* are assumed to be double-length numbers. r,rr,s,ss,u,uu,w */ +/* are temporary storage variables of type double. */ + +#define SUB2A(x,xx,y,yy,z,zz,r,rr,s,ss,u,uu,w) \ + r=(x)-(y); \ + if (ABS(x)>ABS(y)) { rr=((x)-r)-(y); s=(rr-(yy))+(xx); } \ + else { rr=(x)-((y)+r); s=(rr+(xx))-(yy); } \ + if (rr!=0.0) { \ + z=r+s; zz=(r-z)+s; } \ + else { \ + ss=(ABS(xx)>ABS(yy)) ? (((xx)-s)-(yy)) : ((xx)-((yy)+s)); \ + u=r+s; \ + uu=(ABS(r)>ABS(s)) ? ((r-u)+s) : ((s-u)+r) ; \ + w=uu+ss; z=u+w; \ + zz=(ABS(u)>ABS(w)) ? ((u-z)+w) : ((w-z)+u) ; } + + + + + + + diff --git a/libgcc-math/dbl-64/doasin.c b/libgcc-math/dbl-64/doasin.c new file mode 100644 index 00000000000..79f344af2dc --- /dev/null +++ b/libgcc-math/dbl-64/doasin.c @@ -0,0 +1,76 @@ +/* + * IBM Accurate Mathematical Library + * written by International Business Machines Corp. + * Copyright (C) 2001 Free Software Foundation + * + * This program is free software; you can redistribute it and/or modify + * it under the terms of the GNU Lesser General Public License as published by + * the Free Software Foundation; either version 2.1 of the License, or + * (at your option) any later version. + * + * This program is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU Lesser General Public License for more details. + * + * You should have received a copy of the GNU Lesser General Public License + * along with this program; if not, write to the Free Software + * Foundation, Inc., 59 Temple Place - Suite 330, Boston, MA 02111-1307, USA. + */ +/**********************************************************************/ +/* MODULE_NAME: doasin.c */ +/* */ +/* FUNCTION: doasin */ +/* */ +/* FILES NEEDED:endian.h mydefs.h dla.h doasin.h */ +/* mpa.c */ +/* */ +/* Compute arcsin(x,dx,v) of double-length number (x+dx) the result */ +/* stored in v where v= v[0]+v[1] =arcsin(x+dx) */ +/**********************************************************************/ + +#include "endian.h" +#include "mydefs.h" +#include "dla.h" +#include "math_private.h" + +/********************************************************************/ +/* Compute arcsin(x,dx,v) of double-length number (x+dx) the result */ +/* stored in v where v= v[0]+v[1] =arcsin(x+dx) */ +/********************************************************************/ +void __doasin(double x, double dx, double v[]) { + +#include "doasin.h" + + static const double + d5 = 0.22372159090911789889975459505194491E-01, + d6 = 0.17352764422456822913014975683014622E-01, + d7 = 0.13964843843786693521653681033981614E-01, + d8 = 0.11551791438485242609036067259086589E-01, + d9 = 0.97622386568166960207425666787248914E-02, + d10 = 0.83638737193775788576092749009744976E-02, + d11 = 0.79470250400727425881446981833568758E-02; + + double xx,p,pp,u,uu,r,s; + double hx,tx,hy,ty,tp,tq,tc,tcc; + + +/* Taylor series for arcsin for Double-Length numbers */ + xx = x*x+2.0*x*dx; + p = ((((((d11*xx+d10)*xx+d9)*xx+d8)*xx+d7)*xx+d6)*xx+d5)*xx; + pp = 0; + + MUL2(x,dx,x,dx,u,uu,tp,hx,tx,hy,ty,tq,tc,tcc); + ADD2(p,pp,c4.x,cc4.x,p,pp,r,s); + MUL2(p,pp,u,uu,p,pp,tp,hx,tx,hy,ty,tq,tc,tcc); + ADD2(p,pp,c3.x,cc3.x,p,pp,r,s); + MUL2(p,pp,u,uu,p,pp,tp,hx,tx,hy,ty,tq,tc,tcc); + ADD2(p,pp,c2.x,cc2.x,p,pp,r,s); + MUL2(p,pp,u,uu,p,pp,tp,hx,tx,hy,ty,tq,tc,tcc); + ADD2(p,pp,c1.x,cc1.x,p,pp,r,s); + MUL2(p,pp,u,uu,p,pp,tp,hx,tx,hy,ty,tq,tc,tcc); + MUL2(p,pp,x,dx,p,pp,tp,hx,tx,hy,ty,tq,tc,tcc); + ADD2(p,pp,x,dx,p,pp,r,s); + v[0]=p; + v[1]=pp; /* arcsin(x+dx)=v[0]+v[1] */ +} diff --git a/libgcc-math/dbl-64/doasin.h b/libgcc-math/dbl-64/doasin.h new file mode 100644 index 00000000000..0625e518526 --- /dev/null +++ b/libgcc-math/dbl-64/doasin.h @@ -0,0 +1,64 @@ + +/* + * IBM Accurate Mathematical Library + * Written by International Business Machines Corp. + * Copyright (C) 2001 Free Software Foundation, Inc. + * + * This program is free software; you can redistribute it and/or modify + * it under the terms of the GNU Lesser General Public License as published by + * the Free Software Foundation; either version 2.1 of the License, or + * (at your option) any later version. + * + * This program is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU Lesser General Public License for more details. + * + * You should have received a copy of the GNU Lesser General Public License + * along with this program; if not, write to the Free Software + * Foundation, Inc., 59 Temple Place - Suite 330, Boston, MA 02111-1307, USA. + */ + +/************************************************************************/ +/* MODULE_NAME: doasin.h */ +/* */ +/* */ +/* common data and variables definition for BIG or LITTLE ENDIAN */ +/************************************************************************/ + + + +#ifndef DOASIN_H +#define DOASIN_H + +#ifdef BIG_ENDI + + static const mynumber +/**/ c1 = {{0x3FC55555, 0x55555555}}, /* 0.16666666666666666 */ +/**/ cc1 = {{0x3C655555, 0x55775389}}, /* 9.2518585419753846e-18 */ +/**/ c2 = {{0x3FB33333, 0x33333333}}, /* 0.074999999999999997 */ +/**/ cc2 = {{0x3C499993, 0x63F1A115}}, /* 2.7755472886508899e-18 */ +/**/ c3 = {{0x3FA6DB6D, 0xB6DB6DB7}}, /* 0.044642857142857144 */ +/**/ cc3 = {{0xBC320FC0, 0x3D5CF0C5}}, /* -9.7911734574147224e-19 */ +/**/ c4 = {{0x3F9F1C71, 0xC71C71C5}}, /* 0.030381944444444437 */ +/**/ cc4 = {{0xBC02B240, 0xFF23ED1E}}; /* -1.2669108566898312e-19 */ + +#else +#ifdef LITTLE_ENDI + + static const mynumber +/**/ c1 = {{0x55555555, 0x3FC55555}}, /* 0.16666666666666666 */ +/**/ cc1 = {{0x55775389, 0x3C655555}}, /* 9.2518585419753846e-18 */ +/**/ c2 = {{0x33333333, 0x3FB33333}}, /* 0.074999999999999997 */ +/**/ cc2 = {{0x63F1A115, 0x3C499993}}, /* 2.7755472886508899e-18 */ +/**/ c3 = {{0xB6DB6DB7, 0x3FA6DB6D}}, /* 0.044642857142857144 */ +/**/ cc3 = {{0x3D5CF0C5, 0xBC320FC0}}, /* -9.7911734574147224e-19 */ +/**/ c4 = {{0xC71C71C5, 0x3F9F1C71}}, /* 0.030381944444444437 */ +/**/ cc4 = {{0xFF23ED1E, 0xBC02B240}}; /* -1.2669108566898312e-19 */ + + +#endif +#endif + + +#endif diff --git a/libgcc-math/dbl-64/dosincos.c b/libgcc-math/dbl-64/dosincos.c new file mode 100644 index 00000000000..1d347a4bc78 --- /dev/null +++ b/libgcc-math/dbl-64/dosincos.c @@ -0,0 +1,189 @@ +/* + * IBM Accurate Mathematical Library + * written by International Business Machines Corp. + * Copyright (C) 2001 Free Software Foundation + * + * This program is free software; you can redistribute it and/or modify + * it under the terms of the GNU Lesser General Public License as published by + * the Free Software Foundation; either version 2.1 of the License, or + * (at your option) any later version. + * + * This program is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU Lesser General Public License for more details. + * + * You should have received a copy of the GNU Lesser General Public License + * along with this program; if not, write to the Free Software + * Foundation, Inc., 59 Temple Place - Suite 330, Boston, MA 02111-1307, USA. + */ +/********************************************************************/ +/* */ +/* MODULE_NAME: dosincos.c */ +/* */ +/* */ +/* FUNCTIONS: dubsin */ +/* dubcos */ +/* docos */ +/* FILES NEEDED: endian.h mydefs.h dla.h dosincos.h */ +/* sincos.tbl */ +/* */ +/* Routines compute sin() and cos() as Double-Length numbers */ +/********************************************************************/ + + + +#include "endian.h" +#include "mydefs.h" +#include "sincos.tbl" +#include "dla.h" +#include "dosincos.h" +#include "math_private.h" + +/***********************************************************************/ +/* Routine receive Double-Length number (x+dx) and computing sin(x+dx) */ +/* as Double-Length number and store it at array v .It computes it by */ +/* arithmetic action on Double-Length numbers */ +/*(x+dx) between 0 and PI/4 */ +/***********************************************************************/ + +void __dubsin(double x, double dx, double v[]) { + double r,s,p,hx,tx,hy,ty,q,c,cc,d,dd,d2,dd2,e,ee, + sn,ssn,cs,ccs,ds,dss,dc,dcc; +#if 0 + double xx,y,yy,z,zz; +#endif + mynumber u; + int4 k; + + u.x=x+big.x; + k = u.i[LOW_HALF]<<2; + x=x-(u.x-big.x); + d=x+dx; + dd=(x-d)+dx; + /* sin(x+dx)=sin(Xi+t)=sin(Xi)*cos(t) + cos(Xi)sin(t) where t ->0 */ + MUL2(d,dd,d,dd,d2,dd2,p,hx,tx,hy,ty,q,c,cc); + sn=sincos.x[k]; /* */ + ssn=sincos.x[k+1]; /* sin(Xi) and cos(Xi) */ + cs=sincos.x[k+2]; /* */ + ccs=sincos.x[k+3]; /* */ + MUL2(d2,dd2,s7.x,ss7.x,ds,dss,p,hx,tx,hy,ty,q,c,cc); /* Taylor */ + ADD2(ds,dss,s5.x,ss5.x,ds,dss,r,s); + MUL2(d2,dd2,ds,dss,ds,dss,p,hx,tx,hy,ty,q,c,cc); /* series */ + ADD2(ds,dss,s3.x,ss3.x,ds,dss,r,s); + MUL2(d2,dd2,ds,dss,ds,dss,p,hx,tx,hy,ty,q,c,cc); /* for sin */ + MUL2(d,dd,ds,dss,ds,dss,p,hx,tx,hy,ty,q,c,cc); + ADD2(ds,dss,d,dd,ds,dss,r,s); /* ds=sin(t) */ + + MUL2(d2,dd2,c8.x,cc8.x,dc,dcc,p,hx,tx,hy,ty,q,c,cc); ;/* Taylor */ + ADD2(dc,dcc,c6.x,cc6.x,dc,dcc,r,s); + MUL2(d2,dd2,dc,dcc,dc,dcc,p,hx,tx,hy,ty,q,c,cc); /* series */ + ADD2(dc,dcc,c4.x,cc4.x,dc,dcc,r,s); + MUL2(d2,dd2,dc,dcc,dc,dcc,p,hx,tx,hy,ty,q,c,cc); /* for cos */ + ADD2(dc,dcc,c2.x,cc2.x,dc,dcc,r,s); + MUL2(d2,dd2,dc,dcc,dc,dcc,p,hx,tx,hy,ty,q,c,cc); /* dc=cos(t) */ + + MUL2(cs,ccs,ds,dss,e,ee,p,hx,tx,hy,ty,q,c,cc); + MUL2(dc,dcc,sn,ssn,dc,dcc,p,hx,tx,hy,ty,q,c,cc); + SUB2(e,ee,dc,dcc,e,ee,r,s); + ADD2(e,ee,sn,ssn,e,ee,r,s); /* e+ee=sin(x+dx) */ + + v[0]=e; + v[1]=ee; +} +/**********************************************************************/ +/* Routine receive Double-Length number (x+dx) and computes cos(x+dx) */ +/* as Double-Length number and store it in array v .It computes it by */ +/* arithmetic action on Double-Length numbers */ +/*(x+dx) between 0 and PI/4 */ +/**********************************************************************/ + +void __dubcos(double x, double dx, double v[]) { + double r,s,p,hx,tx,hy,ty,q,c,cc,d,dd,d2,dd2,e,ee, + sn,ssn,cs,ccs,ds,dss,dc,dcc; +#if 0 + double xx,y,yy,z,zz; +#endif + mynumber u; + int4 k; + u.x=x+big.x; + k = u.i[LOW_HALF]<<2; + x=x-(u.x-big.x); + d=x+dx; + dd=(x-d)+dx; /* cos(x+dx)=cos(Xi+t)=cos(Xi)cos(t) - sin(Xi)sin(t) */ + MUL2(d,dd,d,dd,d2,dd2,p,hx,tx,hy,ty,q,c,cc); + sn=sincos.x[k]; /* */ + ssn=sincos.x[k+1]; /* sin(Xi) and cos(Xi) */ + cs=sincos.x[k+2]; /* */ + ccs=sincos.x[k+3]; /* */ + MUL2(d2,dd2,s7.x,ss7.x,ds,dss,p,hx,tx,hy,ty,q,c,cc); + ADD2(ds,dss,s5.x,ss5.x,ds,dss,r,s); + MUL2(d2,dd2,ds,dss,ds,dss,p,hx,tx,hy,ty,q,c,cc); + ADD2(ds,dss,s3.x,ss3.x,ds,dss,r,s); + MUL2(d2,dd2,ds,dss,ds,dss,p,hx,tx,hy,ty,q,c,cc); + MUL2(d,dd,ds,dss,ds,dss,p,hx,tx,hy,ty,q,c,cc); + ADD2(ds,dss,d,dd,ds,dss,r,s); + + MUL2(d2,dd2,c8.x,cc8.x,dc,dcc,p,hx,tx,hy,ty,q,c,cc); + ADD2(dc,dcc,c6.x,cc6.x,dc,dcc,r,s); + MUL2(d2,dd2,dc,dcc,dc,dcc,p,hx,tx,hy,ty,q,c,cc); + ADD2(dc,dcc,c4.x,cc4.x,dc,dcc,r,s); + MUL2(d2,dd2,dc,dcc,dc,dcc,p,hx,tx,hy,ty,q,c,cc); + ADD2(dc,dcc,c2.x,cc2.x,dc,dcc,r,s); + MUL2(d2,dd2,dc,dcc,dc,dcc,p,hx,tx,hy,ty,q,c,cc); + + MUL2(cs,ccs,ds,dss,e,ee,p,hx,tx,hy,ty,q,c,cc); + MUL2(dc,dcc,sn,ssn,dc,dcc,p,hx,tx,hy,ty,q,c,cc); + + MUL2(d2,dd2,s7.x,ss7.x,ds,dss,p,hx,tx,hy,ty,q,c,cc); + ADD2(ds,dss,s5.x,ss5.x,ds,dss,r,s); + MUL2(d2,dd2,ds,dss,ds,dss,p,hx,tx,hy,ty,q,c,cc); + ADD2(ds,dss,s3.x,ss3.x,ds,dss,r,s); + MUL2(d2,dd2,ds,dss,ds,dss,p,hx,tx,hy,ty,q,c,cc); + MUL2(d,dd,ds,dss,ds,dss,p,hx,tx,hy,ty,q,c,cc); + ADD2(ds,dss,d,dd,ds,dss,r,s); + MUL2(d2,dd2,c8.x,cc8.x,dc,dcc,p,hx,tx,hy,ty,q,c,cc); + ADD2(dc,dcc,c6.x,cc6.x,dc,dcc,r,s); + MUL2(d2,dd2,dc,dcc,dc,dcc,p,hx,tx,hy,ty,q,c,cc); + ADD2(dc,dcc,c4.x,cc4.x,dc,dcc,r,s); + MUL2(d2,dd2,dc,dcc,dc,dcc,p,hx,tx,hy,ty,q,c,cc); + ADD2(dc,dcc,c2.x,cc2.x,dc,dcc,r,s); + MUL2(d2,dd2,dc,dcc,dc,dcc,p,hx,tx,hy,ty,q,c,cc); + MUL2(sn,ssn,ds,dss,e,ee,p,hx,tx,hy,ty,q,c,cc); + MUL2(dc,dcc,cs,ccs,dc,dcc,p,hx,tx,hy,ty,q,c,cc); + ADD2(e,ee,dc,dcc,e,ee,r,s); + SUB2(cs,ccs,e,ee,e,ee,r,s); + + v[0]=e; + v[1]=ee; +} +/**********************************************************************/ +/* Routine receive Double-Length number (x+dx) and computes cos(x+dx) */ +/* as Double-Length number and store it in array v */ +/**********************************************************************/ +void __docos(double x, double dx, double v[]) { + double y,yy,p,w[2]; + if (x>0) {y=x; yy=dx;} + else {y=-x; yy=-dx;} + if (y<0.5*hp0.x) /* y< PI/4 */ + {__dubcos(y,yy,w); v[0]=w[0]; v[1]=w[1];} + else if (y<1.5*hp0.x) { /* y< 3/4 * PI */ + p=hp0.x-y; /* p = PI/2 - y */ + yy=hp1.x-yy; + y=p+yy; + yy=(p-y)+yy; + if (y>0) {__dubsin(y,yy,w); v[0]=w[0]; v[1]=w[1];} + /* cos(x) = sin ( 90 - x ) */ + else {__dubsin(-y,-yy,w); v[0]=-w[0]; v[1]=-w[1]; + } + } + else { /* y>= 3/4 * PI */ + p=2.0*hp0.x-y; /* p = PI- y */ + yy=2.0*hp1.x-yy; + y=p+yy; + yy=(p-y)+yy; + __dubcos(y,yy,w); + v[0]=-w[0]; + v[1]=-w[1]; + } +} diff --git a/libgcc-math/dbl-64/dosincos.h b/libgcc-math/dbl-64/dosincos.h new file mode 100644 index 00000000000..49d61cd9179 --- /dev/null +++ b/libgcc-math/dbl-64/dosincos.h @@ -0,0 +1,81 @@ + +/* + * IBM Accurate Mathematical Library + * Written by International Business Machines Corp. + * Copyright (C) 2001 Free Software Foundation, Inc. + * + * This program is free software; you can redistribute it and/or modify + * it under the terms of the GNU Lesser General Public License as published by + * the Free Software Foundation; either version 2.1 of the License, or + * (at your option) any later version. + * + * This program is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU Lesser General Public License for more details. + * + * You should have received a copy of the GNU Lesser General Public License + * along with this program; if not, write to the Free Software + * Foundation, Inc., 59 Temple Place - Suite 330, Boston, MA 02111-1307, USA. + */ + +/************************************************************************/ +/* MODULE_NAME: dosincos.h */ +/* */ +/* */ +/* common data and variables definition for BIG or LITTLE ENDIAN */ +/************************************************************************/ + + + +#ifndef DOSINCOS_H +#define DOSINCOS_H + + +#ifdef BIG_ENDI +static const mynumber +/**/ s3 = {{0xBFC55555, 0x55555555}},/* -0.16666666666666666 */ +/**/ ss3 = {{0xBC6553AA, 0xE77EE482}},/* -9.2490366677784492e-18 */ +/**/ s5 = {{0x3F811111, 0x11110F15}},/* 0.008333333333332452 */ +/**/ ss5 = {{0xBC21AC06, 0xDA488820}},/* -4.7899996586987931e-19 */ +/**/ s7 = {{0xBF2A019F, 0x5816C78D}},/* -0.00019841261022928957 */ +/**/ ss7 = {{0x3BCDCEC9, 0x6A18BF2A}},/* 1.2624077757871259e-20 */ +/**/ c2 = {{0x3FE00000, 0x00000000}},/* 0.5 */ +/**/ cc2 = {{0xBA282FD8, 0x00000000}},/* -1.5264073330037701e-28 */ +/**/ c4 = {{0xBFA55555, 0x55555555}},/* -0.041666666666666664 */ +/**/ cc4 = {{0xBC4554BC, 0x2FFF257E}},/* -2.312711276085743e-18 */ +/**/ c6 = {{0x3F56C16C, 0x16C16A96}},/* 0.0013888888888888055 */ +/**/ cc6 = {{0xBBD2E846, 0xE6346F14}},/* -1.6015133010194884e-20 */ +/**/ c8 = {{0xBEFA019F, 0x821D5987}},/* -2.480157866754367e-05 */ +/**/ cc8 = {{0x3B7AB71E, 0x72FFE5CC}},/* 3.5357416224857556e-22 */ + +/**/ big = {{0x42c80000, 0x00000000}}, /* 52776558133248 */ + +/**/ hp0 = {{0x3FF921FB, 0x54442D18}}, /* PI / 2 */ +/**/ hp1 = {{0x3C91A626, 0x33145C07}}; /* 6.123233995736766e-17 */ +#else +#ifdef LITTLE_ENDI +static const mynumber +/**/ s3 = {{0x55555555, 0xBFC55555}},/* -0.16666666666666666 */ +/**/ ss3 = {{0xE77EE482, 0xBC6553AA}},/* -9.2490366677784492e-18 */ +/**/ s5 = {{0x11110F15, 0x3F811111}},/* 0.008333333333332452 */ +/**/ ss5 = {{0xDA488820, 0xBC21AC06}},/* -4.7899996586987931e-19 */ +/**/ s7 = {{0x5816C78D, 0xBF2A019F}},/* -0.00019841261022928957 */ +/**/ ss7 = {{0x6A18BF2A, 0x3BCDCEC9}},/* 1.2624077757871259e-20 */ +/**/ c2 = {{0x00000000, 0x3FE00000}},/* 0.5 */ +/**/ cc2 = {{0x00000000, 0xBA282FD8}},/* -1.5264073330037701e-28 */ +/**/ c4 = {{0x55555555, 0xBFA55555}},/* -0.041666666666666664 */ +/**/ cc4 = {{0x2FFF257E, 0xBC4554BC}},/* -2.312711276085743e-18 */ +/**/ c6 = {{0x16C16A96, 0x3F56C16C}},/* 0.0013888888888888055 */ +/**/ cc6 = {{0xE6346F14, 0xBBD2E846}},/* -1.6015133010194884e-20 */ +/**/ c8 = {{0x821D5987, 0xBEFA019F}},/* -2.480157866754367e-05 */ +/**/ cc8 = {{0x72FFE5CC, 0x3B7AB71E}},/* 3.5357416224857556e-22 */ + +/**/ big = {{0x00000000, 0x42c80000}}, /* 52776558133248 */ + +/**/ hp0 = {{0x54442D18, 0x3FF921FB}}, /* PI / 2 */ +/**/ hp1 = {{0x33145C07, 0x3C91A626}}; /* 6.123233995736766e-17 */ +#endif +#endif + +#endif diff --git a/libgcc-math/dbl-64/e_asin.c b/libgcc-math/dbl-64/e_asin.c new file mode 100644 index 00000000000..ce5d227b71e --- /dev/null +++ b/libgcc-math/dbl-64/e_asin.c @@ -0,0 +1,637 @@ +/* + * IBM Accurate Mathematical Library + * written by International Business Machines Corp. + * Copyright (C) 2001 Free Software Foundation + * + * This program is free software; you can redistribute it and/or modify + * it under the terms of the GNU Lesser General Public License as published by + * the Free Software Foundation; either version 2.1 of the License, or + * (at your option) any later version. + * + * This program is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU Lesser General Public License for more details. + * + * You should have received a copy of the GNU Lesser General Public License + * along with this program; if not, write to the Free Software + * Foundation, Inc., 59 Temple Place - Suite 330, Boston, MA 02111-1307, USA. + */ +/******************************************************************/ +/* MODULE_NAME:uasncs.c */ +/* */ +/* FUNCTIONS: uasin */ +/* uacos */ +/* FILES NEEDED: dla.h endian.h mpa.h mydefs.h usncs.h */ +/* doasin.c sincos32.c dosincos.c mpa.c */ +/* sincos.tbl asincos.tbl powtwo.tbl root.tbl */ +/* */ +/* Ultimate asin/acos routines. Given an IEEE double machine */ +/* number x, compute the correctly rounded value of */ +/* arcsin(x)or arccos(x) according to the function called. */ +/* Assumption: Machine arithmetic operations are performed in */ +/* round to nearest mode of IEEE 754 standard. */ +/* */ +/******************************************************************/ +#include "endian.h" +#include "mydefs.h" +#include "asincos.tbl" +#include "root.tbl" +#include "powtwo.tbl" +#include "MathLib.h" +#include "uasncs.h" +#include "math_private.h" + +void __doasin(double x, double dx, double w[]); +void __dubsin(double x, double dx, double v[]); +void __dubcos(double x, double dx, double v[]); +void __docos(double x, double dx, double v[]); +double __sin32(double x, double res, double res1); +double __cos32(double x, double res, double res1); + +/***************************************************************************/ +/* An ultimate asin routine. Given an IEEE double machine number x */ +/* it computes the correctly rounded (to nearest) value of arcsin(x) */ +/***************************************************************************/ +double __ieee754_asin(double x){ + double x1,x2,xx,s1,s2,res1,p,t,res,r,cor,cc,y,c,z,w[2]; + mynumber u,v; + int4 k,m,n; +#if 0 + int4 nn; +#endif + + u.x = x; + m = u.i[HIGH_HALF]; + k = 0x7fffffff&m; /* no sign */ + + if (k < 0x3e500000) return x; /* for x->0 => sin(x)=x */ + /*----------------------2^-26 <= |x| < 2^ -3 -----------------*/ + else + if (k < 0x3fc00000) { + x2 = x*x; + t = (((((f6*x2 + f5)*x2 + f4)*x2 + f3)*x2 + f2)*x2 + f1)*(x2*x); + res = x+t; /* res=arcsin(x) according to Taylor series */ + cor = (x-res)+t; + if (res == res+1.025*cor) return res; + else { + x1 = x+big; + xx = x*x; + x1 -= big; + x2 = x - x1; + p = x1*x1*x1; + s1 = a1.x*p; + s2 = ((((((c7*xx + c6)*xx + c5)*xx + c4)*xx + c3)*xx + c2)*xx*xx*x + + ((a1.x+a2.x)*x2*x2+ 0.5*x1*x)*x2) + a2.x*p; + res1 = x+s1; + s2 = ((x-res1)+s1)+s2; + res = res1+s2; + cor = (res1-res)+s2; + if (res == res+1.00014*cor) return res; + else { + __doasin(x,0,w); + if (w[0]==(w[0]+1.00000001*w[1])) return w[0]; + else { + y=ABS(x); + res=ABS(w[0]); + res1=ABS(w[0]+1.1*w[1]); + return (m>0)?__sin32(y,res,res1):-__sin32(y,res,res1); + } + } + } + } + /*---------------------0.125 <= |x| < 0.5 -----------------------------*/ + else if (k < 0x3fe00000) { + if (k<0x3fd00000) n = 11*((k&0x000fffff)>>15); + else n = 11*((k&0x000fffff)>>14)+352; + if (m>0) xx = x - asncs.x[n]; + else xx = -x - asncs.x[n]; + t = asncs.x[n+1]*xx; + p=xx*xx*(asncs.x[n+2]+xx*(asncs.x[n+3]+xx*(asncs.x[n+4]+xx*(asncs.x[n+5] + +xx*asncs.x[n+6]))))+asncs.x[n+7]; + t+=p; + res =asncs.x[n+8] +t; + cor = (asncs.x[n+8]-res)+t; + if (res == res+1.05*cor) return (m>0)?res:-res; + else { + r=asncs.x[n+8]+xx*asncs.x[n+9]; + t=((asncs.x[n+8]-r)+xx*asncs.x[n+9])+(p+xx*asncs.x[n+10]); + res = r+t; + cor = (r-res)+t; + if (res == res+1.0005*cor) return (m>0)?res:-res; + else { + res1=res+1.1*cor; + z=0.5*(res1-res); + __dubsin(res,z,w); + z=(w[0]-ABS(x))+w[1]; + if (z>1.0e-27) return (m>0)?min(res,res1):-min(res,res1); + else if (z<-1.0e-27) return (m>0)?max(res,res1):-max(res,res1); + else { + y=ABS(x); + return (m>0)?__sin32(y,res,res1):-__sin32(y,res,res1); + } + } + } + } /* else if (k < 0x3fe00000) */ + /*-------------------- 0.5 <= |x| < 0.75 -----------------------------*/ + else + if (k < 0x3fe80000) { + n = 1056+((k&0x000fe000)>>11)*3; + if (m>0) xx = x - asncs.x[n]; + else xx = -x - asncs.x[n]; + t = asncs.x[n+1]*xx; + p=xx*xx*(asncs.x[n+2]+xx*(asncs.x[n+3]+xx*(asncs.x[n+4]+xx*(asncs.x[n+5] + +xx*(asncs.x[n+6]+xx*asncs.x[n+7])))))+asncs.x[n+8]; + t+=p; + res =asncs.x[n+9] +t; + cor = (asncs.x[n+9]-res)+t; + if (res == res+1.01*cor) return (m>0)?res:-res; + else { + r=asncs.x[n+9]+xx*asncs.x[n+10]; + t=((asncs.x[n+9]-r)+xx*asncs.x[n+10])+(p+xx*asncs.x[n+11]); + res = r+t; + cor = (r-res)+t; + if (res == res+1.0005*cor) return (m>0)?res:-res; + else { + res1=res+1.1*cor; + z=0.5*(res1-res); + __dubsin(res,z,w); + z=(w[0]-ABS(x))+w[1]; + if (z>1.0e-27) return (m>0)?min(res,res1):-min(res,res1); + else if (z<-1.0e-27) return (m>0)?max(res,res1):-max(res,res1); + else { + y=ABS(x); + return (m>0)?__sin32(y,res,res1):-__sin32(y,res,res1); + } + } + } + } /* else if (k < 0x3fe80000) */ + /*--------------------- 0.75 <= |x|< 0.921875 ----------------------*/ + else + if (k < 0x3fed8000) { + n = 992+((k&0x000fe000)>>13)*13; + if (m>0) xx = x - asncs.x[n]; + else xx = -x - asncs.x[n]; + t = asncs.x[n+1]*xx; + p=xx*xx*(asncs.x[n+2]+xx*(asncs.x[n+3]+xx*(asncs.x[n+4]+xx*(asncs.x[n+5] + +xx*(asncs.x[n+6]+xx*(asncs.x[n+7]+xx*asncs.x[n+8]))))))+asncs.x[n+9]; + t+=p; + res =asncs.x[n+10] +t; + cor = (asncs.x[n+10]-res)+t; + if (res == res+1.01*cor) return (m>0)?res:-res; + else { + r=asncs.x[n+10]+xx*asncs.x[n+11]; + t=((asncs.x[n+10]-r)+xx*asncs.x[n+11])+(p+xx*asncs.x[n+12]); + res = r+t; + cor = (r-res)+t; + if (res == res+1.0008*cor) return (m>0)?res:-res; + else { + res1=res+1.1*cor; + z=0.5*(res1-res); + y=hp0.x-res; + z=((hp0.x-y)-res)+(hp1.x-z); + __dubcos(y,z,w); + z=(w[0]-ABS(x))+w[1]; + if (z>1.0e-27) return (m>0)?min(res,res1):-min(res,res1); + else if (z<-1.0e-27) return (m>0)?max(res,res1):-max(res,res1); + else { + y=ABS(x); + return (m>0)?__sin32(y,res,res1):-__sin32(y,res,res1); + } + } + } + } /* else if (k < 0x3fed8000) */ + /*-------------------0.921875 <= |x| < 0.953125 ------------------------*/ + else + if (k < 0x3fee8000) { + n = 884+((k&0x000fe000)>>13)*14; + if (m>0) xx = x - asncs.x[n]; + else xx = -x - asncs.x[n]; + t = asncs.x[n+1]*xx; + p=xx*xx*(asncs.x[n+2]+xx*(asncs.x[n+3]+xx*(asncs.x[n+4]+ + xx*(asncs.x[n+5]+xx*(asncs.x[n+6] + +xx*(asncs.x[n+7]+xx*(asncs.x[n+8]+ + xx*asncs.x[n+9])))))))+asncs.x[n+10]; + t+=p; + res =asncs.x[n+11] +t; + cor = (asncs.x[n+11]-res)+t; + if (res == res+1.01*cor) return (m>0)?res:-res; + else { + r=asncs.x[n+11]+xx*asncs.x[n+12]; + t=((asncs.x[n+11]-r)+xx*asncs.x[n+12])+(p+xx*asncs.x[n+13]); + res = r+t; + cor = (r-res)+t; + if (res == res+1.0007*cor) return (m>0)?res:-res; + else { + res1=res+1.1*cor; + z=0.5*(res1-res); + y=(hp0.x-res)-z; + z=y+hp1.x; + y=(y-z)+hp1.x; + __dubcos(z,y,w); + z=(w[0]-ABS(x))+w[1]; + if (z>1.0e-27) return (m>0)?min(res,res1):-min(res,res1); + else if (z<-1.0e-27) return (m>0)?max(res,res1):-max(res,res1); + else { + y=ABS(x); + return (m>0)?__sin32(y,res,res1):-__sin32(y,res,res1); + } + } + } + } /* else if (k < 0x3fee8000) */ + + /*--------------------0.953125 <= |x| < 0.96875 ------------------------*/ + else + if (k < 0x3fef0000) { + n = 768+((k&0x000fe000)>>13)*15; + if (m>0) xx = x - asncs.x[n]; + else xx = -x - asncs.x[n]; + t = asncs.x[n+1]*xx; + p=xx*xx*(asncs.x[n+2]+xx*(asncs.x[n+3]+xx*(asncs.x[n+4]+ + xx*(asncs.x[n+5]+xx*(asncs.x[n+6] + +xx*(asncs.x[n+7]+xx*(asncs.x[n+8]+ + xx*(asncs.x[n+9]+xx*asncs.x[n+10]))))))))+asncs.x[n+11]; + t+=p; + res =asncs.x[n+12] +t; + cor = (asncs.x[n+12]-res)+t; + if (res == res+1.01*cor) return (m>0)?res:-res; + else { + r=asncs.x[n+12]+xx*asncs.x[n+13]; + t=((asncs.x[n+12]-r)+xx*asncs.x[n+13])+(p+xx*asncs.x[n+14]); + res = r+t; + cor = (r-res)+t; + if (res == res+1.0007*cor) return (m>0)?res:-res; + else { + res1=res+1.1*cor; + z=0.5*(res1-res); + y=(hp0.x-res)-z; + z=y+hp1.x; + y=(y-z)+hp1.x; + __dubcos(z,y,w); + z=(w[0]-ABS(x))+w[1]; + if (z>1.0e-27) return (m>0)?min(res,res1):-min(res,res1); + else if (z<-1.0e-27) return (m>0)?max(res,res1):-max(res,res1); + else { + y=ABS(x); + return (m>0)?__sin32(y,res,res1):-__sin32(y,res,res1); + } + } + } + } /* else if (k < 0x3fef0000) */ + /*--------------------0.96875 <= |x| < 1 --------------------------------*/ + else + if (k<0x3ff00000) { + z = 0.5*((m>0)?(1.0-x):(1.0+x)); + v.x=z; + k=v.i[HIGH_HALF]; + t=inroot[(k&0x001fffff)>>14]*powtwo[511-(k>>21)]; + r=1.0-t*t*z; + t = t*(rt0+r*(rt1+r*(rt2+r*rt3))); + c=t*z; + t=c*(1.5-0.5*t*c); + y=(c+t24)-t24; + cc = (z-y*y)/(t+y); + p=(((((f6*z+f5)*z+f4)*z+f3)*z+f2)*z+f1)*z; + cor = (hp1.x - 2.0*cc)-2.0*(y+cc)*p; + res1 = hp0.x - 2.0*y; + res =res1 + cor; + if (res == res+1.003*((res1-res)+cor)) return (m>0)?res:-res; + else { + c=y+cc; + cc=(y-c)+cc; + __doasin(c,cc,w); + res1=hp0.x-2.0*w[0]; + cor=((hp0.x-res1)-2.0*w[0])+(hp1.x-2.0*w[1]); + res = res1+cor; + cor = (res1-res)+cor; + if (res==(res+1.0000001*cor)) return (m>0)?res:-res; + else { + y=ABS(x); + res1=res+1.1*cor; + return (m>0)?__sin32(y,res,res1):-__sin32(y,res,res1); + } + } + } /* else if (k < 0x3ff00000) */ + /*---------------------------- |x|>=1 -------------------------------*/ + else if (k==0x3ff00000 && u.i[LOW_HALF]==0) return (m>0)?hp0.x:-hp0.x; + else + if (k>0x7ff00000 || (k == 0x7ff00000 && u.i[LOW_HALF] != 0)) return x; + else { + u.i[HIGH_HALF]=0x7ff00000; + v.i[HIGH_HALF]=0x7ff00000; + u.i[LOW_HALF]=0; + v.i[LOW_HALF]=0; + return u.x/v.x; /* NaN */ + } +} + +/*******************************************************************/ +/* */ +/* End of arcsine, below is arccosine */ +/* */ +/*******************************************************************/ + +double __ieee754_acos(double x) +{ + double x1,x2,xx,s1,s2,res1,p,t,res,r,cor,cc,y,c,z,w[2],eps; +#if 0 + double fc; +#endif + mynumber u,v; + int4 k,m,n; +#if 0 + int4 nn; +#endif + u.x = x; + m = u.i[HIGH_HALF]; + k = 0x7fffffff&m; + /*------------------- |x|<2.77556*10^-17 ----------------------*/ + if (k < 0x3c880000) return hp0.x; + + /*----------------- 2.77556*10^-17 <= |x| < 2^-3 --------------*/ + else + if (k < 0x3fc00000) { + x2 = x*x; + t = (((((f6*x2 + f5)*x2 + f4)*x2 + f3)*x2 + f2)*x2 + f1)*(x2*x); + r=hp0.x-x; + cor=(((hp0.x-r)-x)+hp1.x)-t; + res = r+cor; + cor = (r-res)+cor; + if (res == res+1.004*cor) return res; + else { + x1 = x+big; + xx = x*x; + x1 -= big; + x2 = x - x1; + p = x1*x1*x1; + s1 = a1.x*p; + s2 = ((((((c7*xx + c6)*xx + c5)*xx + c4)*xx + c3)*xx + c2)*xx*xx*x + + ((a1.x+a2.x)*x2*x2+ 0.5*x1*x)*x2) + a2.x*p; + res1 = x+s1; + s2 = ((x-res1)+s1)+s2; + r=hp0.x-res1; + cor=(((hp0.x-r)-res1)+hp1.x)-s2; + res = r+cor; + cor = (r-res)+cor; + if (res == res+1.00004*cor) return res; + else { + __doasin(x,0,w); + r=hp0.x-w[0]; + cor=((hp0.x-r)-w[0])+(hp1.x-w[1]); + res=r+cor; + cor=(r-res)+cor; + if (res ==(res +1.00000001*cor)) return res; + else { + res1=res+1.1*cor; + return __cos32(x,res,res1); + } + } + } + } /* else if (k < 0x3fc00000) */ + /*---------------------- 0.125 <= |x| < 0.5 --------------------*/ + else + if (k < 0x3fe00000) { + if (k<0x3fd00000) n = 11*((k&0x000fffff)>>15); + else n = 11*((k&0x000fffff)>>14)+352; + if (m>0) xx = x - asncs.x[n]; + else xx = -x - asncs.x[n]; + t = asncs.x[n+1]*xx; + p=xx*xx*(asncs.x[n+2]+xx*(asncs.x[n+3]+xx*(asncs.x[n+4]+ + xx*(asncs.x[n+5]+xx*asncs.x[n+6]))))+asncs.x[n+7]; + t+=p; + y = (m>0)?(hp0.x-asncs.x[n+8]):(hp0.x+asncs.x[n+8]); + t = (m>0)?(hp1.x-t):(hp1.x+t); + res = y+t; + if (res == res+1.02*((y-res)+t)) return res; + else { + r=asncs.x[n+8]+xx*asncs.x[n+9]; + t=((asncs.x[n+8]-r)+xx*asncs.x[n+9])+(p+xx*asncs.x[n+10]); + if (m>0) + {p = hp0.x-r; t = (((hp0.x-p)-r)-t)+hp1.x; } + else + {p = hp0.x+r; t = ((hp0.x-p)+r)+(hp1.x+t); } + res = p+t; + cor = (p-res)+t; + if (res == (res+1.0002*cor)) return res; + else { + res1=res+1.1*cor; + z=0.5*(res1-res); + __docos(res,z,w); + z=(w[0]-x)+w[1]; + if (z>1.0e-27) return max(res,res1); + else if (z<-1.0e-27) return min(res,res1); + else return __cos32(x,res,res1); + } + } + } /* else if (k < 0x3fe00000) */ + + /*--------------------------- 0.5 <= |x| < 0.75 ---------------------*/ + else + if (k < 0x3fe80000) { + n = 1056+((k&0x000fe000)>>11)*3; + if (m>0) {xx = x - asncs.x[n]; eps=1.04; } + else {xx = -x - asncs.x[n]; eps=1.02; } + t = asncs.x[n+1]*xx; + p=xx*xx*(asncs.x[n+2]+xx*(asncs.x[n+3]+xx*(asncs.x[n+4]+ + xx*(asncs.x[n+5]+xx*(asncs.x[n+6]+ + xx*asncs.x[n+7])))))+asncs.x[n+8]; + t+=p; + y = (m>0)?(hp0.x-asncs.x[n+9]):(hp0.x+asncs.x[n+9]); + t = (m>0)?(hp1.x-t):(hp1.x+t); + res = y+t; + if (res == res+eps*((y-res)+t)) return res; + else { + r=asncs.x[n+9]+xx*asncs.x[n+10]; + t=((asncs.x[n+9]-r)+xx*asncs.x[n+10])+(p+xx*asncs.x[n+11]); + if (m>0) {p = hp0.x-r; t = (((hp0.x-p)-r)-t)+hp1.x; eps=1.0004; } + else {p = hp0.x+r; t = ((hp0.x-p)+r)+(hp1.x+t); eps=1.0002; } + res = p+t; + cor = (p-res)+t; + if (res == (res+eps*cor)) return res; + else { + res1=res+1.1*cor; + z=0.5*(res1-res); + __docos(res,z,w); + z=(w[0]-x)+w[1]; + if (z>1.0e-27) return max(res,res1); + else if (z<-1.0e-27) return min(res,res1); + else return __cos32(x,res,res1); + } + } + } /* else if (k < 0x3fe80000) */ + +/*------------------------- 0.75 <= |x| < 0.921875 -------------*/ + else + if (k < 0x3fed8000) { + n = 992+((k&0x000fe000)>>13)*13; + if (m>0) {xx = x - asncs.x[n]; eps = 1.04; } + else {xx = -x - asncs.x[n]; eps = 1.01; } + t = asncs.x[n+1]*xx; + p=xx*xx*(asncs.x[n+2]+xx*(asncs.x[n+3]+xx*(asncs.x[n+4]+ + xx*(asncs.x[n+5]+xx*(asncs.x[n+6]+xx*(asncs.x[n+7]+ + xx*asncs.x[n+8]))))))+asncs.x[n+9]; + t+=p; + y = (m>0)?(hp0.x-asncs.x[n+10]):(hp0.x+asncs.x[n+10]); + t = (m>0)?(hp1.x-t):(hp1.x+t); + res = y+t; + if (res == res+eps*((y-res)+t)) return res; + else { + r=asncs.x[n+10]+xx*asncs.x[n+11]; + t=((asncs.x[n+10]-r)+xx*asncs.x[n+11])+(p+xx*asncs.x[n+12]); + if (m>0) {p = hp0.x-r; t = (((hp0.x-p)-r)-t)+hp1.x; eps=1.0032; } + else {p = hp0.x+r; t = ((hp0.x-p)+r)+(hp1.x+t); eps=1.0008; } + res = p+t; + cor = (p-res)+t; + if (res == (res+eps*cor)) return res; + else { + res1=res+1.1*cor; + z=0.5*(res1-res); + __docos(res,z,w); + z=(w[0]-x)+w[1]; + if (z>1.0e-27) return max(res,res1); + else if (z<-1.0e-27) return min(res,res1); + else return __cos32(x,res,res1); + } + } + } /* else if (k < 0x3fed8000) */ + +/*-------------------0.921875 <= |x| < 0.953125 ------------------*/ + else + if (k < 0x3fee8000) { + n = 884+((k&0x000fe000)>>13)*14; + if (m>0) {xx = x - asncs.x[n]; eps=1.04; } + else {xx = -x - asncs.x[n]; eps =1.005; } + t = asncs.x[n+1]*xx; + p=xx*xx*(asncs.x[n+2]+xx*(asncs.x[n+3]+xx*(asncs.x[n+4]+ + xx*(asncs.x[n+5]+xx*(asncs.x[n+6] + +xx*(asncs.x[n+7]+xx*(asncs.x[n+8]+ + xx*asncs.x[n+9])))))))+asncs.x[n+10]; + t+=p; + y = (m>0)?(hp0.x-asncs.x[n+11]):(hp0.x+asncs.x[n+11]); + t = (m>0)?(hp1.x-t):(hp1.x+t); + res = y+t; + if (res == res+eps*((y-res)+t)) return res; + else { + r=asncs.x[n+11]+xx*asncs.x[n+12]; + t=((asncs.x[n+11]-r)+xx*asncs.x[n+12])+(p+xx*asncs.x[n+13]); + if (m>0) {p = hp0.x-r; t = (((hp0.x-p)-r)-t)+hp1.x; eps=1.0030; } + else {p = hp0.x+r; t = ((hp0.x-p)+r)+(hp1.x+t); eps=1.0005; } + res = p+t; + cor = (p-res)+t; + if (res == (res+eps*cor)) return res; + else { + res1=res+1.1*cor; + z=0.5*(res1-res); + __docos(res,z,w); + z=(w[0]-x)+w[1]; + if (z>1.0e-27) return max(res,res1); + else if (z<-1.0e-27) return min(res,res1); + else return __cos32(x,res,res1); + } + } + } /* else if (k < 0x3fee8000) */ + + /*--------------------0.953125 <= |x| < 0.96875 ----------------*/ + else + if (k < 0x3fef0000) { + n = 768+((k&0x000fe000)>>13)*15; + if (m>0) {xx = x - asncs.x[n]; eps=1.04; } + else {xx = -x - asncs.x[n]; eps=1.005;} + t = asncs.x[n+1]*xx; + p=xx*xx*(asncs.x[n+2]+xx*(asncs.x[n+3]+xx*(asncs.x[n+4]+ + xx*(asncs.x[n+5]+xx*(asncs.x[n+6] + +xx*(asncs.x[n+7]+xx*(asncs.x[n+8]+xx*(asncs.x[n+9]+ + xx*asncs.x[n+10]))))))))+asncs.x[n+11]; + t+=p; + y = (m>0)?(hp0.x-asncs.x[n+12]):(hp0.x+asncs.x[n+12]); + t = (m>0)?(hp1.x-t):(hp1.x+t); + res = y+t; + if (res == res+eps*((y-res)+t)) return res; + else { + r=asncs.x[n+12]+xx*asncs.x[n+13]; + t=((asncs.x[n+12]-r)+xx*asncs.x[n+13])+(p+xx*asncs.x[n+14]); + if (m>0) {p = hp0.x-r; t = (((hp0.x-p)-r)-t)+hp1.x; eps=1.0030; } + else {p = hp0.x+r; t = ((hp0.x-p)+r)+(hp1.x+t); eps=1.0005; } + res = p+t; + cor = (p-res)+t; + if (res == (res+eps*cor)) return res; + else { + res1=res+1.1*cor; + z=0.5*(res1-res); + __docos(res,z,w); + z=(w[0]-x)+w[1]; + if (z>1.0e-27) return max(res,res1); + else if (z<-1.0e-27) return min(res,res1); + else return __cos32(x,res,res1); + } + } + } /* else if (k < 0x3fef0000) */ + /*-----------------0.96875 <= |x| < 1 ---------------------------*/ + + else + if (k<0x3ff00000) { + z = 0.5*((m>0)?(1.0-x):(1.0+x)); + v.x=z; + k=v.i[HIGH_HALF]; + t=inroot[(k&0x001fffff)>>14]*powtwo[511-(k>>21)]; + r=1.0-t*t*z; + t = t*(rt0+r*(rt1+r*(rt2+r*rt3))); + c=t*z; + t=c*(1.5-0.5*t*c); + y = (t27*c+c)-t27*c; + cc = (z-y*y)/(t+y); + p=(((((f6*z+f5)*z+f4)*z+f3)*z+f2)*z+f1)*z; + if (m<0) { + cor = (hp1.x - cc)-(y+cc)*p; + res1 = hp0.x - y; + res =res1 + cor; + if (res == res+1.002*((res1-res)+cor)) return (res+res); + else { + c=y+cc; + cc=(y-c)+cc; + __doasin(c,cc,w); + res1=hp0.x-w[0]; + cor=((hp0.x-res1)-w[0])+(hp1.x-w[1]); + res = res1+cor; + cor = (res1-res)+cor; + if (res==(res+1.000001*cor)) return (res+res); + else { + res=res+res; + res1=res+1.2*cor; + return __cos32(x,res,res1); + } + } + } + else { + cor = cc+p*(y+cc); + res = y + cor; + if (res == res+1.03*((y-res)+cor)) return (res+res); + else { + c=y+cc; + cc=(y-c)+cc; + __doasin(c,cc,w); + res = w[0]; + cor=w[1]; + if (res==(res+1.000001*cor)) return (res+res); + else { + res=res+res; + res1=res+1.2*cor; + return __cos32(x,res,res1); + } + } + } + } /* else if (k < 0x3ff00000) */ + + /*---------------------------- |x|>=1 -----------------------*/ + else + if (k==0x3ff00000 && u.i[LOW_HALF]==0) return (m>0)?0:2.0*hp0.x; + else + if (k>0x7ff00000 || (k == 0x7ff00000 && u.i[LOW_HALF] != 0)) return x; + else { + u.i[HIGH_HALF]=0x7ff00000; + v.i[HIGH_HALF]=0x7ff00000; + u.i[LOW_HALF]=0; + v.i[LOW_HALF]=0; + return u.x/v.x; + } +} diff --git a/libgcc-math/dbl-64/e_atan2.c b/libgcc-math/dbl-64/e_atan2.c new file mode 100644 index 00000000000..9e1a794ec82 --- /dev/null +++ b/libgcc-math/dbl-64/e_atan2.c @@ -0,0 +1,406 @@ +/* + * IBM Accurate Mathematical Library + * written by International Business Machines Corp. + * Copyright (C) 2001 Free Software Foundation + * + * This program is free software; you can redistribute it and/or modify + * it under the terms of the GNU Lesser General Public License as published by + * the Free Software Foundation; either version 2.1 of the License, or + * (at your option) any later version. + * + * This program is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU Lesser General Public License for more details. + * + * You should have received a copy of the GNU Lesser General Public License + * along with this program; if not, write to the Free Software + * Foundation, Inc., 59 Temple Place - Suite 330, Boston, MA 02111-1307, USA. + */ +/************************************************************************/ +/* MODULE_NAME: atnat2.c */ +/* */ +/* FUNCTIONS: uatan2 */ +/* atan2Mp */ +/* signArctan2 */ +/* normalized */ +/* */ +/* FILES NEEDED: dla.h endian.h mpa.h mydefs.h atnat2.h */ +/* mpatan.c mpatan2.c mpsqrt.c */ +/* uatan.tbl */ +/* */ +/* An ultimate atan2() routine. Given two IEEE double machine numbers y,*/ +/* x it computes the correctly rounded (to nearest) value of atan2(y,x).*/ +/* */ +/* Assumption: Machine arithmetic operations are performed in */ +/* round to nearest mode of IEEE 754 standard. */ +/* */ +/************************************************************************/ + +#include "dla.h" +#include "mpa.h" +#include "MathLib.h" +#include "uatan.tbl" +#include "atnat2.h" +#include "math_private.h" + +/************************************************************************/ +/* An ultimate atan2 routine. Given two IEEE double machine numbers y,x */ +/* it computes the correctly rounded (to nearest) value of atan2(y,x). */ +/* Assumption: Machine arithmetic operations are performed in */ +/* round to nearest mode of IEEE 754 standard. */ +/************************************************************************/ +static double atan2Mp(double ,double ,const int[]); +static double signArctan2(double ,double); +static double normalized(double ,double,double ,double); +void __mpatan2(mp_no *,mp_no *,mp_no *,int); + +double __ieee754_atan2(double y,double x) { + + int i,de,ux,dx,uy,dy; +#if 0 + int p; +#endif + static const int pr[MM]={6,8,10,20,32}; + double ax,ay,u,du,u9,ua,v,vv,dv,t1,t2,t3,t4,t5,t6,t7,t8, + z,zz,cor,s1,ss1,s2,ss2; +#if 0 + double z1,z2; +#endif + number num; +#if 0 + mp_no mperr,mpt1,mpx,mpy,mpz,mpz1,mpz2; +#endif + + static const int ep= 59768832, /* 57*16**5 */ + em=-59768832; /* -57*16**5 */ + + /* x=NaN or y=NaN */ + num.d = x; ux = num.i[HIGH_HALF]; dx = num.i[LOW_HALF]; + if ((ux&0x7ff00000) ==0x7ff00000) { + if (((ux&0x000fffff)|dx)!=0x00000000) return x+x; } + num.d = y; uy = num.i[HIGH_HALF]; dy = num.i[LOW_HALF]; + if ((uy&0x7ff00000) ==0x7ff00000) { + if (((uy&0x000fffff)|dy)!=0x00000000) return y+y; } + + /* y=+-0 */ + if (uy==0x00000000) { + if (dy==0x00000000) { + if ((ux&0x80000000)==0x00000000) return ZERO; + else return opi.d; } } + else if (uy==0x80000000) { + if (dy==0x00000000) { + if ((ux&0x80000000)==0x00000000) return MZERO; + else return mopi.d;} } + + /* x=+-0 */ + if (x==ZERO) { + if ((uy&0x80000000)==0x00000000) return hpi.d; + else return mhpi.d; } + + /* x=+-INF */ + if (ux==0x7ff00000) { + if (dx==0x00000000) { + if (uy==0x7ff00000) { + if (dy==0x00000000) return qpi.d; } + else if (uy==0xfff00000) { + if (dy==0x00000000) return mqpi.d; } + else { + if ((uy&0x80000000)==0x00000000) return ZERO; + else return MZERO; } + } + } + else if (ux==0xfff00000) { + if (dx==0x00000000) { + if (uy==0x7ff00000) { + if (dy==0x00000000) return tqpi.d; } + else if (uy==0xfff00000) { + if (dy==0x00000000) return mtqpi.d; } + else { + if ((uy&0x80000000)==0x00000000) return opi.d; + else return mopi.d; } + } + } + + /* y=+-INF */ + if (uy==0x7ff00000) { + if (dy==0x00000000) return hpi.d; } + else if (uy==0xfff00000) { + if (dy==0x00000000) return mhpi.d; } + + /* either x/y or y/x is very close to zero */ + ax = (x=ep) { return ((y>ZERO) ? hpi.d : mhpi.d); } + else if (de<=em) { + if (x>ZERO) { + if ((z=ay/ax)ZERO) ? opi.d : mopi.d); } } + + /* if either x or y is extremely close to zero, scale abs(x), abs(y). */ + if (axZERO) { + + /* (i) x>0, abs(y)< abs(x): atan(ay/ax) */ + if (ay0, abs(x)<=abs(y): pi/2-atan(ax/ay) */ + else { + if (u= 1/2 */ + if ((z=t1+(zz-ua)) == t1+(zz+ua)) return signArctan2(y,z); + + t1=u-hij[i][0].d; + EADD(t1,du,v,vv) + s1=v*(hij[i][11].d+v*(hij[i][12].d+v*(hij[i][13].d+ + v*(hij[i][14].d+v* hij[i][15].d)))); + ADD2(hij[i][9].d,hij[i][10].d,s1,ZERO,s2,ss2,t1,t2) + MUL2(v,vv,s2,ss2,s1,ss1,t1,t2,t3,t4,t5,t6,t7,t8) + ADD2(hij[i][7].d,hij[i][8].d,s1,ss1,s2,ss2,t1,t2) + MUL2(v,vv,s2,ss2,s1,ss1,t1,t2,t3,t4,t5,t6,t7,t8) + ADD2(hij[i][5].d,hij[i][6].d,s1,ss1,s2,ss2,t1,t2) + MUL2(v,vv,s2,ss2,s1,ss1,t1,t2,t3,t4,t5,t6,t7,t8) + ADD2(hij[i][3].d,hij[i][4].d,s1,ss1,s2,ss2,t1,t2) + MUL2(v,vv,s2,ss2,s1,ss1,t1,t2,t3,t4,t5,t6,t7,t8) + ADD2(hij[i][1].d,hij[i][2].d,s1,ss1,s2,ss2,t1,t2) + SUB2(hpi.d,hpi1.d,s2,ss2,s1,ss1,t1,t2) + if ((z=s1+(ss1-uc.d)) == s1+(ss1+uc.d)) return signArctan2(y,z); + return atan2Mp(x,y,pr); + } + } + } + else { + + /* (iii) x<0, abs(x)< abs(y): pi/2+atan(ax/ay) */ + if (ax= 1/2 */ + if ((z=t1+(zz-ua)) == t1+(zz+ua)) return signArctan2(y,z); + + t1=u-hij[i][0].d; + EADD(t1,du,v,vv) + s1=v*(hij[i][11].d+v*(hij[i][12].d+v*(hij[i][13].d+ + v*(hij[i][14].d+v* hij[i][15].d)))); + ADD2(hij[i][9].d,hij[i][10].d,s1,ZERO,s2,ss2,t1,t2) + MUL2(v,vv,s2,ss2,s1,ss1,t1,t2,t3,t4,t5,t6,t7,t8) + ADD2(hij[i][7].d,hij[i][8].d,s1,ss1,s2,ss2,t1,t2) + MUL2(v,vv,s2,ss2,s1,ss1,t1,t2,t3,t4,t5,t6,t7,t8) + ADD2(hij[i][5].d,hij[i][6].d,s1,ss1,s2,ss2,t1,t2) + MUL2(v,vv,s2,ss2,s1,ss1,t1,t2,t3,t4,t5,t6,t7,t8) + ADD2(hij[i][3].d,hij[i][4].d,s1,ss1,s2,ss2,t1,t2) + MUL2(v,vv,s2,ss2,s1,ss1,t1,t2,t3,t4,t5,t6,t7,t8) + ADD2(hij[i][1].d,hij[i][2].d,s1,ss1,s2,ss2,t1,t2) + ADD2(hpi.d,hpi1.d,s2,ss2,s1,ss1,t1,t2) + if ((z=s1+(ss1-uc.d)) == s1+(ss1+uc.d)) return signArctan2(y,z); + return atan2Mp(x,y,pr); + } + } + + /* (iv) x<0, abs(y)<=abs(x): pi-atan(ax/ay) */ + else { + if (u= 1/2 */ + if ((z=t1+(zz-ua)) == t1+(zz+ua)) return signArctan2(y,z); + + t1=u-hij[i][0].d; + EADD(t1,du,v,vv) + s1=v*(hij[i][11].d+v*(hij[i][12].d+v*(hij[i][13].d+ + v*(hij[i][14].d+v* hij[i][15].d)))); + ADD2(hij[i][9].d,hij[i][10].d,s1,ZERO,s2,ss2,t1,t2) + MUL2(v,vv,s2,ss2,s1,ss1,t1,t2,t3,t4,t5,t6,t7,t8) + ADD2(hij[i][7].d,hij[i][8].d,s1,ss1,s2,ss2,t1,t2) + MUL2(v,vv,s2,ss2,s1,ss1,t1,t2,t3,t4,t5,t6,t7,t8) + ADD2(hij[i][5].d,hij[i][6].d,s1,ss1,s2,ss2,t1,t2) + MUL2(v,vv,s2,ss2,s1,ss1,t1,t2,t3,t4,t5,t6,t7,t8) + ADD2(hij[i][3].d,hij[i][4].d,s1,ss1,s2,ss2,t1,t2) + MUL2(v,vv,s2,ss2,s1,ss1,t1,t2,t3,t4,t5,t6,t7,t8) + ADD2(hij[i][1].d,hij[i][2].d,s1,ss1,s2,ss2,t1,t2) + SUB2(opi.d,opi1.d,s2,ss2,s1,ss1,t1,t2) + if ((z=s1+(ss1-uc.d)) == s1+(ss1+uc.d)) return signArctan2(y,z); + return atan2Mp(x,y,pr); + } + } + } +} + /* Treat the Denormalized case */ +static double normalized(double ax,double ay,double y, double z) + { int p; + mp_no mpx,mpy,mpz,mperr,mpz2,mpt1; + p=6; + __dbl_mp(ax,&mpx,p); __dbl_mp(ay,&mpy,p); __dvd(&mpy,&mpx,&mpz,p); + __dbl_mp(ue.d,&mpt1,p); __mul(&mpz,&mpt1,&mperr,p); + __sub(&mpz,&mperr,&mpz2,p); __mp_dbl(&mpz2,&z,p); + return signArctan2(y,z); +} + /* Fix the sign and return after stage 1 or stage 2 */ +static double signArctan2(double y,double z) +{ + return ((y smallint && n < bigint) { + + y = x*log2e.x + three51.x; + bexp = y - three51.x; /* multiply the result by 2**bexp */ + + junk1.x = y; + + eps = bexp*ln_two2.x; /* x = bexp*ln(2) + t - eps */ + t = x - bexp*ln_two1.x; + + y = t + three33.x; + base = y - three33.x; /* t rounded to a multiple of 2**-18 */ + junk2.x = y; + del = (t - base) - eps; /* x = bexp*ln(2) + base + del */ + eps = del + del*del*(p3.x*del + p2.x); + + binexp.i[HIGH_HALF] =(junk1.i[LOW_HALF]+1023)<<20; + + i = ((junk2.i[LOW_HALF]>>8)&0xfffffffe)+356; + j = (junk2.i[LOW_HALF]&511)<<1; + + al = coar.x[i]*fine.x[j]; + bet =(coar.x[i]*fine.x[j+1] + coar.x[i+1]*fine.x[j]) + coar.x[i+1]*fine.x[j+1]; + + rem=(bet + bet*eps)+al*eps; + res = al + rem; + cor = (al - res) + rem; + if (res == (res+cor*err_0)) return res*binexp.x; + else return __slowexp(x); /*if error is over bound */ + } + + if (n <= smallint) return 1.0; + + if (n >= badint) { + if (n > infint) return(x+x); /* x is NaN */ + if (n < infint) return ( (x>0) ? (hhuge*hhuge) : (tiny*tiny) ); + /* x is finite, cause either overflow or underflow */ + if (junk1.i[LOW_HALF] != 0) return (x+x); /* x is NaN */ + return ((x>0)?inf.x:zero ); /* |x| = inf; return either inf or 0 */ + } + + y = x*log2e.x + three51.x; + bexp = y - three51.x; + junk1.x = y; + eps = bexp*ln_two2.x; + t = x - bexp*ln_two1.x; + y = t + three33.x; + base = y - three33.x; + junk2.x = y; + del = (t - base) - eps; + eps = del + del*del*(p3.x*del + p2.x); + i = ((junk2.i[LOW_HALF]>>8)&0xfffffffe)+356; + j = (junk2.i[LOW_HALF]&511)<<1; + al = coar.x[i]*fine.x[j]; + bet =(coar.x[i]*fine.x[j+1] + coar.x[i+1]*fine.x[j]) + coar.x[i+1]*fine.x[j+1]; + rem=(bet + bet*eps)+al*eps; + res = al + rem; + cor = (al - res) + rem; + if (m>>31) { + ex=junk1.i[LOW_HALF]; + if (res < 1.0) {res+=res; cor+=cor; ex-=1;} + if (ex >=-1022) { + binexp.i[HIGH_HALF] = (1023+ex)<<20; + if (res == (res+cor*err_0)) return res*binexp.x; + else return __slowexp(x); /*if error is over bound */ + } + ex = -(1022+ex); + binexp.i[HIGH_HALF] = (1023-ex)<<20; + res*=binexp.x; + cor*=binexp.x; + eps=1.0000000001+err_0*binexp.x; + t=1.0+res; + y = ((1.0-t)+res)+cor; + res=t+y; + cor = (t-res)+y; + if (res == (res + eps*cor)) + { binexp.i[HIGH_HALF] = 0x00100000; + return (res-1.0)*binexp.x; + } + else return __slowexp(x); /* if error is over bound */ + } + else { + binexp.i[HIGH_HALF] =(junk1.i[LOW_HALF]+767)<<20; + if (res == (res+cor*err_0)) return res*binexp.x*t256.x; + else return __slowexp(x); + } +} + +/************************************************************************/ +/* Compute e^(x+xx)(Double-Length number) .The routine also receive */ +/* bound of error of previous calculation .If after computing exp */ +/* error bigger than allows routine return non positive number */ +/*else return e^(x + xx) (always positive ) */ +/************************************************************************/ + +double __exp1(double x, double xx, double error) { + double bexp, t, eps, del, base, y, al, bet, res, rem, cor; + mynumber junk1, junk2, binexp = {{0,0}}; +#if 0 + int4 k; +#endif + int4 i,j,m,n,ex; + + junk1.x = x; + m = junk1.i[HIGH_HALF]; + n = m&hugeint; /* no sign */ + + if (n > smallint && n < bigint) { + y = x*log2e.x + three51.x; + bexp = y - three51.x; /* multiply the result by 2**bexp */ + + junk1.x = y; + + eps = bexp*ln_two2.x; /* x = bexp*ln(2) + t - eps */ + t = x - bexp*ln_two1.x; + + y = t + three33.x; + base = y - three33.x; /* t rounded to a multiple of 2**-18 */ + junk2.x = y; + del = (t - base) + (xx-eps); /* x = bexp*ln(2) + base + del */ + eps = del + del*del*(p3.x*del + p2.x); + + binexp.i[HIGH_HALF] =(junk1.i[LOW_HALF]+1023)<<20; + + i = ((junk2.i[LOW_HALF]>>8)&0xfffffffe)+356; + j = (junk2.i[LOW_HALF]&511)<<1; + + al = coar.x[i]*fine.x[j]; + bet =(coar.x[i]*fine.x[j+1] + coar.x[i+1]*fine.x[j]) + coar.x[i+1]*fine.x[j+1]; + + rem=(bet + bet*eps)+al*eps; + res = al + rem; + cor = (al - res) + rem; + if (res == (res+cor*(1.0+error+err_1))) return res*binexp.x; + else return -10.0; + } + + if (n <= smallint) return 1.0; /* if x->0 e^x=1 */ + + if (n >= badint) { + if (n > infint) return(zero/zero); /* x is NaN, return invalid */ + if (n < infint) return ( (x>0) ? (hhuge*hhuge) : (tiny*tiny) ); + /* x is finite, cause either overflow or underflow */ + if (junk1.i[LOW_HALF] != 0) return (zero/zero); /* x is NaN */ + return ((x>0)?inf.x:zero ); /* |x| = inf; return either inf or 0 */ + } + + y = x*log2e.x + three51.x; + bexp = y - three51.x; + junk1.x = y; + eps = bexp*ln_two2.x; + t = x - bexp*ln_two1.x; + y = t + three33.x; + base = y - three33.x; + junk2.x = y; + del = (t - base) + (xx-eps); + eps = del + del*del*(p3.x*del + p2.x); + i = ((junk2.i[LOW_HALF]>>8)&0xfffffffe)+356; + j = (junk2.i[LOW_HALF]&511)<<1; + al = coar.x[i]*fine.x[j]; + bet =(coar.x[i]*fine.x[j+1] + coar.x[i+1]*fine.x[j]) + coar.x[i+1]*fine.x[j+1]; + rem=(bet + bet*eps)+al*eps; + res = al + rem; + cor = (al - res) + rem; + if (m>>31) { + ex=junk1.i[LOW_HALF]; + if (res < 1.0) {res+=res; cor+=cor; ex-=1;} + if (ex >=-1022) { + binexp.i[HIGH_HALF] = (1023+ex)<<20; + if (res == (res+cor*(1.0+error+err_1))) return res*binexp.x; + else return -10.0; + } + ex = -(1022+ex); + binexp.i[HIGH_HALF] = (1023-ex)<<20; + res*=binexp.x; + cor*=binexp.x; + eps=1.00000000001+(error+err_1)*binexp.x; + t=1.0+res; + y = ((1.0-t)+res)+cor; + res=t+y; + cor = (t-res)+y; + if (res == (res + eps*cor)) + {binexp.i[HIGH_HALF] = 0x00100000; return (res-1.0)*binexp.x;} + else return -10.0; + } + else { + binexp.i[HIGH_HALF] =(junk1.i[LOW_HALF]+767)<<20; + if (res == (res+cor*(1.0+error+err_1))) + return res*binexp.x*t256.x; + else return -10.0; + } +} diff --git a/libgcc-math/dbl-64/e_log.c b/libgcc-math/dbl-64/e_log.c new file mode 100644 index 00000000000..1a9967b546f --- /dev/null +++ b/libgcc-math/dbl-64/e_log.c @@ -0,0 +1,203 @@ +/* + * IBM Accurate Mathematical Library + * written by International Business Machines Corp. + * Copyright (C) 2001 Free Software Foundation + * + * This program is free software; you can redistribute it and/or modify + * it under the terms of the GNU Lesser General Public License as published by + * the Free Software Foundation; either version 2.1 of the License, or + * (at your option) any later version. + * + * This program is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU Lesser General Public License for more details. + * + * You should have received a copy of the GNU Lesser General Public License + * along with this program; if not, write to the Free Software + * Foundation, Inc., 59 Temple Place - Suite 330, Boston, MA 02111-1307, USA. + */ +/*********************************************************************/ +/* */ +/* MODULE_NAME:ulog.c */ +/* */ +/* FUNCTION:ulog */ +/* */ +/* FILES NEEDED: dla.h endian.h mpa.h mydefs.h ulog.h */ +/* mpexp.c mplog.c mpa.c */ +/* ulog.tbl */ +/* */ +/* An ultimate log routine. Given an IEEE double machine number x */ +/* it computes the correctly rounded (to nearest) value of log(x). */ +/* Assumption: Machine arithmetic operations are performed in */ +/* round to nearest mode of IEEE 754 standard. */ +/* */ +/*********************************************************************/ + + +#include "endian.h" +#include "dla.h" +#include "mpa.h" +#include "MathLib.h" +#include "math_private.h" + +void __mplog(mp_no *, mp_no *, int); + +/*********************************************************************/ +/* An ultimate log routine. Given an IEEE double machine number x */ +/* it computes the correctly rounded (to nearest) value of log(x). */ +/*********************************************************************/ +double __ieee754_log(double x) { +#define M 4 + static const int pr[M]={8,10,18,32}; + int i,j,n,ux,dx,p; +#if 0 + int k; +#endif + double dbl_n,u,p0,q,r0,w,nln2a,luai,lubi,lvaj,lvbj, + sij,ssij,ttij,A,B,B0,y,y1,y2,polI,polII,sa,sb, + t1,t2,t3,t4,t5,t6,t7,t8,t,ra,rb,ww, + a0,aa0,s1,s2,ss2,s3,ss3,a1,aa1,a,aa,b,bb,c; + number num; + mp_no mpx,mpy,mpy1,mpy2,mperr; + +#include "ulog.tbl" +#include "ulog.h" + + /* Treating special values of x ( x<=0, x=INF, x=NaN etc.). */ + + num.d = x; ux = num.i[HIGH_HALF]; dx = num.i[LOW_HALF]; + n=0; + if (ux < 0x00100000) { + if (((ux & 0x7fffffff) | dx) == 0) return MHALF/ZERO; /* return -INF */ + if (ux < 0) return (x-x)/ZERO; /* return NaN */ + n -= 54; x *= two54.d; /* scale x */ + num.d = x; + } + if (ux >= 0x7ff00000) return x+x; /* INF or NaN */ + + /* Regular values of x */ + + w = x-ONE; + if (ABS(w) > U03) { goto case_03; } + + + /*--- Stage I, the case abs(x-1) < 0.03 */ + + t8 = MHALF*w; + EMULV(t8,w,a,aa,t1,t2,t3,t4,t5) + EADD(w,a,b,bb) + + /* Evaluate polynomial II */ + polII = (b0.d+w*(b1.d+w*(b2.d+w*(b3.d+w*(b4.d+ + w*(b5.d+w*(b6.d+w*(b7.d+w*b8.d))))))))*w*w*w; + c = (aa+bb)+polII; + + /* End stage I, case abs(x-1) < 0.03 */ + if ((y=b+(c+b*E2)) == b+(c-b*E2)) return y; + + /*--- Stage II, the case abs(x-1) < 0.03 */ + + a = d11.d+w*(d12.d+w*(d13.d+w*(d14.d+w*(d15.d+w*(d16.d+ + w*(d17.d+w*(d18.d+w*(d19.d+w*d20.d)))))))); + EMULV(w,a,s2,ss2,t1,t2,t3,t4,t5) + ADD2(d10.d,dd10.d,s2,ss2,s3,ss3,t1,t2) + MUL2(w,ZERO,s3,ss3,s2,ss2,t1,t2,t3,t4,t5,t6,t7,t8) + ADD2(d9.d,dd9.d,s2,ss2,s3,ss3,t1,t2) + MUL2(w,ZERO,s3,ss3,s2,ss2,t1,t2,t3,t4,t5,t6,t7,t8) + ADD2(d8.d,dd8.d,s2,ss2,s3,ss3,t1,t2) + MUL2(w,ZERO,s3,ss3,s2,ss2,t1,t2,t3,t4,t5,t6,t7,t8) + ADD2(d7.d,dd7.d,s2,ss2,s3,ss3,t1,t2) + MUL2(w,ZERO,s3,ss3,s2,ss2,t1,t2,t3,t4,t5,t6,t7,t8) + ADD2(d6.d,dd6.d,s2,ss2,s3,ss3,t1,t2) + MUL2(w,ZERO,s3,ss3,s2,ss2,t1,t2,t3,t4,t5,t6,t7,t8) + ADD2(d5.d,dd5.d,s2,ss2,s3,ss3,t1,t2) + MUL2(w,ZERO,s3,ss3,s2,ss2,t1,t2,t3,t4,t5,t6,t7,t8) + ADD2(d4.d,dd4.d,s2,ss2,s3,ss3,t1,t2) + MUL2(w,ZERO,s3,ss3,s2,ss2,t1,t2,t3,t4,t5,t6,t7,t8) + ADD2(d3.d,dd3.d,s2,ss2,s3,ss3,t1,t2) + MUL2(w,ZERO,s3,ss3,s2,ss2,t1,t2,t3,t4,t5,t6,t7,t8) + ADD2(d2.d,dd2.d,s2,ss2,s3,ss3,t1,t2) + MUL2(w,ZERO,s3,ss3,s2,ss2,t1,t2,t3,t4,t5,t6,t7,t8) + MUL2(w,ZERO,s2,ss2,s3,ss3,t1,t2,t3,t4,t5,t6,t7,t8) + ADD2(w,ZERO, s3,ss3, b, bb,t1,t2) + + /* End stage II, case abs(x-1) < 0.03 */ + if ((y=b+(bb+b*E4)) == b+(bb-b*E4)) return y; + goto stage_n; + + /*--- Stage I, the case abs(x-1) > 0.03 */ + case_03: + + /* Find n,u such that x = u*2**n, 1/sqrt(2) < u < sqrt(2) */ + n += (num.i[HIGH_HALF] >> 20) - 1023; + num.i[HIGH_HALF] = (num.i[HIGH_HALF] & 0x000fffff) | 0x3ff00000; + if (num.d > SQRT_2) { num.d *= HALF; n++; } + u = num.d; dbl_n = (double) n; + + /* Find i such that ui=1+(i-75)/2**8 is closest to u (i= 0,1,2,...,181) */ + num.d += h1.d; + i = (num.i[HIGH_HALF] & 0x000fffff) >> 12; + + /* Find j such that vj=1+(j-180)/2**16 is closest to v=u/ui (j= 0,...,361) */ + num.d = u*Iu[i].d + h2.d; + j = (num.i[HIGH_HALF] & 0x000fffff) >> 4; + + /* Compute w=(u-ui*vj)/(ui*vj) */ + p0=(ONE+(i-75)*DEL_U)*(ONE+(j-180)*DEL_V); + q=u-p0; r0=Iu[i].d*Iv[j].d; w=q*r0; + + /* Evaluate polynomial I */ + polI = w+(a2.d+a3.d*w)*w*w; + + /* Add up everything */ + nln2a = dbl_n*LN2A; + luai = Lu[i][0].d; lubi = Lu[i][1].d; + lvaj = Lv[j][0].d; lvbj = Lv[j][1].d; + EADD(luai,lvaj,sij,ssij) + EADD(nln2a,sij,A ,ttij) + B0 = (((lubi+lvbj)+ssij)+ttij)+dbl_n*LN2B; + B = polI+B0; + + /* End stage I, case abs(x-1) >= 0.03 */ + if ((y=A+(B+E1)) == A+(B-E1)) return y; + + + /*--- Stage II, the case abs(x-1) > 0.03 */ + + /* Improve the accuracy of r0 */ + EMULV(p0,r0,sa,sb,t1,t2,t3,t4,t5) + t=r0*((ONE-sa)-sb); + EADD(r0,t,ra,rb) + + /* Compute w */ + MUL2(q,ZERO,ra,rb,w,ww,t1,t2,t3,t4,t5,t6,t7,t8) + + EADD(A,B0,a0,aa0) + + /* Evaluate polynomial III */ + s1 = (c3.d+(c4.d+c5.d*w)*w)*w; + EADD(c2.d,s1,s2,ss2) + MUL2(s2,ss2,w,ww,s3,ss3,t1,t2,t3,t4,t5,t6,t7,t8) + MUL2(s3,ss3,w,ww,s2,ss2,t1,t2,t3,t4,t5,t6,t7,t8) + ADD2(s2,ss2,w,ww,s3,ss3,t1,t2) + ADD2(s3,ss3,a0,aa0,a1,aa1,t1,t2) + + /* End stage II, case abs(x-1) >= 0.03 */ + if ((y=a1+(aa1+E3)) == a1+(aa1-E3)) return y; + + + /* Final stages. Use multi-precision arithmetic. */ + stage_n: + + for (i=0; i= 0x7ff00000) return x+x; + k += (hx>>20)-1023; + i = ((u_int32_t)k&0x80000000)>>31; + hx = (hx&0x000fffff)|((0x3ff-i)<<20); + y = (double)(k+i); + SET_HIGH_WORD(x,hx); + z = y*log10_2lo + ivln10*__ieee754_log(x); + return z+y*log10_2hi; +} diff --git a/libgcc-math/dbl-64/e_pow.c b/libgcc-math/dbl-64/e_pow.c new file mode 100644 index 00000000000..d9bd8b479f4 --- /dev/null +++ b/libgcc-math/dbl-64/e_pow.c @@ -0,0 +1,388 @@ +/* + * IBM Accurate Mathematical Library + * written by International Business Machines Corp. + * Copyright (C) 2001, 2002, 2004 Free Software Foundation + * + * This program is free software; you can redistribute it and/or modify + * it under the terms of the GNU Lesser General Public License as published by + * the Free Software Foundation; either version 2.1 of the License, or + * (at your option) any later version. + * + * This program is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU Lesser General Public License for more details. + * + * You should have received a copy of the GNU Lesser General Public License + * along with this program; if not, write to the Free Software + * Foundation, Inc., 59 Temple Place - Suite 330, Boston, MA 02111-1307, USA. + */ +/***************************************************************************/ +/* MODULE_NAME: upow.c */ +/* */ +/* FUNCTIONS: upow */ +/* power1 */ +/* my_log2 */ +/* log1 */ +/* checkint */ +/* FILES NEEDED: dla.h endian.h mpa.h mydefs.h */ +/* halfulp.c mpexp.c mplog.c slowexp.c slowpow.c mpa.c */ +/* uexp.c upow.c */ +/* root.tbl uexp.tbl upow.tbl */ +/* An ultimate power routine. Given two IEEE double machine numbers y,x */ +/* it computes the correctly rounded (to nearest) value of x^y. */ +/* Assumption: Machine arithmetic operations are performed in */ +/* round to nearest mode of IEEE 754 standard. */ +/* */ +/***************************************************************************/ +#include "endian.h" +#include "upow.h" +#include "dla.h" +#include "mydefs.h" +#include "MathLib.h" +#include "upow.tbl" +#include "math_private.h" + + +double __exp1(double x, double xx, double error); +static double log1(double x, double *delta, double *error); +static double my_log2(double x, double *delta, double *error); +double __slowpow(double x, double y,double z); +static double power1(double x, double y); +static int checkint(double x); + +/***************************************************************************/ +/* An ultimate power routine. Given two IEEE double machine numbers y,x */ +/* it computes the correctly rounded (to nearest) value of X^y. */ +/***************************************************************************/ +double __ieee754_pow(double x, double y) { + double z,a,aa,error, t,a1,a2,y1,y2; +#if 0 + double gor=1.0; +#endif + mynumber u,v; + int k; + int4 qx,qy; + v.x=y; + u.x=x; + if (v.i[LOW_HALF] == 0) { /* of y */ + qx = u.i[HIGH_HALF]&0x7fffffff; + /* Checking if x is not too small to compute */ + if (((qx==0x7ff00000)&&(u.i[LOW_HALF]!=0))||(qx>0x7ff00000)) return NaNQ.x; + if (y == 1.0) return x; + if (y == 2.0) return x*x; + if (y == -1.0) return 1.0/x; + if (y == 0) return 1.0; + } + /* else */ + if(((u.i[HIGH_HALF]>0 && u.i[HIGH_HALF]<0x7ff00000)|| /* x>0 and not x->0 */ + (u.i[HIGH_HALF]==0 && u.i[LOW_HALF]!=0)) && + /* 2^-1023< x<= 2^-1023 * 0x1.0000ffffffff */ + (v.i[HIGH_HALF]&0x7fffffff) < 0x4ff00000) { /* if y<-1 or y>1 */ + z = log1(x,&aa,&error); /* x^y =e^(y log (X)) */ + t = y*134217729.0; + y1 = t - (t-y); + y2 = y - y1; + t = z*134217729.0; + a1 = t - (t-z); + a2 = (z - a1)+aa; + a = y1*a1; + aa = y2*a1 + y*a2; + a1 = a+aa; + a2 = (a-a1)+aa; + error = error*ABS(y); + t = __exp1(a1,a2,1.9e16*error); /* return -10 or 0 if wasn't computed exactly */ + return (t>0)?t:power1(x,y); + } + + if (x == 0) { + if (((v.i[HIGH_HALF] & 0x7fffffff) == 0x7ff00000 && v.i[LOW_HALF] != 0) + || (v.i[HIGH_HALF] & 0x7fffffff) > 0x7ff00000) + return y; + if (ABS(y) > 1.0e20) return (y>0)?0:INF.x; + k = checkint(y); + if (k == -1) + return y < 0 ? 1.0/x : x; + else + return y < 0 ? 1.0/ABS(x) : 0.0; /* return 0 */ + } + /* if x<0 */ + if (u.i[HIGH_HALF] < 0) { + k = checkint(y); + if (k==0) { + if ((v.i[HIGH_HALF] & 0x7fffffff) == 0x7ff00000 && v.i[LOW_HALF] == 0) { + if (x == -1.0) return 1.0; + else if (x > -1.0) return v.i[HIGH_HALF] < 0 ? INF.x : 0.0; + else return v.i[HIGH_HALF] < 0 ? 0.0 : INF.x; + } + else if (u.i[HIGH_HALF] == 0xfff00000 && u.i[LOW_HALF] == 0) + return y < 0 ? 0.0 : INF.x; + return NaNQ.x; /* y not integer and x<0 */ + } + else if (u.i[HIGH_HALF] == 0xfff00000 && u.i[LOW_HALF] == 0) + { + if (k < 0) + return y < 0 ? nZERO.x : nINF.x; + else + return y < 0 ? 0.0 : INF.x; + } + return (k==1)?__ieee754_pow(-x,y):-__ieee754_pow(-x,y); /* if y even or odd */ + } + /* x>0 */ + qx = u.i[HIGH_HALF]&0x7fffffff; /* no sign */ + qy = v.i[HIGH_HALF]&0x7fffffff; /* no sign */ + + if (qx > 0x7ff00000 || (qx == 0x7ff00000 && u.i[LOW_HALF] != 0)) return NaNQ.x; + /* if 0 0x7ff00000 || (qy == 0x7ff00000 && v.i[LOW_HALF] != 0)) + return x == 1.0 ? 1.0 : NaNQ.x; + /* if y<2^-0x7fe */ + + if (qx == 0x7ff00000) /* x= 2^-0x3ff */ + {if (y == 0) return NaNQ.x; + return (y>0)?x:0; } + + if (qy > 0x45f00000 && qy < 0x7ff00000) { + if (x == 1.0) return 1.0; + if (y>0) return (x>1.0)?INF.x:0; + if (y<0) return (x<1.0)?INF.x:0; + } + + if (x == 1.0) return 1.0; + if (y>0) return (x>1.0)?INF.x:0; + if (y<0) return (x<1.0)?INF.x:0; + return 0; /* unreachable, to make the compiler happy */ +} + +/**************************************************************************/ +/* Computing x^y using more accurate but more slow log routine */ +/**************************************************************************/ +static double power1(double x, double y) { + double z,a,aa,error, t,a1,a2,y1,y2; + z = my_log2(x,&aa,&error); + t = y*134217729.0; + y1 = t - (t-y); + y2 = y - y1; + t = z*134217729.0; + a1 = t - (t-z); + a2 = z - a1; + a = y*z; + aa = ((y1*a1-a)+y1*a2+y2*a1)+y2*a2+aa*y; + a1 = a+aa; + a2 = (a-a1)+aa; + error = error*ABS(y); + t = __exp1(a1,a2,1.9e16*error); + return (t >= 0)?t:__slowpow(x,y,z); +} + +/****************************************************************************/ +/* Computing log(x) (x is left argument). The result is the returned double */ +/* + the parameter delta. */ +/* The result is bounded by error (rightmost argument) */ +/****************************************************************************/ +static double log1(double x, double *delta, double *error) { + int i,j,m; +#if 0 + int n; +#endif + double uu,vv,eps,nx,e,e1,e2,t,t1,t2,res,add=0; +#if 0 + double cor; +#endif + mynumber u,v; +#ifdef BIG_ENDI + mynumber +/**/ two52 = {{0x43300000, 0x00000000}}; /* 2**52 */ +#else +#ifdef LITTLE_ENDI + mynumber +/**/ two52 = {{0x00000000, 0x43300000}}; /* 2**52 */ +#endif +#endif + + u.x = x; + m = u.i[HIGH_HALF]; + *error = 0; + *delta = 0; + if (m < 0x00100000) /* 1>20); } + else + {u.i[HIGH_HALF] = (m&0x000fffff)|0x3fe00000; two52.i[LOW_HALF]=(m>>20)+1; } + + v.x = u.x + bigu.x; + uu = v.x - bigu.x; + i = (v.i[LOW_HALF]&0x000003ff)<<2; + if (two52.i[LOW_HALF] == 1023) /* nx = 0 */ + { + if (i > 1192 && i < 1208) /* |x-1| < 1.5*2**-10 */ + { + t = x - 1.0; + t1 = (t+5.0e6)-5.0e6; + t2 = t-t1; + e1 = t - 0.5*t1*t1; + e2 = t*t*t*(r3+t*(r4+t*(r5+t*(r6+t*(r7+t*r8)))))-0.5*t2*(t+t1); + res = e1+e2; + *error = 1.0e-21*ABS(t); + *delta = (e1-res)+e2; + return res; + } /* |x-1| < 1.5*2**-10 */ + else + { + v.x = u.x*(ui.x[i]+ui.x[i+1])+bigv.x; + vv = v.x-bigv.x; + j = v.i[LOW_HALF]&0x0007ffff; + j = j+j+j; + eps = u.x - uu*vv; + e1 = eps*ui.x[i]; + e2 = eps*(ui.x[i+1]+vj.x[j]*(ui.x[i]+ui.x[i+1])); + e = e1+e2; + e2 = ((e1-e)+e2); + t=ui.x[i+2]+vj.x[j+1]; + t1 = t+e; + t2 = (((t-t1)+e)+(ui.x[i+3]+vj.x[j+2]))+e2+e*e*(p2+e*(p3+e*p4)); + res=t1+t2; + *error = 1.0e-24; + *delta = (t1-res)+t2; + return res; + } + } /* nx = 0 */ + else /* nx != 0 */ + { + eps = u.x - uu; + nx = (two52.x - two52e.x)+add; + e1 = eps*ui.x[i]; + e2 = eps*ui.x[i+1]; + e=e1+e2; + e2 = (e1-e)+e2; + t=nx*ln2a.x+ui.x[i+2]; + t1=t+e; + t2=(((t-t1)+e)+nx*ln2b.x+ui.x[i+3]+e2)+e*e*(q2+e*(q3+e*(q4+e*(q5+e*q6)))); + res = t1+t2; + *error = 1.0e-21; + *delta = (t1-res)+t2; + return res; + } /* nx != 0 */ +} + +/****************************************************************************/ +/* More slow but more accurate routine of log */ +/* Computing log(x)(x is left argument).The result is return double + delta.*/ +/* The result is bounded by error (right argument) */ +/****************************************************************************/ +static double my_log2(double x, double *delta, double *error) { + int i,j,m; +#if 0 + int n; +#endif + double uu,vv,eps,nx,e,e1,e2,t,t1,t2,res,add=0; +#if 0 + double cor; +#endif + double ou1,ou2,lu1,lu2,ov,lv1,lv2,a,a1,a2; + double y,yy,z,zz,j1,j2,j3,j4,j5,j6,j7,j8; + mynumber u,v; +#ifdef BIG_ENDI + mynumber +/**/ two52 = {{0x43300000, 0x00000000}}; /* 2**52 */ +#else +#ifdef LITTLE_ENDI + mynumber +/**/ two52 = {{0x00000000, 0x43300000}}; /* 2**52 */ +#endif +#endif + + u.x = x; + m = u.i[HIGH_HALF]; + *error = 0; + *delta = 0; + add=0; + if (m<0x00100000) { /* x < 2^-1022 */ + x = x*t52.x; add = -52.0; u.x = x; m = u.i[HIGH_HALF]; } + + if ((m&0x000fffff) < 0x0006a09e) + {u.i[HIGH_HALF] = (m&0x000fffff)|0x3ff00000; two52.i[LOW_HALF]=(m>>20); } + else + {u.i[HIGH_HALF] = (m&0x000fffff)|0x3fe00000; two52.i[LOW_HALF]=(m>>20)+1; } + + v.x = u.x + bigu.x; + uu = v.x - bigu.x; + i = (v.i[LOW_HALF]&0x000003ff)<<2; + /*------------------------------------- |x-1| < 2**-11------------------------------- */ + if ((two52.i[LOW_HALF] == 1023) && (i == 1200)) + { + t = x - 1.0; + EMULV(t,s3,y,yy,j1,j2,j3,j4,j5); + ADD2(-0.5,0,y,yy,z,zz,j1,j2); + MUL2(t,0,z,zz,y,yy,j1,j2,j3,j4,j5,j6,j7,j8); + MUL2(t,0,y,yy,z,zz,j1,j2,j3,j4,j5,j6,j7,j8); + + e1 = t+z; + e2 = (((t-e1)+z)+zz)+t*t*t*(ss3+t*(s4+t*(s5+t*(s6+t*(s7+t*s8))))); + res = e1+e2; + *error = 1.0e-25*ABS(t); + *delta = (e1-res)+e2; + return res; + } + /*----------------------------- |x-1| > 2**-11 -------------------------- */ + else + { /*Computing log(x) according to log table */ + nx = (two52.x - two52e.x)+add; + ou1 = ui.x[i]; + ou2 = ui.x[i+1]; + lu1 = ui.x[i+2]; + lu2 = ui.x[i+3]; + v.x = u.x*(ou1+ou2)+bigv.x; + vv = v.x-bigv.x; + j = v.i[LOW_HALF]&0x0007ffff; + j = j+j+j; + eps = u.x - uu*vv; + ov = vj.x[j]; + lv1 = vj.x[j+1]; + lv2 = vj.x[j+2]; + a = (ou1+ou2)*(1.0+ov); + a1 = (a+1.0e10)-1.0e10; + a2 = a*(1.0-a1*uu*vv); + e1 = eps*a1; + e2 = eps*a2; + e = e1+e2; + e2 = (e1-e)+e2; + t=nx*ln2a.x+lu1+lv1; + t1 = t+e; + t2 = (((t-t1)+e)+(lu2+lv2+nx*ln2b.x+e2))+e*e*(p2+e*(p3+e*p4)); + res=t1+t2; + *error = 1.0e-27; + *delta = (t1-res)+t2; + return res; + } +} + +/**********************************************************************/ +/* Routine receives a double x and checks if it is an integer. If not */ +/* it returns 0, else it returns 1 if even or -1 if odd. */ +/**********************************************************************/ +static int checkint(double x) { + union {int4 i[2]; double x;} u; + int k,m,n; +#if 0 + int l; +#endif + u.x = x; + m = u.i[HIGH_HALF]&0x7fffffff; /* no sign */ + if (m >= 0x7ff00000) return 0; /* x is +/-inf or NaN */ + if (m >= 0x43400000) return 1; /* |x| >= 2**53 */ + if (m < 0x40000000) return 0; /* |x| < 2, can not be 0 or 1 */ + n = u.i[LOW_HALF]; + k = (m>>20)-1023; /* 1 <= k <= 52 */ + if (k == 52) return (n&1)? -1:1; /* odd or even*/ + if (k>20) { + if (n<<(k-20)) return 0; /* if not integer */ + return (n<<(k-21))?-1:1; + } + if (n) return 0; /*if not integer*/ + if (k == 20) return (m&1)? -1:1; + if (m<<(k+12)) return 0; + return (m<<(k+11))?-1:1; +} diff --git a/libgcc-math/dbl-64/e_rem_pio2.c b/libgcc-math/dbl-64/e_rem_pio2.c new file mode 100644 index 00000000000..a8a8cdb2b21 --- /dev/null +++ b/libgcc-math/dbl-64/e_rem_pio2.c @@ -0,0 +1,183 @@ +/* @(#)e_rem_pio2.c 5.1 93/09/24 */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ + +#if defined(LIBM_SCCS) && !defined(lint) +static char rcsid[] = "$NetBSD: e_rem_pio2.c,v 1.8 1995/05/10 20:46:02 jtc Exp $"; +#endif + +/* __ieee754_rem_pio2(x,y) + * + * return the remainder of x rem pi/2 in y[0]+y[1] + * use __kernel_rem_pio2() + */ + +#include "math.h" +#include "math_private.h" + +/* + * Table of constants for 2/pi, 396 Hex digits (476 decimal) of 2/pi + */ +#ifdef __STDC__ +static const int32_t two_over_pi[] = { +#else +static int32_t two_over_pi[] = { +#endif +0xA2F983, 0x6E4E44, 0x1529FC, 0x2757D1, 0xF534DD, 0xC0DB62, +0x95993C, 0x439041, 0xFE5163, 0xABDEBB, 0xC561B7, 0x246E3A, +0x424DD2, 0xE00649, 0x2EEA09, 0xD1921C, 0xFE1DEB, 0x1CB129, +0xA73EE8, 0x8235F5, 0x2EBB44, 0x84E99C, 0x7026B4, 0x5F7E41, +0x3991D6, 0x398353, 0x39F49C, 0x845F8B, 0xBDF928, 0x3B1FF8, +0x97FFDE, 0x05980F, 0xEF2F11, 0x8B5A0A, 0x6D1F6D, 0x367ECF, +0x27CB09, 0xB74F46, 0x3F669E, 0x5FEA2D, 0x7527BA, 0xC7EBE5, +0xF17B3D, 0x0739F7, 0x8A5292, 0xEA6BFB, 0x5FB11F, 0x8D5D08, +0x560330, 0x46FC7B, 0x6BABF0, 0xCFBC20, 0x9AF436, 0x1DA9E3, +0x91615E, 0xE61B08, 0x659985, 0x5F14A0, 0x68408D, 0xFFD880, +0x4D7327, 0x310606, 0x1556CA, 0x73A8C9, 0x60E27B, 0xC08C6B, +}; + +#ifdef __STDC__ +static const int32_t npio2_hw[] = { +#else +static int32_t npio2_hw[] = { +#endif +0x3FF921FB, 0x400921FB, 0x4012D97C, 0x401921FB, 0x401F6A7A, 0x4022D97C, +0x4025FDBB, 0x402921FB, 0x402C463A, 0x402F6A7A, 0x4031475C, 0x4032D97C, +0x40346B9C, 0x4035FDBB, 0x40378FDB, 0x403921FB, 0x403AB41B, 0x403C463A, +0x403DD85A, 0x403F6A7A, 0x40407E4C, 0x4041475C, 0x4042106C, 0x4042D97C, +0x4043A28C, 0x40446B9C, 0x404534AC, 0x4045FDBB, 0x4046C6CB, 0x40478FDB, +0x404858EB, 0x404921FB, +}; + +/* + * invpio2: 53 bits of 2/pi + * pio2_1: first 33 bit of pi/2 + * pio2_1t: pi/2 - pio2_1 + * pio2_2: second 33 bit of pi/2 + * pio2_2t: pi/2 - (pio2_1+pio2_2) + * pio2_3: third 33 bit of pi/2 + * pio2_3t: pi/2 - (pio2_1+pio2_2+pio2_3) + */ + +#ifdef __STDC__ +static const double +#else +static double +#endif +zero = 0.00000000000000000000e+00, /* 0x00000000, 0x00000000 */ +half = 5.00000000000000000000e-01, /* 0x3FE00000, 0x00000000 */ +two24 = 1.67772160000000000000e+07, /* 0x41700000, 0x00000000 */ +invpio2 = 6.36619772367581382433e-01, /* 0x3FE45F30, 0x6DC9C883 */ +pio2_1 = 1.57079632673412561417e+00, /* 0x3FF921FB, 0x54400000 */ +pio2_1t = 6.07710050650619224932e-11, /* 0x3DD0B461, 0x1A626331 */ +pio2_2 = 6.07710050630396597660e-11, /* 0x3DD0B461, 0x1A600000 */ +pio2_2t = 2.02226624879595063154e-21, /* 0x3BA3198A, 0x2E037073 */ +pio2_3 = 2.02226624871116645580e-21, /* 0x3BA3198A, 0x2E000000 */ +pio2_3t = 8.47842766036889956997e-32; /* 0x397B839A, 0x252049C1 */ + +#ifdef __STDC__ + int32_t __ieee754_rem_pio2(double x, double *y) +#else + int32_t __ieee754_rem_pio2(x,y) + double x,y[]; +#endif +{ + double z,w,t,r,fn; + double tx[3]; + int32_t e0,i,j,nx,n,ix,hx; + u_int32_t low; + + GET_HIGH_WORD(hx,x); /* high word of x */ + ix = hx&0x7fffffff; + if(ix<=0x3fe921fb) /* |x| ~<= pi/4 , no need for reduction */ + {y[0] = x; y[1] = 0; return 0;} + if(ix<0x4002d97c) { /* |x| < 3pi/4, special case with n=+-1 */ + if(hx>0) { + z = x - pio2_1; + if(ix!=0x3ff921fb) { /* 33+53 bit pi is good enough */ + y[0] = z - pio2_1t; + y[1] = (z-y[0])-pio2_1t; + } else { /* near pi/2, use 33+33+53 bit pi */ + z -= pio2_2; + y[0] = z - pio2_2t; + y[1] = (z-y[0])-pio2_2t; + } + return 1; + } else { /* negative x */ + z = x + pio2_1; + if(ix!=0x3ff921fb) { /* 33+53 bit pi is good enough */ + y[0] = z + pio2_1t; + y[1] = (z-y[0])+pio2_1t; + } else { /* near pi/2, use 33+33+53 bit pi */ + z += pio2_2; + y[0] = z + pio2_2t; + y[1] = (z-y[0])+pio2_2t; + } + return -1; + } + } + if(ix<=0x413921fb) { /* |x| ~<= 2^19*(pi/2), medium size */ + t = fabs(x); + n = (int32_t) (t*invpio2+half); + fn = (double)n; + r = t-fn*pio2_1; + w = fn*pio2_1t; /* 1st round good to 85 bit */ + if(n<32&&ix!=npio2_hw[n-1]) { + y[0] = r-w; /* quick check no cancellation */ + } else { + u_int32_t high; + j = ix>>20; + y[0] = r-w; + GET_HIGH_WORD(high,y[0]); + i = j-((high>>20)&0x7ff); + if(i>16) { /* 2nd iteration needed, good to 118 */ + t = r; + w = fn*pio2_2; + r = t-w; + w = fn*pio2_2t-((t-r)-w); + y[0] = r-w; + GET_HIGH_WORD(high,y[0]); + i = j-((high>>20)&0x7ff); + if(i>49) { /* 3rd iteration need, 151 bits acc */ + t = r; /* will cover all possible cases */ + w = fn*pio2_3; + r = t-w; + w = fn*pio2_3t-((t-r)-w); + y[0] = r-w; + } + } + } + y[1] = (r-y[0])-w; + if(hx<0) {y[0] = -y[0]; y[1] = -y[1]; return -n;} + else return n; + } + /* + * all other (large) arguments + */ + if(ix>=0x7ff00000) { /* x is inf or NaN */ + y[0]=y[1]=x-x; return 0; + } + /* set z = scalbn(|x|,ilogb(x)-23) */ + GET_LOW_WORD(low,x); + SET_LOW_WORD(z,low); + e0 = (ix>>20)-1046; /* e0 = ilogb(z)-23; */ + SET_HIGH_WORD(z, ix - ((int32_t)(e0<<20))); + for(i=0;i<2;i++) { + tx[i] = (double)((int32_t)(z)); + z = (z-tx[i])*two24; + } + tx[2] = z; + nx = 3; + while(tx[nx-1]==zero) nx--; /* skip zero term */ + n = __kernel_rem_pio2(tx,y,e0,nx,2,two_over_pi); + if(hx<0) {y[0] = -y[0]; y[1] = -y[1]; return -n;} + return n; +} diff --git a/libgcc-math/dbl-64/e_sqrt.c b/libgcc-math/dbl-64/e_sqrt.c new file mode 100644 index 00000000000..f7e80554917 --- /dev/null +++ b/libgcc-math/dbl-64/e_sqrt.c @@ -0,0 +1,88 @@ +/* + * IBM Accurate Mathematical Library + * written by International Business Machines Corp. + * Copyright (C) 2001 Free Software Foundation + * + * This program is free software; you can redistribute it and/or modify + * it under the terms of the GNU Lesser General Public License as published by + * the Free Software Foundation; either version 2.1 of the License, or + * (at your option) any later version. + * + * This program is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU Lesser General Public License for more details. + * + * You should have received a copy of the GNU Lesser General Public License + * along with this program; if not, write to the Free Software + * Foundation, Inc., 59 Temple Place - Suite 330, Boston, MA 02111-1307, USA. + */ +/*********************************************************************/ +/* MODULE_NAME: uroot.c */ +/* */ +/* FUNCTION: usqrt */ +/* */ +/* FILES NEEDED: dla.h endian.h mydefs.h uroot.h */ +/* uroot.tbl */ +/* */ +/* An ultimate sqrt routine. Given an IEEE double machine number x */ +/* it computes the correctly rounded (to nearest) value of square */ +/* root of x. */ +/* Assumption: Machine arithmetic operations are performed in */ +/* round to nearest mode of IEEE 754 standard. */ +/* */ +/*********************************************************************/ + +#include "endian.h" +#include "mydefs.h" +#include "dla.h" +#include "MathLib.h" +#include "root.tbl" +#include "math_private.h" + +/*********************************************************************/ +/* An ultimate sqrt routine. Given an IEEE double machine number x */ +/* it computes the correctly rounded (to nearest) value of square */ +/* root of x. */ +/*********************************************************************/ +double __ieee754_sqrt(double x) { +#include "uroot.h" + static const double + rt0 = 9.99999999859990725855365213134618E-01, + rt1 = 4.99999999495955425917856814202739E-01, + rt2 = 3.75017500867345182581453026130850E-01, + rt3 = 3.12523626554518656309172508769531E-01; + static const double big = 134217728.0; + double y,t,del,res,res1,hy,z,zz,p,hx,tx,ty,s; + mynumber a,c={{0,0}}; + int4 k; + + a.x=x; + k=a.i[HIGH_HALF]; + a.i[HIGH_HALF]=(k&0x001fffff)|0x3fe00000; + t=inroot[(k&0x001fffff)>>14]; + s=a.x; + /*----------------- 2^-1022 <= | x |< 2^1024 -----------------*/ + if (k>0x000fffff && k<0x7ff00000) { + y=1.0-t*(t*s); + t=t*(rt0+y*(rt1+y*(rt2+y*rt3))); + c.i[HIGH_HALF]=0x20000000+((k&0x7fe00000)>>1); + y=t*s; + hy=(y+big)-big; + del=0.5*t*((s-hy*hy)-(y-hy)*(y+hy)); + res=y+del; + if (res == (res+1.002*((y-res)+del))) return res*c.x; + else { + res1=res+1.5*((y-res)+del); + EMULV(res,res1,z,zz,p,hx,tx,hy,ty); /* (z+zz)=res*res1 */ + return ((((z-s)+zz)<0)?max(res,res1):min(res,res1))*c.x; + } + } + else { + if ((k & 0x7ff00000) == 0x7ff00000) + return x*x+x; /* sqrt(NaN)=NaN, sqrt(+inf)=+inf, sqrt(-inf)=sNaN */ + if (x==0) return x; /* sqrt(+0)=+0, sqrt(-0)=-0 */ + if (k<0) return (x-x)/(x-x); /* sqrt(-ve)=sNaN */ + return tm256.x*__ieee754_sqrt(x*t512.x); + } +} diff --git a/libgcc-math/dbl-64/halfulp.c b/libgcc-math/dbl-64/halfulp.c new file mode 100644 index 00000000000..478a4bacf60 --- /dev/null +++ b/libgcc-math/dbl-64/halfulp.c @@ -0,0 +1,123 @@ +/* + * IBM Accurate Mathematical Library + * written by International Business Machines Corp. + * Copyright (C) 2001, 2005 Free Software Foundation + * + * This program is free software; you can redistribute it and/or modify + * it under the terms of the GNU Lesser General Public License as published by + * the Free Software Foundation; either version 2.1 of the License, or + * (at your option) any later version. + * + * This program is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU Lesser General Public License for more details. + * + * You should have received a copy of the GNU Lesser General Public License + * along with this program; if not, write to the Free Software + * Foundation, Inc., 59 Temple Place - Suite 330, Boston, MA 02111-1307, USA. + */ +/************************************************************************/ +/* */ +/* MODULE_NAME:halfulp.c */ +/* */ +/* FUNCTIONS:halfulp */ +/* FILES NEEDED: mydefs.h dla.h endian.h */ +/* uroot.c */ +/* */ +/*Routine halfulp(double x, double y) computes x^y where result does */ +/*not need rounding. If the result is closer to 0 than can be */ +/*represented it returns 0. */ +/* In the following cases the function does not compute anything */ +/*and returns a negative number: */ +/*1. if the result needs rounding, */ +/*2. if y is outside the interval [0, 2^20-1], */ +/*3. if x can be represented by x=2**n for some integer n. */ +/************************************************************************/ + +#include "endian.h" +#include "mydefs.h" +#include "dla.h" +#include "math_private.h" + +double __ieee754_sqrt(double x); + +static const int4 tab54[32] = { + 262143, 11585, 1782, 511, 210, 107, 63, 42, + 30, 22, 17, 14, 12, 10, 9, 7, + 7, 6, 5, 5, 5, 4, 4, 4, + 3, 3, 3, 3, 3, 3, 3, 3 }; + + +double __halfulp(double x, double y) +{ + mynumber v; + double z,u,uu,j1,j2,j3,j4,j5; + int4 k,l,m,n; + if (y <= 0) { /*if power is negative or zero */ + v.x = y; + if (v.i[LOW_HALF] != 0) return -10.0; + v.x = x; + if (v.i[LOW_HALF] != 0) return -10.0; + if ((v.i[HIGH_HALF]&0x000fffff) != 0) return -10; /* if x =2 ^ n */ + k = ((v.i[HIGH_HALF]&0x7fffffff)>>20)-1023; /* find this n */ + z = (double) k; + return (z*y == -1075.0)?0: -10.0; + } + /* if y > 0 */ + v.x = y; + if (v.i[LOW_HALF] != 0) return -10.0; + + v.x=x; + /* case where x = 2**n for some integer n */ + if (((v.i[HIGH_HALF]&0x000fffff)|v.i[LOW_HALF]) == 0) { + k=(v.i[HIGH_HALF]>>20)-1023; + return (((double) k)*y == -1075.0)?0:-10.0; + } + + v.x = y; + k = v.i[HIGH_HALF]; + m = k<<12; + l = 0; + while (m) + {m = m<<1; l++; } + n = (k&0x000fffff)|0x00100000; + n = n>>(20-l); /* n is the odd integer of y */ + k = ((k>>20) -1023)-l; /* y = n*2**k */ + if (k>5) return -10.0; + if (k>0) for (;k>0;k--) n *= 2; + if (n > 34) return -10.0; + k = -k; + if (k>5) return -10.0; + + /* now treat x */ + while (k>0) { + z = __ieee754_sqrt(x); + EMULV(z,z,u,uu,j1,j2,j3,j4,j5); + if (((u-x)+uu) != 0) break; + x = z; + k--; + } + if (k) return -10.0; + + /* it is impossible that n == 2, so the mantissa of x must be short */ + + v.x = x; + if (v.i[LOW_HALF]) return -10.0; + k = v.i[HIGH_HALF]; + m = k<<12; + l = 0; + while (m) {m = m<<1; l++; } + m = (k&0x000fffff)|0x00100000; + m = m>>(20-l); /* m is the odd integer of x */ + + /* now check whether the length of m**n is at most 54 bits */ + + if (m > tab54[n-3]) return -10.0; + + /* yes, it is - now compute x**n by simple multiplications */ + + u = x; + for (k=1;k= 0 or (e0-3)/24 >= jv + * Hence jv = max(0,(e0-3)/24). + * + * jp jp+1 is the number of terms in PIo2[] needed, jp = jk. + * + * q[] double array with integral value, representing the + * 24-bits chunk of the product of x and 2/pi. + * + * q0 the corresponding exponent of q[0]. Note that the + * exponent for q[i] would be q0-24*i. + * + * PIo2[] double precision array, obtained by cutting pi/2 + * into 24 bits chunks. + * + * f[] ipio2[] in floating point + * + * iq[] integer array by breaking up q[] in 24-bits chunk. + * + * fq[] final product of x*(2/pi) in fq[0],..,fq[jk] + * + * ih integer. If >0 it indicates q[] is >= 0.5, hence + * it also indicates the *sign* of the result. + * + */ + + +/* + * Constants: + * The hexadecimal values are the intended ones for the following + * constants. The decimal values may be used, provided that the + * compiler will convert from decimal to binary accurately enough + * to produce the hexadecimal values shown. + */ + +#include "math.h" +#include "math_private.h" + +#ifdef __STDC__ +static const int init_jk[] = {2,3,4,6}; /* initial value for jk */ +#else +static int init_jk[] = {2,3,4,6}; +#endif + +#ifdef __STDC__ +static const double PIo2[] = { +#else +static double PIo2[] = { +#endif + 1.57079625129699707031e+00, /* 0x3FF921FB, 0x40000000 */ + 7.54978941586159635335e-08, /* 0x3E74442D, 0x00000000 */ + 5.39030252995776476554e-15, /* 0x3CF84698, 0x80000000 */ + 3.28200341580791294123e-22, /* 0x3B78CC51, 0x60000000 */ + 1.27065575308067607349e-29, /* 0x39F01B83, 0x80000000 */ + 1.22933308981111328932e-36, /* 0x387A2520, 0x40000000 */ + 2.73370053816464559624e-44, /* 0x36E38222, 0x80000000 */ + 2.16741683877804819444e-51, /* 0x3569F31D, 0x00000000 */ +}; + +#ifdef __STDC__ +static const double +#else +static double +#endif +zero = 0.0, +one = 1.0, +two24 = 1.67772160000000000000e+07, /* 0x41700000, 0x00000000 */ +twon24 = 5.96046447753906250000e-08; /* 0x3E700000, 0x00000000 */ + +#ifdef __STDC__ + int __kernel_rem_pio2(double *x, double *y, int e0, int nx, int prec, const int32_t *ipio2) +#else + int __kernel_rem_pio2(x,y,e0,nx,prec,ipio2) + double x[], y[]; int e0,nx,prec; int32_t ipio2[]; +#endif +{ + int32_t jz,jx,jv,jp,jk,carry,n,iq[20],i,j,k,m,q0,ih; + double z,fw,f[20],fq[20],q[20]; + + /* initialize jk*/ + jk = init_jk[prec]; + jp = jk; + + /* determine jx,jv,q0, note that 3>q0 */ + jx = nx-1; + jv = (e0-3)/24; if(jv<0) jv=0; + q0 = e0-24*(jv+1); + + /* set up f[0] to f[jx+jk] where f[jx+jk] = ipio2[jv+jk] */ + j = jv-jx; m = jx+jk; + for(i=0;i<=m;i++,j++) f[i] = (j<0)? zero : (double) ipio2[j]; + + /* compute q[0],q[1],...q[jk] */ + for (i=0;i<=jk;i++) { + for(j=0,fw=0.0;j<=jx;j++) fw += x[j]*f[jx+i-j]; q[i] = fw; + } + + jz = jk; +recompute: + /* distill q[] into iq[] reversingly */ + for(i=0,j=jz,z=q[jz];j>0;i++,j--) { + fw = (double)((int32_t)(twon24* z)); + iq[i] = (int32_t)(z-two24*fw); + z = q[j-1]+fw; + } + + /* compute n */ + z = __scalbn(z,q0); /* actual value of z */ + z -= 8.0*__floor(z*0.125); /* trim off integer >= 8 */ + n = (int32_t) z; + z -= (double)n; + ih = 0; + if(q0>0) { /* need iq[jz-1] to determine n */ + i = (iq[jz-1]>>(24-q0)); n += i; + iq[jz-1] -= i<<(24-q0); + ih = iq[jz-1]>>(23-q0); + } + else if(q0==0) ih = iq[jz-1]>>23; + else if(z>=0.5) ih=2; + + if(ih>0) { /* q > 0.5 */ + n += 1; carry = 0; + for(i=0;i0) { /* rare case: chance is 1 in 12 */ + switch(q0) { + case 1: + iq[jz-1] &= 0x7fffff; break; + case 2: + iq[jz-1] &= 0x3fffff; break; + } + } + if(ih==2) { + z = one - z; + if(carry!=0) z -= __scalbn(one,q0); + } + } + + /* check if recomputation is needed */ + if(z==zero) { + j = 0; + for (i=jz-1;i>=jk;i--) j |= iq[i]; + if(j==0) { /* need recomputation */ + for(k=1;iq[jk-k]==0;k++); /* k = no. of terms needed */ + + for(i=jz+1;i<=jz+k;i++) { /* add q[jz+1] to q[jz+k] */ + f[jx+i] = (double) ipio2[jv+i]; + for(j=0,fw=0.0;j<=jx;j++) fw += x[j]*f[jx+i-j]; + q[i] = fw; + } + jz += k; + goto recompute; + } + } + + /* chop off zero terms */ + if(z==0.0) { + jz -= 1; q0 -= 24; + while(iq[jz]==0) { jz--; q0-=24;} + } else { /* break z into 24-bit if necessary */ + z = __scalbn(z,-q0); + if(z>=two24) { + fw = (double)((int32_t)(twon24*z)); + iq[jz] = (int32_t)(z-two24*fw); + jz += 1; q0 += 24; + iq[jz] = (int32_t) fw; + } else iq[jz] = (int32_t) z ; + } + + /* convert integer "bit" chunk to floating-point value */ + fw = __scalbn(one,q0); + for(i=jz;i>=0;i--) { + q[i] = fw*(double)iq[i]; fw*=twon24; + } + + /* compute PIo2[0,...,jp]*q[jz,...,0] */ + for(i=jz;i>=0;i--) { + for(fw=0.0,k=0;k<=jp&&k<=jz-i;k++) fw += PIo2[k]*q[i+k]; + fq[jz-i] = fw; + } + + /* compress fq[] into y[] */ + switch(prec) { + case 0: + fw = 0.0; + for (i=jz;i>=0;i--) fw += fq[i]; + y[0] = (ih==0)? fw: -fw; + break; + case 1: + case 2: + fw = 0.0; + for (i=jz;i>=0;i--) fw += fq[i]; + y[0] = (ih==0)? fw: -fw; + fw = fq[0]-fw; + for (i=1;i<=jz;i++) fw += fq[i]; + y[1] = (ih==0)? fw: -fw; + break; + case 3: /* painful */ + for (i=jz;i>0;i--) { + fw = fq[i-1]+fq[i]; + fq[i] += fq[i-1]-fw; + fq[i-1] = fw; + } + for (i=jz;i>1;i--) { + fw = fq[i-1]+fq[i]; + fq[i] += fq[i-1]-fw; + fq[i-1] = fw; + } + for (fw=0.0,i=jz;i>=2;i--) fw += fq[i]; + if(ih==0) { + y[0] = fq[0]; y[1] = fq[1]; y[2] = fw; + } else { + y[0] = -fq[0]; y[1] = -fq[1]; y[2] = -fw; + } + } + return n&7; +} diff --git a/libgcc-math/dbl-64/mpa.c b/libgcc-math/dbl-64/mpa.c new file mode 100644 index 00000000000..68647ba335d --- /dev/null +++ b/libgcc-math/dbl-64/mpa.c @@ -0,0 +1,508 @@ + +/* + * IBM Accurate Mathematical Library + * written by International Business Machines Corp. + * Copyright (C) 2001 Free Software Foundation + * + * This program is free software; you can redistribute it and/or modify + * it under the terms of the GNU Lesser General Public License as published by + * the Free Software Foundation; either version 2.1 of the License, or + * (at your option) any later version. + * + * This program is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU Lesser General Public License for more details. + * + * You should have received a copy of the GNU Lesser General Public License + * along with this program; if not, write to the Free Software + * Foundation, Inc., 59 Temple Place - Suite 330, Boston, MA 02111-1307, USA. + */ +/************************************************************************/ +/* MODULE_NAME: mpa.c */ +/* */ +/* FUNCTIONS: */ +/* mcr */ +/* acr */ +/* cr */ +/* cpy */ +/* cpymn */ +/* norm */ +/* denorm */ +/* mp_dbl */ +/* dbl_mp */ +/* add_magnitudes */ +/* sub_magnitudes */ +/* add */ +/* sub */ +/* mul */ +/* inv */ +/* dvd */ +/* */ +/* Arithmetic functions for multiple precision numbers. */ +/* Relative errors are bounded */ +/************************************************************************/ + + +#include "endian.h" +#include "mpa.h" +#include "mpa2.h" +#include /* For MIN() */ +/* mcr() compares the sizes of the mantissas of two multiple precision */ +/* numbers. Mantissas are compared regardless of the signs of the */ +/* numbers, even if x->d[0] or y->d[0] are zero. Exponents are also */ +/* disregarded. */ +static int mcr(const mp_no *x, const mp_no *y, int p) { + int i; + for (i=1; i<=p; i++) { + if (X[i] == Y[i]) continue; + else if (X[i] > Y[i]) return 1; + else return -1; } + return 0; +} + + + +/* acr() compares the absolute values of two multiple precision numbers */ +int __acr(const mp_no *x, const mp_no *y, int p) { + int i; + + if (X[0] == ZERO) { + if (Y[0] == ZERO) i= 0; + else i=-1; + } + else if (Y[0] == ZERO) i= 1; + else { + if (EX > EY) i= 1; + else if (EX < EY) i=-1; + else i= mcr(x,y,p); + } + + return i; +} + + +/* cr90 compares the values of two multiple precision numbers */ +int __cr(const mp_no *x, const mp_no *y, int p) { + int i; + + if (X[0] > Y[0]) i= 1; + else if (X[0] < Y[0]) i=-1; + else if (X[0] < ZERO ) i= __acr(y,x,p); + else i= __acr(x,y,p); + + return i; +} + + +/* Copy a multiple precision number. Set *y=*x. x=y is permissible. */ +void __cpy(const mp_no *x, mp_no *y, int p) { + int i; + + EY = EX; + for (i=0; i <= p; i++) Y[i] = X[i]; + + return; +} + + +/* Copy a multiple precision number x of precision m into a */ +/* multiple precision number y of precision n. In case n>m, */ +/* the digits of y beyond the m'th are set to zero. In case */ +/* n= 2**(-1022))) */ +static void norm(const mp_no *x, double *y, int p) +{ + #define R radixi.d + int i; +#if 0 + int k; +#endif + double a,c,u,v,z[5]; + if (p<5) { + if (p==1) c = X[1]; + else if (p==2) c = X[1] + R* X[2]; + else if (p==3) c = X[1] + R*(X[2] + R* X[3]); + else if (p==4) c =(X[1] + R* X[2]) + R*R*(X[3] + R*X[4]); + } + else { + for (a=ONE, z[1]=X[1]; z[1] < TWO23; ) + {a *= TWO; z[1] *= TWO; } + + for (i=2; i<5; i++) { + z[i] = X[i]*a; + u = (z[i] + CUTTER)-CUTTER; + if (u > z[i]) u -= RADIX; + z[i] -= u; + z[i-1] += u*RADIXI; + } + + u = (z[3] + TWO71) - TWO71; + if (u > z[3]) u -= TWO19; + v = z[3]-u; + + if (v == TWO18) { + if (z[4] == ZERO) { + for (i=5; i <= p; i++) { + if (X[i] == ZERO) continue; + else {z[3] += ONE; break; } + } + } + else z[3] += ONE; + } + + c = (z[1] + R *(z[2] + R * z[3]))/a; + } + + c *= X[0]; + + for (i=1; iEX; i--) c *= RADIXI; + + *y = c; + return; +#undef R +} + +/* Convert a multiple precision number *x into a double precision */ +/* number *y, denormalized case (|x| < 2**(-1022))) */ +static void denorm(const mp_no *x, double *y, int p) +{ + int i,k; + double c,u,z[5]; +#if 0 + double a,v; +#endif + +#define R radixi.d + if (EX<-44 || (EX==-44 && X[1] z[3]) u -= TWO5; + + if (u==z[3]) { + for (i=k+1; i <= p; i++) { + if (X[i] == ZERO) continue; + else {z[3] += ONE; break; } + } + } + + c = X[0]*((z[1] + R*(z[2] + R*z[3])) - TWO10); + + *y = c*TWOM1032; + return; + +#undef R +} + +/* Convert a multiple precision number *x into a double precision number *y. */ +/* The result is correctly rounded to the nearest/even. *x is left unchanged */ + +void __mp_dbl(const mp_no *x, double *y, int p) { +#if 0 + int i,k; + double a,c,u,v,z[5]; +#endif + + if (X[0] == ZERO) {*y = ZERO; return; } + + if (EX> -42) norm(x,y,p); + else if (EX==-42 && X[1]>=TWO10) norm(x,y,p); + else denorm(x,y,p); +} + + +/* dbl_mp() converts a double precision number x into a multiple precision */ +/* number *y. If the precision p is too small the result is truncated. x is */ +/* left unchanged. */ + +void __dbl_mp(double x, mp_no *y, int p) { + + int i,n; + double u; + + /* Sign */ + if (x == ZERO) {Y[0] = ZERO; return; } + else if (x > ZERO) Y[0] = ONE; + else {Y[0] = MONE; x=-x; } + + /* Exponent */ + for (EY=ONE; x >= RADIX; EY += ONE) x *= RADIXI; + for ( ; x < ONE; EY -= ONE) x *= RADIX; + + /* Digits */ + n=MIN(p,4); + for (i=1; i<=n; i++) { + u = (x + TWO52) - TWO52; + if (u>x) u -= ONE; + Y[i] = u; x -= u; x *= RADIX; } + for ( ; i<=p; i++) Y[i] = ZERO; + return; +} + + +/* add_magnitudes() adds the magnitudes of *x & *y assuming that */ +/* abs(*x) >= abs(*y) > 0. */ +/* The sign of the sum *z is undefined. x&y may overlap but not x&z or y&z. */ +/* No guard digit is used. The result equals the exact sum, truncated. */ +/* *x & *y are left unchanged. */ + +static void add_magnitudes(const mp_no *x, const mp_no *y, mp_no *z, int p) { + + int i,j,k; + + EZ = EX; + + i=p; j=p+ EY - EX; k=p+1; + + if (j<1) + {__cpy(x,z,p); return; } + else Z[k] = ZERO; + + for (; j>0; i--,j--) { + Z[k] += X[i] + Y[j]; + if (Z[k] >= RADIX) { + Z[k] -= RADIX; + Z[--k] = ONE; } + else + Z[--k] = ZERO; + } + + for (; i>0; i--) { + Z[k] += X[i]; + if (Z[k] >= RADIX) { + Z[k] -= RADIX; + Z[--k] = ONE; } + else + Z[--k] = ZERO; + } + + if (Z[1] == ZERO) { + for (i=1; i<=p; i++) Z[i] = Z[i+1]; } + else EZ += ONE; +} + + +/* sub_magnitudes() subtracts the magnitudes of *x & *y assuming that */ +/* abs(*x) > abs(*y) > 0. */ +/* The sign of the difference *z is undefined. x&y may overlap but not x&z */ +/* or y&z. One guard digit is used. The error is less than one ulp. */ +/* *x & *y are left unchanged. */ + +static void sub_magnitudes(const mp_no *x, const mp_no *y, mp_no *z, int p) { + + int i,j,k; + + EZ = EX; + + if (EX == EY) { + i=j=k=p; + Z[k] = Z[k+1] = ZERO; } + else { + j= EX - EY; + if (j > p) {__cpy(x,z,p); return; } + else { + i=p; j=p+1-j; k=p; + if (Y[j] > ZERO) { + Z[k+1] = RADIX - Y[j--]; + Z[k] = MONE; } + else { + Z[k+1] = ZERO; + Z[k] = ZERO; j--;} + } + } + + for (; j>0; i--,j--) { + Z[k] += (X[i] - Y[j]); + if (Z[k] < ZERO) { + Z[k] += RADIX; + Z[--k] = MONE; } + else + Z[--k] = ZERO; + } + + for (; i>0; i--) { + Z[k] += X[i]; + if (Z[k] < ZERO) { + Z[k] += RADIX; + Z[--k] = MONE; } + else + Z[--k] = ZERO; + } + + for (i=1; Z[i] == ZERO; i++) ; + EZ = EZ - i + 1; + for (k=1; i <= p+1; ) + Z[k++] = Z[i++]; + for (; k <= p; ) + Z[k++] = ZERO; + + return; +} + + +/* Add two multiple precision numbers. Set *z = *x + *y. x&y may overlap */ +/* but not x&z or y&z. One guard digit is used. The error is less than */ +/* one ulp. *x & *y are left unchanged. */ + +void __add(const mp_no *x, const mp_no *y, mp_no *z, int p) { + + int n; + + if (X[0] == ZERO) {__cpy(y,z,p); return; } + else if (Y[0] == ZERO) {__cpy(x,z,p); return; } + + if (X[0] == Y[0]) { + if (__acr(x,y,p) > 0) {add_magnitudes(x,y,z,p); Z[0] = X[0]; } + else {add_magnitudes(y,x,z,p); Z[0] = Y[0]; } + } + else { + if ((n=__acr(x,y,p)) == 1) {sub_magnitudes(x,y,z,p); Z[0] = X[0]; } + else if (n == -1) {sub_magnitudes(y,x,z,p); Z[0] = Y[0]; } + else Z[0] = ZERO; + } + return; +} + + +/* Subtract two multiple precision numbers. *z is set to *x - *y. x&y may */ +/* overlap but not x&z or y&z. One guard digit is used. The error is */ +/* less than one ulp. *x & *y are left unchanged. */ + +void __sub(const mp_no *x, const mp_no *y, mp_no *z, int p) { + + int n; + + if (X[0] == ZERO) {__cpy(y,z,p); Z[0] = -Z[0]; return; } + else if (Y[0] == ZERO) {__cpy(x,z,p); return; } + + if (X[0] != Y[0]) { + if (__acr(x,y,p) > 0) {add_magnitudes(x,y,z,p); Z[0] = X[0]; } + else {add_magnitudes(y,x,z,p); Z[0] = -Y[0]; } + } + else { + if ((n=__acr(x,y,p)) == 1) {sub_magnitudes(x,y,z,p); Z[0] = X[0]; } + else if (n == -1) {sub_magnitudes(y,x,z,p); Z[0] = -Y[0]; } + else Z[0] = ZERO; + } + return; +} + + +/* Multiply two multiple precision numbers. *z is set to *x * *y. x&y */ +/* may overlap but not x&z or y&z. In case p=1,2,3 the exact result is */ +/* truncated to p digits. In case p>3 the error is bounded by 1.001 ulp. */ +/* *x & *y are left unchanged. */ + +void __mul(const mp_no *x, const mp_no *y, mp_no *z, int p) { + + int i, i1, i2, j, k, k2; + double u; + + /* Is z=0? */ + if (X[0]*Y[0]==ZERO) + { Z[0]=ZERO; return; } + + /* Multiply, add and carry */ + k2 = (p<3) ? p+p : p+3; + Z[k2]=ZERO; + for (k=k2; k>1; ) { + if (k > p) {i1=k-p; i2=p+1; } + else {i1=1; i2=k; } + for (i=i1,j=i2-1; i Z[k]) u -= RADIX; + Z[k] -= u; + Z[--k] = u*RADIXI; + } + + /* Is there a carry beyond the most significant digit? */ + if (Z[1] == ZERO) { + for (i=1; i<=p; i++) Z[i]=Z[i+1]; + EZ = EX + EY - 1; } + else + EZ = EX + EY; + + Z[0] = X[0] * Y[0]; + return; +} + + +/* Invert a multiple precision number. Set *y = 1 / *x. */ +/* Relative error bound = 1.001*r**(1-p) for p=2, 1.063*r**(1-p) for p=3, */ +/* 2.001*r**(1-p) for p>3. */ +/* *x=0 is not permissible. *x is left unchanged. */ + +void __inv(const mp_no *x, mp_no *y, int p) { + int i; +#if 0 + int l; +#endif + double t; + mp_no z,w; + static const int np1[] = {0,0,0,0,1,2,2,2,2,3,3,3,3,3,3,3,3,3, + 4,4,4,4,4,4,4,4,4,4,4,4,4,4,4}; + const mp_no mptwo = {1,{1.0,2.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0, + 0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0, + 0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0, + 0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0}}; + + __cpy(x,&z,p); z.e=0; __mp_dbl(&z,&t,p); + t=ONE/t; __dbl_mp(t,y,p); EY -= EX; + + for (i=0; i3. *y=0 is not permissible. */ + +void __dvd(const mp_no *x, const mp_no *y, mp_no *z, int p) { + + mp_no w; + + if (X[0] == ZERO) Z[0] = ZERO; + else {__inv(y,&w,p); __mul(x,&w,z,p);} + return; +} diff --git a/libgcc-math/dbl-64/mpa.h b/libgcc-math/dbl-64/mpa.h new file mode 100644 index 00000000000..912b5e41121 --- /dev/null +++ b/libgcc-math/dbl-64/mpa.h @@ -0,0 +1,89 @@ + +/* + * IBM Accurate Mathematical Library + * Written by International Business Machines Corp. + * Copyright (C) 2001 Free Software Foundation, Inc. + * + * This program is free software; you can redistribute it and/or modify + * it under the terms of the GNU Lesser General Public License as published by + * the Free Software Foundation; either version 2.1 of the License, or + * (at your option) any later version. + * + * This program is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU Lesser General Public License for more details. + * + * You should have received a copy of the GNU Lesser General Public License + * along with this program; if not, write to the Free Software + * Foundation, Inc., 59 Temple Place - Suite 330, Boston, MA 02111-1307, USA. + */ + +/************************************************************************/ +/* MODULE_NAME: mpa.h */ +/* */ +/* FUNCTIONS: */ +/* mcr */ +/* acr */ +/* cr */ +/* cpy */ +/* cpymn */ +/* mp_dbl */ +/* dbl_mp */ +/* add */ +/* sub */ +/* mul */ +/* inv */ +/* dvd */ +/* */ +/* Arithmetic functions for multiple precision numbers. */ +/* Common types and definition */ +/************************************************************************/ + +#ifndef MPA_H +#define MPA_H + +typedef struct {/* This structure holds the details of a multi-precision */ + int e; /* floating point number, x: d[0] holds its sign (-1,0 or 1) */ + double d[40]; /* e holds its exponent (...,-2,-1,0,1,2,...) and */ +} mp_no; /* d[1]...d[p] hold its mantissa digits. The value of x is, */ + /* x = d[1]*r**(e-1) + d[2]*r**(e-2) + ... + d[p]*r**(e-p). */ + /* Here r = 2**24, 0 <= d[i] < r and 1 <= p <= 32. */ + /* p is a global variable. A multi-precision number is */ + /* always normalized. Namely, d[1] > 0. An exception is */ + /* a zero which is characterized by d[0] = 0. The terms */ + /* d[p+1], d[p+2], ... of a none zero number have no */ + /* significance and so are the terms e, d[1],d[2],... */ + /* of a zero. */ + +typedef union { int i[2]; double d; } number; + +#define X x->d +#define Y y->d +#define Z z->d +#define EX x->e +#define EY y->e +#define EZ z->e + +#define ABS(x) ((x) < 0 ? -(x) : (x)) + +int __acr(const mp_no *, const mp_no *, int); +int __cr(const mp_no *, const mp_no *, int); +void __cpy(const mp_no *, mp_no *, int); +void __cpymn(const mp_no *, int, mp_no *, int); +void __mp_dbl(const mp_no *, double *, int); +void __dbl_mp(double, mp_no *, int); +void __add(const mp_no *, const mp_no *, mp_no *, int); +void __sub(const mp_no *, const mp_no *, mp_no *, int); +void __mul(const mp_no *, const mp_no *, mp_no *, int); +void __inv(const mp_no *, mp_no *, int); +void __dvd(const mp_no *, const mp_no *, mp_no *, int); + +extern void __mpatan (mp_no *, mp_no *, int); +extern void __mpatan2 (mp_no *, mp_no *, mp_no *, int); +extern void __mpsqrt (mp_no *, mp_no *, int); +extern void __mpexp (mp_no *, mp_no *__y, int); +extern void __c32 (mp_no *, mp_no *, mp_no *, int); +extern int __mpranred (double, mp_no *, int); + +#endif diff --git a/libgcc-math/dbl-64/mpa2.h b/libgcc-math/dbl-64/mpa2.h new file mode 100644 index 00000000000..54284bb8dc5 --- /dev/null +++ b/libgcc-math/dbl-64/mpa2.h @@ -0,0 +1,98 @@ + +/* + * IBM Accurate Mathematical Library + * Written by International Business Machines Corp. + * Copyright (C) 2001 Free Software Foundation, Inc. + * + * This program is free software; you can redistribute it and/or modify + * it under the terms of the GNU Lesser General Public License as published by + * the Free Software Foundation; either version 2.1 of the License, or + * (at your option) any later version. + * + * This program is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU Lesser General Public License for more details. + * + * You should have received a copy of the GNU Lesser General Public License + * along with this program; if not, write to the Free Software + * Foundation, Inc., 59 Temple Place - Suite 330, Boston, MA 02111-1307, USA. + */ + +/**************************************************************************/ +/* */ +/* MODULE_NAME:mpa2.h */ +/* */ +/* */ +/* variables prototype and definition according to type of processor */ +/* types definition */ +/**************************************************************************/ + +#ifndef MPA2_H +#define MPA2_H + + +#ifdef BIG_ENDI +static const number +/**/ radix = {{0x41700000, 0x00000000} }, /* 2**24 */ +/**/ radixi = {{0x3e700000, 0x00000000} }, /* 2**-24 */ +/**/ cutter = {{0x44b00000, 0x00000000} }, /* 2**76 */ +/**/ zero = {{0x00000000, 0x00000000} }, /* 0 */ +/**/ one = {{0x3ff00000, 0x00000000} }, /* 1 */ +/**/ mone = {{0xbff00000, 0x00000000} }, /* -1 */ +/**/ two = {{0x40000000, 0x00000000} }, /* 2 */ +/**/ half = {{0x3fe00000, 0x00000000} }, /* 1/2 */ +/**/ two5 = {{0x40400000, 0x00000000} }, /* 2**5 */ +/**/ two10 = {{0x40900000, 0x00000000} }, /* 2**10 */ +/**/ two18 = {{0x41100000, 0x00000000} }, /* 2**18 */ +/**/ two19 = {{0x41200000, 0x00000000} }, /* 2**19 */ +/**/ two23 = {{0x41600000, 0x00000000} }, /* 2**23 */ +/**/ two52 = {{0x43300000, 0x00000000} }, /* 2**52 */ +/**/ two57 = {{0x43800000, 0x00000000} }, /* 2**57 */ +/**/ two71 = {{0x44600000, 0x00000000} }, /* 2**71 */ +/**/ twom1032 = {{0x00000400, 0x00000000} }; /* 2**-1032 */ + +#else +#ifdef LITTLE_ENDI +static const number +/**/ radix = {{0x00000000, 0x41700000} }, /* 2**24 */ +/**/ radixi = {{0x00000000, 0x3e700000} }, /* 2**-24 */ +/**/ cutter = {{0x00000000, 0x44b00000} }, /* 2**76 */ +/**/ zero = {{0x00000000, 0x00000000} }, /* 0 */ +/**/ one = {{0x00000000, 0x3ff00000} }, /* 1 */ +/**/ mone = {{0x00000000, 0xbff00000} }, /* -1 */ +/**/ two = {{0x00000000, 0x40000000} }, /* 2 */ +/**/ half = {{0x00000000, 0x3fe00000} }, /* 1/2 */ +/**/ two5 = {{0x00000000, 0x40400000} }, /* 2**5 */ +/**/ two10 = {{0x00000000, 0x40900000} }, /* 2**10 */ +/**/ two18 = {{0x00000000, 0x41100000} }, /* 2**18 */ +/**/ two19 = {{0x00000000, 0x41200000} }, /* 2**19 */ +/**/ two23 = {{0x00000000, 0x41600000} }, /* 2**23 */ +/**/ two52 = {{0x00000000, 0x43300000} }, /* 2**52 */ +/**/ two57 = {{0x00000000, 0x43800000} }, /* 2**57 */ +/**/ two71 = {{0x00000000, 0x44600000} }, /* 2**71 */ +/**/ twom1032 = {{0x00000000, 0x00000400} }; /* 2**-1032 */ + +#endif +#endif + +#define RADIX radix.d +#define RADIXI radixi.d +#define CUTTER cutter.d +#define ZERO zero.d +#define ONE one.d +#define MONE mone.d +#define TWO two.d +#define HALF half.d +#define TWO5 two5.d +#define TWO10 two10.d +#define TWO18 two18.d +#define TWO19 two19.d +#define TWO23 two23.d +#define TWO52 two52.d +#define TWO57 two57.d +#define TWO71 two71.d +#define TWOM1032 twom1032.d + + +#endif diff --git a/libgcc-math/dbl-64/mpatan.c b/libgcc-math/dbl-64/mpatan.c new file mode 100644 index 00000000000..ee21c251381 --- /dev/null +++ b/libgcc-math/dbl-64/mpatan.c @@ -0,0 +1,102 @@ + +/* + * IBM Accurate Mathematical Library + * written by International Business Machines Corp. + * Copyright (C) 2001 Free Software Foundation + * + * This program is free software; you can redistribute it and/or modify + * it under the terms of the GNU Lesser General Public License as published by + * the Free Software Foundation; either version 2.1 of the License, or + * (at your option) any later version. + * + * This program is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU Lesser General Public License for more details. + * + * You should have received a copy of the GNU Lesser General Public License + * along with this program; if not, write to the Free Software + * Foundation, Inc., 59 Temple Place - Suite 330, Boston, MA 02111-1307, USA. + */ +/******************************************************************/ +/* */ +/* MODULE_NAME:mpatan.c */ +/* */ +/* FUNCTIONS:mpatan */ +/* */ +/* FILES NEEDED: mpa.h endian.h mpatan.h */ +/* mpa.c */ +/* */ +/* Multi-Precision Atan function subroutine, for precision p >= 4.*/ +/* The relative error of the result is bounded by 34.32*r**(1-p), */ +/* where r=2**24. */ +/******************************************************************/ + +#include "endian.h" +#include "mpa.h" +void __mpsqrt(mp_no *, mp_no *, int); + +void __mpatan(mp_no *x, mp_no *y, int p) { +#include "mpatan.h" + + int i,m,n; + double dx; + mp_no + mpone = {0,{0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0, + 0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0, + 0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0}}, + mptwo = {0,{0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0, + 0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0, + 0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0}}, + mptwoim1 = {0,{0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0, + 0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0, + 0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0}}; + + mp_no mps,mpsm,mpt,mpt1,mpt2,mpt3; + + /* Choose m and initiate mpone, mptwo & mptwoim1 */ + if (EX>0) m=7; + else if (EX<0) m=0; + else { + __mp_dbl(x,&dx,p); dx=ABS(dx); + for (m=6; m>0; m--) + {if (dx>xm[m].d) break;} + } + mpone.e = mptwo.e = mptwoim1.e = 1; + mpone.d[0] = mpone.d[1] = mptwo.d[0] = mptwoim1.d[0] = ONE; + mptwo.d[1] = TWO; + + /* Reduce x m times */ + __mul(x,x,&mpsm,p); + if (m==0) __cpy(x,&mps,p); + else { + for (i=0; i1; i--) { + mptwoim1.d[1] -= TWO; + __dvd(&mpsm,&mptwoim1,&mpt1,p); + __mul(&mpsm,&mpt,&mpt2,p); + __sub(&mpt1,&mpt2,&mpt,p); + } + __mul(&mps,&mpt,&mpt1,p); + __sub(&mps,&mpt1,&mpt,p); + + /* Compute Atan(x) */ + mptwoim1.d[1] = twom[m].d; + __mul(&mptwoim1,&mpt,y,p); + + return; +} diff --git a/libgcc-math/dbl-64/mpatan.h b/libgcc-math/dbl-64/mpatan.h new file mode 100644 index 00000000000..d420ff34088 --- /dev/null +++ b/libgcc-math/dbl-64/mpatan.h @@ -0,0 +1,174 @@ + +/* + * IBM Accurate Mathematical Library + * Written by International Business Machines Corp. + * Copyright (C) 2001 Free Software Foundation, Inc. + * + * This program is free software; you can redistribute it and/or modify + * it under the terms of the GNU Lesser General Public License as published by + * the Free Software Foundation; either version 2.1 of the License, or + * (at your option) any later version. + * + * This program is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU Lesser General Public License for more details. + * + * You should have received a copy of the GNU Lesser General Public License + * along with this program; if not, write to the Free Software + * Foundation, Inc., 59 Temple Place - Suite 330, Boston, MA 02111-1307, USA. + */ + +/******************************************************************/ +/* */ +/* MODULE_NAME:mpatan.h */ +/* */ +/* common data and variables prototype and definition */ +/******************************************************************/ + +#ifndef MPATAN_H +#define MPATAN_H + +#ifdef BIG_ENDI + static const number + xm[8] = { /* x[m] */ +/**/ {{0x00000000, 0x00000000} }, /* 0.0 */ +/**/ {{0x3f8930be, 0x00000000} }, /* 0.0123 */ +/**/ {{0x3f991687, 0x00000000} }, /* 0.0245 */ +/**/ {{0x3fa923a2, 0x00000000} }, /* 0.0491 */ +/**/ {{0x3fb930be, 0x00000000} }, /* 0.0984 */ +/**/ {{0x3fc95810, 0x00000000} }, /* 0.198 */ +/**/ {{0x3fda7ef9, 0x00000000} }, /* 0.414 */ +/**/ {{0x3ff00000, 0x00000000} }, /* 1.0 */ + }; + static const number + twonm1[33] = { /* 2n-1 */ +/**/ {{0x00000000, 0x00000000} }, /* 0 */ +/**/ {{0x00000000, 0x00000000} }, /* 0 */ +/**/ {{0x00000000, 0x00000000} }, /* 0 */ +/**/ {{0x00000000, 0x00000000} }, /* 0 */ +/**/ {{0x40260000, 0x00000000} }, /* 11 */ +/**/ {{0x402e0000, 0x00000000} }, /* 15 */ +/**/ {{0x40330000, 0x00000000} }, /* 19 */ +/**/ {{0x40350000, 0x00000000} }, /* 21 */ +/**/ {{0x40390000, 0x00000000} }, /* 25 */ +/**/ {{0x403d0000, 0x00000000} }, /* 29 */ +/**/ {{0x40408000, 0x00000000} }, /* 33 */ +/**/ {{0x40428000, 0x00000000} }, /* 37 */ +/**/ {{0x40448000, 0x00000000} }, /* 41 */ +/**/ {{0x40468000, 0x00000000} }, /* 45 */ +/**/ {{0x40488000, 0x00000000} }, /* 49 */ +/**/ {{0x404a8000, 0x00000000} }, /* 53 */ +/**/ {{0x404b8000, 0x00000000} }, /* 55 */ +/**/ {{0x404d8000, 0x00000000} }, /* 59 */ +/**/ {{0x404f8000, 0x00000000} }, /* 63 */ +/**/ {{0x4050c000, 0x00000000} }, /* 67 */ +/**/ {{0x4051c000, 0x00000000} }, /* 71 */ +/**/ {{0x4052c000, 0x00000000} }, /* 75 */ +/**/ {{0x4053c000, 0x00000000} }, /* 79 */ +/**/ {{0x4054c000, 0x00000000} }, /* 83 */ +/**/ {{0x40554000, 0x00000000} }, /* 85 */ +/**/ {{0x40564000, 0x00000000} }, /* 89 */ +/**/ {{0x40574000, 0x00000000} }, /* 93 */ +/**/ {{0x40584000, 0x00000000} }, /* 97 */ +/**/ {{0x40594000, 0x00000000} }, /* 101 */ +/**/ {{0x405a4000, 0x00000000} }, /* 105 */ +/**/ {{0x405b4000, 0x00000000} }, /* 109 */ +/**/ {{0x405c4000, 0x00000000} }, /* 113 */ +/**/ {{0x405d4000, 0x00000000} }, /* 117 */ + }; + + static const number + twom[8] = { /* 2**m */ +/**/ {{0x3ff00000, 0x00000000} }, /* 1.0 */ +/**/ {{0x40000000, 0x00000000} }, /* 2.0 */ +/**/ {{0x40100000, 0x00000000} }, /* 4.0 */ +/**/ {{0x40200000, 0x00000000} }, /* 8.0 */ +/**/ {{0x40300000, 0x00000000} }, /* 16.0 */ +/**/ {{0x40400000, 0x00000000} }, /* 32.0 */ +/**/ {{0x40500000, 0x00000000} }, /* 64.0 */ +/**/ {{0x40600000, 0x00000000} }, /* 128.0 */ + }; + + static const number +/**/ one = {{0x3ff00000, 0x00000000} }, /* 1 */ +/**/ two = {{0x40000000, 0x00000000} }; /* 2 */ + +#else +#ifdef LITTLE_ENDI + + static const number + xm[8] = { /* x[m] */ +/**/ {{0x00000000, 0x00000000} }, /* 0.0 */ +/**/ {{0x00000000, 0x3f8930be} }, /* 0.0123 */ +/**/ {{0x00000000, 0x3f991687} }, /* 0.0245 */ +/**/ {{0x00000000, 0x3fa923a2} }, /* 0.0491 */ +/**/ {{0x00000000, 0x3fb930be} }, /* 0.0984 */ +/**/ {{0x00000000, 0x3fc95810} }, /* 0.198 */ +/**/ {{0x00000000, 0x3fda7ef9} }, /* 0.414 */ +/**/ {{0x00000000, 0x3ff00000} }, /* 1.0 */ + }; + static const number + twonm1[33] = { /* 2n-1 */ +/**/ {{0x00000000, 0x00000000} }, /* 0 */ +/**/ {{0x00000000, 0x00000000} }, /* 0 */ +/**/ {{0x00000000, 0x00000000} }, /* 0 */ +/**/ {{0x00000000, 0x00000000} }, /* 0 */ +/**/ {{0x00000000, 0x40260000} }, /* 11 */ +/**/ {{0x00000000, 0x402e0000} }, /* 15 */ +/**/ {{0x00000000, 0x40330000} }, /* 19 */ +/**/ {{0x00000000, 0x40350000} }, /* 21 */ +/**/ {{0x00000000, 0x40390000} }, /* 25 */ +/**/ {{0x00000000, 0x403d0000} }, /* 29 */ +/**/ {{0x00000000, 0x40408000} }, /* 33 */ +/**/ {{0x00000000, 0x40428000} }, /* 37 */ +/**/ {{0x00000000, 0x40448000} }, /* 41 */ +/**/ {{0x00000000, 0x40468000} }, /* 45 */ +/**/ {{0x00000000, 0x40488000} }, /* 49 */ +/**/ {{0x00000000, 0x404a8000} }, /* 53 */ +/**/ {{0x00000000, 0x404b8000} }, /* 55 */ +/**/ {{0x00000000, 0x404d8000} }, /* 59 */ +/**/ {{0x00000000, 0x404f8000} }, /* 63 */ +/**/ {{0x00000000, 0x4050c000} }, /* 67 */ +/**/ {{0x00000000, 0x4051c000} }, /* 71 */ +/**/ {{0x00000000, 0x4052c000} }, /* 75 */ +/**/ {{0x00000000, 0x4053c000} }, /* 79 */ +/**/ {{0x00000000, 0x4054c000} }, /* 83 */ +/**/ {{0x00000000, 0x40554000} }, /* 85 */ +/**/ {{0x00000000, 0x40564000} }, /* 89 */ +/**/ {{0x00000000, 0x40574000} }, /* 93 */ +/**/ {{0x00000000, 0x40584000} }, /* 97 */ +/**/ {{0x00000000, 0x40594000} }, /* 101 */ +/**/ {{0x00000000, 0x405a4000} }, /* 105 */ +/**/ {{0x00000000, 0x405b4000} }, /* 109 */ +/**/ {{0x00000000, 0x405c4000} }, /* 113 */ +/**/ {{0x00000000, 0x405d4000} }, /* 117 */ + }; + + static const number + twom[8] = { /* 2**m */ +/**/ {{0x00000000, 0x3ff00000} }, /* 1.0 */ +/**/ {{0x00000000, 0x40000000} }, /* 2.0 */ +/**/ {{0x00000000, 0x40100000} }, /* 4.0 */ +/**/ {{0x00000000, 0x40200000} }, /* 8.0 */ +/**/ {{0x00000000, 0x40300000} }, /* 16.0 */ +/**/ {{0x00000000, 0x40400000} }, /* 32.0 */ +/**/ {{0x00000000, 0x40500000} }, /* 64.0 */ +/**/ {{0x00000000, 0x40600000} }, /* 128.0 */ + }; + + static const number +/**/ one = {{0x00000000, 0x3ff00000} }, /* 1 */ +/**/ two = {{0x00000000, 0x40000000} }; /* 2 */ + +#endif +#endif + +#define ONE one.d +#define TWO two.d + + static const int + np[33] = { 0, 0, 0, 0, 6, 8,10,11,13,15,17,19,21,23,25,27,28, + 30,32,34,36,38,40,42,43,45,47,49,51,53,55,57,59}; + +#endif diff --git a/libgcc-math/dbl-64/mpatan2.c b/libgcc-math/dbl-64/mpatan2.c new file mode 100644 index 00000000000..91df9205663 --- /dev/null +++ b/libgcc-math/dbl-64/mpatan2.c @@ -0,0 +1,70 @@ + +/* + * IBM Accurate Mathematical Library + * written by International Business Machines Corp. + * Copyright (C) 2001 Free Software Foundation + * + * This program is free software; you can redistribute it and/or modify + * it under the terms of the GNU Lesser General Public License as published by + * the Free Software Foundation; either version 2.1 of the License, or + * (at your option) any later version. + * + * This program is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU Lesser General Public License for more details. + * + * You should have received a copy of the GNU Lesser General Public License + * along with this program; if not, write to the Free Software + * Foundation, Inc., 59 Temple Place - Suite 330, Boston, MA 02111-1307, USA. + */ +/******************************************************************/ +/* MODULE_NAME: mpatan2.c */ +/* */ +/* FUNCTIONS:mpatan2 */ +/* */ +/* FILES NEEDED: mpa.h */ +/* mpa.c mpatan.c mpsqrt.c */ +/* */ +/* Multi-Precision Atan2(y,x) function subroutine, */ +/* for precision p >= 4. */ +/* y=0 is not permitted if x<=0. No error messages are given. */ +/* The relative error of the result is bounded by 44.84*r**(1-p) */ +/* if x <= 0, y != 0 and by 37.33*r**(1-p) if x>0. here r=2**24. */ +/* */ +/******************************************************************/ + + + +#include "mpa.h" + +void __mpsqrt(mp_no *, mp_no *, int); +void __mpatan(mp_no *, mp_no *, int); + +/* Multi-Precision Atan2(y,x) function subroutine, for p >= 4. */ +/* y=0 is not permitted if x<=0. No error messages are given. */ +void __mpatan2(mp_no *y, mp_no *x, mp_no *z, int p) { + + static const double Zero = 0.0, One = 1.0; + + mp_no mpone = {0,{0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0, + 0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0, + 0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0}}; + mp_no mpt1,mpt2,mpt3; + + + if (X[0] <= Zero) { + mpone.e = 1; mpone.d[0] = mpone.d[1] = One; + __dvd(x,y,&mpt1,p); __mul(&mpt1,&mpt1,&mpt2,p); + if (mpt1.d[0] != Zero) mpt1.d[0] = One; + __add(&mpt2,&mpone,&mpt3,p); __mpsqrt(&mpt3,&mpt2,p); + __add(&mpt1,&mpt2,&mpt3,p); mpt3.d[0]=Y[0]; + __mpatan(&mpt3,&mpt1,p); __add(&mpt1,&mpt1,z,p); + } + else + { __dvd(y,x,&mpt1,p); + __mpatan(&mpt1,z,p); + } + + return; +} diff --git a/libgcc-math/dbl-64/mpexp.c b/libgcc-math/dbl-64/mpexp.c new file mode 100644 index 00000000000..6398679dc36 --- /dev/null +++ b/libgcc-math/dbl-64/mpexp.c @@ -0,0 +1,106 @@ + +/* + * IBM Accurate Mathematical Library + * written by International Business Machines Corp. + * Copyright (C) 2001 Free Software Foundation + * + * This program is free software; you can redistribute it and/or modify + * it under the terms of the GNU Lesser General Public License as published by + * the Free Software Foundation; either version 2.1 of the License, or + * (at your option) any later version. + * + * This program is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU Lesser General Public License for more details. + * + * You should have received a copy of the GNU Lesser General Public License + * along with this program; if not, write to the Free Software + * Foundation, Inc., 59 Temple Place - Suite 330, Boston, MA 02111-1307, USA. + */ +/*************************************************************************/ +/* MODULE_NAME:mpexp.c */ +/* */ +/* FUNCTIONS: mpexp */ +/* */ +/* FILES NEEDED: mpa.h endian.h mpexp.h */ +/* mpa.c */ +/* */ +/* Multi-Precision exponential function subroutine */ +/* ( for p >= 4, 2**(-55) <= abs(x) <= 1024 ). */ +/*************************************************************************/ + +#include "endian.h" +#include "mpa.h" +#include "mpa2.h" +#include "mpexp.h" + +/* Multi-Precision exponential function subroutine (for p >= 4, */ +/* 2**(-55) <= abs(x) <= 1024). */ +void __mpexp(mp_no *x, mp_no *y, int p) { + + int i,j,k,m,m1,m2,n; + double a,b; + static const int np[33] = {0,0,0,0,3,3,4,4,5,4,4,5,5,5,6,6,6,6,6,6, + 6,6,6,6,7,7,7,7,8,8,8,8,8}; + static const int m1p[33]= {0,0,0,0,17,23,23,28,27,38,42,39,43,47,43,47,50,54, + 57,60,64,67,71,74,68,71,74,77,70,73,76,78,81}; + static const int m1np[7][18] = { + { 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0}, + { 0, 0, 0, 0,36,48,60,72, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0}, + { 0, 0, 0, 0,24,32,40,48,56,64,72, 0, 0, 0, 0, 0, 0, 0}, + { 0, 0, 0, 0,17,23,29,35,41,47,53,59,65, 0, 0, 0, 0, 0}, + { 0, 0, 0, 0, 0, 0,23,28,33,38,42,47,52,57,62,66, 0, 0}, + { 0, 0, 0, 0, 0, 0, 0, 0,27, 0, 0,39,43,47,51,55,59,63}, + { 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,43,47,50,54}}; + mp_no mpone = {0,{0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0, + 0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0, + 0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0}}; + mp_no mpk = {0,{0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0, + 0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0, + 0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0}}; + mp_no mps,mpak,mpt1,mpt2; + + /* Choose m,n and compute a=2**(-m) */ + n = np[p]; m1 = m1p[p]; a = twomm1[p].d; + for (i=0; iEX; i--) a *= RADIX; + b = X[1]*RADIXI; m2 = 24*EX; + for (; b0; i--,n--) { if (m1np[i][p]+m2>0) break; } + } + + /* Compute s=x*2**(-m). Put result in mps */ + __dbl_mp(a,&mpt1,p); + __mul(x,&mpt1,&mps,p); + + /* Evaluate the polynomial. Put result in mpt2 */ + mpone.e=1; mpone.d[0]=ONE; mpone.d[1]=ONE; + mpk.e = 1; mpk.d[0] = ONE; mpk.d[1]=nn[n].d; + __dvd(&mps,&mpk,&mpt1,p); + __add(&mpone,&mpt1,&mpak,p); + for (k=n-1; k>1; k--) { + __mul(&mps,&mpak,&mpt1,p); + mpk.d[1]=nn[k].d; + __dvd(&mpt1,&mpk,&mpt2,p); + __add(&mpone,&mpt2,&mpak,p); + } + __mul(&mps,&mpak,&mpt1,p); + __add(&mpone,&mpt1,&mpt2,p); + + /* Raise polynomial value to the power of 2**m. Put result in y */ + for (k=0,j=0; k= 4, */ +/* 2**(-1024) < x < 2**1024) and x is outside of the interval */ +/* [1-2**(-54),1+2**(-54)]. Upon entry, x should be set to the */ +/* multi-precision value of the input and y should be set into a multi- */ +/* precision value of an approximation of log(x) with relative error */ +/* bound of at most 2**(-52). The routine improves the accuracy of y. */ +/* */ +/************************************************************************/ +#include "endian.h" +#include "mpa.h" + +void __mpexp(mp_no *, mp_no *, int); + +void __mplog(mp_no *x, mp_no *y, int p) { +#include "mplog.h" + int i,m; +#if 0 + int j,k,m1,m2,n; + double a,b; +#endif + static const int mp[33] = {0,0,0,0,0,1,1,2,2,2,2,3,3,3,3,3,3,3,3, + 4,4,4,4,4,4,4,4,4,4,4,4,4,4}; + mp_no mpone = {0,{0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0, + 0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0, + 0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0}}; + mp_no mpt1,mpt2; + + /* Choose m and initiate mpone */ + m = mp[p]; mpone.e = 1; mpone.d[0]=mpone.d[1]=ONE; + + /* Perform m newton iterations to solve for y: exp(y)-x=0. */ + /* The iterations formula is: y(n+1)=y(n)+(x*exp(-y(n))-1). */ + __cpy(y,&mpt1,p); + for (i=0; i= 4. */ +/* The relative error is bounded by 3.501*r**(1-p), where r=2**24. */ +/* */ +/****************************************************************************/ +#include "endian.h" +#include "mpa.h" + +/****************************************************************************/ +/* Multi-Precision square root function subroutine for precision p >= 4. */ +/* The relative error is bounded by 3.501*r**(1-p), where r=2**24. */ +/* Routine receives two pointers to Multi Precision numbers: */ +/* x (left argument) and y (next argument). Routine also receives precision */ +/* p as integer. Routine computes sqrt(*x) and stores result in *y */ +/****************************************************************************/ + +double fastiroot(double); + +void __mpsqrt(mp_no *x, mp_no *y, int p) { +#include "mpsqrt.h" + + int i,m,ex,ey; + double dx,dy; + mp_no + mphalf = {0,{0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0, + 0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0, + 0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0}}, + mp3halfs = {0,{0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0, + 0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0, + 0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0}}; + mp_no mpxn,mpz,mpu,mpt1,mpt2; + + /* Prepare multi-precision 1/2 and 3/2 */ + mphalf.e =0; mphalf.d[0] =ONE; mphalf.d[1] =HALFRAD; + mp3halfs.e=1; mp3halfs.d[0]=ONE; mp3halfs.d[1]=ONE; mp3halfs.d[2]=HALFRAD; + + ex=EX; ey=EX/2; __cpy(x,&mpxn,p); mpxn.e -= (ey+ey); + __mp_dbl(&mpxn,&dx,p); dy=fastiroot(dx); __dbl_mp(dy,&mpu,p); + __mul(&mpxn,&mphalf,&mpz,p); + + m=mp[p]; + for (i=0; i>1; + z = ((c3*z + c2)*z + c1)*z + c0; /* 2**-7 */ + z = z*(1.5 - 0.5*y*z*z); /* 2**-14 */ + p.d = z*(1.5 - 0.5*y*z*z); /* 2**-28 */ + p.i[HIGH_HALF] -= n; + t = x*p.d; + return p.d*(1.5 - 0.5*p.d*t); +} diff --git a/libgcc-math/dbl-64/mpsqrt.h b/libgcc-math/dbl-64/mpsqrt.h new file mode 100644 index 00000000000..729d57af2ce --- /dev/null +++ b/libgcc-math/dbl-64/mpsqrt.h @@ -0,0 +1,51 @@ +/* + * IBM Accurate Mathematical Library + * Written by International Business Machines Corp. + * Copyright (C) 2001 Free Software Foundation, Inc. + * + * This program is free software; you can redistribute it and/or modify + * it under the terms of the GNU Lesser General Public License as published by + * the Free Software Foundation; either version 2.1 of the License, or + * (at your option) any later version. + * + * This program is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU Lesser General Public License for more details. + * + * You should have received a copy of the GNU Lesser General Public License + * along with this program; if not, write to the Free Software + * Foundation, Inc., 59 Temple Place - Suite 330, Boston, MA 02111-1307, USA. + */ + +/******************************************************************/ +/* */ +/* MODULE_NAME:mpatan.h */ +/* */ +/* common data and variables prototype and definition */ +/******************************************************************/ + +#ifndef MPSQRT_H +#define MPSQRT_H + +#ifdef BIG_ENDI + static const number +/**/ one = {{0x3ff00000, 0x00000000} }, /* 1 */ +/**/ halfrad = {{0x41600000, 0x00000000} }; /* 2**23 */ + +#else +#ifdef LITTLE_ENDI + static const number +/**/ one = {{0x00000000, 0x3ff00000} }, /* 1 */ +/**/ halfrad = {{0x00000000, 0x41600000} }; /* 2**23 */ + +#endif +#endif + +#define ONE one.d +#define HALFRAD halfrad.d + + static const int mp[33] = {0,0,0,0,1,2,2,2,2,3,3,3,3,3,3,3,3,4,4,4,4,4,4,4, + 4,4,4,4,4,4,4,4,4}; + +#endif diff --git a/libgcc-math/dbl-64/mptan.c b/libgcc-math/dbl-64/mptan.c new file mode 100644 index 00000000000..ed4c20b44e9 --- /dev/null +++ b/libgcc-math/dbl-64/mptan.c @@ -0,0 +1,60 @@ + +/* + * IBM Accurate Mathematical Library + * written by International Business Machines Corp. + * Copyright (C) 2001 Free Software Foundation + * + * This program is free software; you can redistribute it and/or modify + * it under the terms of the GNU Lesser General Public License as published by + * the Free Software Foundation; either version 2.1 of the License, or + * (at your option) any later version. + * + * This program is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU Lesser General Public License for more details. + * + * You should have received a copy of the GNU Lesser General Public License + * along with this program; if not, write to the Free Software + * Foundation, Inc., 59 Temple Place - Suite 330, Boston, MA 02111-1307, USA. + */ +/**********************************************************************/ +/* MODULE_NAME:mptan.c */ +/* */ +/* FUNCTION: mptan */ +/* */ +/* FILES NEEDED: endian.h mpa.h */ +/* mpa.c sincos32.c branred.c */ +/* */ +/* Multi-Precision tan() function subroutine, for p=32. It is based */ +/* on the routines mpranred() and c32(). mpranred() performs range */ +/* reduction of a double number x into a multiple precision number */ +/* y, such that y=x-n*pi/2, abs(y)d[0] *= Mone; + } /* tan is negative in this area */ + else __dvd(&mps,&mpc,mpy,p); + + return; +} diff --git a/libgcc-math/dbl-64/mydefs.h b/libgcc-math/dbl-64/mydefs.h new file mode 100644 index 00000000000..a47f2b506ab --- /dev/null +++ b/libgcc-math/dbl-64/mydefs.h @@ -0,0 +1,38 @@ +/* + * IBM Accurate Mathematical Library + * Written by International Business Machines Corp. + * Copyright (C) 2001 Free Software Foundation, Inc. + * + * This program is free software; you can redistribute it and/or modify + * it under the terms of the GNU Lesser General Public License as published by + * the Free Software Foundation; either version 2.1 of the License, or + * (at your option) any later version. + * + * This program is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU Lesser General Public License for more details. + * + * You should have received a copy of the GNU Lesser General Public License + * along with this program; if not, write to the Free Software + * Foundation, Inc., 59 Temple Place - Suite 330, Boston, MA 02111-1307, USA. + */ + +/******************************************************************/ +/* */ +/* MODULE_NAME:mydefs.h */ +/* */ +/* common data and definition */ +/******************************************************************/ + +#ifndef MY_H +#define MY_H + +typedef int int4; +typedef union {int4 i[2]; double x;} mynumber; + +#define ABS(x) (((x)>0)?(x):-(x)) +#define max(x,y) (((y)>(x))?(y):(x)) +#define min(x,y) (((y)<(x))?(y):(x)) + +#endif diff --git a/libgcc-math/dbl-64/powtwo.tbl b/libgcc-math/dbl-64/powtwo.tbl new file mode 100644 index 00000000000..53c49c10f7c --- /dev/null +++ b/libgcc-math/dbl-64/powtwo.tbl @@ -0,0 +1,32 @@ +/* + * IBM Accurate Mathematical Library + * Written by International Business Machines Corp. + * Copyright (C) 2001 Free Software Foundation, Inc. + * + * This program is free software; you can redistribute it and/or modify + * it under the terms of the GNU Lesser General Public License as published by + * the Free Software Foundation; either version 2.1 of the License, or + * (at your option) any later version. + * + * This program is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU Lesser General Public License for more details. + * + * You should have received a copy of the GNU Lesser General Public License + * along with this program; if not, write to the Free Software + * Foundation, Inc., 59 Temple Place - Suite 330, Boston, MA 02111-1307, USA. + */ + +/****************************************************************/ +/* TABLES FOR THE upow() FUNCTION */ +/****************************************************************/ + + + +static const double powtwo[] = { 1.0, 2.0, 4.0, + 8.0, 16.0, 32.0, 64.0, 128.0, + 256.0, 512.0, 1024.0, 2048.0, 4096.0, + 8192.0, 16384.0, 32768.0, 65536.0, 131072.0, + 262144.0, 524288.0, 1048576.0, 2097152.0, 4194304.0, + 8388608.0, 16777216.0, 33554432.0, 67108864.0, 134217728.0 }; diff --git a/libgcc-math/dbl-64/root.tbl b/libgcc-math/dbl-64/root.tbl new file mode 100644 index 00000000000..066e588ce7e --- /dev/null +++ b/libgcc-math/dbl-64/root.tbl @@ -0,0 +1,58 @@ +/* + * IBM Accurate Mathematical Library + * Written by International Business Machines Corp. + * Copyright (C) 2001 Free Software Foundation, Inc. + * + * This program is free software; you can redistribute it and/or modify + * it under the terms of the GNU Lesser General Public License as published by + * the Free Software Foundation; either version 2.1 of the License, or + * (at your option) any later version. + * + * This program is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU Lesser General Public License for more details. + * + * You should have received a copy of the GNU Lesser General Public License + * along with this program; if not, write to the Free Software + * Foundation, Inc., 59 Temple Place - Suite 330, Boston, MA 02111-1307, USA. + */ + +/****************************************************************/ +/* TABLES FOR THE usqrt() FUNCTION */ +/****************************************************************/ + + +static const double inroot[128] = { + 1.40872145012100, 1.39792649065766, 1.38737595123859, 1.37706074531819, + 1.36697225234682, 1.35710228748795, 1.34744307370643, 1.33798721601135, + 1.32872767765984, 1.31965775814772, 1.31077107283046, 1.30206153403386, + 1.29352333352711, 1.28515092624400, 1.27693901514820, 1.26888253714903, + 1.26097664998256, 1.25321671998073, 1.24559831065844, 1.23811717205462, + 1.23076923076923, 1.22355058064300, 1.21645747403153, 1.20948631362953, + 1.20263364480453, 1.19589614840310, 1.18927063399547, 1.18275403352732, + 1.17634339535009, 1.17003587860341, 1.16382874792529, 1.15771936846787, + 1.15170520119791, 1.14578379846309, 1.13995279980655, 1.13420992801334, + 1.12855298537376, 1.12297985014975, 1.11748847323133, 1.11207687497107, + 1.10674314218572, 1.10148542531442, 1.09630193572405, 1.09119094315276, + 1.08615077328341, 1.08117980543918, 1.07627647039410, 1.07143924829188, + 1.06666666666667, 1.06195729855996, 1.05730976072814, 1.05272271193563, + 1.04819485132867, 1.04372491688551, 1.03931168393861, 1.03495396376504, + 1.03065060224133, 1.02640047855933, 1.02220250399990, 1.01805562076124, + 1.01395880083916, 1.00991104495649, 1.00591138153909, 1.00195886573624, + 0.99611649018350, 0.98848330114434, 0.98102294317595, 0.97372899112030, + 0.96659534932828, 0.95961623024651, 0.95278613468066, 0.94609983358253, + 0.93955235122353, 0.93313894963169, 0.92685511418159, 0.92069654023750, + 0.91465912076005, 0.90873893479530, 0.90293223677296, 0.89723544654727, + 0.89164514012056, 0.88615804099474, 0.88077101210109, 0.87548104826333, + 0.87028526915267, 0.86518091269740, 0.86016532891275, 0.85523597411976, + 0.85039040552437, 0.84562627613070, 0.84094132996422, 0.83633339758291, + 0.83180039185606, 0.82734030399203, 0.82295119979782, 0.81863121615464, + 0.81437855769486, 0.81019149366693, 0.80606835497581, 0.80200753138734, + 0.79800746888611, 0.79406666717674, 0.79018367731967, 0.78635709949278, + 0.78258558087123, 0.77886781361798, 0.77520253297841, 0.77158851547266, + 0.76802457717971, 0.76450957210799, 0.76104239064719, 0.75762195809661, + 0.75424723326565, 0.75091720714229, 0.74763090162560, 0.74438736831878, + 0.74118568737933, 0.73802496642311, 0.73490433947940, 0.73182296599416, + 0.72878002987884, 0.72577473860242, 0.72280632232420, 0.71987403306536, + 0.71697714391715, 0.71411494828392, 0.71128675915902, 0.70849190843208 }; diff --git a/libgcc-math/dbl-64/s_atan.c b/libgcc-math/dbl-64/s_atan.c new file mode 100644 index 00000000000..556f5b216dd --- /dev/null +++ b/libgcc-math/dbl-64/s_atan.c @@ -0,0 +1,230 @@ +/* + * IBM Accurate Mathematical Library + * written by International Business Machines Corp. + * Copyright (C) 2001 Free Software Foundation + * + * This program is free software; you can redistribute it and/or modify + * it under the terms of the GNU Lesser General Public License as published by + * the Free Software Foundation; either version 2.1 of the License, or + * (at your option) any later version. + * + * This program is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU Lesser General Public License for more details. + * + * You should have received a copy of the GNU Lesser General Public License + * along with this program; if not, write to the Free Software + * Foundation, Inc., 59 Temple Place - Suite 330, Boston, MA 02111-1307, USA. + */ +/************************************************************************/ +/* MODULE_NAME: atnat.c */ +/* */ +/* FUNCTIONS: uatan */ +/* atanMp */ +/* signArctan */ +/* */ +/* */ +/* FILES NEEDED: dla.h endian.h mpa.h mydefs.h atnat.h */ +/* mpatan.c mpatan2.c mpsqrt.c */ +/* uatan.tbl */ +/* */ +/* An ultimate atan() routine. Given an IEEE double machine number x */ +/* it computes the correctly rounded (to nearest) value of atan(x). */ +/* */ +/* Assumption: Machine arithmetic operations are performed in */ +/* round to nearest mode of IEEE 754 standard. */ +/* */ +/************************************************************************/ + +#include "dla.h" +#include "mpa.h" +#include "MathLib.h" +#include "uatan.tbl" +#include "atnat.h" +#include "math.h" + +void __mpatan(mp_no *,mp_no *,int); /* see definition in mpatan.c */ +static double atanMp(double,const int[]); +double __signArctan(double,double); +/* An ultimate atan() routine. Given an IEEE double machine number x, */ +/* routine computes the correctly rounded (to nearest) value of atan(x). */ +double atan(double x) { + + + double cor,s1,ss1,s2,ss2,t1,t2,t3,t4,t5,t6,t7,t8,t9,t10,u,u2,u3, + v,vv,w,ww,y,yy,z,zz; +#if 0 + double y1,y2; +#endif + int i,ux,dx; +#if 0 + int p; +#endif + static const int pr[M]={6,8,10,32}; + number num; +#if 0 + mp_no mpt1,mpx,mpy,mpy1,mpy2,mperr; +#endif + + num.d = x; ux = num.i[HIGH_HALF]; dx = num.i[LOW_HALF]; + + /* x=NaN */ + if (((ux&0x7ff00000)==0x7ff00000) && (((ux&0x000fffff)|dx)!=0x00000000)) + return x+x; + + /* Regular values of x, including denormals +-0 and +-INF */ + u = (x= 1/2 */ + if ((y=t1+(yy-u3)) == t1+(yy+u3)) return __signArctan(x,y); + + DIV2(ONE,ZERO,u,ZERO,w,ww,t1,t2,t3,t4,t5,t6,t7,t8,t9,t10) + t1=w-hij[i][0].d; + EADD(t1,ww,z,zz) + s1=z*(hij[i][11].d+z*(hij[i][12].d+z*(hij[i][13].d+ + z*(hij[i][14].d+z* hij[i][15].d)))); + ADD2(hij[i][9].d,hij[i][10].d,s1,ZERO,s2,ss2,t1,t2) + MUL2(z,zz,s2,ss2,s1,ss1,t1,t2,t3,t4,t5,t6,t7,t8) + ADD2(hij[i][7].d,hij[i][8].d,s1,ss1,s2,ss2,t1,t2) + MUL2(z,zz,s2,ss2,s1,ss1,t1,t2,t3,t4,t5,t6,t7,t8) + ADD2(hij[i][5].d,hij[i][6].d,s1,ss1,s2,ss2,t1,t2) + MUL2(z,zz,s2,ss2,s1,ss1,t1,t2,t3,t4,t5,t6,t7,t8) + ADD2(hij[i][3].d,hij[i][4].d,s1,ss1,s2,ss2,t1,t2) + MUL2(z,zz,s2,ss2,s1,ss1,t1,t2,t3,t4,t5,t6,t7,t8) + ADD2(hij[i][1].d,hij[i][2].d,s1,ss1,s2,ss2,t1,t2) + SUB2(HPI,HPI1,s2,ss2,s1,ss1,t1,t2) + if ((y=s1+(ss1-U7)) == s1+(ss1+U7)) return __signArctan(x,y); + + return atanMp(x,pr); + } + else { + if (u= E */ + if (x>0) return HPI; + else return MHPI; } + } + } + +} + + + /* Fix the sign of y and return */ +double __signArctan(double x,double y){ + + if (x>20)&0x7ff)-0x3ff; + if(j0<20) { + if(j0<0) { /* raise inexact if x != 0 */ + if(huge+x>0.0) {/* return 0*sign(x) if |x|<1 */ + if(i0>=0) {i0=i1=0;} + else if(((i0&0x7fffffff)|i1)!=0) + { i0=0xbff00000;i1=0;} + } + } else { + i = (0x000fffff)>>j0; + if(((i0&i)|i1)==0) return x; /* x is integral */ + if(huge+x>0.0) { /* raise inexact flag */ + if(i0<0) i0 += (0x00100000)>>j0; + i0 &= (~i); i1=0; + } + } + } else if (j0>51) { + if(j0==0x400) return x+x; /* inf or NaN */ + else return x; /* x is integral */ + } else { + i = ((u_int32_t)(0xffffffff))>>(j0-20); + if((i1&i)==0) return x; /* x is integral */ + if(huge+x>0.0) { /* raise inexact flag */ + if(i0<0) { + if(j0==20) i0+=1; + else { + j = i1+(1<<(52-j0)); + if(j. + * Changed to return -1 for -Inf by Ulrich Drepper . + * Public domain. + */ + +#if defined(LIBM_SCCS) && !defined(lint) +static char rcsid[] = "$NetBSD: s_isinf.c,v 1.3 1995/05/11 23:20:14 jtc Exp $"; +#endif + +/* + * isinf(x) returns 1 is x is inf, -1 if x is -inf, else 0; + * no branching! + */ + +#include "math.h" +#include "math_private.h" + +int +__isinf (double x) +{ + int32_t hx,lx; + EXTRACT_WORDS(hx,lx,x); + lx |= (hx & 0x7fffffff) ^ 0x7ff00000; + lx |= -lx; + return ~(lx >> 31) & (hx >> 30); +} +hidden_def (__isinf) +weak_alias (__isinf, isinf) +#ifdef NO_LONG_DOUBLE +strong_alias (__isinf, __isinfl) +weak_alias (__isinf, isinfl) +#endif diff --git a/libgcc-math/dbl-64/s_scalbn.c b/libgcc-math/dbl-64/s_scalbn.c new file mode 100644 index 00000000000..336917c838b --- /dev/null +++ b/libgcc-math/dbl-64/s_scalbn.c @@ -0,0 +1,70 @@ +/* @(#)s_scalbn.c 5.1 93/09/24 */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ + +#if defined(LIBM_SCCS) && !defined(lint) +static char rcsid[] = "$NetBSD: s_scalbn.c,v 1.8 1995/05/10 20:48:08 jtc Exp $"; +#endif + +/* + * scalbn (double x, int n) + * scalbn(x,n) returns x* 2**n computed by exponent + * manipulation rather than by actually performing an + * exponentiation or a multiplication. + */ + +#include "math.h" +#include "math_private.h" + +#ifdef __STDC__ +static const double +#else +static double +#endif +two54 = 1.80143985094819840000e+16, /* 0x43500000, 0x00000000 */ +twom54 = 5.55111512312578270212e-17, /* 0x3C900000, 0x00000000 */ +huge = 1.0e+300, +tiny = 1.0e-300; + +#ifdef __STDC__ + double __scalbn (double x, int n) +#else + double __scalbn (x,n) + double x; int n; +#endif +{ + int32_t k,hx,lx; + EXTRACT_WORDS(hx,lx,x); + k = (hx&0x7ff00000)>>20; /* extract exponent */ + if (k==0) { /* 0 or subnormal x */ + if ((lx|(hx&0x7fffffff))==0) return x; /* +-0 */ + x *= two54; + GET_HIGH_WORD(hx,x); + k = ((hx&0x7ff00000)>>20) - 54; + } + if (k==0x7ff) return x+x; /* NaN or Inf */ + k = k+n; + if (n> 50000 || k > 0x7fe) + return huge*__builtin_copysign(huge,x); /* overflow */ + if (n< -50000) return tiny*__builtin_copysign(tiny,x); /*underflow*/ + if (k > 0) /* normal result */ + {SET_HIGH_WORD(x,(hx&0x800fffff)|(k<<20)); return x;} + if (k <= -54) + return tiny*__builtin_copysign(tiny,x); /*underflow*/ + k += 54; /* subnormal result */ + SET_HIGH_WORD(x,(hx&0x800fffff)|(k<<20)); + return x*twom54; +} +weak_alias (__scalbn, scalbn) +#ifdef NO_LONG_DOUBLE +strong_alias (__scalbn, __scalbnl) +weak_alias (__scalbn, scalbnl) +#endif diff --git a/libgcc-math/dbl-64/s_sin.c b/libgcc-math/dbl-64/s_sin.c new file mode 100644 index 00000000000..86e1a6d1216 --- /dev/null +++ b/libgcc-math/dbl-64/s_sin.c @@ -0,0 +1,1129 @@ +/* + * IBM Accurate Mathematical Library + * written by International Business Machines Corp. + * Copyright (C) 2001 Free Software Foundation + * + * This program is free software; you can redistribute it and/or modify + * it under the terms of the GNU Lesser General Public License as published by + * the Free Software Foundation; either version 2.1 of the License, or + * (at your option) any later version. + * + * This program is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU Lesser General Public License for more details. + * + * You should have received a copy of the GNU Lesser General Public License + * along with this program; if not, write to the Free Software + * Foundation, Inc., 59 Temple Place - Suite 330, Boston, MA 02111-1307, USA. + */ +/****************************************************************************/ +/* */ +/* MODULE_NAME:usncs.c */ +/* */ +/* FUNCTIONS: usin */ +/* ucos */ +/* slow */ +/* slow1 */ +/* slow2 */ +/* sloww */ +/* sloww1 */ +/* sloww2 */ +/* bsloww */ +/* bsloww1 */ +/* bsloww2 */ +/* cslow2 */ +/* csloww */ +/* csloww1 */ +/* csloww2 */ +/* FILES NEEDED: dla.h endian.h mpa.h mydefs.h usncs.h */ +/* branred.c sincos32.c dosincos.c mpa.c */ +/* sincos.tbl */ +/* */ +/* An ultimate sin and routine. Given an IEEE double machine number x */ +/* it computes the correctly rounded (to nearest) value of sin(x) or cos(x) */ +/* Assumption: Machine arithmetic operations are performed in */ +/* round to nearest mode of IEEE 754 standard. */ +/* */ +/****************************************************************************/ + + +#include "endian.h" +#include "mydefs.h" +#include "usncs.h" +#include "MathLib.h" +#include "sincos.tbl" +#include "math_private.h" + +static const double + sn3 = -1.66666666666664880952546298448555E-01, + sn5 = 8.33333214285722277379541354343671E-03, + cs2 = 4.99999999999999999999950396842453E-01, + cs4 = -4.16666666666664434524222570944589E-02, + cs6 = 1.38888874007937613028114285595617E-03; + +void __dubsin(double x, double dx, double w[]); +void __docos(double x, double dx, double w[]); +double __mpsin(double x, double dx); +double __mpcos(double x, double dx); +double __mpsin1(double x); +double __mpcos1(double x); +static double slow(double x); +static double slow1(double x); +static double slow2(double x); +static double sloww(double x, double dx, double orig); +static double sloww1(double x, double dx, double orig); +static double sloww2(double x, double dx, double orig, int n); +static double bsloww(double x, double dx, double orig, int n); +static double bsloww1(double x, double dx, double orig, int n); +static double bsloww2(double x, double dx, double orig, int n); +int __branred(double x, double *a, double *aa); +static double cslow2(double x); +static double csloww(double x, double dx, double orig); +static double csloww1(double x, double dx, double orig); +static double csloww2(double x, double dx, double orig, int n); +/*******************************************************************/ +/* An ultimate sin routine. Given an IEEE double machine number x */ +/* it computes the correctly rounded (to nearest) value of sin(x) */ +/*******************************************************************/ +double __sin(double x){ + double xx,res,t,cor,y,s,c,sn,ssn,cs,ccs,xn,a,da,db,eps,xn1,xn2; +#if 0 + double w[2]; +#endif + mynumber u,v; + int4 k,m,n; +#if 0 + int4 nn; +#endif + + u.x = x; + m = u.i[HIGH_HALF]; + k = 0x7fffffff&m; /* no sign */ + if (k < 0x3e500000) /* if x->0 =>sin(x)=x */ + return x; + /*---------------------------- 2^-26 < |x|< 0.25 ----------------------*/ + else if (k < 0x3fd00000){ + xx = x*x; + /*Taylor series */ + t = ((((s5.x*xx + s4.x)*xx + s3.x)*xx + s2.x)*xx + s1.x)*(xx*x); + res = x+t; + cor = (x-res)+t; + return (res == res + 1.07*cor)? res : slow(x); + } /* else if (k < 0x3fd00000) */ +/*---------------------------- 0.25<|x|< 0.855469---------------------- */ + else if (k < 0x3feb6000) { + u.x=(m>0)?big.x+x:big.x-x; + y=(m>0)?x-(u.x-big.x):x+(u.x-big.x); + xx=y*y; + s = y + y*xx*(sn3 +xx*sn5); + c = xx*(cs2 +xx*(cs4 + xx*cs6)); + k=u.i[LOW_HALF]<<2; + sn=(m>0)?sincos.x[k]:-sincos.x[k]; + ssn=(m>0)?sincos.x[k+1]:-sincos.x[k+1]; + cs=sincos.x[k+2]; + ccs=sincos.x[k+3]; + cor=(ssn+s*ccs-sn*c)+cs*s; + res=sn+cor; + cor=(sn-res)+cor; + return (res==res+1.025*cor)? res : slow1(x); + } /* else if (k < 0x3feb6000) */ + +/*----------------------- 0.855469 <|x|<2.426265 ----------------------*/ + else if (k < 0x400368fd ) { + + y = (m>0)? hp0.x-x:hp0.x+x; + if (y>=0) { + u.x = big.x+y; + y = (y-(u.x-big.x))+hp1.x; + } + else { + u.x = big.x-y; + y = (-hp1.x) - (y+(u.x-big.x)); + } + xx=y*y; + s = y + y*xx*(sn3 +xx*sn5); + c = xx*(cs2 +xx*(cs4 + xx*cs6)); + k=u.i[LOW_HALF]<<2; + sn=sincos.x[k]; + ssn=sincos.x[k+1]; + cs=sincos.x[k+2]; + ccs=sincos.x[k+3]; + cor=(ccs-s*ssn-cs*c)-sn*s; + res=cs+cor; + cor=(cs-res)+cor; + return (res==res+1.020*cor)? ((m>0)?res:-res) : slow2(x); + } /* else if (k < 0x400368fd) */ + +/*-------------------------- 2.426265<|x|< 105414350 ----------------------*/ + else if (k < 0x419921FB ) { + t = (x*hpinv.x + toint.x); + xn = t - toint.x; + v.x = t; + y = (x - xn*mp1.x) - xn*mp2.x; + n =v.i[LOW_HALF]&3; + da = xn*mp3.x; + a=y-da; + da = (y-a)-da; + eps = ABS(x)*1.2e-30; + + switch (n) { /* quarter of unit circle */ + case 0: + case 2: + xx = a*a; + if (n) {a=-a;da=-da;} + if (xx < 0.01588) { + /*Taylor series */ + t = (((((s5.x*xx + s4.x)*xx + s3.x)*xx + s2.x)*xx + s1.x)*a - 0.5*da)*xx+da; + res = a+t; + cor = (a-res)+t; + cor = (cor>0)? 1.02*cor+eps : 1.02*cor -eps; + return (res == res + cor)? res : sloww(a,da,x); + } + else { + if (a>0) + {m=1;t=a;db=da;} + else + {m=0;t=-a;db=-da;} + u.x=big.x+t; + y=t-(u.x-big.x); + xx=y*y; + s = y + (db+y*xx*(sn3 +xx*sn5)); + c = y*db+xx*(cs2 +xx*(cs4 + xx*cs6)); + k=u.i[LOW_HALF]<<2; + sn=sincos.x[k]; + ssn=sincos.x[k+1]; + cs=sincos.x[k+2]; + ccs=sincos.x[k+3]; + cor=(ssn+s*ccs-sn*c)+cs*s; + res=sn+cor; + cor=(sn-res)+cor; + cor = (cor>0)? 1.035*cor+eps : 1.035*cor-eps; + return (res==res+cor)? ((m)?res:-res) : sloww1(a,da,x); + } + break; + + case 1: + case 3: + if (a<0) + {a=-a;da=-da;} + u.x=big.x+a; + y=a-(u.x-big.x)+da; + xx=y*y; + k=u.i[LOW_HALF]<<2; + sn=sincos.x[k]; + ssn=sincos.x[k+1]; + cs=sincos.x[k+2]; + ccs=sincos.x[k+3]; + s = y + y*xx*(sn3 +xx*sn5); + c = xx*(cs2 +xx*(cs4 + xx*cs6)); + cor=(ccs-s*ssn-cs*c)-sn*s; + res=cs+cor; + cor=(cs-res)+cor; + cor = (cor>0)? 1.025*cor+eps : 1.025*cor-eps; + return (res==res+cor)? ((n&2)?-res:res) : sloww2(a,da,x,n); + + break; + + } + + } /* else if (k < 0x419921FB ) */ + +/*---------------------105414350 <|x|< 281474976710656 --------------------*/ + else if (k < 0x42F00000 ) { + t = (x*hpinv.x + toint.x); + xn = t - toint.x; + v.x = t; + xn1 = (xn+8.0e22)-8.0e22; + xn2 = xn - xn1; + y = ((((x - xn1*mp1.x) - xn1*mp2.x)-xn2*mp1.x)-xn2*mp2.x); + n =v.i[LOW_HALF]&3; + da = xn1*pp3.x; + t=y-da; + da = (y-t)-da; + da = (da - xn2*pp3.x) -xn*pp4.x; + a = t+da; + da = (t-a)+da; + eps = 1.0e-24; + + switch (n) { + case 0: + case 2: + xx = a*a; + if (n) {a=-a;da=-da;} + if (xx < 0.01588) { + /* Taylor series */ + t = (((((s5.x*xx + s4.x)*xx + s3.x)*xx + s2.x)*xx + s1.x)*a - 0.5*da)*xx+da; + res = a+t; + cor = (a-res)+t; + cor = (cor>0)? 1.02*cor+eps : 1.02*cor -eps; + return (res == res + cor)? res : bsloww(a,da,x,n); + } + else { + if (a>0) {m=1;t=a;db=da;} + else {m=0;t=-a;db=-da;} + u.x=big.x+t; + y=t-(u.x-big.x); + xx=y*y; + s = y + (db+y*xx*(sn3 +xx*sn5)); + c = y*db+xx*(cs2 +xx*(cs4 + xx*cs6)); + k=u.i[LOW_HALF]<<2; + sn=sincos.x[k]; + ssn=sincos.x[k+1]; + cs=sincos.x[k+2]; + ccs=sincos.x[k+3]; + cor=(ssn+s*ccs-sn*c)+cs*s; + res=sn+cor; + cor=(sn-res)+cor; + cor = (cor>0)? 1.035*cor+eps : 1.035*cor-eps; + return (res==res+cor)? ((m)?res:-res) : bsloww1(a,da,x,n); + } + break; + + case 1: + case 3: + if (a<0) + {a=-a;da=-da;} + u.x=big.x+a; + y=a-(u.x-big.x)+da; + xx=y*y; + k=u.i[LOW_HALF]<<2; + sn=sincos.x[k]; + ssn=sincos.x[k+1]; + cs=sincos.x[k+2]; + ccs=sincos.x[k+3]; + s = y + y*xx*(sn3 +xx*sn5); + c = xx*(cs2 +xx*(cs4 + xx*cs6)); + cor=(ccs-s*ssn-cs*c)-sn*s; + res=cs+cor; + cor=(cs-res)+cor; + cor = (cor>0)? 1.025*cor+eps : 1.025*cor-eps; + return (res==res+cor)? ((n&2)?-res:res) : bsloww2(a,da,x,n); + + break; + + } + + } /* else if (k < 0x42F00000 ) */ + +/* -----------------281474976710656 <|x| <2^1024----------------------------*/ + else if (k < 0x7ff00000) { + + n = __branred(x,&a,&da); + switch (n) { + case 0: + if (a*a < 0.01588) return bsloww(a,da,x,n); + else return bsloww1(a,da,x,n); + break; + case 2: + if (a*a < 0.01588) return bsloww(-a,-da,x,n); + else return bsloww1(-a,-da,x,n); + break; + + case 1: + case 3: + return bsloww2(a,da,x,n); + break; + } + + } /* else if (k < 0x7ff00000 ) */ + +/*--------------------- |x| > 2^1024 ----------------------------------*/ + else return x / x; + return 0; /* unreachable */ +} + + +/*******************************************************************/ +/* An ultimate cos routine. Given an IEEE double machine number x */ +/* it computes the correctly rounded (to nearest) value of cos(x) */ +/*******************************************************************/ + +double __cos(double x) +{ + double y,xx,res,t,cor,s,c,sn,ssn,cs,ccs,xn,a,da,db,eps,xn1,xn2; + mynumber u,v; + int4 k,m,n; + + u.x = x; + m = u.i[HIGH_HALF]; + k = 0x7fffffff&m; + + if (k < 0x3e400000 ) return 1.0; /* |x|<2^-27 => cos(x)=1 */ + + else if (k < 0x3feb6000 ) {/* 2^-27 < |x| < 0.855469 */ + y=ABS(x); + u.x = big.x+y; + y = y-(u.x-big.x); + xx=y*y; + s = y + y*xx*(sn3 +xx*sn5); + c = xx*(cs2 +xx*(cs4 + xx*cs6)); + k=u.i[LOW_HALF]<<2; + sn=sincos.x[k]; + ssn=sincos.x[k+1]; + cs=sincos.x[k+2]; + ccs=sincos.x[k+3]; + cor=(ccs-s*ssn-cs*c)-sn*s; + res=cs+cor; + cor=(cs-res)+cor; + return (res==res+1.020*cor)? res : cslow2(x); + +} /* else if (k < 0x3feb6000) */ + + else if (k < 0x400368fd ) {/* 0.855469 <|x|<2.426265 */; + y=hp0.x-ABS(x); + a=y+hp1.x; + da=(y-a)+hp1.x; + xx=a*a; + if (xx < 0.01588) { + t = (((((s5.x*xx + s4.x)*xx + s3.x)*xx + s2.x)*xx + s1.x)*a - 0.5*da)*xx+da; + res = a+t; + cor = (a-res)+t; + cor = (cor>0)? 1.02*cor+1.0e-31 : 1.02*cor -1.0e-31; + return (res == res + cor)? res : csloww(a,da,x); + } + else { + if (a>0) {m=1;t=a;db=da;} + else {m=0;t=-a;db=-da;} + u.x=big.x+t; + y=t-(u.x-big.x); + xx=y*y; + s = y + (db+y*xx*(sn3 +xx*sn5)); + c = y*db+xx*(cs2 +xx*(cs4 + xx*cs6)); + k=u.i[LOW_HALF]<<2; + sn=sincos.x[k]; + ssn=sincos.x[k+1]; + cs=sincos.x[k+2]; + ccs=sincos.x[k+3]; + cor=(ssn+s*ccs-sn*c)+cs*s; + res=sn+cor; + cor=(sn-res)+cor; + cor = (cor>0)? 1.035*cor+1.0e-31 : 1.035*cor-1.0e-31; + return (res==res+cor)? ((m)?res:-res) : csloww1(a,da,x); +} + +} /* else if (k < 0x400368fd) */ + + + else if (k < 0x419921FB ) {/* 2.426265<|x|< 105414350 */ + t = (x*hpinv.x + toint.x); + xn = t - toint.x; + v.x = t; + y = (x - xn*mp1.x) - xn*mp2.x; + n =v.i[LOW_HALF]&3; + da = xn*mp3.x; + a=y-da; + da = (y-a)-da; + eps = ABS(x)*1.2e-30; + + switch (n) { + case 1: + case 3: + xx = a*a; + if (n == 1) {a=-a;da=-da;} + if (xx < 0.01588) { + t = (((((s5.x*xx + s4.x)*xx + s3.x)*xx + s2.x)*xx + s1.x)*a - 0.5*da)*xx+da; + res = a+t; + cor = (a-res)+t; + cor = (cor>0)? 1.02*cor+eps : 1.02*cor -eps; + return (res == res + cor)? res : csloww(a,da,x); + } + else { + if (a>0) {m=1;t=a;db=da;} + else {m=0;t=-a;db=-da;} + u.x=big.x+t; + y=t-(u.x-big.x); + xx=y*y; + s = y + (db+y*xx*(sn3 +xx*sn5)); + c = y*db+xx*(cs2 +xx*(cs4 + xx*cs6)); + k=u.i[LOW_HALF]<<2; + sn=sincos.x[k]; + ssn=sincos.x[k+1]; + cs=sincos.x[k+2]; + ccs=sincos.x[k+3]; + cor=(ssn+s*ccs-sn*c)+cs*s; + res=sn+cor; + cor=(sn-res)+cor; + cor = (cor>0)? 1.035*cor+eps : 1.035*cor-eps; + return (res==res+cor)? ((m)?res:-res) : csloww1(a,da,x); + } + break; + + case 0: + case 2: + if (a<0) {a=-a;da=-da;} + u.x=big.x+a; + y=a-(u.x-big.x)+da; + xx=y*y; + k=u.i[LOW_HALF]<<2; + sn=sincos.x[k]; + ssn=sincos.x[k+1]; + cs=sincos.x[k+2]; + ccs=sincos.x[k+3]; + s = y + y*xx*(sn3 +xx*sn5); + c = xx*(cs2 +xx*(cs4 + xx*cs6)); + cor=(ccs-s*ssn-cs*c)-sn*s; + res=cs+cor; + cor=(cs-res)+cor; + cor = (cor>0)? 1.025*cor+eps : 1.025*cor-eps; + return (res==res+cor)? ((n)?-res:res) : csloww2(a,da,x,n); + + break; + + } + + } /* else if (k < 0x419921FB ) */ + + + else if (k < 0x42F00000 ) { + t = (x*hpinv.x + toint.x); + xn = t - toint.x; + v.x = t; + xn1 = (xn+8.0e22)-8.0e22; + xn2 = xn - xn1; + y = ((((x - xn1*mp1.x) - xn1*mp2.x)-xn2*mp1.x)-xn2*mp2.x); + n =v.i[LOW_HALF]&3; + da = xn1*pp3.x; + t=y-da; + da = (y-t)-da; + da = (da - xn2*pp3.x) -xn*pp4.x; + a = t+da; + da = (t-a)+da; + eps = 1.0e-24; + + switch (n) { + case 1: + case 3: + xx = a*a; + if (n==1) {a=-a;da=-da;} + if (xx < 0.01588) { + t = (((((s5.x*xx + s4.x)*xx + s3.x)*xx + s2.x)*xx + s1.x)*a - 0.5*da)*xx+da; + res = a+t; + cor = (a-res)+t; + cor = (cor>0)? 1.02*cor+eps : 1.02*cor -eps; + return (res == res + cor)? res : bsloww(a,da,x,n); + } + else { + if (a>0) {m=1;t=a;db=da;} + else {m=0;t=-a;db=-da;} + u.x=big.x+t; + y=t-(u.x-big.x); + xx=y*y; + s = y + (db+y*xx*(sn3 +xx*sn5)); + c = y*db+xx*(cs2 +xx*(cs4 + xx*cs6)); + k=u.i[LOW_HALF]<<2; + sn=sincos.x[k]; + ssn=sincos.x[k+1]; + cs=sincos.x[k+2]; + ccs=sincos.x[k+3]; + cor=(ssn+s*ccs-sn*c)+cs*s; + res=sn+cor; + cor=(sn-res)+cor; + cor = (cor>0)? 1.035*cor+eps : 1.035*cor-eps; + return (res==res+cor)? ((m)?res:-res) : bsloww1(a,da,x,n); + } + break; + + case 0: + case 2: + if (a<0) {a=-a;da=-da;} + u.x=big.x+a; + y=a-(u.x-big.x)+da; + xx=y*y; + k=u.i[LOW_HALF]<<2; + sn=sincos.x[k]; + ssn=sincos.x[k+1]; + cs=sincos.x[k+2]; + ccs=sincos.x[k+3]; + s = y + y*xx*(sn3 +xx*sn5); + c = xx*(cs2 +xx*(cs4 + xx*cs6)); + cor=(ccs-s*ssn-cs*c)-sn*s; + res=cs+cor; + cor=(cs-res)+cor; + cor = (cor>0)? 1.025*cor+eps : 1.025*cor-eps; + return (res==res+cor)? ((n)?-res:res) : bsloww2(a,da,x,n); + break; + + } + + } /* else if (k < 0x42F00000 ) */ + + else if (k < 0x7ff00000) {/* 281474976710656 <|x| <2^1024 */ + + n = __branred(x,&a,&da); + switch (n) { + case 1: + if (a*a < 0.01588) return bsloww(-a,-da,x,n); + else return bsloww1(-a,-da,x,n); + break; + case 3: + if (a*a < 0.01588) return bsloww(a,da,x,n); + else return bsloww1(a,da,x,n); + break; + + case 0: + case 2: + return bsloww2(a,da,x,n); + break; + } + + } /* else if (k < 0x7ff00000 ) */ + + + + + else return x / x; /* |x| > 2^1024 */ + return 0; + +} + +/************************************************************************/ +/* Routine compute sin(x) for 2^-26 < |x|< 0.25 by Taylor with more */ +/* precision and if still doesn't accurate enough by mpsin or dubsin */ +/************************************************************************/ + +static double slow(double x) { +static const double th2_36 = 206158430208.0; /* 1.5*2**37 */ + double y,x1,x2,xx,r,t,res,cor,w[2]; + x1=(x+th2_36)-th2_36; + y = aa.x*x1*x1*x1; + r=x+y; + x2=x-x1; + xx=x*x; + t = (((((s5.x*xx + s4.x)*xx + s3.x)*xx + s2.x)*xx + bb.x)*xx + 3.0*aa.x*x1*x2)*x +aa.x*x2*x2*x2; + t=((x-r)+y)+t; + res=r+t; + cor = (r-res)+t; + if (res == res + 1.0007*cor) return res; + else { + __dubsin(ABS(x),0,w); + if (w[0] == w[0]+1.000000001*w[1]) return (x>0)?w[0]:-w[0]; + else return (x>0)?__mpsin(x,0):-__mpsin(-x,0); + } +} +/*******************************************************************************/ +/* Routine compute sin(x) for 0.25<|x|< 0.855469 by sincos.tbl and Taylor */ +/* and if result still doesn't accurate enough by mpsin or dubsin */ +/*******************************************************************************/ + +static double slow1(double x) { + mynumber u; + double sn,ssn,cs,ccs,s,c,w[2],y,y1,y2,c1,c2,xx,cor,res; + static const double t22 = 6291456.0; + int4 k; + y=ABS(x); + u.x=big.x+y; + y=y-(u.x-big.x); + xx=y*y; + s = y*xx*(sn3 +xx*sn5); + c = xx*(cs2 +xx*(cs4 + xx*cs6)); + k=u.i[LOW_HALF]<<2; + sn=sincos.x[k]; /* Data */ + ssn=sincos.x[k+1]; /* from */ + cs=sincos.x[k+2]; /* tables */ + ccs=sincos.x[k+3]; /* sincos.tbl */ + y1 = (y+t22)-t22; + y2 = y - y1; + c1 = (cs+t22)-t22; + c2=(cs-c1)+ccs; + cor=(ssn+s*ccs+cs*s+c2*y+c1*y2)-sn*c; + y=sn+c1*y1; + cor = cor+((sn-y)+c1*y1); + res=y+cor; + cor=(y-res)+cor; + if (res == res+1.0005*cor) return (x>0)?res:-res; + else { + __dubsin(ABS(x),0,w); + if (w[0] == w[0]+1.000000005*w[1]) return (x>0)?w[0]:-w[0]; + else return (x>0)?__mpsin(x,0):-__mpsin(-x,0); + } +} +/**************************************************************************/ +/* Routine compute sin(x) for 0.855469 <|x|<2.426265 by sincos.tbl */ +/* and if result still doesn't accurate enough by mpsin or dubsin */ +/**************************************************************************/ +static double slow2(double x) { + mynumber u; + double sn,ssn,cs,ccs,s,c,w[2],y,y1,y2,e1,e2,xx,cor,res,del; + static const double t22 = 6291456.0; + int4 k; + y=ABS(x); + y = hp0.x-y; + if (y>=0) { + u.x = big.x+y; + y = y-(u.x-big.x); + del = hp1.x; + } + else { + u.x = big.x-y; + y = -(y+(u.x-big.x)); + del = -hp1.x; + } + xx=y*y; + s = y*xx*(sn3 +xx*sn5); + c = y*del+xx*(cs2 +xx*(cs4 + xx*cs6)); + k=u.i[LOW_HALF]<<2; + sn=sincos.x[k]; + ssn=sincos.x[k+1]; + cs=sincos.x[k+2]; + ccs=sincos.x[k+3]; + y1 = (y+t22)-t22; + y2 = (y - y1)+del; + e1 = (sn+t22)-t22; + e2=(sn-e1)+ssn; + cor=(ccs-cs*c-e1*y2-e2*y)-sn*s; + y=cs-e1*y1; + cor = cor+((cs-y)-e1*y1); + res=y+cor; + cor=(y-res)+cor; + if (res == res+1.0005*cor) return (x>0)?res:-res; + else { + y=ABS(x)-hp0.x; + y1=y-hp1.x; + y2=(y-y1)-hp1.x; + __docos(y1,y2,w); + if (w[0] == w[0]+1.000000005*w[1]) return (x>0)?w[0]:-w[0]; + else return (x>0)?__mpsin(x,0):-__mpsin(-x,0); + } +} +/***************************************************************************/ +/* Routine compute sin(x+dx) (Double-Length number) where x is small enough*/ +/* to use Taylor series around zero and (x+dx) */ +/* in first or third quarter of unit circle.Routine receive also */ +/* (right argument) the original value of x for computing error of */ +/* result.And if result not accurate enough routine calls mpsin1 or dubsin */ +/***************************************************************************/ + +static double sloww(double x,double dx, double orig) { + static const double th2_36 = 206158430208.0; /* 1.5*2**37 */ + double y,x1,x2,xx,r,t,res,cor,w[2],a,da,xn; + union {int4 i[2]; double x;} v; + int4 n; + x1=(x+th2_36)-th2_36; + y = aa.x*x1*x1*x1; + r=x+y; + x2=(x-x1)+dx; + xx=x*x; + t = (((((s5.x*xx + s4.x)*xx + s3.x)*xx + s2.x)*xx + bb.x)*xx + 3.0*aa.x*x1*x2)*x +aa.x*x2*x2*x2+dx; + t=((x-r)+y)+t; + res=r+t; + cor = (r-res)+t; + cor = (cor>0)? 1.0005*cor+ABS(orig)*3.1e-30 : 1.0005*cor-ABS(orig)*3.1e-30; + if (res == res + cor) return res; + else { + (x>0)? __dubsin(x,dx,w) : __dubsin(-x,-dx,w); + cor = (w[1]>0)? 1.000000001*w[1] + ABS(orig)*1.1e-30 : 1.000000001*w[1] - ABS(orig)*1.1e-30; + if (w[0] == w[0]+cor) return (x>0)?w[0]:-w[0]; + else { + t = (orig*hpinv.x + toint.x); + xn = t - toint.x; + v.x = t; + y = (orig - xn*mp1.x) - xn*mp2.x; + n =v.i[LOW_HALF]&3; + da = xn*pp3.x; + t=y-da; + da = (y-t)-da; + y = xn*pp4.x; + a = t - y; + da = ((t-a)-y)+da; + if (n&2) {a=-a; da=-da;} + (a>0)? __dubsin(a,da,w) : __dubsin(-a,-da,w); + cor = (w[1]>0)? 1.000000001*w[1] + ABS(orig)*1.1e-40 : 1.000000001*w[1] - ABS(orig)*1.1e-40; + if (w[0] == w[0]+cor) return (a>0)?w[0]:-w[0]; + else return __mpsin1(orig); + } + } +} +/***************************************************************************/ +/* Routine compute sin(x+dx) (Double-Length number) where x in first or */ +/* third quarter of unit circle.Routine receive also (right argument) the */ +/* original value of x for computing error of result.And if result not */ +/* accurate enough routine calls mpsin1 or dubsin */ +/***************************************************************************/ + +static double sloww1(double x, double dx, double orig) { + mynumber u; + double sn,ssn,cs,ccs,s,c,w[2],y,y1,y2,c1,c2,xx,cor,res; + static const double t22 = 6291456.0; + int4 k; + y=ABS(x); + u.x=big.x+y; + y=y-(u.x-big.x); + dx=(x>0)?dx:-dx; + xx=y*y; + s = y*xx*(sn3 +xx*sn5); + c = xx*(cs2 +xx*(cs4 + xx*cs6)); + k=u.i[LOW_HALF]<<2; + sn=sincos.x[k]; + ssn=sincos.x[k+1]; + cs=sincos.x[k+2]; + ccs=sincos.x[k+3]; + y1 = (y+t22)-t22; + y2 = (y - y1)+dx; + c1 = (cs+t22)-t22; + c2=(cs-c1)+ccs; + cor=(ssn+s*ccs+cs*s+c2*y+c1*y2-sn*y*dx)-sn*c; + y=sn+c1*y1; + cor = cor+((sn-y)+c1*y1); + res=y+cor; + cor=(y-res)+cor; + cor = (cor>0)? 1.0005*cor+3.1e-30*ABS(orig) : 1.0005*cor-3.1e-30*ABS(orig); + if (res == res + cor) return (x>0)?res:-res; + else { + __dubsin(ABS(x),dx,w); + cor = (w[1]>0)? 1.000000005*w[1]+1.1e-30*ABS(orig) : 1.000000005*w[1]-1.1e-30*ABS(orig); + if (w[0] == w[0]+cor) return (x>0)?w[0]:-w[0]; + else return __mpsin1(orig); + } +} +/***************************************************************************/ +/* Routine compute sin(x+dx) (Double-Length number) where x in second or */ +/* fourth quarter of unit circle.Routine receive also the original value */ +/* and quarter(n= 1or 3)of x for computing error of result.And if result not*/ +/* accurate enough routine calls mpsin1 or dubsin */ +/***************************************************************************/ + +static double sloww2(double x, double dx, double orig, int n) { + mynumber u; + double sn,ssn,cs,ccs,s,c,w[2],y,y1,y2,e1,e2,xx,cor,res; + static const double t22 = 6291456.0; + int4 k; + y=ABS(x); + u.x=big.x+y; + y=y-(u.x-big.x); + dx=(x>0)?dx:-dx; + xx=y*y; + s = y*xx*(sn3 +xx*sn5); + c = y*dx+xx*(cs2 +xx*(cs4 + xx*cs6)); + k=u.i[LOW_HALF]<<2; + sn=sincos.x[k]; + ssn=sincos.x[k+1]; + cs=sincos.x[k+2]; + ccs=sincos.x[k+3]; + + y1 = (y+t22)-t22; + y2 = (y - y1)+dx; + e1 = (sn+t22)-t22; + e2=(sn-e1)+ssn; + cor=(ccs-cs*c-e1*y2-e2*y)-sn*s; + y=cs-e1*y1; + cor = cor+((cs-y)-e1*y1); + res=y+cor; + cor=(y-res)+cor; + cor = (cor>0)? 1.0005*cor+3.1e-30*ABS(orig) : 1.0005*cor-3.1e-30*ABS(orig); + if (res == res + cor) return (n&2)?-res:res; + else { + __docos(ABS(x),dx,w); + cor = (w[1]>0)? 1.000000005*w[1]+1.1e-30*ABS(orig) : 1.000000005*w[1]-1.1e-30*ABS(orig); + if (w[0] == w[0]+cor) return (n&2)?-w[0]:w[0]; + else return __mpsin1(orig); + } +} +/***************************************************************************/ +/* Routine compute sin(x+dx) or cos(x+dx) (Double-Length number) where x */ +/* is small enough to use Taylor series around zero and (x+dx) */ +/* in first or third quarter of unit circle.Routine receive also */ +/* (right argument) the original value of x for computing error of */ +/* result.And if result not accurate enough routine calls other routines */ +/***************************************************************************/ + +static double bsloww(double x,double dx, double orig,int n) { + static const double th2_36 = 206158430208.0; /* 1.5*2**37 */ + double y,x1,x2,xx,r,t,res,cor,w[2]; +#if 0 + double a,da,xn; + union {int4 i[2]; double x;} v; +#endif + x1=(x+th2_36)-th2_36; + y = aa.x*x1*x1*x1; + r=x+y; + x2=(x-x1)+dx; + xx=x*x; + t = (((((s5.x*xx + s4.x)*xx + s3.x)*xx + s2.x)*xx + bb.x)*xx + 3.0*aa.x*x1*x2)*x +aa.x*x2*x2*x2+dx; + t=((x-r)+y)+t; + res=r+t; + cor = (r-res)+t; + cor = (cor>0)? 1.0005*cor+1.1e-24 : 1.0005*cor-1.1e-24; + if (res == res + cor) return res; + else { + (x>0)? __dubsin(x,dx,w) : __dubsin(-x,-dx,w); + cor = (w[1]>0)? 1.000000001*w[1] + 1.1e-24 : 1.000000001*w[1] - 1.1e-24; + if (w[0] == w[0]+cor) return (x>0)?w[0]:-w[0]; + else return (n&1)?__mpcos1(orig):__mpsin1(orig); + } +} + +/***************************************************************************/ +/* Routine compute sin(x+dx) or cos(x+dx) (Double-Length number) where x */ +/* in first or third quarter of unit circle.Routine receive also */ +/* (right argument) the original value of x for computing error of result.*/ +/* And if result not accurate enough routine calls other routines */ +/***************************************************************************/ + +static double bsloww1(double x, double dx, double orig,int n) { +mynumber u; + double sn,ssn,cs,ccs,s,c,w[2],y,y1,y2,c1,c2,xx,cor,res; + static const double t22 = 6291456.0; + int4 k; + y=ABS(x); + u.x=big.x+y; + y=y-(u.x-big.x); + dx=(x>0)?dx:-dx; + xx=y*y; + s = y*xx*(sn3 +xx*sn5); + c = xx*(cs2 +xx*(cs4 + xx*cs6)); + k=u.i[LOW_HALF]<<2; + sn=sincos.x[k]; + ssn=sincos.x[k+1]; + cs=sincos.x[k+2]; + ccs=sincos.x[k+3]; + y1 = (y+t22)-t22; + y2 = (y - y1)+dx; + c1 = (cs+t22)-t22; + c2=(cs-c1)+ccs; + cor=(ssn+s*ccs+cs*s+c2*y+c1*y2-sn*y*dx)-sn*c; + y=sn+c1*y1; + cor = cor+((sn-y)+c1*y1); + res=y+cor; + cor=(y-res)+cor; + cor = (cor>0)? 1.0005*cor+1.1e-24 : 1.0005*cor-1.1e-24; + if (res == res + cor) return (x>0)?res:-res; + else { + __dubsin(ABS(x),dx,w); + cor = (w[1]>0)? 1.000000005*w[1]+1.1e-24: 1.000000005*w[1]-1.1e-24; + if (w[0] == w[0]+cor) return (x>0)?w[0]:-w[0]; + else return (n&1)?__mpcos1(orig):__mpsin1(orig); + } +} + +/***************************************************************************/ +/* Routine compute sin(x+dx) or cos(x+dx) (Double-Length number) where x */ +/* in second or fourth quarter of unit circle.Routine receive also the */ +/* original value and quarter(n= 1or 3)of x for computing error of result. */ +/* And if result not accurate enough routine calls other routines */ +/***************************************************************************/ + +static double bsloww2(double x, double dx, double orig, int n) { +mynumber u; + double sn,ssn,cs,ccs,s,c,w[2],y,y1,y2,e1,e2,xx,cor,res; + static const double t22 = 6291456.0; + int4 k; + y=ABS(x); + u.x=big.x+y; + y=y-(u.x-big.x); + dx=(x>0)?dx:-dx; + xx=y*y; + s = y*xx*(sn3 +xx*sn5); + c = y*dx+xx*(cs2 +xx*(cs4 + xx*cs6)); + k=u.i[LOW_HALF]<<2; + sn=sincos.x[k]; + ssn=sincos.x[k+1]; + cs=sincos.x[k+2]; + ccs=sincos.x[k+3]; + + y1 = (y+t22)-t22; + y2 = (y - y1)+dx; + e1 = (sn+t22)-t22; + e2=(sn-e1)+ssn; + cor=(ccs-cs*c-e1*y2-e2*y)-sn*s; + y=cs-e1*y1; + cor = cor+((cs-y)-e1*y1); + res=y+cor; + cor=(y-res)+cor; + cor = (cor>0)? 1.0005*cor+1.1e-24 : 1.0005*cor-1.1e-24; + if (res == res + cor) return (n&2)?-res:res; + else { + __docos(ABS(x),dx,w); + cor = (w[1]>0)? 1.000000005*w[1]+1.1e-24 : 1.000000005*w[1]-1.1e-24; + if (w[0] == w[0]+cor) return (n&2)?-w[0]:w[0]; + else return (n&1)?__mpsin1(orig):__mpcos1(orig); + } +} + +/************************************************************************/ +/* Routine compute cos(x) for 2^-27 < |x|< 0.25 by Taylor with more */ +/* precision and if still doesn't accurate enough by mpcos or docos */ +/************************************************************************/ + +static double cslow2(double x) { + mynumber u; + double sn,ssn,cs,ccs,s,c,w[2],y,y1,y2,e1,e2,xx,cor,res; + static const double t22 = 6291456.0; + int4 k; + y=ABS(x); + u.x = big.x+y; + y = y-(u.x-big.x); + xx=y*y; + s = y*xx*(sn3 +xx*sn5); + c = xx*(cs2 +xx*(cs4 + xx*cs6)); + k=u.i[LOW_HALF]<<2; + sn=sincos.x[k]; + ssn=sincos.x[k+1]; + cs=sincos.x[k+2]; + ccs=sincos.x[k+3]; + y1 = (y+t22)-t22; + y2 = y - y1; + e1 = (sn+t22)-t22; + e2=(sn-e1)+ssn; + cor=(ccs-cs*c-e1*y2-e2*y)-sn*s; + y=cs-e1*y1; + cor = cor+((cs-y)-e1*y1); + res=y+cor; + cor=(y-res)+cor; + if (res == res+1.0005*cor) + return res; + else { + y=ABS(x); + __docos(y,0,w); + if (w[0] == w[0]+1.000000005*w[1]) return w[0]; + else return __mpcos(x,0); + } +} + +/***************************************************************************/ +/* Routine compute cos(x+dx) (Double-Length number) where x is small enough*/ +/* to use Taylor series around zero and (x+dx) .Routine receive also */ +/* (right argument) the original value of x for computing error of */ +/* result.And if result not accurate enough routine calls other routines */ +/***************************************************************************/ + + +static double csloww(double x,double dx, double orig) { + static const double th2_36 = 206158430208.0; /* 1.5*2**37 */ + double y,x1,x2,xx,r,t,res,cor,w[2],a,da,xn; + union {int4 i[2]; double x;} v; + int4 n; + x1=(x+th2_36)-th2_36; + y = aa.x*x1*x1*x1; + r=x+y; + x2=(x-x1)+dx; + xx=x*x; + /* Taylor series */ + t = (((((s5.x*xx + s4.x)*xx + s3.x)*xx + s2.x)*xx + bb.x)*xx + 3.0*aa.x*x1*x2)*x +aa.x*x2*x2*x2+dx; + t=((x-r)+y)+t; + res=r+t; + cor = (r-res)+t; + cor = (cor>0)? 1.0005*cor+ABS(orig)*3.1e-30 : 1.0005*cor-ABS(orig)*3.1e-30; + if (res == res + cor) return res; + else { + (x>0)? __dubsin(x,dx,w) : __dubsin(-x,-dx,w); + cor = (w[1]>0)? 1.000000001*w[1] + ABS(orig)*1.1e-30 : 1.000000001*w[1] - ABS(orig)*1.1e-30; + if (w[0] == w[0]+cor) return (x>0)?w[0]:-w[0]; + else { + t = (orig*hpinv.x + toint.x); + xn = t - toint.x; + v.x = t; + y = (orig - xn*mp1.x) - xn*mp2.x; + n =v.i[LOW_HALF]&3; + da = xn*pp3.x; + t=y-da; + da = (y-t)-da; + y = xn*pp4.x; + a = t - y; + da = ((t-a)-y)+da; + if (n==1) {a=-a; da=-da;} + (a>0)? __dubsin(a,da,w) : __dubsin(-a,-da,w); + cor = (w[1]>0)? 1.000000001*w[1] + ABS(orig)*1.1e-40 : 1.000000001*w[1] - ABS(orig)*1.1e-40; + if (w[0] == w[0]+cor) return (a>0)?w[0]:-w[0]; + else return __mpcos1(orig); + } + } +} + +/***************************************************************************/ +/* Routine compute sin(x+dx) (Double-Length number) where x in first or */ +/* third quarter of unit circle.Routine receive also (right argument) the */ +/* original value of x for computing error of result.And if result not */ +/* accurate enough routine calls other routines */ +/***************************************************************************/ + +static double csloww1(double x, double dx, double orig) { + mynumber u; + double sn,ssn,cs,ccs,s,c,w[2],y,y1,y2,c1,c2,xx,cor,res; + static const double t22 = 6291456.0; + int4 k; + y=ABS(x); + u.x=big.x+y; + y=y-(u.x-big.x); + dx=(x>0)?dx:-dx; + xx=y*y; + s = y*xx*(sn3 +xx*sn5); + c = xx*(cs2 +xx*(cs4 + xx*cs6)); + k=u.i[LOW_HALF]<<2; + sn=sincos.x[k]; + ssn=sincos.x[k+1]; + cs=sincos.x[k+2]; + ccs=sincos.x[k+3]; + y1 = (y+t22)-t22; + y2 = (y - y1)+dx; + c1 = (cs+t22)-t22; + c2=(cs-c1)+ccs; + cor=(ssn+s*ccs+cs*s+c2*y+c1*y2-sn*y*dx)-sn*c; + y=sn+c1*y1; + cor = cor+((sn-y)+c1*y1); + res=y+cor; + cor=(y-res)+cor; + cor = (cor>0)? 1.0005*cor+3.1e-30*ABS(orig) : 1.0005*cor-3.1e-30*ABS(orig); + if (res == res + cor) return (x>0)?res:-res; + else { + __dubsin(ABS(x),dx,w); + cor = (w[1]>0)? 1.000000005*w[1]+1.1e-30*ABS(orig) : 1.000000005*w[1]-1.1e-30*ABS(orig); + if (w[0] == w[0]+cor) return (x>0)?w[0]:-w[0]; + else return __mpcos1(orig); + } +} + + +/***************************************************************************/ +/* Routine compute sin(x+dx) (Double-Length number) where x in second or */ +/* fourth quarter of unit circle.Routine receive also the original value */ +/* and quarter(n= 1or 3)of x for computing error of result.And if result not*/ +/* accurate enough routine calls other routines */ +/***************************************************************************/ + +static double csloww2(double x, double dx, double orig, int n) { + mynumber u; + double sn,ssn,cs,ccs,s,c,w[2],y,y1,y2,e1,e2,xx,cor,res; + static const double t22 = 6291456.0; + int4 k; + y=ABS(x); + u.x=big.x+y; + y=y-(u.x-big.x); + dx=(x>0)?dx:-dx; + xx=y*y; + s = y*xx*(sn3 +xx*sn5); + c = y*dx+xx*(cs2 +xx*(cs4 + xx*cs6)); + k=u.i[LOW_HALF]<<2; + sn=sincos.x[k]; + ssn=sincos.x[k+1]; + cs=sincos.x[k+2]; + ccs=sincos.x[k+3]; + + y1 = (y+t22)-t22; + y2 = (y - y1)+dx; + e1 = (sn+t22)-t22; + e2=(sn-e1)+ssn; + cor=(ccs-cs*c-e1*y2-e2*y)-sn*s; + y=cs-e1*y1; + cor = cor+((cs-y)-e1*y1); + res=y+cor; + cor=(y-res)+cor; + cor = (cor>0)? 1.0005*cor+3.1e-30*ABS(orig) : 1.0005*cor-3.1e-30*ABS(orig); + if (res == res + cor) return (n)?-res:res; + else { + __docos(ABS(x),dx,w); + cor = (w[1]>0)? 1.000000005*w[1]+1.1e-30*ABS(orig) : 1.000000005*w[1]-1.1e-30*ABS(orig); + if (w[0] == w[0]+cor) return (n)?-w[0]:w[0]; + else return __mpcos1(orig); + } +} + +weak_alias (__cos, cos) +weak_alias (__sin, sin) + +#ifdef NO_LONG_DOUBLE +strong_alias (__sin, __sinl) +weak_alias (__sin, sinl) +strong_alias (__cos, __cosl) +weak_alias (__cos, cosl) +#endif diff --git a/libgcc-math/dbl-64/s_tan.c b/libgcc-math/dbl-64/s_tan.c new file mode 100644 index 00000000000..cf8d4d02670 --- /dev/null +++ b/libgcc-math/dbl-64/s_tan.c @@ -0,0 +1,486 @@ +/* + * IBM Accurate Mathematical Library + * written by International Business Machines Corp. + * Copyright (C) 2001 Free Software Foundation + * + * This program is free software; you can redistribute it and/or modify + * it under the terms of the GNU Lesser General Public License as published by + * the Free Software Foundation; either version 2.1 of the License, or + * (at your option) any later version. + * + * This program is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU Lesser General Public License for more details. + * + * You should have received a copy of the GNU Lesser General Public License + * along with this program; if not, write to the Free Software + * Foundation, Inc., 59 Temple Place - Suite 330, Boston, MA 02111-1307, USA. + */ +/*********************************************************************/ +/* MODULE_NAME: utan.c */ +/* */ +/* FUNCTIONS: utan */ +/* tanMp */ +/* */ +/* FILES NEEDED:dla.h endian.h mpa.h mydefs.h utan.h */ +/* branred.c sincos32.c mptan.c */ +/* utan.tbl */ +/* */ +/* An ultimate tan routine. Given an IEEE double machine number x */ +/* it computes the correctly rounded (to nearest) value of tan(x). */ +/* Assumption: Machine arithmetic operations are performed in */ +/* round to nearest mode of IEEE 754 standard. */ +/* */ +/*********************************************************************/ +#include "endian.h" +#include "dla.h" +#include "mpa.h" +#include "MathLib.h" +#include "math.h" + +static double tanMp(double); +void __mptan(double, mp_no *, int); + +double tan(double x) { +#include "utan.h" +#include "utan.tbl" + + int ux,i,n; + double a,da,a2,b,db,c,dc,c1,cc1,c2,cc2,c3,cc3,fi,ffi,gi,pz,s,sy, + t,t1,t2,t3,t4,t5,t6,t7,t8,t9,t10,w,x2,xn,xx2,y,ya,yya,z0,z,zz,z2,zz2; + int p; + number num,v; + mp_no mpa,mpt1,mpt2; +#if 0 + mp_no mpy; +#endif + + int __branred(double, double *, double *); + int __mpranred(double, mp_no *, int); + + /* x=+-INF, x=NaN */ + num.d = x; ux = num.i[HIGH_HALF]; + if ((ux&0x7ff00000)==0x7ff00000) return x-x; + + w=(x1.0;a-=2.0) { + mpk.d[1]=a*(a-1.0); + __mul(&gor,&mpk,&mpt1,p); + __cpy(&mpt1,&gor,p); + __mul(&x2,&sum,&mpt1,p); + __sub(&gor,&mpt1,&sum,p); + } + __mul(x,&sum,y,p); +} + +/**********************************************************************/ +/* Compute Multi-Precision cos() function for given p. Receive Multi */ +/* Precision number x and result stored at y */ +/**********************************************************************/ +static void cc32(mp_no *x, mp_no *y, int p) { + int i; + double a; +#if 0 + double b; + static const mp_no mpone = {1,{1.0,1.0}}; +#endif + mp_no mpt1,x2,gor,sum ,mpk={1,{1.0}}; +#if 0 + mp_no mpt2; +#endif + for (i=1;i<=p;i++) mpk.d[i]=0; + + __mul(x,x,&x2,p); + mpk.d[1]=27.0; + __mul(&oofac27,&mpk,&gor,p); + __cpy(&gor,&sum,p); + for (a=26.0;a>2.0;a-=2.0) { + mpk.d[1]=a*(a-1.0); + __mul(&gor,&mpk,&mpt1,p); + __cpy(&mpt1,&gor,p); + __mul(&x2,&sum,&mpt1,p); + __sub(&gor,&mpt1,&sum,p); + } + __mul(&x2,&sum,y,p); +} + +/***************************************************************************/ +/* c32() computes both sin(x), cos(x) as Multi precision numbers */ +/***************************************************************************/ +void __c32(mp_no *x, mp_no *y, mp_no *z, int p) { + static const mp_no mpt={1,{1.0,2.0}}, one={1,{1.0,1.0}}; + mp_no u,t,t1,t2,c,s; + int i; + __cpy(x,&u,p); + u.e=u.e-1; + cc32(&u,&c,p); + ss32(&u,&s,p); + for (i=0;i<24;i++) { + __mul(&c,&s,&t,p); + __sub(&s,&t,&t1,p); + __add(&t1,&t1,&s,p); + __sub(&mpt,&c,&t1,p); + __mul(&t1,&c,&t2,p); + __add(&t2,&t2,&c,p); + } + __sub(&one,&c,y,p); + __cpy(&s,z,p); +} + +/************************************************************************/ +/*Routine receive double x and two double results of sin(x) and return */ +/*result which is more accurate */ +/*Computing sin(x) with multi precision routine c32 */ +/************************************************************************/ +double __sin32(double x, double res, double res1) { + int p; + mp_no a,b,c; + p=32; + __dbl_mp(res,&a,p); + __dbl_mp(0.5*(res1-res),&b,p); + __add(&a,&b,&c,p); + if (x>0.8) + { __sub(&hp,&c,&a,p); + __c32(&a,&b,&c,p); + } + else __c32(&c,&a,&b,p); /* b=sin(0.5*(res+res1)) */ + __dbl_mp(x,&c,p); /* c = x */ + __sub(&b,&c,&a,p); + /* if a>0 return min(res,res1), otherwise return max(res,res1) */ + if (a.d[0]>0) return (resres1)?res:res1; +} + +/************************************************************************/ +/*Routine receive double x and two double results of cos(x) and return */ +/*result which is more accurate */ +/*Computing cos(x) with multi precision routine c32 */ +/************************************************************************/ +double __cos32(double x, double res, double res1) { + int p; + mp_no a,b,c; + p=32; + __dbl_mp(res,&a,p); + __dbl_mp(0.5*(res1-res),&b,p); + __add(&a,&b,&c,p); + if (x>2.4) + { __sub(&pi,&c,&a,p); + __c32(&a,&b,&c,p); + b.d[0]=-b.d[0]; + } + else if (x>0.8) + { __sub(&hp,&c,&a,p); + __c32(&a,&c,&b,p); + } + else __c32(&c,&b,&a,p); /* b=cos(0.5*(res+res1)) */ + __dbl_mp(x,&c,p); /* c = x */ + __sub(&b,&c,&a,p); + /* if a>0 return max(res,res1), otherwise return min(res,res1) */ + if (a.d[0]>0) return (res>res1)?res:res1; + else return (res0.8) { __sub(&hp,&c,&a,p); __c32(&a,&b,&c,p); } + else __c32(&c,&a,&b,p); /* b = sin(x+dx) */ + __mp_dbl(&b,&y,p); + return y; +} + +/*******************************************************************/ +/* Compute cos()of double-length number (x+dx) as Multi Precision */ +/* number and return result as double */ +/*******************************************************************/ +double __mpcos(double x, double dx) { + int p; + double y; + mp_no a,b,c; + p=32; + __dbl_mp(x,&a,p); + __dbl_mp(dx,&b,p); + __add(&a,&b,&c,p); + if (x>0.8) + { __sub(&hp,&c,&b,p); + __c32(&b,&c,&a,p); + } + else __c32(&c,&a,&b,p); /* a = cos(x+dx) */ + __mp_dbl(&a,&y,p); + return y; +} + +/******************************************************************/ +/* mpranred() performs range reduction of a double number x into */ +/* multi precision number y, such that y=x-n*pi/2, abs(y)= 8388608.0) + { t +=1.0; + __sub(&c,&one,&b,p); + __mul(&b,&hp,y,p); + } + else __mul(&c,&hp,y,p); + n = (int) t; + if (x < 0) { y->d[0] = - y->d[0]; n = -n; } + return (n&3); + } +} + +/*******************************************************************/ +/* Multi-Precision sin() function subroutine, for p=32. It is */ +/* based on the routines mpranred() and c32(). */ +/*******************************************************************/ +double __mpsin1(double x) +{ + int p; + int n; + mp_no u,s,c; + double y; + p=32; + n=__mpranred(x,&u,p); /* n is 0, 1, 2 or 3 */ + __c32(&u,&c,&s,p); + switch (n) { /* in which quarter of unit circle y is*/ + case 0: + __mp_dbl(&s,&y,p); + return y; + break; + + case 2: + __mp_dbl(&s,&y,p); + return -y; + break; + + case 1: + __mp_dbl(&c,&y,p); + return y; + break; + + case 3: + __mp_dbl(&c,&y,p); + return -y; + break; + + } + return 0; /* unreachable, to make the compiler happy */ +} + +/*****************************************************************/ +/* Multi-Precision cos() function subroutine, for p=32. It is */ +/* based on the routines mpranred() and c32(). */ +/*****************************************************************/ + +double __mpcos1(double x) +{ + int p; + int n; + mp_no u,s,c; + double y; + + p=32; + n=__mpranred(x,&u,p); /* n is 0, 1, 2 or 3 */ + __c32(&u,&c,&s,p); + switch (n) { /* in what quarter of unit circle y is*/ + + case 0: + __mp_dbl(&c,&y,p); + return y; + break; + + case 2: + __mp_dbl(&c,&y,p); + return -y; + break; + + case 1: + __mp_dbl(&s,&y,p); + return -y; + break; + + case 3: + __mp_dbl(&s,&y,p); + return y; + break; + + } + return 0; /* unreachable, to make the compiler happy */ +} +/******************************************************************/ diff --git a/libgcc-math/dbl-64/sincos32.h b/libgcc-math/dbl-64/sincos32.h new file mode 100644 index 00000000000..ee9d5a4ccfb --- /dev/null +++ b/libgcc-math/dbl-64/sincos32.h @@ -0,0 +1,82 @@ +/* + * IBM Accurate Mathematical Library + * Written by International Business Machines Corp. + * Copyright (C) 2001 Free Software Foundation, Inc. + * + * This program is free software; you can redistribute it and/or modify + * it under the terms of the GNU Lesser General Public License as published by + * the Free Software Foundation; either version 2.1 of the License, or + * (at your option) any later version. + * + * This program is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU Lesser General Public License for more details. + * + * You should have received a copy of the GNU Lesser General Public License + * along with this program; if not, write to the Free Software + * Foundation, Inc., 59 Temple Place - Suite 330, Boston, MA 02111-1307, USA. + */ + +/******************************************************************/ +/* */ +/* MODULE_NAME:sincos32.h */ +/* */ +/* common data and variables prototype and definition */ +/******************************************************************/ + +#ifndef SINCOS32_H +#define SINCCOS32_H + +#ifdef BIG_ENDI +static const number +/**/ hpinv = {{0x3FE45F30, 0x6DC9C883}}, /* 0.63661977236758138 */ +/**/ toint = {{0x43380000, 0x00000000}}; /* 6755399441055744 */ + +#else +#ifdef LITTLE_ENDI +static const number +/**/ hpinv = {{0x6DC9C883, 0x3FE45F30}}, /* 0.63661977236758138 */ +/**/ toint = {{0x00000000, 0x43380000}}; /* 6755399441055744 */ + +#endif +#endif + +static const mp_no + oofac27 = {-3,{1.0,7.0,4631664.0,12006312.0,13118056.0,6538613.0,646354.0, + 8508025.0,9131256.0,7548776.0,2529842.0,8864927.0,660489.0,15595125.0,12777885.0, + 11618489.0,13348664.0,5486686.0,514518.0,11275535.0,4727621.0,3575562.0, + 13579710.0,5829745.0,7531862.0,9507898.0,6915060.0,4079264.0,1907586.0, + 6078398.0,13789314.0,5504104.0,14136.0}}, + pi = {1,{1.0,3.0, + 2375530.0,8947107.0,578323.0,1673774.0,225395.0,4498441.0,3678761.0, + 10432976.0,536314.0,10021966.0,7113029.0,2630118.0,3723283.0,7847508.0, + 6737716.0,15273068.0,12626985.0,12044668.0,5299519.0,8705461.0,11880201.0, + 1544726.0,14014857.0,7994139.0,13709579.0,10918111.0,11906095.0,16610011.0, + 13638367.0,12040417.0,11529578.0,2522774.0}}, + hp = {1,{1.0, 1.0, + 9576373.0,4473553.0,8677769.0,9225495.0,112697.0,10637828.0, + 10227988.0,13605096.0,268157.0,5010983.0,3556514.0,9703667.0, + 1861641.0,12312362.0,3368858.0,7636534.0,6313492.0,14410942.0, + 2649759.0,12741338.0,14328708.0,9160971.0,7007428.0,12385677.0, + 15243397.0,13847663.0,14341655.0,16693613.0,15207791.0,14408816.0, + 14153397.0,1261387.0,6110792.0,2291862.0,4181138.0,5295267.0}}; + +static const double toverp[75] = { + 10680707.0, 7228996.0, 1387004.0, 2578385.0, 16069853.0, + 12639074.0, 9804092.0, 4427841.0, 16666979.0, 11263675.0, + 12935607.0, 2387514.0, 4345298.0, 14681673.0, 3074569.0, + 13734428.0, 16653803.0, 1880361.0, 10960616.0, 8533493.0, + 3062596.0, 8710556.0, 7349940.0, 6258241.0, 3772886.0, + 3769171.0, 3798172.0, 8675211.0, 12450088.0, 3874808.0, + 9961438.0, 366607.0, 15675153.0, 9132554.0, 7151469.0, + 3571407.0, 2607881.0, 12013382.0, 4155038.0, 6285869.0, + 7677882.0, 13102053.0, 15825725.0, 473591.0, 9065106.0, + 15363067.0, 6271263.0, 9264392.0, 5636912.0, 4652155.0, + 7056368.0, 13614112.0, 10155062.0, 1944035.0, 9527646.0, + 15080200.0, 6658437.0, 6231200.0, 6832269.0, 16767104.0, + 5075751.0, 3212806.0, 1398474.0, 7579849.0, 6349435.0, + 12618859.0, 4703257.0, 12806093.0, 14477321.0, 2786137.0, + 12875403.0, 9837734.0, 14528324.0, 13719321.0, 343717.0 }; + +#endif diff --git a/libgcc-math/dbl-64/slowexp.c b/libgcc-math/dbl-64/slowexp.c new file mode 100644 index 00000000000..78c107f7093 --- /dev/null +++ b/libgcc-math/dbl-64/slowexp.c @@ -0,0 +1,66 @@ +/* + * IBM Accurate Mathematical Library + * written by International Business Machines Corp. + * Copyright (C) 2001 Free Software Foundation + * + * This program is free software; you can redistribute it and/or modify + * it under the terms of the GNU Lesser General Public License as published by + * the Free Software Foundation; either version 2.1 of the License, or + * (at your option) any later version. + * + * This program is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU Lesser General Public License for more details. + * + * You should have received a copy of the GNU Lesser General Public License + * along with this program; if not, write to the Free Software + * Foundation, Inc., 59 Temple Place - Suite 330, Boston, MA 02111-1307, USA. + */ +/**************************************************************************/ +/* MODULE_NAME:slowexp.c */ +/* */ +/* FUNCTION:slowexp */ +/* */ +/* FILES NEEDED:mpa.h */ +/* mpa.c mpexp.c */ +/* */ +/*Converting from double precision to Multi-precision and calculating */ +/* e^x */ +/**************************************************************************/ +#include "mpa.h" +#include "math_private.h" + +void __mpexp(mp_no *x, mp_no *y, int p); + +/*Converting from double precision to Multi-precision and calculating e^x */ +double __slowexp(double x) { + double w,z,res,eps=3.0e-26; +#if 0 + double y; +#endif + int p; +#if 0 + int orig,i; +#endif + mp_no mpx, mpy, mpz,mpw,mpeps,mpcor; + + p=6; + __dbl_mp(x,&mpx,p); /* Convert a double precision number x */ + /* into a multiple precision number mpx with prec. p. */ + __mpexp(&mpx, &mpy, p); /* Multi-Precision exponential function */ + __dbl_mp(eps,&mpeps,p); + __mul(&mpeps,&mpy,&mpcor,p); + __add(&mpy,&mpcor,&mpw,p); + __sub(&mpy,&mpcor,&mpz,p); + __mp_dbl(&mpw, &w, p); + __mp_dbl(&mpz, &z, p); + if (w == z) return w; + else { /* if calculating is not exactly */ + p = 32; + __dbl_mp(x,&mpx,p); + __mpexp(&mpx, &mpy, p); + __mp_dbl(&mpy, &res, p); + return res; + } +} diff --git a/libgcc-math/dbl-64/slowpow.c b/libgcc-math/dbl-64/slowpow.c new file mode 100644 index 00000000000..e11a532bf86 --- /dev/null +++ b/libgcc-math/dbl-64/slowpow.c @@ -0,0 +1,74 @@ +/* + * IBM Accurate Mathematical Library + * written by International Business Machines Corp. + * Copyright (C) 2001 Free Software Foundation + * + * This program is free software; you can redistribute it and/or modify + * it under the terms of the GNU Lesser General Public License as published by + * the Free Software Foundation; either version 2.1 of the License, or + * (at your option) any later version. + * + * This program is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU Lesser General Public License for more details. + * + * You should have received a copy of the GNU Lesser General Public License + * along with this program; if not, write to the Free Software + * Foundation, Inc., 59 Temple Place - Suite 330, Boston, MA 02111-1307, USA. + */ +/*************************************************************************/ +/* MODULE_NAME:slowpow.c */ +/* */ +/* FUNCTION:slowpow */ +/* */ +/*FILES NEEDED:mpa.h */ +/* mpa.c mpexp.c mplog.c halfulp.c */ +/* */ +/* Given two IEEE double machine numbers y,x , routine computes the */ +/* correctly rounded (to nearest) value of x^y. Result calculated by */ +/* multiplication (in halfulp.c) or if result isn't accurate enough */ +/* then routine converts x and y into multi-precision doubles and */ +/* calls to mpexp routine */ +/*************************************************************************/ + +#include "mpa.h" +#include "math_private.h" + +void __mpexp(mp_no *x, mp_no *y, int p); +void __mplog(mp_no *x, mp_no *y, int p); +double ulog(double); +double __halfulp(double x,double y); + +double __slowpow(double x, double y, double z) { + double res,res1; + mp_no mpx, mpy, mpz,mpw,mpp,mpr,mpr1; + static const mp_no eps = {-3,{1.0,4.0}}; + int p; + + res = __halfulp(x,y); /* halfulp() returns -10 or x^y */ + if (res >= 0) return res; /* if result was really computed by halfulp */ + /* else, if result was not really computed by halfulp */ + p = 10; /* p=precision */ + __dbl_mp(x,&mpx,p); + __dbl_mp(y,&mpy,p); + __dbl_mp(z,&mpz,p); + __mplog(&mpx, &mpz, p); /* log(x) = z */ + __mul(&mpy,&mpz,&mpw,p); /* y * z =w */ + __mpexp(&mpw, &mpp, p); /* e^w =pp */ + __add(&mpp,&eps,&mpr,p); /* pp+eps =r */ + __mp_dbl(&mpr, &res, p); + __sub(&mpp,&eps,&mpr1,p); /* pp -eps =r1 */ + __mp_dbl(&mpr1, &res1, p); /* converting into double precision */ + if (res == res1) return res; + + p = 32; /* if we get here result wasn't calculated exactly, continue */ + __dbl_mp(x,&mpx,p); /* for more exact calculation */ + __dbl_mp(y,&mpy,p); + __dbl_mp(z,&mpz,p); + __mplog(&mpx, &mpz, p); /* log(c)=z */ + __mul(&mpy,&mpz,&mpw,p); /* y*z =w */ + __mpexp(&mpw, &mpp, p); /* e^w=pp */ + __mp_dbl(&mpp, &res, p); /* converting into double precision */ + return res; +} diff --git a/libgcc-math/dbl-64/t_exp.c b/libgcc-math/dbl-64/t_exp.c new file mode 100644 index 00000000000..7a33a9080c1 --- /dev/null +++ b/libgcc-math/dbl-64/t_exp.c @@ -0,0 +1,436 @@ +/* Accurate tables for exp(). + Copyright (C) 1998 Free Software Foundation, Inc. + This file is part of the GNU C Library. + Contributed by Geoffrey Keating + + The GNU C Library is free software; you can redistribute it and/or + modify it under the terms of the GNU Lesser General Public + License as published by the Free Software Foundation; either + version 2.1 of the License, or (at your option) any later version. + + The GNU C Library is distributed in the hope that it will be useful, + but WITHOUT ANY WARRANTY; without even the implied warranty of + MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU + Lesser General Public License for more details. + + You should have received a copy of the GNU Lesser General Public + License along with the GNU C Library; if not, write to the Free + Software Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA + 02111-1307 USA. */ + +/* This table has the property that, for all integers -177 <= i <= 177, + exp(i/512.0 + __exp_deltatable[abs(i)]) == __exp_atable[i+177] + r + for some -2^-64 < r < 2^-64 (abs(r) < 2^-65 if i <= 0); and that + __exp_deltatable[abs(i)] == t * 2^-60 + for integer t so that abs(t) <= 8847927 * 2^8. */ + +#define W52 (2.22044605e-16) +#define W55 (2.77555756e-17) +#define W58 (3.46944695e-18) +#define W59 (1.73472348e-18) +#define W60 (8.67361738e-19) +const float __exp_deltatable[178] = { + 0*W60, 16558714*W60, -10672149*W59, 1441652*W60, + -15787963*W55, 462888*W60, 7291806*W60, 1698880*W60, + -14375103*W58, -2021016*W60, 728829*W60, -3759654*W60, + 3202123*W60, -10916019*W58, -251570*W60, -1043086*W60, + 8207536*W60, -409964*W60, -5993931*W60, -475500*W60, + 2237522*W60, 324170*W60, -244117*W60, 32077*W60, + 123907*W60, -1019734*W60, -143*W60, 813077*W60, + 743345*W60, 462461*W60, 629794*W60, 2125066*W60, + -2339121*W60, -337951*W60, 9922067*W60, -648704*W60, + 149407*W60, -2687209*W60, -631608*W60, 2128280*W60, + -4882082*W60, 2001360*W60, 175074*W60, 2923216*W60, + -538947*W60, -1212193*W60, -1920926*W60, -1080577*W60, + 3690196*W60, 2643367*W60, 2911937*W60, 671455*W60, + -1128674*W60, 593282*W60, -5219347*W60, -1941490*W60, + 11007953*W60, 239609*W60, -2969658*W60, -1183650*W60, + 942998*W60, 699063*W60, 450569*W60, -329250*W60, + -7257875*W60, -312436*W60, 51626*W60, 555877*W60, + -641761*W60, 1565666*W60, 884327*W60, -10960035*W60, + -2004679*W60, -995793*W60, -2229051*W60, -146179*W60, + -510327*W60, 1453482*W60, -3778852*W60, -2238056*W60, + -4895983*W60, 3398883*W60, -252738*W60, 1230155*W60, + 346918*W60, 1109352*W60, 268941*W60, -2930483*W60, + -1036263*W60, -1159280*W60, 1328176*W60, 2937642*W60, + -9371420*W60, -6902650*W60, -1419134*W60, 1442904*W60, + -1319056*W60, -16369*W60, 696555*W60, -279987*W60, + -7919763*W60, 252741*W60, 459711*W60, -1709645*W60, + 354913*W60, 6025867*W60, -421460*W60, -853103*W60, + -338649*W60, 962151*W60, 955965*W60, 784419*W60, + -3633653*W60, 2277133*W60, -8847927*W52, 1223028*W60, + 5907079*W60, 623167*W60, 5142888*W60, 2599099*W60, + 1214280*W60, 4870359*W60, 593349*W60, -57705*W60, + 7761209*W60, -5564097*W60, 2051261*W60, 6216869*W60, + 4692163*W60, 601691*W60, -5264906*W60, 1077872*W60, + -3205949*W60, 1833082*W60, 2081746*W60, -987363*W60, + -1049535*W60, 2015244*W60, 874230*W60, 2168259*W60, + -1740124*W60, -10068269*W60, -18242*W60, -3013583*W60, + 580601*W60, -2547161*W60, -535689*W60, 2220815*W60, + 1285067*W60, 2806933*W60, -983086*W60, -1729097*W60, + -1162985*W60, -2561904*W60, 801988*W60, 244351*W60, + 1441893*W60, -7517981*W60, 271781*W60, -15021588*W60, + -2341588*W60, -919198*W60, 1642232*W60, 4771771*W60, + -1220099*W60, -3062372*W60, 628624*W60, 1278114*W60, + 13083513*W60, -10521925*W60, 3180310*W60, -1659307*W60, + 3543773*W60, 2501203*W60, 4151*W60, -340748*W60, + -2285625*W60, 2495202*W60 +}; + +const double __exp_atable[355] /* __attribute__((mode(DF))) */ = { + 0.707722561055888932371, /* 0x0.b52d4e46605c27ffd */ + 0.709106182438804188967, /* 0x0.b587fb96f75097ffb */ + 0.710492508843861281234, /* 0x0.b5e2d649899167ffd */ + 0.711881545564593931623, /* 0x0.b63dde74d36bdfffe */ + 0.713273297897442870573, /* 0x0.b699142f945f87ffc */ + 0.714667771153751463236, /* 0x0.b6f477909c4ea0001 */ + 0.716064970655995725059, /* 0x0.b75008aec758f8004 */ + 0.717464901723956938193, /* 0x0.b7abc7a0eea7e0002 */ + 0.718867569715736398602, /* 0x0.b807b47e1586c7ff8 */ + 0.720272979947266023271, /* 0x0.b863cf5d10e380003 */ + 0.721681137825144314297, /* 0x0.b8c01855195c37ffb */ + 0.723092048691992950199, /* 0x0.b91c8f7d213740004 */ + 0.724505717938892290800, /* 0x0.b97934ec5002d0007 */ + 0.725922150953176470431, /* 0x0.b9d608b9c92ea7ffc */ + 0.727341353138962865022, /* 0x0.ba330afcc29e98003 */ + 0.728763329918453162104, /* 0x0.ba903bcc8618b7ffc */ + 0.730188086709957051568, /* 0x0.baed9b40591ba0000 */ + 0.731615628948127705309, /* 0x0.bb4b296f931e30002 */ + 0.733045962086486091436, /* 0x0.bba8e671a05617ff9 */ + 0.734479091556371366251, /* 0x0.bc06d25dd49568001 */ + 0.735915022857225542529, /* 0x0.bc64ed4bce8f6fff9 */ + 0.737353761441304711410, /* 0x0.bcc33752f915d7ff9 */ + 0.738795312814142124419, /* 0x0.bd21b08af98e78005 */ + 0.740239682467211168593, /* 0x0.bd80590b65e9a8000 */ + 0.741686875913991849885, /* 0x0.bddf30ebec4a10000 */ + 0.743136898669507939299, /* 0x0.be3e38443c84e0007 */ + 0.744589756269486091620, /* 0x0.be9d6f2c1d32a0002 */ + 0.746045454254026796384, /* 0x0.befcd5bb59baf8004 */ + 0.747503998175051087583, /* 0x0.bf5c6c09ca84c0003 */ + 0.748965393601880857739, /* 0x0.bfbc322f5b18b7ff8 */ + 0.750429646104262104698, /* 0x0.c01c2843f776fffff */ + 0.751896761271877989160, /* 0x0.c07c4e5fa18b88002 */ + 0.753366744698445112140, /* 0x0.c0dca49a5fb18fffd */ + 0.754839601988627206827, /* 0x0.c13d2b0c444db0005 */ + 0.756315338768691947122, /* 0x0.c19de1cd798578006 */ + 0.757793960659406629066, /* 0x0.c1fec8f623723fffd */ + 0.759275473314173443536, /* 0x0.c25fe09e8a0f47ff8 */ + 0.760759882363831851927, /* 0x0.c2c128dedc88f8000 */ + 0.762247193485956486805, /* 0x0.c322a1cf7d6e7fffa */ + 0.763737412354726363781, /* 0x0.c3844b88cb9347ffc */ + 0.765230544649828092739, /* 0x0.c3e626232bd8f7ffc */ + 0.766726596071518051729, /* 0x0.c44831b719bf18002 */ + 0.768225572321911687194, /* 0x0.c4aa6e5d12d078001 */ + 0.769727479119219348810, /* 0x0.c50cdc2da64a37ffb */ + 0.771232322196981678892, /* 0x0.c56f7b41744490001 */ + 0.772740107296721268087, /* 0x0.c5d24bb1259e70004 */ + 0.774250840160724651565, /* 0x0.c6354d95640dd0007 */ + 0.775764526565368872643, /* 0x0.c6988106fec447fff */ + 0.777281172269557396602, /* 0x0.c6fbe61eb1bd0ffff */ + 0.778800783068235302750, /* 0x0.c75f7cf560942fffc */ + 0.780323364758801041312, /* 0x0.c7c345a3f1983fffe */ + 0.781848923151573727006, /* 0x0.c8274043594cb0002 */ + 0.783377464064598849602, /* 0x0.c88b6cec94b3b7ff9 */ + 0.784908993312207869935, /* 0x0.c8efcbb89cba27ffe */ + 0.786443516765346961618, /* 0x0.c9545cc0a88c70003 */ + 0.787981040257604625744, /* 0x0.c9b9201dc643bfffa */ + 0.789521569657452682047, /* 0x0.ca1e15e92a5410007 */ + 0.791065110849462849192, /* 0x0.ca833e3c1ae510005 */ + 0.792611669712891875319, /* 0x0.cae8992fd84667ffd */ + 0.794161252150049179450, /* 0x0.cb4e26ddbc207fff8 */ + 0.795713864077794763584, /* 0x0.cbb3e75f301b60003 */ + 0.797269511407239561694, /* 0x0.cc19dacd978cd8002 */ + 0.798828200086368567220, /* 0x0.cc8001427e55d7ffb */ + 0.800389937624300440456, /* 0x0.cce65ade24d360006 */ + 0.801954725261124767840, /* 0x0.cd4ce7a5de839fffb */ + 0.803522573691593189330, /* 0x0.cdb3a7c79a678fffd */ + 0.805093487311204114563, /* 0x0.ce1a9b563965ffffc */ + 0.806667472122675088819, /* 0x0.ce81c26b838db8000 */ + 0.808244534127439906441, /* 0x0.cee91d213f8428002 */ + 0.809824679342317166307, /* 0x0.cf50ab9144d92fff9 */ + 0.811407913793616542005, /* 0x0.cfb86dd5758c2ffff */ + 0.812994243520784198882, /* 0x0.d0206407c20e20005 */ + 0.814583674571603966162, /* 0x0.d0888e4223facfff9 */ + 0.816176213022088536960, /* 0x0.d0f0ec9eb3f7c8002 */ + 0.817771864936188586101, /* 0x0.d1597f377d6768002 */ + 0.819370636400374108252, /* 0x0.d1c24626a46eafff8 */ + 0.820972533518165570298, /* 0x0.d22b41865ff1e7ff9 */ + 0.822577562404315121269, /* 0x0.d2947170f32ec7ff9 */ + 0.824185729164559344159, /* 0x0.d2fdd60097795fff8 */ + 0.825797039949601741075, /* 0x0.d3676f4fb796d0001 */ + 0.827411500902565544264, /* 0x0.d3d13d78b5f68fffb */ + 0.829029118181348834154, /* 0x0.d43b40960546d8001 */ + 0.830649897953322891022, /* 0x0.d4a578c222a058000 */ + 0.832273846408250750368, /* 0x0.d50fe617a3ba78005 */ + 0.833900969738858188772, /* 0x0.d57a88b1218e90002 */ + 0.835531274148056613016, /* 0x0.d5e560a94048f8006 */ + 0.837164765846411529371, /* 0x0.d6506e1aac8078003 */ + 0.838801451086016225394, /* 0x0.d6bbb1204074e0001 */ + 0.840441336100884561780, /* 0x0.d72729d4c28518004 */ + 0.842084427144139224814, /* 0x0.d792d8530e12b0001 */ + 0.843730730487052604790, /* 0x0.d7febcb61273e7fff */ + 0.845380252404570153833, /* 0x0.d86ad718c308dfff9 */ + 0.847032999194574087728, /* 0x0.d8d727962c69d7fff */ + 0.848688977161248581090, /* 0x0.d943ae49621ce7ffb */ + 0.850348192619261200615, /* 0x0.d9b06b4d832ef8005 */ + 0.852010651900976245816, /* 0x0.da1d5ebdc22220005 */ + 0.853676361342631029337, /* 0x0.da8a88b555baa0006 */ + 0.855345327311054837175, /* 0x0.daf7e94f965f98004 */ + 0.857017556155879489641, /* 0x0.db6580a7c98f7fff8 */ + 0.858693054267390953857, /* 0x0.dbd34ed9617befff8 */ + 0.860371828028939855647, /* 0x0.dc4153ffc8b65fff9 */ + 0.862053883854957292436, /* 0x0.dcaf90368bfca8004 */ + 0.863739228154875360306, /* 0x0.dd1e0399328d87ffe */ + 0.865427867361348468455, /* 0x0.dd8cae435d303fff9 */ + 0.867119807911702289458, /* 0x0.ddfb9050b1cee8006 */ + 0.868815056264353846599, /* 0x0.de6aa9dced8448001 */ + 0.870513618890481399881, /* 0x0.ded9fb03db7320006 */ + 0.872215502247877139094, /* 0x0.df4983e1380657ff8 */ + 0.873920712852848668986, /* 0x0.dfb94490ffff77ffd */ + 0.875629257204025623884, /* 0x0.e0293d2f1cb01fff9 */ + 0.877341141814212965880, /* 0x0.e0996dd786fff0007 */ + 0.879056373217612985183, /* 0x0.e109d6a64f5d57ffc */ + 0.880774957955916648615, /* 0x0.e17a77b78e72a7ffe */ + 0.882496902590150900078, /* 0x0.e1eb5127722cc7ff8 */ + 0.884222213673356738383, /* 0x0.e25c63121fb0c8006 */ + 0.885950897802399772740, /* 0x0.e2cdad93ec5340003 */ + 0.887682961567391237685, /* 0x0.e33f30c925fb97ffb */ + 0.889418411575228162725, /* 0x0.e3b0ecce2d05ffff9 */ + 0.891157254447957902797, /* 0x0.e422e1bf727718006 */ + 0.892899496816652704641, /* 0x0.e4950fb9713fc7ffe */ + 0.894645145323828439008, /* 0x0.e50776d8b0e60fff8 */ + 0.896394206626591749641, /* 0x0.e57a1739c8fadfffc */ + 0.898146687421414902124, /* 0x0.e5ecf0f97c5798007 */ + 0.899902594367530173098, /* 0x0.e660043464e378005 */ + 0.901661934163603406867, /* 0x0.e6d3510747e150006 */ + 0.903424713533971135418, /* 0x0.e746d78f06cd97ffd */ + 0.905190939194458810123, /* 0x0.e7ba97e879c91fffc */ + 0.906960617885092856864, /* 0x0.e82e92309390b0007 */ + 0.908733756358986566306, /* 0x0.e8a2c6845544afffa */ + 0.910510361377119825629, /* 0x0.e9173500c8abc7ff8 */ + 0.912290439722343249336, /* 0x0.e98bddc30f98b0002 */ + 0.914073998177417412765, /* 0x0.ea00c0e84bc4c7fff */ + 0.915861043547953501680, /* 0x0.ea75de8db8094fffe */ + 0.917651582652244779397, /* 0x0.eaeb36d09d3137ffe */ + 0.919445622318405764159, /* 0x0.eb60c9ce4ed3dffff */ + 0.921243169397334638073, /* 0x0.ebd697a43995b0007 */ + 0.923044230737526172328, /* 0x0.ec4ca06fc7768fffa */ + 0.924848813220121135342, /* 0x0.ecc2e44e865b6fffb */ + 0.926656923710931002014, /* 0x0.ed39635df34e70006 */ + 0.928468569126343790092, /* 0x0.edb01dbbc2f5b7ffa */ + 0.930283756368834757725, /* 0x0.ee2713859aab57ffa */ + 0.932102492359406786818, /* 0x0.ee9e44d9342870004 */ + 0.933924784042873379360, /* 0x0.ef15b1d4635438005 */ + 0.935750638358567643520, /* 0x0.ef8d5a94f60f50007 */ + 0.937580062297704630580, /* 0x0.f0053f38f345cffff */ + 0.939413062815381727516, /* 0x0.f07d5fde3a2d98001 */ + 0.941249646905368053689, /* 0x0.f0f5bca2d481a8004 */ + 0.943089821583810716806, /* 0x0.f16e55a4e497d7ffe */ + 0.944933593864477061592, /* 0x0.f1e72b028a2827ffb */ + 0.946780970781518460559, /* 0x0.f2603cd9fb5430001 */ + 0.948631959382661205081, /* 0x0.f2d98b497d2a87ff9 */ + 0.950486566729423554277, /* 0x0.f353166f63e3dffff */ + 0.952344799896018723290, /* 0x0.f3ccde6a11ae37ffe */ + 0.954206665969085765512, /* 0x0.f446e357f66120000 */ + 0.956072172053890279009, /* 0x0.f4c12557964f0fff9 */ + 0.957941325265908139014, /* 0x0.f53ba48781046fffb */ + 0.959814132734539637840, /* 0x0.f5b66106555d07ffa */ + 0.961690601603558903308, /* 0x0.f6315af2c2027fffc */ + 0.963570739036113010927, /* 0x0.f6ac926b8aeb80004 */ + 0.965454552202857141381, /* 0x0.f728078f7c5008002 */ + 0.967342048278315158608, /* 0x0.f7a3ba7d66a908001 */ + 0.969233234469444204768, /* 0x0.f81fab543e1897ffb */ + 0.971128118008140250896, /* 0x0.f89bda33122c78007 */ + 0.973026706099345495256, /* 0x0.f9184738d4cf97ff8 */ + 0.974929006031422851235, /* 0x0.f994f284d3a5c0008 */ + 0.976835024947348973265, /* 0x0.fa11dc35bc7820002 */ + 0.978744770239899142285, /* 0x0.fa8f046b4fb7f8007 */ + 0.980658249138918636210, /* 0x0.fb0c6b449ab1cfff9 */ + 0.982575468959622777535, /* 0x0.fb8a10e1088fb7ffa */ + 0.984496437054508843888, /* 0x0.fc07f5602d79afffc */ + 0.986421160608523028820, /* 0x0.fc8618e0e55e47ffb */ + 0.988349647107594098099, /* 0x0.fd047b83571b1fffa */ + 0.990281903873210800357, /* 0x0.fd831d66f4c018002 */ + 0.992217938695037382475, /* 0x0.fe01fead3320bfff8 */ + 0.994157757657894713987, /* 0x0.fe811f703491e8006 */ + 0.996101369488558541238, /* 0x0.ff007fd5744490005 */ + 0.998048781093141101932, /* 0x0.ff801ffa9b9280007 */ + 1.000000000000000000000, /* 0x1.00000000000000000 */ + 1.001955033605393285965, /* 0x1.0080200565d29ffff */ + 1.003913889319761887310, /* 0x1.0100802aa0e80fff0 */ + 1.005876574715736104818, /* 0x1.01812090377240007 */ + 1.007843096764807100351, /* 0x1.020201541aad7fff6 */ + 1.009813464316352327214, /* 0x1.0283229c4c9820007 */ + 1.011787683565730677817, /* 0x1.030484836910a000e */ + 1.013765762469146736174, /* 0x1.0386272b9c077fffe */ + 1.015747708536026694351, /* 0x1.04080ab526304fff0 */ + 1.017733529475172815584, /* 0x1.048a2f412375ffff0 */ + 1.019723232714418781378, /* 0x1.050c94ef7ad5e000a */ + 1.021716825883923762690, /* 0x1.058f3be0f1c2d0004 */ + 1.023714316605201180057, /* 0x1.06122436442e2000e */ + 1.025715712440059545995, /* 0x1.06954e0fec63afff2 */ + 1.027721021151397406936, /* 0x1.0718b98f41c92fff6 */ + 1.029730250269221158939, /* 0x1.079c66d49bb2ffff1 */ + 1.031743407506447551857, /* 0x1.082056011a9230009 */ + 1.033760500517691527387, /* 0x1.08a487359ebd50002 */ + 1.035781537016238873464, /* 0x1.0928fa93490d4fff3 */ + 1.037806524719013578963, /* 0x1.09adb03b3e5b3000d */ + 1.039835471338248051878, /* 0x1.0a32a84e9e5760004 */ + 1.041868384612101516848, /* 0x1.0ab7e2eea5340ffff */ + 1.043905272300907460835, /* 0x1.0b3d603ca784f0009 */ + 1.045946142174331239262, /* 0x1.0bc3205a042060000 */ + 1.047991002016745332165, /* 0x1.0c4923682a086fffe */ + 1.050039859627715177527, /* 0x1.0ccf698898f3a000d */ + 1.052092722826109660856, /* 0x1.0d55f2dce5d1dfffb */ + 1.054149599440827866881, /* 0x1.0ddcbf86b09a5fff6 */ + 1.056210497317612961855, /* 0x1.0e63cfa7abc97fffd */ + 1.058275424318780855142, /* 0x1.0eeb23619c146fffb */ + 1.060344388322010722446, /* 0x1.0f72bad65714bffff */ + 1.062417397220589476718, /* 0x1.0ffa9627c38d30004 */ + 1.064494458915699715017, /* 0x1.1082b577d0eef0003 */ + 1.066575581342167566880, /* 0x1.110b18e893a90000a */ + 1.068660772440545025953, /* 0x1.1193c09c267610006 */ + 1.070750040138235936705, /* 0x1.121cacb4959befff6 */ + 1.072843392435016474095, /* 0x1.12a5dd543cf36ffff */ + 1.074940837302467588937, /* 0x1.132f529d59552000b */ + 1.077042382749654914030, /* 0x1.13b90cb250d08fff5 */ + 1.079148036789447484528, /* 0x1.14430bb58da3dfff9 */ + 1.081257807444460983297, /* 0x1.14cd4fc984c4a000e */ + 1.083371702785017154417, /* 0x1.1557d910df9c7000e */ + 1.085489730853784307038, /* 0x1.15e2a7ae292d30002 */ + 1.087611899742884524772, /* 0x1.166dbbc422d8c0004 */ + 1.089738217537583819804, /* 0x1.16f9157586772ffff */ + 1.091868692357631731528, /* 0x1.1784b4e533cacfff0 */ + 1.094003332327482702577, /* 0x1.18109a360fc23fff2 */ + 1.096142145591650907149, /* 0x1.189cc58b155a70008 */ + 1.098285140311341168136, /* 0x1.1929370751ea50002 */ + 1.100432324652149906842, /* 0x1.19b5eecdd79cefff0 */ + 1.102583706811727015711, /* 0x1.1a42ed01dbdba000e */ + 1.104739294993289488947, /* 0x1.1ad031c69a2eafff0 */ + 1.106899097422573863281, /* 0x1.1b5dbd3f66e120003 */ + 1.109063122341542140286, /* 0x1.1beb8f8fa8150000b */ + 1.111231377994659874592, /* 0x1.1c79a8dac6ad0fff4 */ + 1.113403872669181282605, /* 0x1.1d0809445a97ffffc */ + 1.115580614653132185460, /* 0x1.1d96b0effc9db000e */ + 1.117761612217810673898, /* 0x1.1e25a001332190000 */ + 1.119946873713312474002, /* 0x1.1eb4d69bdb2a9fff1 */ + 1.122136407473298902480, /* 0x1.1f4454e3bfae00006 */ + 1.124330221845670330058, /* 0x1.1fd41afcbb48bfff8 */ + 1.126528325196519908506, /* 0x1.2064290abc98c0001 */ + 1.128730725913251964394, /* 0x1.20f47f31c9aa7000f */ + 1.130937432396844410880, /* 0x1.21851d95f776dfff0 */ + 1.133148453059692917203, /* 0x1.2216045b6784efffa */ + 1.135363796355857157764, /* 0x1.22a733a6692ae0004 */ + 1.137583470716100553249, /* 0x1.2338ab9b3221a0004 */ + 1.139807484614418608939, /* 0x1.23ca6c5e27aadfff7 */ + 1.142035846532929888057, /* 0x1.245c7613b7f6c0004 */ + 1.144268564977221958089, /* 0x1.24eec8e06b035000c */ + 1.146505648458203463465, /* 0x1.258164e8cea85fff8 */ + 1.148747105501412235671, /* 0x1.26144a5180d380009 */ + 1.150992944689175123667, /* 0x1.26a7793f5de2efffa */ + 1.153243174560058870217, /* 0x1.273af1d712179000d */ + 1.155497803703682491111, /* 0x1.27ceb43d81d42fff1 */ + 1.157756840726344771440, /* 0x1.2862c097a3d29000c */ + 1.160020294239811677834, /* 0x1.28f7170a74cf4fff1 */ + 1.162288172883275239058, /* 0x1.298bb7bb0faed0004 */ + 1.164560485298402170388, /* 0x1.2a20a2ce920dffff4 */ + 1.166837240167474476460, /* 0x1.2ab5d86a4631ffff6 */ + 1.169118446164539637555, /* 0x1.2b4b58b36d5220009 */ + 1.171404112007080167155, /* 0x1.2be123cf786790002 */ + 1.173694246390975415341, /* 0x1.2c7739e3c0aac000d */ + 1.175988858069749065617, /* 0x1.2d0d9b15deb58fff6 */ + 1.178287955789017793514, /* 0x1.2da4478b627040002 */ + 1.180591548323240091978, /* 0x1.2e3b3f69fb794fffc */ + 1.182899644456603782686, /* 0x1.2ed282d76421d0004 */ + 1.185212252993012693694, /* 0x1.2f6a11f96c685fff3 */ + 1.187529382762033236513, /* 0x1.3001ecf60082ffffa */ + 1.189851042595508889847, /* 0x1.309a13f30f28a0004 */ + 1.192177241354644978669, /* 0x1.31328716a758cfff7 */ + 1.194507987909589896687, /* 0x1.31cb4686e1e85fffb */ + 1.196843291137896336843, /* 0x1.32645269dfd04000a */ + 1.199183159977805113226, /* 0x1.32fdaae604c39000f */ + 1.201527603343041317132, /* 0x1.339750219980dfff3 */ + 1.203876630171082595692, /* 0x1.3431424300e480007 */ + 1.206230249419600664189, /* 0x1.34cb8170b3fee000e */ + 1.208588470077065268869, /* 0x1.35660dd14dbd4fffc */ + 1.210951301134513435915, /* 0x1.3600e78b6bdfc0005 */ + 1.213318751604272271958, /* 0x1.369c0ec5c38ebfff2 */ + 1.215690830512196507537, /* 0x1.373783a718d29000f */ + 1.218067546930756250870, /* 0x1.37d3465662f480007 */ + 1.220448909901335365929, /* 0x1.386f56fa770fe0008 */ + 1.222834928513994334780, /* 0x1.390bb5ba5fc540004 */ + 1.225225611877684750397, /* 0x1.39a862bd3c7a8fff3 */ + 1.227620969111500981433, /* 0x1.3a455e2a37bcafffd */ + 1.230021009336254911271, /* 0x1.3ae2a8287dfbefff6 */ + 1.232425741726685064472, /* 0x1.3b8040df76f39fffa */ + 1.234835175450728295084, /* 0x1.3c1e287682e48fff1 */ + 1.237249319699482263931, /* 0x1.3cbc5f151b86bfff8 */ + 1.239668183679933477545, /* 0x1.3d5ae4e2cc0a8000f */ + 1.242091776620540377629, /* 0x1.3df9ba07373bf0006 */ + 1.244520107762172811399, /* 0x1.3e98deaa0d8cafffe */ + 1.246953186383919165383, /* 0x1.3f3852f32973efff0 */ + 1.249391019292643401078, /* 0x1.3fd816ffc72b90001 */ + 1.251833623164381181797, /* 0x1.40782b17863250005 */ + 1.254280999953110153911, /* 0x1.41188f42caf400000 */ + 1.256733161434815393410, /* 0x1.41b943b42945bfffd */ + 1.259190116985283935980, /* 0x1.425a4893e5f10000a */ + 1.261651875958665236542, /* 0x1.42fb9e0a2df4c0009 */ + 1.264118447754797758244, /* 0x1.439d443f608c4fff9 */ + 1.266589841787181258708, /* 0x1.443f3b5bebf850008 */ + 1.269066067469190262045, /* 0x1.44e183883e561fff7 */ + 1.271547134259576328224, /* 0x1.45841cecf7a7a0001 */ + 1.274033051628237434048, /* 0x1.462707b2c43020009 */ + 1.276523829025464573684, /* 0x1.46ca44023aa410007 */ + 1.279019475999373156531, /* 0x1.476dd2045d46ffff0 */ + 1.281520002043128991825, /* 0x1.4811b1e1f1f19000b */ + 1.284025416692967214122, /* 0x1.48b5e3c3edd74fff4 */ + 1.286535729509738823464, /* 0x1.495a67d3613c8fff7 */ + 1.289050950070396384145, /* 0x1.49ff3e396e19d000b */ + 1.291571087985403654081, /* 0x1.4aa4671f5b401fff1 */ + 1.294096152842774794011, /* 0x1.4b49e2ae56d19000d */ + 1.296626154297237043484, /* 0x1.4befb10fd84a3fff4 */ + 1.299161101984141142272, /* 0x1.4c95d26d41d84fff8 */ + 1.301701005575179204100, /* 0x1.4d3c46f01d9f0fff3 */ + 1.304245874766450485904, /* 0x1.4de30ec21097d0003 */ + 1.306795719266019562007, /* 0x1.4e8a2a0ccce3d0002 */ + 1.309350548792467483458, /* 0x1.4f3198fa10346fff5 */ + 1.311910373099227200545, /* 0x1.4fd95bb3be8cffffd */ + 1.314475201942565174546, /* 0x1.50817263bf0e5fffb */ + 1.317045045107389400535, /* 0x1.5129dd3418575000e */ + 1.319619912422941299109, /* 0x1.51d29c4f01c54ffff */ + 1.322199813675649204855, /* 0x1.527bafde83a310009 */ + 1.324784758729532718739, /* 0x1.5325180cfb8b3fffd */ + 1.327374757430096474625, /* 0x1.53ced504b2bd0fff4 */ + 1.329969819671041886272, /* 0x1.5478e6f02775e0001 */ + 1.332569955346704748651, /* 0x1.55234df9d8a59fff8 */ + 1.335175174370685002822, /* 0x1.55ce0a4c5a6a9fff6 */ + 1.337785486688218616860, /* 0x1.56791c1263abefff7 */ + 1.340400902247843806217, /* 0x1.57248376aef21fffa */ + 1.343021431036279800211, /* 0x1.57d040a420c0bfff3 */ + 1.345647083048053138662, /* 0x1.587c53c5a630f0002 */ + 1.348277868295411074918, /* 0x1.5928bd063fd7bfff9 */ + 1.350913796821875845231, /* 0x1.59d57c9110ad60006 */ + 1.353554878672557082439, /* 0x1.5a8292913d68cfffc */ + 1.356201123929036356254, /* 0x1.5b2fff3212db00007 */ + 1.358852542671913132777, /* 0x1.5bddc29edcc06fff3 */ + 1.361509145047255398051, /* 0x1.5c8bdd032ed16000f */ + 1.364170941142184734180, /* 0x1.5d3a4e8a5bf61fff4 */ + 1.366837941171020309735, /* 0x1.5de9176042f1effff */ + 1.369510155261156381121, /* 0x1.5e9837b062f4e0005 */ + 1.372187593620959988833, /* 0x1.5f47afa69436cfff1 */ + 1.374870266463378287715, /* 0x1.5ff77f6eb3f8cfffd */ + 1.377558184010425845733, /* 0x1.60a7a734a9742fff9 */ + 1.380251356531521533853, /* 0x1.6158272490016000c */ + 1.382949794301995272203, /* 0x1.6208ff6a8978a000f */ + 1.385653507605306700170, /* 0x1.62ba3032c0a280004 */ + 1.388362506772382154503, /* 0x1.636bb9a994784000f */ + 1.391076802081129493127, /* 0x1.641d9bfb29a7bfff6 */ + 1.393796403973427855412, /* 0x1.64cfd7545928b0002 */ + 1.396521322756352656542, /* 0x1.65826be167badfff8 */ + 1.399251568859207761660, /* 0x1.663559cf20826000c */ + 1.401987152677323100733, /* 0x1.66e8a14a29486fffc */ + 1.404728084651919228815, /* 0x1.679c427f5a4b6000b */ + 1.407474375243217723560, /* 0x1.68503d9ba0add000f */ + 1.410226034922914983815, /* 0x1.690492cbf6303fff9 */ + 1.412983074197955213304, /* 0x1.69b9423d7b548fff6 */ +}; diff --git a/libgcc-math/dbl-64/t_exp2.h b/libgcc-math/dbl-64/t_exp2.h new file mode 100644 index 00000000000..1fd73338cf3 --- /dev/null +++ b/libgcc-math/dbl-64/t_exp2.h @@ -0,0 +1,585 @@ +/* These values are accurate to 52+12 bits when represented as + a double. */ +static const double exp2_accuratetable[512] = { +0.707106781187802013759 /* 0x0.b504f333fb3f80007 */, +0.708064712808760599040 /* 0x0.b543baa0f71b38000 */, +0.709023942160304065938 /* 0x0.b58297d3a8d518002 */, +0.709984470998547667624 /* 0x0.b5c18ad39b4ba0001 */, +0.710946301084324217006 /* 0x0.b60093a85e8d30001 */, +0.711909434180505784637 /* 0x0.b63fb25984e628005 */, +0.712873872052760648733 /* 0x0.b67ee6eea3b5f8003 */, +0.713839616467838999908 /* 0x0.b6be316f518c98001 */, +0.714806669195984345523 /* 0x0.b6fd91e328d148007 */, +0.715775032009894562898 /* 0x0.b73d0851c69e20002 */, +0.716744706683768884058 /* 0x0.b77c94c2c9b3d0003 */, +0.717715694995770148178 /* 0x0.b7bc373dd52eb0003 */, +0.718687998724665488852 /* 0x0.b7fbefca8cd530004 */, +0.719661619652575468291 /* 0x0.b83bbe70981da8001 */, +0.720636559564428180758 /* 0x0.b87ba337a194b0006 */, +0.721612820246623098989 /* 0x0.b8bb9e27556508004 */, +0.722590403488338473025 /* 0x0.b8fbaf4762c798006 */, +0.723569311081411870036 /* 0x0.b93bd69f7be1d0000 */, +0.724549544820974333906 /* 0x0.b97c1437567828007 */, +0.725531106502312561633 /* 0x0.b9bc6816a87ae8002 */, +0.726513997924421062181 /* 0x0.b9fcd2452bee00000 */, +0.727498220889519875430 /* 0x0.ba3d52ca9e6148002 */, +0.728483777200401694265 /* 0x0.ba7de9aebe05c8003 */, +0.729470668664712662563 /* 0x0.babe96f94e62a8002 */, +0.730458897090379144517 /* 0x0.baff5ab2134df0004 */, +0.731448464287988597833 /* 0x0.bb4034e0d38ab0000 */, +0.732439372072965166897 /* 0x0.bb81258d5b2d60001 */, +0.733431622260458326859 /* 0x0.bbc22cbf75fd28001 */, +0.734425216668725511232 /* 0x0.bc034a7ef32c00001 */, +0.735420157118880535324 /* 0x0.bc447ed3a50fe0005 */, +0.736416445434497690674 /* 0x0.bc85c9c560b350001 */, +0.737414083433310718618 /* 0x0.bcc72b5bf4b4e0000 */, +0.738413072966152328496 /* 0x0.bd08a39f5417a8007 */, +0.739413415848264365956 /* 0x0.bd4a32974abcd0002 */, +0.740415113911250699637 /* 0x0.bd8bd84bb68300002 */, +0.741418168994518067562 /* 0x0.bdcd94c47ddd30003 */, +0.742422582936659858376 /* 0x0.be0f6809865968006 */, +0.743428357577745613238 /* 0x0.be515222b72530003 */, +0.744435494762383687126 /* 0x0.be935317fc6ba0002 */, +0.745443996335090397492 /* 0x0.bed56af1423de8001 */, +0.746453864145572798553 /* 0x0.bf1799b67a6248007 */, +0.747465100043933849969 /* 0x0.bf59df6f970e70002 */, +0.748477705883256683178 /* 0x0.bf9c3c248dbee8001 */, +0.749491683518965001732 /* 0x0.bfdeafdd568308000 */, +0.750507034813367890373 /* 0x0.c0213aa1f0fc38004 */, +0.751523761622240105153 /* 0x0.c063dc7a559ca0003 */, +0.752541865811731880422 /* 0x0.c0a6956e883ed8000 */, +0.753561349247157341600 /* 0x0.c0e965868bd220006 */, +0.754582213796583967110 /* 0x0.c12c4cca664cb8002 */, +0.755604461332336940791 /* 0x0.c16f4b42225350006 */, +0.756628093726406381068 /* 0x0.c1b260f5ca2c48002 */, +0.757653112855631305506 /* 0x0.c1f58ded6d72d8001 */, +0.758679520599333412360 /* 0x0.c238d2311e7d08001 */, +0.759707318837184453227 /* 0x0.c27c2dc8f00368005 */, +0.760736509456435783249 /* 0x0.c2bfa0bcfd1400000 */, +0.761767094336480043995 /* 0x0.c3032b155818d0000 */, +0.762799075372231349951 /* 0x0.c346ccda248cc0001 */, +0.763832454453522768941 /* 0x0.c38a8613805488005 */, +0.764867233473625618441 /* 0x0.c3ce56c98d1ca8005 */, +0.765903414329434539816 /* 0x0.c4123f04708d80002 */, +0.766940998920452976510 /* 0x0.c4563ecc532dc0001 */, +0.767979989148100838946 /* 0x0.c49a56295f9f88006 */, +0.769020386915772125040 /* 0x0.c4de8523c2b0a0001 */, +0.770062194131770905170 /* 0x0.c522cbc3ae94e0003 */, +0.771105412703856241146 /* 0x0.c5672a1154e6b8004 */, +0.772150044545352520777 /* 0x0.c5aba014ed5f18003 */, +0.773196091570364285606 /* 0x0.c5f02dd6b09288003 */, +0.774243555696622731700 /* 0x0.c634d35edb1260003 */, +0.775292438842697939641 /* 0x0.c67990b5aa5c18004 */, +0.776342742931542928455 /* 0x0.c6be65e360bed8000 */, +0.777394469888802008854 /* 0x0.c70352f0437f50004 */, +0.778447621641124243320 /* 0x0.c74857e498fd00006 */, +0.779502200118583399303 /* 0x0.c78d74c8ab5b60000 */, +0.780558207255445668515 /* 0x0.c7d2a9a4c959f8000 */, +0.781615644985491186966 /* 0x0.c817f681412f80002 */, +0.782674515247667956808 /* 0x0.c85d5b6666c150006 */, +0.783734819983036512536 /* 0x0.c8a2d85c904760003 */, +0.784796561133562109454 /* 0x0.c8e86d6c14f850002 */, +0.785859740645942328471 /* 0x0.c92e1a9d513ec8002 */, +0.786924360469767103536 /* 0x0.c973dff8a4b390007 */, +0.787990422552312885808 /* 0x0.c9b9bd866c6440007 */, +0.789057928854407064640 /* 0x0.c9ffb34f1444b0001 */, +0.790126881326406182996 /* 0x0.ca45c15afcc570001 */, +0.791197281930050233534 /* 0x0.ca8be7b292db38000 */, +0.792269132620954885659 /* 0x0.cad2265e3cbee8000 */, +0.793342435380726906957 /* 0x0.cb187d667d3d38006 */, +0.794417192158282659010 /* 0x0.cb5eecd3b33158006 */, +0.795493404931386649540 /* 0x0.cba574ae5d2e80001 */, +0.796571075671306805268 /* 0x0.cbec14fef2a348004 */, +0.797650206352955137846 /* 0x0.cc32cdcdef0000000 */, +0.798730798954342069432 /* 0x0.cc799f23d11d18000 */, +0.799812855456121796232 /* 0x0.ccc089091abb28004 */, +0.800896377841454287795 /* 0x0.cd078b86505c18003 */, +0.801981368096190028208 /* 0x0.cd4ea6a3f97720007 */, +0.803067828208752554378 /* 0x0.cd95da6aa057b8007 */, +0.804155760170129796375 /* 0x0.cddd26e2d21b28001 */, +0.805245165974338261710 /* 0x0.ce248c151f3330001 */, +0.806336047619038653883 /* 0x0.ce6c0a0a1c1350001 */, +0.807428407102107836855 /* 0x0.ceb3a0ca5d6be0006 */, +0.808522246427078927792 /* 0x0.cefb505e7e2550007 */, +0.809617567597010201484 /* 0x0.cf4318cf18a268002 */, +0.810714372621179513182 /* 0x0.cf8afa24ce1c98004 */, +0.811812663508675536069 /* 0x0.cfd2f4683f9810005 */, +0.812912442272482604912 /* 0x0.d01b07a2126188003 */, +0.814013710929394895825 /* 0x0.d06333daeff618001 */, +0.815116471495287542325 /* 0x0.d0ab791b80d028006 */, +0.816220725993571205593 /* 0x0.d0f3d76c75b330000 */, +0.817326476447408967199 /* 0x0.d13c4ed67f1cf8000 */, +0.818433724883006474832 /* 0x0.d184df6250e3b0001 */, +0.819542473330909460055 /* 0x0.d1cd8918a3a328004 */, +0.820652723822034690935 /* 0x0.d2164c02305fa0002 */, +0.821764478391968422618 /* 0x0.d25f2827b53fb0005 */, +0.822877739077315761840 /* 0x0.d2a81d91f188b8000 */, +0.823992507918612782109 /* 0x0.d2f12c49a8d290005 */, +0.825108786960634610365 /* 0x0.d33a5457a35e40003 */, +0.826226578247117093869 /* 0x0.d38395c4a84848007 */, +0.827345883828319528258 /* 0x0.d3ccf09985d958004 */, +0.828466705754248966560 /* 0x0.d41664df0a1320005 */, +0.829589046080638992111 /* 0x0.d45ff29e094330000 */, +0.830712906863802391671 /* 0x0.d4a999df585a20005 */, +0.831838290163696481037 /* 0x0.d4f35aabd04a60006 */, +0.832965198041969556729 /* 0x0.d53d350c4be258002 */, +0.834093632565442222342 /* 0x0.d5872909aba050007 */, +0.835223595802037643865 /* 0x0.d5d136acd138e8006 */, +0.836355089820669306292 /* 0x0.d61b5dfe9f7780004 */, +0.837488116698010487424 /* 0x0.d6659f0801afa8005 */, +0.838622678508982644113 /* 0x0.d6aff9d1e147d8004 */, +0.839758777333464490056 /* 0x0.d6fa6e652d19e0000 */, +0.840896415254110962690 /* 0x0.d744fccad70d00003 */, +0.842035594355151628676 /* 0x0.d78fa50bd2c3b0000 */, +0.843176316724478125433 /* 0x0.d7da673117e730007 */, +0.844318584453106590905 /* 0x0.d8254343a19038003 */, +0.845462399634695271912 /* 0x0.d870394c6dbf30003 */, +0.846607764365415071965 /* 0x0.d8bb49547d37c0004 */, +0.847754680744707056494 /* 0x0.d9067364d45608003 */, +0.848903150873708822763 /* 0x0.d951b7867953b0006 */, +0.850053176859071113491 /* 0x0.d99d15c2787a30006 */, +0.851204760807439786431 /* 0x0.d9e88e21de11a0003 */, +0.852357904828824897169 /* 0x0.da3420adba1508003 */, +0.853512611037803181642 /* 0x0.da7fcd6f2184d8005 */, +0.854668881550406100980 /* 0x0.dacb946f2afaf8000 */, +0.855826718478671755185 /* 0x0.db1775b6e8ad48000 */, +0.856986123964844970247 /* 0x0.db63714f8e0818006 */, +0.858147100114499461478 /* 0x0.dbaf87422625b8000 */, +0.859309649060962410524 /* 0x0.dbfbb797daa460002 */, +0.860473772936213743282 /* 0x0.dc480259d3a710001 */, +0.861639473872910177676 /* 0x0.dc9467913a0f48006 */, +0.862806754008130227807 /* 0x0.dce0e7473b9b28003 */, +0.863975615481124226159 /* 0x0.dd2d8185086c20006 */, +0.865146060433749419813 /* 0x0.dd7a3653d38168005 */, +0.866318091005120138881 /* 0x0.ddc705bcccd628000 */, +0.867491709362415264210 /* 0x0.de13efc9434100004 */, +0.868666917636779056818 /* 0x0.de60f4825df9b8005 */, +0.869843717989716047624 /* 0x0.deae13f16599c0003 */, +0.871022112578215268471 /* 0x0.defb4e1f9dc388002 */, +0.872202103559697183859 /* 0x0.df48a3164a92f0001 */, +0.873383693097737778847 /* 0x0.df9612deb6e878007 */, +0.874566883362160263365 /* 0x0.dfe39d82348310001 */, +0.875751676517234511901 /* 0x0.e031430a0f0688000 */, +0.876938074732511840819 /* 0x0.e07f037f97e548001 */, +0.878126080186539592654 /* 0x0.e0ccdeec2a75e0006 */, +0.879315695055312818168 /* 0x0.e11ad5591f4078001 */, +0.880506921518618312932 /* 0x0.e168e6cfd2f880004 */, +0.881699761760385225541 /* 0x0.e1b71359a6df60003 */, +0.882894217964411143207 /* 0x0.e2055afffc1178000 */, +0.884090292325693805080 /* 0x0.e253bdcc3ffbb8001 */, +0.885287987031581180559 /* 0x0.e2a23bc7d7a1d8002 */, +0.886487304278189114386 /* 0x0.e2f0d4fc31ab80004 */, +0.887688246263368285778 /* 0x0.e33f8972bea8a8005 */, +0.888890815189881999840 /* 0x0.e38e5934f49010007 */, +0.890095013257492739835 /* 0x0.e3dd444c460bd0007 */, +0.891300842677948068626 /* 0x0.e42c4ac232f380000 */, +0.892508305659222567226 /* 0x0.e47b6ca036f8b8005 */, +0.893717404414979710310 /* 0x0.e4caa9efd40e58002 */, +0.894928141160697743242 /* 0x0.e51a02ba8e2610007 */, +0.896140518115016826430 /* 0x0.e5697709ecab90000 */, +0.897354537501434679237 /* 0x0.e5b906e77c61d0006 */, +0.898570201543732793877 /* 0x0.e608b25cca5ba8005 */, +0.899787512470129891014 /* 0x0.e6587973688ce8002 */, +0.901006472512270728537 /* 0x0.e6a85c34ecadb8000 */, +0.902227083902570559127 /* 0x0.e6f85aaaed4f20006 */, +0.903449348881299796343 /* 0x0.e74874df09a530003 */, +0.904673269686823378091 /* 0x0.e798aadadecba0007 */, +0.905898848559668845585 /* 0x0.e7e8fca80c3ee0001 */, +0.907126087750156795426 /* 0x0.e8396a503c3fe0005 */, +0.908354989505901100354 /* 0x0.e889f3dd1615b0002 */, +0.909585556079328783087 /* 0x0.e8da9958465228007 */, +0.910817789726044213523 /* 0x0.e92b5acb7d0578001 */, +0.912051692703457872481 /* 0x0.e97c38406c3c30003 */, +0.913287267274154990210 /* 0x0.e9cd31c0cbb370001 */, +0.914524515702244578108 /* 0x0.ea1e475654d540000 */, +0.915763440256158633982 /* 0x0.ea6f790ac5cc78001 */, +0.917004043205012497909 /* 0x0.eac0c6e7dd8448007 */, +0.918246326823137892807 /* 0x0.eb1230f760a428007 */, +0.919490293387826285200 /* 0x0.eb63b7431714a8007 */, +0.920735945178816406225 /* 0x0.ebb559d4cb6f30007 */, +0.921983284479243714322 /* 0x0.ec0718b64c0940002 */, +0.923232313574974705626 /* 0x0.ec58f3f16a3910002 */, +0.924483034755387955725 /* 0x0.ecaaeb8ffb3168005 */, +0.925735450311948926408 /* 0x0.ecfcff9bd67078000 */, +0.926989562542820610982 /* 0x0.ed4f301edad1a0007 */, +0.928245373740515189457 /* 0x0.eda17d22e0f9b0001 */, +0.929502886213858126045 /* 0x0.edf3e6b1d37d40001 */, +0.930762102264245716494 /* 0x0.ee466cd594c5c8005 */, +0.932023024199046146183 /* 0x0.ee990f980dcdb0005 */, +0.933285654329454095216 /* 0x0.eeebcf032bc470007 */, +0.934549994971191289044 /* 0x0.ef3eab20e0d3c0001 */, +0.935816048439005676599 /* 0x0.ef91a3fb1e1340004 */, +0.937083817055075818404 /* 0x0.efe4b99bdcc618006 */, +0.938353303143720007819 /* 0x0.f037ec0d1889b8000 */, +0.939624509028518128972 /* 0x0.f08b3b58cc2bb8006 */, +0.940897437041863904384 /* 0x0.f0dea788fc2a90000 */, +0.942172089516254085427 /* 0x0.f13230a7ad21b8003 */, +0.943448468787511540534 /* 0x0.f185d6bee754e0006 */, +0.944726577195256100890 /* 0x0.f1d999d8b73478005 */, +0.946006417082291717338 /* 0x0.f22d79ff2cb130000 */, +0.947287990793413858827 /* 0x0.f281773c59ec48007 */, +0.948571300678290207925 /* 0x0.f2d5919a566268001 */, +0.949856349088629370320 /* 0x0.f329c9233bceb0001 */, +0.951143138379053731954 /* 0x0.f37e1de1272068002 */, +0.952431670908847949364 /* 0x0.f3d28fde3a6728006 */, +0.953721949039916472305 /* 0x0.f4271f249a93f0001 */, +0.955013975135367898520 /* 0x0.f47bcbbe6deab0001 */, +0.956307751564417496418 /* 0x0.f4d095b5e16638004 */, +0.957603280698967163097 /* 0x0.f5257d1524f590006 */, +0.958900564911197350604 /* 0x0.f57a81e668d628000 */, +0.960199606581278120057 /* 0x0.f5cfa433e60e50007 */, +0.961500408088936442422 /* 0x0.f624e407d527a0007 */, +0.962802971817578789903 /* 0x0.f67a416c72b760006 */, +0.964107300155846558292 /* 0x0.f6cfbc6c011458004 */, +0.965413395493874504368 /* 0x0.f7255510c439a8002 */, +0.966721260225105960572 /* 0x0.f77b0b6503c5b8006 */, +0.968030896745834645873 /* 0x0.f7d0df730a7940005 */, +0.969342307458006424716 /* 0x0.f826d145294be8003 */, +0.970655494764855020231 /* 0x0.f87ce0e5b29fd8000 */, +0.971970461071268720958 /* 0x0.f8d30e5efaa8f0004 */, +0.973287208789983648852 /* 0x0.f92959bb5e3c08001 */, +0.974605740331924708124 /* 0x0.f97fc305383028004 */, +0.975926058115625383329 /* 0x0.f9d64a46ebb9f8004 */, +0.977248164559556209435 /* 0x0.fa2cef8adbfc68004 */, +0.978572062087848637573 /* 0x0.fa83b2db7253d0007 */, +0.979897753126343307191 /* 0x0.fada944319fda0005 */, +0.981225240104636631254 /* 0x0.fb3193cc425870002 */, +0.982554525455618277276 /* 0x0.fb88b1815e61d0003 */, +0.983885611617111077747 /* 0x0.fbdfed6ce683e0007 */, +0.985218501026348891812 /* 0x0.fc3747995282f8006 */, +0.986553196127724962867 /* 0x0.fc8ec0112202a0005 */, +0.987889699367056062238 /* 0x0.fce656ded63710002 */, +0.989228013193998778636 /* 0x0.fd3e0c0cf48d50005 */, +0.990568140061241164686 /* 0x0.fd95dfa605c7b0003 */, +0.991910082424819927754 /* 0x0.fdedd1b4965710004 */, +0.993253842749249660216 /* 0x0.fe45e2433bfea0000 */, +0.994599423484053835071 /* 0x0.fe9e115c7c05f0005 */, +0.995946827107488830167 /* 0x0.fef65f0afb4c28006 */, +0.997296056085008264529 /* 0x0.ff4ecb59509cc8001 */, +0.998647112892057764479 /* 0x0.ffa756521dbfd0007 */, +1.000000000000000000000 /* 0x1.00000000000000000 */, +1.001354719891689004659 /* 0x1.0058c86da14aa0005 */, +1.002711275050312211844 /* 0x1.00b1afa5abead0003 */, +1.004069667960743483835 /* 0x1.010ab5b2cc0660009 */, +1.005429901112333324093 /* 0x1.0163da9fb2af30008 */, +1.006791976999887428009 /* 0x1.01bd1e7716f6a0008 */, +1.008155898118476168101 /* 0x1.02168143b03890006 */, +1.009521666967782227439 /* 0x1.027003103ae320002 */, +1.010889286051850133326 /* 0x1.02c9a3e7783030002 */, +1.012258757875921233497 /* 0x1.032363d42aaa8000e */, +1.013630084952214405194 /* 0x1.037d42e11c88d0000 */, +1.015003269791313389451 /* 0x1.03d741191635a0001 */, +1.016378314911229763267 /* 0x1.04315e86e84630008 */, +1.017755222831652872635 /* 0x1.048b9b35652800002 */, +1.019133996077934645224 /* 0x1.04e5f72f65827000b */, +1.020514637175266248212 /* 0x1.0540727fc1cfa0006 */, +1.021897148653734488385 /* 0x1.059b0d3157ebb0002 */, +1.023281533050062419584 /* 0x1.05f5c74f0cfeb0002 */, +1.024667792897328677539 /* 0x1.0650a0e3c22ee0003 */, +1.026055930738840826806 /* 0x1.06ab99fa63e1b0008 */, +1.027445949118511947550 /* 0x1.0706b29ddf2700009 */, +1.028837850584049418178 /* 0x1.0761ead9253ab0009 */, +1.030231637685799839262 /* 0x1.07bd42b72a3f80008 */, +1.031627312979383592802 /* 0x1.0818ba42e824a000c */, +1.033024879021186448496 /* 0x1.0874518759b0b0008 */, +1.034424338374263729911 /* 0x1.08d0088f80ffa0006 */, +1.035825693601787333992 /* 0x1.092bdf66604e30005 */, +1.037228947273990842283 /* 0x1.0987d617019cd000a */, +1.038634101961269928846 /* 0x1.09e3ecac6f199000f */, +1.040041160239590700707 /* 0x1.0a402331b91270002 */, +1.041450124688240164200 /* 0x1.0a9c79b1f37c3000b */, +1.042860997889083929381 /* 0x1.0af8f038352160000 */, +1.044273782427270314011 /* 0x1.0b5586cf986890006 */, +1.045688480893644856116 /* 0x1.0bb23d833dfbf0006 */, +1.047105095879385272564 /* 0x1.0c0f145e46e330007 */, +1.048523629981608529302 /* 0x1.0c6c0b6bdaadc000f */, +1.049944085800634585634 /* 0x1.0cc922b72470a000f */, +1.051366465939483019223 /* 0x1.0d265a4b5238b0007 */, +1.052790773004648849929 /* 0x1.0d83b23395e510002 */, +1.054217009607077093512 /* 0x1.0de12a7b263970006 */, +1.055645178360430591625 /* 0x1.0e3ec32d3cf680000 */, +1.057075281882416506511 /* 0x1.0e9c7c55184f5000e */, +1.058507322794714378170 /* 0x1.0efa55fdfad51000a */, +1.059941303721639416236 /* 0x1.0f58503329fed0003 */, +1.061377227289284297385 /* 0x1.0fb66affed37f0000 */, +1.062815096132297298980 /* 0x1.1014a66f95540000c */, +1.064254912884593951029 /* 0x1.1073028d725850007 */, +1.065696680185205469411 /* 0x1.10d17f64d9ea2000b */, +1.067140400676658718053 /* 0x1.11301d012586a0007 */, +1.068586077004890055886 /* 0x1.118edb6db26ab0003 */, +1.070033711820396415998 /* 0x1.11edbab5e2d6e000b */, +1.071483307775789262099 /* 0x1.124cbae51b5ef0001 */, +1.072934867526001312439 /* 0x1.12abdc06c3240000c */, +1.074388393734249103080 /* 0x1.130b1e264a62e0005 */, +1.075843889063253344684 /* 0x1.136a814f20ccd0003 */, +1.077301356179926061823 /* 0x1.13ca058cbaaed000b */, +1.078760797756675327056 /* 0x1.1429aaea9260e000e */, +1.080222216468626150775 /* 0x1.148971742537c0009 */, +1.081685614993597610617 /* 0x1.14e95934f37e8000b */, +1.083150996013011013776 /* 0x1.1549623881762000d */, +1.084618362213087383633 /* 0x1.15a98c8a58a6a000b */, +1.086087716284427351384 /* 0x1.1609d8360768c0008 */, +1.087559060917626885283 /* 0x1.166a45471c13f0008 */, +1.089032398810997337465 /* 0x1.16cad3c92d7b50009 */, +1.090507732647478578212 /* 0x1.172b83c7c18b5000f */, +1.091985065182095926460 /* 0x1.178c554ead72a000c */, +1.093464399073070136880 /* 0x1.17ed48695befe000c */, +1.094945737045367906172 /* 0x1.184e5d23812500007 */, +1.096429081816546080591 /* 0x1.18af9388c90e40005 */, +1.097914436104650892651 /* 0x1.1910eba4e031a0001 */, +1.099401802629782043408 /* 0x1.19726583755720003 */, +1.100891184121537858001 /* 0x1.19d4013041b860007 */, +1.102382583308144647940 /* 0x1.1a35beb6fd0cd0007 */, +1.103876002922312915544 /* 0x1.1a979e2363fa10000 */, +1.105371445702084232160 /* 0x1.1af99f8139025000e */, +1.106868914387219016199 /* 0x1.1b5bc2dc408b9000e */, +1.108368411723785085252 /* 0x1.1bbe084045eb30002 */, +1.109869940458469095340 /* 0x1.1c206fb91524c000e */, +1.111373503344554869449 /* 0x1.1c82f952817cc0001 */, +1.112879103137133007859 /* 0x1.1ce5a51860344000f */, +1.114386742595953938610 /* 0x1.1d4873168babf000e */, +1.115896424484008608911 /* 0x1.1dab6358e1d4a000f */, +1.117408151567338414664 /* 0x1.1e0e75eb43f9c000c */, +1.118921926613465345265 /* 0x1.1e71aad995078000f */, +1.120437752409564780022 /* 0x1.1ed5022fcd8600003 */, +1.121955631720569668277 /* 0x1.1f387bf9cd88b0000 */, +1.123475567332998359439 /* 0x1.1f9c18438cdec000a */, +1.124997562033035469759 /* 0x1.1fffd71902f970002 */, +1.126521618608448571713 /* 0x1.2063b88629079000e */, +1.128047739853580200284 /* 0x1.20c7bc96ff72a0002 */, +1.129575928566289189112 /* 0x1.212be3578a81e0006 */, +1.131106187546149888259 /* 0x1.21902cd3d05f70007 */, +1.132638519598779369743 /* 0x1.21f49917ddda5000c */, +1.134172927531616359481 /* 0x1.2259282fc1c24000e */, +1.135709414157753949251 /* 0x1.22bdda27911e90007 */, +1.137247982292643566662 /* 0x1.2322af0b638e60007 */, +1.138788634756517259562 /* 0x1.2387a6e755f270000 */, +1.140331374372893558110 /* 0x1.23ecc1c788c890006 */, +1.141876203969685699176 /* 0x1.2451ffb821639000c */, +1.143423126377846266197 /* 0x1.24b760c5486dc0009 */, +1.144972144431494420774 /* 0x1.251ce4fb2a0cc0005 */, +1.146523260971646252006 /* 0x1.25828c65f9fb8000d */, +1.148076478839068270690 /* 0x1.25e85711ebaeb0000 */, +1.149631800883562204903 /* 0x1.264e450b3c8a30008 */, +1.151189229953253789786 /* 0x1.26b4565e281a20003 */, +1.152748768902654319399 /* 0x1.271a8b16f0f000002 */, +1.154310420590433317050 /* 0x1.2780e341de2fc0001 */, +1.155874187878668246681 /* 0x1.27e75eeb3abc90007 */, +1.157440073633736243899 /* 0x1.284dfe1f5633e000a */, +1.159008080725518974322 /* 0x1.28b4c0ea840d90001 */, +1.160578212048386514965 /* 0x1.291ba75932ae60000 */, +1.162150470417516290340 /* 0x1.2982b177796850008 */, +1.163724858777502646494 /* 0x1.29e9df51fdd900001 */, +1.165301379991388053320 /* 0x1.2a5130f50bf34000e */, +1.166880036952526289469 /* 0x1.2ab8a66d10fdc0008 */, +1.168460832550151540268 /* 0x1.2b203fc675b7a000a */, +1.170043769683112966389 /* 0x1.2b87fd0dad7260008 */, +1.171628851252754177681 /* 0x1.2befde4f2e3da000d */, +1.173216080163546060084 /* 0x1.2c57e397719940002 */, +1.174805459325657830448 /* 0x1.2cc00cf2f7491000c */, +1.176396991650083379037 /* 0x1.2d285a6e3ff90000b */, +1.177990680055698513602 /* 0x1.2d90cc15d4ff90005 */, +1.179586527463262646306 /* 0x1.2df961f641c57000c */, +1.181184536796979545103 /* 0x1.2e621c1c157cd000d */, +1.182784710984701836994 /* 0x1.2ecafa93e35af0004 */, +1.184387052960675701386 /* 0x1.2f33fd6a459cb0000 */, +1.185991565661414393112 /* 0x1.2f9d24abd8fd1000e */, +1.187598252026902612178 /* 0x1.300670653e083000a */, +1.189207115003001469262 /* 0x1.306fe0a31bc040008 */, +1.190818157535919796833 /* 0x1.30d9757219895000e */, +1.192431382587621380206 /* 0x1.31432edef01a1000f */, +1.194046793097208292195 /* 0x1.31ad0cf63f0630008 */, +1.195664392040319823392 /* 0x1.32170fc4ce0db000c */, +1.197284182375793593084 /* 0x1.32813757527750005 */, +1.198906167074650808198 /* 0x1.32eb83ba8eef3000f */, +1.200530349107333139048 /* 0x1.3355f4fb457e5000d */, +1.202156731453099647353 /* 0x1.33c08b2641df9000c */, +1.203785317090505513368 /* 0x1.342b46484f07b0005 */, +1.205416109005122526928 /* 0x1.3496266e3fa270005 */, +1.207049110184904572310 /* 0x1.35012ba4e8fa10000 */, +1.208684323627194912036 /* 0x1.356c55f92aabb0004 */, +1.210321752322854882437 /* 0x1.35d7a577dd33f0004 */, +1.211961399276747286580 /* 0x1.36431a2de8748000d */, +1.213603267492579629347 /* 0x1.36aeb4283309e000c */, +1.215247359985374142610 /* 0x1.371a7373b00160000 */, +1.216893679753690671322 /* 0x1.3786581d404e90000 */, +1.218542229828181611183 /* 0x1.37f26231e82e4000c */, +1.220193013225231215567 /* 0x1.385e91be9c2d20002 */, +1.221846032973555429280 /* 0x1.38cae6d05e66f0000 */, +1.223501292099485437962 /* 0x1.393761742e5830001 */, +1.225158793636904830441 /* 0x1.39a401b713cb3000e */, +1.226818540625497444577 /* 0x1.3a10c7a61ceae0007 */, +1.228480536107136034131 /* 0x1.3a7db34e5a4a50003 */, +1.230144783126481566885 /* 0x1.3aeac4bcdf8d60001 */, +1.231811284734168454619 /* 0x1.3b57fbfec6e950008 */, +1.233480043984379381835 /* 0x1.3bc559212e7a2000f */, +1.235151063936380300149 /* 0x1.3c32dc3139f2a0004 */, +1.236824347652524913647 /* 0x1.3ca0853c106ac000e */, +1.238499898199571624970 /* 0x1.3d0e544eddd240003 */, +1.240177718649636107175 /* 0x1.3d7c4976d3fcd0000 */, +1.241857812073360767273 /* 0x1.3dea64c1231f70004 */, +1.243540181554270152039 /* 0x1.3e58a63b099920005 */, +1.245224830175077013244 /* 0x1.3ec70df1c4e46000e */, +1.246911761022835740725 /* 0x1.3f359bf29741c000e */, +1.248600977188942806639 /* 0x1.3fa4504ac7b800009 */, +1.250292481770148400634 /* 0x1.40132b07a330d000a */, +1.251986277866492969263 /* 0x1.40822c367a340000b */, +1.253682368581898742876 /* 0x1.40f153e4a18e0000d */, +1.255380757024939564249 /* 0x1.4160a21f73289000d */, +1.257081446308726757662 /* 0x1.41d016f44deaa000c */, +1.258784439550028944083 /* 0x1.423fb27094c090008 */, +1.260489739869405489991 /* 0x1.42af74a1aec1c0006 */, +1.262197350394008266193 /* 0x1.431f5d950a453000c */, +1.263907274252603851764 /* 0x1.438f6d58176860004 */, +1.265619514578811388761 /* 0x1.43ffa3f84b9eb000d */, +1.267334074511444086425 /* 0x1.44700183221180008 */, +1.269050957191869555296 /* 0x1.44e0860618b930006 */, +1.270770165768063009230 /* 0x1.4551318eb4d20000e */, +1.272491703389059036805 /* 0x1.45c2042a7cc26000b */, +1.274215573211836316547 /* 0x1.4632fde6ffacd000d */, +1.275941778396075143580 /* 0x1.46a41ed1cfac40001 */, +1.277670322103555911043 /* 0x1.471566f8812ac0000 */, +1.279401207505722393185 /* 0x1.4786d668b33260005 */, +1.281134437771823675369 /* 0x1.47f86d3002637000a */, +1.282870016078732078362 /* 0x1.486a2b5c13c00000e */, +1.284607945607987078432 /* 0x1.48dc10fa916bd0004 */, +1.286348229545787758022 /* 0x1.494e1e192aaa30007 */, +1.288090871080605159846 /* 0x1.49c052c5913df000c */, +1.289835873406902644341 /* 0x1.4a32af0d7d8090002 */, +1.291583239722392528754 /* 0x1.4aa532feab5e10002 */, +1.293332973229098792374 /* 0x1.4b17dea6db8010008 */, +1.295085077135345708087 /* 0x1.4b8ab213d57d9000d */, +1.296839554650994097442 /* 0x1.4bfdad53629e10003 */, +1.298596408992440220988 /* 0x1.4c70d0735358a000d */, +1.300355643380135983739 /* 0x1.4ce41b817c99e0001 */, +1.302117261036232376282 /* 0x1.4d578e8bb52cb0003 */, +1.303881265192249561154 /* 0x1.4dcb299fde2920008 */, +1.305647659079073541490 /* 0x1.4e3eeccbd7f4c0003 */, +1.307416445934474813521 /* 0x1.4eb2d81d8a86f000b */, +1.309187629001237640529 /* 0x1.4f26eba2e35a5000e */, +1.310961211525240921493 /* 0x1.4f9b2769d35090009 */, +1.312737196755087820678 /* 0x1.500f8b804e4a30000 */, +1.314515587949291131086 /* 0x1.508417f4530d00009 */, +1.316296388365203462468 /* 0x1.50f8ccd3df1840003 */, +1.318079601265708777911 /* 0x1.516daa2cf60020002 */, +1.319865229921343141607 /* 0x1.51e2b00da3c2b0007 */, +1.321653277603506371251 /* 0x1.5257de83f5512000d */, +1.323443747588034513690 /* 0x1.52cd359dfc7d5000e */, +1.325236643161341820781 /* 0x1.5342b569d6baa000f */, +1.327031967602244177939 /* 0x1.53b85df59921b0000 */, +1.328829724206201046165 /* 0x1.542e2f4f6b17e0006 */, +1.330629916266568235675 /* 0x1.54a4298571b27000e */, +1.332432547083447937938 /* 0x1.551a4ca5d97190009 */, +1.334237619959296017340 /* 0x1.559098bed16bf0008 */, +1.336045138203900251029 /* 0x1.56070dde90c800000 */, +1.337855105129210686631 /* 0x1.567dac13510cd0009 */, +1.339667524053662184301 /* 0x1.56f4736b52e2c000c */, +1.341482398296830025383 /* 0x1.576b63f4d8333000f */, +1.343299731186792467254 /* 0x1.57e27dbe2c40e0003 */, +1.345119526053918823702 /* 0x1.5859c0d59cd37000f */, +1.346941786233264881662 /* 0x1.58d12d497cd9a0005 */, +1.348766515064854010261 /* 0x1.5948c32824b87000c */, +1.350593715891792223641 /* 0x1.59c0827ff03890007 */, +1.352423392064920459908 /* 0x1.5a386b5f43a3e0006 */, +1.354255546937278120764 /* 0x1.5ab07dd485af1000c */, +1.356090183865519494030 /* 0x1.5b28b9ee21085000f */, +1.357927306213322804534 /* 0x1.5ba11fba8816e000b */, +1.359766917346459269620 /* 0x1.5c19af482f8f2000f */, +1.361609020638567812980 /* 0x1.5c9268a594cc00004 */, +1.363453619463660171403 /* 0x1.5d0b4be135916000c */, +1.365300717204201985683 /* 0x1.5d84590998eeb0005 */, +1.367150317245710233754 /* 0x1.5dfd902d494e40001 */, +1.369002422974674892971 /* 0x1.5e76f15ad22c40008 */, +1.370857037789471544224 /* 0x1.5ef07ca0cc166000b */, +1.372714165088220639199 /* 0x1.5f6a320dcf5280006 */, +1.374573808273481745378 /* 0x1.5fe411b0790800009 */, +1.376435970755022220096 /* 0x1.605e1b976e4b1000e */, +1.378300655944092456600 /* 0x1.60d84fd155d15000e */, +1.380167867259843417228 /* 0x1.6152ae6cdf0030003 */, +1.382037608124419003675 /* 0x1.61cd3778bc879000d */, +1.383909881963391264069 /* 0x1.6247eb03a4dc40009 */, +1.385784692209972801544 /* 0x1.62c2c91c56d9b0002 */, +1.387662042298923203992 /* 0x1.633dd1d1930ec0001 */, +1.389541935670444372533 /* 0x1.63b90532200630004 */, +1.391424375772021271329 /* 0x1.6434634ccc4cc0007 */, +1.393309366052102982208 /* 0x1.64afec30677e90008 */, +1.395196909966106124701 /* 0x1.652b9febc8e0f000d */, +1.397087010973788290271 /* 0x1.65a77e8dcc7f10004 */, +1.398979672539331309267 /* 0x1.66238825534170000 */, +1.400874898129892187656 /* 0x1.669fbcc1415600008 */, +1.402772691220124823310 /* 0x1.671c1c708328e000a */, +1.404673055288671035301 /* 0x1.6798a7420988b000d */, +1.406575993818903302975 /* 0x1.68155d44ca77a000f */, +1.408481510297352468121 /* 0x1.68923e87bf70e000a */, +1.410389608216942924956 /* 0x1.690f4b19e8f74000c */, +1.412300291075172076232 /* 0x1.698c830a4c94c0008 */ +}; +#define S (1.0/4503599627370496.0) /* 2^-52 */ +static const float exp2_deltatable[512] = { + 11527*S, -963*S, 884*S, -781*S, -2363*S, -3441*S, 123*S, 526*S, + -6*S, 1254*S, -1138*S, 1519*S, 1576*S, -65*S, 1040*S, 793*S, + -1662*S, -5063*S, -387*S, 968*S, -941*S, 984*S, -2856*S, -545*S, + 495*S, -5246*S, -2109*S, 1281*S, 2075*S, 909*S, -1642*S,-78233*S, +-31653*S, -265*S, 130*S, 430*S, 2482*S, -742*S, 1616*S, -2213*S, + -519*S, 20*S, -3134*S,-13981*S, 1343*S, -1740*S, 247*S, 1679*S, + -1097*S, 3131*S, 871*S, -1480*S, 1936*S, -1827*S, 17325*S, 528*S, + -322*S, 1404*S, -152*S, -1845*S, -212*S, 2639*S, -476*S, 2960*S, + -962*S, -1012*S, -1231*S, 3030*S, 1659*S, -486*S, 2154*S, 1728*S, + -2793*S, 699*S, -1560*S, -2125*S, 2156*S, 142*S, -1888*S, 4426*S, +-13443*S, 1970*S, -50*S, 1771*S,-43399*S, 4979*S, -2448*S, -370*S, + 1414*S, 1075*S, 232*S, 206*S, 873*S, 2141*S, 2970*S, 1279*S, + -2331*S, 336*S, -2595*S, 753*S, -3384*S, -616*S, 89*S, -818*S, + 5755*S, -241*S, -528*S, -661*S, -3777*S, -354*S, 250*S, 3881*S, + 2632*S, -2131*S, 2565*S, -316*S, 1746*S, -2541*S, -1324*S, -50*S, + 2564*S, -782*S, 1176*S, 6452*S, -1002*S, 1288*S, 336*S, -185*S, + 3063*S, 3784*S, 2169*S, 686*S, 328*S, -400*S, 312*S, -4517*S, + -1457*S, 1046*S, -1530*S, -685*S, 1328*S,-49815*S, -895*S, 1063*S, + -2091*S, -672*S, -1710*S, -665*S, 1545*S, 1819*S,-45265*S, 3548*S, + -554*S, -568*S, 4752*S, -1907*S,-13738*S, 675*S, 9611*S, -1115*S, + -815*S, 408*S, -1281*S, -937*S,-16376*S, -4772*S, -1440*S, 992*S, + 788*S, 10364*S, -1602*S, -661*S, -1783*S, -265*S, -20*S, -3781*S, + -861*S, -345*S, -994*S, 1364*S, -5339*S, 1620*S, 9390*S, -1066*S, + -305*S, -170*S, 175*S, 2461*S, -490*S, -769*S, -1450*S, 3315*S, + 2418*S, -45*S, -852*S, -1295*S, -488*S, -96*S, 1142*S, -2639*S, + 7905*S, -9306*S, -3859*S, 760*S, 1057*S, -1570*S, 3977*S, 209*S, + -514*S, 7151*S, 1646*S, 627*S, 599*S, -774*S, -1468*S, 633*S, + -473*S, 851*S, 2406*S, 143*S, 74*S, 4260*S, 1177*S, -913*S, + 2670*S, -3298*S, -1662*S, -120*S, -3264*S, -2148*S, 410*S, 2078*S, + -2098*S, -926*S, 3580*S, -1289*S, 2450*S, -1158*S, 907*S, -590*S, + 986*S, 1801*S, 1145*S, -1677*S, 3455*S, 956*S, 710*S, 144*S, + 153*S, -255*S, -1898*S, 28102*S, 2748*S, 1194*S, -3009*S, 7076*S, + 0*S, -2720*S, 711*S, 1225*S, -3034*S, -473*S, 378*S, -1046*S, + 962*S, -2006*S, 4647*S, 3206*S, 1769*S, -2665*S, 1254*S, 2025*S, + -2430*S, 6193*S, 1224*S, -856*S, -1592*S, -325*S, -1521*S, 1827*S, + -264*S, 2403*S, -1065*S, 967*S, -681*S, -2106*S, -474*S, 1333*S, + -893*S, 2296*S, 592*S, -1220*S, -326*S, 990*S, 139*S, 206*S, + -779*S, -1683*S, 1238*S, 6098*S, 136*S, 1197*S, 790*S, -107*S, + -1004*S, -2449*S, 939*S, 5568*S, 156*S, 1812*S, 2792*S, -1094*S, + -2677*S, -251*S, 2297*S, 943*S, -1329*S, 2883*S, -853*S, -2626*S, +-105929*S, -6552*S, 1095*S, -1508*S, 1003*S, 5039*S, -2600*S, -749*S, + 1790*S, 890*S, 2016*S, -1073*S, 624*S, -2084*S, -1536*S, -1330*S, + 358*S, 2444*S, -179*S,-25759*S, -243*S, -552*S, -124*S, 3766*S, + 1192*S, -1614*S, 6*S, -1227*S, 345*S, -981*S, -295*S, -1006*S, + -995*S, -1195*S, 706*S, 2512*S, -1758*S, -734*S, -6286*S, -922*S, + 1530*S, 1542*S, 1223*S, 61*S, -83*S, 522*S,116937*S, -914*S, + -418*S, -7339*S, 249*S, -520*S, -762*S, 426*S, -505*S, 2664*S, + -1093*S, -1035*S, 2130*S, 4878*S, 1982*S, 1551*S, 2304*S, 193*S, + 1532*S, -7268*S, 24357*S, 531*S, 2676*S, -1170*S, 1465*S, -1917*S, + 2143*S, 1466*S, -7*S, -7300*S, 3297*S, -1197*S, -289*S, -1548*S, + 26226*S, 4401*S, 4123*S, -1588*S, 4243*S, 4069*S, -1276*S, -2010*S, + 1407*S, 1478*S, 488*S, -2366*S, -2909*S, -2534*S, -1285*S, 7095*S, + -645*S, -2089*S, -944*S, -40*S, -1363*S, -833*S, 917*S, 1609*S, + 1286*S, 1677*S, 1613*S, -2295*S, -1248*S, 40*S, 26*S, 2038*S, + 698*S, 2675*S, -1755*S, -3522*S, -1614*S, -6111*S, 270*S, 1822*S, + -234*S, -2844*S, -1201*S, -830*S, 1193*S, 2354*S, 47*S, 1522*S, + -78*S, -640*S, 2425*S, -1596*S, 1563*S, 1169*S, -1006*S, -83*S, + 2362*S, -3521*S, -314*S, 1814*S, -1751*S, 305*S, 1715*S, -3741*S, + 7847*S, 1291*S, 1206*S, 36*S, 1397*S, -1419*S, -1194*S, -2014*S, + 1742*S, -578*S, -207*S, 875*S, 1539*S, 2826*S, -1165*S, -909*S, + 1849*S, 927*S, 2018*S, -981*S, 1637*S, -463*S, 905*S, 6618*S, + 400*S, 630*S, 2614*S, 900*S, 2323*S, -1094*S, -1858*S, -212*S, + -2069*S, 747*S, 1845*S, -1450*S, 444*S, -213*S, -438*S, 1158*S, + 4738*S, 2497*S, -370*S, -2016*S, -518*S, -1160*S, -1510*S, 123*S +}; +/* Maximum magnitude in above table: 116937 */ +#undef S diff --git a/libgcc-math/dbl-64/uasncs.h b/libgcc-math/dbl-64/uasncs.h new file mode 100644 index 00000000000..69fbb58a50f --- /dev/null +++ b/libgcc-math/dbl-64/uasncs.h @@ -0,0 +1,70 @@ +/* + * IBM Accurate Mathematical Library + * Written by International Business Machines Corp. + * Copyright (C) 2001 Free Software Foundation, Inc. + * + * This program is free software; you can redistribute it and/or modify + * it under the terms of the GNU Lesser General Public License as published by + * the Free Software Foundation; either version 2.1 of the License, or + * (at your option) any later version. + * + * This program is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU Lesser General Public License for more details. + * + * You should have received a copy of the GNU Lesser General Public License + * along with this program; if not, write to the Free Software + * Foundation, Inc., 59 Temple Place - Suite 330, Boston, MA 02111-1307, USA. + */ + +/******************************************************************/ +/* */ +/* MODULE_NAME:uasncs.h */ +/* */ +/* common data and variables prototype and definition */ +/******************************************************************/ + +#ifndef UANSNCS_H +#define UANSNCS_H + +#ifdef BIG_ENDI + static const mynumber +/**/ a1 = {{0x3FC55580, 0x00000000 }}, /* 0.1666717529296875 */ +/**/ a2 = {{0xBED55555, 0x55552330 }}, /* -5.0862630208224597e-06 */ +/**/ hp0 = {{0x3FF921FB, 0x54442D18 }}, /* 1.5707963267948966 */ +/**/ hp1 = {{0x3C91A626, 0x33145C07 }}; /* 6.123233995736766e-17 */ + +#else +#ifdef LITTLE_ENDI + static const mynumber +/**/ a1 = {{0x00000000, 0x3FC55580 }}, /* 0.1666717529296875 */ +/**/ a2 = {{0x55552330, 0xBED55555 }}, /* -5.0862630208224597e-06 */ +/**/ hp0 = {{0x54442D18, 0x3FF921FB }}, /* 1.5707963267948966 */ +/**/ hp1 = {{0x33145C07, 0x3C91A626 }}; /* 6.123233995736766e-17 */ + +#endif +#endif + +static const double + f1 = 1.66666666666664110590506577996662E-01, + f2 = 7.50000000026122686814431784722623E-02, + f3 = 4.46428561421059750978517350006940E-02, + f4 = 3.03821268582119319911193410625235E-02, + f5 = 2.23551211026525610742786300334557E-02, + f6 = 1.81382903404565056280372531963613E-02; +static const double + c2 = 0.74999999999985410757087492918602258E-01, + c3 = 0.44642857150311968932423372477866076E-01, + c4 = 0.30381942574778615766200591683810471E-01, + c5 = 0.22372413472984868331447708777000650E-01, + c6 = 0.17333630246451830686009693735025490E-01, + c7 = 0.14710362893628210269950864741085777E-01; + +static const double big = 103079215104.0, t24 = 16777216.0, t27 = 134217728.0; +static const double + rt0 = 9.99999999859990725855365213134618E-01, + rt1 = 4.99999999495955425917856814202739E-01, + rt2 = 3.75017500867345182581453026130850E-01, + rt3 = 3.12523626554518656309172508769531E-01; +#endif diff --git a/libgcc-math/dbl-64/uatan.tbl b/libgcc-math/dbl-64/uatan.tbl new file mode 100644 index 00000000000..5b4b5f27ae7 --- /dev/null +++ b/libgcc-math/dbl-64/uatan.tbl @@ -0,0 +1,11135 @@ +/* + * IBM Accurate Mathematical Library + * Written by International Business Machines Corp. + * Copyright (C) 2001 Free Software Foundation, Inc. + * + * This program is free software; you can redistribute it and/or modify + * it under the terms of the GNU Lesser General Public License as published by + * the Free Software Foundation; either version 2.1 of the License, or + * (at your option) any later version. + * + * This program is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU Lesser General Public License for more details. + * + * You should have received a copy of the GNU Lesser General Public License + * along with this program; if not, write to the Free Software + * Foundation, Inc., 59 Temple Place - Suite 330, Boston, MA 02111-1307, USA. + */ + +/****************************************************************/ +/* TABLES FOR THE uatan() FUNCTION */ +/****************************************************************/ + +#include "endian.h" + +#ifdef BIG_ENDI + + static const number + cij[241][7] = { /* x0,cij for (1/16,1) */ +/**/ {{{0X3FB04006, 0X65E0244E} }, +/**/ {{0X3FB03A73, 0X7B53DD20} }, +/**/ {{0X3FEFDF1F, 0XCF5CFB72} }, +/**/ {{0XBFB01EB3, 0XCE2AE4C2} }, +/**/ {{0XBFD4D29E, 0XDD58A40D} }, +/**/ {{0X3FAFDA4A, 0XD907A18A} }, +/**/ {{0X3FC814DF, 0X4DF65B18} } }, +/**/ {{{0X3FB0FFFD, 0XB9B88CD8} }, +/**/ {{0X3FB0F99C, 0X63645300} }, +/**/ {{0X3FEFDC08, 0XA3DED30F} }, +/**/ {{0XBFB0D9DC, 0X669C1AED} }, +/**/ {{0XBFD4C669, 0XF7138DE2} }, +/**/ {{0X3FB0A12F, 0X29D085A7} }, +/**/ {{0X3FC7F0EE, 0XCFD48D20} } }, +/**/ {{{0X3FB1FFF1, 0X5A73D4F1} }, +/**/ {{0X3FB1F85F, 0X2BEE2040} }, +/**/ {{0X3FEFD7B3, 0X42B56D31} }, +/**/ {{0XBFB1D2B7, 0XB69DEA40} }, +/**/ {{0XBFD4B552, 0X3922ECC9} }, +/**/ {{0X3FB18F93, 0X522B1A04} }, +/**/ {{0X3FC7BEAD, 0X5660F061} } }, +/**/ {{{0X3FB2FFFD, 0XB2524AA2} }, +/**/ {{0X3FB2F716, 0XE71790A0} }, +/**/ {{0X3FEFD31F, 0X53B496A4} }, +/**/ {{0XBFB2CAD8, 0X4AAB7374} }, +/**/ {{0XBFD4A34B, 0X58DD2FB2} }, +/**/ {{0X3FB27C0A, 0XD0CECC18} }, +/**/ {{0X3FC789D2, 0X5D2743D7} } }, +/**/ {{{0X3FB3FFFE, 0X0573F3AC} }, +/**/ {{0X3FB3F59D, 0X1702F6A0} }, +/**/ {{0X3FEFCE4D, 0XB071ACC2} }, +/**/ {{0XBFB3C20F, 0X64DB3686} }, +/**/ {{0XBFD49059, 0XEB3BFE93} }, +/**/ {{0X3FB36659, 0XCAF74FED} }, +/**/ {{0X3FC75269, 0X1C011FB0} } }, +/**/ {{{0X3FB4FFEF, 0X894384D6} }, +/**/ {{0X3FB4F3ED, 0X0CE204C0} }, +/**/ {{0X3FEFC93E, 0XA8EA5A01} }, +/**/ {{0XBFB4B84F, 0X7B5457C9} }, +/**/ {{0XBFD47C80, 0X7401F2F9} }, +/**/ {{0X3FB44E64, 0XB4F67209} }, +/**/ {{0X3FC7187D, 0X4C540B77} } }, +/**/ {{{0X3FB5FFF8, 0XDF406528} }, +/**/ {{0X3FB5F22B, 0X3C73D820} }, +/**/ {{0X3FEFC3F1, 0XB1F60F13} }, +/**/ {{0XBFB5ADB2, 0XCB7FA73B} }, +/**/ {{0XBFD467BE, 0X2B1EB555} }, +/**/ {{0X3FB53435, 0X99EDC463} }, +/**/ {{0X3FC6DC1B, 0X238F5059} } }, +/**/ {{{0X3FB7000F, 0X8C4F0D56} }, +/**/ {{0X3FB6F04B, 0X495A2FA0} }, +/**/ {{0X3FEFBE67, 0X340DCE97} }, +/**/ {{0XBFB6A224, 0X4D98E1AD} }, +/**/ {{0XBFD45216, 0X14064DF1} }, +/**/ {{0X3FB617AA, 0X2BA78A66} }, +/**/ {{0X3FC69D4F, 0X50A3D7AC} } }, +/**/ {{{0X3FB8000F, 0XBB4057CF} }, +/**/ {{0X3FB7EE27, 0XBE2CD3A0} }, +/**/ {{0X3FEFB8A0, 0X39EC9246} }, +/**/ {{0XBFB79577, 0X31D9C773} }, +/**/ {{0XBFD43B8D, 0XB6DC7D72} }, +/**/ {{0X3FB6F88A, 0XD69547DF} }, +/**/ {{0X3FC65C26, 0XF633CE8C} } }, +/**/ {{{0X3FB8FFF2, 0X39CF2B7F} }, +/**/ {{0X3FB8EBB7, 0X9F979E80} }, +/**/ {{0X3FEFB29D, 0X435506E1} }, +/**/ {{0XBFB8879A, 0X69B9CDB5} }, +/**/ {{0XBFD42428, 0X85FEAFA9} }, +/**/ {{0X3FB7D6BA, 0XB6191A0E} }, +/**/ {{0X3FC618AF, 0XA7CB8BB5} } }, +/**/ {{{0X3FB9FFF9, 0X6E2F0772} }, +/**/ {{0X3FB9E93A, 0XD32A9480} }, +/**/ {{0X3FEFAC5D, 0X04A3EC40} }, +/**/ {{0XBFB978C2, 0X53F6EA97} }, +/**/ {{0XBFD40BE3, 0X089C36F6} }, +/**/ {{0X3FB8B25C, 0X885AEB77} }, +/**/ {{0X3FC5D2F7, 0X63CADCE1} } }, +/**/ {{{0X3FBB0002, 0X6316B097} }, +/**/ {{0X3FBAE68C, 0XCE24CC00} }, +/**/ {{0X3FEFA5E0, 0X938C5C66} }, +/**/ {{0XBFBA68C3, 0X76F14E4B} }, +/**/ {{0XBFD3F2C3, 0X1696CD7C} }, +/**/ {{0X3FB98B3B, 0X722A2CB4} }, +/**/ {{0X3FC58B0C, 0X9067AD62} } }, +/**/ {{{0X3FBC0008, 0X604F58B1} }, +/**/ {{0X3FBBE3A7, 0X05650780} }, +/**/ {{0X3FEF9F28, 0X5A7A2773} }, +/**/ {{0XBFBB578F, 0X3D5AC0A4} }, +/**/ {{0XBFD3D8CB, 0XF767119F} }, +/**/ {{0X3FBA613D, 0XC7E31B88} }, +/**/ {{0X3FC540FD, 0XF5594565} } }, +/**/ {{{0X3FBD0002, 0X6CCA4EBA} }, +/**/ {{0X3FBCE07E, 0XC1298A80} }, +/**/ {{0X3FEF9834, 0XE8D36C4A} }, +/**/ {{0XBFBC4513, 0X5BCAC5FE} }, +/**/ {{0XBFD3BE01, 0X8B5236F1} }, +/**/ {{0X3FBB3447, 0X2E991970} }, +/**/ {{0X3FC4F4DA, 0XB8ADB373} } }, +/**/ {{{0X3FBDFFF4, 0XB2B47FCA} }, +/**/ {{0X3FBDDD16, 0X4A051D80} }, +/**/ {{0X3FEF9106, 0X78DCC895} }, +/**/ {{0XBFBD3149, 0XF0966844} }, +/**/ {{0XBFD3A266, 0X744F9A5F} }, +/**/ {{0X3FBC0446, 0XEDB7F27A} }, +/**/ {{0X3FC4A6B2, 0X583F9ECA} } }, +/**/ {{{0X3FBF000A, 0XA9A05BE0} }, +/**/ {{0X3FBED996, 0XA3BDA540} }, +/**/ {{0X3FEF899C, 0X1B8BA97F} }, +/**/ {{0XBFBE1C51, 0X2287A677} }, +/**/ {{0XBFD385F8, 0XEDC130BB} }, +/**/ {{0X3FBCD14B, 0XF306FF50} }, +/**/ {{0X3FC45694, 0XA667A72B} } }, +/**/ {{{0X3FBFFFFA, 0XBA8F63DE} }, +/**/ {{0X3FBFD5B5, 0X69FE4780} }, +/**/ {{0X3FEF81F8, 0X4863DC7D} }, +/**/ {{0XBFBF05DB, 0XD1518706} }, +/**/ {{0XBFD368C4, 0X4687A69C} }, +/**/ {{0X3FBD9B08, 0X1B3868DA} }, +/**/ {{0X3FC40491, 0XC345ADFC} } }, +/**/ {{{0X3FC07FFA, 0X6ECCADA8} }, +/**/ {{0X3FC068D0, 0X0A396400} }, +/**/ {{0X3FEF7A19, 0XF1FCFC6B} }, +/**/ {{0XBFBFEE0C, 0X861DF0DF} }, +/**/ {{0XBFD34AC6, 0X5A586C0C} }, +/**/ {{0X3FBE618F, 0X189D637A} }, +/**/ {{0X3FC3B0BA, 0X195779D4} } }, +/**/ {{{0X3FC10003, 0X33432713} }, +/**/ {{0X3FC0E6B0, 0XF203D1A0} }, +/**/ {{0X3FEF7200, 0XFE0EB463} }, +/**/ {{0XBFC06A72, 0XE15CB19A} }, +/**/ {{0XBFD32C00, 0XB8DB761E} }, +/**/ {{0X3FBF24D8, 0XA11F5E3E} }, +/**/ {{0X3FC35B1E, 0X569E85DD} } }, +/**/ {{{0X3FC17FFC, 0XDA1C4811} }, +/**/ {{0X3FC16462, 0X29EBDA00} }, +/**/ {{0X3FEF69AF, 0X7D558737} }, +/**/ {{0XBFC0DD17, 0X0B33969B} }, +/**/ {{0XBFD30C7D, 0X33AC50D1} }, +/**/ {{0X3FBFE4AA, 0X9BE43F0F} }, +/**/ {{0X3FC303CF, 0X692539CB} } }, +/**/ {{{0X3FC1FFFF, 0X3CCA418D} }, +/**/ {{0X3FC1E1FA, 0X3B978EA0} }, +/**/ {{0X3FEF6124, 0X45D421A9} }, +/**/ {{0XBFC14F03, 0XACAC8AA8} }, +/**/ {{0XBFD2EC39, 0X62E675A3} }, +/**/ {{0X3FC0508C, 0X2FA6B426} }, +/**/ {{0X3FC2AADE, 0X780A6467} } }, +/**/ {{{0X3FC27FF7, 0XD9C78922} }, +/**/ {{0X3FC25F66, 0X1B91E640} }, +/**/ {{0X3FEF5860, 0XF52E192C} }, +/**/ {{0XBFC1C023, 0XE5DE2394} }, +/**/ {{0XBFD2CB3D, 0X6BEE0ABD} }, +/**/ {{0X3FC0ACFB, 0X5E075C1A} }, +/**/ {{0X3FC2505C, 0XDFFE453A} } }, +/**/ {{{0X3FC2FFF7, 0XA1FC1AAA} }, +/**/ {{0X3FC2DCB5, 0X83257C40} }, +/**/ {{0X3FEF4F64, 0XC719B6FB} }, +/**/ {{0XBFC23082, 0X61514083} }, +/**/ {{0XBFD2A988, 0X7F7B72D5} }, +/**/ {{0X3FC107A7, 0X7C887402} }, +/**/ {{0X3FC1F45C, 0X2C3CD6D1} } }, +/**/ {{{0X3FC38005, 0X9D78E15E} }, +/**/ {{0X3FC359EE, 0X6AC98EE0} }, +/**/ {{0X3FEF462F, 0X944CEC16} }, +/**/ {{0XBFC2A020, 0XD85B87A9} }, +/**/ {{0XBFD2871C, 0X2E4AB369} }, +/**/ {{0X3FC1608D, 0XC31A65D9} }, +/**/ {{0X3FC196EE, 0X130BBE50} } }, +/**/ {{{0X3FC40004, 0X9F431B1A} }, +/**/ {{0X3FC3D6F3, 0X6BD65360} }, +/**/ {{0X3FEF3CC3, 0XDD99B68A} }, +/**/ {{0XBFC30EE1, 0XB3DD00ED} }, +/**/ {{0XBFD26403, 0XF8482664} }, +/**/ {{0X3FC1B792, 0XFE136626} }, +/**/ {{0X3FC13824, 0X6EAC7440} } }, +/**/ {{{0X3FC48004, 0XE01D95A1} }, +/**/ {{0X3FC453D3, 0X86F00CC0} }, +/**/ {{0X3FEF3320, 0XE3970539} }, +/**/ {{0XBFC37CCF, 0X0A5279AA} }, +/**/ {{0XBFD2403F, 0X3B151D5D} }, +/**/ {{0X3FC20CBB, 0XE331C9E6} }, +/**/ {{0X3FC0D811, 0X39E3F097} } }, +/**/ {{{0X3FC4FFF7, 0XAA9382DD} }, +/**/ {{0X3FC4D07F, 0X8C590A80} }, +/**/ {{0X3FEF2948, 0X34DF28E0} }, +/**/ {{0XBFC3E9D8, 0X5B43915C} }, +/**/ {{0XBFD21BD5, 0XEB8845A2} }, +/**/ {{0X3FC25FF8, 0XAC6AC8AD} }, +/**/ {{0X3FC076C6, 0X88ED96CA} } }, +/**/ {{{0X3FC58006, 0X352408BE} }, +/**/ {{0X3FC54D1E, 0XC39A73E0} }, +/**/ {{0X3FEF1F37, 0X09AE009C} }, +/**/ {{0XBFC4561C, 0XB9BE8550} }, +/**/ {{0XBFD1F6C0, 0X0053F52E} }, +/**/ {{0X3FC2B15D, 0XEF783BE9} }, +/**/ {{0X3FC01456, 0X8615239B} } }, +/**/ {{{0X3FC5FFFF, 0X2B193F81} }, +/**/ {{0X3FC5C980, 0X4F73E000} }, +/**/ {{0X3FEF14F1, 0XAE110E29} }, +/**/ {{0XBFC4C16E, 0X9098B3D2} }, +/**/ {{0XBFD1D10F, 0X8F058241} }, +/**/ {{0X3FC300C6, 0XA14FA897} }, +/**/ {{0X3FBF61A6, 0XD56607C0} } }, +/**/ {{{0X3FC68008, 0X4460E6E1} }, +/**/ {{0X3FC645C8, 0X04A55E20} }, +/**/ {{0X3FEF0A75, 0X8FA36EC5} }, +/**/ {{0XBFC52BE9, 0XD62FA883} }, +/**/ {{0XBFD1AABD, 0X69A74048} }, +/**/ {{0X3FC34E45, 0X1679EB02} }, +/**/ {{0X3FBE989E, 0XF7C14C3D} } }, +/**/ {{{0X3FC6FFFB, 0X9E99A846} }, +/**/ {{0X3FC6C1D0, 0X4B35FD40} }, +/**/ {{0X3FEEFFC6, 0X3EF8EF95} }, +/**/ {{0XBFC5956B, 0X76A2FE63} }, +/**/ {{0XBFD183D8, 0XDDC78DDF} }, +/**/ {{0X3FC399BD, 0XAC606D66} }, +/**/ {{0X3FBDCDBA, 0X070D286A} } }, +/**/ {{{0X3FC78008, 0X0FFCD490} }, +/**/ {{0X3FC73DC5, 0XB55758E0} }, +/**/ {{0X3FEEF4E0, 0X457E2065} }, +/**/ {{0XBFC5FE16, 0X7D6FF9BC} }, +/**/ {{0XBFD15C57, 0X9FADD384} }, +/**/ {{0X3FC3E347, 0X73E52D32} }, +/**/ {{0X3FBD011C, 0X9A65AE4B} } }, +/**/ {{{0X3FC80006, 0X148E79C1} }, +/**/ {{0X3FC7B981, 0X2B7F8CA0} }, +/**/ {{0X3FEEE9C7, 0X701687ED} }, +/**/ {{0XBFC665C7, 0X0E1EF36D} }, +/**/ {{0XBFD13449, 0XCCBCBDAB} }, +/**/ {{0X3FC42AC7, 0X5C71B3E8} }, +/**/ {{0X3FBC32EB, 0X3E81980E} } }, +/**/ {{{0X3FC88006, 0X0F487C17} }, +/**/ {{0X3FC83511, 0XBC0E3640} }, +/**/ {{0X3FEEDE7A, 0XD2D55329} }, +/**/ {{0XBFC6CC87, 0X37E644BA} }, +/**/ {{0XBFD10BAE, 0X60597557} }, +/**/ {{0X3FC47043, 0X13E26FBE} }, +/**/ {{0X3FBB634A, 0X6FB18BF4} } }, +/**/ {{{0X3FC90004, 0XD3518D76} }, +/**/ {{0X3FC8B073, 0X8874C100} }, +/**/ {{0X3FEED2FB, 0X2ED6673B} }, +/**/ {{0XBFC73251, 0X2A6EBAC3} }, +/**/ {{0XBFD0E28A, 0X6924232F} }, +/**/ {{0X3FC4B3B5, 0X73BCC03F} }, +/**/ {{0X3FBA925E, 0X8C72507F} } }, +/**/ {{{0X3FC97FFF, 0XD2F20D5C} }, +/**/ {{0X3FC92BA3, 0X51AF5920} }, +/**/ {{0X3FEEC749, 0X3D32449F} }, +/**/ {{0XBFC7971F, 0XC308255F} }, +/**/ {{0XBFD0B8E2, 0XD572D28F} }, +/**/ {{0X3FC4F51A, 0X337448FE} }, +/**/ {{0X3FB9C04B, 0XCFCBC620} } }, +/**/ {{{0X3FCA0005, 0XBF80F060} }, +/**/ {{0X3FC9A6AE, 0X6E9E8960} }, +/**/ {{0X3FEEBB64, 0X1EF200E7} }, +/**/ {{0XBFC7FAFB, 0X6E96E5C1} }, +/**/ {{0XBFD08EB6, 0XEC6AD647} }, +/**/ {{0X3FC53475, 0XF53D0BA6} }, +/**/ {{0X3FB8ED36, 0X4433C20E} } }, +/**/ {{{0X3FCA7FF7, 0XDEECA8E4} }, +/**/ {{0X3FCA2176, 0X948578E0} }, +/**/ {{0X3FEEAF4F, 0X328FF98B} }, +/**/ {{0XBFC85DC9, 0X58149B1C} }, +/**/ {{0XBFD06414, 0XF933A1AB} }, +/**/ {{0X3FC571B7, 0X60C45A8F} }, +/**/ {{0X3FB81941, 0XBE58C308} } }, +/**/ {{{0X3FCAFFFF, 0X7DEFD553} }, +/**/ {{0X3FCA9C22, 0X9EBA6B80} }, +/**/ {{0X3FEEA307, 0X10A85E10} }, +/**/ {{0XBFC8BFA6, 0X7F9DEA61} }, +/**/ {{0XBFD038F3, 0X5A474E8F} }, +/**/ {{0X3FC5ACF0, 0X30C225D2} }, +/**/ {{0X3FB74491, 0XD062812F} } }, +/**/ {{{0X3FCB7FFE, 0X669932A5} }, +/**/ {{0X3FCB1694, 0XCFF6DFE0} }, +/**/ {{0X3FEE968F, 0X1921D387} }, +/**/ {{0XBFC92078, 0XE075D95A} }, +/**/ {{0XBFD00D60, 0X526793C4} }, +/**/ {{0X3FC5E610, 0X73842A52} }, +/**/ {{0X3FB66F49, 0XC5331D5A} } }, +/**/ {{{0X3FCBFFF9, 0XB44759F3} }, +/**/ {{0X3FCB90D1, 0X5073A2A0} }, +/**/ {{0X3FEE89E7, 0X56598313} }, +/**/ {{0XBFC98041, 0XCFB9203D} }, +/**/ {{0XBFCFC2BC, 0XBED91B37} }, +/**/ {{0X3FC61D19, 0X6D4FC2FC} }, +/**/ {{0X3FB5998C, 0X9411537E} } }, +/**/ {{{0X3FCC8007, 0X5568F3EC} }, +/**/ {{0X3FCC0AEC, 0X4A31DBE0} }, +/**/ {{0X3FEE7D0E, 0X18F270A8} }, +/**/ {{0XBFC9DF0E, 0XF522B132} }, +/**/ {{0XBFCF69D4, 0X2179C242} }, +/**/ {{0X3FC65213, 0X36646FCD} }, +/**/ {{0X3FB4C37C, 0XDC699095} } }, +/**/ {{{0X3FCCFFF8, 0X601A799F} }, +/**/ {{0X3FCC84B8, 0X49DB66A0} }, +/**/ {{0X3FEE7008, 0XA0EE780E} }, +/**/ {{0XBFCA3CBB, 0X3A403934} }, +/**/ {{0XBFCF102F, 0XD490BE32} }, +/**/ {{0X3FC684EA, 0X037D4137} }, +/**/ {{0X3FB3ED3C, 0XD9EC855A} } }, +/**/ {{{0X3FCD7FF9, 0X7BBF1497} }, +/**/ {{0X3FCCFE5F, 0X1E008CE0} }, +/**/ {{0X3FEE62D2, 0XF04615C7} }, +/**/ {{0XBFCA9965, 0X15AADE2C} }, +/**/ {{0XBFCEB5B9, 0X0B44B682} }, +/**/ {{0X3FC6B5AF, 0X92EC8D57} }, +/**/ {{0X3FB316EE, 0X60D831AE} } }, +/**/ {{{0X3FCE0008, 0X40209B20} }, +/**/ {{0X3FCD77DD, 0XB145A760} }, +/**/ {{0X3FEE556D, 0XBE1DFDF1} }, +/**/ {{0XBFCAF508, 0X2186AF0F} }, +/**/ {{0XBFCE5A79, 0X9420489D} }, +/**/ {{0X3FC6E462, 0X454FEB2C} }, +/**/ {{0X3FB240B2, 0XD2945A8C} } }, +/**/ {{{0X3FCE8000, 0XC0AE943C} }, +/**/ {{0X3FCDF111, 0X3CA10100} }, +/**/ {{0X3FEE47DD, 0X59E7308B} }, +/**/ {{0XBFCB4F88, 0X9439F69F} }, +/**/ {{0XBFCDFE93, 0X798DE600} }, +/**/ {{0X3FC710F5, 0X8F267389} }, +/**/ {{0X3FB16AAB, 0X1A8A373E} } }, +/**/ {{{0X3FCF0003, 0X6D532803} }, +/**/ {{0X3FCE6A17, 0XCB4E5C80} }, +/**/ {{0X3FEE3A1E, 0XE3D0F6C2} }, +/**/ {{0XBFCBA8FB, 0X6E31F768} }, +/**/ {{0XBFCDA1F7, 0XE6A382E3} }, +/**/ {{0X3FC73B75, 0XB36AC4C0} }, +/**/ {{0X3FB094F7, 0XA3470B0A} } }, +/**/ {{{0X3FCF7FFA, 0X48B8AFC3} }, +/**/ {{0X3FCEE2DB, 0XE1654560} }, +/**/ {{0X3FEE2C35, 0X43F2AB37} }, +/**/ {{0XBFCC014F, 0X598207D6} }, +/**/ {{0XBFCD44BF, 0X1EFE809A} }, +/**/ {{0X3FC763DC, 0X698A561E} }, +/**/ {{0X3FAF7F70, 0XA7CF78A3} } }, +/**/ {{{0X3FD00002, 0XEB334FAE} }, +/**/ {{0X3FCF5B7B, 0X77AB25E0} }, +/**/ {{0X3FEE1E1D, 0X78A5C127} }, +/**/ {{0XBFCC5898, 0XC555D571} }, +/**/ {{0XBFCCE6D9, 0XB706CF86} }, +/**/ {{0X3FC78A35, 0X0823F643} }, +/**/ {{0X3FADD619, 0X0B9118E8} } }, +/**/ {{{0X3FD03FFC, 0XA8AF86FE} }, +/**/ {{0X3FCFD3CB, 0XB53A0C00} }, +/**/ {{0X3FEE0FDC, 0XFDCBAC8B} }, +/**/ {{0XBFCCAEB7, 0X6C3246FF} }, +/**/ {{0XBFCC8870, 0XD6E19AD3} }, +/**/ {{0X3FC7AE73, 0XD2C48E91} }, +/**/ {{0X3FAC2E26, 0X0510FDB0} } }, +/**/ {{{0X3FD07FFC, 0XD38984B7} }, +/**/ {{0X3FD025F7, 0X5732D4A0} }, +/**/ {{0X3FEE0170, 0X49C17AB3} }, +/**/ {{0XBFCD03C2, 0X9AFE5028} }, +/**/ {{0XBFCC2971, 0X9A2C1833} }, +/**/ {{0X3FC7D0A5, 0X69041DCF} }, +/**/ {{0X3FAA87D3, 0XF497C653} } }, +/**/ {{{0X3FD0BFFF, 0X1ED2ADD7} }, +/**/ {{0X3FD061ED, 0XCD7F7420} }, +/**/ {{0X3FEDF2D8, 0XDA96B750} }, +/**/ {{0XBFCD57B2, 0XC777881E} }, +/**/ {{0XBFCBC9EA, 0X8692B503} }, +/**/ {{0X3FC7F0C9, 0X42ABF9E7} }, +/**/ {{0X3FA8E35E, 0X04B42BB4} } }, +/**/ {{{0X3FD10003, 0XA8515CDA} }, +/**/ {{0X3FD09DC9, 0X027416A0} }, +/**/ {{0X3FEDE417, 0X34899950} }, +/**/ {{0XBFCDAA86, 0X7983EDE4} }, +/**/ {{0XBFCB69E3, 0X999706B6} }, +/**/ {{0X3FC80EE1, 0XB0F126DB} }, +/**/ {{0X3FA740FE, 0X17EE9BAB} } }, +/**/ {{{0X3FD14001, 0XF3AF9CC5} }, +/**/ {{0X3FD0D980, 0XB6E1ABA0} }, +/**/ {{0X3FEDD52D, 0XE0412681} }, +/**/ {{0XBFCDFC31, 0X6863B28B} }, +/**/ {{0XBFCB0971, 0XC55B8D5A} }, +/**/ {{0X3FC82AED, 0XA6731AAC} }, +/**/ {{0X3FA5A0EC, 0XC73BD8F0} } }, +/**/ {{{0X3FD18003, 0XB6122509} }, +/**/ {{0X3FD1151D, 0XAA1E67A0} }, +/**/ {{0X3FEDC61B, 0X2E0C1F32} }, +/**/ {{0XBFCE4CBE, 0XB9BA6B7E} }, +/**/ {{0XBFCAA88E, 0X90C2431C} }, +/**/ {{0X3FC844F4, 0X8BCBDA5E} }, +/**/ {{0X3FA40361, 0X50E585FF} } }, +/**/ {{{0X3FD1BFFF, 0XA6A2A153} }, +/**/ {{0X3FD15096, 0XE7A18DC0} }, +/**/ {{0X3FEDB6E1, 0XE1218F3F} }, +/**/ {{0XBFCE9C21, 0X9621D6A2} }, +/**/ {{0XBFCA4750, 0X22627B04} }, +/**/ {{0X3FC85CF5, 0XFF8B908E} }, +/**/ {{0X3FA26891, 0X9833C0D6} } }, +/**/ {{{0X3FD1FFFD, 0X2D345AAF} }, +/**/ {{0X3FD18BF3, 0X053BF760} }, +/**/ {{0X3FEDA780, 0XCC3ACB29} }, +/**/ {{0XBFCEEA62, 0X2AA756AE} }, +/**/ {{0XBFC9E5B3, 0X47ED9793} }, +/**/ {{0X3FC872F8, 0X87AB542A} }, +/**/ {{0X3FA0D0B2, 0X158E9E9A} } }, +/**/ {{{0X3FD23FFC, 0XF14CF05A} }, +/**/ {{0X3FD1C732, 0X4D568460} }, +/**/ {{0X3FED97F8, 0X55F32D3D} }, +/**/ {{0XBFCF3780, 0X21D457C8} }, +/**/ {{0XBFC983BE, 0XF065B845} }, +/**/ {{0X3FC886FF, 0XFBA70CD8} }, +/**/ {{0X3F9E77EB, 0XAEB85CCC} } }, +/**/ {{{0X3FD27FFE, 0X0BAE6FC9} }, +/**/ {{0X3FD20253, 0X9A27C160} }, +/**/ {{0X3FED8849, 0X4619176E} }, +/**/ {{0XBFCF8379, 0X5C0AC9EC} }, +/**/ {{0XBFC9217C, 0X5E645195} }, +/**/ {{0X3FC8990F, 0XF4264515} }, +/**/ {{0X3F9B551C, 0XE6B92E65} } }, +/**/ {{{0X3FD2C001, 0XA297A7DE} }, +/**/ {{0X3FD23D57, 0XACB927C0} }, +/**/ {{0X3FED7873, 0XE4958FB6} }, +/**/ {{0XBFCFCE4E, 0X43572249} }, +/**/ {{0XBFC8BEF1, 0X9F3560F3} }, +/**/ {{0X3FC8A92C, 0XDF7F0E5B} }, +/**/ {{0X3F983958, 0X116F3B19} } }, +/**/ {{{0X3FD2FFFE, 0X7267616A} }, +/**/ {{0X3FD27835, 0XB2F378C0} }, +/**/ {{0X3FED687B, 0X13906586} }, +/**/ {{0XBFD00BF9, 0XAFDA1A0F} }, +/**/ {{0XBFC85C34, 0XC197AD7D} }, +/**/ {{0X3FC8B759, 0X1E99F0A7} }, +/**/ {{0X3F9524FA, 0X6525C365} } }, +/**/ {{{0X3FD33FFE, 0X48153B20} }, +/**/ {{0X3FD2B2F6, 0X6A2FDCC0} }, +/**/ {{0X3FED585C, 0XF827FBE4} }, +/**/ {{0XBFD03039, 0XB45A6918} }, +/**/ {{0XBFC7F93E, 0X5DFC3F72} }, +/**/ {{0X3FC8C39B, 0XC5210022} }, +/**/ {{0X3F92185E, 0X168FB62E} } }, +/**/ {{{0X3FD38003, 0X8122579A} }, +/**/ {{0X3FD2ED9B, 0XAF6EC1E0} }, +/**/ {{0X3FED4819, 0X872F20D3} }, +/**/ {{0XBFD053E8, 0X1F4C1031} }, +/**/ {{0XBFC79612, 0X621FFD79} }, +/**/ {{0X3FC8CDF9, 0XDB9D9DFC} }, +/**/ {{0X3F8E27B4, 0X80C6852F} } }, +/**/ {{{0X3FD3C003, 0X3EF39141} }, +/**/ {{0X3FD3281B, 0X4668C700} }, +/**/ {{0X3FED37B4, 0X18590D1A} }, +/**/ {{0XBFD076FE, 0XA3EF2560} }, +/**/ {{0XBFC732C9, 0X3033287A} }, +/**/ {{0X3FC8D676, 0XCA2E5458} }, +/**/ {{0X3F882F85, 0XD80944B1} } }, +/**/ {{{0X3FD40001, 0X63FA0E31} }, +/**/ {{0X3FD36278, 0X7B565000} }, +/**/ {{0X3FED272C, 0X47A813DA} }, +/**/ {{0XBFD0997F, 0X493B9D88} }, +/**/ {{0XBFC6CF64, 0X3DA9FE3C} }, +/**/ {{0X3FC8DD18, 0XC1CD3331} }, +/**/ {{0X3F8248D1, 0XF70F6E07} } }, +/**/ {{{0X3FD44003, 0X74071092} }, +/**/ {{0X3FD39CB8, 0X0F0A4000} }, +/**/ {{0X3FED1681, 0X3BA47A6B} }, +/**/ {{0XBFD0BB6C, 0XD8788947} }, +/**/ {{0XBFC66BE2, 0X589596A6} }, +/**/ {{0X3FC8E1E5, 0XC9B3EC1E} }, +/**/ {{0X3F78E868, 0XD20FAB86} } }, +/**/ {{{0X3FD48000, 0XC880F200} }, +/**/ {{0X3FD3D6D1, 0XDEFFB460} }, +/**/ {{0X3FED05B5, 0XCADC576C} }, +/**/ {{0XBFD0DCC2, 0XA1D352C2} }, +/**/ {{0XBFC60858, 0X3D7D2574} }, +/**/ {{0X3FC8E4E3, 0X03208BC0} }, +/**/ {{0X3F6AC909, 0X6379E732} } }, +/**/ {{{0X3FD4C000, 0X4D97D2CB} }, +/**/ {{0X3FD410CB, 0XF3A2E220} }, +/**/ {{0X3FECF4C8, 0XBB7ED511} }, +/**/ {{0XBFD0FD84, 0X37766A49} }, +/**/ {{0XBFC5A4C2, 0X5AABC13C} }, +/**/ {{0X3FC8E616, 0XC80DAC4B} }, +/**/ {{0X3F4038AA, 0XB04695C2} } }, +/**/ {{{0X3FD4FFFD, 0X9397539F} }, +/**/ {{0X3FD44AA2, 0X06A7DEC0} }, +/**/ {{0X3FECE3BB, 0XCF479DDE} }, +/**/ {{0XBFD11DAF, 0X4D122984} }, +/**/ {{0XBFC5412E, 0XB1024DF0} }, +/**/ {{0X3FC8E587, 0X1B2C560D} }, +/**/ {{0XBF625DA8, 0X951C088D} } }, +/**/ {{{0X3FD53FFF, 0XF304715F} }, +/**/ {{0X3FD4845A, 0X791F3900} }, +/**/ {{0X3FECD28D, 0XA45E0FD8} }, +/**/ {{0XBFD13D47, 0X8D61F221} }, +/**/ {{0XBFC4DD98, 0XD3E9BB99} }, +/**/ {{0X3FC8E33A, 0X0F181507} }, +/**/ {{0XBF743C33, 0XD08BD25C} } }, +/**/ {{{0X3FD58002, 0XE88EA386} }, +/**/ {{0X3FD4BDF0, 0XF575D6C0} }, +/**/ {{0X3FECC140, 0X02035609} }, +/**/ {{0XBFD15C4A, 0XB808071E} }, +/**/ {{0XBFC47A0E, 0XB2945FCF} }, +/**/ {{0X3FC8DF35, 0XFC056447} }, +/**/ {{0XBF7F2011, 0XB00A45CD} } }, +/**/ {{{0X3FD5BFFD, 0X70F4D590} }, +/**/ {{0X3FD4F75D, 0X284D7AE0} }, +/**/ {{0X3FECAFD5, 0XF2DE98B6} }, +/**/ {{0XBFD17AB4, 0XA2B42F42} }, +/**/ {{0XBFC416A5, 0X1C285A92} }, +/**/ {{0X3FC8D982, 0X511D6C5A} }, +/**/ {{0XBF84ECC1, 0X77008605} } }, +/**/ {{{0X3FD5FFFD, 0XB70D6E53} }, +/**/ {{0X3FD530AB, 0X8E2FF500} }, +/**/ {{0X3FEC9E4C, 0X32D2429D} }, +/**/ {{0XBFD1988C, 0X35190681} }, +/**/ {{0XBFC3B34C, 0XBF748319} }, +/**/ {{0X3FC8D224, 0X98D3A613} }, +/**/ {{0XBF8A33D4, 0XAA295F9F} } }, +/**/ {{{0X3FD63FFC, 0X5C7399E2} }, +/**/ {{0X3FD569D5, 0X4F022E80} }, +/**/ {{0X3FEC8CA5, 0X58DD180F} }, +/**/ {{0XBFD1B5CE, 0X1D701DE4} }, +/**/ {{0XBFC35017, 0XA7806A5A} }, +/**/ {{0X3FC8C924, 0X56C01CF9} }, +/**/ {{0XBF8F64D9, 0X942059E1} } }, +/**/ {{{0X3FD67FFD, 0X9A1AC7D2} }, +/**/ {{0X3FD5A2DD, 0XF50031E0} }, +/**/ {{0X3FEC7AE0, 0XCEFF6DEB} }, +/**/ {{0XBFD1D27C, 0X7C8C245B} }, +/**/ {{0XBFC2ED05, 0XC6AA933F} }, +/**/ {{0X3FC8BE87, 0XDDC5CF1F} }, +/**/ {{0XBF923FB6, 0XD594386F} } }, +/**/ {{{0X3FD6BFFD, 0X6F7B9353} }, +/**/ {{0X3FD5DBC1, 0XB4E066C0} }, +/**/ {{0X3FEC6900, 0X456B591A} }, +/**/ {{0XBFD1EE95, 0XC2D6D0AA} }, +/**/ {{0XBFC28A23, 0XB11086F7} }, +/**/ {{0X3FC8B256, 0XDDE22D5A} }, +/**/ {{0XBF94C19A, 0X489D85A4} } }, +/**/ {{{0X3FD6FFFB, 0XF02A83E4} }, +/**/ {{0X3FD61480, 0X6A237DC0} }, +/**/ {{0X3FEC5704, 0X4CC81773} }, +/**/ {{0XBFD20A1A, 0X4B9029CA} }, +/**/ {{0XBFC22777, 0X89F5FB1C} }, +/**/ {{0X3FC8A498, 0X9B09E911} }, +/**/ {{0XBF9737EC, 0X130D419A} } }, +/**/ {{{0X3FD73FFE, 0X128C213A} }, +/**/ {{0X3FD64D1E, 0X42499480} }, +/**/ {{0X3FEC44EC, 0X129C0D30} }, +/**/ {{0XBFD2250C, 0X83787259} }, +/**/ {{0XBFC1C4FF, 0XD55BE4FC} }, +/**/ {{0X3FC89553, 0X36B2D603} }, +/**/ {{0XBF99A284, 0X2E43DF46} } }, +/**/ {{{0X3FD77FFB, 0XEA0CDC7A} }, +/**/ {{0X3FD68594, 0X05B0E220} }, +/**/ {{0X3FEC32BA, 0X687132C0} }, +/**/ {{0XBFD23F69, 0X7273497E} }, +/**/ {{0XBFC162CE, 0XCD39B037} }, +/**/ {{0X3FC8848F, 0XFA930AAF} }, +/**/ {{0XBF9C013D, 0XA4554412} } }, +/**/ {{{0X3FD7C003, 0XF18EDAB8} }, +/**/ {{0X3FD6BDEE, 0X4127BEE0} }, +/**/ {{0X3FEC206B, 0XC01607BD} }, +/**/ {{0XBFD25937, 0X5FEE2F42} }, +/**/ {{0XBFC100D4, 0X307761E1} }, +/**/ {{0X3FC87252, 0X5DFEC556} }, +/**/ {{0XBF9E53F6, 0X7958F973} } }, +/**/ {{{0X3FD7FFFD, 0X41F35C4C} }, +/**/ {{0X3FD6F616, 0XDA6607A0} }, +/**/ {{0X3FEC0E07, 0XCDDC8437} }, +/**/ {{0XBFD2726C, 0XBFB4DAEA} }, +/**/ {{0XBFC09F3B, 0XE0DB1472} }, +/**/ {{0X3FC85EA9, 0X2A95AA1B} }, +/**/ {{0XBFA04D47, 0XD872CFA2} } }, +/**/ {{{0X3FD84003, 0X26C7C46B} }, +/**/ {{0X3FD72E25, 0X96B8BE00} }, +/**/ {{0X3FEBFB87, 0X4CDEDF38} }, +/**/ {{0XBFD28B14, 0XD09404F3} }, +/**/ {{0XBFC03DE1, 0XE7FB61F2} }, +/**/ {{0X3FC84993, 0XACB33BE9} }, +/**/ {{0XBFA16A76, 0X9B1DE607} } }, +/**/ {{{0X3FD88003, 0XCA90B179} }, +/**/ {{0X3FD7660A, 0XA104A220} }, +/**/ {{0X3FEBE8EF, 0XF236E2F6} }, +/**/ {{0XBFD2A329, 0X19A94DDF} }, +/**/ {{0XBFBFB9CE, 0X0856A081} }, +/**/ {{0X3FC8331F, 0X33F70280} }, +/**/ {{0XBFA2817A, 0XF01308CC} } }, +/**/ {{{0X3FD8C003, 0XE9692FD5} }, +/**/ {{0X3FD79DC9, 0XF0B2CB00} }, +/**/ {{0X3FEBD640, 0XF2966495} }, +/**/ {{0XBFD2BAAB, 0XFD6EC2EA} }, +/**/ {{0XBFBEF892, 0XE08E9C2D} }, +/**/ {{0X3FC81B52, 0X031873E3} }, +/**/ {{0XBFA39249, 0XAC12113D} } }, +/**/ {{{0X3FD8FFFE, 0X35BE5C5F} }, +/**/ {{0X3FD7D55E, 0XBDCCDFC0} }, +/**/ {{0X3FEBC37C, 0X6EABCF77} }, +/**/ {{0XBFD2D19C, 0X2D74F445} }, +/**/ {{0XBFBE382C, 0XE63F2CDB} }, +/**/ {{0X3FC80236, 0X0E6FE2AE} }, +/**/ {{0XBFA49CD9, 0X0E66AB41} } }, +/**/ {{{0X3FD94002, 0XAA8974CD} }, +/**/ {{0X3FD80CD6, 0XB8AFD880} }, +/**/ {{0X3FEBB09E, 0X4468CCBA} }, +/**/ {{0XBFD2E7FF, 0XEC84E686} }, +/**/ {{0XBFBD7876, 0X88C659E8} }, +/**/ {{0X3FC7E7CC, 0XC2F15460} }, +/**/ {{0XBFA5A120, 0XB410D3ED} } }, +/**/ {{{0X3FD98002, 0XE08EFDEA} }, +/**/ {{0X3FD84425, 0X34856920} }, +/**/ {{0X3FEB9DAB, 0X3F290478} }, +/**/ {{0XBFD2FDD2, 0XBB81EDEF} }, +/**/ {{0XBFBCB9A5, 0X31E68398} }, +/**/ {{0X3FC7CC23, 0XC2DBB11B} }, +/**/ {{0XBFA69F19, 0X98467E78} } }, +/**/ {{{0X3FD9C002, 0X75294B6B} }, +/**/ {{0X3FD87B4D, 0X299F6200} }, +/**/ {{0X3FEB8AA2, 0XDE96CF1F} }, +/**/ {{0XBFD31316, 0X8C4D45D2} }, +/**/ {{0XBFBBFBB7, 0XEDCE4DBA} }, +/**/ {{0X3FC7AF41, 0X8907FEC9} }, +/**/ {{0XBFA796BE, 0X07419F55} } }, +/**/ {{{0X3FDA0002, 0XF3E490EC} }, +/**/ {{0X3FD8B24F, 0XC21A4500} }, +/**/ {{0X3FEB7785, 0X3B5EF7DD} }, +/**/ {{0XBFD327CC, 0X8EAE70CD} }, +/**/ {{0XBFBB3EB3, 0XD49E40DA} }, +/**/ {{0X3FC7912D, 0X4D93F7EA} }, +/**/ {{0XBFA88809, 0X9E21606A} } }, +/**/ {{{0X3FDA3FFF, 0X458461B6} }, +/**/ {{0X3FD8E928, 0X7754D2C0} }, +/**/ {{0X3FEB6454, 0X6A0DAF0E} }, +/**/ {{0XBFD33BF3, 0XDC2A9A3F} }, +/**/ {{0XBFBA82B1, 0X4917D003} }, +/**/ {{0X3FC771F1, 0X7C7566CF} }, +/**/ {{0XBFA972F9, 0X3D700DD8} } }, +/**/ {{{0X3FDA8002, 0X87E12AAE} }, +/**/ {{0X3FD91FE0, 0XA5DFD000} }, +/**/ {{0X3FEB510D, 0XA0D82E05} }, +/**/ {{0XBFD34F90, 0XA76AD312} }, +/**/ {{0XBFB9C798, 0XDEEC35AD} }, +/**/ {{0X3FC75190, 0X8A0EF43E} }, +/**/ {{0XBFAA578B, 0X0872EFC8} } }, +/**/ {{{0X3FDAC001, 0X49A86C84} }, +/**/ {{0X3FD9566E, 0X5C4516E0} }, +/**/ {{0X3FEB3DB4, 0XDD03F6B6} }, +/**/ {{0XBFD362A0, 0X291C1F82} }, +/**/ {{0XBFB90D95, 0X03F6DF60} }, +/**/ {{0X3FC73018, 0X25091E92} }, +/**/ {{0XBFAB35BE, 0X577A022B} } }, +/**/ {{{0X3FDAFFFF, 0X2F4CC2E1} }, +/**/ {{0X3FD98CD4, 0X94226540} }, +/**/ {{0X3FEB2A49, 0X9297200A} }, +/**/ {{0XBFD37524, 0X5153FD01} }, +/**/ {{0XBFB854A3, 0XAE3DE27E} }, +/**/ {{0X3FC70D8E, 0X7EB3F331} }, +/**/ {{0XBFAC0D93, 0XB6AD570E} } }, +/**/ {{{0X3FDB4000, 0XC2F3711E} }, +/**/ {{0X3FD9C317, 0X01CDC4C0} }, +/**/ {{0X3FEB16CA, 0XEA63781B} }, +/**/ {{0XBFD3871F, 0X3665B649} }, +/**/ {{0XBFB79CC0, 0X3F70FBC6} }, +/**/ {{0X3FC6E9F9, 0X061DFC2E} }, +/**/ {{0XBFACDF0C, 0XD837F9C3} } }, +/**/ {{{0X3FDB8000, 0XA777E180} }, +/**/ {{0X3FD9F930, 0XF3748F20} }, +/**/ {{0X3FEB033B, 0X0FB0162A} }, +/**/ {{0XBFD39890, 0X25978CAB} }, +/**/ {{0XBFB6E602, 0X5C765AAB} }, +/**/ {{0X3FC6C562, 0X9C16D678} }, +/**/ {{0XBFADAA2C, 0X92A16EBF} } }, +/**/ {{{0X3FDBBFFD, 0X087E14ED} }, +/**/ {{0X3FDA2F20, 0XBF0DDB00} }, +/**/ {{0X3FEAEF9B, 0X1CCE6E94} }, +/**/ {{0XBFD3A977, 0X8B73E3C3} }, +/**/ {{0XBFB63077, 0X09EFD1CC} }, +/**/ {{0X3FC69FD4, 0X58408D3A} }, +/**/ {{0XBFAE6EF6, 0XD2E48013} } }, +/**/ {{{0X3FDC0000, 0XF0086783} }, +/**/ {{0X3FDA64EF, 0X8D448080} }, +/**/ {{0X3FEADBE8, 0X35990B5A} }, +/**/ {{0XBFD3B9D9, 0X27241B86} }, +/**/ {{0XBFB57C06, 0XC20E4001} }, +/**/ {{0X3FC6794F, 0X90E6C8AB} }, +/**/ {{0XBFAF2D70, 0X9A630A27} } }, +/**/ {{{0X3FDC4001, 0X863E58F8} }, +/**/ {{0X3FDA9A94, 0X1C3A1BA0} }, +/**/ {{0X3FEAC826, 0X35ED7DD2} }, +/**/ {{0XBFD3C9B3, 0X0C075B50} }, +/**/ {{0XBFB4C8D7, 0XA429793C} }, +/**/ {{0X3FC651E2, 0X95903C22} }, +/**/ {{0XBFAFE59F, 0XF0F8B649} } }, +/**/ {{{0X3FDC7FFC, 0X6C62C3BF} }, +/**/ {{0X3FDAD00C, 0X580A5840} }, +/**/ {{0X3FEAB456, 0X62D1D808} }, +/**/ {{0XBFD3D905, 0XACBB06EC} }, +/**/ {{0XBFB416F7, 0X421E42DC} }, +/**/ {{0X3FC62996, 0XE5608EFD} }, +/**/ {{0XBFB04BC5, 0XF14B649A} } }, +/**/ {{{0X3FDCC002, 0X34B2A209} }, +/**/ {{0X3FDB0565, 0XF68F3B40} }, +/**/ {{0X3FEAA074, 0X1E3DC946} }, +/**/ {{0XBFD3E7D5, 0XE2DB674E} }, +/**/ {{0XBFB3663E, 0XA4833FFE} }, +/**/ {{0X3FC60069, 0XC4F0392B} }, +/**/ {{0XBFB0A19E, 0X38B10201} } }, +/**/ {{{0X3FDCFFFC, 0XAAC5F9F9} }, +/**/ {{0X3FDB3A8E, 0X59C45CC0} }, +/**/ {{0X3FEA8C86, 0XD2389C24} }, +/**/ {{0XBFD3F61F, 0X8362B2CB} }, +/**/ {{0XBFB2B6F1, 0XC6C746A6} }, +/**/ {{0X3FC5D671, 0X426D2946} }, +/**/ {{0XBFB0F45D, 0X4981CE75} } }, +/**/ {{{0X3FDD4004, 0X0D800C64} }, +/**/ {{0X3FDB6F99, 0X88AF6580} }, +/**/ {{0X3FEA7887, 0X7498CED2} }, +/**/ {{0XBFD403E8, 0XEF8975C0} }, +/**/ {{0XBFB208D4, 0XBEA81E2B} }, +/**/ {{0X3FC5ABA5, 0X283FFA4E} }, +/**/ {{0XBFB14408, 0X11705130} } }, +/**/ {{{0X3FDD7FFE, 0XB0E64500} }, +/**/ {{0X3FDBA472, 0X2324E140} }, +/**/ {{0X3FEA647E, 0X8C5AD680} }, +/**/ {{0XBFD4112D, 0XA03F042D} }, +/**/ {{0XBFB15C33, 0X9580389C} }, +/**/ {{0X3FC5801E, 0X49D9889E} }, +/**/ {{0XBFB190A3, 0XEF96554F} } }, +/**/ {{{0X3FDDBFFE, 0X2DFCF4EB} }, +/**/ {{0X3FDBD926, 0X9F1D27A0} }, +/**/ {{0X3FEA5067, 0X1AC286CA} }, +/**/ {{0XBFD41DF2, 0X590A4DE1} }, +/**/ {{0XBFB0B0E4, 0X8BD1EFA5} }, +/**/ {{0X3FC553D8, 0X702506D0} }, +/**/ {{0XBFB1DA36, 0XADA415A6} } }, +/**/ {{{0X3FDDFFFD, 0X8A34BBC2} }, +/**/ {{0X3FDC0DB2, 0XC4F7A2C0} }, +/**/ {{0X3FEA3C43, 0X2EF70BB3} }, +/**/ {{0XBFD42A37, 0X16EE647C} }, +/**/ {{0XBFB006FA, 0XDB6270BB} }, +/**/ {{0X3FC526DE, 0X86F08DE6} }, +/**/ {{0XBFB220C6, 0X7E5061FB} } }, +/**/ {{{0X3FDE3FFD, 0XD26415C0} }, +/**/ {{0X3FDC4217, 0X58282940} }, +/**/ {{0X3FEA2812, 0XF391DDCB} }, +/**/ {{0XBFD435FD, 0X18EDDF0A} }, +/**/ {{0XBFAEBCF2, 0X88A589AF} }, +/**/ {{0X3FC4F937, 0X4CF96163} }, +/**/ {{0XBFB26459, 0XF6A18481} } }, +/**/ {{{0X3FDE7FFF, 0X37F72672} }, +/**/ {{0X3FDC7654, 0X67AA3DC0} }, +/**/ {{0X3FEA13D6, 0XD6CE86B3} }, +/**/ {{0XBFD44145, 0X74037E91} }, +/**/ {{0XBFAD6EC9, 0X3B2CC445} }, +/**/ {{0X3FC4CAEA, 0X0564F101} }, +/**/ {{0XBFB2A4F8, 0X0C49CD64} } }, +/**/ {{{0X3FDEBFFD, 0XA11BC00F} }, +/**/ {{0X3FDCAA66, 0X85E23660} }, +/**/ {{0X3FE9FF90, 0XA25C2396} }, +/**/ {{0XBFD44C10, 0X8A64724F} }, +/**/ {{0XBFAC2399, 0X2F871E82} }, +/**/ {{0X3FC49C01, 0X0AFBFB85} }, +/**/ {{0XBFB2E2A8, 0X0F0FF3FE} } }, +/**/ {{{0X3FDEFFFF, 0X3313756D} }, +/**/ {{0X3FDCDE52, 0X9D30CC20} }, +/**/ {{0X3FE9EB3E, 0XDFF9491F} }, +/**/ {{0XBFD45660, 0X7E6ABAAE} }, +/**/ {{0XBFAADB4C, 0X3E8AA98D} }, +/**/ {{0X3FC46C7F, 0X25D8FF7D} }, +/**/ {{0XBFB31D71, 0XA71D448D} } }, +/**/ {{{0X3FDF4001, 0X914B856E} }, +/**/ {{0X3FDD1216, 0XAAC1BB20} }, +/**/ {{0X3FE9D6E2, 0XC9BC4315} }, +/**/ {{0XBFD46036, 0X004E7E91} }, +/**/ {{0XBFA995F7, 0XFB901F89} }, +/**/ {{0X3FC43C6D, 0X3F5BE04A} }, +/**/ {{0XBFB3555C, 0XCE8ABF92} } }, +/**/ {{{0X3FDF8003, 0XCD144428} }, +/**/ {{0X3FDD45B1, 0XD93E9640} }, +/**/ {{0X3FE9C27D, 0X256FDFEB} }, +/**/ {{0XBFD46992, 0X09F7C145} }, +/**/ {{0XBFA853A9, 0XED521174} }, +/**/ {{0X3FC40BD3, 0X2B27751F} }, +/**/ {{0XBFB38A71, 0XCFA5C5F2} } }, +/**/ {{{0X3FDFC002, 0X00545BD9} }, +/**/ {{0X3FDD7920, 0XF536D960} }, +/**/ {{0X3FE9AE0F, 0XAAE99EA5} }, +/**/ {{0XBFD47275, 0X38DD66F4} }, +/**/ {{0XBFA7147D, 0XB5484F74} }, +/**/ {{0X3FC3DABA, 0XF8EFC373} }, +/**/ {{0XBFB3BCB9, 0X3EA6B864} } }, +/**/ {{{0X3FDFFFFB, 0XDA6F2AA8} }, +/**/ {{0X3FDDAC63, 0XB420FAA0} }, +/**/ {{0X3FE9999A, 0XED4D0CAB} }, +/**/ {{0XBFD47AE0, 0XBFCC6072} }, +/**/ {{0XBFA5D87C, 0X25BF7A4A} }, +/**/ {{0X3FC3A92B, 0XF5999EE5} }, +/**/ {{0XBFB3EC3B, 0XF7F09D08} } }, +/**/ {{{0X3FE01FFF, 0XA65118C8} }, +/**/ {{0X3FDDDF85, 0X2BF70C00} }, +/**/ {{0X3FE9851A, 0XECD72AE5} }, +/**/ {{0XBFD482D7, 0X8F5794C5} }, +/**/ {{0XBFA49F68, 0X2E4A020B} }, +/**/ {{0X3FC37722, 0X25A156DA} }, +/**/ {{0XBFB41903, 0X19F58064} } }, +/**/ {{{0X3FE04001, 0X9C0B0556} }, +/**/ {{0X3FDE127D, 0XFA2BA200} }, +/**/ {{0X3FE97093, 0X08C17A55} }, +/**/ {{0XBFD48A59, 0X957A7EFD} }, +/**/ {{0XBFA36976, 0X2648F2BB} }, +/**/ {{0X3FC344AB, 0X592569B1} }, +/**/ {{0XBFB44318, 0X03752DDB} } }, +/**/ {{{0X3FE05FFF, 0XC24501DB} }, +/**/ {{0X3FDE4547, 0XA495BCC0} }, +/**/ {{0X3FE95C06, 0X4F225B79} }, +/**/ {{0XBFD49167, 0X2163F5B8} }, +/**/ {{0XBFA236D3, 0X4B79B89F} }, +/**/ {{0X3FC311D4, 0XB530B7BE} }, +/**/ {{0XBFB46A84, 0X4D931476} } }, +/**/ {{{0X3FE07FFE, 0X865125FC} }, +/**/ {{0X3FDE77E9, 0X2A5FAD60} }, +/**/ {{0X3FE94772, 0X5C13B0EA} }, +/**/ {{0XBFD49802, 0X6F33ABCA} }, +/**/ {{0XBFA1075A, 0XDE947C6B} }, +/**/ {{0X3FC2DE9D, 0XD8D5E01B} }, +/**/ {{0XBFB48F51, 0XCA17CA60} } }, +/**/ {{{0X3FE0A002, 0X107EAC25} }, +/**/ {{0X3FDEAA69, 0X08243180} }, +/**/ {{0X3FE932D4, 0XF339824B} }, +/**/ {{0XBFD49E2D, 0X7145F475} }, +/**/ {{0XBF9FB5D8, 0X00571424} }, +/**/ {{0X3FC2AB06, 0X85D1CF84} }, +/**/ {{0XBFB4B18A, 0X7DBBBABE} } }, +/**/ {{{0X3FE0BFFF, 0X7376E5D4} }, +/**/ {{0X3FDEDCB5, 0XF79FF560} }, +/**/ {{0X3FE91E35, 0X8EE1B492} }, +/**/ {{0XBFD4A3E7, 0X49498453} }, +/**/ {{0XBF9D63E4, 0XBE685C6F} }, +/**/ {{0X3FC27726, 0XC4B1F032} }, +/**/ {{0XBFB4D138, 0X9E6ECC3A} } }, +/**/ {{{0X3FE0DFFE, 0X1715EE2E} }, +/**/ {{0X3FDF0EDB, 0X9BE1BB80} }, +/**/ {{0X3FE9098F, 0XD993BD60} }, +/**/ {{0XBFD4A932, 0X9B84E907} }, +/**/ {{0XBF9B185A, 0XE07DBA5E} }, +/**/ {{0X3FC242F8, 0XF2D7A804} }, +/**/ {{0XBFB4EE66, 0X8DDAA340} } }, +/**/ {{{0X3FE10001, 0X7F3D776C} }, +/**/ {{0X3FDF40DF, 0X6119E100} }, +/**/ {{0X3FE8F4E1, 0XFB44BCFB} }, +/**/ {{0XBFD4AE11, 0X16E3467E} }, +/**/ {{0XBF98D304, 0XCF368422} }, +/**/ {{0X3FC20E7D, 0X736708AE} }, +/**/ {{0XBFB5091E, 0XD7B3658D} } }, +/**/ {{{0X3FE11FFE, 0XFD8C7B65} }, +/**/ {{0X3FDF72B0, 0X8FD21560} }, +/**/ {{0X3FE8E033, 0X4770FB0A} }, +/**/ {{0XBFD4B282, 0X5C0F6783} }, +/**/ {{0XBF9694AC, 0X7FFE0364} }, +/**/ {{0X3FC1D9CB, 0XE529BF4C} }, +/**/ {{0XBFB5216C, 0X2C73E5F0} } }, +/**/ {{{0X3FE14000, 0XAFA3EE71} }, +/**/ {{0X3FDFA45E, 0XE3324D60} }, +/**/ {{0X3FE8CB7D, 0X9FF684DF} }, +/**/ {{0XBFD4B689, 0X17ADD34D} }, +/**/ {{0XBF945CA3, 0X67276E70} }, +/**/ {{0X3FC1A4D9, 0XA1FBF3B1} }, +/**/ {{0XBFB53759, 0X5FBA2374} } }, +/**/ {{{0X3FE15FFF, 0X73336187} }, +/**/ {{0X3FDFD5DF, 0X3DE48D00} }, +/**/ {{0X3FE8B6C6, 0X0CBE3546} }, +/**/ {{0XBFD4BA25, 0X9B291BCB} }, +/**/ {{0XBF922B6F, 0X5FB712CC} }, +/**/ {{0X3FC16FB8, 0X55E28B0B} }, +/**/ {{0XBFB54AF1, 0X633F423C} } }, +/**/ {{{0X3FE17FFF, 0X6C447B82} }, +/**/ {{0X3FE0039C, 0X0208ECC0} }, +/**/ {{0X3FE8A20A, 0X48F15926} }, +/**/ {{0XBFD4BD59, 0XA5808AC3} }, +/**/ {{0XBF9000CD, 0X5EEF6F2A} }, +/**/ {{0X3FC13A66, 0XEBE54AA7} }, +/**/ {{0XBFB55C3F, 0X45420CE4} } }, +/**/ {{{0X3FE19FFF, 0XAE932B61} }, +/**/ {{0X3FE01C33, 0XE0091BC0} }, +/**/ {{0X3FE88D4B, 0X55664E00} }, +/**/ {{0XBFD4C026, 0X579F5ABB} }, +/**/ {{0XBF8BB9A6, 0X8797C32A} }, +/**/ {{0X3FC104EC, 0X95D4F64E} }, +/**/ {{0XBFB56B4E, 0X2BBC325E} } }, +/**/ {{{0X3FE1BFFF, 0XBA12AE50} }, +/**/ {{0X3FE034B6, 0XD3ABA020} }, +/**/ {{0X3FE87889, 0XEBDCCF04} }, +/**/ {{0XBFD4C28C, 0XE6D463C1} }, +/**/ {{0XBF877F1C, 0XB36211FC} }, +/**/ {{0X3FC0CF4F, 0XB90B11E7} }, +/**/ {{0XBFB57829, 0X52DCBE1A} } }, +/**/ {{{0X3FE1E001, 0X4B459E41} }, +/**/ {{0X3FE04D26, 0X2DC05800} }, +/**/ {{0X3FE863C5, 0X51625B6A} }, +/**/ {{0XBFD4C48E, 0XAFFDD399} }, +/**/ {{0XBF8351CB, 0X603059CA} }, +/**/ {{0X3FC09992, 0XDE65D0D9} }, +/**/ {{0XBFB582DC, 0X087BB367} } }, +/**/ {{{0X3FE20000, 0X32306F33} }, +/**/ {{0X3FE0657E, 0XBAFB6CE0} }, +/**/ {{0X3FE84F00, 0XA1E2EEC3} }, +/**/ {{0XBFD4C62C, 0XB79EC8C6} }, +/**/ {{0XBF7E6488, 0XD95DE8D1} }, +/**/ {{0X3FC063C2, 0X661DF241} }, +/**/ {{0XBFB58B71, 0XAAA63BAD} } }, +/**/ {{{0X3FE22000, 0XD30A486C} }, +/**/ {{0X3FE07DC3, 0XD2165080} }, +/**/ {{0X3FE83A39, 0X66B3E5BF} }, +/**/ {{0XBFD4C768, 0X7DE04DEE} }, +/**/ {{0XBF763FF7, 0X800F052F} }, +/**/ {{0X3FC02DDC, 0X28F35EDD} }, +/**/ {{0XBFB591F5, 0XA351CF91} } }, +/**/ {{{0X3FE23FFE, 0X215E03FC} }, +/**/ {{0X3FE095F1, 0X9F380A00} }, +/**/ {{0X3FE82573, 0X48BE5F3F} }, +/**/ {{0XBFD4C843, 0X1B793F77} }, +/**/ {{0XBF6C6E63, 0X625993B8} }, +/**/ {{0X3FBFEFDB, 0X8C5E4B3B} }, +/**/ {{0XBFB59673, 0X66FE9CA7} } }, +/**/ {{{0X3FE26000, 0X6833D65D} }, +/**/ {{0X3FE0AE0E, 0X6496A8C0} }, +/**/ {{0X3FE810A9, 0X45B44AA3} }, +/**/ {{0XBFD4C8BE, 0X055B407A} }, +/**/ {{0XBF5920A7, 0XAE83F0A4} }, +/**/ {{0X3FBF83DC, 0X860A6A5E} }, +/**/ {{0XBFB598F6, 0X70D98EE7} } }, +/**/ {{{0X3FE28000, 0XE82D4D50} }, +/**/ {{0X3FE0C615, 0X095F5300} }, +/**/ {{0X3FE7FBE0, 0X1E9337B7} }, +/**/ {{0XBFD4C8DA, 0X573C6F6A} }, +/**/ {{0X3F38B6C7, 0XC50F565D} }, +/**/ {{0X3FBF17DB, 0XC9C4B6CA} }, +/**/ {{0XBFB5998A, 0X45D6DAE0} } }, +/**/ {{{0X3FE29FFF, 0X203B6A0B} }, +/**/ {{0X3FE0DE05, 0X30852720} }, +/**/ {{0X3FE7E718, 0X8520538D} }, +/**/ {{0XBFD4C899, 0X668C6963} }, +/**/ {{0X3F6286EC, 0XBECA8AB0} }, +/**/ {{0X3FBEABE4, 0X9B6AC5BD} }, +/**/ {{0XBFB5983A, 0X575A9684} } }, +/**/ {{{0X3FE2C001, 0XE91A9D93} }, +/**/ {{0X3FE0F5E3, 0XF7817A20} }, +/**/ {{0X3FE7D24E, 0X63A45D97} }, +/**/ {{0XBFD4C7FC, 0X5F83C46D} }, +/**/ {{0X3F70E199, 0X5D9C800A} }, +/**/ {{0X3FBE3FE9, 0X3721A8E0} }, +/**/ {{0XBFB59512, 0X377DA840} } }, +/**/ {{{0X3FE2DFFF, 0XC6FB4948} }, +/**/ {{0X3FE10DAA, 0X4CE36040} }, +/**/ {{0X3FE7BD88, 0X3E39011F} }, +/**/ {{0XBFD4C704, 0XB5EAE11F} }, +/**/ {{0X3F786398, 0X192C622B} }, +/**/ {{0X3FBDD412, 0XB62BA357} }, +/**/ {{0XBFB5901D, 0X5F0E020E} } }, +/**/ {{{0X3FE2FFFF, 0X39CB4EED} }, +/**/ {{0X3FE1255D, 0X0970AD60} }, +/**/ {{0X3FE7A8C2, 0X365B7A9B} }, +/**/ {{0XBFD4C5B3, 0X8925F532} }, +/**/ {{0X3F7FCB03, 0X785E3070} }, +/**/ {{0X3FBD6854, 0X0EEDF3B3} }, +/**/ {{0XBFB58967, 0X479C252A} } }, +/**/ {{{0X3FE31FFE, 0X002E31CB} }, +/**/ {{0X3FE13CFA, 0X81FD3780} }, +/**/ {{0X3FE793FE, 0X1BBE9667} }, +/**/ {{0XBFD4C40A, 0X3046F4C7} }, +/**/ {{0X3F838BAE, 0X8F5E6BF1} }, +/**/ {{0X3FBCFCBD, 0X83775C98} }, +/**/ {{0XBFB580FB, 0X62E887AB} } }, +/**/ {{{0X3FE34000, 0XEDC7BFFD} }, +/**/ {{0X3FE15486, 0X44D05200} }, +/**/ {{0X3FE77F39, 0X244A1DA5} }, +/**/ {{0XBFD4C209, 0X9FB764C1} }, +/**/ {{0X3F8724E2, 0X851B0BE5} }, +/**/ {{0X3FBC9147, 0X507C76E0} }, +/**/ {{0XBFB576E5, 0X19C7F0AB} } }, +/**/ {{{0X3FE36001, 0XCE042830} }, +/**/ {{0X3FE16BFB, 0XC1656AE0} }, +/**/ {{0X3FE76A77, 0XAD3B2B77} }, +/**/ {{0XBFD4BFB3, 0X74AAC296} }, +/**/ {{0X3F8AB070, 0X05B229C2} }, +/**/ {{0X3FBC260E, 0X87DCA54B} }, +/**/ {{0XBFB56B2F, 0XC90DF763} } }, +/**/ {{{0X3FE37FFE, 0X89B8FC54} }, +/**/ {{0X3FE18359, 0X77D0BA80} }, +/**/ {{0X3FE755BB, 0X660CAA3D} }, +/**/ {{0XBFD4BD09, 0X308BB975} }, +/**/ {{0X3F8E2E26, 0XFE0A1240} }, +/**/ {{0X3FBBBB22, 0X18790F26} }, +/**/ {{0XBFB55DE6, 0XC094F3DA} } }, +/**/ {{{0X3FE3A001, 0X9B4DA842} }, +/**/ {{0X3FE19AA7, 0X100CD140} }, +/**/ {{0X3FE740FD, 0XD801F889} }, +/**/ {{0XBFD4BA0B, 0X2C32C656} }, +/**/ {{0X3F90CF99, 0X8ECA44A2} }, +/**/ {{0X3FBB5066, 0XC9863443} }, +/**/ {{0XBFB54F15, 0X406672B5} } }, +/**/ {{{0X3FE3C000, 0XCE6B63E8} }, +/**/ {{0X3FE1B1DD, 0X1D0B0AE0} }, +/**/ {{0X3FE72C45, 0XF28670E6} }, +/**/ {{0XBFD4B6BB, 0X92422E2E} }, +/**/ {{0X3F928141, 0XA0D32146} }, +/**/ {{0X3FBAE606, 0X37452321} }, +/**/ {{0XBFB53EC6, 0X77D91F56} } }, +/**/ {{{0X3FE3DFFF, 0X114A2607} }, +/**/ {{0X3FE1C8FD, 0XC6FF6F20} }, +/**/ {{0X3FE71792, 0X206847A7} }, +/**/ {{0XBFD4B31B, 0X669BD306} }, +/**/ {{0X3F942C3A, 0X04FFD28A} }, +/**/ {{0X3FBA7BFD, 0XE7FC0825} }, +/**/ {{0XBFB52D05, 0X82F471BA} } }, +/**/ {{{0X3FE3FFFF, 0XC1DA9B7D} }, +/**/ {{0X3FE1E00B, 0X7F2E8840} }, +/**/ {{0X3FE702E0, 0X84371133} }, +/**/ {{0XBFD4AF2B, 0X8012FBE4} }, +/**/ {{0X3F95D0B4, 0XBFC47F4B} }, +/**/ {{0X3FBA1249, 0XD80AB6C5} }, +/**/ {{0XBFB519DD, 0X69A4108D} } }, +/**/ {{{0X3FE41FFE, 0XE11D9C33} }, +/**/ {{0X3FE1F703, 0X67C3EC20} }, +/**/ {{0X3FE6EE34, 0X026A76A0} }, +/**/ {{0XBFD4AAED, 0X96514B12} }, +/**/ {{0X3F976E83, 0X07BA2905} }, +/**/ {{0X3FB9A8FE, 0X261A1221} }, +/**/ {{0XBFB50559, 0X1D552BA0} } }, +/**/ {{{0X3FE43FFF, 0XFA174676} }, +/**/ {{0X3FE20DE8, 0X0FAFF860} }, +/**/ {{0X3FE6D98A, 0X9EA6D162} }, +/**/ {{0XBFD4A662, 0X6B927B3B} }, +/**/ {{0X3F9905D8, 0XF84ADBB0} }, +/**/ {{0X3FB94015, 0XDD484DB5} }, +/**/ {{0XBFB4EF83, 0X783EEF44} } }, +/**/ {{{0X3FE45FFF, 0X0D457FA4} }, +/**/ {{0X3FE224B6, 0X9F675300} }, +/**/ {{0X3FE6C4E7, 0X3A093351} }, +/**/ {{0XBFD4A18B, 0XCBF2BFF8} }, +/**/ {{0X3F9A968A, 0X84BB8C16} }, +/**/ {{0X3FB8D7A4, 0X93FBB975} }, +/**/ {{0XBFB4D867, 0X3B37E4FB} } }, +/**/ {{{0X3FE47FFE, 0X8F910E57} }, +/**/ {{0X3FE23B70, 0XDD92B840} }, +/**/ {{0X3FE6B048, 0X89B04359} }, +/**/ {{0XBFD49C6A, 0X974B07FF} }, +/**/ {{0X3F9C20BE, 0X25F20251} }, +/**/ {{0X3FB86FA8, 0X82E9673D} }, +/**/ {{0XBFB4C00F, 0X0D12F550} } }, +/**/ {{{0X3FE4A001, 0X7323FC6B} }, +/**/ {{0X3FE25218, 0XE34E3420} }, +/**/ {{0X3FE69BAC, 0XF277FE27} }, +/**/ {{0XBFD496FF, 0X7F856ABA} }, +/**/ {{0X3F9DA49E, 0X9928150C} }, +/**/ {{0X3FB8081E, 0X3EB66A26} }, +/**/ {{0XBFB4A685, 0X78AB06C5} } }, +/**/ {{{0X3FE4C000, 0XB1BF0500} }, +/**/ {{0X3FE268A9, 0XBD8B2C80} }, +/**/ {{0X3FE68719, 0X42ABBD42} }, +/**/ {{0XBFD4914C, 0XEC74E64A} }, +/**/ {{0X3F9F21DE, 0XD0C3EEEC} }, +/**/ {{0X3FB7A122, 0X5B30AA05} }, +/**/ {{0XBFB48BD4, 0XEC53EF43} } }, +/**/ {{{0X3FE4E001, 0X1D07207B} }, +/**/ {{0X3FE27F26, 0XDA64F7A0} }, +/**/ {{0X3FE6728A, 0XA7CFBEB2} }, +/**/ {{0XBFD48B53, 0X3FCBB247} }, +/**/ {{0X3FA04C60, 0XA7354A41} }, +/**/ {{0X3FB73AAA, 0XEFF6F27A} }, +/**/ {{0XBFB47007, 0XB81A6BB2} } }, +/**/ {{{0X3FE4FFFE, 0X5F36EB46} }, +/**/ {{0X3FE2958D, 0X35DDD180} }, +/**/ {{0X3FE65E04, 0X307B6AF3} }, +/**/ {{0XBFD48514, 0X828BB6E6} }, +/**/ {{0X3FA1048E, 0X48993ED9} }, +/**/ {{0X3FB6D4CB, 0X468D7C59} }, +/**/ {{0XBFB45328, 0X0D484989} } }, +/**/ {{{0X3FE52001, 0X2AFDF759} }, +/**/ {{0X3FE2ABE2, 0XEB1C3280} }, +/**/ {{0X3FE64980, 0X8DC5DAAD} }, +/**/ {{0XBFD47E90, 0X2C11E3B7} }, +/**/ {{0X3FA1B9AE, 0X88E1B343} }, +/**/ {{0X3FB66F6C, 0XFF4501BF} }, +/**/ {{0XBFB4353F, 0XFCD6B8DE} } }, +/**/ {{{0X3FE54001, 0XDFDB2423} }, +/**/ {{0X3FE2C222, 0XAB0402C0} }, +/**/ {{0X3FE63504, 0XE7E657FB} }, +/**/ {{0XBFD477C8, 0XEEE53FA9} }, +/**/ {{0X3FA26B9A, 0X696CD845} }, +/**/ {{0X3FB60AAD, 0X6A3AA6EF} }, +/**/ {{0XBFB41659, 0X7704E1F4} } }, +/**/ {{{0X3FE55FFE, 0X72D2A74F} }, +/**/ {{0X3FE2D84B, 0X16BE7240} }, +/**/ {{0X3FE62092, 0XCE54AEDE} }, +/**/ {{0XBFD470C0, 0X7B764156} }, +/**/ {{0X3FA31A4C, 0X4D9ABEE7} }, +/**/ {{0X3FB5A697, 0XA899A63D} }, +/**/ {{0XBFB3F67E, 0X49FA7FB1} } }, +/**/ {{{0X3FE58000, 0XEE716C33} }, +/**/ {{0X3FE2EE63, 0X284F3FE0} }, +/**/ {{0X3FE60C24, 0X181C5720} }, +/**/ {{0XBFD46975, 0XC383B0C1} }, +/**/ {{0X3FA3C5FF, 0XC40A1A5A} }, +/**/ {{0X3FB54311, 0X0B7B3B72} }, +/**/ {{0XBFB3D5B8, 0X21700401} } }, +/**/ {{{0X3FE59FFF, 0X9825CD2A} }, +/**/ {{0X3FE30464, 0X2DEFCF40} }, +/**/ {{0X3FE5F7BF, 0X3C14A317} }, +/**/ {{0XBFD461EC, 0X227A4CDE} }, +/**/ {{0X3FA46E85, 0X6DA8D837} }, +/**/ {{0X3FB4E03C, 0X6162F4C8} }, +/**/ {{0XBFB3B410, 0X857F5976} } }, +/**/ {{{0X3FE5BFFD, 0XFE2A42CD} }, +/**/ {{0X3FE31A50, 0XA5110DC0} }, +/**/ {{0X3FE5E362, 0X33CF1268} }, +/**/ {{0XBFD45A23, 0XF68B7DBC} }, +/**/ {{0X3FA513F5, 0XDE40F0E9} }, +/**/ {{0X3FB47E12, 0XDE05901E} }, +/**/ {{0XBFB39190, 0XDA5CABB5} } }, +/**/ {{{0X3FE5E000, 0X57330799} }, +/**/ {{0X3FE3302B, 0X75253480} }, +/**/ {{0X3FE5CF0A, 0X901DA45A} }, +/**/ {{0XBFD4521D, 0X552754CF} }, +/**/ {{0X3FA5B66B, 0XBBF000BB} }, +/**/ {{0X3FB41C8B, 0XD2BAF7B2} }, +/**/ {{0XBFB36E42, 0X5F53241A} } }, +/**/ {{{0X3FE60001, 0X4D6055DA} }, +/**/ {{0X3FE345F0, 0XFF2EDA60} }, +/**/ {{0X3FE5BABB, 0XF2EA5900} }, +/**/ {{0XBFD449DA, 0XB2008754} }, +/**/ {{0X3FA655D1, 0X18F56FBB} }, +/**/ {{0X3FB3BBBB, 0X89A0C1B2} }, +/**/ {{0XBFB34A2E, 0X2E8D60FC} } }, +/**/ {{{0X3FE62001, 0X2C3809CB} }, +/**/ {{0X3FE35BA1, 0X812D5040} }, +/**/ {{0X3FE5A676, 0X671E49E9} }, +/**/ {{0XBFD4415D, 0X230E6216} }, +/**/ {{0X3FA6F22D, 0X6B05C7F7} }, +/**/ {{0X3FB35BA4, 0XCFE6B72B} }, +/**/ {{0XBFB3255D, 0X3C3BFA3B} } }, +/**/ {{{0X3FE64000, 0X87B47ECC} }, +/**/ {{0X3FE3713D, 0X69715580} }, +/**/ {{0X3FE59239, 0XC8FB0E69} }, +/**/ {{0XBFD438A5, 0XA5BD1F6E} }, +/**/ {{0X3FA78B89, 0X7F9B13CF} }, +/**/ {{0X3FB2FC49, 0X74F57C8F} }, +/**/ {{0XBFB2FFD8, 0X566CAACA} } }, +/**/ {{{0X3FE66000, 0XA746397F} }, +/**/ {{0X3FE386C5, 0X9D968940} }, +/**/ {{0X3FE57E05, 0X83073C58} }, +/**/ {{0XBFD42FB4, 0XFE3D0083} }, +/**/ {{0X3FA821F1, 0X4B9E1EEB} }, +/**/ {{0X3FB29DA9, 0X1952EE82} }, +/**/ {{0XBFB2D9A8, 0X245866A8} } }, +/**/ {{{0X3FE68000, 0XE4E3094B} }, +/**/ {{0X3FE39C39, 0XB5FE3900} }, +/**/ {{0X3FE569DA, 0X36DD131E} }, +/**/ {{0XBFD4268C, 0X74778FE0} }, +/**/ {{0X3FA8B567, 0X9AB0310F} }, +/**/ {{0X3FB23FC8, 0XF2E43205} }, +/**/ {{0XBFB2B2D5, 0X26483573} } }, +/**/ {{{0X3FE6A001, 0XE2E37787} }, +/**/ {{0X3FE3B19A, 0X27D52620} }, +/**/ {{0X3FE555B7, 0XB5D865CD} }, +/**/ {{0XBFD41D2C, 0XF1600CD3} }, +/**/ {{0X3FA945F5, 0X4B79E859} }, +/**/ {{0X3FB1E2AA, 0X46A0B02D} }, +/**/ {{0XBFB28B67, 0XB508A35B} } }, +/**/ {{{0X3FE6BFFE, 0X0DF4BBFB} }, +/**/ {{0X3FE3C6E3, 0X46F2B6E0} }, +/**/ {{0X3FE541A1, 0XB658AFBE} }, +/**/ {{0XBFD41399, 0X388DA137} }, +/**/ {{0X3FA9D387, 0XE5B3C2BA} }, +/**/ {{0X3FB18660, 0X173397F9} }, +/**/ {{0XBFB26368, 0X01DB4945} } }, +/**/ {{{0X3FE6DFFF, 0XEA406CEA} }, +/**/ {{0X3FE3DC1C, 0X1BB3D400} }, +/**/ {{0X3FE52D91, 0XD33FFE8E} }, +/**/ {{0XBFD409CF, 0X36BCFFE9} }, +/**/ {{0X3FAA5E54, 0X174405AF} }, +/**/ {{0X3FB12ACE, 0XDC041806} }, +/**/ {{0XBFB23ADE, 0X160D6557} } }, +/**/ {{{0X3FE70000, 0XED01EA65} }, +/**/ {{0X3FE3F140, 0X54E51400} }, +/**/ {{0X3FE5198C, 0X5C8B9119} }, +/**/ {{0XBFD3FFD1, 0XF2EA4FF7} }, +/**/ {{0X3FAAE643, 0X308C81CD} }, +/**/ {{0X3FB0D00C, 0X1960AAF7} }, +/**/ {{0XBFB211D1, 0XD2F50D25} } }, +/**/ {{{0X3FE72002, 0X00D515EB} }, +/**/ {{0X3FE40650, 0X983BB3E0} }, +/**/ {{0X3FE50590, 0XF2175C71} }, +/**/ {{0XBFD3F5A2, 0X361BB15C} }, +/**/ {{0X3FAB6B5F, 0X9B536AFC} }, +/**/ {{0X3FB07617, 0XA731624D} }, +/**/ {{0XBFB1E84A, 0XF1A8C054} } }, +/**/ {{{0X3FE74001, 0X1323DE6D} }, +/**/ {{0X3FE41B4B, 0X9483E720} }, +/**/ {{0X3FE4F1A1, 0X1027BA01} }, +/**/ {{0XBFD3EB41, 0XBB978C8F} }, +/**/ {{0X3FABEDA7, 0X7765626A} }, +/**/ {{0X3FB01CF9, 0X97F58C8A} }, +/**/ {{0XBFB1BE51, 0X03074348} } }, +/**/ {{{0X3FE75FFF, 0X25CAB4CA} }, +/**/ {{0X3FE43032, 0X0001D5C0} }, +/**/ {{0X3FE4DDBC, 0X4573FB6C} }, +/**/ {{0XBFD3E0B1, 0X41F21D2A} }, +/**/ {{0X3FAC6D25, 0XD1BDA00F} }, +/**/ {{0X3FAF8962, 0X5935EE68} }, +/**/ {{0XBFB193EB, 0X6F8E0689} } }, +/**/ {{{0X3FE77FFE, 0X90921F76} }, +/**/ {{0X3FE44505, 0X6CC6AF00} }, +/**/ {{0X3FE4C9E1, 0X4CFFBDAE} }, +/**/ {{0XBFD3D5F1, 0X0B247EC4} }, +/**/ {{0X3FACE9EA, 0X943F4516} }, +/**/ {{0X3FAEDA73, 0XF24A8AF1} }, +/**/ {{0XBFB16921, 0X776AAC42} } }, +/**/ {{{0X3FE79FFE, 0X47B2F83B} }, +/**/ {{0X3FE459C5, 0X35C19F20} }, +/**/ {{0X3FE4B610, 0XFC8F20BD} }, +/**/ {{0XBFD3CB02, 0X73DF2A0D} }, +/**/ {{0X3FAD63F8, 0X23C5D6DE} }, +/**/ {{0X3FAE2D31, 0X9C5116AB} }, +/**/ {{0XBFB13DFA, 0X326E2972} } }, +/**/ {{{0X3FE7BFFF, 0X2F1E79A9} }, +/**/ {{0X3FE46E71, 0XF84DF5C0} }, +/**/ {{0X3FE4A24A, 0XF586B1BD} }, +/**/ {{0XBFD3BFE6, 0X2EF81E5B} }, +/**/ {{0X3FADDB58, 0X738896F0} }, +/**/ {{0X3FAD819A, 0X2515DE78} }, +/**/ {{0XBFB1127C, 0X9026FDD0} } }, +/**/ {{{0X3FE7E001, 0X973C8D05} }, +/**/ {{0X3FE4830B, 0XF0FB9580} }, +/**/ {{0X3FE48E8F, 0X3466B08E} }, +/**/ {{0XBFD3B49D, 0X1C53A01A} }, +/**/ {{0X3FAE5013, 0X25103EED} }, +/**/ {{0X3FACD7AF, 0X5290F4AF} }, +/**/ {{0XBFB0E6AF, 0X57EF003B} } }, +/**/ {{{0X3FE7FFFF, 0X69EFC092} }, +/**/ {{0X3FE4978F, 0X431C3800} }, +/**/ {{0X3FE47AE1, 0XA3E1064A} }, +/**/ {{0XBFD3A92A, 0X666C50C4} }, +/**/ {{0X3FAEC219, 0X4098A4BE} }, +/**/ {{0X3FAC2F94, 0X2EEE57E0} }, +/**/ {{0XBFB0BA99, 0X290D5730} } }, +/**/ {{{0X3FE82001, 0XC52B5232} }, +/**/ {{0X3FE4AC01, 0XD2B83340} }, +/**/ {{0X3FE4673C, 0XD31B7CF5} }, +/**/ {{0XBFD39D8B, 0XC67D05F0} }, +/**/ {{0X3FAF3192, 0X2A81B5D5} }, +/**/ {{0X3FAB891B, 0X8AA20E90} }, +/**/ {{0XBFB08E40, 0X7ADCEFD6} } }, +/**/ {{{0X3FE84000, 0XBD4D4E3F} }, +/**/ {{0X3FE4C05E, 0X9B1DBC60} }, +/**/ {{0X3FE453A5, 0XC8D629F7} }, +/**/ {{0XBFD391C5, 0X13E9EF47} }, +/**/ {{0X3FAF9E69, 0X17383D6B} }, +/**/ {{0X3FAAE471, 0X278E21B9} }, +/**/ {{0XBFB061AB, 0X9CF54D10} } }, +/**/ {{{0X3FE86001, 0X8C869CBD} }, +/**/ {{0X3FE4D4A8, 0XFD2285A0} }, +/**/ {{0X3FE44019, 0X79B82471} }, +/**/ {{0XBFD385D5, 0X5C3E2929} }, +/**/ {{0X3FB0045B, 0X7B2C8FF2} }, +/**/ {{0X3FAA417C, 0X39D7CA4F} }, +/**/ {{0XBFB034E0, 0XB767B7D4} } }, +/**/ {{{0X3FE87FFE, 0XB5DB3710} }, +/**/ {{0X3FE4E8DD, 0X8B93BCA0} }, +/**/ {{0X3FE42C9B, 0X66C6E6BF} }, +/**/ {{0XBFD379BF, 0XA32EE2A1} }, +/**/ {{0X3FB03838, 0X6187FE0F} }, +/**/ {{0X3FA9A05A, 0X8B3A0B33} }, +/**/ {{0XBFB007E5, 0XCAEE03A9} } }, +/**/ {{{0X3FE8A000, 0X863C77E3} }, +/**/ {{0X3FE4FD01, 0X8FCD1E80} }, +/**/ {{0X3FE41926, 0XA8A8093F} }, +/**/ {{0XBFD36D81, 0XB5EE344D} }, +/**/ {{0X3FB06ADC, 0X2841F292} }, +/**/ {{0X3FA900E4, 0X2484560B} }, +/**/ {{0XBFAFB581, 0X62792F0A} } }, +/**/ {{{0X3FE8BFFF, 0X0ED982AF} }, +/**/ {{0X3FE51110, 0X16E28AC0} }, +/**/ {{0X3FE405C0, 0X389112EE} }, +/**/ {{0XBFD3611F, 0X89D38DC7} }, +/**/ {{0X3FB09C3D, 0XB450B9F7} }, +/**/ {{0X3FA86342, 0X312D0C4A} }, +/**/ {{0XBFAF5AEE, 0X3A6CA012} } }, +/**/ {{{0X3FE8E000, 0X02C3AEAE} }, +/**/ {{0X3FE5250C, 0XC0AB0A40} }, +/**/ {{0X3FE3F264, 0XC65593C5} }, +/**/ {{0XBFD35497, 0XD82BE900} }, +/**/ {{0X3FB0CC69, 0X68546D39} }, +/**/ {{0X3FA7C759, 0XDB8499FD} }, +/**/ {{0XBFAF001D, 0X36A32337} } }, +/**/ {{{0X3FE90000, 0XECBFA97B} }, +/**/ {{0X3FE538F6, 0X0E8D4EE0} }, +/**/ {{0X3FE3DF15, 0XF4119333} }, +/**/ {{0XBFD347EC, 0X7D2149F4} }, +/**/ {{0X3FB0FB5E, 0XFA921D3C} }, +/**/ {{0X3FA72D38, 0X69693E89} }, +/**/ {{0XBFAEA519, 0X23A0F5F3} } }, +/**/ {{{0X3FE91FFF, 0XD251C01C} }, +/**/ {{0X3FE54CCA, 0XD3F3BD20} }, +/**/ {{0X3FE3CBD5, 0X1554DD15} }, +/**/ {{0XBFD33B1F, 0X2BC94245} }, +/**/ {{0X3FB1291F, 0X2FC4C3F6} }, +/**/ {{0X3FA694E8, 0X1B7A765C} }, +/**/ {{0XBFAE49EC, 0X826E86F6} } }, +/**/ {{{0X3FE94001, 0XD90AF4E6} }, +/**/ {{0X3FE5608E, 0X4D4EC640} }, +/**/ {{0X3FE3B89F, 0X3445EF72} }, +/**/ {{0XBFD32E2E, 0XB7BBD79A} }, +/**/ {{0X3FB155B4, 0XE401D071} }, +/**/ {{0X3FA5FE51, 0X3A256F1C} }, +/**/ {{0XBFADEEA1, 0X890FF662} } }, +/**/ {{{0X3FE96001, 0X04FD6C17} }, +/**/ {{0X3FE5743C, 0XD5673C20} }, +/**/ {{0X3FE3A578, 0X09EBC6E2} }, +/**/ {{0XBFD3211E, 0X6DA5039C} }, +/**/ {{0X3FB1811B, 0X4E62286B} }, +/**/ {{0X3FA56990, 0X71BECE9D} }, +/**/ {{0XBFAD9342, 0X23911641} } }, +/**/ {{{0X3FE98000, 0X2D214B82} }, +/**/ {{0X3FE587D8, 0X3B0D6120} }, +/**/ {{0X3FE3925E, 0X01EAAC3E} }, +/**/ {{0XBFD313EE, 0X08425504} }, +/**/ {{0X3FB1AB5A, 0X02BDB571} }, +/**/ {{0X3FA4D698, 0X9EBD70B8} }, +/**/ {{0XBFAD37D7, 0XF482965A} } }, +/**/ {{{0X3FE99FFD, 0XEB980651} }, +/**/ {{0X3FE59B5F, 0XB16BA7A0} }, +/**/ {{0X3FE37F52, 0X10B1AB7A} }, +/**/ {{0XBFD3069E, 0XF993D676} }, +/**/ {{0X3FB1D472, 0XCDED25A8} }, +/**/ {{0X3FA44570, 0X2D0ABD9A} }, +/**/ {{0XBFACDC6C, 0X56221AA1} } }, +/**/ {{{0X3FE9BFFF, 0XE5504053} }, +/**/ {{0X3FE5AED6, 0XB55DE6A0} }, +/**/ {{0X3FE36C50, 0XFA91C51E} }, +/**/ {{0XBFD2F92F, 0XBE311E56} }, +/**/ {{0X3FB1FC70, 0X5BE3AF05} }, +/**/ {{0X3FA3B5FD, 0XACD5CDC7} }, +/**/ {{0XBFAC8108, 0X5ADBB9B8} } }, +/**/ {{{0X3FE9E001, 0X6E60A234} }, +/**/ {{0X3FE5C23A, 0X79ACD480} }, +/**/ {{0X3FE3595D, 0XA5FAB2EA} }, +/**/ {{0XBFD2EBA3, 0X1DDECEEA} }, +/**/ {{0X3FB22350, 0X35736518} }, +/**/ {{0X3FA32856, 0X22F9FD28} }, +/**/ {{0XBFAC25B4, 0XCE8B2259} } }, +/**/ {{{0X3FE9FFFF, 0XB685741B} }, +/**/ {{0X3FE5D589, 0X5AD40460} }, +/**/ {{0X3FE34679, 0XD832B8D3} }, +/**/ {{0XBFD2DDFB, 0X230EDA41} }, +/**/ {{0X3FB24912, 0XB23C0BA2} }, +/**/ {{0X3FA29C85, 0X4C4E86DA} }, +/**/ {{0XBFABCA7A, 0X37002A55} } }, +/**/ {{{0X3FEA2001, 0X9D59B943} }, +/**/ {{0X3FE5E8C7, 0X8C187EA0} }, +/**/ {{0X3FE333A1, 0X9EDE2183} }, +/**/ {{0XBFD2D035, 0XB0043779} }, +/**/ {{0X3FB26DC3, 0X7AB9110C} }, +/**/ {{0X3FA2126C, 0X959CFC0E} }, +/**/ {{0XBFAB6F60, 0XD556233E} } }, +/**/ {{{0X3FEA3FFF, 0XBE9E153F} }, +/**/ {{0X3FE5FBF0, 0XA9C08AE0} }, +/**/ {{0X3FE320D9, 0X6F7861AA} }, +/**/ {{0XBFD2C256, 0XC2200F18} }, +/**/ {{0X3FB2915D, 0XA6795293} }, +/**/ {{0X3FA18A2B, 0X256A8FDE} }, +/**/ {{0XBFAB1470, 0XA67A4E89} } }, +/**/ {{{0X3FEA5FFE, 0X7A23A1CE} }, +/**/ {{0X3FE60F07, 0X63200600} }, +/**/ {{0X3FE30E1E, 0XD13D395E} }, +/**/ {{0XBFD2B45D, 0X44403932} }, +/**/ {{0X3FB2B3E9, 0XC967F013} }, +/**/ {{0X3FA103AD, 0X35D002B8} }, +/**/ {{0XBFAAB9B1, 0X6496A8F1} } }, +/**/ {{{0X3FEA8001, 0X57F250B8} }, +/**/ {{0X3FE6220D, 0XDD6453A0} }, +/**/ {{0X3FE2FB6F, 0XCFFFCC1E} }, +/**/ {{0XBFD2A648, 0X6F8D8291} }, +/**/ {{0X3FB2D56F, 0X03654CC3} }, +/**/ {{0X3FA07EE3, 0X4BB6E7A6} }, +/**/ {{0XBFAA5F2A, 0X87992F03} } }, +/**/ {{{0X3FEAA000, 0XDD839D49} }, +/**/ {{0X3FE634FF, 0XB412C9A0} }, +/**/ {{0X3FE2E8D0, 0XE2D59E01} }, +/**/ {{0XBFD2981C, 0X5467CFDD} }, +/**/ {{0X3FB2F5E8, 0XFF1FADB5} }, +/**/ {{0X3F9FF7D6, 0XA3BA803C} }, +/**/ {{0XBFAA04E3, 0X46AF8DB7} } }, +/**/ {{{0X3FEAC000, 0X770DF220} }, +/**/ {{0X3FE647DE, 0XFEF70020} }, +/**/ {{0X3FE2D640, 0X220AFF7F} }, +/**/ {{0XBFD289D8, 0X36F9E74F} }, +/**/ {{0X3FB3155E, 0XE509140A} }, +/**/ {{0X3F9EF56B, 0X61AB0B7F} }, +/**/ {{0XBFA9AAE2, 0X98CE391F} } }, +/**/ {{{0X3FEAE001, 0X125BBE48} }, +/**/ {{0X3FE65AAC, 0X57A24D20} }, +/**/ {{0X3FE2C3BD, 0X1BFB3559} }, +/**/ {{0XBFD27B7C, 0X6DDE55DD} }, +/**/ {{0X3FB333D5, 0X15C4C270} }, +/**/ {{0X3F9DF67A, 0X9BAC4ECF} }, +/**/ {{0XBFA9512F, 0X363A972B} } }, +/**/ {{{0X3FEAFFFE, 0X7C321839} }, +/**/ {{0X3FE66D65, 0X569B83C0} }, +/**/ {{0X3FE2B14A, 0X53FBF8D9} }, +/**/ {{0XBFD26D0B, 0X9CFA03CE} }, +/**/ {{0X3FB3514B, 0X2CAA2E0C} }, +/**/ {{0X3F9CFB22, 0X4597BE9A} }, +/**/ {{0XBFA8F7CF, 0X99110022} } }, +/**/ {{{0X3FEB1FFE, 0X75486924} }, +/**/ {{0X3FE6800D, 0X68CEFB40} }, +/**/ {{0X3FE29EE4, 0X8E6AA814} }, +/**/ {{0XBFD25E83, 0XE8AFA7EB} }, +/**/ {{0X3FB36DC9, 0XFB0E8AC8} }, +/**/ {{0X3F9C0331, 0XAD5D66CA} }, +/**/ {{0XBFA89EC9, 0XFEDB1E8B} } }, +/**/ {{{0X3FEB4001, 0X5FB8DEB8} }, +/**/ {{0X3FE692A4, 0XD137C500} }, +/**/ {{0X3FE28C8B, 0XABFF668E} }, +/**/ {{0XBFD24FE5, 0XD8E71E0A} }, +/**/ {{0X3FB38955, 0X1297317A} }, +/**/ {{0X3F9B0EA3, 0X1D844655} }, +/**/ {{0XBFA84624, 0X6914067D} } }, +/**/ {{{0X3FEB6000, 0X386C27B9} }, +/**/ {{0X3FE6A527, 0X8CDF6FC0} }, +/**/ {{0X3FE27A43, 0XC5758DB8} }, +/**/ {{0XBFD24135, 0X59CADCE0} }, +/**/ {{0X3FB3A3E9, 0XEE34AE91} }, +/**/ {{0X3F9A1DA8, 0X1C5FFF05} }, +/**/ {{0XBFA7EDE4, 0X9EC8AAC6} } }, +/**/ {{{0X3FEB8000, 0XD1EFDDB3} }, +/**/ {{0X3FE6B799, 0X0ACCB660} }, +/**/ {{0X3FE26809, 0X9983AAB2} }, +/**/ {{0XBFD23270, 0X76047E08} }, +/**/ {{0X3FB3BD90, 0XF132139B} }, +/**/ {{0X3F993010, 0X58DEB3E1} }, +/**/ {{0XBFA79610, 0X2D194CE9} } }, +/**/ {{{0X3FEB9FFE, 0X42CC4047} }, +/**/ {{0X3FE6C9F6, 0X86445E60} }, +/**/ {{0X3FE255E0, 0X069F871F} }, +/**/ {{0XBFD2239A, 0X25461639} }, +/**/ {{0X3FB3D649, 0XA926C127} }, +/**/ {{0X3F9845FB, 0XC5A21F70} }, +/**/ {{0XBFA73EAC, 0X68E20BE6} } }, +/**/ {{{0X3FEBC001, 0X951AEAAD} }, +/**/ {{0X3FE6DC45, 0X3C4E45A0} }, +/**/ {{0X3FE243C1, 0XFF6573B0} }, +/**/ {{0XBFD214AE, 0XE38FA7E7} }, +/**/ {{0X3FB3EE1E, 0X5EA1330F} }, +/**/ {{0X3F975F24, 0X2BCCE6DF} }, +/**/ {{0XBFA6E7BE, 0X6F3902C5} } }, +/**/ {{{0X3FEBDFFE, 0X6616FE11} }, +/**/ {{0X3FE6EE7E, 0X27106FE0} }, +/**/ {{0X3FE231B6, 0X97B587F0} }, +/**/ {{0XBFD205B5, 0X240FEF32} }, +/**/ {{0X3FB40509, 0X44EB818C} }, +/**/ {{0X3F967BDE, 0X108160F9} }, +/**/ {{0XBFA6914B, 0X271D18AD} } }, +/**/ {{{0X3FEBFFFF, 0X54511C72} }, +/**/ {{0X3FE700A7, 0X643BBB40} }, +/**/ {{0X3FE21FB7, 0XE1823C8B} }, +/**/ {{0XBFD1F6A8, 0X9A854F7A} }, +/**/ {{0X3FB41B15, 0X71F04837} }, +/**/ {{0X3F959BD8, 0XBBD10F7C} }, +/**/ {{0XBFA63B57, 0X41F03711} } }, +/**/ {{{0X3FEC2000, 0XC537593E} }, +/**/ {{0X3FE712BE, 0XF36D6400} }, +/**/ {{0X3FE20DC7, 0XF754B2D5} }, +/**/ {{0XBFD1E78B, 0X9D24DBED} }, +/**/ {{0X3FB43043, 0X94F485E0} }, +/**/ {{0X3F94BF29, 0X122A6884} }, +/**/ {{0XBFA5E5E7, 0X3D2AA4E9} } }, +/**/ {{{0X3FEC4000, 0XDDD35719} }, +/**/ {{0X3FE724C3, 0XD7FA3000} }, +/**/ {{0X3FE1FBE7, 0XF2A8B1BF} }, +/**/ {{0XBFD1D85F, 0XB25DDDF6} }, +/**/ {{0X3FB44495, 0XD2E3B20F} }, +/**/ {{0X3F93E5D6, 0X7FCC1B30} }, +/**/ {{0XBFA590FF, 0X62D0D00F} } }, +/**/ {{{0X3FEC6000, 0X402375B6} }, +/**/ {{0X3FE736B6, 0X7DFF3720} }, +/**/ {{0X3FE1EA17, 0X86C92387} }, +/**/ {{0XBFD1C925, 0X31DDFC58} }, +/**/ {{0X3FB4580F, 0XF8B6CBC2} }, +/**/ {{0X3F930FD7, 0X00CE998E} }, +/**/ {{0XBFA53CA3, 0XCB299E5F} } }, +/**/ {{{0X3FEC7FFF, 0X19904FE4} }, +/**/ {{0X3FE74897, 0X0F395860} }, +/**/ {{0X3FE1D856, 0XA825BA33} }, +/**/ {{0XBFD1B9DC, 0XA75E0FC5} }, +/**/ {{0X3FB46AB5, 0X79F8FD7D} }, +/**/ {{0X3F923D23, 0XA5A90AFE} }, +/**/ {{0XBFA4E8D8, 0X5D2F574B} } }, +/**/ {{{0X3FEC9FFE, 0XF9E2409D} }, +/**/ {{0X3FE75A66, 0X79E7F1C0} }, +/**/ {{0X3FE1C6A4, 0X8740D2E9} }, +/**/ {{0XBFD1AA85, 0XF198392C} }, +/**/ {{0X3FB47C8A, 0X808C583A} }, +/**/ {{0X3F916DAC, 0X857F2526} }, +/**/ {{0XBFA495A0, 0XD0477576} } }, +/**/ {{{0X3FECC001, 0XE038EF72} }, +/**/ {{0X3FE76C25, 0XE6815140} }, +/**/ {{0X3FE1B500, 0X19BDADF8} }, +/**/ {{0XBFD19B20, 0XB4A469AE} }, +/**/ {{0X3FB48D93, 0X42387EA2} }, +/**/ {{0X3F90A15F, 0X7305BAF5} }, +/**/ {{0XBFA44300, 0XACAE4E17} } }, +/**/ {{{0X3FECDFFE, 0XEB72037F} }, +/**/ {{0X3FE77DD0, 0X7A7A4AA0} }, +/**/ {{0X3FE1A36E, 0X4F1F6702} }, +/**/ {{0XBFD18BB1, 0XD0992CF8} }, +/**/ {{0X3FB49DCE, 0X5AA4990D} }, +/**/ {{0X3F8FB0DD, 0X63759665} }, +/**/ {{0XBFA3F0FB, 0X4D2F0C0F} } }, +/**/ {{{0X3FECFFFF, 0XEA4839ED} }, +/**/ {{0X3FE78F6B, 0XB17088C0} }, +/**/ {{0X3FE191E9, 0XCF32122F} }, +/**/ {{0XBFD17C35, 0X220400AC} }, +/**/ {{0X3FB4AD44, 0X0A159641} }, +/**/ {{0X3F8E252C, 0X80894CA9} }, +/**/ {{0XBFA39F93, 0XDF89C265} } }, +/**/ {{{0X3FED1FFD, 0XEC3EC8B2} }, +/**/ {{0X3FE7A0F3, 0XC8C6C880} }, +/**/ {{0X3FE18076, 0X729F01D6} }, +/**/ {{0XBFD16CAE, 0X98515540} }, +/**/ {{0X3FB4BBF4, 0X1B0933FF} }, +/**/ {{0X3F8C9FF5, 0XE09A60CD} }, +/**/ {{0XBFA34ECD, 0X662A5704} } }, +/**/ {{{0X3FED3FFF, 0X7084EDD4} }, +/**/ {{0X3FE7B26C, 0X5F02F220} }, +/**/ {{0X3FE16F10, 0XB9973206} }, +/**/ {{0XBFD15D1B, 0X9E1E0A54} }, +/**/ {{0X3FB4C9E4, 0XAC2C9A30} }, +/**/ {{0X3F8B20DD, 0XEFCE76CC} }, +/**/ {{0XBFA2FEAA, 0XB888BC37} } }, +/**/ {{{0X3FED5FFE, 0X8D728E7C} }, +/**/ {{0X3FE7C3D2, 0X488D7E80} }, +/**/ {{0X3FE15DBB, 0XE622A5A7} }, +/**/ {{0XBFD14D7F, 0XA305CEB2} }, +/**/ {{0X3FB4D716, 0X417BF1C7} }, +/**/ {{0X3F89A81E, 0XE19FE239} }, +/**/ {{0XBFA2AF2E, 0X84DDAD07} } }, +/**/ {{{0X3FED7FFF, 0X70AA3B03} }, +/**/ {{0X3FE7D527, 0XDB239580} }, +/**/ {{0X3FE14C75, 0XBE4FEA01} }, +/**/ {{0XBFD13DD9, 0X2AD706AA} }, +/**/ {{0X3FB4E38D, 0XB49D32AA} }, +/**/ {{0X3F88357A, 0X37DF2B6D} }, +/**/ {{0XBFA2605B, 0X507CD77B} } }, +/**/ {{{0X3FED9FFF, 0X1434FBA3} }, +/**/ {{0X3FE7E66B, 0X82C8A720} }, +/**/ {{0X3FE13B3F, 0XED9B7FED} }, +/**/ {{0XBFD12E2A, 0X3AC9D646} }, +/**/ {{0X3FB4EF4C, 0XE7B01CF5} }, +/**/ {{0X3F86C905, 0XD25FD52D} }, +/**/ {{0XBFA21233, 0X798666EF} } }, +/**/ {{{0X3FEDBFFE, 0XA8C8DE8C} }, +/**/ {{0X3FE7F79D, 0XF4A0A520} }, +/**/ {{0X3FE12A19, 0XD7FC2119} }, +/**/ {{0XBFD11E72, 0XC6BE19DF} }, +/**/ {{0X3FB4FA57, 0X634E1B91} }, +/**/ {{0X3F8562A6, 0X47F96DF5} }, +/**/ {{0XBFA1C4B9, 0X373AF599} } }, +/**/ {{{0X3FEDE000, 0X26573DF5} }, +/**/ {{0X3FE808C0, 0X4DBCB960} }, +/**/ {{0X3FE11902, 0X7903E4B9} }, +/**/ {{0XBFD10EB2, 0X5CDFED06} }, +/**/ {{0X3FB504B0, 0XCCA681FA} }, +/**/ {{0X3F840238, 0X6F3CDE09} }, +/**/ {{0XBFA177EE, 0X9BA8FA6A} } }, +/**/ {{{0X3FEDFFFE, 0X35009B66} }, +/**/ {{0X3FE819CF, 0XC2CB5340} }, +/**/ {{0X3FE107FC, 0XB1C942B5} }, +/**/ {{0XBFD0FEEC, 0X230D7D92} }, +/**/ {{0X3FB50E5A, 0X75C5B4F1} }, +/**/ {{0X3F82A7E8, 0XE3C139D8} }, +/**/ {{0XBFA12BD5, 0X93FA642B} } }, +/**/ {{{0X3FEE2000, 0X492D4C68} }, +/**/ {{0X3FE82AD0, 0X5CCB8680} }, +/**/ {{0X3FE0F704, 0X928E55DF} }, +/**/ {{0XBFD0EF1C, 0XEE0B0721} }, +/**/ {{0X3FB51759, 0X937BFB74} }, +/**/ {{0X3F815359, 0X2BC9FDDB} }, +/**/ {{0XBFA0E06F, 0XEA1D1824} } }, +/**/ {{{0X3FEE4000, 0X9412BB65} }, +/**/ {{0X3FE83BBF, 0X14001A60} }, +/**/ {{0X3FE0E61D, 0X37F485DA} }, +/**/ {{0XBFD0DF48, 0X1B2BD37D} }, +/**/ {{0X3FB51FAF, 0X64024D14} }, +/**/ {{0X3F8004B9, 0X9B849698} }, +/**/ {{0XBFA095BF, 0X450A2434} } }, +/**/ {{{0X3FEE5FFF, 0X4758EF2F} }, +/**/ {{0X3FE84C9C, 0X1531C180} }, +/**/ {{0X3FE0D546, 0X8B7FECE7} }, +/**/ {{0XBFD0CF6E, 0X105BFE1E} }, +/**/ {{0X3FB5275E, 0XF9C5E03A} }, +/**/ {{0X3F7D77F2, 0X17AA1137} }, +/**/ {{0XBFA04BC5, 0X2A6891E1} } }, +/**/ {{{0X3FEE8000, 0X380F819F} }, +/**/ {{0X3FE85D69, 0X74CCC060} }, +/**/ {{0X3FE0C47E, 0X8F1DA5B5} }, +/**/ {{0XBFD0BF8D, 0X62AD700F} }, +/**/ {{0X3FB52E6C, 0X1F3FBC2B} }, +/**/ {{0X3F7AF1C3, 0XEE24AD7D} }, +/**/ {{0XBFA00282, 0XFECE26C9} } }, +/**/ {{{0X3FEEA000, 0XA6D8CB7B} }, +/**/ {{0X3FE86E25, 0XD00E3A60} }, +/**/ {{0X3FE0B3C6, 0XBA314D62} }, +/**/ {{0XBFD0AFA7, 0XE7CB2D84} }, +/**/ {{0X3FB534D9, 0X08E9071F} }, +/**/ {{0X3F787704, 0X4CE5E5C9} }, +/**/ {{0XBF9F73F4, 0X0EB7C9D5} } }, +/**/ {{{0X3FEEC000, 0X5A13BA60} }, +/**/ {{0X3FE87ED1, 0X19B163E0} }, +/**/ {{0X3FE0A31F, 0X2EBB7AD7} }, +/**/ {{0XBFD09FBE, 0X33A3FCE1} }, +/**/ {{0X3FB53AA8, 0X89D9AF5D} }, +/**/ {{0X3F760799, 0XF7F7040B} }, +/**/ {{0XBF9EE456, 0XD3F0B3FB} } }, +/**/ {{{0X3FEEDFFF, 0X58F8DD18} }, +/**/ {{0X3FE88F6B, 0X6681CA80} }, +/**/ {{0X3FE09287, 0XEC4360B3} }, +/**/ {{0XBFD08FD0, 0XB7CE07E5} }, +/**/ {{0X3FB53FDD, 0X7BDEDD3F} }, +/**/ {{0X3F73A366, 0X70C52E66} }, +/**/ {{0XBF9E5630, 0X5DCA7315} } }, +/**/ {{{0X3FEEFFFF, 0XBE033400} }, +/**/ {{0X3FE89FF5, 0XDD4D7960} }, +/**/ {{0X3FE081FF, 0XDFFE15BD} }, +/**/ {{0XBFD07FDE, 0XDAE56C0F} }, +/**/ {{0X3FB5447A, 0XF84D6F5D} }, +/**/ {{0X3F714A24, 0X7982941E} }, +/**/ {{0XBF9DC982, 0X81E68835} } }, +/**/ {{{0X3FEF2001, 0XE6B5125D} }, +/**/ {{0X3FE8B070, 0XBBE88160} }, +/**/ {{0X3FE07186, 0XDF7122E2} }, +/**/ {{0XBFD06FE8, 0XDE905325} }, +/**/ {{0X3FB54883, 0XB5DEEC7A} }, +/**/ {{0X3F6DF762, 0XB4A186D5} }, +/**/ {{0XBF9D3E4E, 0XDE20F495} } }, +/**/ {{{0X3FEF3FFD, 0XF770E0DB} }, +/**/ {{0X3FE8C0D8, 0X09E96380} }, +/**/ {{0X3FE06120, 0XF5A576A9} }, +/**/ {{0XBFD05FF3, 0X1D2912FF} }, +/**/ {{0X3FB54BF9, 0X8CD1001F} }, +/**/ {{0X3F6970FC, 0X6E90DC16} }, +/**/ {{0XBF9CB496, 0XD8EB587E} } }, +/**/ {{{0X3FEF5FFE, 0X4E16DA33} }, +/**/ {{0X3FE8D131, 0X29BCCDC0} }, +/**/ {{0X3FE050C8, 0XD33BA4E9} }, +/**/ {{0XBFD04FF8, 0XD74C83D2} }, +/**/ {{0X3FB54EE0, 0X592BB252} }, +/**/ {{0X3F64FF61, 0X7193EEB5} }, +/**/ {{0XBF9C2C5B, 0XA459AC86} } }, +/**/ {{{0X3FEF8000, 0X4576FF2E} }, +/**/ {{0X3FE8E17A, 0XCCE443A0} }, +/**/ {{0X3FE0407F, 0XD8A97B6C} }, +/**/ {{0XBFD03FFB, 0XC91B3E55} }, +/**/ {{0X3FB5513A, 0X5F3357F7} }, +/**/ {{0X3F60A2BA, 0X14C92B53} }, +/**/ {{0XBF9BA59E, 0X3E70DF71} } }, +/**/ {{{0X3FEF9FFF, 0X39B6A330} }, +/**/ {{0X3FE8F1B2, 0XA7F515A0} }, +/**/ {{0X3FE03048, 0X63064158} }, +/**/ {{0XBFD02FFE, 0XACBAADA8} }, +/**/ {{0X3FB55309, 0XF27448C0} }, +/**/ {{0X3F58B6D6, 0X4850006B} }, +/**/ {{0XBF9B205F, 0X742323DF} } }, +/**/ {{{0X3FEFC001, 0XAA76C0B9} }, +/**/ {{0X3FE901DC, 0X15D66D80} }, +/**/ {{0X3FE0201F, 0X28D9B4AA} }, +/**/ {{0XBFD01FFE, 0XA98D4C38} }, +/**/ {{0X3FB55452, 0X089780F8} }, +/**/ {{0X3F5050B5, 0X7F35C5BB} }, +/**/ {{0XBF9A9C9F, 0XE19247AF} } }, +/**/ {{{0X3FEFDFFE, 0X39A592CA} }, +/**/ {{0X3FE911F2, 0X6D88A780} }, +/**/ {{0X3FE01008, 0XE40C6538} }, +/**/ {{0XBFD01000, 0XD31688DE} }, +/**/ {{0X3FB55514, 0XE32F1816} }, +/**/ {{0X3F402A15, 0X4E1628D2} }, +/**/ {{0XBF9A1A5F, 0XF4FAF5A0} } }, +/**/ {{{0X3FEFF801, 0X8E92D1B0} }, +/**/ {{0X3FE91DFB, 0X9BB4BF00} }, +/**/ {{0X3FE003FF, 0XB884C5A9} }, +/**/ {{0XBFD003FF, 0X3876A954} }, +/**/ {{0X3FB55551, 0X5539DDFB} }, +/**/ {{0X3F2007E7, 0X7B95E6C2} }, +/**/ {{0XBF99B9A7, 0X18A3BA58} } }, + }; + + static const number + hij[241][16] = { /* x0,hij for (1/16,1) */ +/**/ {{{0x3fb04000, 0x00000000} }, +/**/ {{0x3fb03a6d, 0x1c06693d} }, +/**/ {{0xbc428a02, 0xd4e7f128} }, +/**/ {{0x3fefdf1f, 0xe92592ae} }, +/**/ {{0x3c88bfc0, 0xb5490162} }, +/**/ {{0xbfb01ead, 0x8f7e4151} }, +/**/ {{0xbc5395e8, 0x0b64d205} }, +/**/ {{0xbfd4d29f, 0x433dd49b} }, +/**/ {{0xbc75b19d, 0x4aa42633} }, +/**/ {{0x3fafda41, 0xce35961d} }, +/**/ {{0x3c4e6a5f, 0x425d7696} }, +/**/ {{0x3fc814dd, 0x6c1bb5e2} }, +/**/ {{0xbfaf4cb7, 0x2b33739f} }, +/**/ {{0xbfc048b2, 0xc267d8ec} }, +/**/ {{0x3fae9649, 0xe8ababc6} }, +/**/ {{0x3fb78293, 0xfe802692} } }, +/**/ {{{0x3fb10000, 0x00000000} }, +/**/ {{0x3fb0f99e, 0xa71d52a7} }, +/**/ {{0xbc22069f, 0xeec3624f} }, +/**/ {{0x3fefdc08, 0x9a49d2a9} }, +/**/ {{0x3c7780f7, 0x68b2ce25} }, +/**/ {{0xbfb0d9de, 0x9da73e1d} }, +/**/ {{0x3c4ebf46, 0xa1a487bf} }, +/**/ {{0xbfd4c669, 0xd13ea108} }, +/**/ {{0x3c7354bc, 0xebb4528c} }, +/**/ {{0x3fb0a137, 0x789374c1} }, +/**/ {{0xbc56c223, 0xc3f2c5c2} }, +/**/ {{0x3fc7f0e7, 0x79c60cda} }, +/**/ {{0xbfb05062, 0xcdcc7b81} }, +/**/ {{0xbfc019e4, 0xc5266783} }, +/**/ {{0x3fafd0b2, 0xf2540289} }, +/**/ {{0x3fb71107, 0xf6d3cd8a} } }, +/**/ {{{0x3fb20000, 0x00000000} }, +/**/ {{0x3fb1f86d, 0xbf082d59} }, +/**/ {{0xbc4095dc, 0x7732ef81} }, +/**/ {{0x3fefd7b3, 0x01722b81} }, +/**/ {{0xbc5e618c, 0x8a212e02} }, +/**/ {{0xbfb1d2c5, 0xee4e9cfa} }, +/**/ {{0x3c426273, 0x29abece0} }, +/**/ {{0xbfd4b551, 0x37eb7f46} }, +/**/ {{0x3c73b360, 0x01d8bf12} }, +/**/ {{0x3fb18fa7, 0x6adb6a7c} }, +/**/ {{0xbc5c00d8, 0x398999ad} }, +/**/ {{0x3fc7bea5, 0xf4a7cff3} }, +/**/ {{0xbfb13008, 0x61f84829} }, +/**/ {{0xbfbfb14f, 0xa8e135a1} }, +/**/ {{0x3fb0b532, 0x4324f177} }, +/**/ {{0x3fb6734a, 0x3498dd9d} } }, +/**/ {{{0x3fb30000, 0x00000000} }, +/**/ {{0x3fb2f719, 0x318a4a9a} }, +/**/ {{0x3c03fd17, 0x79b9801f} }, +/**/ {{0x3fefd31f, 0x48e238fe} }, +/**/ {{0xbc876a7a, 0xd8c45327} }, +/**/ {{0xbfb2cada, 0x852096e2} }, +/**/ {{0x3c460860, 0x11efd787} }, +/**/ {{0xbfd4a34b, 0x2e476a39} }, +/**/ {{0x3c7254f2, 0xeb11ee51} }, +/**/ {{0x3fb27c13, 0xc54ae225} }, +/**/ {{0x3c513096, 0x4ae66f0c} }, +/**/ {{0x3fc789ca, 0xef0d59d0} }, +/**/ {{0xbfb20c06, 0x6d9aaa8c} }, +/**/ {{0xbfbf2885, 0x846ba912} }, +/**/ {{0x3fb17c5f, 0xc697ef5e} }, +/**/ {{0x3fb5ce93, 0xcad31e6e} } }, +/**/ {{{0x3fb40000, 0x00000000} }, +/**/ {{0x3fb3f59f, 0x0e7c559d} }, +/**/ {{0x3c5ac4ce, 0x285df847} }, +/**/ {{0x3fefce4d, 0xa6ab93e9} }, +/**/ {{0xbc6be46b, 0x18a97736} }, +/**/ {{0xbfb3c211, 0x4d22b635} }, +/**/ {{0x3c42033c, 0x6950679f} }, +/**/ {{0xbfd49059, 0xc4d74033} }, +/**/ {{0x3c57dd7c, 0xd7e376aa} }, +/**/ {{0x3fb36662, 0xc0896a7c} }, +/**/ {{0xbc36cf6a, 0xd79232cf} }, +/**/ {{0x3fc75261, 0xa13a97a2} }, +/**/ {{0xbfb2e431, 0x5fdd1509} }, +/**/ {{0xbfbe9999, 0x6e52db32} }, +/**/ {{0x3fb23da4, 0xb0a71e9f} }, +/**/ {{0x3fb52335, 0xe3bc8178} } }, +/**/ {{{0x3fb50000, 0x00000000} }, +/**/ {{0x3fb4f3fd, 0x677292fb} }, +/**/ {{0x3c4008d3, 0x6264979e} }, +/**/ {{0x3fefc93e, 0x53a1ee0d} }, +/**/ {{0xbc64421a, 0x20fd2bdf} }, +/**/ {{0xbfb4b85f, 0x4aba88e3} }, +/**/ {{0x3c54f184, 0x3c9d1e89} }, +/**/ {{0xbfd47c7f, 0x25ae4668} }, +/**/ {{0xbc7d7581, 0x816630d1} }, +/**/ {{0x3fb44e7b, 0x07f85056} }, +/**/ {{0x3c56d63c, 0x910bdf4f} }, +/**/ {{0x3fc71875, 0xc439029c} }, +/**/ {{0xbfb3b85e, 0xf2bcfa10} }, +/**/ {{0xbfbe04bb, 0x9707b205} }, +/**/ {{0x3fb2f8c6, 0x95e3e0cc} }, +/**/ {{0x3fb47184, 0x8093431b} } }, +/**/ {{{0x3fb60000, 0x00000000} }, +/**/ {{0x3fb5f232, 0x4fd2d7b2} }, +/**/ {{0x3c58a8da, 0x4401318e} }, +/**/ {{0x3fefc3f1, 0x8b549418} }, +/**/ {{0x3c34d896, 0x836f8130} }, +/**/ {{0xbfb5adb9, 0x9cdd92e7} }, +/**/ {{0x3c4d4161, 0xeb397cc3} }, +/**/ {{0xbfd467bd, 0x93f8f1dc} }, +/**/ {{0xbc609d7b, 0xffc760ad} }, +/**/ {{0x3fb53443, 0xbea6b2fe} }, +/**/ {{0x3c5eb03c, 0x4b24f5db} }, +/**/ {{0x3fc6dc13, 0x8de3d005} }, +/**/ {{0xbfb48866, 0x37d2d99d} }, +/**/ {{0xbfbd6a1d, 0xf6663fcb} }, +/**/ {{0x3fb3ad8e, 0x0adff464} }, +/**/ {{0x3fb3b9d6, 0x4159c223} } }, +/**/ {{{0x3fb70000, 0x00000000} }, +/**/ {{0x3fb6f03b, 0xdcea4b0d} }, +/**/ {{0xbc33f00e, 0x512fa17d} }, +/**/ {{0x3fefbe67, 0x8c07a436} }, +/**/ {{0xbc84baaa, 0x46250d6f} }, +/**/ {{0xbfb6a215, 0x7e3ba4c7} }, +/**/ {{0xbc3504e7, 0x54503f8d} }, +/**/ {{0xbfd45217, 0x6b82d03a} }, +/**/ {{0x3c7d1f0d, 0xbebdd1db} }, +/**/ {{0x3fb617a4, 0x841d5604} }, +/**/ {{0xbc47168b, 0x6681c436} }, +/**/ {{0x3fc69d47, 0xaccec6ce} }, +/**/ {{0xbfb5541f, 0xa4715800} }, +/**/ {{0xbfbcc9f4, 0x335a1c1b} }, +/**/ {{0x3fb45bc6, 0xbac0061f} }, +/**/ {{0x3fb2fc84, 0x2b3853b6} } }, +/**/ {{{0x3fb80000, 0x00000000} }, +/**/ {{0x3fb7ee18, 0x2602f10f} }, +/**/ {{0xbc5cfb65, 0x4c0c3d98} }, +/**/ {{0x3fefb8a0, 0x96acfacc} }, +/**/ {{0xbc82962e, 0x18495af3} }, +/**/ {{0xbfb79568, 0x46635c89} }, +/**/ {{0x3c5ac468, 0xa6bfd498} }, +/**/ {{0xbfd43b8f, 0x2037b997} }, +/**/ {{0xbc72ad53, 0xe2f12373} }, +/**/ {{0x3fb6f885, 0x7900c4ee} }, +/**/ {{0x3c53145d, 0x0aef1f9d} }, +/**/ {{0x3fc65c1f, 0x4409ba0e} }, +/**/ {{0xbfb61b65, 0x1d176e0c} }, +/**/ {{0xbfbc2473, 0x8ad65152} }, +/**/ {{0x3fb5033f, 0x7bc246c1} }, +/**/ {{0x3fb239e9, 0x6db30b46} } }, +/**/ {{{0x3fb90000, 0x00000000} }, +/**/ {{0x3fb8ebc5, 0x4478fb28} }, +/**/ {{0x3c473288, 0x0cad24cc} }, +/**/ {{0x3fefb29c, 0xeedcd6d7} }, +/**/ {{0x3c8efa9e, 0x23ea50f0} }, +/**/ {{0xbfb887a7, 0x6ae09982} }, +/**/ {{0x3c5b2275, 0x53801511} }, +/**/ {{0xbfd42427, 0x3da0757c} }, +/**/ {{0xbc7199e5, 0x311c7ac8} }, +/**/ {{0x3fb7d6cf, 0x4388717b} }, +/**/ {{0xbc5c4eb2, 0x3dd070b4} }, +/**/ {{0x3fc618a7, 0xe6c2b5f3} }, +/**/ {{0xbfb6de12, 0x00313569} }, +/**/ {{0xbfbb79d2, 0xb6316619} }, +/**/ {{0x3fb5a3ca, 0x61af5c21} }, +/**/ {{0x3fb17263, 0x26e60289} } }, +/**/ {{{0x3fba0000, 0x00000000} }, +/**/ {{0x3fb9e941, 0x53cfdcf1} }, +/**/ {{0x3c5a332e, 0x1d69c47e} }, +/**/ {{0x3fefac5c, 0xdace3776} }, +/**/ {{0xbc8c9a78, 0x1ad91ab5} }, +/**/ {{0xbfb978c8, 0x8054ad75} }, +/**/ {{0xbc5e35b8, 0x8ed66c17} }, +/**/ {{0xbfd40be2, 0x665afed1} }, +/**/ {{0x3c62eeef, 0x08ef10fb} }, +/**/ {{0x3fb8b26b, 0x13c989d2} }, +/**/ {{0x3c329f11, 0xbfeab3ba} }, +/**/ {{0x3fc5d2ef, 0x93c8f97c} }, +/**/ {{0xbfb79c03, 0x30234881} }, +/**/ {{0xbfbaca49, 0xd0f650c8} }, +/**/ {{0x3fb63d3c, 0xce2dcccc} }, +/**/ {{0x3fb0a650, 0x26fb0af2} } }, +/**/ {{{0x3fbb0000, 0x00000000} }, +/**/ {{0x3fbae68a, 0x71c722b8} }, +/**/ {{0x3c4c014e, 0x6910b9db} }, +/**/ {{0x3fefa5e0, 0xa34ef42b} }, +/**/ {{0xbc836583, 0xeb56d5b9} }, +/**/ {{0xbfba68c1, 0x3b881779} }, +/**/ {{0xbc473a0d, 0x13a09314} }, +/**/ {{0xbfd3f2c3, 0x538e939c} }, +/**/ {{0xbc68ed49, 0xee53e648} }, +/**/ {{0x3fb98b42, 0xa7d45973} }, +/**/ {{0xbc523943, 0x461ca7c4} }, +/**/ {{0x3fc58b04, 0xb0f2e2bb} }, +/**/ {{0xbfb85517, 0x1c9d23dc} }, +/**/ {{0xbfba1612, 0x3e3b5a66} }, +/**/ {{0x3fb6cf6f, 0x7ef1d0b9} }, +/**/ {{0x3fafac21, 0x6617b315} } }, +/**/ {{{0x3fbc0000, 0x00000000} }, +/**/ {{0x3fbbe39e, 0xbe6f07c3} }, +/**/ {{0x3c5f7b8f, 0x29a05987} }, +/**/ {{0x3fef9f28, 0x93bb9192} }, +/**/ {{0x3c78260b, 0x7cd1bdab} }, +/**/ {{0xbfbb5787, 0x72759741} }, +/**/ {{0x3c52f93f, 0xa6767247} }, +/**/ {{0xbfd3d8cc, 0xd45bbe91} }, +/**/ {{0x3c664839, 0x2edc0762} }, +/**/ {{0x3fba6140, 0x4fa31d26} }, +/**/ {{0x3c400647, 0x97891510} }, +/**/ {{0x3fc540f6, 0x0668fd66} }, +/**/ {{0xbfb9092d, 0xcb2f6e8f} }, +/**/ {{0xbfb95d66, 0x8d902073} }, +/**/ {{0x3fb75a3e, 0x99c53d16} }, +/**/ {{0x3fae040c, 0x8f475e61} } }, +/**/ {{{0x3fbd0000, 0x00000000} }, +/**/ {{0x3fbce07c, 0x5c3cca32} }, +/**/ {{0x3c4138e6, 0x425918a7} }, +/**/ {{0x3fef9834, 0xf9f6d421} }, +/**/ {{0x3c6f3089, 0x8c22a239} }, +/**/ {{0xbfbc4511, 0x1d4e69a5} }, +/**/ {{0x3c254c0f, 0xd2083ce8} }, +/**/ {{0xbfd3be01, 0xcd488978} }, +/**/ {{0x3c5612db, 0x6362ec0f} }, +/**/ {{0x3fbb344e, 0xf0d94873} }, +/**/ {{0xbc182beb, 0xfdf7db72} }, +/**/ {{0x3fc4f4d2, 0xb9d86c04} }, +/**/ {{0xbfb9b828, 0xdf238807} }, +/**/ {{0xbfb8a082, 0x5f93ffd6} }, +/**/ {{0x3fb7dd89, 0xb6650b0c} }, +/**/ {{0x3fac5526, 0xb62676ef} } }, +/**/ {{{0x3fbe0000, 0x00000000} }, +/**/ {{0x3fbddd21, 0x701eba6e} }, +/**/ {{0x3c594eff, 0xcd76fe58} }, +/**/ {{0x3fef9106, 0x266112ba} }, +/**/ {{0x3c74c302, 0x6b7e18b1} }, +/**/ {{0xbfbd3154, 0x5777816c} }, +/**/ {{0x3c5dc7e4, 0x1f9dbddd} }, +/**/ {{0xbfd3a265, 0x37a90881} }, +/**/ {{0xbc75bd61, 0xeb7ba840} }, +/**/ {{0x3fbc045a, 0x0a52514b} }, +/**/ {{0xbc35ca88, 0xcff49a99} }, +/**/ {{0x3fc4a6aa, 0x498eeb56} }, +/**/ {{0xbfba61eb, 0xa09232cf} }, +/**/ {{0xbfb7dfa2, 0x4a464027} }, +/**/ {{0x3fb85933, 0xe633c053} }, +/**/ {{0x3faaa036, 0x3f920107} } }, +/**/ {{{0x3fbf0000, 0x00000000} }, +/**/ {{0x3fbed98c, 0x2190043b} }, +/**/ {{0xbc23a598, 0x592c7b13} }, +/**/ {{0x3fef899c, 0x6bcf4ad8} }, +/**/ {{0x3c55fd73, 0x912c09b0} }, +/**/ {{0xbfbe1c47, 0x607f91a0} }, +/**/ {{0x3c576677, 0x5b5db022} }, +/**/ {{0xbfd385fa, 0x21046f5f} }, +/**/ {{0x3c7f01c3, 0x4487f4b8} }, +/**/ {{0x3fbcd14d, 0xb77f2d51} }, +/**/ {{0x3c57a86d, 0x30a2ccfe} }, +/**/ {{0x3fc4568c, 0x8782b530} }, +/**/ {{0xbfbb065b, 0x02b7ad2d} }, +/**/ {{0xbfb71b03, 0xbd215555} }, +/**/ {{0x3fb8cd23, 0xb9c1c1de} }, +/**/ {{0x3fa8e602, 0x8dbfa69b} } }, +/**/ {{{0x3fc00000, 0x00000000} }, +/**/ {{0x3fbfd5ba, 0x9aac2f6e} }, +/**/ {{0xbc4cd376, 0x86760c17} }, +/**/ {{0x3fef81f8, 0x1f81f820} }, +/**/ {{0xbc8f81f8, 0x1f81f820} }, +/**/ {{0xbfbf05e0, 0x9d0dc11b} }, +/**/ {{0xbc35a199, 0x1d821725} }, +/**/ {{0xbfd368c3, 0xaa76e1d7} }, +/**/ {{0xbc672d4c, 0xc796f8cd} }, +/**/ {{0x3fbd9b16, 0xb391c2e3} }, +/**/ {{0x3c58051b, 0x8086c51d} }, +/**/ {{0x3fc40489, 0x94488c86} }, +/**/ {{0xbfbba55d, 0xa98401c8} }, +/**/ {{0xbfb652e4, 0xe5127e64} }, +/**/ {{0x3fb93943, 0x442e53ae} }, +/**/ {{0x3fa72753, 0x86286f75} } }, +/**/ {{{0x3fc08000, 0x00000000} }, +/**/ {{0x3fc068d5, 0x84212b3e} }, +/**/ {{0xbc69e2d2, 0x83019bfd} }, +/**/ {{0x3fef7a19, 0x991bb133} }, +/**/ {{0x3c7a956a, 0x66627723} }, +/**/ {{0xbfbfee16, 0x97c8e137} }, +/**/ {{0x3c4d9399, 0x66dbe7af} }, +/**/ {{0xbfd34ac5, 0x0810323a} }, +/**/ {{0x3c6a1a57, 0x6bc6c512} }, +/**/ {{0x3fbe61a2, 0x5c75a6f9} }, +/**/ {{0xbc492b99, 0xd75c8f85} }, +/**/ {{0x3fc3b0b1, 0xd9fa3f20} }, +/**/ {{0xbfbc3edb, 0xee66d309} }, +/**/ {{0xbfb58784, 0x905eeb33} }, +/**/ {{0x3fb99d80, 0x1c65bb14} }, +/**/ {{0x3fa564f1, 0x18a09884} } }, +/**/ {{{0x3fc10000, 0x00000000} }, +/**/ {{0x3fc0e6ad, 0xccf40882} }, +/**/ {{0xbc6d71a3, 0x1bb98d0d} }, +/**/ {{0x3fef7201, 0x32978bad} }, +/**/ {{0x3c816476, 0x599381e9} }, +/**/ {{0xbfc06a70, 0x011b81fd} }, +/**/ {{0xbc422f5d, 0x9ba697ca} }, +/**/ {{0xbfd32c01, 0x802fc0a5} }, +/**/ {{0x3c7d8e47, 0x08a20868} }, +/**/ {{0x3fbf24de, 0xb59597fe} }, +/**/ {{0xbc43288f, 0x410d31eb} }, +/**/ {{0x3fc35b16, 0x070feb24} }, +/**/ {{0xbfbcd2bf, 0xe4565b78} }, +/**/ {{0xbfb4b922, 0x128768c6} }, +/**/ {{0x3fb9f9cb, 0x5c42a097} }, +/**/ {{0x3fa39fa2, 0xc7f97f2e} } }, +/**/ {{{0x3fc18000, 0x00000000} }, +/**/ {{0x3fc16465, 0x41060850} }, +/**/ {{0x3c66bcee, 0x8ae7ea92} }, +/**/ {{0x3fef69af, 0x483f492b} }, +/**/ {{0xbc6e3280, 0x57db963e} }, +/**/ {{0xbfc0dd19, 0xdacaa844} }, +/**/ {{0xbc6133c7, 0xad7fc21e} }, +/**/ {{0xbfd30c7c, 0x6addaea8} }, +/**/ {{0xbc71443d, 0x89161c76} }, +/**/ {{0x3fbfe4ba, 0x6a6d3cd2} }, +/**/ {{0x3c50d4b8, 0x423ee67a} }, +/**/ {{0x3fc303c7, 0x092e569a} }, +/**/ {{0xbfbd60f5, 0x5b11d3b6} }, +/**/ {{0xbfb3e7fd, 0x283b5c55} }, +/**/ {{0x3fba4e19, 0x9d9a6ab7} }, +/**/ {{0x3fa1d82f, 0x3487cc29} } }, +/**/ {{{0x3fc20000, 0x00000000} }, +/**/ {{0x3fc1e1fa, 0xfb043727} }, +/**/ {{0xbc4b4859, 0x14dacf8c} }, +/**/ {{0x3fef6124, 0x38a14f5e} }, +/**/ {{0x3c798e9e, 0x001f6124} }, +/**/ {{0xbfc14f04, 0x59d3fb7c} }, +/**/ {{0x3c531efa, 0x4cc99cb2} }, +/**/ {{0xbfd2ec39, 0x31219b34} }, +/**/ {{0xbc618697, 0x6e004611} }, +/**/ {{0x3fc05092, 0x68736312} }, +/**/ {{0x3c67aad4, 0x8a06e4b5} }, +/**/ {{0x3fc2aad6, 0x07eca5ec} }, +/**/ {{0xbfbde969, 0xe19fe31c} }, +/**/ {{0xbfb31455, 0xdb6b9127} }, +/**/ {{0x3fba9a62, 0xf53dd9ee} }, +/**/ {{0x3fa00f5b, 0xa8e4ede0} } }, +/**/ {{{0x3fc28000, 0x00000000} }, +/**/ {{0x3fc25f6e, 0x171a535c} }, +/**/ {{0x3c67c6d7, 0xbde1a310} }, +/**/ {{0x3fef5860, 0x64866d22} }, +/**/ {{0x3c88c6ff, 0xd1f6326c} }, +/**/ {{0xbfc1c02b, 0x13c11396} }, +/**/ {{0xbc51b469, 0xffeb1a0f} }, +/**/ {{0xbfd2cb3b, 0x4c571b0f} }, +/**/ {{0x3c6e4f76, 0x2fb0b163} }, +/**/ {{0x3fc0ad06, 0xf5c213ab} }, +/**/ {{0x3c625bf2, 0xabea9e66} }, +/**/ {{0x3fc25054, 0x5f93bbb2} }, +/**/ {{0xbfbe6c0c, 0xc80a32c8} }, +/**/ {{0xbfb23e6c, 0x678d0d1e} }, +/**/ {{0x3fbadea2, 0xebf8ae4b} }, +/**/ {{0x3f9c8bd7, 0x527f133b} } }, +/**/ {{{0x3fc30000, 0x00000000} }, +/**/ {{0x3fc2dcbd, 0xb2fba1ff} }, +/**/ {{0x3c58f287, 0x05561534} }, +/**/ {{0x3fef4f64, 0x2ee76e94} }, +/**/ {{0x3c80ec89, 0xc6da5865} }, +/**/ {{0xbfc23089, 0xb322f867} }, +/**/ {{0x3c4c2b54, 0x5fcd0d6f} }, +/**/ {{0xbfd2a986, 0x45802261} }, +/**/ {{0xbc79a132, 0x5ae78b8a} }, +/**/ {{0x3fc107b3, 0x35a9d974} }, +/**/ {{0x3c5ef22d, 0xb725e335} }, +/**/ {{0x3fc1f453, 0x9bd98832} }, +/**/ {{0xbfbee8cf, 0x2057aad4} }, +/**/ {{0xbfb16681, 0x1e1bc3a1} }, +/**/ {{0x3fbb1ad8, 0x759c8f58} }, +/**/ {{0x3f98f941, 0x0b15b4aa} } }, +/**/ {{{0x3fc38000, 0x00000000} }, +/**/ {{0x3fc359e8, 0xedeb99a4} }, +/**/ {{0xbc6a5fd7, 0x4e4604c6} }, +/**/ {{0x3fef462f, 0xfce28238} }, +/**/ {{0x3c83dc01, 0xd90595d1} }, +/**/ {{0xbfc2a01b, 0xf7edfa6d} }, +/**/ {{0xbc6b11fb, 0x4a3b5c9a} }, +/**/ {{0xbfd2871d, 0xb4959402} }, +/**/ {{0xbc4a3702, 0x2fcf7ea3} }, +/**/ {{0x3fc1608f, 0xd8d7fe8c} }, +/**/ {{0x3c61ac60, 0xf8f1d41c} }, +/**/ {{0x3fc196e5, 0x729a89ca} }, +/**/ {{0xbfbf5fa3, 0xbec74f31} }, +/**/ {{0xbfb08cd4, 0x4b6c9767} }, +/**/ {{0x3fbb4f05, 0xe624ce15} }, +/**/ {{0x3f956871, 0xddb2020c} } }, +/**/ {{{0x3fc40000, 0x00000000} }, +/**/ {{0x3fc3d6ee, 0xe8c6626c} }, +/**/ {{0x3c661a3b, 0x0ce9281b} }, +/**/ {{0x3fef3cc4, 0x35b0713c} }, +/**/ {{0x3c81d0a7, 0xe69ea094} }, +/**/ {{0xbfc30edd, 0xb7d169f0} }, +/**/ {{0x3c6b3394, 0xae999b97} }, +/**/ {{0xbfd26405, 0x3fd62b3c} }, +/**/ {{0x3c73e339, 0xc0736df9} }, +/**/ {{0x3fc1b795, 0xe8e57ee3} }, +/**/ {{0xbc6130dc, 0x0a42c7f6} }, +/**/ {{0x3fc1381b, 0xbe93b8e5} }, +/**/ {{0xbfbfd07f, 0x394e1bf7} }, +/**/ {{0xbfaf634c, 0x37bb5315} }, +/**/ {{0x3fbb7b30, 0xe501e57b} }, +/**/ {{0x3f91dae1, 0x20503792} } }, +/**/ {{{0x3fc48000, 0x00000000} }, +/**/ {{0x3fc453ce, 0xc6092a9e} }, +/**/ {{0x3c61f653, 0xb3a5a78b} }, +/**/ {{0x3fef3321, 0x4299ace8} }, +/**/ {{0xbc87414c, 0x3a742b30} }, +/**/ {{0xbfc37cca, 0xde8b2323} }, +/**/ {{0x3c649378, 0x7b50aedf} }, +/**/ {{0xbfd24040, 0x9b13f4d0} }, +/**/ {{0x3c7e271f, 0xb7dc85c0} }, +/**/ {{0x3fc20cbe, 0xc9024068} }, +/**/ {{0x3c50921f, 0x88ef3da7} }, +/**/ {{0x3fc0d808, 0x7a1f1270} }, +/**/ {{0xbfc01dab, 0xf32d5436} }, +/**/ {{0xbfadaa6d, 0x02e6f09c} }, +/**/ {{0x3fbb9f62, 0x5e9cd766} }, +/**/ {{0x3f8ca3fe, 0xab964c04} } }, +/**/ {{{0x3fc50000, 0x00000000} }, +/**/ {{0x3fc4d087, 0xa9da4f17} }, +/**/ {{0x3c61f323, 0xf1adf158} }, +/**/ {{0x3fef2947, 0x8eeb3352} }, +/**/ {{0x3c871eb0, 0x8799a164} }, +/**/ {{0xbfc3e9df, 0x6e36e75c} }, +/**/ {{0x3c541555, 0x4e37666f} }, +/**/ {{0xbfd21bd3, 0x87008bd0} }, +/**/ {{0xbc609e14, 0xc24ff75f} }, +/**/ {{0x3fc26004, 0x36860504} }, +/**/ {{0xbc58f8ca, 0x1ebc8c40} }, +/**/ {{0x3fc076bd, 0xb9f4ead3} }, +/**/ {{0xbfc05012, 0xed70ddd5} }, +/**/ {{0xbfabef8a, 0x33e194b1} }, +/**/ {{0x3fbbbba6, 0x7423a91f} }, +/**/ {{0x3f859e6a, 0xdd99da12} } }, +/**/ {{{0x3fc58000, 0x00000000} }, +/**/ {{0x3fc54d18, 0xba11570a} }, +/**/ {{0x3c618282, 0xf2884073} }, +/**/ {{0x3fef1f37, 0x87eb4d7d} }, +/**/ {{0x3c8476f0, 0xedda13e6} }, +/**/ {{0xbfc45617, 0x7f997c7c} }, +/**/ {{0xbc46bf5b, 0x6423ceda} }, +/**/ {{0xbfd1f6c1, 0xd0784ec7} }, +/**/ {{0xbc74ec12, 0xd106a8e0} }, +/**/ {{0x3fc2b160, 0x4967338d} }, +/**/ {{0x3c5309c0, 0x61339c25} }, +/**/ {{0x3fc0144d, 0xa7f42962} }, +/**/ {{0xbfc07f71, 0x73dbaeec} }, +/**/ {{0xbfaa3322, 0x2aeda9a4} }, +/**/ {{0x3fbbd00c, 0x69b152b3} }, +/**/ {{0x3f7d4f90, 0x4c782821} } }, +/**/ {{{0x3fc60000, 0x00000000} }, +/**/ {{0x3fc5c981, 0x1e3ec26a} }, +/**/ {{0xbc5054ab, 0x2c010f3d} }, +/**/ {{0x3fef14f1, 0x9cce28eb} }, +/**/ {{0xbc8b7c25, 0x2708cd6e} }, +/**/ {{0xbfc4c16f, 0x42678d07} }, +/**/ {{0x3c5f55ba, 0xc1560017} }, +/**/ {{0xbfd1d10f, 0x4fccc153} }, +/**/ {{0x3c529588, 0x1bcc361d} }, +/**/ {{0x3fc300cd, 0x74979f8c} }, +/**/ {{0xbc6b1da5, 0x0bc1e891} }, +/**/ {{0x3fbf6194, 0xfbe70208} }, +/**/ {{0xbfc0abc5, 0x4b1c266f} }, +/**/ {{0xbfa875b2, 0x3b74e858} }, +/**/ {{0x3fbbdca6, 0x92e46f11} }, +/**/ {{0x3f6f0b17, 0x9de94aef} } }, +/**/ {{{0x3fc68000, 0x00000000} }, +/**/ {{0x3fc645bf, 0xffb3aa74} }, +/**/ {{0xbc3f536b, 0x677c2cb4} }, +/**/ {{0x3fef0a76, 0x3eaa4ed6} }, +/**/ {{0x3c888c52, 0x0b06c761} }, +/**/ {{0xbfc52be2, 0xfd884489} }, +/**/ {{0x3c67ec59, 0xbe5c728a} }, +/**/ {{0xbfd1aabf, 0xe80e4e0a} }, +/**/ {{0xbc71320e, 0xe90c909e} }, +/**/ {{0x3fc34e46, 0x864781ca} }, +/**/ {{0x3c42fcb3, 0x126138ee} }, +/**/ {{0x3fbe988d, 0x013b5d4f} }, +/**/ {{0xbfc0d50d, 0x122409a2} }, +/**/ {{0xbfa6b7b6, 0x7bb562c1} }, +/**/ {{0x3fbbe18a, 0x3df8dee8} }, +/**/ {{0x3f3e4009, 0x8809e1ef} } }, +/**/ {{{0x3fc70000, 0x00000000} }, +/**/ {{0x3fc6c1d4, 0x898933d9} }, +/**/ {{0xbc52954a, 0x7603c427} }, +/**/ {{0x3feeffc5, 0xe06cfb34} }, +/**/ {{0xbc85c037, 0x379877c2} }, +/**/ {{0xbfc5956f, 0x0f53a52c} }, +/**/ {{0x3c4d46a2, 0xe566376c} }, +/**/ {{0xbfd183d7, 0x86559c11} }, +/**/ {{0x3c7d2520, 0x64734c7f} }, +/**/ {{0x3fc399c6, 0xa80eddd5} }, +/**/ {{0x3c616c26, 0x40fbef6f} }, +/**/ {{0x3fbdcda7, 0xf4b571a7} }, +/**/ {{0xbfc0fb48, 0x3fd42996} }, +/**/ {{0xbfa4f9a9, 0x95c85118} }, +/**/ {{0x3fbbdecf, 0x9d795df4} }, +/**/ {{0xbf672003, 0xb85bf719} } }, +/**/ {{{0x3fc78000, 0x00000000} }, +/**/ {{0x3fc73dbd, 0xe8a7d202} }, +/**/ {{0xbc55ad0f, 0x6d4a665d} }, +/**/ {{0x3feef4e0, 0xf6ce5590} }, +/**/ {{0xbc833df6, 0x556900ef} }, +/**/ {{0xbfc5fe0f, 0xedcc9488} }, +/**/ {{0x3c5078de, 0xd2b9e35c} }, +/**/ {{0xbfd15c5a, 0x210cab36} }, +/**/ {{0x3c67fa93, 0xf55e532a} }, +/**/ {{0x3fc3e349, 0x5efd9a41} }, +/**/ {{0xbc6cf709, 0xc8573a12} }, +/**/ {{0x3fbd010a, 0x6c903aef} }, +/**/ {{0xbfc11e77, 0x20571328} }, +/**/ {{0xbfa33c04, 0x9a1875dd} }, +/**/ {{0x3fbbd491, 0xb09ec0ce} }, +/**/ {{0xbf78d197, 0x35537a65} } }, +/**/ {{{0x3fc80000, 0x00000000} }, +/**/ {{0x3fc7b97b, 0x4bce5b02} }, +/**/ {{0x3c5347b0, 0xb4f881ca} }, +/**/ {{0x3feee9c7, 0xf8458e02} }, +/**/ {{0xbc616380, 0x7ba71fe1} }, +/**/ {{0xbfc665c2, 0x26d69eeb} }, +/**/ {{0xbc572a33, 0xfdb5eea8} }, +/**/ {{0xbfd1344b, 0xb737e8f3} }, +/**/ {{0xbc757b70, 0x62badf41} }, +/**/ {{0x3fc42aca, 0x8b929b0b} }, +/**/ {{0x3c43cdb5, 0x7a8b7d91} }, +/**/ {{0x3fbc32d8, 0xf683981c} }, +/**/ {{0xbfc13e9a, 0xd22d5ecc} }, +/**/ {{0xbfa17f3e, 0xd35c8c33} }, +/**/ {{0x3fbbc2ee, 0x2a73307e} }, +/**/ {{0xbf82ee04, 0x2bddc834} } }, +/**/ {{{0x3fc88000, 0x00000000} }, +/**/ {{0x3fc8350b, 0xe398ebc8} }, +/**/ {{0xbc55a913, 0x32b9c90d} }, +/**/ {{0x3feede7b, 0x5cfce04c} }, +/**/ {{0x3c8507c2, 0x3b51a72f} }, +/**/ {{0xbfc6cc82, 0x6067718b} }, +/**/ {{0x3c6d00ca, 0xdbfc430f} }, +/**/ {{0xbfd10bb0, 0x4fbf6fe8} }, +/**/ {{0x3c321748, 0x53749c72} }, +/**/ {{0x3fc47046, 0x699a36ad} }, +/**/ {{0xbc63924c, 0x3994d40c} }, +/**/ {{0x3fbb6338, 0x0dfb7483} }, +/**/ {{0xbfc15bb5, 0x42ee5820} }, +/**/ {{0xbf9f879b, 0x385194fc} }, +/**/ {{0x3fbbaa05, 0x57d040e9} }, +/**/ {{0xbf895566, 0xada71ca0} } }, +/**/ {{{0x3fc90000, 0x00000000} }, +/**/ {{0x3fc8b06e, 0xe2879c29} }, +/**/ {{0xbc6118cd, 0x30308c4f} }, +/**/ {{0x3feed2fb, 0x9ec57f51} }, +/**/ {{0xbc83fdc5, 0xc0d106ba} }, +/**/ {{0xbfc7324d, 0x58b40d27} }, +/**/ {{0x3c68e240, 0xfc062163} }, +/**/ {{0xbfd0e28b, 0xf8b8a2bf} }, +/**/ {{0xbc7b8d8a, 0x64c55b39} }, +/**/ {{0x3fc4b3b9, 0x8ff46730} }, +/**/ {{0xbc5af146, 0x988563da} }, +/**/ {{0x3fba924c, 0x1277a10d} }, +/**/ {{0xbfc175c9, 0x2bbfd54d} }, +/**/ {{0xbf9c1448, 0x6c522340} }, +/**/ {{0x3fbb89fa, 0x044f2f6b} }, +/**/ {{0xbf8f9cc7, 0xaaecc742} } }, +/**/ {{{0x3fc98000, 0x00000000} }, +/**/ {{0x3fc92ba3, 0x7d050272} }, +/**/ {{0xbc60d3de, 0xd0ff4764} }, +/**/ {{0x3feec749, 0x390b6afe} }, +/**/ {{0xbc5c3d17, 0x4e3659ca} }, +/**/ {{0xbfc7971f, 0xe659b3de} }, +/**/ {{0x3c4cab11, 0x373f554d} }, +/**/ {{0xbfd0b8e2, 0xc6b052a4} }, +/**/ {{0x3c7da014, 0x6f3b74bc} }, +/**/ {{0x3fc4f520, 0xf0432146} }, +/**/ {{0xbc6769ad, 0xa8027290} }, +/**/ {{0x3fb9c039, 0x3e17b570} }, +/**/ {{0xbfc18cda, 0x0d8833a4} }, +/**/ {{0xbf98a567, 0x4627d340} }, +/**/ {{0x3fbb62f1, 0x5e42eff7} }, +/**/ {{0xbf92e10a, 0x7ee3bed3} } }, +/**/ {{{0x3fca0000, 0x00000000} }, +/**/ {{0x3fc9a6a8, 0xe96c8626} }, +/**/ {{0x3c4cf601, 0xe7b4348e} }, +/**/ {{0x3feebb64, 0xa8c932d7} }, +/**/ {{0x3c20538d, 0x79aae302} }, +/**/ {{0xbfc7faf6, 0xf88295fe} }, +/**/ {{0xbc687a81, 0x932909e9} }, +/**/ {{0xbfd08eb8, 0xd3f5a07b} }, +/**/ {{0xbc620a05, 0xfb7d6aaa} }, +/**/ {{0x3fc53479, 0xd6814372} }, +/**/ {{0xbc53c682, 0x0a0c6620} }, +/**/ {{0x3fb8ed23, 0x9c562d77} }, +/**/ {{0xbfc1a0ec, 0x2cdd89fd} }, +/**/ {{0xbf953bd4, 0xfec9df82} }, +/**/ {{0x3fbb3512, 0xd9d3f0f6} }, +/**/ {{0xbf95e1ab, 0x4534ccf5} } }, +/**/ {{{0x3fca8000, 0x00000000} }, +/**/ {{0x3fca217e, 0x601081a6} }, +/**/ {{0xbc60def8, 0xa60af374} }, +/**/ {{0x3feeaf4e, 0x6c7ba732} }, +/**/ {{0x3c89fa72, 0xe91fffe1} }, +/**/ {{0xbfc85dcf, 0x970642c3} }, +/**/ {{0xbc5732c2, 0x5b7f0ad0} }, +/**/ {{0xbfd06412, 0x3fe5c74d} }, +/**/ {{0xbc7d0053, 0x4a82f9b1} }, +/**/ {{0x3fc571c1, 0xe882973d} }, +/**/ {{0x3c59d9a3, 0x9090f12c} }, +/**/ {{0x3fb8192f, 0x00f5d0e0} }, +/**/ {{0xbfc1b204, 0x8db53983} }, +/**/ {{0xbf91d869, 0xbdd7b47e} }, +/**/ {{0x3fbb0088, 0x1355a903} }, +/**/ {{0xbf98cf57, 0x724a2ad9} } }, +/**/ {{{0x3fcb0000, 0x00000000} }, +/**/ {{0x3fca9c23, 0x1b403279} }, +/**/ {{0x3c60e8bb, 0xe89cca85} }, +/**/ {{0x3feea307, 0x04157b4f} }, +/**/ {{0x3c8ad743, 0xfd8bf1f0} }, +/**/ {{0xbfc8bfa6, 0xe285e2fd} }, +/**/ {{0xbc6ce765, 0x9c834c8f} }, +/**/ {{0xbfd038f3, 0x2e38fd26} }, +/**/ {{0x3c6a42ec, 0xef212a80} }, +/**/ {{0x3fc5acf7, 0x255d65d5} }, +/**/ {{0xbc619fba, 0xbe486771} }, +/**/ {{0x3fb7447e, 0xff244e15} }, +/**/ {{0xbfc1c028, 0xeed71b69} }, +/**/ {{0xbf8cf7f0, 0xaceecf68} }, +/**/ {{0x3fbac57c, 0xb0ee161b} }, +/**/ {{0xbf9ba92d, 0xefc8f53e} } }, +/**/ {{{0x3fcb8000, 0x00000000} }, +/**/ {{0x3fcb1696, 0x574d780c} }, +/**/ {{0xbc585ab8, 0xfc15a673} }, +/**/ {{0x3fee968e, 0xf0f2da5a} }, +/**/ {{0xbc6fffe1, 0x69710f0d} }, +/**/ {{0xbfc9207a, 0x148444b5} }, +/**/ {{0xbc66661a, 0x1802fa91} }, +/**/ {{0xbfd00d5f, 0xc65096ca} }, +/**/ {{0x3c7f2a2e, 0x8920e744} }, +/**/ {{0x3fc5e617, 0xe4be288d} }, +/**/ {{0x3c67fa48, 0x99be934f} }, +/**/ {{0x3fb66f36, 0xe0d4c87a} }, +/**/ {{0xbfc1cb5f, 0xc5179ce8} }, +/**/ {{0xbf864e9c, 0x1011bb6c} }, +/**/ {{0x3fba841e, 0x43a75476} }, +/**/ {{0xbf9e6e5b, 0x845fc859} } }, +/**/ {{{0x3fcc0000, 0x00000000} }, +/**/ {{0x3fcb90d7, 0x529260a2} }, +/**/ {{0x3c217b10, 0xd2e0e5ab} }, +/**/ {{0x3fee89e6, 0xb5ccf172} }, +/**/ {{0x3c820357, 0x153be26a} }, +/**/ {{0xbfc98046, 0x7f79bfd6} }, +/**/ {{0xbc0799ee, 0xf5d60955} }, +/**/ {{0xbfcfc2b8, 0x650d32f4} }, +/**/ {{0xbc6b59de, 0x4d01b49e} }, +/**/ {{0x3fc61d22, 0xd625e475} }, +/**/ {{0xbc68013f, 0xe23c6105} }, +/**/ {{0x3fb59979, 0x9e54f300} }, +/**/ {{0xbfc1d3b0, 0x365c2b85} }, +/**/ {{0xbf7f6cc9, 0x0afb6b97} }, +/**/ {{0x3fba3c9c, 0x28035c12} }, +/**/ {{0xbfa08f0d, 0x8331488a} } }, +/**/ {{{0x3fcc8000, 0x00000000} }, +/**/ {{0x3fcc0ae5, 0x4d768467} }, +/**/ {{0xbc604cdb, 0xf55f26dc} }, +/**/ {{0x3fee7d0e, 0xd6ad70cb} }, +/**/ {{0x3c8e6761, 0xee20d17d} }, +/**/ {{0xbfc9df09, 0x8ee3fcf8} }, +/**/ {{0x3c62daa3, 0xed723e81} }, +/**/ {{0xbfcf69d9, 0x3efdc9b4} }, +/**/ {{0x3c6c7b6f, 0x85a20110} }, +/**/ {{0x3fc65217, 0x0013c661} }, +/**/ {{0xbc678a0c, 0xab1387be} }, +/**/ {{0x3fb4c369, 0xd61f268e} }, +/**/ {{0xbfc1d922, 0x146d6110} }, +/**/ {{0xbf726199, 0xc0b0ed0a} }, +/**/ {{0x3fb9ef27, 0x6629c856} }, +/**/ {{0xbfa1dbda, 0xc1ea955d} } }, +/**/ {{{0x3fcd0000, 0x00000000} }, +/**/ {{0x3fcc84bf, 0x8a742e6e} }, +/**/ {{0xbc595bdd, 0x0682ea26} }, +/**/ {{0x3fee7007, 0xd8e205ea} }, +/**/ {{0x3c816199, 0x7b2991c1} }, +/**/ {{0xbfca3cc0, 0xc751a854} }, +/**/ {{0xbc66a2fd, 0x4efbc78c} }, +/**/ {{0xbfcf102a, 0x76f43baa} }, +/**/ {{0x3c6cfc38, 0x38d996b1} }, +/**/ {{0x3fc684f3, 0xbf1a9ad6} }, +/**/ {{0x3c52eaf7, 0x7c3b6690} }, +/**/ {{0x3fb3ed29, 0xc4ebba84} }, +/**/ {{0xbfc1dbbd, 0xd79a6a53} }, +/**/ {{0xbf55fa5b, 0xfd09510e} }, +/**/ {{0x3fb99bf2, 0x91c74d50} }, +/**/ {{0xbfa31d41, 0x3002c38b} } }, +/**/ {{{0x3fcd8000, 0x00000000} }, +/**/ {{0x3fccfe65, 0x4e1d5395} }, +/**/ {{0x3c647b9a, 0x3f71eafb} }, +/**/ {{0x3fee62d2, 0x42efd10e} }, +/**/ {{0x3c850a65, 0xa021973e} }, +/**/ {{0xbfca9969, 0xc66a1be4} }, +/**/ {{0x3c326164, 0x3753f036} }, +/**/ {{0xbfceb5b4, 0x6b550477} }, +/**/ {{0xbc64cacb, 0xa3ef610f} }, +/**/ {{0x3fc6b5b8, 0xc4e2c295} }, +/**/ {{0x3c66b228, 0x98b2ac7f} }, +/**/ {{0x3fb316db, 0x3e03bb80} }, +/**/ {{0xbfc1db8c, 0x99312ba1} }, +/**/ {{0x3f5ce5b0, 0x8536556f} }, +/**/ {{0x3fb94331, 0xa9b62abf} }, +/**/ {{0xbfa452f3, 0xb36f42fc} } }, +/**/ {{{0x3fce0000, 0x00000000} }, +/**/ {{0x3fcd77d5, 0xdf205736} }, +/**/ {{0x3c6c648d, 0x1534597e} }, +/**/ {{0x3fee556e, 0x9c86d7c6} }, +/**/ {{0xbc830c25, 0x34c9abfd} }, +/**/ {{0xbfcaf502, 0x42f10c89} }, +/**/ {{0xbc411261, 0xf8576d95} }, +/**/ {{0xbfce5a7f, 0x7b1596d9} }, +/**/ {{0x3c574baa, 0x78f7ae18} }, +/**/ {{0x3fc6e466, 0x171949b1} }, +/**/ {{0xbc6ff86b, 0x52f9c399} }, +/**/ {{0x3fb2409f, 0xa3d6f244} }, +/**/ {{0xbfc1d898, 0x0dceacbf} }, +/**/ {{0x3f73c3b6, 0xdc715080} }, +/**/ {{0x3fb8e519, 0xf78687ab} }, +/**/ {{0xbfa57cac, 0x6b1251ec} } }, +/**/ {{{0x3fce8000, 0x00000000} }, +/**/ {{0x3fcdf110, 0x864c9d9e} }, +/**/ {{0xbc35818b, 0x53bf4781} }, +/**/ {{0x3fee47dd, 0x6e7576a6} }, +/**/ {{0x3c89d322, 0x24b84595} }, +/**/ {{0xbfcb4f88, 0x0cc64717} }, +/**/ {{0xbc624035, 0x44bb97a3} }, +/**/ {{0xbfcdfe94, 0x046e8a3b} }, +/**/ {{0xbc6078ee, 0xd278da00} }, +/**/ {{0x3fc710fc, 0x0e4ccbb7} }, +/**/ {{0xbc58c89c, 0x1da51f71} }, +/**/ {{0x3fb16a97, 0xe0d7022a} }, +/**/ {{0xbfc1d2ea, 0x7f8b58f8} }, +/**/ {{0x3f800ed5, 0xaf259d18} }, +/**/ {{0x3fb881e1, 0xeefd29c7} }, +/**/ {{0xbfa69a2c, 0xae6aa0c1} } }, +/**/ {{{0x3fcf0000, 0x00000000} }, +/**/ {{0x3fce6a14, 0x8e96ec4d} }, +/**/ {{0x3c6866b2, 0x2029f765} }, +/**/ {{0x3fee3a1f, 0x429bd423} }, +/**/ {{0xbc86174a, 0x48961291} }, +/**/ {{0xbfcba8f9, 0x0ce18ad9} }, +/**/ {{0x3c62e3e9, 0xb50eb15d} }, +/**/ {{0xbfcda1fa, 0x63927806} }, +/**/ {{0xbbed7b15, 0x8073bacf} }, +/**/ {{0x3fc73b7b, 0x54b8d3bb} }, +/**/ {{0x3c602afb, 0x74869c1c} }, +/**/ {{0x3fb094e4, 0x60993bd6} }, +/**/ {{0xbfc1ca8e, 0xc806a157} }, +/**/ {{0x3f862263, 0xa854d278} }, +/**/ {{0x3fb819c1, 0x0d9e7452} }, +/**/ {{0xbfa7ab3d, 0x08743869} } }, +/**/ {{{0x3fcf8000, 0x00000000} }, +/**/ {{0x3fcee2e1, 0x451d980d} }, +/**/ {{0xbc59a770, 0x8c46ba91} }, +/**/ {{0x3fee2c34, 0xa3df5666} }, +/**/ {{0xbc8ef949, 0x19a92865} }, +/**/ {{0xbfcc0153, 0x454a9009} }, +/**/ {{0x3c5572bf, 0xda1123ca} }, +/**/ {{0xbfcd44ba, 0xf169cd42} }, +/**/ {{0xbc6db0f2, 0xf1052e0a} }, +/**/ {{0x3fc763e4, 0xe5006ad1} }, +/**/ {{0x3c66e21a, 0x3e902796} }, +/**/ {{0x3faf7f4a, 0x12812c7d} }, +/**/ {{0xbfc1bf90, 0x4a558d9d} }, +/**/ {{0x3f8c1b52, 0x2be7fbfd} }, +/**/ {{0x3fb7acef, 0xba5b0263} }, +/**/ {{0xbfa8afad, 0x2dddf4e5} } }, +/**/ {{{0x3fd00000, 0x00000000} }, +/**/ {{0x3fcf5b75, 0xf92c80dd} }, +/**/ {{0x3c68ab6e, 0x3cf7afbd} }, +/**/ {{0x3fee1e1e, 0x1e1e1e1e} }, +/**/ {{0x3c6e1e1e, 0x1e1e1e1e} }, +/**/ {{0xbfcc5894, 0xd10d4986} }, +/**/ {{0x3c5f00e2, 0xc4a6886a} }, +/**/ {{0xbfcce6de, 0x0253d27e} }, +/**/ {{0xbc65d764, 0x3c5fce89} }, +/**/ {{0x3fc78a3a, 0x08d88b02} }, +/**/ {{0x3c4fc5d6, 0x32bd57e4} }, +/**/ {{0x3fadd5f2, 0x6a622b44} }, +/**/ {{0xbfc1b1fa, 0xecd7c4e0} }, +/**/ {{0x3f90fc3e, 0x1fc8b549} }, +/**/ {{0x3fb73ba7, 0x25728acf} }, +/**/ {{0xbfa9a753, 0xeeba051f} } }, +/**/ {{{0x3fd04000, 0x00000000} }, +/**/ {{0x3fcfd3d1, 0xfc40dbe4} }, +/**/ {{0x3c437146, 0xf3a1c5ea} }, +/**/ {{0x3fee0fdc, 0x3e228818} }, +/**/ {{0xbc62e075, 0x8c042ef5} }, +/**/ {{0xbfccaebb, 0xe42a71b9} }, +/**/ {{0xbc69fa0a, 0x8025fd1d} }, +/**/ {{0xbfcc886b, 0xe4ed28e5} }, +/**/ {{0xbc59ccc3, 0x7604b95a} }, +/**/ {{0x3fc7ae7c, 0x57a32fb9} }, +/**/ {{0x3c67393b, 0xe36848c2} }, +/**/ {{0x3fac2dff, 0x5a1b7b6f} }, +/**/ {{0xbfc1a1db, 0x12f690d4} }, +/**/ {{0x3f93dc65, 0xa575dc1d} }, +/**/ {{0x3fb6c621, 0x28a107f6} }, +/**/ {{0xbfaa920f, 0x23d2c35f} } }, +/**/ {{{0x3fd08000, 0x00000000} }, +/**/ {{0x3fd025fa, 0x510665b6} }, +/**/ {{0xbc7672df, 0x6832fa48} }, +/**/ {{0x3fee016f, 0x9196b776} }, +/**/ {{0x3c81da3a, 0xb14efc08} }, +/**/ {{0xbfcd03c6, 0xcb847375} }, +/**/ {{0xbc6819f2, 0xfc4c6f52} }, +/**/ {{0xbfcc296c, 0xe0dbf8a5} }, +/**/ {{0xbc55cc84, 0x27fb1c17} }, +/**/ {{0x3fc7d0ad, 0xb4fbbf40} }, +/**/ {{0x3c6378b3, 0x41b71641} }, +/**/ {{0x3faa87ad, 0x440404cd} }, +/**/ {{0xbfc18f3d, 0x96d156a8} }, +/**/ {{0x3f96ad9b, 0x9ef40490} }, +/**/ {{0x3fb64c98, 0x27a95e14} }, +/**/ {{0xbfab6fc3, 0x97cfdce0} } }, +/**/ {{{0x3fd0c000, 0x00000000} }, +/**/ {{0x3fd061ee, 0xa03d6291} }, +/**/ {{0xbc45f760, 0xdb154301} }, +/**/ {{0x3fedf2d8, 0xa6f82a61} }, +/**/ {{0xbc6cedbb, 0x560866af} }, +/**/ {{0xbfcd57b3, 0xecc8c02c} }, +/**/ {{0x3c641512, 0x85b9541c} }, +/**/ {{0xbfcbc9e9, 0x35a209c0} }, +/**/ {{0x3c65bfd8, 0x4914a5d1} }, +/**/ {{0x3fc7f0d0, 0x4f358b07} }, +/**/ {{0xbc60dc70, 0x3f47a5cc} }, +/**/ {{0x3fa8e337, 0x50af01c1} }, +/**/ {{0xbfc17a2f, 0xc2daf61b} }, +/**/ {{0x3f996f63, 0x57b649f0} }, +/**/ {{0x3fb5cf46, 0xf14fef28} }, +/**/ {{0xbfac405c, 0xec5a22c2} } }, +/**/ {{{0x3fd10000, 0x00000000} }, +/**/ {{0x3fd09dc5, 0x97d86362} }, +/**/ {{0x3c762e47, 0x390cb865} }, +/**/ {{0x3fede418, 0x0d8b5ae6} }, +/**/ {{0x3c719298, 0x23f66cf0} }, +/**/ {{0xbfcdaa81, 0xc655a596} }, +/**/ {{0x3c666d0d, 0x6a90480b} }, +/**/ {{0xbfcb69e9, 0x1974fd6c} }, +/**/ {{0xbc68e199, 0xec28723f} }, +/**/ {{0x3fc80ee6, 0x9dcd2641} }, +/**/ {{0x3c37ccfe, 0x45b4bb82} }, +/**/ {{0x3fa740d7, 0x64b143be} }, +/**/ {{0xbfc162bf, 0x4b6b7330} }, +/**/ {{0x3f9c2147, 0x7a20d203} }, +/**/ {{0x3fb54e68, 0xa0d6b625} }, +/**/ {{0xbfad03cd, 0x7b6e81ad} } }, +/**/ {{{0x3fd14000, 0x00000000} }, +/**/ {{0x3fd0d97e, 0xe509acb3} }, +/**/ {{0x3c747c31, 0x7bd5a3eb} }, +/**/ {{0x3fedd52e, 0x554f6dcf} }, +/**/ {{0xbc75c686, 0xddcd060b} }, +/**/ {{0xbfcdfc2e, 0xef1cb578} }, +/**/ {{0xbc46ae20, 0xd1677d50} }, +/**/ {{0xbfcb0974, 0xb81cdb34} }, +/**/ {{0x3c36ed8e, 0xda61c86c} }, +/**/ {{0x3fc82af3, 0x5fcd53c1} }, +/**/ {{0xbc424fe5, 0x57b559e7} }, +/**/ {{0x3fa5a0c6, 0x17013aef} }, +/**/ {{0xbfc148fa, 0x484940dd} }, +/**/ {{0x3f9ec2da, 0x1737ca6d} }, +/**/ {{0x3fb4ca38, 0x800ba495} }, +/**/ {{0xbfadba0e, 0x35128042} } }, +/**/ {{{0x3fd18000, 0x00000000} }, +/**/ {{0x3fd1151a, 0x362431ca} }, +/**/ {{0xbc74dc8d, 0xc9077b9f} }, +/**/ {{0x3fedc61c, 0x0ef1f116} }, +/**/ {{0xbc8fe39f, 0x2d41c166} }, +/**/ {{0xbfce4cba, 0x1681d2c9} }, +/**/ {{0x3c340fb4, 0x369a3c18} }, +/**/ {{0xbfcaa894, 0x31d921e2} }, +/**/ {{0x3c6bf59e, 0x64c48da4} }, +/**/ {{0x3fc844f9, 0x9a284cea} }, +/**/ {{0xbc563be0, 0x629cfeb8} }, +/**/ {{0x3fa4033a, 0xa7f26285} }, +/**/ {{0xbfc12cef, 0x2e2d72ea} }, +/**/ {{0x3fa0a9da, 0x554d151d} }, +/**/ {{0x3fb442f1, 0xe9f9174f} }, +/**/ {{0xbfae631e, 0x799e467c} } }, +/**/ {{{0x3fd1c000, 0x00000000} }, +/**/ {{0x3fd15097, 0x3a9ce547} }, +/**/ {{0xbc7796ba, 0x7f9ca328} }, +/**/ {{0x3fedb6e1, 0xcbc2abaa} }, +/**/ {{0xbc823b7a, 0xc39a4e7c} }, +/**/ {{0xbfce9c22, 0x0436f806} }, +/**/ {{0xbc64a5ec, 0x885803cb} }, +/**/ {{0xbfca474f, 0x9a4c8963} }, +/**/ {{0x3c671cf3, 0x6793b663} }, +/**/ {{0x3fc85cfc, 0x9606243b} }, +/**/ {{0x3c5fd2b2, 0x1dcd45ed} }, +/**/ {{0x3fa2686a, 0xf8cc655f} }, +/**/ {{0xbfc10eac, 0xc8460b94} }, +/**/ {{0x3fa1e9bc, 0x0d6eb5ba} }, +/**/ {{0x3fb3b8d0, 0x2e4749c2} }, +/**/ {{0xbfaeff03, 0xf0d19201} } }, +/**/ {{{0x3fd20000, 0x00000000} }, +/**/ {{0x3fd18bf5, 0xa30bf178} }, +/**/ {{0x3c630ca4, 0x748b1bf9} }, +/**/ {{0x3feda780, 0x1da7801e} }, +/**/ {{0xbc861ff8, 0x961ff896} }, +/**/ {{0xbfceea65, 0x9814cb11} }, +/**/ {{0xbc5f9845, 0x34cb01ca} }, +/**/ {{0xbfc9e5ae, 0xf76f9fa1} }, +/**/ {{0x3c688b7a, 0xa3ee6a86} }, +/**/ {{0x3fc872ff, 0xdf090624} }, +/**/ {{0x3c31016f, 0x6fbad4bb} }, +/**/ {{0x3fa0d08b, 0x83fe02bc} }, +/**/ {{0xbfc0ee42, 0x31b98637} }, +/**/ {{0x3fa320e6, 0x5b309f28} }, +/**/ {{0x3fb32c0e, 0x755cbc43} }, +/**/ {{0xbfaf8dca, 0x5dea1ddb} } }, +/**/ {{{0x3fd24000, 0x00000000} }, +/**/ {{0x3fd1c735, 0x212dd884} }, +/**/ {{0xbc67d9ac, 0x78cb2f2e} }, +/**/ {{0x3fed97f7, 0x971063d2} }, +/**/ {{0x3c67a20b, 0xc8b326b7} }, +/**/ {{0xbfcf3783, 0xc9f01359} }, +/**/ {{0x3c4a8b96, 0xd0a651ad} }, +/**/ {{0xbfc983ba, 0x408a6757} }, +/**/ {{0x3c6dfff9, 0xe6424f06} }, +/**/ {{0x3fc88707, 0x41881aad} }, +/**/ {{0xbc63baf9, 0x2204fd29} }, +/**/ {{0x3f9e779e, 0xabd6e10d} }, +/**/ {{0xbfc0cbbe, 0xcf2eab41} }, +/**/ {{0x3fa44f31, 0x1659f377} }, +/**/ {{0x3fb29ce7, 0xa54a8a94} }, +/**/ {{0xbfb007c1, 0xb87973d7} } }, +/**/ {{{0x3fd28000, 0x00000000} }, +/**/ {{0x3fd20255, 0x67e47c96} }, +/**/ {{0xbc618323, 0x28f4290e} }, +/**/ {{0x3fed8848, 0xcaeb6c2a} }, +/**/ {{0x3c81e70d, 0xa08296a2} }, +/**/ {{0xbfcf837b, 0xa96c2792} }, +/**/ {{0xbc6ab5ce, 0xc6884369} }, +/**/ {{0xbfc92179, 0x5d351cdb} }, +/**/ {{0x3c617000, 0x68719d81} }, +/**/ {{0x3fc89916, 0xc8c1ca07} }, +/**/ {{0xbc6a3339, 0x18b0f81b} }, +/**/ {{0x3f9b54d0, 0x0caf6121} }, +/**/ {{0xbfc0a732, 0x485ba392} }, +/**/ {{0x3fa57477, 0xc250c31e} }, +/**/ {{0x3fb20b96, 0x4790b4a8} }, +/**/ {{0xbfb04223, 0x4ac23178} } }, +/**/ {{{0x3fd2c000, 0x00000000} }, +/**/ {{0x3fd23d56, 0x2b381042} }, +/**/ {{0xbc5c5317, 0x16200088} }, +/**/ {{0x3fed7874, 0x4c98f347} }, +/**/ {{0xbc8a7dac, 0x9a72647e} }, +/**/ {{0xbfcfce4c, 0x5dca68a2} }, +/**/ {{0x3c6433de, 0x8fb9ffdd} }, +/**/ {{0xbfc8bef4, 0x246041ce} }, +/**/ {{0xbc66c620, 0x1fb39160} }, +/**/ {{0x3fc8a932, 0xbd062535} }, +/**/ {{0xbc6e24c7, 0xfbc3a86c} }, +/**/ {{0x3f98390b, 0x64d0109d} }, +/**/ {{0xbfc080ac, 0x819f2998} }, +/**/ {{0x3fa69099, 0x8784ffb8} }, +/**/ {{0x3fb17854, 0x6fc55e9b} }, +/**/ {{0xbfb07618, 0x5f970a81} } }, +/**/ {{{0x3fd30000, 0x00000000} }, +/**/ {{0x3fd27837, 0x2057ef46} }, +/**/ {{0xbc7077cd, 0xd36dfc81} }, +/**/ {{0x3fed687a, 0xafdfd5ba} }, +/**/ {{0xbc782e68, 0xe19d8d3d} }, +/**/ {{0xbfd00bfa, 0x92db6fdb} }, +/**/ {{0x3c7854cd, 0xc0af523f} }, +/**/ {{0xbfc85c32, 0x5b640da2} }, +/**/ {{0x3c5d5bdd, 0x5e6f23d6} }, +/**/ {{0x3fc8b75f, 0xa1da32d2} }, +/**/ {{0x3c2788df, 0x29860bfe} }, +/**/ {{0x3f9524ad, 0xee810d60} }, +/**/ {{0xbfc0583d, 0x95a69dea} }, +/**/ {{0x3fa7a379, 0x2b4d3dec} }, +/**/ {{0x3fb0e35b, 0xa3290dfe} }, +/**/ {{0xbfb0a3b2, 0x19e12287} } }, +/**/ {{{0x3fd34000, 0x00000000} }, +/**/ {{0x3fd2b2f7, 0xfd9b5fe2} }, +/**/ {{0x3c2423cf, 0xc1c2d443} }, +/**/ {{0x3fed585c, 0x88e1caa2} }, +/**/ {{0xbc2c8af2, 0x01239e18} }, +/**/ {{0xbfd0303a, 0xab890af7} }, +/**/ {{0x3c7d42bf, 0x726290e6} }, +/**/ {{0xbfc7f93b, 0xb5175de0} }, +/**/ {{0x3c5d5d4b, 0xe0ddc367} }, +/**/ {{0x3fc8c3a2, 0x3414de7c} }, +/**/ {{0x3c5ade9b, 0xba92bfce} }, +/**/ {{0x3f921811, 0xda70853d} }, +/**/ {{0xbfc02df5, 0xcf23aaf0} }, +/**/ {{0x3fa8acfd, 0x06445ff8} }, +/**/ {{0x3fb04ce4, 0xc130eba4} }, +/**/ {{0xbfb0cb04, 0x29de3135} } }, +/**/ {{{0x3fd38000, 0x00000000} }, +/**/ {{0x3fd2ed98, 0x7a823cfe} }, +/**/ {{0x3c6b9125, 0x8ea012ca} }, +/**/ {{0x3fed481a, 0x6c0fd782} }, +/**/ {{0x3c82dda4, 0x85ff74ea} }, +/**/ {{0xbfd053e6, 0x2f5c1e18} }, +/**/ {{0xbc679cf2, 0x8ec637b8} }, +/**/ {{0xbfc79617, 0xd0ee3e3b} }, +/**/ {{0xbc4e91e0, 0x732049a6} }, +/**/ {{0x3fc8cdff, 0x67f6478d} }, +/**/ {{0xbc5cb659, 0xf5079e63} }, +/**/ {{0x3f8e271c, 0x8e8ef686} }, +/**/ {{0xbfc001e5, 0xa2940881} }, +/**/ {{0x3fa9ad0e, 0xf937caae} }, +/**/ {{0x3faf6a4f, 0xda1e257f} }, +/**/ {{0xbfb0ec24, 0xb07d42be} } }, +/**/ {{{0x3fd3c000, 0x00000000} }, +/**/ {{0x3fd32818, 0x4fb58952} }, +/**/ {{0xbc7a95f0, 0xa9939f2f} }, +/**/ {{0x3fed37b4, 0xee1ee130} }, +/**/ {{0x3c747541, 0x6fbb1f2d} }, +/**/ {{0xbfd076fc, 0xe022dd0d} }, +/**/ {{0x3c6d8659, 0x5534523a} }, +/**/ {{0xbfc732ce, 0x3a201d6b} }, +/**/ {{0xbc56a551, 0xc98a3a62} }, +/**/ {{0x3fc8d67c, 0x673a29b8} }, +/**/ {{0xbc54ae9d, 0xff95efe6} }, +/**/ {{0x3f882eee, 0x74ce6814} }, +/**/ {{0xbfbfa83b, 0x503ba8f4} }, +/**/ {{0x3faaa39c, 0x60b63f75} }, +/**/ {{0x3fae38b8, 0xf07ff274} }, +/**/ {{0xbfb1072c, 0x2200fe4d} } }, +/**/ {{{0x3fd40000, 0x00000000} }, +/**/ {{0x3fd36277, 0x3707ebcc} }, +/**/ {{0xbc6963a5, 0x44b672d8} }, +/**/ {{0x3fed272c, 0xa3fc5b1a} }, +/**/ {{0x3c8ae01d, 0x272ca3fc} }, +/**/ {{0xbfd0997e, 0x8aec9d8e} }, +/**/ {{0x3c74aeda, 0x72595f36} }, +/**/ {{0xbfc6cf66, 0x66d5c0ff} }, +/**/ {{0x3c410e2a, 0x3ca66cc1} }, +/**/ {{0x3fc8dd1e, 0x8f2617b5} }, +/**/ {{0xbc6d173e, 0x4facfb67} }, +/**/ {{0x3f82483b, 0x33966883} }, +/**/ {{0xbfbf495d, 0x2b05b16b} }, +/**/ {{0x3fab9096, 0x074fdeaf} }, +/**/ {{0x3fad0571, 0x9c4605c9} }, +/**/ {{0xbfb11c35, 0x280318fd} } }, +/**/ {{{0x3fd44000, 0x00000000} }, +/**/ {{0x3fd39cb4, 0xeb76157c} }, +/**/ {{0xbc72f4da, 0x5a214713} }, +/**/ {{0x3fed1682, 0x22c31625} }, +/**/ {{0x3c8ac111, 0xd5e51b41} }, +/**/ {{0xbfd0bb6b, 0x07e9a89a} }, +/**/ {{0x3c76fb53, 0x7faa1dda} }, +/**/ {{0xbfc66be7, 0xb75f0772} }, +/**/ {{0xbc69a77d, 0xee6d618b} }, +/**/ {{0x3fc8e1eb, 0x6e943d69} }, +/**/ {{0xbc6982c4, 0xc5ec9ebe} }, +/**/ {{0x3f78e73c, 0x9c2d3c0c} }, +/**/ {{0xbfbee752, 0x7059f387} }, +/**/ {{0x3fac73f0, 0x16982f58} }, +/**/ {{0x3fabd0e4, 0xc146b407} }, +/**/ {{0xbfb12b5c, 0x82f43254} } }, +/**/ {{{0x3fd48000, 0x00000000} }, +/**/ {{0x3fd3d6d1, 0x29271134} }, +/**/ {{0x3c7137ca, 0x41cc958a} }, +/**/ {{0x3fed05b5, 0xffb0304c} }, +/**/ {{0xbc8fc921, 0x33e896e5} }, +/**/ {{0xbfd0dcc2, 0x3a49e254} }, +/**/ {{0x3c704578, 0x925cb599} }, +/**/ {{0xbfc60859, 0x75708502} }, +/**/ {{0xbc5f88bc, 0x9feebe6c} }, +/**/ {{0x3fc8e4e8, 0xc3fb5c1c} }, +/**/ {{0x3c6de114, 0xd6b77a05} }, +/**/ {{0x3f6ac6b3, 0xdbc6c857} }, +/**/ {{0xbfbe823c, 0xdeabd793} }, +/**/ {{0x3fad4da2, 0x06fb52a7} }, +/**/ {{0x3faa9b7b, 0x2bea698c} }, +/**/ {{0xbfb134c0, 0xeb32d745} } }, +/**/ {{{0x3fd4c000, 0x00000000} }, +/**/ {{0x3fd410cb, 0xad6c7d33} }, +/**/ {{0xbc7b0c8b, 0xae13b512} }, +/**/ {{0x3fecf4c8, 0xd0182625} }, +/**/ {{0x3c8e6308, 0xf4103798} }, +/**/ {{0xbfd0fd84, 0x101a5438} }, +/**/ {{0x3c425fcd, 0x7d2e3e34} }, +/**/ {{0xbfc5a4c2, 0xd36904f6} }, +/**/ {{0x3c5d3583, 0x54f27bb6} }, +/**/ {{0x3fc8e61c, 0x7b74b00c} }, +/**/ {{0x3c32f7ad, 0xefe568b6} }, +/**/ {{0x3f402f60, 0xaa3667f2} }, +/**/ {{0xbfbe1a3e, 0x4c9859c0} }, +/**/ {{0x3fae1da6, 0x8e77c589} }, +/**/ {{0x3fa9659b, 0x6ed5823e} }, +/**/ {{0xbfb13882, 0xf1d3d420} } }, +/**/ {{{0x3fd50000, 0x00000000} }, +/**/ {{0x3fd44aa4, 0x36c2af0a} }, +/**/ {{0xbc75d5e4, 0x3c55b3ba} }, +/**/ {{0x3fece3bb, 0x295c0773} }, +/**/ {{0xbc826fd5, 0x91851b41} }, +/**/ {{0xbfd11db0, 0x8221a582} }, +/**/ {{0x3c7e9654, 0xa9f31d11} }, +/**/ {{0xbfc5412a, 0xeb9ef661} }, +/**/ {{0x3c573faf, 0x5e60433c} }, +/**/ {{0x3fc8e58c, 0xacc06b3a} }, +/**/ {{0xbc5dba9a, 0x64dd81ed} }, +/**/ {{0xbf625ff7, 0xcfe3f01e} }, +/**/ {{0xbfbdaf78, 0x9dae4b1c} }, +/**/ {{0x3faee3fb, 0x8e4e3e16} }, +/**/ {{0x3fa82fa9, 0xc2c60fed} }, +/**/ {{0xbfb136c4, 0xe13555d9} } }, +/**/ {{{0x3fd54000, 0x00000000} }, +/**/ {{0x3fd4845a, 0x84d0c21b} }, +/**/ {{0x3c71e28a, 0x7563c6a6} }, +/**/ {{0x3fecd28d, 0xa0decfad} }, +/**/ {{0xbc72b2c8, 0x49610c12} }, +/**/ {{0xbfd13d47, 0x93bb8da8} }, +/**/ {{0x3c5df07a, 0x1b48d912} }, +/**/ {{0xbfc4dd98, 0xbfb5c8b7} }, +/**/ {{0x3c58a9ff, 0x39a108d7} }, +/**/ {{0x3fc8e33f, 0x99496dc4} }, +/**/ {{0x3c380d8b, 0x19d3995c} }, +/**/ {{0xbf743d59, 0xba1bc2d2} }, +/**/ {{0xbfbd420d, 0xb77862a1} }, +/**/ {{0x3fafa0a1, 0xffb9511c} }, +/**/ {{0x3fa6fa07, 0xe8a86cad} }, +/**/ {{0xbfb12faa, 0x9d75a109} } }, +/**/ {{{0x3fd58000, 0x00000000} }, +/**/ {{0x3fd4bdee, 0x586890e7} }, +/**/ {{0xbc6e4dc7, 0x7c22a757} }, +/**/ {{0x3fecc140, 0xcbfae3a7} }, +/**/ {{0xbc41045d, 0xd8b6f9b9} }, +/**/ {{0xbfd15c49, 0x52b34cdc} }, +/**/ {{0x3c729992, 0x2daa60ac} }, +/**/ {{0xbfc47a13, 0x37fb39ef} }, +/**/ {{0x3c5cb3b2, 0x3482d371} }, +/**/ {{0x3fc8df3b, 0xaa28e022} }, +/**/ {{0xbc61a8ab, 0x969a5447} }, +/**/ {{0xbf7f2135, 0xc651ecb4} }, +/**/ {{0xbfbcd21f, 0x76cc63f7} }, +/**/ {{0x3fb029ce, 0xefdf4de1} }, +/**/ {{0x3fa5c515, 0x0de3bf96} }, +/**/ {{0xbfb12359, 0x84e55ab4} } }, +/**/ {{{0x3fd5c000, 0x00000000} }, +/**/ {{0x3fd4f75f, 0x73869979} }, +/**/ {{0xbc595a1c, 0xf7ff1108} }, +/**/ {{0x3fecafd5, 0x3ff7b52c} }, +/**/ {{0x3c86e099, 0x684b6314} }, +/**/ {{0xbfd17ab5, 0xd71d366e} }, +/**/ {{0x3c602f2c, 0xae2f7b71} }, +/**/ {{0xbfc416a1, 0x22cc956f} }, +/**/ {{0x3c61d29e, 0xe98c24c1} }, +/**/ {{0x3fc8d987, 0x6e2a4f9f} }, +/**/ {{0xbc60de73, 0x4a6a7880} }, +/**/ {{0xbf84ed52, 0x909e42ec} }, +/**/ {{0xbfbc5fcf, 0xa56263a8} }, +/**/ {{0x3fb07e7b, 0x0d159803} }, +/**/ {{0x3fa4912d, 0xb2ddf20b} }, +/**/ {{0xbfb111f8, 0x508c8585} } }, +/**/ {{{0x3fd60000, 0x00000000} }, +/**/ {{0x3fd530ad, 0x9951cd4a} }, +/**/ {{0xbc625664, 0x80884082} }, +/**/ {{0x3fec9e4b, 0x91ff8d87} }, +/**/ {{0xbc7723ff, 0x1b0da370} }, +/**/ {{0xbfd1988d, 0x432f5908} }, +/**/ {{0x3c7d065e, 0xf8714cda} }, +/**/ {{0xbfc3b349, 0x3403e07c} }, +/**/ {{0x3c6b571d, 0x2717fbb0} }, +/**/ {{0x3fc8d229, 0x97d0e938} }, +/**/ {{0x3c66b228, 0xb08a0625} }, +/**/ {{0xbf8a3464, 0xc2fe9cde} }, +/**/ {{0xbfbbeb3f, 0xefb6f244} }, +/**/ {{0x3fb0ce5a, 0x39e67c0b} }, +/**/ {{0x3fa35eab, 0x93b4fb73} }, +/**/ {{0xbfb0fbae, 0xf4d86f78} } }, +/**/ {{{0x3fd64000, 0x00000000} }, +/**/ {{0x3fd569d8, 0x8e1b4cd8} }, +/**/ {{0xbc6fec61, 0xe713cfe2} }, +/**/ {{0x3fec8ca4, 0x57157fc9} }, +/**/ {{0x3c70da14, 0x515734ba} }, +/**/ {{0xbfd1b5cf, 0xc3195094} }, +/**/ {{0x3c740cce, 0xa9537e45} }, +/**/ {{0xbfc35012, 0x046cee83} }, +/**/ {{0xbc651b6c, 0xe446fd10} }, +/**/ {{0x3fc8c928, 0xfb5e6a95} }, +/**/ {{0x3c656cd2, 0x82469bf3} }, +/**/ {{0xbf8f6568, 0xa4afbb1b} }, +/**/ {{0xbfbb7491, 0xdb3aba50} }, +/**/ {{0x3fb11972, 0xb9fd56ec} }, +/**/ {{0x3fa22de5, 0x9329e15e} }, +/**/ {{0xbfb0e0a6, 0x8287d93d} } }, +/**/ {{{0x3fd68000, 0x00000000} }, +/**/ {{0x3fd5a2e0, 0x175e0f4e} }, +/**/ {{0x3c713b7a, 0x8f82e457} }, +/**/ {{0x3fec7ae0, 0x240b83ae} }, +/**/ {{0xbc885b56, 0x10d398ed} }, +/**/ {{0xbfd1d27d, 0x8cdb4db0} }, +/**/ {{0x3c11d95f, 0x2db0447f} }, +/**/ {{0xbfc2ed02, 0x11425541} }, +/**/ {{0xbc11d124, 0x6b2cbaa3} }, +/**/ {{0x3fc8be8c, 0x8cdc5c4d} }, +/**/ {{0xbc542511, 0x794444b0} }, +/**/ {{0xbf923ffd, 0xd25a5415} }, +/**/ {{0xbfbafbe6, 0xbcd1df44} }, +/**/ {{0x3fb15fcc, 0x26bdf05c} }, +/**/ {{0x3fa0ff2f, 0xa7b853e6} }, +/**/ {{0xbfb0c109, 0x07e9a35f} } }, +/**/ {{{0x3fd6c000, 0x00000000} }, +/**/ {{0x3fd5dbc3, 0xfbbe768d} }, +/**/ {{0x3c6ea0ec, 0x1b76f7da} }, +/**/ {{0x3fec68ff, 0x8d78b9ce} }, +/**/ {{0xbc83ab41, 0x4cb5a0c3} }, +/**/ {{0xbfd1ee96, 0xe01c5e6e} }, +/**/ {{0x3c73922c, 0xfb76d8dd} }, +/**/ {{0xbfc28a1f, 0xbbb23677} }, +/**/ {{0x3c6e592a, 0x288601f2} }, +/**/ {{0x3fc8b25b, 0x5e282403} }, +/**/ {{0xbbef7d58, 0x707e09fa} }, +/**/ {{0xbf94c1e0, 0xb65add31} }, +/**/ {{0xbfba815f, 0xafa52f1b} }, +/**/ {{0x3fb1a16f, 0x63712acc} }, +/**/ {{0x3f9fa5b5, 0x95a8d3ad} }, +/**/ {{0xbfb09d01, 0x72814750} } }, +/**/ {{{0x3fd70000, 0x00000000} }, +/**/ {{0x3fd61484, 0x0309cfe2} }, +/**/ {{0xbc7a7257, 0x15711f00} }, +/**/ {{0x3fec5703, 0x27afd9eb} }, +/**/ {{0x3c63c2ab, 0xb32c1d72} }, +/**/ {{0xbfd20a1c, 0x06000419} }, +/**/ {{0xbc7b5fe7, 0xf51a3a28} }, +/**/ {{0xbfc22771, 0x486ad2c8} }, +/**/ {{0xbc499ab5, 0xf84a7eae} }, +/**/ {{0x3fc8a49c, 0x9d027817} }, +/**/ {{0xbc53fcab, 0x2e376ecc} }, +/**/ {{0xbf973831, 0xeaabcb23} }, +/**/ {{0xbfba051d, 0x8c46fbce} }, +/**/ {{0x3fb1de66, 0x9132e9cc} }, +/**/ {{0x3f9d5269, 0xd48d5d65} }, +/**/ {{0xbfb074bb, 0x712354a4} } }, +/**/ {{{0x3fd74000, 0x00000000} }, +/**/ {{0x3fd64d1f, 0xf635c1c6} }, +/**/ {{0xbc7fa403, 0xe7c0fdbe} }, +/**/ {{0x3fec44eb, 0x86b5cbf8} }, +/**/ {{0xbc6a4101, 0xbc5b562d} }, +/**/ {{0xbfd2250d, 0x50fb21ad} }, +/**/ {{0xbc750066, 0xa39bdc1a} }, +/**/ {{0xbfc1c4fc, 0xdf2ed728} }, +/**/ {{0x3c6a87bb, 0x006772e9} }, +/**/ {{0x3fc89557, 0x9122b9b7} }, +/**/ {{0xbc05454e, 0x45b04f75} }, +/**/ {{0xbf99a2c9, 0x6c7888f1} }, +/**/ {{0xbfb98740, 0xe02d36ad} }, +/**/ {{0x3fb216bd, 0x02a99665} }, +/**/ {{0x3f9b0511, 0xb73aeccb} }, +/**/ {{0xbfb04863, 0x569b1738} } }, +/**/ {{{0x3fd78000, 0x00000000} }, +/**/ {{0x3fd68597, 0x9f5fa6fe} }, +/**/ {{0xbc425781, 0x4d1ada9c} }, +/**/ {{0x3fec32b9, 0x3e386c7f} }, +/**/ {{0x3c756033, 0x8cbaa5bf} }, +/**/ {{0xbfd23f6b, 0x1ca84e79} }, +/**/ {{0x3c604cc0, 0xf123d574} }, +/**/ {{0xbfc162c8, 0x8a715435} }, +/**/ {{0x3c5cf6db, 0x454fb8fd} }, +/**/ {{0x3fc88493, 0x9a4eb534} }, +/**/ {{0xbc668a5c, 0x42b959b0} }, +/**/ {{0xbf9c0182, 0x42580bb5} }, +/**/ {{0xbfb907e9, 0xe5822d56} }, +/**/ {{0x3fb24a7f, 0x2f8f8273} }, +/**/ {{0x3f98be3c, 0xa3527f46} }, +/**/ {{0xbfb01825, 0xfce97270} } }, +/**/ {{{0x3fd7c000, 0x00000000} }, +/**/ {{0x3fd6bdea, 0xc9cbd76d} }, +/**/ {{0xbc5a5c56, 0x3e6de828} }, +/**/ {{0x3fec206c, 0xe1857d04} }, +/**/ {{0xbc80439f, 0xf5c83872} }, +/**/ {{0xbfd25935, 0xcd9b9870} }, +/**/ {{0x3c6aaf98, 0xf1ec7306} }, +/**/ {{0xbfc100da, 0x36f94d02} }, +/**/ {{0xbc6e72ca, 0xd96d84ff} }, +/**/ {{0x3fc87258, 0x2e774351} }, +/**/ {{0x3c6c50a2, 0xb8860ef0} }, +/**/ {{0xbf9e543a, 0x741ef0ec} }, +/**/ {{0xbfb88738, 0x7b4d0ec2} }, +/**/ {{0x3fb279ba, 0xa8164103} }, +/**/ {{0x3f967e73, 0xa7f1ae35} }, +/**/ {{0xbfafc861, 0x5257c3de} } }, +/**/ {{{0x3fd80000, 0x00000000} }, +/**/ {{0x3fd6f619, 0x41e4def1} }, +/**/ {{0xbc7c63aa, 0xe6f6e918} }, +/**/ {{0x3fec0e07, 0x0381c0e0} }, +/**/ {{0x3c8c0e07, 0x0381c0e0} }, +/**/ {{0xbfd2726d, 0xd135c174} }, +/**/ {{0xbc2d352d, 0xe0951cf8} }, +/**/ {{0xbfc09f37, 0xb38cc8cf} }, +/**/ {{0xbc69db81, 0xae75327f} }, +/**/ {{0x3fc85eac, 0xd7da413c} }, +/**/ {{0x3c5b1a89, 0x6ebae2bc} }, +/**/ {{0xbfa04d69, 0x80fcc815} }, +/**/ {{0xbfb8054c, 0x1df326f9} }, +/**/ {{0x3fb2a47e, 0x082bda60} }, +/**/ {{0x3f944639, 0x7091d5a4} }, +/**/ {{0xbfaf5961, 0xe072e48c} } }, +/**/ {{{0x3fd84000, 0x00000000} }, +/**/ {{0x3fd72e22, 0xd53aa2aa} }, +/**/ {{0xbc7d9c93, 0x4e79f27c} }, +/**/ {{0x3febfb88, 0x36a04729} }, +/**/ {{0xbc872745, 0x9ac2ea21} }, +/**/ {{0xbfd28b13, 0x9d7702cf} }, +/**/ {{0x3c7819b9, 0x4be8bff6} }, +/**/ {{0xbfc03de6, 0xb0a35176} }, +/**/ {{0x3c5dbfb0, 0xc83347af} }, +/**/ {{0x3fc84999, 0x332a4f86} }, +/**/ {{0x3c5d304e, 0x0a22d12d} }, +/**/ {{0xbfa16a97, 0xed6b2d30} }, +/**/ {{0xbfb78243, 0xe0128950} }, +/**/ {{0x3fb2cad8, 0xeaa98f57} }, +/**/ {{0x3f92160a, 0x3bb39c5b} }, +/**/ {{0xbfaee3a9, 0x3804caa3} } }, +/**/ {{{0x3fd88000, 0x00000000} }, +/**/ {{0x3fd76607, 0x52817502} }, +/**/ {{0xbc4dd117, 0x91cc7600} }, +/**/ {{0x3febe8f1, 0x0cd9e1fe} }, +/**/ {{0xbc7a9688, 0xa21e102a} }, +/**/ {{0xbfd2a327, 0xb0d161e9} }, +/**/ {{0xbc60a2a9, 0x14b44140} }, +/**/ {{0xbfbfb9d9, 0x803f8d3b} }, +/**/ {{0x3c5e5779, 0x2a5c4097} }, +/**/ {{0x3fc83324, 0xedbcc363} }, +/**/ {{0x3c651fbc, 0xa0442744} }, +/**/ {{0xbfa2819b, 0xe91477c3} }, +/**/ {{0xbfb6fe3e, 0x63b6abf0} }, +/**/ {{0x3fb2ecdb, 0xdc73a89a} }, +/**/ {{0x3f8fdcb7, 0xaa755298} }, +/**/ {{0xbfae6793, 0x237c2f3d} } }, +/**/ {{{0x3fd8c000, 0x00000000} }, +/**/ {{0x3fd79dc6, 0x899118d1} }, +/**/ {{0x3c2b7413, 0xa0ef606d} }, +/**/ {{0x3febd642, 0x17a4cbc3} }, +/**/ {{0xbc55ee5d, 0x3200a548} }, +/**/ {{0xbfd2baaa, 0x91faa133} }, +/**/ {{0xbc6bd391, 0xfaf41548} }, +/**/ {{0xbfbef89e, 0xaa22d832} }, +/**/ {{0x3c413b3b, 0xc874fdb9} }, +/**/ {{0x3fc81b57, 0xc3be300a} }, +/**/ {{0x3c6baf9b, 0xc01a615f} }, +/**/ {{0xbfa3926a, 0x4a872ec7} }, +/**/ {{0xbfb67959, 0xd3e743cd} }, +/**/ {{0x3fb30a98, 0x4f919505} }, +/**/ {{0x3f8b9f3b, 0x28b78b08} }, +/**/ {{0xbfade57b, 0x71e33e9d} } }, +/**/ {{{0x3fd90000, 0x00000000} }, +/**/ {{0x3fd7d560, 0x4b63b3f7} }, +/**/ {{0x3c769c88, 0x5c2b249a} }, +/**/ {{0x3febc37b, 0xe7ec7a8d} }, +/**/ {{0xbc6f1246, 0x2b0e2727} }, +/**/ {{0xbfd2d19c, 0xcfbdd7fa} }, +/**/ {{0x3c7d0b11, 0x5e00c582} }, +/**/ {{0xbfbe3827, 0x86f8309b} }, +/**/ {{0x3c5d64e9, 0xfa6c56a7} }, +/**/ {{0x3fc80239, 0x7e6de8de} }, +/**/ {{0x3c68d62f, 0x7776e849} }, +/**/ {{0xbfa49cf9, 0x4f6d8017} }, +/**/ {{0xbfb5f3b3, 0xde917e27} }, +/**/ {{0x3fb32420, 0x8e455cc2} }, +/**/ {{0x3f877470, 0xb9fc88fe} }, +/**/ {{0xbfad5dbd, 0xc6b10536} } }, +/**/ {{{0x3fd94000, 0x00000000} }, +/**/ {{0x3fd80cd4, 0x6a14b1d1} }, +/**/ {{0xbc7e79f9, 0x9684fa19} }, +/**/ {{0x3febb09f, 0x0e09a222} }, +/**/ {{0x3c85748e, 0x7e047edd} }, +/**/ {{0xbfd2e7ff, 0x00ccbbc8} }, +/**/ {{0xbc78eb0a, 0x96875561} }, +/**/ {{0xbfbd787e, 0x804ecc06} }, +/**/ {{0xbc27263b, 0x2e4351f8} }, +/**/ {{0x3fc7e7d1, 0xf260d7b4} }, +/**/ {{0xbc430525, 0x8ed258e3} }, +/**/ {{0xbfa5a140, 0x968d3d02} }, +/**/ {{0xbfb56d69, 0xaecb845e} }, +/**/ {{0x3fb33987, 0xae292f95} }, +/**/ {{0x3f835d1d, 0x48e09ecd} }, +/**/ {{0xbfacd0b5, 0x6b6f9aca} } }, +/**/ {{{0x3fd98000, 0x00000000} }, +/**/ {{0x3fd84422, 0xb8df95d7} }, +/**/ {{0x3c7d76a0, 0x299b41b6} }, +/**/ {{0x3feb9dac, 0x19ba64d6} }, +/**/ {{0xbc4f643a, 0xa13ee09f} }, +/**/ {{0xbfd2fdd1, 0xc390a5c9} }, +/**/ {{0x3c575152, 0xaa856fcc} }, +/**/ {{0xbfbcb9ad, 0xc0e99751} }, +/**/ {{0x3c4e2d44, 0x1347a357} }, +/**/ {{0x3fc7cc28, 0xfdcbfd40} }, +/**/ {{0x3c60dc32, 0xe516db08} }, +/**/ {{0xbfa69f39, 0x19851d86} }, +/**/ {{0xbfb4e697, 0xe772087d} }, +/**/ {{0x3fb34ae1, 0x835992de} }, +/**/ {{0x3f7eb3f1, 0xe5326389} }, +/**/ {{0xbfac3ebd, 0x234575e8} } }, +/**/ {{{0x3fd9c000, 0x00000000} }, +/**/ {{0x3fd87b4b, 0x0c1ebedc} }, +/**/ {{0xbc76dcfa, 0xa2fa470f} }, +/**/ {{0x3feb8aa3, 0x9a1ab378} }, +/**/ {{0x3c8efdb0, 0xb797ab93} }, +/**/ {{0xbfd31315, 0xbdfb5e5a} }, +/**/ {{0x3c5813a8, 0x862f0c0d} }, +/**/ {{0xbfbbfbbf, 0x3478f169} }, +/**/ {{0xbc51e810, 0xd9e52582} }, +/**/ {{0x3fc7af46, 0x86d6ec76} }, +/**/ {{0xbc6336de, 0x3c13b159} }, +/**/ {{0xbfa796dd, 0x264b8050} }, +/**/ {{0xbfb45f5a, 0x9e1f6bef} }, +/**/ {{0x3fb35842, 0x93b26fc1} }, +/**/ {{0x3f76d75e, 0x39bc3abf} }, +/**/ {{0xbfaba82f, 0x006e38b2} } }, +/**/ {{{0x3fda0000, 0x00000000} }, +/**/ {{0x3fd8b24d, 0x394a1b25} }, +/**/ {{0x3c7b6d0b, 0xa3748fa8} }, +/**/ {{0x3feb7786, 0x1d9cdc98} }, +/**/ {{0xbc62e22c, 0x345bd7a8} }, +/**/ {{0xbfd327cb, 0x9d57b8f5} }, +/**/ {{0xbc135343, 0x753cc4f1} }, +/**/ {{0xbfbb3ebc, 0x8761b154} }, +/**/ {{0x3c5abeec, 0x8c168fdd} }, +/**/ {{0x3fc79132, 0x79f68c54} }, +/**/ {{0xbc658ab9, 0xd8d15eda} }, +/**/ {{0xbfa88828, 0x5872d73c} }, +/**/ {{0xbfb3d7cd, 0x567be750} }, +/**/ {{0x3fb361c0, 0x0a24fc71} }, +/**/ {{0x3f6e4b7a, 0x46aa98b6} }, +/**/ {{0xbfab0d64, 0x3bad3a76} } }, +/**/ {{{0x3fda4000, 0x00000000} }, +/**/ {{0x3fd8e929, 0x16f5cde8} }, +/**/ {{0x3c74c0a7, 0xe12bfafb} }, +/**/ {{0x3feb6454, 0x32024b37} }, +/**/ {{0xbc7987f7, 0x69cc9b53} }, +/**/ {{0xbfd33bf4, 0x161a0a40} }, +/**/ {{0x3c7a2321, 0x83ff46db} }, +/**/ {{0xbfba82af, 0x26913418} }, +/**/ {{0x3c3c4c62, 0x10a559fe} }, +/**/ {{0x3fc771f4, 0xc8506679} }, +/**/ {{0xbc54aaed, 0x63c7ccc3} }, +/**/ {{0xbfa97317, 0x9237e7ff} }, +/**/ {{0xbfb3500a, 0xfde5f112} }, +/**/ {{0x3fb3676f, 0xaa2c3459} }, +/**/ {{0x3f5e80cd, 0x04721907} }, +/**/ {{0xbfaa6eb5, 0x0dc212a5} } }, +/**/ {{{0x3fda8000, 0x00000000} }, +/**/ {{0x3fd91fde, 0x7cd0c662} }, +/**/ {{0x3c710741, 0x88054b53} }, +/**/ {{0x3feb510e, 0x6454751c} }, +/**/ {{0xbc199bfd, 0x7e0f2dca} }, +/**/ {{0xbfd34f8f, 0xe3b081f4} }, +/**/ {{0x3c7d7209, 0x3e2c0515} }, +/**/ {{0xbfb9c7a0, 0x3f5e2d2f} }, +/**/ {{0xbc20b02e, 0xea3bd312} }, +/**/ {{0x3fc75195, 0x6626c39a} }, +/**/ {{0x3c6f30d2, 0xb4219a8a} }, +/**/ {{0xbfaa57a8, 0xf55dfea5} }, +/**/ {{0xbfb2c82d, 0xe771fa17} }, +/**/ {{0x3fb36967, 0xc3654ab4} }, +/**/ {{0x3f11f322, 0xa23eb6eb} }, +/**/ {{0xbfa9cc78, 0x8ae579b1} } }, +/**/ {{{0x3fdac000, 0x00000000} }, +/**/ {{0x3fd9566d, 0x43a34907} }, +/**/ {{0x3c69b015, 0x37e0af2b} }, +/**/ {{0x3feb3db5, 0x40ddf8d3} }, +/**/ {{0xbc616f46, 0x793c10b8} }, +/**/ {{0xbfd3629f, 0xc8537217} }, +/**/ {{0x3c505738, 0x38143614} }, +/**/ {{0xbfb90d98, 0xbf75f20a} }, +/**/ {{0x3c4dc715, 0x6b842647} }, +/**/ {{0x3fc7301c, 0x494dd1e6} }, +/**/ {{0x3c5ec3d6, 0xf49f85b4} }, +/**/ {{0xbfab35db, 0xdbdd23b1} }, +/**/ {{0xbfb2404f, 0xc8407216} }, +/**/ {{0x3fb367bf, 0x255139f9} }, +/**/ {{0xbf5b8a0d, 0x65acd6da} }, +/**/ {{0xbfa92704, 0x8052f51d} } }, +/**/ {{{0x3fdb0000, 0x00000000} }, +/**/ {{0x3fd98cd5, 0x454d6b18} }, +/**/ {{0x3c79e6c9, 0x88fd0a77} }, +/**/ {{0x3feb2a49, 0x5323eb6a} }, +/**/ {{0xbc572202, 0x70cc9678} }, +/**/ {{0xbfd37524, 0x8cd58cc4} }, +/**/ {{0x3c6978a3, 0xda42aa4e} }, +/**/ {{0xbfb854a1, 0x54d5f784} }, +/**/ {{0xbc5e9a15, 0xb33b3d0d} }, +/**/ {{0x3fc70d91, 0x67aa0c46} }, +/**/ {{0xbc6aa72f, 0xa4ac9df8} }, +/**/ {{0xbfac0db0, 0xd0665a46} }, +/**/ {{0xbfb1b889, 0xb428e30d} }, +/**/ {{0x3fb3628d, 0x134448b0} }, +/**/ {{0xbf6bbbc1, 0x67619c9c} }, +/**/ {{0xbfa87ead, 0x53e1f653} } }, +/**/ {{{0x3fdb4000, 0x00000000} }, +/**/ {{0x3fd9c316, 0x5cc58107} }, +/**/ {{0x3c4b6696, 0x02250cfb} }, +/**/ {{0x3feb16cb, 0x25df55f4} }, +/**/ {{0xbc653abc, 0xf48e26bc} }, +/**/ {{0xbfd3871f, 0x00742189} }, +/**/ {{0xbc725ae2, 0xc05df451} }, +/**/ {{0xbfb79cc2, 0x6dd13675} }, +/**/ {{0x3be1d4e0, 0x991905e4} }, +/**/ {{0x3fc6e9fc, 0xb5b8147e} }, +/**/ {{0x3c46463b, 0xa57d4eca} }, +/**/ {{0xbfacdf29, 0x86c1db89} }, +/**/ {{0xbfb130f4, 0x1ab8d1c4} }, +/**/ {{0x3fb359e9, 0x38881228} }, +/**/ {{0xbf74a987, 0x53bec2ff} }, +/**/ {{0xbfa7d3c5, 0xe5af58b6} } }, +/**/ {{{0x3fdb8000, 0x00000000} }, +/**/ {{0x3fd9f930, 0x66168002} }, +/**/ {{0xbc7c8270, 0x47c9439a} }, +/**/ {{0x3feb033b, 0x42f6e2c9} }, +/**/ {{0xbc6eb80c, 0xc48702a7} }, +/**/ {{0xbfd3988f, 0xf8a76337} }, +/**/ {{0xbc636968, 0x5b1bb38a} }, +/**/ {{0xbfb6e604, 0x39212b04} }, +/**/ {{0xbc3c2e20, 0xba255e71} }, +/**/ {{0x3fc6c566, 0x251e2d41} }, +/**/ {{0x3c230ab3, 0x47236369} }, +/**/ {{0xbfadaa48, 0xd40b3417} }, +/**/ {{0xbfb0a9a6, 0xc484f2cc} }, +/**/ {{0x3fb34deb, 0x9cb4573e} }, +/**/ {{0xbf7b44ca, 0x1def6f17} }, +/**/ {{0xbfa7269f, 0x73d683b8} } }, +/**/ {{{0x3fdbc000, 0x00000000} }, +/**/ {{0x3fda2f23, 0x3e5e530b} }, +/**/ {{0x3c5814d5, 0xf797086b} }, +/**/ {{0x3feaef9a, 0x3378ba79} }, +/**/ {{0x3c7da16a, 0x4476e241} }, +/**/ {{0xbfd3a978, 0x50f2beab} }, +/**/ {{0x3c7b7e7f, 0xad5a31ea} }, +/**/ {{0xbfb6306e, 0xa602212f} }, +/**/ {{0xbc31ec15, 0x9ec38d55} }, +/**/ {{0x3fc69fd5, 0xa3477c6a} }, +/**/ {{0x3c571f2f, 0xb2996038} }, +/**/ {{0xbfae6f12, 0xa6cf162d} }, +/**/ {{0xbfb022b8, 0xd0cb2655} }, +/**/ {{0x3fb33eac, 0x9842912f} }, +/**/ {{0xbf80d789, 0x4919e78d} }, +/**/ {{0xbfa67789, 0x8037e242} } }, +/**/ {{{0x3fdc0000, 0x00000000} }, +/**/ {{0x3fda64ee, 0xc3cc23fd} }, +/**/ {{0xbc724dec, 0x1b50b7ff} }, +/**/ {{0x3feadbe8, 0x7f94905e} }, +/**/ {{0x3c2adbe8, 0x7f94905e} }, +/**/ {{0xbfd3b9d8, 0xeab54af9} }, +/**/ {{0x3c75b97d, 0x54fd0941} }, +/**/ {{0xbfb57c09, 0x645a7f9e} }, +/**/ {{0xbc5e79f6, 0x09320811} }, +/**/ {{0x3fc67953, 0x180938f2} }, +/**/ {{0x3c6246f2, 0xe7aee726} }, +/**/ {{0xbfaf2d8b, 0xff0ea012} }, +/**/ {{0xbfaf3881, 0x66c7250c} }, +/**/ {{0x3fb32c44, 0xc95ff694} }, +/**/ {{0xbf83f3f0, 0x25d7ff49} }, +/**/ {{0xbfa5c6d1, 0xb848e1d1} } }, +/**/ {{{0x3fdc4000, 0x00000000} }, +/**/ {{0x3fda9a92, 0xd59e98cf} }, +/**/ {{0x3c42e42d, 0xff75d817} }, +/**/ {{0x3feac826, 0xae95dea9} }, +/**/ {{0xbc534eec, 0x633dec57} }, +/**/ {{0xbfd3c9b2, 0xacfa5b18} }, +/**/ {{0x3c7a7e0c, 0x6c4d8d27} }, +/**/ {{0xbfb4c8db, 0xe4ecc0f6} }, +/**/ {{0xbc534990, 0xc0c32772} }, +/**/ {{0x3fc651e6, 0x6451e377} }, +/**/ {{0xbc6ea814, 0x2a9bb1f1} }, +/**/ {{0xbfafe5ba, 0xe62bc1b2} }, +/**/ {{0xbfae2ca8, 0x65fe3642} }, +/**/ {{0x3fb316cd, 0x09015968} }, +/**/ {{0xbf86f764, 0x3ce97a26} }, +/**/ {{0xbfa514c3, 0xdee8421b} } }, +/**/ {{{0x3fdc8000, 0x00000000} }, +/**/ {{0x3fdad00f, 0x5422058b} }, +/**/ {{0x3c7fc4c3, 0x3891d2e8} }, +/**/ {{0x3feab455, 0x46de51cf} }, +/**/ {{0xbc5b834a, 0xdbc38cc9} }, +/**/ {{0xbfd3d906, 0x844a38eb} }, +/**/ {{0x3c6198e5, 0xbc44eee8} }, +/**/ {{0xbfb416ed, 0x5993cade} }, +/**/ {{0xbc235ccb, 0xfa289b6c} }, +/**/ {{0x3fc62997, 0x60e2a3af} }, +/**/ {{0xbc69a660, 0xcf7bda0e} }, +/**/ {{0xbfb04bd3, 0x33612b72} }, +/**/ {{0xbfad2210, 0xcf62bcd9} }, +/**/ {{0x3fb2fe5e, 0x603bfc37} }, +/**/ {{0xbf89e1ba, 0xa9bce7ec} }, +/**/ {{0xbfa461a9, 0xb83029d5} } }, +/**/ {{{0x3fdcc000, 0x00000000} }, +/**/ {{0x3fdb0564, 0x20ae9344} }, +/**/ {{0xbc793139, 0x46363455} }, +/**/ {{0x3feaa074, 0xcde0631f} }, +/**/ {{0x3c84b49a, 0x143fe6d4} }, +/**/ {{0xbfd3e7d5, 0x627b115b} }, +/**/ {{0x3c77a502, 0x332989c0} }, +/**/ {{0xbfb36644, 0xb589513f} }, +/**/ {{0x3c3abdc9, 0x105eec96} }, +/**/ {{0x3fc6006d, 0xdd12e0be} }, +/**/ {{0xbc4f0281, 0x5d67cb35} }, +/**/ {{0xbfb0a1ab, 0x4238ba83} }, +/**/ {{0xbfac18e3, 0x73889526} }, +/**/ {{0x3fb2e311, 0xfde6351a} }, +/**/ {{0xbf8cb2d2, 0xc256833f} }, +/**/ {{0xbfa3adca, 0xf73e36f0} } }, +/**/ {{{0x3fdd0000, 0x00000000} }, +/**/ {{0x3fdb3a91, 0x1da65c6c} }, +/**/ {{0x3c7ae187, 0xb1ca5040} }, +/**/ {{0x3fea8c85, 0xc81a2254} }, +/**/ {{0xbc83c191, 0x8d67728b} }, +/**/ {{0xbfd3f620, 0x3e8218e0} }, +/**/ {{0xbc72bf32, 0x52bd43ef} }, +/**/ {{0xbfb2b6e8, 0xadb5f398} }, +/**/ {{0x3c340287, 0x6b74d451} }, +/**/ {{0x3fc5d671, 0x9d9e25fc} }, +/**/ {{0x3c639669, 0x518d7a71} }, +/**/ {{0xbfb0f46a, 0x19cc29a0} }, +/**/ {{0xbfab1147, 0xc1a69750} }, +/**/ {{0x3fb2c501, 0x2c826e6b} }, +/**/ {{0xbf8f6a95, 0xcbc1b186} }, +/**/ {{0xbfa2f96d, 0x2de89811} } }, +/**/ {{{0x3fdd4000, 0x00000000} }, +/**/ {{0x3fdb6f96, 0x2e737efc} }, +/**/ {{0xbc5ca534, 0x64981e71} }, +/**/ {{0x3fea7888, 0xb9102ddc} }, +/**/ {{0xbc7791b2, 0x3c46d7d5} }, +/**/ {{0xbfd403e8, 0x1444efb5} }, +/**/ {{0xbc6047c5, 0x4f3d22a6} }, +/**/ {{0xbfb208df, 0xb90ac1cc} }, +/**/ {{0x3c4078b1, 0x2d2115d8} }, +/**/ {{0x3fc5abaa, 0x5b7c61a2} }, +/**/ {{0x3c3eef6a, 0x2bd2d19a} }, +/**/ {{0xbfb14414, 0xa8850e1a} }, +/**/ {{0xbfaa0b63, 0xc6580343} }, +/**/ {{0x3fb2a445, 0x4876cfdf} }, +/**/ {{0xbf91047b, 0x562d0829} }, +/**/ {{0xbfa244d3, 0xbe562a83} } }, +/**/ {{{0x3fdd8000, 0x00000000} }, +/**/ {{0x3fdba473, 0x378624a5} }, +/**/ {{0x3c7519a1, 0xb46e4aff} }, +/**/ {{0x3fea647e, 0x2348d9a3} }, +/**/ {{0xbc84f6c2, 0x9156e59f} }, +/**/ {{0xbfd4112d, 0xe46b4c91} }, +/**/ {{0xbc78c11d, 0x110fe0b7} }, +/**/ {{0xbfb15c30, 0x10e3d572} }, +/**/ {{0x3c53b45b, 0x4427c00b} }, +/**/ {{0x3fc5801f, 0xc2c486ae} }, +/**/ {{0xbc49bb5e, 0xc20ced8b} }, +/**/ {{0xbfb190b0, 0x4cddef65} }, +/**/ {{0xbfa9075c, 0x2ae4bcd0} }, +/**/ {{0x3fb280f7, 0xb69396b9} }, +/**/ {{0xbf9246f8, 0xce179ccb} }, +/**/ {{0xbfa1903f, 0xce6e9b2b} } }, +/**/ {{{0x3fddc000, 0x00000000} }, +/**/ {{0x3fdbd928, 0x1e528192} }, +/**/ {{0xbc74b154, 0x39af6b66} }, +/**/ {{0x3fea5066, 0x88478403} }, +/**/ {{0xbc85c7e8, 0xbe71620f} }, +/**/ {{0xbfd41df2, 0xb430f4ac} }, +/**/ {{0xbc55db82, 0xe79c7595} }, +/**/ {{0xbfb0b0df, 0xb173ac76} }, +/**/ {{0x3c57f440, 0xe4738d25} }, +/**/ {{0x3fc553d9, 0x7199976b} }, +/**/ {{0x3c54990c, 0x2a872a12} }, +/**/ {{0xbfb1da42, 0xd137dd01} }, +/**/ {{0xbfa80554, 0x350bfdb5} }, +/**/ {{0x3fb25b31, 0xdae9e17f} }, +/**/ {{0xbf937cc5, 0xe9e265b4} }, +/**/ {{0xbfa0dbf0, 0x3d16a202} } }, +/**/ {{{0x3fde0000, 0x00000000} }, +/**/ {{0x3fdc0db4, 0xc94ec9f0} }, +/**/ {{0xbc7cc1ce, 0x70934c34} }, +/**/ {{0x3fea3c42, 0x68881898} }, +/**/ {{0x3c8f907f, 0xe5c3bd97} }, +/**/ {{0xbfd42a37, 0x8d38076d} }, +/**/ {{0xbc6b8354, 0x7e19d62d} }, +/**/ {{0xbfb006f4, 0x5a36f1bd} }, +/**/ {{0xbc41701e, 0xca398c09} }, +/**/ {{0x3fc526de, 0xf7221a2a} }, +/**/ {{0xbc211868, 0x8041247e} }, +/**/ {{0xbfb220d2, 0x67b0229a} }, +/**/ {{0xbfa7056d, 0xc74d0c66} }, +/**/ {{0x3fb2330d, 0x0ff472e2} }, +/**/ {{0xbf94a5e9, 0x9cb74216} }, +/**/ {{0xbfa02821, 0x992b9e1f} } }, +/**/ {{{0x3fde4000, 0x00000000} }, +/**/ {{0x3fdc4219, 0x1ff11eb7} }, +/**/ {{0xbc7b17df, 0x434b3eee} }, +/**/ {{0x3fea2812, 0x437ac09e} }, +/**/ {{0xbc540368, 0xf9618c21} }, +/**/ {{0xbfd435fd, 0x7d5ba406} }, +/**/ {{0x3c75605b, 0x5e0a732a} }, +/**/ {{0xbfaebce7, 0x1ce0c104} }, +/**/ {{0xbc446d02, 0xd4eb3297} }, +/**/ {{0x3fc4f937, 0xd289f60b} }, +/**/ {{0x3c5b88b7, 0xe736fa8b} }, +/**/ {{0xbfb26465, 0xa5f78db4} }, +/**/ {{0xbfa607c9, 0x61a972db} }, +/**/ {{0x3fb208a2, 0x9e13b088} }, +/**/ {{0xbf95c26f, 0x06c33653} }, +/**/ {{0xbf9eea1c, 0x346237b1} } }, +/**/ {{{0x3fde8000, 0x00000000} }, +/**/ {{0x3fdc7655, 0x0aad71f9} }, +/**/ {{0xbc774b8b, 0xff7043e4} }, +/**/ {{0x3fea13d6, 0x977fc070} }, +/**/ {{0xbc86c451, 0xd9440881} }, +/**/ {{0xbfd44145, 0x9682eee2} }, +/**/ {{0x3c74156f, 0xb13901b4} }, +/**/ {{0xbfad6ec5, 0x2b58de73} }, +/**/ {{0x3c2ced26, 0xdf653988} }, +/**/ {{0x3fc4caeb, 0x720eb232} }, +/**/ {{0x3c614246, 0x92f3f809} }, +/**/ {{0xbfb2a503, 0x812caa81} }, +/**/ {{0xbfa50c86, 0x22dc20a7} }, +/**/ {{0x3fb1dc0b, 0xb35de59d} }, +/**/ {{0xbf96d265, 0x4adc8c38} }, +/**/ {{0xbf9d85db, 0x35444e0c} } }, +/**/ {{{0x3fdec000, 0x00000000} }, +/**/ {{0x3fdcaa68, 0x72f3631b} }, +/**/ {{0x3c295067, 0x81636f48} }, +/**/ {{0x3fe9ff8f, 0xe1e381db} }, +/**/ {{0xbc6fffe6, 0x00701e1c} }, +/**/ {{0xbfd44c10, 0xee747cac} }, +/**/ {{0xbc7a7f22, 0xced401ad} }, +/**/ {{0xbfac238c, 0xf898de26} }, +/**/ {{0x3c1eb191, 0xdaa7d32f} }, +/**/ {{0x3fc49c01, 0x32160e42} }, +/**/ {{0x3c649f02, 0x03d0023c} }, +/**/ {{0xbfb2e2b3, 0x49ba4fb7} }, +/**/ {{0xbfa413c1, 0xca00d6c7} }, +/**/ {{0x3fb1ad61, 0x5bc495cf} }, +/**/ {{0xbf97d5df, 0x63d0ff69} }, +/**/ {{0xbf9c23eb, 0x27af7010} } }, +/**/ {{{0x3fdf0000, 0x00000000} }, +/**/ {{0x3fdcde53, 0x432c1351} }, +/**/ {{0xbc7a2cfa, 0x4418f1ad} }, +/**/ {{0x3fe9eb3e, 0x9edacacc} }, +/**/ {{0xbc8942c5, 0x87d23ca5} }, +/**/ {{0xbfd45660, 0x9eaa285d} }, +/**/ {{0x3c4fe8e6, 0x52cf85b4} }, +/**/ {{0xbfaadb48, 0x28319af3} }, +/**/ {{0xbc207b46, 0x31b456b0} }, +/**/ {{0x3fc46c80, 0x5c4ee7c2} }, +/**/ {{0x3c4bdfc1, 0xb4443c76} }, +/**/ {{0xbfb31d7c, 0xa73bc33f} }, +/**/ {{0xbfa31d98, 0xb8a731f5} }, +/**/ {{0x3fb17cbc, 0x798f7481} }, +/**/ {{0xbf98ccf3, 0xf977e9ca} }, +/**/ {{0xbf9ac4b2, 0x36ea1578} } }, +/**/ {{{0x3fdf4000, 0x00000000} }, +/**/ {{0x3fdd1215, 0x66b7f2ad} }, +/**/ {{0x3c7be678, 0x35886c30} }, +/**/ {{0x3fe9d6e3, 0x497f1fed} }, +/**/ {{0xbc8ec056, 0x9a35c454} }, +/**/ {{0xbfd46035, 0xc4255988} }, +/**/ {{0x3c7ddb7b, 0x7144427c} }, +/**/ {{0xbfa995ff, 0xe9b44acd} }, +/**/ {{0x3c3c9d56, 0xb529cf65} }, +/**/ {{0x3fc43c70, 0x26dc5cda} }, +/**/ {{0x3c6d6ee6, 0xfde6cd82} }, +/**/ {{0xbfb35567, 0x9467b39a} }, +/**/ {{0xbfa22a25, 0xf54ca1ba} }, +/**/ {{0x3fb14a35, 0xbe2d5d2d} }, +/**/ {{0xbf99b7bd, 0x35a34e74} }, +/**/ {{0xbf996891, 0xc4948489} } }, +/**/ {{{0x3fdf8000, 0x00000000} }, +/**/ {{0x3fdd45ae, 0xc9ec862b} }, +/**/ {{0x3c689421, 0x163ef92d} }, +/**/ {{0x3fe9c27e, 0x5bcb52c7} }, +/**/ {{0xbc892d91, 0xf148a350} }, +/**/ {{0xbfd46991, 0x7f43bff0} }, +/**/ {{0xbc738b23, 0x8da13c27} }, +/**/ {{0xbfa853bc, 0xf9f19dcd} }, +/**/ {{0x3c2ea7a9, 0x2433c5cf} }, +/**/ {{0x3fc40bd7, 0xb38b19e0} }, +/**/ {{0xbc5d466e, 0x1c2a2863} }, +/**/ {{0xbfb38a7c, 0x5b0333a7} }, +/**/ {{0xbfa13983, 0x2e3896d7} }, +/**/ {{0x3fb115e5, 0xa35b7545} }, +/**/ {{0xbf9a9658, 0x99098556} }, +/**/ {{0xbf980fe6, 0x693ac59e} } }, +/**/ {{{0x3fdfc000, 0x00000000} }, +/**/ {{0x3fdd791f, 0x5a1226f5} }, +/**/ {{0xbc64017e, 0xa5b64a76} }, +/**/ {{0x3fe9ae10, 0x4e983ae9} }, +/**/ {{0xbc8d45ed, 0x52b783d7} }, +/**/ {{0xbfd47274, 0xf394891f} }, +/**/ {{0xbc7cd478, 0x22e08713} }, +/**/ {{0xbfa71487, 0xa445379d} }, +/**/ {{0x3c1569aa, 0x831d87b7} }, +/**/ {{0x3fc3dabe, 0x0f10bc36} }, +/**/ {{0x3bd8df2b, 0x1cb9bbe6} }, +/**/ {{0xbfb3bcc3, 0x8fddd862} }, +/**/ {{0xbfa04bc8, 0xbcb632d9} }, +/**/ {{0x3fb0dfe4, 0x64a26d77} }, +/**/ {{0xbf9b68e6, 0xd04027d1} }, +/**/ {{0xbf96bb07, 0xf792c5d9} } }, +/**/ {{{0x3fe00000, 0x00000000} }, +/**/ {{0x3fddac67, 0x0561bb4f} }, +/**/ {{0x3c7a2b7f, 0x222f65e2} }, +/**/ {{0x3fe99999, 0x9999999a} }, +/**/ {{0xbc899999, 0x9999999a} }, +/**/ {{0xbfd47ae1, 0x47ae147b} }, +/**/ {{0x3c5eb851, 0xeb851eb8} }, +/**/ {{0xbfa5d867, 0xc3ece2a5} }, +/**/ {{0xbc3a485c, 0xd7b900af} }, +/**/ {{0x3fc3a92a, 0x30553261} }, +/**/ {{0x3c6f06f6, 0x94467382} }, +/**/ {{0xbfb3ec46, 0x0ed80a18} }, +/**/ {{0xbf9ec21b, 0x514d88d8} }, +/**/ {{0x3fb0a849, 0xf929a833} }, +/**/ {{0xbf9c2f8b, 0x88dfb80c} }, +/**/ {{0xbf956a49, 0x8245bf09} } }, +/**/ {{{0x3fe02000, 0x00000000} }, +/**/ {{0x3fdddf85, 0xbb026974} }, +/**/ {{0x3c643bbb, 0x0c0a1226} }, +/**/ {{0x3fe9851a, 0xb35b2797} }, +/**/ {{0x3c89cd14, 0x18a8fead} }, +/**/ {{0xbfd482d7, 0xa5042a2d} }, +/**/ {{0x3c0dbc04, 0xa8224d16} }, +/**/ {{0xbfa49f64, 0xc56ade02} }, +/**/ {{0x3c451e52, 0x47da7eea} }, +/**/ {{0x3fc37722, 0xf7c5fe7d} }, +/**/ {{0xbc5165be, 0xd22c4b5c} }, +/**/ {{0xbfb4190c, 0xf6f48c5d} }, +/**/ {{0xbf9cf2cf, 0x58d0c132} }, +/**/ {{0x3fb06f2e, 0x0ddfdd74} }, +/**/ {{0xbf9cea6d, 0x46e65336} }, +/**/ {{0xbf941df9, 0x6423af3b} } }, +/**/ {{{0x3fe04000, 0x00000000} }, +/**/ {{0x3fde127b, 0x6b0744b0} }, +/**/ {{0xbc52b098, 0x6398d4ab} }, +/**/ {{0x3fe97094, 0x113dcc5a} }, +/**/ {{0xbc842780, 0x4de8c575} }, +/**/ {{0xbfd48a59, 0x37beb8e5} }, +/**/ {{0xbc601dd2, 0x9dc7541e} }, +/**/ {{0xbfa36985, 0xa7f2a8fe} }, +/**/ {{0xbc45e414, 0x7437d42d} }, +/**/ {{0x3fc344af, 0x2eb33dd6} }, +/**/ {{0xbc6d66e9, 0xe3a3193c} }, +/**/ {{0xbfb44321, 0xa6763232} }, +/**/ {{0xbf9b29d6, 0x7217dfc9} }, +/**/ {{0x3fb034a7, 0xfff8a866} }, +/**/ {{0xbf9d99b5, 0x3a6e931d} }, +/**/ {{0xbf92d661, 0x4a9f7e19} } }, +/**/ {{{0x3fe06000, 0x00000000} }, +/**/ {{0x3fde4548, 0x066cf51a} }, +/**/ {{0x3c43a3aa, 0x12ce98f2} }, +/**/ {{0x3fe95c06, 0x2774fe53} }, +/**/ {{0x3c810dfd, 0x3b851412} }, +/**/ {{0xbfd49167, 0x2e911e43} }, +/**/ {{0xbc7f6506, 0x09466fcd} }, +/**/ {{0xbfa236d0, 0xfedfb0c1} }, +/**/ {{0xbc3f6870, 0x79cb63a9} }, +/**/ {{0x3fc311d5, 0x86b6561c} }, +/**/ {{0x3c561982, 0x9543fc9a} }, +/**/ {{0xbfb46a8d, 0xb70aa5a7} }, +/**/ {{0xbf996756, 0xf5ac1efc} }, +/**/ {{0x3faff19d, 0xaf7c84b3} }, +/**/ {{0xbf9e3d8f, 0x15ce96b8} }, +/**/ {{0xbf9193c6, 0x42726021} } }, +/**/ {{{0x3fe08000, 0x00000000} }, +/**/ {{0x3fde77eb, 0x7f175a34} }, +/**/ {{0x3c70e53d, 0xc1bf3435} }, +/**/ {{0x3fe94771, 0x69044ba4} }, +/**/ {{0xbc7d53e2, 0x92d5fbc1} }, +/**/ {{0xbfd49802, 0xba91fd89} }, +/**/ {{0x3c71963e, 0xc3c8c4f3} }, +/**/ {{0xbfa1074c, 0xf33546d5} }, +/**/ {{0x3c4bc296, 0xc71ad288} }, +/**/ {{0x3fc2de9c, 0x99222665} }, +/**/ {{0x3c6e4a10, 0x28dadb64} }, +/**/ {{0xbfb48f5a, 0xfa031cb1} }, +/**/ {{0xbf97ab74, 0xbc0c6420} }, +/**/ {{0x3faf7772, 0x876d0f75} }, +/**/ {{0xbf9ed628, 0xe431fc96} }, +/**/ {{0xbf905668, 0xc64515ec} } }, +/**/ {{{0x3fe0a000, 0x00000000} }, +/**/ {{0x3fdeaa65, 0xc7cf28c4} }, +/**/ {{0x3c62fb2c, 0xeca3bf05} }, +/**/ {{0x3fe932d6, 0x47bd0aaa} }, +/**/ {{0x3c6bdfec, 0x697b6e3c} }, +/**/ {{0xbfd49e2d, 0x0f13a7e8} }, +/**/ {{0x3c6198c5, 0x20412940} }, +/**/ {{0xbf9fb5fe, 0x8a4e92df} }, +/**/ {{0xbc3cbb58, 0x6309a51a} }, +/**/ {{0x3fc2ab0a, 0xe67c9829} }, +/**/ {{0xbc647643, 0x06a4c4ef} }, +/**/ {{0xbfb4b193, 0x749bc711} }, +/**/ {{0xbf95f651, 0x27bef265} }, +/**/ {{0x3faefafb, 0x28347ebf} }, +/**/ {{0xbf9f63b2, 0xe0c06e2f} }, +/**/ {{0xbf8e3d09, 0x9e7b9dd7} } }, +/**/ {{{0x3fe0c000, 0x00000000} }, +/**/ {{0x3fdedcb6, 0xd43f8435} }, +/**/ {{0xbc5fc976, 0x330884e4} }, +/**/ {{0x3fe91e35, 0x343c31e5} }, +/**/ {{0xbc8fd46f, 0x9bb96799} }, +/**/ {{0xbfd4a3e7, 0x617d19a1} }, +/**/ {{0xbc7d7303, 0xea58b250} }, +/**/ {{0xbf9d63da, 0x9b55d156} }, +/**/ {{0xbc14bf72, 0xd5b4cc6c} }, +/**/ {{0x3fc27726, 0xd6016a7c} }, +/**/ {{0x3c4eba22, 0x435ec4b4} }, +/**/ {{0xbfb4d141, 0x5c52b3c6} }, +/**/ {{0xbf94480b, 0x2fdd9fbd} }, +/**/ {{0x3fae7c63, 0x6d3af4b6} }, +/**/ {{0xbf9fe65f, 0x4e61315b} }, +/**/ {{0xbf8bd8a3, 0xcea37283} } }, +/**/ {{{0x3fe0e000, 0x00000000} }, +/**/ {{0x3fdf0ede, 0x98f393d0} }, +/**/ {{0xbc72f40a, 0x87cb1894} }, +/**/ {{0x3fe9098e, 0x9de85688} }, +/**/ {{0xbc7c2de1, 0xa3791e64} }, +/**/ {{0xbfd4a932, 0xe9238ed7} }, +/**/ {{0xbc67a1bb, 0x28864386} }, +/**/ {{0xbf9b1838, 0x001dec68} }, +/**/ {{0xbc33ee0e, 0x8f0ffbdd} }, +/**/ {{0x3fc242f6, 0xb52e1005} }, +/**/ {{0xbc5476eb, 0x371fd2c1} }, +/**/ {{0xbfb4ee6f, 0x134edf2d} }, +/**/ {{0xbf92a0bf, 0x6b13becc} }, +/**/ {{0x3fadfbd6, 0x650f859c} }, +/**/ {{0xbfa02f31, 0x281586f4} }, +/**/ {{0xbf898006, 0x7a73449e} } }, +/**/ {{{0x3fe10000, 0x00000000} }, +/**/ {{0x3fdf40dd, 0x0b541418} }, +/**/ {{0xbc6a3992, 0xdc382a23} }, +/**/ {{0x3fe8f4e2, 0xf2efd135} }, +/**/ {{0xbc74c3c0, 0xd4218911} }, +/**/ {{0xbfd4ae10, 0xdf24b2d1} }, +/**/ {{0x3c713b12, 0x79d0ac37} }, +/**/ {{0xbf98d31f, 0xd7365f3f} }, +/**/ {{0xbc18bf3b, 0x62531dc5} }, +/**/ {{0x3fc20e80, 0xb7567664} }, +/**/ {{0xbc54a699, 0xd450197f} }, +/**/ {{0xbfb50927, 0x24d80ddd} }, +/**/ {{0xbf910088, 0x1b0516ab} }, +/**/ {{0x3fad797e, 0x4a356567} }, +/**/ {{0xbfa065f8, 0xe14758ed} }, +/**/ {{0xbf87338f, 0x73d2f6bb} } }, +/**/ {{{0x3fe12000, 0x00000000} }, +/**/ {{0x3fdf72b2, 0x21a4e495} }, +/**/ {{0x3c5489c2, 0x0f7eb740} }, +/**/ {{0x3fe8e032, 0xa0470831} }, +/**/ {{0xbc8c154a, 0xe75570cd} }, +/**/ {{0xbfd4b282, 0x7e416c35} }, +/**/ {{0xbc7f1837, 0x60646afd} }, +/**/ {{0xbf96949a, 0x7a6bec27} }, +/**/ {{0x3c38238f, 0xe6b77ba9} }, +/**/ {{0x3fc1d9ca, 0xf5428c61} }, +/**/ {{0x3c6a968d, 0xcd7881aa} }, +/**/ {{0xbfb52174, 0x41e00b6e} }, +/**/ {{0xbf8ecefa, 0x702ad3de} }, +/**/ {{0x3facf584, 0x7c8ae0dc} }, +/**/ {{0xbfa097a2, 0x8aa44fa8} }, +/**/ {{0xbf84f394, 0x2ed63408} } }, +/**/ {{{0x3fe14000, 0x00000000} }, +/**/ {{0x3fdfa45d, 0xd3029259} }, +/**/ {{0xbc7ca563, 0xdc28d8b5} }, +/**/ {{0x3fe8cb7e, 0x11a6de80} }, +/**/ {{0x3c610be6, 0xac22b8f8} }, +/**/ {{0xbfd4b689, 0x02b9488a} }, +/**/ {{0x3c5ea0bd, 0xaf91d442} }, +/**/ {{0xbf945caf, 0x821fd17e} }, +/**/ {{0x3c38e464, 0x0e51a049} }, +/**/ {{0x3fc1a4db, 0x6cd45aad} }, +/**/ {{0x3c2288e0, 0xf4200d5e} }, +/**/ {{0xbfb53761, 0x3d9dd7c4} }, +/**/ {{0xbf8bab68, 0xfb107457} }, +/**/ {{0x3fac7011, 0x7b46ebd1} }, +/**/ {{0xbfa0c44a, 0x93134a8f} }, +/**/ {{0xbf82c061, 0xf1fa4589} } }, +/**/ {{{0x3fe16000, 0x00000000} }, +/**/ {{0x3fdfd5e0, 0x175fdf83} }, +/**/ {{0x3c63a87b, 0x1ec49b15} }, +/**/ {{0x3fe8b6c5, 0xb18b4749} }, +/**/ {{0xbc5fabb8, 0xb7d58c0a} }, +/**/ {{0xbfd4ba25, 0xaa26890c} }, +/**/ {{0x3c50e395, 0x0ef9b688} }, +/**/ {{0xbf922b65, 0xc8a9b4c0} }, +/**/ {{0x3c2835ee, 0xd319146f} }, +/**/ {{0x3fc16fb8, 0x00b681bd} }, +/**/ {{0x3c1df633, 0x279133b0} }, +/**/ {{0xbfb54af9, 0x0a3b410c} }, +/**/ {{0xbf889682, 0xebe14682} }, +/**/ {{0x3fabe94c, 0xdf89e086} }, +/**/ {{0xbfa0ec0e, 0x0e55a6f8} }, +/**/ {{0xbf809a3e, 0x08af68f3} } }, +/**/ {{{0x3fe18000, 0x00000000} }, +/**/ {{0x3fe0039c, 0x73c1a40c} }, +/**/ {{0xbc8b32c9, 0x49c9d593} }, +/**/ {{0x3fe8a209, 0xe931fcd3} }, +/**/ {{0x3c6cb8f0, 0x8e68c94c} }, +/**/ {{0xbfd4bd59, 0xb35ad2d8} }, +/**/ {{0xbc61ac1a, 0xcaa606b4} }, +/**/ {{0xbf9000c3, 0x6dc339ef} }, +/**/ {{0x3c2c62e2, 0xaeaeaa73} }, +/**/ {{0x3fc13a66, 0x7812ee2d} }, +/**/ {{0x3c6a8cc2, 0x948ffe5b} }, +/**/ {{0xbfb55c46, 0xb5955c9c} }, +/**/ {{0xbf85906b, 0x0fd2b503} }, +/**/ {{0x3fab615d, 0x577de2da} }, +/**/ {{0xbfa10f0a, 0xa34d31ec} }, +/**/ {{0xbf7d02cb, 0xefe48ad0} } }, +/**/ {{{0x3fe1a000, 0x00000000} }, +/**/ {{0x3fe01c34, 0x1e82422d} }, +/**/ {{0x3c83db44, 0xfcca90ee} }, +/**/ {{0x3fe88d4b, 0x20995a88} }, +/**/ {{0x3c802777, 0x1e42e681} }, +/**/ {{0xbfd4c026, 0x5e3c840f} }, +/**/ {{0x3c7d7c65, 0x3800420d} }, +/**/ {{0xbf8bb99b, 0xb3f88703} }, +/**/ {{0x3c1f62ec, 0x4bf63e82} }, +/**/ {{0x3fc104ec, 0x7e5193ee} }, +/**/ {{0xbc27771e, 0xbae4e07d} }, +/**/ {{0xbfb56b55, 0x66104515} }, +/**/ {{0xbf829940, 0x061a20d1} }, +/**/ {{0x3faad868, 0xa20334d9} }, +/**/ {{0xbfa12d5e, 0x7aba8ee6} }, +/**/ {{0xbf78ec1f, 0x69774b8d} } }, +/**/ {{{0x3fe1c000, 0x00000000} }, +/**/ {{0x3fe034b7, 0x09250488} }, +/**/ {{0x3c78f9b3, 0x8d855410} }, +/**/ {{0x3fe87889, 0xbe7f594b} }, +/**/ {{0xbc7530e1, 0xc826e7a3} }, +/**/ {{0xbfd4c28c, 0xeba4af80} }, +/**/ {{0x3c7104a9, 0xe6a95faa} }, +/**/ {{0xbf877f13, 0x846dba10} }, +/**/ {{0x3c2bc924, 0x4abd0010} }, +/**/ {{0x3fc0cf4f, 0xa2deff9f} }, +/**/ {{0xbc67d17e, 0xa013c015} }, +/**/ {{0xbfb57830, 0x577e7899} }, +/**/ {{0xbf7f6238, 0xb49ea16d} }, +/**/ {{0x3faa4e93, 0x8ae4a926} }, +/**/ {{0xbfa14728, 0x2e77f633} }, +/**/ {{0xbf74f0d3, 0xb81c893e} } }, +/**/ {{{0x3fe1e000, 0x00000000} }, +/**/ {{0x3fe04d25, 0x314342e6} }, +/**/ {{0xbc81c863, 0x6442c767} }, +/**/ {{0x3fe863c6, 0x2860ad7e} }, +/**/ {{0xbc81dcb2, 0x137a2d8f} }, +/**/ {{0xbfd4c48e, 0x9d3dc03a} }, +/**/ {{0xbc7d92af, 0x197b1db9} }, +/**/ {{0xbf8351f6, 0x5653b1a7} }, +/**/ {{0xbbe368b4, 0x2127dea7} }, +/**/ {{0x3fc09995, 0x58fa8ca4} }, +/**/ {{0xbc446391, 0x530429e5} }, +/**/ {{0xbfb582e2, 0xd81c26eb} }, +/**/ {{0xbf79b02d, 0x3e63c109} }, +/**/ {{0x3fa9c401, 0xe7904294} }, +/**/ {{0xbfa15c86, 0xb933b0f3} }, +/**/ {{0xbf711137, 0xd8d860e1} } }, +/**/ {{{0x3fe20000, 0x00000000} }, +/**/ {{0x3fe0657e, 0x94db30d0} }, +/**/ {{0xbc7d5b49, 0x5f6349e6} }, +/**/ {{0x3fe84f00, 0xc2780614} }, +/**/ {{0xbc7fe7b0, 0xff3d87fa} }, +/**/ {{0xbfd4c62c, 0xb562c625} }, +/**/ {{0x3c77b2c3, 0xa78e848c} }, +/**/ {{0xbf7e6495, 0xb3a4bcb7} }, +/**/ {{0x3c14eb89, 0xe3f2b0a5} }, +/**/ {{0x3fc063c2, 0xf78c0dc4} }, +/**/ {{0xbc6badf0, 0x7539dc13} }, +/**/ {{0xbfb58b78, 0x459eb443} }, +/**/ {{0xbf741c83, 0x1386e6b4} }, +/**/ {{0x3fa938d6, 0x944ff706} }, +/**/ {{0xbfa16d99, 0x66ad4037} }, +/**/ {{0xbf6a9b1a, 0x01fc736a} } }, +/**/ {{{0x3fe22000, 0x00000000} }, +/**/ {{0x3fe07dc3, 0x324e9b38} }, +/**/ {{0x3c7b70c9, 0xe04450ac} }, +/**/ {{0x3fe83a39, 0xefbd6bfe} }, +/**/ {{0xbc7b2885, 0x21f5de26} }, +/**/ {{0xbfd4c768, 0x76ff6c9e} }, +/**/ {{0x3c56a2c0, 0xdebc1603} }, +/**/ {{0xbf76402c, 0xd9cccfd7} }, +/**/ {{0xbc1b39c0, 0x4e9786c1} }, +/**/ {{0x3fc02ddd, 0xb900b57a} }, +/**/ {{0x3c45d916, 0xea88a215} }, +/**/ {{0xbfb591fc, 0x0a58ab40} }, +/**/ {{0xbf6d4eb0, 0x32a37ac9} }, +/**/ {{0x3fa8ad33, 0x71fe75f8} }, +/**/ {{0xbfa17a7f, 0xc477a855} }, +/**/ {{0xbf634c0e, 0x2b035011} } }, +/**/ {{{0x3fe24000, 0x00000000} }, +/**/ {{0x3fe095f3, 0x0861a590} }, +/**/ {{0xbc7121b2, 0x0a15a9f3} }, +/**/ {{0x3fe82572, 0x11e5c14d} }, +/**/ {{0xbc7df9fc, 0xacd80b09} }, +/**/ {{0xbfd4c843, 0x25709bff} }, +/**/ {{0x3c7a9ef6, 0x1790f484} }, +/**/ {{0xbf6c6d74, 0x8a0def34} }, +/**/ {{0xbc051e57, 0x2a8142d7} }, +/**/ {{0x3fbfefd5, 0x765e156b} }, +/**/ {{0xbc3e6048, 0xf0e29c9e} }, +/**/ {{0xbfb59679, 0x9a724e28} }, +/**/ {{0xbf62a185, 0xcf13e192} }, +/**/ {{0x3fa82139, 0x6433c13f} }, +/**/ {{0xbfa18359, 0x9342e95d} }, +/**/ {{0xbf586b34, 0x8f974107} } }, +/**/ {{{0x3fe26000, 0x00000000} }, +/**/ {{0x3fe0ae0e, 0x1639866c} }, +/**/ {{0x3c7075ab, 0xf2de445a} }, +/**/ {{0x3fe810a9, 0x89625f5d} }, +/**/ {{0xbc8e4bea, 0x0fcf7262} }, +/**/ {{0xbfd4c8be, 0x0465c69b} }, +/**/ {{0x3c462ef4, 0xd7f7f89c} }, +/**/ {{0xbf59210e, 0x4de612d5} }, +/**/ {{0xbbf43659, 0xba53898d} }, +/**/ {{0x3fbf83dd, 0xfe836c69} }, +/**/ {{0xbc36cb56, 0x27f5499a} }, +/**/ {{0xbfb598fc, 0x7136edda} }, +/**/ {{0xbf50634c, 0x00013fb7} }, +/**/ {{0x3fa79508, 0x4fe557c2} }, +/**/ {{0xbfa18846, 0xb8ae41dc} }, +/**/ {{0xbf455fce, 0xe36bd239} } }, +/**/ {{{0x3fe28000, 0x00000000} }, +/**/ {{0x3fe0c614, 0x5b5b43da} }, +/**/ {{0x3c5974fa, 0x13b5404f} }, +/**/ {{0x3fe7fbe0, 0xb560d35c} }, +/**/ {{0xbc84f066, 0xae5a0887} }, +/**/ {{0xbfd4c8da, 0x57c2e1cb} }, +/**/ {{0x3c73de0e, 0xe0a3774c} }, +/**/ {{0x3f38b341, 0x61c69f3c} }, +/**/ {{0x3bd7b2e2, 0x7b200371} }, +/**/ {{0x3fbf17de, 0xd351e8ed} }, +/**/ {{0x3c5bce38, 0x650c5a9c} }, +/**/ {{0xbfb59990, 0x0e77234c} }, +/**/ {{0x3f3006ef, 0x99f594ee} }, +/**/ {{0x3fa708bf, 0x1a75a6cc} }, +/**/ {{0xbfa18967, 0x31a471d5} }, +/**/ {{0x3f24cc7e, 0x59bf0521} } }, +/**/ {{{0x3fe2a000, 0x00000000} }, +/**/ {{0x3fe0de05, 0xd7aa6f7d} }, +/**/ {{0xbc783684, 0xb1c529ab} }, +/**/ {{0x3fe7e717, 0xf3cab884} }, +/**/ {{0x3c7e1b21, 0x3b1fa4c7} }, +/**/ {{0xbfd4c899, 0x63830b4b} }, +/**/ {{0xbc7b6e32, 0xae3ffeff} }, +/**/ {{0x3f628757, 0xfc06cc4f} }, +/**/ {{0xbbb4c155, 0x56f01f66} }, +/**/ {{0x3fbeabe1, 0x8424efd8} }, +/**/ {{0x3bdf5129, 0x6e5604ea} }, +/**/ {{0xbfb5983f, 0xf3ffff64} }, +/**/ {{0x3f57ec04, 0x1f564189} }, +/**/ {{0x3fa67c7b, 0xa92e6e68} }, +/**/ {{0xbfa186db, 0x0542d0ff} }, +/**/ {{0x3f4ee247, 0x11a37bde} } }, +/**/ {{{0x3fe2c000, 0x00000000} }, +/**/ {{0x3fe0f5e2, 0x8b67e295} }, +/**/ {{0x3be311b1, 0x7ec990d0} }, +/**/ {{0x3fe7d24f, 0xa145af59} }, +/**/ {{0xbc83c6d1, 0xabdb623b} }, +/**/ {{0xbfd4c7fc, 0x6b9bdb30} }, +/**/ {{0x3c7c2fae, 0xd3bbb84b} }, +/**/ {{0x3f70e125, 0xc729b366} }, +/**/ {{0x3c1291fb, 0x7a19993c} }, +/**/ {{0x3fbe3fef, 0x66cf0dd8} }, +/**/ {{0xbc5428b7, 0xcd5e7640} }, +/**/ {{0xbfb59517, 0xa3273c21} }, +/**/ {{0x3f65adcf, 0x36891acb} }, +/**/ {{0x3fa5f05a, 0xe121c017} }, +/**/ {{0xbfa180c2, 0x384bad65} }, +/**/ {{0x3f5bd6f1, 0xd31e02a7} } }, +/**/ {{{0x3fe2e000, 0x00000000} }, +/**/ {{0x3fe10daa, 0x77307a0d} }, +/**/ {{0x3c869c33, 0xd44c7b05} }, +/**/ {{0x3fe7bd88, 0x19337139} }, +/**/ {{0xbc7fd248, 0x00e777ef} }, +/**/ {{0xbfd4c704, 0xb3e16264} }, +/**/ {{0xbc7ed720, 0xd46ed4e3} }, +/**/ {{0x3f7863a5, 0x62c1daf7} }, +/**/ {{0x3c155e73, 0x30cc82d1} }, +/**/ {{0x3fbdd411, 0x97a241da} }, +/**/ {{0x3c27a15a, 0x9ac44edd} }, +/**/ {{0xbfb59022, 0x9a6c71a6} }, +/**/ {{0x3f6f285a, 0xb5534ebe} }, +/**/ {{0x3fa56478, 0xa76d3cf7} }, +/**/ {{0xbfa1773c, 0xc1240db6} }, +/**/ {{0x3f63e5a1, 0x3891a70c} } }, +/**/ {{{0x3fe30000, 0x00000000} }, +/**/ {{0x3fe1255d, 0x9bfbd2a9} }, +/**/ {{0xbc52bdae, 0xe1c0ee35} }, +/**/ {{0x3fe7a8c1, 0xb5b1ffa1} }, +/**/ {{0x3c873e4a, 0x4e005ea3} }, +/**/ {{0xbfd4c5b3, 0x7fead5b8} }, +/**/ {{0x3c77958e, 0x55abc25a} }, +/**/ {{0x3f7fcb31, 0x01e4c970} }, +/**/ {{0xbc1ad968, 0xc5337fda} }, +/**/ {{0x3fbd6850, 0xf983ecf1} }, +/**/ {{0xbc3e45e6, 0x02ed6910} }, +/**/ {{0xbfb5896c, 0x532f49b6} }, +/**/ {{0x3f7432e2, 0xeaefcf7f} }, +/**/ {{0x3fa4d8ef, 0xe1db38f0} }, +/**/ {{0xbfa16a6a, 0x7c5c9def} }, +/**/ {{0x3f69a742, 0x7b6fe5d0} } }, +/**/ {{{0x3fe32000, 0x00000000} }, +/**/ {{0x3fe13cfb, 0xfb1b056e} }, +/**/ {{0x3c83110e, 0x6fc3ed38} }, +/**/ {{0x3fe793fc, 0xcf9bee6c} }, +/**/ {{0xbc8dc7d2, 0xd8d91b6c} }, +/**/ {{0xbfd4c40a, 0x12f7e51f} }, +/**/ {{0x3c7d1e10, 0x0d5d686d} }, +/**/ {{0x3f838be8, 0x839d28fa} }, +/**/ {{0x3c13427a, 0x52131640} }, +/**/ {{0x3fbcfcb6, 0x360bfed5} }, +/**/ {{0xbc5e3cb4, 0xa36f599f} }, +/**/ {{0xbfb58100, 0x3f7aa463} }, +/**/ {{0x3f78b31e, 0xb76f2bc0} }, +/**/ {{0x3fa44dda, 0x77dd6b80} }, +/**/ {{0xbfa15a6b, 0x21c53ca9} }, +/**/ {{0x3f6f30a7, 0x6cd99ed4} } }, +/**/ {{{0x3fe34000, 0x00000000} }, +/**/ {{0x3fe15485, 0x9637646a} }, +/**/ {{0xbc84ba7c, 0x548bf3c3} }, +/**/ {{0x3fe77f39, 0xbe88c85e} }, +/**/ {{0xbc6a983f, 0x9b6750c8} }, +/**/ {{0xbfd4c209, 0xafd6bee5} }, +/**/ {{0x3c7d21ef, 0x5e73e93a} }, +/**/ {{0x3f8724c7, 0xfc556ca7} }, +/**/ {{0xbc23cef2, 0x42e5673e} }, +/**/ {{0x3fbc9149, 0xbdaef67d} }, +/**/ {{0xbc1e549c, 0x3f04fcdc} }, +/**/ {{0xbfb576e9, 0xc7e4996a} }, +/**/ {{0x3f7d14fc, 0xba6ceedb} }, +/**/ {{0x3fa3c351, 0x53dcdc4a} }, +/**/ {{0xbfa1475e, 0x3a0a53a1} }, +/**/ {{0x3f724116, 0x62102619} } }, +/**/ {{{0x3fe36000, 0x00000000} }, +/**/ {{0x3fe16bfa, 0x6f5137e1} }, +/**/ {{0x3c79606f, 0xe141bd35} }, +/**/ {{0x3fe76a78, 0xd8cd8d65} }, +/**/ {{0x3c854a99, 0xddf1f71f} }, +/**/ {{0xbfd4bfb3, 0x98cabe40} }, +/**/ {{0xbc61e24d, 0x9ef99598} }, +/**/ {{0x3f8ab03d, 0x388e6864} }, +/**/ {{0x3c210541, 0xc340d113} }, +/**/ {{0x3fbc2613, 0xc7f24ec4} }, +/**/ {{0x3c54042a, 0x0a59af31} }, +/**/ {{0xbfb56b34, 0x49833ac1} }, +/**/ {{0x3f80ac4f, 0x22f6cd28} }, +/**/ {{0x3fa3396c, 0x64dac153} }, +/**/ {{0xbfa13163, 0x14dadf32} }, +/**/ {{0x3f74ce20, 0x21aeee27} } }, +/**/ {{{0x3fe38000, 0x00000000} }, +/**/ {{0x3fe1835a, 0x88be7c13} }, +/**/ {{0x3c8c621c, 0xec00c301} }, +/**/ {{0x3fe755ba, 0x737d49ca} }, +/**/ {{0xbc8abaf3, 0xd4cb44c6} }, +/**/ {{0xbfd4bd09, 0x0f73c4b3} }, +/**/ {{0x3c3e9ebf, 0xa9936e0b} }, +/**/ {{0x3f8e2e4f, 0x8920477f} }, +/**/ {{0xbc0889e3, 0x0360e009} }, +/**/ {{0x3fbbbb1c, 0x53aaefa0} }, +/**/ {{0xbc5edb26, 0xa1007b7f} }, +/**/ {{0xbfb55deb, 0x13f5f619} }, +/**/ {{0x3f82bf14, 0xe675741e} }, +/**/ {{0x3fa2b042, 0xa05e0ebf} }, +/**/ {{0xbfa11898, 0xbf95c5c1} }, +/**/ {{0x3f773faf, 0xe421ee51} } }, +/**/ {{{0x3fe3a000, 0x00000000} }, +/**/ {{0x3fe19aa5, 0xe5299f9a} }, +/**/ {{0xbc8a606c, 0x2c58f835} }, +/**/ {{0x3fe740fe, 0xe269c5b3} }, +/**/ {{0x3c873eff, 0x4c82509c} }, +/**/ {{0xbfd4ba0b, 0x54b63d79} }, +/**/ {{0xbc51d68a, 0x75bceeff} }, +/**/ {{0x3f90cf83, 0x9d9b3eb0} }, +/**/ {{0xbc107399, 0x68a7ca2f} }, +/**/ {{0x3fbb506b, 0x27453d35} }, +/**/ {{0x3c326b36, 0x00bdfedd} }, +/**/ {{0xbfb54f19, 0x67836cef} }, +/**/ {{0x3f84c2e5, 0x567ed6e8} }, +/**/ {{0x3fa227ea, 0x04a983e8} }, +/**/ {{0xbfa0fd1d, 0xfc7ce22f} }, +/**/ {{0x3f79960c, 0x2ffea71d} } }, +/**/ {{{0x3fe3c000, 0x00000000} }, +/**/ {{0x3fe1b1dc, 0x87904285} }, +/**/ {{0xbc621e8c, 0x8aef8f29} }, +/**/ {{0x3fe72c46, 0x78244c5a} }, +/**/ {{0x3c888c36, 0xe664f3a2} }, +/**/ {{0xbfd4b6bb, 0xa8a3ca2f} }, +/**/ {{0xbc778793, 0x1e1f3e19} }, +/**/ {{0x3f928136, 0xc8a3d8bb} }, +/**/ {{0x3c3dc4d8, 0x140daf1c} }, +/**/ {{0x3fbae607, 0xd1165ef3} }, +/**/ {{0xbc5fbfaa, 0x6305876c} }, +/**/ {{0xbfb53eca, 0x734b94bd} }, +/**/ {{0x3f86b7d8, 0x7c458eb1} }, +/**/ {{0x3fa1a077, 0x9b360f57} }, +/**/ {{0xbfa0df11, 0x3a6beabd} }, +/**/ {{0x3f7bd182, 0xaf42dc87} } }, +/**/ {{{0x3fe3e000, 0x00000000} }, +/**/ {{0x3fe1c8fe, 0x7341f64f} }, +/**/ {{0x3c728bbc, 0x9d5e792a} }, +/**/ {{0x3fe71791, 0x85fe8a32} }, +/**/ {{0x3c8f15bd, 0xe8bbb0d0} }, +/**/ {{0xbfd4b31b, 0x4a6497be} }, +/**/ {{0x3c737223, 0x782968f7} }, +/**/ {{0x3f942c46, 0x5e0c3122} }, +/**/ {{0xbc33e26a, 0x86422b13} }, +/**/ {{0x3fba7bf9, 0xa7b659b8} }, +/**/ {{0xbc3cdf63, 0x25381986} }, +/**/ {{0xbfb52d09, 0x538deb45} }, +/**/ {{0x3f889e08, 0xa0c1f425} }, +/**/ {{0x3fa119ff, 0x7b6d72e6} }, +/**/ {{0xbfa0be90, 0x8d11287b} }, +/**/ {{0x3f7df267, 0xbce83ad4} } }, +/**/ {{{0x3fe40000, 0x00000000} }, +/**/ {{0x3fe1e00b, 0xabdefeb4} }, +/**/ {{0xbc5928df, 0x287a668f} }, +/**/ {{0x3fe702e0, 0x5c0b8170} }, +/**/ {{0x3c7702e0, 0x5c0b8170} }, +/**/ {{0xbfd4af2b, 0x78215a76} }, +/**/ {{0xbc581c2e, 0xab3a13d8} }, +/**/ {{0x3f95d0b7, 0xe9e4a9d0} }, +/**/ {{0xbc3aa02a, 0xebf91fc7} }, +/**/ {{0x3fba1247, 0xca629942} }, +/**/ {{0xbc46961a, 0xc245db83} }, +/**/ {{0xbfb519e1, 0x100385b4} }, +/**/ {{0x3f8a7592, 0x32616ed8} }, +/**/ {{0x3fa09494, 0xcda1223a} }, +/**/ {{0xbfa09bb9, 0xa5a5c251} }, +/**/ {{0x3f7ff915, 0xf489d8ba} } }, +/**/ {{{0x3fe42000, 0x00000000} }, +/**/ {{0x3fe1f704, 0x3557138a} }, +/**/ {{0x3c76c659, 0xf6d7dd47} }, +/**/ {{0x3fe6ee33, 0x4920943e} }, +/**/ {{0xbc62723e, 0x61a3a541} }, +/**/ {{0xbfd4aaed, 0x6eedf042} }, +/**/ {{0x3c5b337a, 0xe7561ed4} }, +/**/ {{0x3f976e91, 0x68796803} }, +/**/ {{0xbc0e806f, 0x44d1db93} }, +/**/ {{0x3fb9a8f9, 0x21688625} }, +/**/ {{0x3c540185, 0xb1ec0554} }, +/**/ {{0xbfb5055c, 0x9a4cbc61} }, +/**/ {{0x3f8c3e93, 0xab0be204} }, +/**/ {{0x3fa01049, 0xce3968a1} }, +/**/ {{0xbfa076a9, 0xcc2331ba} }, +/**/ {{0x3f80f2f6, 0xe220db7e} } }, +/**/ {{{0x3fe44000, 0x00000000} }, +/**/ {{0x3fe20de8, 0x13e823b2} }, +/**/ {{0xbc8791d7, 0x53ebb744} }, +/**/ {{0x3fe6d98a, 0x9ad6a3fd} }, +/**/ {{0xbc808110, 0xc4e69862} }, +/**/ {{0xbfd4a662, 0x6ab4a79d} }, +/**/ {{0x3c52ed25, 0x9fc1cc2b} }, +/**/ {{0x3f9905d9, 0x42e6dc28} }, +/**/ {{0xbc228c79, 0xe39b7707} }, +/**/ {{0x3fb94014, 0x5e97c6f4} }, +/**/ {{0xbc52b822, 0xf8779202} }, +/**/ {{0xbfb4ef86, 0xcc723054} }, +/**/ {{0x3f8df92d, 0x76852811} }, +/**/ {{0x3f9f1a5f, 0xa231ee3f} }, +/**/ {{0xbfa04f7d, 0xd8f34e77} }, +/**/ {{0x3f81dcaa, 0x80706a34} } }, +/**/ {{{0x3fe46000, 0x00000000} }, +/**/ {{0x3fe224b7, 0x4c1d192a} }, +/**/ {{0x3c8d6d3d, 0xf88a60c4} }, +/**/ {{0x3fe6c4e6, 0x9d8b44ec} }, +/**/ {{0xbc589d5c, 0x4ed04ec2} }, +/**/ {{0xbfd4a18b, 0xa6222a08} }, +/**/ {{0xbc66c919, 0xd3867dbd} }, +/**/ {{0x3f9a9696, 0x4bb5a8a0} }, +/**/ {{0x3c36698e, 0x927bb5bd} }, +/**/ {{0x3fb8d79f, 0xfdbbcc76} }, +/**/ {{0x3c2578bd, 0x4efb71a1} }, +/**/ {{0xbfb4d86a, 0x6778e363} }, +/**/ {{0x3f8fa581, 0xd930230d} }, +/**/ {{0x3f9e16ae, 0x8a6221aa} }, +/**/ {{0xbfa02652, 0x2f183972} }, +/**/ {{0x3f82b9db, 0x3e507f4f} } }, +/**/ {{{0x3fe48000, 0x00000000} }, +/**/ {{0x3fe23b71, 0xe2cc9e6a} }, +/**/ {{0x3c6c421c, 0x9f38224e} }, +/**/ {{0x3fe6b047, 0x9c620595} }, +/**/ {{0x3c8867df, 0x07d7f0c2} }, +/**/ {{0xbfd49c6a, 0x5a920887} }, +/**/ {{0xbc764547, 0x37bcc433} }, +/**/ {{0x3f9c20cf, 0xbb7e5931} }, +/**/ {{0xbc3d86f5, 0x4db6bef2} }, +/**/ {{0x3fb86fa2, 0x451c4a5d} }, +/**/ {{0xbc475142, 0x15afb52c} }, +/**/ {{0xbfb4c012, 0x120917da} }, +/**/ {{0x3f90a1da, 0x6b9c3fad} }, +/**/ {{0x3f9d159f, 0x708543e5} }, +/**/ {{0xbf9ff685, 0x6d929bce} }, +/**/ {{0x3f838ac0, 0xd0361a66} } }, +/**/ {{{0x3fe4a000, 0x00000000} }, +/**/ {{0x3fe25217, 0xdd17e501} }, +/**/ {{0x3c856aa8, 0x8c1b679c} }, +/**/ {{0x3fe69bad, 0xe145c95d} }, +/**/ {{0xbc873257, 0x5605046d} }, +/**/ {{0xbfd496ff, 0xbffbe8a8} }, +/**/ {{0x3c36a5c5, 0xc7b45e6f} }, +/**/ {{0x3f9da48d, 0x2d9556eb} }, +/**/ {{0x3c3ff0e8, 0x1871a19d} }, +/**/ {{0x3fb80821, 0x46043f42} }, +/**/ {{0x3c550eec, 0xe660cfa1} }, +/**/ {{0xbfb4a688, 0x5727a8cb} }, +/**/ {{0x3f9169f6, 0x0e13efbc} }, +/**/ {{0x3f9c174f, 0xb59149dd} }, +/**/ {{0xbf9f9cd5, 0xb10444dd} }, +/**/ {{0x3f844f95, 0x03e91dd9} } }, +/**/ {{{0x3fe4c000, 0x00000000} }, +/**/ {{0x3fe268a9, 0x40696da6} }, +/**/ {{0x3c5d1348, 0xa04c73cc} }, +/**/ {{0x3fe68719, 0xb4ea3592} }, +/**/ {{0xbc7ecf86, 0x088ed284} }, +/**/ {{0xbfd4914d, 0x0ce1507d} }, +/**/ {{0xbc6410ef, 0x4dff2946} }, +/**/ {{0x3f9f21d6, 0x9cbf7eb7} }, +/**/ {{0x3c39bc22, 0xeaaad7e2} }, +/**/ {{0x3fb7a122, 0xdd4f3070} }, +/**/ {{0x3c50d950, 0x1cfe44af} }, +/**/ {{0xbfb48bd7, 0xa50188df} }, +/**/ {{0x3f922b27, 0x71756204} }, +/**/ {{0x3f9b1bdb, 0x0810a33a} }, +/**/ {{0xbf9f3fca, 0xf1011313} }, +/**/ {{0x3f850893, 0x8fe0f49b} } }, +/**/ {{{0x3fe4e000, 0x00000000} }, +/**/ {{0x3fe27f26, 0x1273d1b3} }, +/**/ {{0x3c843bf3, 0x6151dd9f} }, +/**/ {{0x3fe6728b, 0x5ecd3069} }, +/**/ {{0x3c67417b, 0x539f23ff} }, +/**/ {{0xbfd48b53, 0x763c0fe8} }, +/**/ {{0xbc677a1a, 0x6027975c} }, +/**/ {{0x3fa04c5a, 0x2ff7dd6a} }, +/**/ {{0xbc40808e, 0x496202e8} }, +/**/ {{0x3fb73aac, 0xb3fc3f7c} }, +/**/ {{0x3c4b58cb, 0x86b114ff} }, +/**/ {{0xbfb4700a, 0x4bc91249} }, +/**/ {{0x3f92e582, 0xef2490f8} }, +/**/ {{0x3f9a235b, 0x6c875580} }, +/**/ {{0xbf9edf99, 0xe55cd596} }, +/**/ {{0x3f85b5f9, 0xe40c5a18} } }, +/**/ {{{0x3fe50000, 0x00000000} }, +/**/ {{0x3fe2958e, 0x59308e31} }, +/**/ {{0xbc709e73, 0xb0c6c087} }, +/**/ {{0x3fe65e03, 0x2538713c} }, +/**/ {{0xbc601392, 0x42c09163} }, +/**/ {{0xbfd48514, 0x2f6d4575} }, +/**/ {{0xbc356341, 0x4568af3f} }, +/**/ {{0x3fa10497, 0x9386fd1d} }, +/**/ {{0xbc4a756a, 0x230a452f} }, +/**/ {{0x3fb6d4c4, 0x3fc6c180} }, +/**/ {{0x3c5ab2b9, 0xdb3fe137} }, +/**/ {{0xbfb4532a, 0x7ca4cfd0} }, +/**/ {{0x3f93991d, 0x90eb1d30} }, +/**/ {{0x3f992de9, 0x46163051} }, +/**/ {{0xbf9e7c76, 0x2de874ff} }, +/**/ {{0x3f865806, 0xfc0c1cb2} } }, +/**/ {{{0x3fe52000, 0x00000000} }, +/**/ {{0x3fe2abe2, 0x1aded073} }, +/**/ {{0x3c8c28c0, 0x01ad022e} }, +/**/ {{0x3fe64981, 0x4d432177} }, +/**/ {{0x3c83f41b, 0x055e240c} }, +/**/ {{0xbfd47e90, 0x6a2cfd01} }, +/**/ {{0x3c628585, 0xf152d080} }, +/**/ {{0x3fa1b9a7, 0xfbe3ed9e} }, +/**/ {{0xbc18a085, 0xf259fe04} }, +/**/ {{0x3fb66f6e, 0xc3c40175} }, +/**/ {{0x3c41d80a, 0xb0fda762} }, +/**/ {{0xbfb43542, 0x48af643a} }, +/**/ {{0x3f94460d, 0x05ad7652} }, +/**/ {{0x3f983b9b, 0x5f55ab26} }, +/**/ {{0xbf9e1692, 0x4be18b23} }, +/**/ {{0x3f86eefb, 0x32e755a3} } }, +/**/ {{{0x3fe54000, 0x00000000} }, +/**/ {{0x3fe2c221, 0x5e024466} }, +/**/ {{0xbc44b810, 0xda3a4be1} }, +/**/ {{0x3fe63506, 0x1ad38da0} }, +/**/ {{0xbc67f12a, 0x94ec14b0} }, +/**/ {{0xbfd477c9, 0x567a6652} }, +/**/ {{0x3c7be71c, 0xbbb9df88} }, +/**/ {{0x3fa26b90, 0x1535acb9} }, +/**/ {{0xbc30ff6c, 0xff041454} }, +/**/ {{0x3fb60ab1, 0x5105d8fa} }, +/**/ {{0x3c535a89, 0x3f2d6492} }, +/**/ {{0xbfb4165b, 0xa0083319} }, +/**/ {{0x3f94ec67, 0x965eb0a7} }, +/**/ {{0x3f974c86, 0xf36231e5} }, +/**/ {{0xbf9dae1f, 0x9c25f4a4} }, +/**/ {{0x3f877b18, 0x183e42dc} } }, +/**/ {{{0x3fe56000, 0x00000000} }, +/**/ {{0x3fe2d84c, 0x2961e48c} }, +/**/ {{0xbc7f2542, 0x0a36e506} }, +/**/ {{0x3fe62091, 0xd0a0e5d4} }, +/**/ {{0x3c82a27d, 0xcccb008e} }, +/**/ {{0xbfd470c0, 0x228ca1b6} }, +/**/ {{0xbc788e9b, 0x32884415} }, +/**/ {{0x3fa31a54, 0xb365e4d9} }, +/**/ {{0x3c3e6e70, 0xda0f99ae} }, +/**/ {{0x3fb5a690, 0xc741ccb7} }, +/**/ {{0xbc383905, 0x6508ffe1} }, +/**/ {{0xbfb3f680, 0x50f46c17} }, +/**/ {{0x3f958c44, 0x1b344c30} }, +/**/ {{0x3f9660bf, 0xb713db8a} }, +/**/ {{0xbf9d434e, 0x5224992a} }, +/**/ {{0x3f87fca0, 0x46ffb16e} } }, +/**/ {{{0x3fe58000, 0x00000000} }, +/**/ {{0x3fe2ee62, 0x8406cbca} }, +/**/ {{0x3c8c5d5e, 0x9ff0cf8d} }, +/**/ {{0x3fe60c24, 0xb0350d38} }, +/**/ {{0x3c81ffe9, 0xf3db4fcb} }, +/**/ {{0xbfd46975, 0xfac420bd} }, +/**/ {{0x3c7e6994, 0x850528a0} }, +/**/ {{0x3fa3c5fa, 0xd098b4ee} }, +/**/ {{0x3c353c41, 0xaa6a6874} }, +/**/ {{0x3fb54311, 0xd57c5b53} }, +/**/ {{0x3c50d02e, 0x72d146e0} }, +/**/ {{0xbfb3d5ba, 0x071017e0} }, +/**/ {{0x3f9625b9, 0xf11b08a7} }, +/**/ {{0x3f957857, 0xe25bbc6f} }, +/**/ {{0xbf9cd64d, 0x7384981f} }, +/**/ {{0x3f8873d7, 0x3da3b8d5} } }, +/**/ {{{0x3fe5a000, 0x00000000} }, +/**/ {{0x3fe30464, 0x753b090b} }, +/**/ {{0xbc73e712, 0x61da18f3} }, +/**/ {{0x3fe5f7be, 0xf9ee77b6} }, +/**/ {{0x3c8949f7, 0x854f9928} }, +/**/ {{0xbfd461ec, 0x099c98f6} }, +/**/ {{0x3c5da491, 0x3eafe889} }, +/**/ {{0x3fa46e87, 0x8ba9e286} }, +/**/ {{0x3c42573a, 0x5377a1a9} }, +/**/ {{0x3fb4e038, 0xfab82ffb} }, +/**/ {{0xbc414e45, 0x402ef939} }, +/**/ {{0xbfb3b412, 0x4a8ec478} }, +/**/ {{0x3f96b8e0, 0xef6dba07} }, +/**/ {{0x3f949360, 0x39c13c6e} }, +/**/ {{0xbf9c674a, 0xd47bfddb} }, +/**/ {{0x3f88e101, 0x37ed6935} } }, +/**/ {{{0x3fe5c000, 0x00000000} }, +/**/ {{0x3fe31a52, 0x048874be} }, +/**/ {{0x3c840cab, 0x87a7ac24} }, +/**/ {{0x3fe5e360, 0xed021586} }, +/**/ {{0x3c86a444, 0xb32ab7e4} }, +/**/ {{0xbfd45a23, 0x779f86c4} }, +/**/ {{0xbc75b9dc, 0x6b782501} }, +/**/ {{0x3fa51400, 0x26af940c} }, +/**/ {{0x3c4f700e, 0xf9ce64e2} }, +/**/ {{0x3fb47e0a, 0x86a8eb42} }, +/**/ {{0xbc5a4df9, 0x36377584} }, +/**/ {{0xbfb39192, 0x7f8b6d42} }, +/**/ {{0x3f9745d1, 0x5deeeabc} }, +/**/ {{0x3f93b1e8, 0x17fa1033} }, +/**/ {{0xbf9bf673, 0x14cf2061} }, +/**/ {{0x3f894463, 0x0a340016} } }, +/**/ {{{0x3fe5e000, 0x00000000} }, +/**/ {{0x3fe3302b, 0x39b78856} }, +/**/ {{0x3c85dd2e, 0xd87ba82b} }, +/**/ {{0x3fe5cf0a, 0xc77d4bea} }, +/**/ {{0xbc8684ab, 0x0d42ab66} }, +/**/ {{0xbfd4521d, 0x6b573e11} }, +/**/ {{0xbc7601b9, 0xb90c9c27} }, +/**/ {{0x3fa5b66a, 0x0582aeaa} }, +/**/ {{0x3c281575, 0x8cc985ad} }, +/**/ {{0x3fb41c8a, 0x9a69373d} }, +/**/ {{0xbc33df07, 0x25ea8f67} }, +/**/ {{0xbfb36e43, 0xe5673a18} }, +/**/ {{0x3f97cca3, 0xeb05f3bc} }, +/**/ {{0x3f92d3fd, 0x7797abe9} }, +/**/ {{0xbf9b83f1, 0x9d71c254} }, +/**/ {{0x3f899e41, 0xfe333861} } }, +/**/ {{{0x3fe60000, 0x00000000} }, +/**/ {{0x3fe345f0, 0x1cce37bb} }, +/**/ {{0x3c810211, 0x37c71102} }, +/**/ {{0x3fe5babc, 0xc647fa91} }, +/**/ {{0x3c84339b, 0x8056eaf3} }, +/**/ {{0xbfd449db, 0x094286d0} }, +/**/ {{0x3c75e178, 0x512b1c7b} }, +/**/ {{0x3fa655ca, 0xac4cf102} }, +/**/ {{0xbc27a1e4, 0x61e8206a} }, +/**/ {{0x3fb3bbbd, 0x2933dd9c} }, +/**/ {{0xbc517633, 0xbd42c006} }, +/**/ {{0xbfb34a2f, 0x9636afc9} }, +/**/ {{0x3f984d71, 0xa2400f6f} }, +/**/ {{0x3f91f9ac, 0xfcc53cab} }, +/**/ {{0xbf9b0ff0, 0x9ec31ef1} }, +/**/ {{0x3f89eee3, 0xb1615b05} } }, +/**/ {{{0x3fe62000, 0x00000000} }, +/**/ {{0x3fe35ba0, 0xb60eccce} }, +/**/ {{0x3c8e3ba1, 0x9b9368b9} }, +/**/ {{0x3fe5a677, 0x25268d22} }, +/**/ {{0x3c7bc76e, 0xaf72cee6} }, +/**/ {{0xbfd4415d, 0x73c8c31c} }, +/**/ {{0xbc3e5b3c, 0xe00e5645} }, +/**/ {{0x3fa6f227, 0xbe1ce1b6} }, +/**/ {{0xbc04a922, 0xe699fcac} }, +/**/ {{0x3fb35ba5, 0xf91f9885} }, +/**/ {{0xbc43f8be, 0x418827b3} }, +/**/ {{0xbfb3255e, 0x863cebc9} }, +/**/ {{0x3f98c853, 0xe315ca66} }, +/**/ {{0x3f912301, 0xff116cac} }, +/**/ {{0xbf9a9a99, 0x0f5e09c2} }, +/**/ {{0x3f8a368d, 0xf4c8d587} } }, +/**/ {{{0x3fe64000, 0x00000000} }, +/**/ {{0x3fe3713d, 0x0df6c504} }, +/**/ {{0xbc54f789, 0xe031606d} }, +/**/ {{0x3fe5923a, 0x1ebc184f} }, +/**/ {{0x3c829fe8, 0xbe5956dd} }, +/**/ {{0xbfd438a5, 0xcb2e9cc9} }, +/**/ {{0xbc7c1839, 0x7d6ce3eb} }, +/**/ {{0x3fa78b86, 0xfb7fa678} }, +/**/ {{0x3befb53e, 0xd082025e} }, +/**/ {{0x3fb2fc48, 0xa3dd5905} }, +/**/ {{0x3c5fd567, 0x06b78682} }, +/**/ {{0xbfb2ffd9, 0x8374843c} }, +/**/ {{0x3f993d64, 0x57f51471} }, +/**/ {{0x3f905006, 0x933f6cc5} }, +/**/ {{0xbf9a2412, 0xab7658df} }, +/**/ {{0x3f8a7586, 0xae624ab4} } }, +/**/ {{{0x3fe66000, 0x00000000} }, +/**/ {{0x3fe386c5, 0x2d3db11f} }, +/**/ {{0xbc8b78e1, 0xcbebe6a0} }, +/**/ {{0x3fe57e05, 0xec8c8203} }, +/**/ {{0x3c8ea585, 0x5e7f92dc} }, +/**/ {{0xbfd42fb5, 0x2d8b381e} }, +/**/ {{0xbc63afe6, 0x5cff451e} }, +/**/ {{0x3fa821ee, 0x4120d643} }, +/**/ {{0xbc3e664f, 0xcbc4d2dc} }, +/**/ {{0x3fb29da8, 0x9778bfdb} }, +/**/ {{0x3c3760dd, 0x7c2057a5} }, +/**/ {{0xbfb2d9a9, 0x3525a55a} }, +/**/ {{0x3f99acbc, 0xed9015c8} }, +/**/ {{0x3f8f0187, 0x2a35e7d2} }, +/**/ {{0xbf99ac83, 0xf4bcdfc7} }, +/**/ {{0x3f8aac13, 0xbbeb4f11} } }, +/**/ {{{0x3fe68000, 0x00000000} }, +/**/ {{0x3fe39c39, 0x1cd4171a} }, +/**/ {{0xbc823043, 0x31d8bf46} }, +/**/ {{0x3fe569da, 0xc6feb417} }, +/**/ {{0x3c803ce5, 0x0625e450} }, +/**/ {{0xbfd4268c, 0xb6bde980} }, +/**/ {{0xbc6e8f76, 0xe8258561} }, +/**/ {{0x3fa8b563, 0x86705749} }, +/**/ {{0x3c418e14, 0xe6172281} }, +/**/ {{0x3fb23fc9, 0x171a8768} }, +/**/ {{0xbc562184, 0x3225d825} }, +/**/ {{0xbfb2b2d6, 0x1b8904fd} }, +/**/ {{0x3f9a1677, 0xca70ce88} }, +/**/ {{0x3f8d6a81, 0x62963581} }, +/**/ {{0xbf993412, 0x32c353bb} }, +/**/ {{0x3f8ada7a, 0xd7354ec0} } }, +/**/ {{{0x3fe6a000, 0x00000000} }, +/**/ {{0x3fe3b198, 0xe5e2564b} }, +/**/ {{0xbc72f922, 0x1f0752ac} }, +/**/ {{0x3fe555b8, 0xe55ed910} }, +/**/ {{0xbc5615bc, 0x656f2eb2} }, +/**/ {{0xbfd41d2d, 0x80646bca} }, +/**/ {{0xbc75d1d6, 0x1ff3506f} }, +/**/ {{0x3fa945ec, 0xdc4e5727} }, +/**/ {{0x3c213c8e, 0x18968922} }, +/**/ {{0x3fb1e2ad, 0x3bcc9fa4} }, +/**/ {{0x3c2b899c, 0x0a43c591} }, +/**/ {{0xbfb28b68, 0x8f774533} }, +/**/ {{0x3f9a7aaf, 0x46d16acc} }, +/**/ {{0x3f8bdb08, 0xde405cc6} }, +/**/ {{0xbf98bae1, 0x73d9884b} }, +/**/ {{0x3f8b0101, 0x7be7742a} } }, +/**/ {{{0x3fe6c000, 0x00000000} }, +/**/ {{0x3fe3c6e4, 0x91c78dc5} }, +/**/ {{0xbc8e1450, 0x94fd0ba7} }, +/**/ {{0x3fe541a0, 0x7de0a269} }, +/**/ {{0x3c8b9072, 0x163b639c} }, +/**/ {{0xbfd41398, 0xa1d194fc} }, +/**/ {{0xbc7ef191, 0x8629402d} }, +/**/ {{0x3fa9d390, 0x6bbd69eb} }, +/**/ {{0x3c488aec, 0xd2c4a6a5} }, +/**/ {{0x3fb18657, 0xf53fbee6} }, +/**/ {{0x3c54e6aa, 0x0104d1dd} }, +/**/ {{0xbfb26368, 0xc2245ee6} }, +/**/ {{0x3f9ad97d, 0xe4b91b16} }, +/**/ {{0x3f8a5328, 0x74b192c7} }, +/**/ {{0xbf984114, 0x8e5d8b31} }, +/**/ {{0x3f8b1fec, 0xceadce82} } }, +/**/ {{{0x3fe6e000, 0x00000000} }, +/**/ {{0x3fe3dc1c, 0x2a188504} }, +/**/ {{0x3c82ce63, 0x70f4e971} }, +/**/ {{0x3fe52d91, 0xc5a197ed} }, +/**/ {{0xbc804b92, 0x1baab820} }, +/**/ {{0xbfd409cf, 0x300486f8} }, +/**/ {{0xbc6d3bb8, 0xae804189} }, +/**/ {{0x3faa5e54, 0x749adab8} }, +/**/ {{0x3c20b0d5, 0xc631cfd3} }, +/**/ {{0x3fb12acc, 0x0a922c54} }, +/**/ {{0x3c521a06, 0x7cbc4417} }, +/**/ {{0xbfb23ade, 0xbce6ae05} }, +/**/ {{0x3f9b32fe, 0x485d279b} }, +/**/ {{0x3f88d2e8, 0xd9b56b96} }, +/**/ {{0xbf97c6cd, 0x227841f4} }, +/**/ {{0x3f8b3781, 0x85cf6ba0} } }, +/**/ {{{0x3fe70000, 0x00000000} }, +/**/ {{0x3fe3f13f, 0xb89e96f4} }, +/**/ {{0x3c7ecf8b, 0x492644f0} }, +/**/ {{0x3fe5198c, 0xf0ab6f99} }, +/**/ {{0x3c71b875, 0x5e1ffaba} }, +/**/ {{0xbfd3ffd2, 0x3da059f4} }, +/**/ {{0x3c5bba8e, 0x77eee53d} }, +/**/ {{0x3faae63f, 0x4c5d36dc} }, +/**/ {{0xbc4e6e4e, 0x2a3994d6} }, +/**/ {{0x3fb0d00c, 0x1b178ada} }, +/**/ {{0x3c4b94c3, 0xb3e710cc} }, +/**/ {{0xbfb211d2, 0x61093929} }, +/**/ {{0x3f9b874b, 0x30c5dd59} }, +/**/ {{0x3f875a50, 0xb0b899ed} }, +/**/ {{0xbf974c2b, 0x9c404912} }, +/**/ {{0x3f8b4803, 0xd3249a4d} } }, +/**/ {{{0x3fe72000, 0x00000000} }, +/**/ {{0x3fe4064f, 0x47569f49} }, +/**/ {{0xbc8aad88, 0xf91bf2b2} }, +/**/ {{0x3fe50592, 0x31f66da7} }, +/**/ {{0xbc8837f1, 0x134b7507} }, +/**/ {{0xbfd3f5a2, 0xdae43e4d} }, +/**/ {{0xbc7f29b0, 0xdc59e382} }, +/**/ {{0x3fab6b57, 0x5cd91a8c} }, +/**/ {{0xbc225bf7, 0xd6ab0dfc} }, +/**/ {{0x3fb0761a, 0x9f216d7a} }, +/**/ {{0x3c577818, 0xe546203e} }, +/**/ {{0xbfb1e84b, 0x67a8cf31} }, +/**/ {{0x3f9bd67f, 0x70b6dd6f} }, +/**/ {{0x3f85e964, 0x9ff677e5} }, +/**/ {{0xbf96d14f, 0x363cf426} }, +/**/ {{0x3f8b51b7, 0x4f6617de} } }, +/**/ {{{0x3fe74000, 0x00000000} }, +/**/ {{0x3fe41b4a, 0xe06fea41} }, +/**/ {{0x3c63d60a, 0x53277652} }, +/**/ {{0x3fe4f1a1, 0xbb6bcc2c} }, +/**/ {{0x3c5c8d69, 0x7c81f558} }, +/**/ {{0xbfd3eb42, 0x15a41364} }, +/**/ {{0x3c728a9c, 0x617c316a} }, +/**/ {{0x3fabeda3, 0x230c44b8} }, +/**/ {{0x3c41fa15, 0x50d9e9da} }, +/**/ {{0x3fb01cf9, 0xe8c87fc3} }, +/**/ {{0x3c410990, 0xa175df34} }, +/**/ {{0xbfb1be51, 0x619b963c} }, +/**/ {{0x3f9c20b5, 0xe7da421c} }, +/**/ {{0x3f848027, 0x637b86b0} }, +/**/ {{0xbf965655, 0xfc436ff1} }, +/**/ {{0x3f8b54de, 0xe6cd859f} } }, +/**/ {{{0x3fe76000, 0x00000000} }, +/**/ {{0x3fe43032, 0x8e4b26d6} }, +/**/ {{0xbc813159, 0x1070b99f} }, +/**/ {{0x3fe4ddbb, 0xbde829f5} }, +/**/ {{0xbc735ff2, 0xb6d17615} }, +/**/ {{0xbfd3e0b0, 0xf941711a} }, +/**/ {{0x3c7d3454, 0xe9027227} }, +/**/ {{0x3fac6d29, 0x2deef5c2} }, +/**/ {{0x3c476533, 0x0ba13bb6} }, +/**/ {{0x3faf8958, 0x496c1e5e} }, +/**/ {{0x3c49ebf2, 0xe1abdf2f} }, +/**/ {{0xbfb193eb, 0xb762a82c} }, +/**/ {{0x3f9c6609, 0x7c2df93f} }, +/**/ {{0x3f831e99, 0xdff7724a} }, +/**/ {{0xbf95db5c, 0xcea82a5a} }, +/**/ {{0x3f8b51bc, 0xc6ff27bb} } }, +/**/ {{{0x3fe78000, 0x00000000} }, +/**/ {{0x3fe44506, 0x5b795b56} }, +/**/ {{0xbc7f76d0, 0x163f79c8} }, +/**/ {{0x3fe4c9e0, 0x693e0015} }, +/**/ {{0xbc7b0fcb, 0x60fff59b} }, +/**/ {{0xbfd3d5f0, 0x8ea521a8} }, +/**/ {{0x3c561573, 0xb5bcc402} }, +/**/ {{0x3face9f0, 0x1d4b9b62} }, +/**/ {{0x3c481226, 0xf2c93cfb} }, +/**/ {{0x3faeda66, 0xb5db8847} }, +/**/ {{0xbc44ec99, 0x3a386670} }, +/**/ {{0xbfb16921, 0xa92559e3} }, +/**/ {{0x3f9ca695, 0x13b2a17d} }, +/**/ {{0x3f81c4bb, 0x355982b3} }, +/**/ {{0xbf95607f, 0x65bec936} }, +/**/ {{0x3f8b4892, 0x4e349f67} } }, +/**/ {{{0x3fe7a000, 0x00000000} }, +/**/ {{0x3fe459c6, 0x52badc7f} }, +/**/ {{0x3c819969, 0x8e8e135c} }, +/**/ {{0x3fe4b60f, 0xec381dcb} }, +/**/ {{0xbc6b9874, 0x4724e4f2} }, +/**/ {{0xbfd3cb01, 0xdc390960} }, +/**/ {{0xbc7243b1, 0x7ba1320c} }, +/**/ {{0x3fad63fe, 0xa09cca72} }, +/**/ {{0x3c48308c, 0xe5ab8d04} }, +/**/ {{0x3fae2d22, 0xdf2eb652} }, +/**/ {{0xbc4988a3, 0x4eb29ad3} }, +/**/ {{0xbfb13dfa, 0x4eb5cb96} }, +/**/ {{0x3f9ce273, 0x8e5b2657} }, +/**/ {{0x3f807288, 0xd132be74} }, +/**/ {{0xbf94e5d8, 0x55a31e9e} }, +/**/ {{0x3f8b399f, 0xfba00cb2} } }, +/**/ {{{0x3fe7c000, 0x00000000} }, +/**/ {{0x3fe46e72, 0x7efe4716} }, +/**/ {{0xbc639b9b, 0x1b844cc9} }, +/**/ {{0x3fe4a24a, 0x749c2a47} }, +/**/ {{0xbc8f9d05, 0x82d8a2e5} }, +/**/ {{0xbfd3bfe5, 0xe5e27a03} }, +/**/ {{0xbc5047da, 0xb30f6d58} }, +/**/ {{0x3faddb5b, 0x75f185ec} }, +/**/ {{0x3c43b680, 0x23d5084a} }, +/**/ {{0x3fad8190, 0x479061d2} }, +/**/ {{0xbbf4565c, 0x602d3547} }, +/**/ {{0xbfb1127c, 0x979e619e} }, +/**/ {{0x3f9d19bf, 0xc03c4720} }, +/**/ {{0x3f7e4ffd, 0x01b2b45f} }, +/**/ {{0xbf946b81, 0x1245b0bb} }, +/**/ {{0x3f8b2525, 0x60fec8ec} } }, +/**/ {{{0x3fe7e000, 0x00000000} }, +/**/ {{0x3fe4830a, 0xeb5f7bfe} }, +/**/ {{0xbc5a2656, 0x66764a73} }, +/**/ {{0x3fe48e90, 0x2f2d2be4} }, +/**/ {{0x3c810a8e, 0x969bba3b} }, +/**/ {{0xbfd3b49d, 0xacfcef4d} }, +/**/ {{0xbc6a4f98, 0xb7a61548} }, +/**/ {{0x3fae500d, 0x68d7d101} }, +/**/ {{0xbc305c3e, 0x04860c21} }, +/**/ {{0x3facd7b2, 0x2c98ea9c} }, +/**/ {{0x3c48692b, 0xd46adca0} }, +/**/ {{0xbfb0e6af, 0x4b37c6a5} }, +/**/ {{0x3f9d4c94, 0x6bfb2662} }, +/**/ {{0x3f7bca2d, 0x0692cc75} }, +/**/ {{0xbf93f191, 0xf3b69312} }, +/**/ {{0x3f8b0b61, 0x1552b8ee} } }, +/**/ {{{0x3fe80000, 0x00000000} }, +/**/ {{0x3fe4978f, 0xa3269ee1} }, +/**/ {{0x3c72419a, 0x87f2a458} }, +/**/ {{0x3fe47ae1, 0x47ae147b} }, +/**/ {{0xbc6eb851, 0xeb851eb8} }, +/**/ {{0xbfd3a92a, 0x30553261} }, +/**/ {{0xbc7f06f6, 0x94467382} }, +/**/ {{0x3faec21b, 0x514d88d8} }, +/**/ {{0x3c3cd061, 0xf45873a6} }, +/**/ {{0x3fac2f8b, 0x88dfb80c} }, +/**/ {{0xbc14fcbc, 0x53add20b} }, +/**/ {{0xbfb0ba99, 0x08c71945} }, +/**/ {{0x3f9d7b0c, 0x3d79f13f} }, +/**/ {{0x3f795393, 0x357dfc67} }, +/**/ {{0xbf937822, 0x3aa97829} }, +/**/ {{0x3f8aec90, 0xa8b90db0} } }, +/**/ {{{0x3fe82000, 0x00000000} }, +/**/ {{0x3fe4ac00, 0xb1c71762} }, +/**/ {{0x3c8b20e7, 0x2382b900} }, +/**/ {{0x3fe4673d, 0xe8e45252} }, +/**/ {{0x3c57d208, 0x67458f9c} }, +/**/ {{0xbfd39d8c, 0x6c24e1b3} }, +/**/ {{0xbc7830c5, 0x973c6d15} }, +/**/ {{0x3faf318c, 0x12b78147} }, +/**/ {{0xbc4fa440, 0xd318184c} }, +/**/ {{0x3fab891f, 0x158b44e7} }, +/**/ {{0x3c4d5f9f, 0x45d7f1f3} }, +/**/ {{0xbfb08e40, 0x47a3e8ba} }, +/**/ {{0x3f9da541, 0xc4c1a21a} }, +/**/ {{0x3f76ec1e, 0x3c0d1d71} }, +/**/ {{0xbf92ff48, 0x152e0bfc} }, +/**/ {{0x3f8ac8f0, 0x9955298f} } }, +/**/ {{{0x3fe84000, 0x00000000} }, +/**/ {{0x3fe4c05e, 0x22de94e5} }, +/**/ {{0xbc8c0ac1, 0xf09f2edf} }, +/**/ {{0x3fe453a6, 0x3c9a6560} }, +/**/ {{0x3c77a95f, 0x828bba02} }, +/**/ {{0xbfd391c5, 0x5a0e5b1c} }, +/**/ {{0x3c7d553d, 0xcd3f76d2} }, +/**/ {{0x3faf9e66, 0x9adede86} }, +/**/ {{0xbc225e54, 0xd6d2bac0} }, +/**/ {{0x3faae46f, 0x4bdf89d7} }, +/**/ {{0x3c39c98c, 0x2b25b8d9} }, +/**/ {{0xbfb061ab, 0x5765a5c1} }, +/**/ {{0x3f9dcb4f, 0x7127d649} }, +/**/ {{0x3f7493ba, 0x13002646} }, +/**/ {{0xbf928718, 0xa397d1a6} }, +/**/ {{0x3f8aa0bc, 0x494648b5} } }, +/**/ {{{0x3fe86000, 0x00000000} }, +/**/ {{0x3fe4d4a8, 0x023414e8} }, +/**/ {{0x3c6e3a89, 0x1daa88b0} }, +/**/ {{0x3fe4401a, 0x6ba2786e} }, +/**/ {{0xbc4b8213, 0xe3b5f317} }, +/**/ {{0xbfd385d5, 0xf11905c0} }, +/**/ {{0xbc72a1e9, 0xa2f42dd1} }, +/**/ {{0x3fb00458, 0xf07a526f} }, +/**/ {{0xbc14f965, 0xac5fd817} }, +/**/ {{0x3faa417e, 0x66ca7da2} }, +/**/ {{0x3c4b1e1a, 0xa050b433} }, +/**/ {{0xbfb034e0, 0x60182e4f} }, +/**/ {{0x3f9ded4f, 0x8cafa41b} }, +/**/ {{0x3f724a50, 0x1fa4f037} }, +/**/ {{0xbf920fa7, 0xfd90e915} }, +/**/ {{0x3f8a742d, 0xf59e7acf} } }, +/**/ {{{0x3fe88000, 0x00000000} }, +/**/ {{0x3fe4e8de, 0x5bb6ec04} }, +/**/ {{0x3c84a33d, 0xbeb3796c} }, +/**/ {{0x3fe42c9a, 0x9dd8fdc1} }, +/**/ {{0x3c5192da, 0xaf80050b} }, +/**/ {{0xbfd379bf, 0x25adf97f} }, +/**/ {{0xbc774019, 0x20cd3651} }, +/**/ {{0x3fb0383a, 0x724dbb01} }, +/**/ {{0x3c5c4e67, 0xeb93e538} }, +/**/ {{0x3fa9a04e, 0x646e65df} }, +/**/ {{0x3c21a7cb, 0x894a6b77} }, +/**/ {{0xbfb007e5, 0x62771c79} }, +/**/ {{0x3f9e0b5c, 0x37a45544} }, +/**/ {{0x3f700fc7, 0x54993092} }, +/**/ {{0xbf919909, 0x37534c25} }, +/**/ {{0x3f8a437e, 0xae51732a} } }, +/**/ {{{0x3fe8a000, 0x00000000} }, +/**/ {{0x3fe4fd01, 0x3b7dd17e} }, +/**/ {{0x3c7d513f, 0x3e7c24b5} }, +/**/ {{0x3fe41926, 0xfa274ef1} }, +/**/ {{0x3c8ad830, 0x4d72ecb3} }, +/**/ {{0xbfd36d81, 0xe995018a} }, +/**/ {{0x3c7e7ec5, 0x6fd6094d} }, +/**/ {{0x3fb06adb, 0x567bb975} }, +/**/ {{0x3c5212c1, 0xf0d7364f} }, +/**/ {{0x3fa900e1, 0x07a9b624} }, +/**/ {{0xbc4e5b5b, 0xc16bcc85} }, +/**/ {{0xbfafb580, 0x705f052b} }, +/**/ {{0x3f9e258f, 0x646ce12e} }, +/**/ {{0x3f6bc808, 0xa3c63841} }, +/**/ {{0xbf91234e, 0x67043d41} }, +/**/ {{0x3f8a0ee6, 0x4f11b221} } }, +/**/ {{{0x3fe8c000, 0x00000000} }, +/**/ {{0x3fe51110, 0xadc5ed81} }, +/**/ {{0x3c723dcd, 0x6832a63e} }, +/**/ {{0x3fe405bf, 0xa6864f90} }, +/**/ {{0xbc7419c5, 0x662cd5df} }, +/**/ {{0xbfd3611f, 0x2bf1f7e4} }, +/**/ {{0xbc6e94dd, 0x65483b78} }, +/**/ {{0x3fb09c3f, 0x23e21be9} }, +/**/ {{0x3c22db63, 0xcaca858d} }, +/**/ {{0x3fa86337, 0xd99c3f1d} }, +/**/ {{0x3c034382, 0xdc0a6dfc} }, +/**/ {{0xbfaf5aed, 0x284f8093} }, +/**/ {{0x3f9e3c02, 0xd396fb43} }, +/**/ {{0x3f678dd3, 0x08b96150} }, +/**/ {{0xbf90ae88, 0xaa2dcc3a} }, +/**/ {{0x3f89d69b, 0x79128ee7} } }, +/**/ {{{0x3fe8e000, 0x00000000} }, +/**/ {{0x3fe5250c, 0xbef1e9fb} }, +/**/ {{0xbc5539b7, 0xa3228870} }, +/**/ {{0x3fe3f264, 0xc8011245} }, +/**/ {{0xbc6641f1, 0x44cc720b} }, +/**/ {{0xbfd35497, 0xd942778a} }, +/**/ {{0x3c750a5a, 0x9bd7dbd6} }, +/**/ {{0x3fb0cc69, 0x6438739e} }, +/**/ {{0x3bf5d933, 0x435f798d} }, +/**/ {{0x3fa7c754, 0x2b29722f} }, +/**/ {{0xbbe736fe, 0x5b3af27b} }, +/**/ {{0xbfaf001c, 0x059a3c24} }, +/**/ {{0x3f9e4ed0, 0x101882b0} }, +/**/ {{0x3f6370ae, 0x88dc4269} }, +/**/ {{0xbf903ac8, 0x2b5280b6} }, +/**/ {{0x3f899ad3, 0x8da5b2ad} } }, +/**/ {{{0x3fe90000, 0x00000000} }, +/**/ {{0x3fe538f5, 0x7b89061f} }, +/**/ {{0xbc81bb74, 0xabda520c} }, +/**/ {{0x3fe3df16, 0x82b78014} }, +/**/ {{0xbc7074be, 0xa43ff610} }, +/**/ {{0xbfd347ec, 0xdb5be2e4} }, +/**/ {{0x3c7848c8, 0x8a0e9303} }, +/**/ {{0x3fb0fb5d, 0xa3a11be4} }, +/**/ {{0x3c3d68f2, 0x09dd0d69} }, +/**/ {{0x3fa72d37, 0x16778170} }, +/**/ {{0xbc4ea85d, 0x2200d1d4} }, +/**/ {{0xbfaea517, 0xd4cdbd49} }, +/**/ {{0x3f9e5e10, 0x6bc61b6f} }, +/**/ {{0x3f5ee0af, 0xd0517524} }, +/**/ {{0xbf8f9038, 0x4f2ec799} }, +/**/ {{0x3f895bc2, 0xa9aaa5bb} } }, +/**/ {{{0x3fe92000, 0x00000000} }, +/**/ {{0x3fe54cca, 0xf0362c8f} }, +/**/ {{0x3c88a324, 0x7f8f43c1} }, +/**/ {{0x3fe3cbd4, 0xf9e1016e} }, +/**/ {{0xbc88dea6, 0x431b67e7} }, +/**/ {{0xbfd33b1f, 0x1969bc63} }, +/**/ {{0x3c6ef16e, 0x5f3d8fd8} }, +/**/ {{0x3fb1291f, 0x703d3bf6} }, +/**/ {{0xbc566e82, 0xb04e0672} }, +/**/ {{0x3fa694e1, 0x806b26f2} }, +/**/ {{0x3c302819, 0xafcee740} }, +/**/ {{0xbfae49eb, 0x16dcee96} }, +/**/ {{0x3f9e69dc, 0xfbfdb35f} }, +/**/ {{0x3f571910, 0x70c48510} }, +/**/ {{0xbf8ead25, 0xe90198c8} }, +/**/ {{0x3f89199b, 0xa1c723cb} } }, +/**/ {{{0x3fe94000, 0x00000000} }, +/**/ {{0x3fe5608d, 0x29c70c34} }, +/**/ {{0x3c89939c, 0xf0de8088} }, +/**/ {{0x3fe3b8a0, 0x4fcf28c3} }, +/**/ {{0xbc469c2b, 0xcb80013c} }, +/**/ {{0xbfd32e2f, 0x77ec4ef9} }, +/**/ {{0x3c7f9d06, 0xc61f7341} }, +/**/ {{0x3fb155b2, 0x59c3bcdf} }, +/**/ {{0xbc2d692e, 0x3583c01b} }, +/**/ {{0x3fa5fe54, 0x1a1fe15d} }, +/**/ {{0x3c430dc5, 0x5d9bad81} }, +/**/ {{0xbfadeea0, 0x01d944a8} }, +/**/ {{0x3f9e724e, 0x9683b244} }, +/**/ {{0x3f4f13d4, 0x491379ef} }, +/**/ {{0xbf8dcc74, 0x0b7cf74b} }, +/**/ {{0x3f88d48f, 0xff5f0625} } }, +/**/ {{{0x3fe96000, 0x00000000} }, +/**/ {{0x3fe5743c, 0x352b33ba} }, +/**/ {{0xbc8ea00d, 0x34c87ea6} }, +/**/ {{0x3fe3a578, 0xa5f05e48} }, +/**/ {{0xbc8ba1ec, 0x00e4639b} }, +/**/ {{0xbfd3211e, 0xd8b7a43f} }, +/**/ {{0xbc6d4b54, 0x676e23a8} }, +/**/ {{0x3fb18119, 0xf11b2c2d} }, +/**/ {{0x3c34855b, 0x3a3bf5fa} }, +/**/ {{0x3fa5698f, 0x625c76bf} }, +/**/ {{0xbc2f758a, 0xbedb0264} }, +/**/ {{0xbfad9340, 0x81b60103} }, +/**/ {{0x3f9e777d, 0xce91900f} }, +/**/ {{0x3f406543, 0x34fddb2f} }, +/**/ {{0xbf8cee3b, 0xe6077f81} }, +/**/ {{0x3f888ccf, 0xfe42afde} } }, +/**/ {{{0x3fe98000, 0x00000000} }, +/**/ {{0x3fe587d8, 0x1f732fbb} }, +/**/ {{0xbc75e5c9, 0xd8c5a950} }, +/**/ {{0x3fe3925e, 0x1cd28c98} }, +/**/ {{0x3c8c8443, 0x1ffec6da} }, +/**/ {{0xbfd313ee, 0x1af2c622} }, +/**/ {{0x3c0a0e9b, 0xbc3f7ac8} }, +/**/ {{0x3fb1ab59, 0xc7f683c3} }, +/**/ {{0x3c5eaf17, 0x12c04500} }, +/**/ {{0x3fa4d693, 0xa7039179} }, +/**/ {{0xbc4c8d74, 0xa4ce58a2} }, +/**/ {{0xbfad37d6, 0x391400b3} }, +/**/ {{0x3f9e7982, 0xf2148a36} }, +/**/ {{0x3f112956, 0xb6df63ca} }, +/**/ {{0xbf8c1294, 0xfbd0f7ee} }, +/**/ {{0x3f88428a, 0x8b0b0a0e} } }, +/**/ {{{0x3fe9a000, 0x00000000} }, +/**/ {{0x3fe59b60, 0xf5cfab9e} }, +/**/ {{0xbc81b04c, 0x41026bc5} }, +/**/ {{0x3fe37f50, 0xd425cdfc} }, +/**/ {{0x3c865633, 0x518aef64} }, +/**/ {{0xbfd3069e, 0x1b1749db} }, +/**/ {{0xbc311c20, 0xa119d9bc} }, +/**/ {{0x3fb1d475, 0x7074cee3} }, +/**/ {{0xbc5102e0, 0x4ff61e2c} }, +/**/ {{0x3fa44561, 0x06804def} }, +/**/ {{0x3c4e829f, 0xc3865804} }, +/**/ {{0xbfacdc6a, 0x82158836} }, +/**/ {{0x3f9e7876, 0x071b2eec} }, +/**/ {{0xbf375b85, 0xf17c4beb} }, +/**/ {{0xbf8b3995, 0x2fa03971} }, +/**/ {{0x3f87f5ed, 0x421a433b} } }, +/**/ {{{0x3fe9c000, 0x00000000} }, +/**/ {{0x3fe5aed6, 0xc5909517} }, +/**/ {{0x3c87312f, 0x714a9436} }, +/**/ {{0x3fe36c50, 0xeabf19f5} }, +/**/ {{0x3c70d1dc, 0x52485cca} }, +/**/ {{0xbfd2f92f, 0xb2f12226} }, +/**/ {{0x3c5400ba, 0x3e5d3d61} }, +/**/ {{0x3fb1fc70, 0x7cc3a41b} }, +/**/ {{0x3c4b58e7, 0x8819ff5b} }, +/**/ {{0x3fa3b5f7, 0x712e9269} }, +/**/ {{0xbc4e436a, 0x7879d8ab} }, +/**/ {{0xbfac8106, 0x6f398221} }, +/**/ {{0x3f9e746e, 0xc97073c7} }, +/**/ {{0xbf4914de, 0xecfc2d6a} }, +/**/ {{0xbf8a6350, 0xcfa74bd5} }, +/**/ {{0x3f87a724, 0x6f38ad9e} } }, +/**/ {{{0x3fe9e000, 0x00000000} }, +/**/ {{0x3fe5c239, 0x9c244261} }, +/**/ {{0xbc831bd4, 0xe9e56b35} }, +/**/ {{0x3fe3595e, 0x7e9af2dc} }, +/**/ {{0x3c81ef2d, 0x9dc90e6a} }, +/**/ {{0xbfd2eba3, 0xb99eb689} }, +/**/ {{0xbc7b12ef, 0x6a2f2701} }, +/**/ {{0x3fb2234e, 0x7ec46b9b} }, +/**/ {{0x3c59f30c, 0x8d415d66} }, +/**/ {{0x3fa32856, 0xaabf0d26} }, +/**/ {{0xbc122571, 0x3f33d7ea} }, +/**/ {{0xbfac25b2, 0xcc3da9ce} }, +/**/ {{0x3f9e6d84, 0xa8630cad} }, +/**/ {{0xbf5308c5, 0xbeba707a} }, +/**/ {{0xbf898fda, 0xa1585fd1} }, +/**/ {{0x3f87565b, 0x0dc54356} } }, +/**/ {{{0x3fea0000, 0x00000000} }, +/**/ {{0x3fe5d589, 0x87169b18} }, +/**/ {{0x3c60028e, 0x4bc5e7ca} }, +/**/ {{0x3fe34679, 0xace01346} }, +/**/ {{0x3c8e6b38, 0x04d19e6b} }, +/**/ {{0xbfd2ddfb, 0x03913da2} }, +/**/ {{0xbc763ec8, 0x9a19adbd} }, +/**/ {{0x3fb24913, 0x07b46905} }, +/**/ {{0xbc4e7be8, 0xd6f0307f} }, +/**/ {{0x3fa29c7e, 0x4b96b773} }, +/**/ {{0xbc24c2cd, 0x9182d783} }, +/**/ {{0xbfabca78, 0x1f071f44} }, +/**/ {{0x3f9e63ce, 0xc4b7b7c4} }, +/**/ {{0xbf59529a, 0x125f35b0} }, +/**/ {{0xbf88bf43, 0xed369b2b} }, +/**/ {{0x3f8703ba, 0xc97185cd} } }, +/**/ {{{0x3fea2000, 0x00000000} }, +/**/ {{0x3fe5e8c6, 0x941043d0} }, +/**/ {{0xbc70bf75, 0xbe451e70} }, +/**/ {{0x3fe333a2, 0x91e21aec} }, +/**/ {{0x3c7ae035, 0x7acfc84f} }, +/**/ {{0xbfd2d036, 0x628d5861} }, +/**/ {{0x3c67c5fb, 0xe463d006} }, +/**/ {{0x3fb26dc1, 0xa7d77fb2} }, +/**/ {{0xbc5432bd, 0xc47ba861} }, +/**/ {{0x3fa2126d, 0xc229bece} }, +/**/ {{0xbc4be1bf, 0x1da8ed9e} }, +/**/ {{0xbfab6f5e, 0xa890e568} }, +/**/ {{0x3f9e5763, 0xeec5339a} }, +/**/ {{0xbf5f68a6, 0x5274aa52} }, +/**/ {{0xbf87f19c, 0x8a9df558} }, +/**/ {{0x3f86af6b, 0xff809dc5} } }, +/**/ {{{0x3fea4000, 0x00000000} }, +/**/ {{0x3fe5fbf0, 0xd0d5cc4a} }, +/**/ {{0xbc5b4cfd, 0x000b7158} }, +/**/ {{0x3fe320d9, 0x49243ad8} }, +/**/ {{0xbc8ce5e0, 0x433f7be5} }, +/**/ {{0xbfd2c256, 0xa5abec2f} }, +/**/ {{0xbc68785b, 0x04494dc1} }, +/**/ {{0x3fb2915d, 0xee25a81c} }, +/**/ {{0x3c3e7045, 0x68b37e8b} }, +/**/ {{0x3fa18a24, 0x5451b7d2} }, +/**/ {{0xbc3b2d29, 0x79d21dd5} }, +/**/ {{0xbfab146e, 0x65dfcf66} }, +/**/ {{0x3f9e485a, 0xa4b895b9} }, +/**/ {{0xbf62a5d4, 0x14770b65} }, +/**/ {{0xbf8726f2, 0xeb7dab0f} }, +/**/ {{0x3f865995, 0xc081d40d} } }, +/**/ {{{0x3fea6000, 0x00000000} }, +/**/ {{0x3fe60f08, 0x4b46e05f} }, +/**/ {{0xbc8dbb86, 0x99945193} }, +/**/ {{0x3fe30e1d, 0xed5be099} }, +/**/ {{0x3c6c6e78, 0x373fae45} }, +/**/ {{0xbfd2b45c, 0x995b3a02} }, +/**/ {{0x3c7cb97b, 0xe7cea2ad} }, +/**/ {{0x3fb2b3eb, 0x67fb0cde} }, +/**/ {{0xbc402927, 0x4920d50b} }, +/**/ {{0x3fa103a1, 0x209f00e4} }, +/**/ {{0xbc36fb57, 0xecac275a} }, +/**/ {{0xbfaab9af, 0x10fb6629} }, +/**/ {{0x3f9e36c9, 0x1100b94a} }, +/**/ {{0xbf657e30, 0x58620e6c} }, +/**/ {{0xbf865f54, 0x2801158e} }, +/**/ {{0x3f86025d, 0xd27eaf07} } }, +/**/ {{{0x3fea8000, 0x00000000} }, +/**/ {{0x3fe6220d, 0x115d7b8e} }, +/**/ {{0xbc62b785, 0x350ee8c1} }, +/**/ {{0x3fe2fb70, 0x98736048} }, +/**/ {{0x3c87a751, 0x4df7c4fa} }, +/**/ {{0xbfd2a649, 0x07603054} }, +/**/ {{0x3c7c41eb, 0xf564247c} }, +/**/ {{0x3fb2d56d, 0xa0cac592} }, +/**/ {{0x3c333138, 0x4e757ddf} }, +/**/ {{0x3fa07ee3, 0x1fa53ce5} }, +/**/ {{0xbc41bd0c, 0x28113a76} }, +/**/ {{0xbfaa5f28, 0x21eb5271} }, +/**/ {{0x3f9e22c5, 0x08df7f4f} }, +/**/ {{0xbf683dca, 0x107b528f} }, +/**/ {{0xbf859acc, 0x0a22f693} }, +/**/ {{0x3f85a9e8, 0xb39536ba} } }, +/**/ {{{0x3feaa000, 0x00000000} }, +/**/ {{0x3fe634ff, 0x312d1f3b} }, +/**/ {{0x3c89d2f3, 0x15f2b598} }, +/**/ {{0x3fe2e8d1, 0x638c9d15} }, +/**/ {{0x3c831ae5, 0xfe1a437d} }, +/**/ {{0xbfd2981c, 0xb6d7f622} }, +/**/ {{0xbc53da87, 0x86e9fe4d} }, +/**/ {{0x3fb2f5e8, 0x21d425b2} }, +/**/ {{0xbc186482, 0xae2616cb} }, +/**/ {{0x3f9ff7d2, 0x4a85a0e4} }, +/**/ {{0xbc294288, 0xe2d9205b} }, +/**/ {{0xbfaa04e0, 0xcfb8dc09} }, +/**/ {{0x3f9e0c64, 0x0b1f9c73} }, +/**/ {{0xbf6ae504, 0xbd3845d8} }, +/**/ {{0xbf84d965, 0x19278cae} }, +/**/ {{0x3f855059, 0x9cf7183b} } }, +/**/ {{{0x3feac000, 0x00000000} }, +/**/ {{0x3fe647de, 0xb8e20b90} }, +/**/ {{0xbc5eca04, 0x023a51cf} }, +/**/ {{0x3fe2d640, 0x6703b033} }, +/**/ {{0x3c870ae6, 0x38039b02} }, +/**/ {{0xbfd289d8, 0x6c39acf5} }, +/**/ {{0xbc71f038, 0x0238a7ee} }, +/**/ {{0x3fb3155e, 0x71da955f} }, +/**/ {{0xbc5faa02, 0xd41f84df} }, +/**/ {{0x3f9ef563, 0xc3c69caa} }, +/**/ {{0x3c331d29, 0x75403dbd} }, +/**/ {{0xbfa9aae0, 0x1174124f} }, +/**/ {{0x3f9df3bb, 0x3eedb30b} }, +/**/ {{0xbf6d7445, 0x1c632765} }, +/**/ {{0xbf841b28, 0xa4fa03e7} }, +/**/ {{0x3f84f5d2, 0x8646990d} } }, +/**/ {{{0x3feae000, 0x00000000} }, +/**/ {{0x3fe65aab, 0xb6c07b03} }, +/**/ {{0xbc67939b, 0x3af32729} }, +/**/ {{0x3fe2c3bd, 0xba718de8} }, +/**/ {{0xbc82d2fc, 0xc4990a2b} }, +/**/ {{0xbfd27b7c, 0xe9586818} }, +/**/ {{0x3c780d5e, 0x880839ca} }, +/**/ {{0x3fb333d4, 0x14dfe9e3} }, +/**/ {{0x3c536469, 0xbce74cae} }, +/**/ {{0x3f9df677, 0xc77983b8} }, +/**/ {{0x3c373272, 0xb42f53aa} }, +/**/ {{0xbfa9512c, 0x9f3c360e} }, +/**/ {{0x3f9dd8df, 0x72d37b24} }, +/**/ {{0xbf6febf1, 0x02e417f5} }, +/**/ {{0xbf83601e, 0xd16a1579} }, +/**/ {{0x3f849a74, 0x294a83e4} } }, +/**/ {{{0x3feb0000, 0x00000000} }, +/**/ {{0x3fe66d66, 0x3923e087} }, +/**/ {{0xbc76ea6f, 0xebe8bbba} }, +/**/ {{0x3fe2b149, 0x74aea886} }, +/**/ {{0x3c868ffd, 0xa9d6d16a} }, +/**/ {{0xbfd26d0a, 0xed65571e} }, +/**/ {{0x3c6cf972, 0x476fb5f2} }, +/**/ {{0x3fb3514c, 0x8be1339f} }, +/**/ {{0x3c5c8c0f, 0x3f722216} }, +/**/ {{0x3f9cfb0b, 0x300f8f9b} }, +/**/ {{0xbc0edd81, 0x38d1c932} }, +/**/ {{0xbfa8f7cc, 0xf34b004f} }, +/**/ {{0x3f9dbbe5, 0x1bd3bde0} }, +/**/ {{0xbf712637, 0x9bf7dceb} }, +/**/ {{0xbf82a84e, 0xa146e5b2} }, +/**/ {{0x3f843e5e, 0x05f2718e} } }, +/**/ {{{0x3feb2000, 0x00000000} }, +/**/ {{0x3fe6800e, 0x4e7e2858} }, +/**/ {{0xbc58ea6a, 0x1b3e90f0} }, +/**/ {{0x3fe29ee3, 0xabd5912c} }, +/**/ {{0xbc61b3cd, 0xb17c28e3} }, +/**/ {{0xbfd25e83, 0x34f221eb} }, +/**/ {{0xbc74c483, 0xfa300585} }, +/**/ {{0x3fb36dcb, 0x5495f6e3} }, +/**/ {{0x3c59b55b, 0x311973fe} }, +/**/ {{0x3f9c031a, 0x9864d139} }, +/**/ {{0x3c28fdf3, 0xbd00e171} }, +/**/ {{0xbfa89ec7, 0x4b026585} }, +/**/ {{0x3f9d9ce0, 0x54a5ed3d} }, +/**/ {{0xbf724b13, 0xa8cb6dfc} }, +/**/ {{0xbf81f3be, 0x015469a9} }, +/**/ {{0x3f83e1ae, 0x66a50a89} } }, +/**/ {{{0x3feb4000, 0x00000000} }, +/**/ {{0x3fe692a4, 0x0556fb6a} }, +/**/ {{0x3c8d94b9, 0x5a8ea2cc} }, +/**/ {{0x3fe28c8c, 0x75459603} }, +/**/ {{0x3c8b1c3b, 0x2945fc08} }, +/**/ {{0xbfd24fe6, 0x79f37468} }, +/**/ {{0xbc4e3751, 0x0ec1ef94} }, +/**/ {{0x3fb38953, 0xe931c53b} }, +/**/ {{0xbc3b108d, 0x16d80688} }, +/**/ {{0x3f9b0ea2, 0x5e1b50b5} }, +/**/ {{0x3c0074c0, 0x63fd1067} }, +/**/ {{0xbfa84621, 0xa7fc7800} }, +/**/ {{0x3f9d7be4, 0xdd10256e} }, +/**/ {{0xbf7364c0, 0xc9592c5e} }, +/**/ {{0xbf814271, 0xd318d707} }, +/**/ {{0x3f838482, 0x64d217b8} } }, +/**/ {{{0x3feb6000, 0x00000000} }, +/**/ {{0x3fe6a527, 0x6c4b0576} }, +/**/ {{0xbc8f6b65, 0x9c46a69e} }, +/**/ {{0x3fe27a43, 0xe5a55de9} }, +/**/ {{0x3c66846e, 0xedc25d49} }, +/**/ {{0xbfd24135, 0x73c3b821} }, +/**/ {{0xbc79202a, 0x56ab5808} }, +/**/ {{0x3fb3a3e9, 0xc0282c84} }, +/**/ {{0x3c4057ca, 0x03d25dab} }, +/**/ {{0x3f9a1d9e, 0xa3eb854d} }, +/**/ {{0xbc3775ed, 0xf03e2fb1} }, +/**/ {{0xbfa7ede1, 0xd11d1043} }, +/**/ {{0x3f9d5906, 0x195e6961} }, +/**/ {{0xbf747373, 0x65130256} }, +/**/ {{0xbf80946d, 0xf77fd664} }, +/**/ {{0x3f8326f5, 0xedc272c2} } }, +/**/ {{{0x3feb8000, 0x00000000} }, +/**/ {{0x3fe6b798, 0x920b3d99} }, +/**/ {{0xbc8a8038, 0x6188c50e} }, +/**/ {{0x3fe2680a, 0x10e5813e} }, +/**/ {{0xbc8f5497, 0x2242a6bc} }, +/**/ {{0xbfd23270, 0xd725fa1c} }, +/**/ {{0x3c757282, 0x5c781b14} }, +/**/ {{0x3fb3bd90, 0x4bf2f124} }, +/**/ {{0x3c31ae9c, 0x6a14ed74} }, +/**/ {{0x3f99300b, 0x53ea1533} }, +/**/ {{0x3c2a8d88, 0x68f98d7e} }, +/**/ {{0xbfa7960d, 0x53a4e537} }, +/**/ {{0x3f9d3457, 0x11f5f086} }, +/**/ {{0xbf757760, 0x19baa1da} }, +/**/ {{0xbf7fd36a, 0xb2a2ca7e} }, +/**/ {{0x3f82c923, 0xc7a02081} } }, +/**/ {{{0x3feba000, 0x00000000} }, +/**/ {{0x3fe6c9f7, 0x855c3198} }, +/**/ {{0x3c7c09de, 0x29bd280d} }, +/**/ {{0x3fe255df, 0x0a431fbd} }, +/**/ {{0x3c8d9866, 0xf09a745d} }, +/**/ {{0xbfd22399, 0x5648fb1f} }, +/**/ {{0x3c412100, 0xb4df0b3e} }, +/**/ {{0x3fb3d64a, 0xfada8899} }, +/**/ {{0x3c3dd891, 0x659c4346} }, +/**/ {{0x3f9845e4, 0x21c2d0a1} }, +/**/ {{0x3c28c6b1, 0xf397827c} }, +/**/ {{0xbfa73ea9, 0x8445c1cc} }, +/**/ {{0x3f9d0dea, 0x730360f8} }, +/**/ {{0xbf7670bb, 0xac51ce30} }, +/**/ {{0xbf7e8493, 0xeef50deb} }, +/**/ {{0x3f826b25, 0x96b119a9} } }, +/**/ {{{0x3febc000, 0x00000000} }, +/**/ {{0x3fe6dc44, 0x551553af} }, +/**/ {{0xbc5bf886, 0x3573828e} }, +/**/ {{0x3fe243c2, 0xe44a7335} }, +/**/ {{0xbc667287, 0x65d1ffd7} }, +/**/ {{0xbfd214af, 0xa0ca68d3} }, +/**/ {{0xbc71296c, 0x88820895} }, +/**/ {{0x3fb3ee1d, 0x36c0c9a2} }, +/**/ {{0x3c540bf6, 0x831dfabe} }, +/**/ {{0x3f975f24, 0x8ce8de84} }, +/**/ {{0xbc125368, 0x43eb5853} }, +/**/ {{0xbfa6e7bb, 0x803788f8} }, +/**/ {{0x3f9ce5d2, 0x8c42d5f9} }, +/**/ {{0xbf775fba, 0xfaadb3ab} }, +/**/ {{0xbf7d3c59, 0xde4c28da} }, +/**/ {{0x3f820d13, 0xe2bf7ef5} } }, +/**/ {{{0x3febe000, 0x00000000} }, +/**/ {{0x3fe6ee7f, 0x10204aef} }, +/**/ {{0x3c8692ee, 0xa3066272} }, +/**/ {{0x3fe231b5, 0xb0d95ee5} }, +/**/ {{0x3c7aae7e, 0x1eb505b6} }, +/**/ {{0xbfd205b4, 0x63ba3e08} }, +/**/ {{0x3c71c6d1, 0xb975517d} }, +/**/ {{0x3fb4050a, 0x64edc729} }, +/**/ {{0x3c4960ed, 0x715db809} }, +/**/ {{0x3f967bc7, 0xe2bc143b} }, +/**/ {{0xbc2cbf17, 0xf0823143} }, +/**/ {{0xbfa69148, 0x2e4dbc47} }, +/**/ {{0x3f9cbc21, 0x50e0982e} }, +/**/ {{0xbf784492, 0xedaa432a} }, +/**/ {{0xbf7bfabd, 0x0b4850f3} }, +/**/ {{0x3f81af06, 0x1caa2f2c} } }, +/**/ {{{0x3fec0000, 0x00000000} }, +/**/ {{0x3fe700a7, 0xc5784634} }, +/**/ {{0xbc78c34d, 0x25aadef6} }, +/**/ {{0x3fe21fb7, 0x8121fb78} }, +/**/ {{0x3c621fb7, 0x8121fb78} }, +/**/ {{0xbfd1f6a8, 0x499e4889} }, +/**/ {{0xbc60e934, 0x6d4e0249} }, +/**/ {{0x3fb41b15, 0xe5decb17} }, +/**/ {{0x3c5194f4, 0xab3541e6} }, +/**/ {{0x3f959bc9, 0x40a374b5} }, +/**/ {{0xbc39dc6e, 0x54be0e10} }, +/**/ {{0xbfa63b54, 0x400d3c9a} }, +/**/ {{0x3f9c90e8, 0x57717232} }, +/**/ {{0xbf791f78, 0x6bfa704e} }, +/**/ {{0xbf7abfbc, 0x643da6dd} }, +/**/ {{0x3f815112, 0xa418ed31} } }, +/**/ {{{0x3fec2000, 0x00000000} }, +/**/ {{0x3fe712be, 0x84295198} }, +/**/ {{0x3c85cd90, 0x337d8881} }, +/**/ {{0x3fe20dc8, 0x65ad1f5b} }, +/**/ {{0xbc88102a, 0xd7b50d48} }, +/**/ {{0xbfd1e78b, 0xfa75d2f4} }, +/**/ {{0x3c723734, 0x619624d2} }, +/**/ {{0x3fb43043, 0x1517663e} }, +/**/ {{0xbc4af8a4, 0xe5e1ddf1} }, +/**/ {{0x3f94bf23, 0x961cd605} }, +/**/ {{0xbc26e86e, 0x5ca14507} }, +/**/ {{0xbfa5e5e4, 0x32c1ffd7} }, +/**/ {{0x3f9c6438, 0xda0191cd} }, +/**/ {{0xbf79f0a0, 0x4d921d2b} }, +/**/ {{0xbf798b55, 0x4e35d54e} }, +/**/ {{0x3f80f34e, 0xcd4f7bfd} } }, +/**/ {{{0x3fec4000, 0x00000000} }, +/**/ {{0x3fe724c3, 0x5b4fae7b} }, +/**/ {{0x3c5948b3, 0x2db3499b} }, +/**/ {{0x3fe1fbe8, 0x6e5ce35d} }, +/**/ {{0x3c8101d1, 0x561e27a3} }, +/**/ {{0xbfd1d860, 0x1bbd70f4} }, +/**/ {{0xbc7b4c97, 0xfa32c4d1} }, +/**/ {{0x3fb44495, 0x48f48a77} }, +/**/ {{0xbc2ccfed, 0xb47fdf89} }, +/**/ {{0x3f93e5d1, 0xa6c1af2c} }, +/**/ {{0xbc14af58, 0xc3b5a19b} }, +/**/ {{0xbfa590fc, 0x5094795f} }, +/**/ {{0x3f9c3623, 0xb638ebc2} }, +/**/ {{0xbf7ab83f, 0x4fa66d0e} }, +/**/ {{0xbf785d83, 0xb787e297} }, +/**/ {{0x3f8095ce, 0xe71b4cea} } }, +/**/ {{{0x3fec6000, 0x00000000} }, +/**/ {{0x3fe736b6, 0x5a172dff} }, +/**/ {{0x3c7775fd, 0x06a892d1} }, +/**/ {{0x3fe1ea17, 0xaa6f2377} }, +/**/ {{0xbc8395a8, 0xcb44ec07} }, +/**/ {{0xbfd1c925, 0x5072ec76} }, +/**/ {{0xbc6e11b3, 0xf650d5de} }, +/**/ {{0x3fb4580f, 0xd281a42b} }, +/**/ {{0xbc55bbce, 0xf63226cb} }, +/**/ {{0x3f930fce, 0x0c411254} }, +/**/ {{0x3c3a4412, 0xc9852726} }, +/**/ {{0xbfa53ca0, 0xb19e766e} }, +/**/ {{0x3f9c06b9, 0x6d941dd5} }, +/**/ {{0xbf7b768a, 0x094128b2} }, +/**/ {{0xbf773642, 0x2a047c42} }, +/**/ {{0x3f8038a6, 0x40d7925f} } }, +/**/ {{{0x3fec8000, 0x00000000} }, +/**/ {{0x3fe74897, 0x8fba8e0f} }, +/**/ {{0x3c47b2a6, 0x165884a1} }, +/**/ {{0x3fe1d856, 0x287ffb8a} }, +/**/ {{0xbc658a1f, 0xfee27a9d} }, +/**/ {{0xbfd1b9dc, 0x39195240} }, +/**/ {{0x3c604646, 0x551dc6bf} }, +/**/ {{0x3fb46ab5, 0xfd4fa866} }, +/**/ {{0x3c5f62a7, 0xc2febe43} }, +/**/ {{0x3f923d13, 0x384eda2c} }, +/**/ {{0x3c3b9a7c, 0x1dfd9f34} }, +/**/ {{0xbfa4e8d5, 0x3cff324c} }, +/**/ {{0x3f9bd60a, 0x25b0d0ad} }, +/**/ {{0xbf7c2bb4, 0xe063d1e6} }, +/**/ {{0xbf761589, 0xdcb54dd5} }, +/**/ {{0x3f7fb7ce, 0x61077b85} } }, +/**/ {{{0x3feca000, 0x00000000} }, +/**/ {{0x3fe75a67, 0x0b82d8d8} }, +/**/ {{0x3c8ee4ac, 0x4c729087} }, +/**/ {{0x3fe1c6a3, 0xf68c4011} }, +/**/ {{0xbc8e54e4, 0x32671c29} }, +/**/ {{0xbfd1aa85, 0x73bd1c8f} }, +/**/ {{0x3c7525ad, 0x41d7bd80} }, +/**/ {{0x3fb47c8b, 0x0f4e0cc0} }, +/**/ {{0x3c2efdd1, 0xd854875c} }, +/**/ {{0x3f916d9b, 0x7688134d} }, +/**/ {{0xbc1abef6, 0x42a6f922} }, +/**/ {{0xbfa4959d, 0xa9ee694e} }, +/**/ {{0x3f9ba425, 0xa8aca118} }, +/**/ {{0xbf7cd7f3, 0xffb6fa1f} }, +/**/ {{0xbf74fb52, 0xc52e395a} }, +/**/ {{0x3f7eff46, 0x31d14661} } }, +/**/ {{{0x3fecc000, 0x00000000} }, +/**/ {{0x3fe76c24, 0xdcc6c6c0} }, +/**/ {{0x3c819525, 0x51adc83d} }, +/**/ {{0x3fe1b501, 0x21f3f28c} }, +/**/ {{0xbc45712f, 0x5f1d67b6} }, +/**/ {{0xbfd19b21, 0x9bf87a43} }, +/**/ {{0xbc64520a, 0xb2071e48} }, +/**/ {{0x3fb48d92, 0x48a59e43} }, +/**/ {{0x3c5f8e56, 0x42014b8b} }, +/**/ {{0x3f90a160, 0xee4caccb} }, +/**/ {{0x3c2bd92b, 0x7b6daa67} }, +/**/ {{0xbfa442fd, 0x80ce3489} }, +/**/ {{0x3f9b711b, 0x65959e45} }, +/**/ {{0xbf7d7b7b, 0x4cc2673a} }, +/**/ {{0xbf73e793, 0xa86f8a8e} }, +/**/ {{0x3f7e47d4, 0xdf91602d} } }, +/**/ {{{0x3fece000, 0x00000000} }, +/**/ {{0x3fe77dd1, 0x12ea22c7} }, +/**/ {{0x3c873260, 0x8fc10d3d} }, +/**/ {{0x3fe1a36d, 0xb77cb1a2} }, +/**/ {{0xbc42c20d, 0x6e625be9} }, +/**/ {{0xbfd18bb1, 0x4af7b13c} }, +/**/ {{0xbc68446b, 0xbc063e5a} }, +/**/ {{0x3fb49dce, 0xe3952cbb} }, +/**/ {{0x3c588e60, 0x58cf9123} }, +/**/ {{0x3f8fb0bb, 0x491cfa44} }, +/**/ {{0x3c1534fc, 0x0e3f2a43} }, +/**/ {{0xbfa3f0f8, 0x1c3b7aca} }, +/**/ {{0x3f9b3cfa, 0x70eb708a} }, +/**/ {{0xbf7e167e, 0x5eaa8b7f} }, +/**/ {{0xbf72da42, 0x2b587c04} }, +/**/ {{0x3f7d9199, 0x882fa65b} } }, +/**/ {{{0x3fed0000, 0x00000000} }, +/**/ {{0x3fe78f6b, 0xbd5d315e} }, +/**/ {{0x3c8406a0, 0x89803740} }, +/**/ {{0x3fe191e9, 0xc35424ca} }, +/**/ {{0xbc8fa3c1, 0xf4be863f} }, +/**/ {{0xbfd17c35, 0x177d9a85} }, +/**/ {{0xbc717b81, 0x6a99d546} }, +/**/ {{0x3fb4ad44, 0x144fffae} }, +/**/ {{0x3c3538b3, 0xdccca2a3} }, +/**/ {{0x3f8e2516, 0xfb2b5523} }, +/**/ {{0x3c0f7c11, 0x60181bd9} }, +/**/ {{0xbfa39f90, 0xaa1cc641} }, +/**/ {{0x3f9b07d1, 0x85304289} }, +/**/ {{0xbf7ea930, 0x756fd193} }, +/**/ {{0xbf71d352, 0xe2a9a0de} }, +/**/ {{0x3f7cdcb1, 0x886fc912} } }, +/**/ {{{0x3fed2000, 0x00000000} }, +/**/ {{0x3fe7a0f4, 0xeb9c19a2} }, +/**/ {{0x3c613c67, 0xcd815f57} }, +/**/ {{0x3fe18075, 0x5112636f} }, +/**/ {{0x3c80a172, 0x7a335b20} }, +/**/ {{0xbfd16cad, 0x95e83705} }, +/**/ {{0x3c62a94b, 0x7b21d5e1} }, +/**/ {{0x3fb4bbf5, 0x08de0a7c} }, +/**/ {{0x3c3570d0, 0x057457a0} }, +/**/ {{0x3f8c9fc8, 0x7d750fdf} }, +/**/ {{0x3c2900a7, 0xfe4cff3c} }, +/**/ {{0xbfa34eca, 0x2caf50ea} }, +/**/ {{0x3f9ad1af, 0x03888c77} }, +/**/ {{0xbf7f33c4, 0x71ac3a86} }, +/**/ {{0xbf70d2b9, 0x6296fd58} }, +/**/ {{0x3f7c2938, 0x886d16b8} } }, +/**/ {{{0x3fed4000, 0x00000000} }, +/**/ {{0x3fe7b26c, 0xad2e50fe} }, +/**/ {{0xbc8ce80d, 0xf30411fb} }, +/**/ {{0x3fe16f10, 0x6bbc577a} }, +/**/ {{0xbc7d0db6, 0xbd8abf47} }, +/**/ {{0xbfd15d1b, 0x58355b5f} }, +/**/ {{0xbc5b5457, 0xbcc70038} }, +/**/ {{0x3fb4c9e4, 0xe8fdd51d} }, +/**/ {{0x3c462959, 0x28ac9383} }, +/**/ {{0x3f8b20c3, 0x2029f143} }, +/**/ {{0xbc2f8a44, 0x2b420400} }, +/**/ {{0xbfa2fea7, 0x7b921c49} }, +/**/ {{0x3f9a9aa0, 0xf468e79e} }, +/**/ {{0xbf7fb66c, 0xcccbcb4f} }, +/**/ {{0xbf6fb0d0, 0x9bd39a5f} }, +/**/ {{0x3f7b7748, 0x8813998f} } }, +/**/ {{{0x3fed6000, 0x00000000} }, +/**/ {{0x3fe7c3d3, 0x11a6092b} }, +/**/ {{0x3c8bb3cb, 0x2d303288} }, +/**/ {{0x3fe15dbb, 0x1dc61b17} }, +/**/ {{0xbc8f0487, 0xbb77dc56} }, +/**/ {{0xbfd14d7e, 0xee0771ca} }, +/**/ {{0x3c72d38b, 0xdc2fcbd0} }, +/**/ {{0x3fb4d716, 0xd6080f0e} }, +/**/ {{0xbc5cb5bc, 0xa9fbc2c3} }, +/**/ {{0x3f89a7f9, 0xfc42e02f} }, +/**/ {{0xbc201eec, 0x857be8a4} }, +/**/ {{0xbfa2af2b, 0x44ceebb3} }, +/**/ {{0x3f9a62b5, 0x08511639} }, +/**/ {{0xbf8018ad, 0xc8de23de} }, +/**/ {{0xbf6dc8a2, 0xc964501a} }, +/**/ {{0x3f7ac6f9, 0xeb913697} } }, +/**/ {{{0x3fed8000, 0x00000000} }, +/**/ {{0x3fe7d528, 0x289fa093} }, +/**/ {{0x3c856082, 0x1e2f3aa9} }, +/**/ {{0x3fe14c75, 0x711551bb} }, +/**/ {{0xbc80c88e, 0x71970f2c} }, +/**/ {{0xbfd13dd8, 0xe4aa5095} }, +/**/ {{0x3c66dd31, 0xb4b7ae12} }, +/**/ {{0x3fb4e38d, 0xead4c211} }, +/**/ {{0x3c513fb0, 0xe392a31e} }, +/**/ {{0x3f88355f, 0xf6b74576} }, +/**/ {{0x3ba8cb44, 0xf3561ab7} }, +/**/ {{0xbfa26058, 0x0de0faaa} }, +/**/ {{0x3f9a29f8, 0x989371f0} }, +/**/ {{0xbf805261, 0x2b085d9a} }, +/**/ {{0xbf6beccb, 0x2511c555} }, +/**/ {{0x3f7a1863, 0x87b9d333} } }, +/**/ {{{0x3feda000, 0x00000000} }, +/**/ {{0x3fe7e66c, 0x01c114fe} }, +/**/ {{0xbc8c82b8, 0x8b760b8d} }, +/**/ {{0x3fe13b3f, 0x6f037c44} }, +/**/ {{0xbc635393, 0x8562c8c0} }, +/**/ {{0xbfd12e29, 0xc7182435} }, +/**/ {{0xbc73da80, 0x0d0fda95} }, +/**/ {{0x3fb4ef4d, 0x3ba21a8b} }, +/**/ {{0xbc17c450, 0x9aa41146} }, +/**/ {{0x3f86c8e7, 0xc39dff46} }, +/**/ {{0x3c1ddd70, 0x800ba9ae} }, +/**/ {{0xbfa21230, 0x34b94b56} }, +/**/ {{0x3f99f078, 0xa827f95a} }, +/**/ {{0xbf808869, 0x19caa997} }, +/**/ {{0xbf6a1d29, 0xf8c46d26} }, +/**/ {{0x3f796b9a, 0xae59da17} } }, +/**/ {{{0x3fedc000, 0x00000000} }, +/**/ {{0x3fe7f79e, 0xacb97898} }, +/**/ {{0x3c8fd5ca, 0x80ead221} }, +/**/ {{0x3fe12a19, 0x20604825} }, +/**/ {{0xbc5cc7d6, 0xa18970f8} }, +/**/ {{0xbfd11e72, 0x1dfe6ba4} }, +/**/ {{0x3c706717, 0x9d653d1c} }, +/**/ {{0x3fb4fa57, 0xd5fcbb3b} }, +/**/ {{0x3c1922c8, 0x5f50bc06} }, +/**/ {{0x3f856283, 0xe93a179f} }, +/**/ {{0xbc01c2ec, 0x5ea7135a} }, +/**/ {{0xbfa1c4b5, 0xf0c06b4f} }, +/**/ {{0x3f99b641, 0xe48a3b04} }, +/**/ {{0xbf80badd, 0xe1280a21} }, +/**/ {{0xbf68599e, 0x1be3c5dd} }, +/**/ {{0x3f78c0b3, 0x3a72c8e6} } }, +/**/ {{{0x3fede000, 0x00000000} }, +/**/ {{0x3fe808c0, 0x3940694b} }, +/**/ {{0xbc800f32, 0x7715f6a5} }, +/**/ {{0x3fe11902, 0x8d73d98e} }, +/**/ {{0x3c71d158, 0x30f8e290} }, +/**/ {{0xbfd10eb2, 0x6fc305eb} }, +/**/ {{0xbc7fd2e3, 0x3858c4b7} }, +/**/ {{0x3fb504b0, 0xc0a99255} }, +/**/ {{0x3c55c054, 0x142e134f} }, +/**/ {{0x3f840226, 0xc2f371cf} }, +/**/ {{0xbbfc85b0, 0xfc7d6225} }, +/**/ {{0xbfa177eb, 0x53d58f53} }, +/**/ {{0x3f997b60, 0xa6a1627d} }, +/**/ {{0xbf80e9d7, 0x89757c78} }, +/**/ {{0xbf66a205, 0x0d433cd6} }, +/**/ {{0x3f7817bf, 0x9c5dbd9f} } }, +/**/ {{{0x3fee0000, 0x00000000} }, +/**/ {{0x3fe819d0, 0xb7158a4d} }, +/**/ {{0xbc7bf762, 0x29d3b917} }, +/**/ {{0x3fe107fb, 0xbe011080} }, +/**/ {{0xbc8107fb, 0xbe011080} }, +/**/ {{0xbfd0feeb, 0x40894fcd} }, +/**/ {{0x3c76fbb9, 0xc155af9a} }, +/**/ {{0x3fb50e5a, 0xfb9125f7} }, +/**/ {{0x3c357762, 0x2f3313b0} }, +/**/ {{0x3f82a7c2, 0x843ba55a} }, +/**/ {{0x3c1f4994, 0x3fc197b7} }, +/**/ {{0xbfa12bd2, 0x4b4ae875} }, +/**/ {{0x3f993fe0, 0xf3b1b1ee} }, +/**/ {{0xbf81156d, 0xd4c2083b} }, +/**/ {{0xbf64f63b, 0x0c35aa9c} }, +/**/ {{0x3f7770d0, 0xe5d0462f} } }, +/**/ {{{0x3fee2000, 0x00000000} }, +/**/ {{0x3fe82ad0, 0x36000005} }, +/**/ {{0x3c74592f, 0xce924d24} }, +/**/ {{0x3fe0f704, 0xb947c8b7} }, +/**/ {{0x3c436cd7, 0x48a651b3} }, +/**/ {{0xbfd0ef1d, 0x1237505b} }, +/**/ {{0x3c69239b, 0x1b86b9d1} }, +/**/ {{0x3fb51759, 0x7fac4e21} }, +/**/ {{0xbc42a8cc, 0xbfce0e36} }, +/**/ {{0x3f815349, 0x3b5f3edd} }, +/**/ {{0xbc25e1f1, 0x88c702d9} }, +/**/ {{0xbfa0e06c, 0xa0df17a9} }, +/**/ {{0x3f9903ce, 0x7e56b8b1} }, +/**/ {{0xbf813db8, 0x3c701e30} }, +/**/ {{0xbf63561b, 0x30c99e47} }, +/**/ {{0x3f76cbf6, 0xd5bffce0} } }, +/**/ {{{0x3fee4000, 0x00000000} }, +/**/ {{0x3fe83bbe, 0xc5cdee22} }, +/**/ {{0x3c631071, 0x04ffc6c3} }, +/**/ {{0x3fe0e61d, 0x86071468} }, +/**/ {{0xbc70ccc4, 0x59be09c9} }, +/**/ {{0xbfd0df48, 0x647af38b} }, +/**/ {{0x3c7dd47c, 0x427c295b} }, +/**/ {{0x3fb51faf, 0x3ef25277} }, +/**/ {{0x3bdf056a, 0xa81026a7} }, +/**/ {{0x3f8004ac, 0xd443a18b} }, +/**/ {{0x3c027610, 0x8178f329} }, +/**/ {{0xbfa095bb, 0xfbb3a658} }, +/**/ {{0x3f98c734, 0xa7859d46} }, +/**/ {{0xbf8162cd, 0xeefe9a81} }, +/**/ {{0xbf61c17f, 0x8330eac0} }, +/**/ {{0x3f76293f, 0xe421c20a} } }, +/**/ {{{0x3fee6000, 0x00000000} }, +/**/ {{0x3fe84c9c, 0x7653f7eb} }, +/**/ {{0xbc383611, 0xfe0a3e8f} }, +/**/ {{0x3fe0d546, 0x2a7f71b5} }, +/**/ {{0x3c757061, 0x596848c6} }, +/**/ {{0xbfd0cf6d, 0xb4cf51a6} }, +/**/ {{0x3c4c99ab, 0x5b18bb8c} }, +/**/ {{0x3fb5275f, 0x24486227} }, +/**/ {{0x3c5b4a59, 0xbb1f4f56} }, +/**/ {{0x3f7d77be, 0x36238bb2} }, +/**/ {{0x3c1ddbd1, 0xcaec6ba2} }, +/**/ {{0xbfa04bc1, 0xe1406cd0} }, +/**/ {{0x3f988a1e, 0x7f96d6ca} }, +/**/ {{0xbf8184c5, 0xcdffc380} }, +/**/ {{0xbf603841, 0x12561f8b} }, +/**/ {{0x3f7588b9, 0x4d81a668} } }, +/**/ {{{0x3fee8000, 0x00000000} }, +/**/ {{0x3fe85d69, 0x576cc2c5} }, +/**/ {{0x3c66b66e, 0x7fc8b8c3} }, +/**/ {{0x3fe0c47e, 0xac74fadc} }, +/**/ {{0xbc8035f8, 0x77bb1887} }, +/**/ {{0xbfd0bf8d, 0x7e8202a9} }, +/**/ {{0x3c798048, 0x1f4d2357} }, +/**/ {{0x3fb52e6c, 0x13725c73} }, +/**/ {{0xbc34c3af, 0xf5b19ded} }, +/**/ {{0x3f7af1a3, 0x7d9c2711} }, +/**/ {{0x3bea7ec7, 0x1af1098d} }, +/**/ {{0xbfa0027f, 0xb643d11f} }, +/**/ {{0x3f984c96, 0xc756b7d7} }, +/**/ {{0xbf81a3b6, 0x6c3ca3ae} }, +/**/ {{0xbf5d7470, 0x13459246} }, +/**/ {{0x3f74ea6f, 0x1e70d9a4} } }, +/**/ {{{0x3feea000, 0x00000000} }, +/**/ {{0x3fe86e25, 0x78f87ae5} }, +/**/ {{0x3c8022b1, 0x375cfe34} }, +/**/ {{0x3fe0b3c7, 0x11319104} }, +/**/ {{0x3c8ac394, 0x25152519} }, +/**/ {{0xbfd0afa8, 0x3ab87c8a} }, +/**/ {{0x3c724f26, 0x27b31384} }, +/**/ {{0x3fb534d8, 0xe904e078} }, +/**/ {{0xbc55bfde, 0xf8948323} }, +/**/ {{0x3f7876ec, 0xa7bb2dfb} }, +/**/ {{0xbc197116, 0x8a87be50} }, +/**/ {{0xbf9f73ed, 0x7f5f95b4} }, +/**/ {{0x3f980ea7, 0xf11c3266} }, +/**/ {{0xbf81bfb6, 0x0c032389} }, +/**/ {{0xbf5a8e77, 0x8bf305a1} }, +/**/ {{0x3f744e6c, 0x3ec72e6d} } }, +/**/ {{{0x3feec000, 0x00000000} }, +/**/ {{0x3fe87ed0, 0xeadc5a2a} }, +/**/ {{0x3c70af5a, 0xd957f4bc} }, +/**/ {{0x3fe0a31f, 0x5d8701b3} }, +/**/ {{0xbc869b25, 0x263ce937} }, +/**/ {{0xbfd09fbe, 0x60757b83} }, +/**/ {{0x3c767aff, 0xa96db9ef} }, +/**/ {{0x3fb53aa8, 0x7a589afb} }, +/**/ {{0xbc4b7e8e, 0x0844ff86} }, +/**/ {{0x3f76077c, 0xacf1a65c} }, +/**/ {{0xbc19a3b2, 0xb13331a9} }, +/**/ {{0xbf9ee450, 0x472733eb} }, +/**/ {{0x3f97d05c, 0x21e541d7} }, +/**/ {{0xbf81d8da, 0x9d9d4dfc} }, +/**/ {{0xbf57be45, 0xd3ce1b4a} }, +/**/ {{0x3f73b4ba, 0x7cb60047} } }, +/**/ {{{0x3feee000, 0x00000000} }, +/**/ {{0x3fe88f6b, 0xbd023119} }, +/**/ {{0xbc532d1d, 0x25aba660} }, +/**/ {{0x3fe09287, 0x95d126c6} }, +/**/ {{0x3c85aad3, 0xeccc37a6} }, +/**/ {{0xbfd08fd0, 0x649e7367} }, +/**/ {{0x3c71e96c, 0xed21a127} }, +/**/ {{0x3fb53fdd, 0x957ec910} }, +/**/ {{0xbc339c23, 0xaf97a601} }, +/**/ {{0x3f73a336, 0x5a18e5a2} }, +/**/ {{0xbc1f7225, 0x477571de} }, +/**/ {{0xbf9e5629, 0xd4044135} }, +/**/ {{0x3f9791bd, 0x32786dc4} }, +/**/ {{0xbf81ef39, 0xbdf030c4} }, +/**/ {{0xbf550386, 0xe21b8bcb} }, +/**/ {{0x3f731d62, 0x97aa7fb2} } }, +/**/ {{{0x3fef0000, 0x00000000} }, +/**/ {{0x3fe89ff5, 0xff57f1f8} }, +/**/ {{0xbc855b9a, 0x5e177a1b} }, +/**/ {{0x3fe081ff, 0xbdf80108} }, +/**/ {{0x3c6ffbdf, 0x80108200} }, +/**/ {{0xbfd07fde, 0xba010928} }, +/**/ {{0x3c38d37f, 0x7bae0295} }, +/**/ {{0x3fb5447b, 0x0136e69f} }, +/**/ {{0x3c50316a, 0x0dda278d} }, +/**/ {{0x3f7149fc, 0x55103947} }, +/**/ {{0x3c176e96, 0x849e505f} }, +/**/ {{0xbf9dc97b, 0xfbe9a2ee} }, +/**/ {{0x3f9752d4, 0xb08adda9} }, +/**/ {{0xbf8202e8, 0xb540d106} }, +/**/ {{0xbf525de5, 0x859de3e9} }, +/**/ {{0x3f72886c, 0x4afd9f21} } }, +/**/ {{{0x3fef2000, 0x00000000} }, +/**/ {{0x3fe8b06f, 0xc1cf3dff} }, +/**/ {{0xbc80fb31, 0x2656db6d} }, +/**/ {{0x3fe07187, 0xd971cd38} }, +/**/ {{0x3c89baa4, 0x202c20ac} }, +/**/ {{0xbfd06fe9, 0xd15893ab} }, +/**/ {{0xbc7a864b, 0xdc0cb586} }, +/**/ {{0x3fb54883, 0x7ce57fed} }, +/**/ {{0xbc49498e, 0x294f4b18} }, +/**/ {{0x3f6df762, 0x426ebecc} }, +/**/ {{0xbc022f08, 0xf28644c0} }, +/**/ {{0xbf9d3e48, 0x5c564b44} }, +/**/ {{0x3f9713ab, 0xdfea7acf} }, +/**/ {{0xbf8213fc, 0x761db35c} }, +/**/ {{0xbf4f9a17, 0x10d60f49} }, +/**/ {{0x3f71f5de, 0x58700e9b} } }, +/**/ {{{0x3fef4000, 0x00000000} }, +/**/ {{0x3fe8c0d9, 0x145cf49d} }, +/**/ {{0x3c8bea40, 0x76dc4333} }, +/**/ {{0x3fe0611f, 0xeb45139a} }, +/**/ {{0x3c7e4998, 0x65aadb1f} }, +/**/ {{0xbfd05ff2, 0x1953a316} }, +/**/ {{0x3c759922, 0xa1b67b0f} }, +/**/ {{0x3fb54bf9, 0xc08c1d66} }, +/**/ {{0x3c5b9353, 0xd220330c} }, +/**/ {{0x3f69706e, 0x478cb604} }, +/**/ {{0xbbfdb6d3, 0xa22fd45a} }, +/**/ {{0xbf9cb490, 0x5c0d1d38} }, +/**/ {{0x3f96d44b, 0xbbaba2f2} }, +/**/ {{0xbf822289, 0x9c6b7de1} }, +/**/ {{0xbf4aa143, 0xa49803b6} }, +/**/ {{0x3f7165be, 0x9270e49e} } }, +/**/ {{{0x3fef6000, 0x00000000} }, +/**/ {{0x3fe8d132, 0x06f8c4cb} }, +/**/ {{0xbc7b018c, 0xbaa89a8b} }, +/**/ {{0x3fe050c7, 0xf60ab1f4} }, +/**/ {{0x3c63f8e2, 0xc6cf5796} }, +/**/ {{0xbfd04ff7, 0xfe998dc0} }, +/**/ {{0x3c77873c, 0x7dc56419} }, +/**/ {{0x3fb54ee0, 0x7cc24121} }, +/**/ {{0x3c313117, 0x8e5c84c5} }, +/**/ {{0x3f64fee1, 0x50066301} }, +/**/ {{0x3c043698, 0x017261a1} }, +/**/ {{0xbf9c2c55, 0x2cc5b4f1} }, +/**/ {{0x3f9694bc, 0xf759f369} }, +/**/ {{0xbf822ea4, 0x6c93426a} }, +/**/ {{0xbf45d0a1, 0x135d6c51} }, +/**/ {{0x3f70d811, 0xe62dc18f} } }, +/**/ {{{0x3fef8000, 0x00000000} }, +/**/ {{0x3fe8e17a, 0xa99cc05e} }, +/**/ {{0xbc7ec182, 0xab042f61} }, +/**/ {{0x3fe0407f, 0xfbefe001} }, +/**/ {{0x3c401ffe, 0xfbf80041} }, +/**/ {{0xbfd03ffb, 0xebd00209} }, +/**/ {{0xbc53ff3c, 0xb9004112} }, +/**/ {{0x3fb5513a, 0x5aaf6d91} }, +/**/ {{0x3c54a20d, 0xc0516ddb} }, +/**/ {{0x3f60a27f, 0xc6ac4038} }, +/**/ {{0x3bf06bee, 0x2a340912} }, +/**/ {{0xbf9ba597, 0xccd6032a} }, +/**/ {{0x3f965508, 0x002bb974} }, +/**/ {{0xbf823860, 0xd2d1068b} }, +/**/ {{0xbf41277e, 0x666265bc} }, +/**/ {{0x3f704cdc, 0x656b66ea} } }, +/**/ {{{0x3fefa000, 0x00000000} }, +/**/ {{0x3fe8f1b3, 0x0c44f167} }, +/**/ {{0x3c6dd1ca, 0xb93933fd} }, +/**/ {{0x3fe03047, 0xfeb82e4e} }, +/**/ {{0x3c69ee56, 0x5272e5ac} }, +/**/ {{0xbfd02ffe, 0x49a09c45} }, +/**/ {{0xbc700a59, 0xb26267bb} }, +/**/ {{0x3fb55309, 0xfc062d2f} }, +/**/ {{0x3c5dba48, 0xb11938e0} }, +/**/ {{0x3f58b61b, 0xe4f365be} }, +/**/ {{0x3bf8b585, 0xa79ad31a} }, +/**/ {{0xbf9b2059, 0x08d4ad17} }, +/**/ {{0x3f961534, 0xfe379940} }, +/**/ {{0xbf823fd2, 0x62a1270e} }, +/**/ {{0xbf394a53, 0x3f3a0aec} }, +/**/ {{0x3f6f8842, 0xa04bcae2} } }, +/**/ {{{0x3fefc000, 0x00000000} }, +/**/ {{0x3fe901db, 0x3eeef187} }, +/**/ {{0x3c868665, 0xe5603c8f} }, +/**/ {{0x3fe0201f, 0xffbf7f80} }, +/**/ {{0x3c20201f, 0xffbf7f80} }, +/**/ {{0xbfd01fff, 0x7ebe8004} }, +/**/ {{0xbc4213ff, 0xcf979001} }, +/**/ {{0x3fb55451, 0xfb0012db} }, +/**/ {{0xbc395606, 0xf73aa59f} }, +/**/ {{0x3f50509f, 0xfc757100} }, +/**/ {{0x3bebc7da, 0xfee554d0} }, +/**/ {{0xbf9a9c99, 0x7d3424d0} }, +/**/ {{0x3f95d54b, 0xd5ac0217} }, +/**/ {{0xbf82450c, 0x564b3c49} }, +/**/ {{0xbf3091df, 0xe6d3e986} }, +/**/ {{0x3f6e7bc6, 0x3bef5a22} } }, +/**/ {{{0x3fefe000, 0x00000000} }, +/**/ {{0x3fe911f3, 0x5199833b} }, +/**/ {{0x3c63ae8a, 0x0edbf522} }, +/**/ {{0x3fe01007, 0xfffbfbfe} }, +/**/ {{0x3ba01007, 0xfffbfbfe} }, +/**/ {{0xbfd00fff, 0xefebf400} }, +/**/ {{0xbc401209, 0xfff9f97d} }, +/**/ {{0x3fb55514, 0xea5aaaf6} }, +/**/ {{0xbc529baa, 0xb5b7b240} }, +/**/ {{0x3f402827, 0xffc7abc4} }, +/**/ {{0x3b5ba3d6, 0xbfee6ab3} }, +/**/ {{0xbf9a1a59, 0x97d67093} }, +/**/ {{0x3f959554, 0x28080aaf} }, +/**/ {{0xbf824821, 0x8e892ce2} }, +/**/ {{0xbf204877, 0xfe70a2a6} }, +/**/ {{0x3f6d7447, 0x0e8ddd67} } }, +/**/ {{{0x3feff800, 0x00000000} }, +/**/ {{0x3fe91dfa, 0xd439826e} }, +/**/ {{0xbc786a19, 0x6df48d55} }, +/**/ {{0x3fe00400, 0x7ffffbff} }, +/**/ {{0xbbeffffe, 0xffbff800} }, +/**/ {{0xbfd003ff, 0xffbfebfd} }, +/**/ {{0xbb600480, 0x9ffff9fe} }, +/**/ {{0x3fb55551, 0x53aa5aab} }, +/**/ {{0xbc542a4a, 0x9baaab5b} }, +/**/ {{0x3f200a02, 0x7fffc7eb} }, +/**/ {{0xbb7dfffe, 0x4770e940} }, +/**/ {{0xbf99b9a5, 0x9997d8d0} }, +/**/ {{0x3f956555, 0x50a80a03} }, +/**/ {{0xbf824914, 0x86456493} }, +/**/ {{0xbf001207, 0x7ffe7329} }, +/**/ {{0x3f6cb1ef, 0x1c63fe2a} } }, + }; + +#else +#ifdef LITTLE_ENDI + + static const number + cij[241][7] = { /* x0,cij for (1/16,1) */ +/**/ {{{0X65E0244E, 0X3FB04006} }, +/**/ {{0X7B53DD20, 0X3FB03A73} }, +/**/ {{0XCF5CFB72, 0X3FEFDF1F} }, +/**/ {{0XCE2AE4C2, 0XBFB01EB3} }, +/**/ {{0XDD58A40D, 0XBFD4D29E} }, +/**/ {{0XD907A18A, 0X3FAFDA4A} }, +/**/ {{0X4DF65B18, 0X3FC814DF} } }, +/**/ {{{0XB9B88CD8, 0X3FB0FFFD} }, +/**/ {{0X63645300, 0X3FB0F99C} }, +/**/ {{0XA3DED30F, 0X3FEFDC08} }, +/**/ {{0X669C1AED, 0XBFB0D9DC} }, +/**/ {{0XF7138DE2, 0XBFD4C669} }, +/**/ {{0X29D085A7, 0X3FB0A12F} }, +/**/ {{0XCFD48D20, 0X3FC7F0EE} } }, +/**/ {{{0X5A73D4F1, 0X3FB1FFF1} }, +/**/ {{0X2BEE2040, 0X3FB1F85F} }, +/**/ {{0X42B56D31, 0X3FEFD7B3} }, +/**/ {{0XB69DEA40, 0XBFB1D2B7} }, +/**/ {{0X3922ECC9, 0XBFD4B552} }, +/**/ {{0X522B1A04, 0X3FB18F93} }, +/**/ {{0X5660F061, 0X3FC7BEAD} } }, +/**/ {{{0XB2524AA2, 0X3FB2FFFD} }, +/**/ {{0XE71790A0, 0X3FB2F716} }, +/**/ {{0X53B496A4, 0X3FEFD31F} }, +/**/ {{0X4AAB7374, 0XBFB2CAD8} }, +/**/ {{0X58DD2FB2, 0XBFD4A34B} }, +/**/ {{0XD0CECC18, 0X3FB27C0A} }, +/**/ {{0X5D2743D7, 0X3FC789D2} } }, +/**/ {{{0X0573F3AC, 0X3FB3FFFE} }, +/**/ {{0X1702F6A0, 0X3FB3F59D} }, +/**/ {{0XB071ACC2, 0X3FEFCE4D} }, +/**/ {{0X64DB3686, 0XBFB3C20F} }, +/**/ {{0XEB3BFE93, 0XBFD49059} }, +/**/ {{0XCAF74FED, 0X3FB36659} }, +/**/ {{0X1C011FB0, 0X3FC75269} } }, +/**/ {{{0X894384D6, 0X3FB4FFEF} }, +/**/ {{0X0CE204C0, 0X3FB4F3ED} }, +/**/ {{0XA8EA5A01, 0X3FEFC93E} }, +/**/ {{0X7B5457C9, 0XBFB4B84F} }, +/**/ {{0X7401F2F9, 0XBFD47C80} }, +/**/ {{0XB4F67209, 0X3FB44E64} }, +/**/ {{0X4C540B77, 0X3FC7187D} } }, +/**/ {{{0XDF406528, 0X3FB5FFF8} }, +/**/ {{0X3C73D820, 0X3FB5F22B} }, +/**/ {{0XB1F60F13, 0X3FEFC3F1} }, +/**/ {{0XCB7FA73B, 0XBFB5ADB2} }, +/**/ {{0X2B1EB555, 0XBFD467BE} }, +/**/ {{0X99EDC463, 0X3FB53435} }, +/**/ {{0X238F5059, 0X3FC6DC1B} } }, +/**/ {{{0X8C4F0D56, 0X3FB7000F} }, +/**/ {{0X495A2FA0, 0X3FB6F04B} }, +/**/ {{0X340DCE97, 0X3FEFBE67} }, +/**/ {{0X4D98E1AD, 0XBFB6A224} }, +/**/ {{0X14064DF1, 0XBFD45216} }, +/**/ {{0X2BA78A66, 0X3FB617AA} }, +/**/ {{0X50A3D7AC, 0X3FC69D4F} } }, +/**/ {{{0XBB4057CF, 0X3FB8000F} }, +/**/ {{0XBE2CD3A0, 0X3FB7EE27} }, +/**/ {{0X39EC9246, 0X3FEFB8A0} }, +/**/ {{0X31D9C773, 0XBFB79577} }, +/**/ {{0XB6DC7D72, 0XBFD43B8D} }, +/**/ {{0XD69547DF, 0X3FB6F88A} }, +/**/ {{0XF633CE8C, 0X3FC65C26} } }, +/**/ {{{0X39CF2B7F, 0X3FB8FFF2} }, +/**/ {{0X9F979E80, 0X3FB8EBB7} }, +/**/ {{0X435506E1, 0X3FEFB29D} }, +/**/ {{0X69B9CDB5, 0XBFB8879A} }, +/**/ {{0X85FEAFA9, 0XBFD42428} }, +/**/ {{0XB6191A0E, 0X3FB7D6BA} }, +/**/ {{0XA7CB8BB5, 0X3FC618AF} } }, +/**/ {{{0X6E2F0772, 0X3FB9FFF9} }, +/**/ {{0XD32A9480, 0X3FB9E93A} }, +/**/ {{0X04A3EC40, 0X3FEFAC5D} }, +/**/ {{0X53F6EA97, 0XBFB978C2} }, +/**/ {{0X089C36F6, 0XBFD40BE3} }, +/**/ {{0X885AEB77, 0X3FB8B25C} }, +/**/ {{0X63CADCE1, 0X3FC5D2F7} } }, +/**/ {{{0X6316B097, 0X3FBB0002} }, +/**/ {{0XCE24CC00, 0X3FBAE68C} }, +/**/ {{0X938C5C66, 0X3FEFA5E0} }, +/**/ {{0X76F14E4B, 0XBFBA68C3} }, +/**/ {{0X1696CD7C, 0XBFD3F2C3} }, +/**/ {{0X722A2CB4, 0X3FB98B3B} }, +/**/ {{0X9067AD62, 0X3FC58B0C} } }, +/**/ {{{0X604F58B1, 0X3FBC0008} }, +/**/ {{0X05650780, 0X3FBBE3A7} }, +/**/ {{0X5A7A2773, 0X3FEF9F28} }, +/**/ {{0X3D5AC0A4, 0XBFBB578F} }, +/**/ {{0XF767119F, 0XBFD3D8CB} }, +/**/ {{0XC7E31B88, 0X3FBA613D} }, +/**/ {{0XF5594565, 0X3FC540FD} } }, +/**/ {{{0X6CCA4EBA, 0X3FBD0002} }, +/**/ {{0XC1298A80, 0X3FBCE07E} }, +/**/ {{0XE8D36C4A, 0X3FEF9834} }, +/**/ {{0X5BCAC5FE, 0XBFBC4513} }, +/**/ {{0X8B5236F1, 0XBFD3BE01} }, +/**/ {{0X2E991970, 0X3FBB3447} }, +/**/ {{0XB8ADB373, 0X3FC4F4DA} } }, +/**/ {{{0XB2B47FCA, 0X3FBDFFF4} }, +/**/ {{0X4A051D80, 0X3FBDDD16} }, +/**/ {{0X78DCC895, 0X3FEF9106} }, +/**/ {{0XF0966844, 0XBFBD3149} }, +/**/ {{0X744F9A5F, 0XBFD3A266} }, +/**/ {{0XEDB7F27A, 0X3FBC0446} }, +/**/ {{0X583F9ECA, 0X3FC4A6B2} } }, +/**/ {{{0XA9A05BE0, 0X3FBF000A} }, +/**/ {{0XA3BDA540, 0X3FBED996} }, +/**/ {{0X1B8BA97F, 0X3FEF899C} }, +/**/ {{0X2287A677, 0XBFBE1C51} }, +/**/ {{0XEDC130BB, 0XBFD385F8} }, +/**/ {{0XF306FF50, 0X3FBCD14B} }, +/**/ {{0XA667A72B, 0X3FC45694} } }, +/**/ {{{0XBA8F63DE, 0X3FBFFFFA} }, +/**/ {{0X69FE4780, 0X3FBFD5B5} }, +/**/ {{0X4863DC7D, 0X3FEF81F8} }, +/**/ {{0XD1518706, 0XBFBF05DB} }, +/**/ {{0X4687A69C, 0XBFD368C4} }, +/**/ {{0X1B3868DA, 0X3FBD9B08} }, +/**/ {{0XC345ADFC, 0X3FC40491} } }, +/**/ {{{0X6ECCADA8, 0X3FC07FFA} }, +/**/ {{0X0A396400, 0X3FC068D0} }, +/**/ {{0XF1FCFC6B, 0X3FEF7A19} }, +/**/ {{0X861DF0DF, 0XBFBFEE0C} }, +/**/ {{0X5A586C0C, 0XBFD34AC6} }, +/**/ {{0X189D637A, 0X3FBE618F} }, +/**/ {{0X195779D4, 0X3FC3B0BA} } }, +/**/ {{{0X33432713, 0X3FC10003} }, +/**/ {{0XF203D1A0, 0X3FC0E6B0} }, +/**/ {{0XFE0EB463, 0X3FEF7200} }, +/**/ {{0XE15CB19A, 0XBFC06A72} }, +/**/ {{0XB8DB761E, 0XBFD32C00} }, +/**/ {{0XA11F5E3E, 0X3FBF24D8} }, +/**/ {{0X569E85DD, 0X3FC35B1E} } }, +/**/ {{{0XDA1C4811, 0X3FC17FFC} }, +/**/ {{0X29EBDA00, 0X3FC16462} }, +/**/ {{0X7D558737, 0X3FEF69AF} }, +/**/ {{0X0B33969B, 0XBFC0DD17} }, +/**/ {{0X33AC50D1, 0XBFD30C7D} }, +/**/ {{0X9BE43F0F, 0X3FBFE4AA} }, +/**/ {{0X692539CB, 0X3FC303CF} } }, +/**/ {{{0X3CCA418D, 0X3FC1FFFF} }, +/**/ {{0X3B978EA0, 0X3FC1E1FA} }, +/**/ {{0X45D421A9, 0X3FEF6124} }, +/**/ {{0XACAC8AA8, 0XBFC14F03} }, +/**/ {{0X62E675A3, 0XBFD2EC39} }, +/**/ {{0X2FA6B426, 0X3FC0508C} }, +/**/ {{0X780A6467, 0X3FC2AADE} } }, +/**/ {{{0XD9C78922, 0X3FC27FF7} }, +/**/ {{0X1B91E640, 0X3FC25F66} }, +/**/ {{0XF52E192C, 0X3FEF5860} }, +/**/ {{0XE5DE2394, 0XBFC1C023} }, +/**/ {{0X6BEE0ABD, 0XBFD2CB3D} }, +/**/ {{0X5E075C1A, 0X3FC0ACFB} }, +/**/ {{0XDFFE453A, 0X3FC2505C} } }, +/**/ {{{0XA1FC1AAA, 0X3FC2FFF7} }, +/**/ {{0X83257C40, 0X3FC2DCB5} }, +/**/ {{0XC719B6FB, 0X3FEF4F64} }, +/**/ {{0X61514083, 0XBFC23082} }, +/**/ {{0X7F7B72D5, 0XBFD2A988} }, +/**/ {{0X7C887402, 0X3FC107A7} }, +/**/ {{0X2C3CD6D1, 0X3FC1F45C} } }, +/**/ {{{0X9D78E15E, 0X3FC38005} }, +/**/ {{0X6AC98EE0, 0X3FC359EE} }, +/**/ {{0X944CEC16, 0X3FEF462F} }, +/**/ {{0XD85B87A9, 0XBFC2A020} }, +/**/ {{0X2E4AB369, 0XBFD2871C} }, +/**/ {{0XC31A65D9, 0X3FC1608D} }, +/**/ {{0X130BBE50, 0X3FC196EE} } }, +/**/ {{{0X9F431B1A, 0X3FC40004} }, +/**/ {{0X6BD65360, 0X3FC3D6F3} }, +/**/ {{0XDD99B68A, 0X3FEF3CC3} }, +/**/ {{0XB3DD00ED, 0XBFC30EE1} }, +/**/ {{0XF8482664, 0XBFD26403} }, +/**/ {{0XFE136626, 0X3FC1B792} }, +/**/ {{0X6EAC7440, 0X3FC13824} } }, +/**/ {{{0XE01D95A1, 0X3FC48004} }, +/**/ {{0X86F00CC0, 0X3FC453D3} }, +/**/ {{0XE3970539, 0X3FEF3320} }, +/**/ {{0X0A5279AA, 0XBFC37CCF} }, +/**/ {{0X3B151D5D, 0XBFD2403F} }, +/**/ {{0XE331C9E6, 0X3FC20CBB} }, +/**/ {{0X39E3F097, 0X3FC0D811} } }, +/**/ {{{0XAA9382DD, 0X3FC4FFF7} }, +/**/ {{0X8C590A80, 0X3FC4D07F} }, +/**/ {{0X34DF28E0, 0X3FEF2948} }, +/**/ {{0X5B43915C, 0XBFC3E9D8} }, +/**/ {{0XEB8845A2, 0XBFD21BD5} }, +/**/ {{0XAC6AC8AD, 0X3FC25FF8} }, +/**/ {{0X88ED96CA, 0X3FC076C6} } }, +/**/ {{{0X352408BE, 0X3FC58006} }, +/**/ {{0XC39A73E0, 0X3FC54D1E} }, +/**/ {{0X09AE009C, 0X3FEF1F37} }, +/**/ {{0XB9BE8550, 0XBFC4561C} }, +/**/ {{0X0053F52E, 0XBFD1F6C0} }, +/**/ {{0XEF783BE9, 0X3FC2B15D} }, +/**/ {{0X8615239B, 0X3FC01456} } }, +/**/ {{{0X2B193F81, 0X3FC5FFFF} }, +/**/ {{0X4F73E000, 0X3FC5C980} }, +/**/ {{0XAE110E29, 0X3FEF14F1} }, +/**/ {{0X9098B3D2, 0XBFC4C16E} }, +/**/ {{0X8F058241, 0XBFD1D10F} }, +/**/ {{0XA14FA897, 0X3FC300C6} }, +/**/ {{0XD56607C0, 0X3FBF61A6} } }, +/**/ {{{0X4460E6E1, 0X3FC68008} }, +/**/ {{0X04A55E20, 0X3FC645C8} }, +/**/ {{0X8FA36EC5, 0X3FEF0A75} }, +/**/ {{0XD62FA883, 0XBFC52BE9} }, +/**/ {{0X69A74048, 0XBFD1AABD} }, +/**/ {{0X1679EB02, 0X3FC34E45} }, +/**/ {{0XF7C14C3D, 0X3FBE989E} } }, +/**/ {{{0X9E99A846, 0X3FC6FFFB} }, +/**/ {{0X4B35FD40, 0X3FC6C1D0} }, +/**/ {{0X3EF8EF95, 0X3FEEFFC6} }, +/**/ {{0X76A2FE63, 0XBFC5956B} }, +/**/ {{0XDDC78DDF, 0XBFD183D8} }, +/**/ {{0XAC606D66, 0X3FC399BD} }, +/**/ {{0X070D286A, 0X3FBDCDBA} } }, +/**/ {{{0X0FFCD490, 0X3FC78008} }, +/**/ {{0XB55758E0, 0X3FC73DC5} }, +/**/ {{0X457E2065, 0X3FEEF4E0} }, +/**/ {{0X7D6FF9BC, 0XBFC5FE16} }, +/**/ {{0X9FADD384, 0XBFD15C57} }, +/**/ {{0X73E52D32, 0X3FC3E347} }, +/**/ {{0X9A65AE4B, 0X3FBD011C} } }, +/**/ {{{0X148E79C1, 0X3FC80006} }, +/**/ {{0X2B7F8CA0, 0X3FC7B981} }, +/**/ {{0X701687ED, 0X3FEEE9C7} }, +/**/ {{0X0E1EF36D, 0XBFC665C7} }, +/**/ {{0XCCBCBDAB, 0XBFD13449} }, +/**/ {{0X5C71B3E8, 0X3FC42AC7} }, +/**/ {{0X3E81980E, 0X3FBC32EB} } }, +/**/ {{{0X0F487C17, 0X3FC88006} }, +/**/ {{0XBC0E3640, 0X3FC83511} }, +/**/ {{0XD2D55329, 0X3FEEDE7A} }, +/**/ {{0X37E644BA, 0XBFC6CC87} }, +/**/ {{0X60597557, 0XBFD10BAE} }, +/**/ {{0X13E26FBE, 0X3FC47043} }, +/**/ {{0X6FB18BF4, 0X3FBB634A} } }, +/**/ {{{0XD3518D76, 0X3FC90004} }, +/**/ {{0X8874C100, 0X3FC8B073} }, +/**/ {{0X2ED6673B, 0X3FEED2FB} }, +/**/ {{0X2A6EBAC3, 0XBFC73251} }, +/**/ {{0X6924232F, 0XBFD0E28A} }, +/**/ {{0X73BCC03F, 0X3FC4B3B5} }, +/**/ {{0X8C72507F, 0X3FBA925E} } }, +/**/ {{{0XD2F20D5C, 0X3FC97FFF} }, +/**/ {{0X51AF5920, 0X3FC92BA3} }, +/**/ {{0X3D32449F, 0X3FEEC749} }, +/**/ {{0XC308255F, 0XBFC7971F} }, +/**/ {{0XD572D28F, 0XBFD0B8E2} }, +/**/ {{0X337448FE, 0X3FC4F51A} }, +/**/ {{0XCFCBC620, 0X3FB9C04B} } }, +/**/ {{{0XBF80F060, 0X3FCA0005} }, +/**/ {{0X6E9E8960, 0X3FC9A6AE} }, +/**/ {{0X1EF200E7, 0X3FEEBB64} }, +/**/ {{0X6E96E5C1, 0XBFC7FAFB} }, +/**/ {{0XEC6AD647, 0XBFD08EB6} }, +/**/ {{0XF53D0BA6, 0X3FC53475} }, +/**/ {{0X4433C20E, 0X3FB8ED36} } }, +/**/ {{{0XDEECA8E4, 0X3FCA7FF7} }, +/**/ {{0X948578E0, 0X3FCA2176} }, +/**/ {{0X328FF98B, 0X3FEEAF4F} }, +/**/ {{0X58149B1C, 0XBFC85DC9} }, +/**/ {{0XF933A1AB, 0XBFD06414} }, +/**/ {{0X60C45A8F, 0X3FC571B7} }, +/**/ {{0XBE58C308, 0X3FB81941} } }, +/**/ {{{0X7DEFD553, 0X3FCAFFFF} }, +/**/ {{0X9EBA6B80, 0X3FCA9C22} }, +/**/ {{0X10A85E10, 0X3FEEA307} }, +/**/ {{0X7F9DEA61, 0XBFC8BFA6} }, +/**/ {{0X5A474E8F, 0XBFD038F3} }, +/**/ {{0X30C225D2, 0X3FC5ACF0} }, +/**/ {{0XD062812F, 0X3FB74491} } }, +/**/ {{{0X669932A5, 0X3FCB7FFE} }, +/**/ {{0XCFF6DFE0, 0X3FCB1694} }, +/**/ {{0X1921D387, 0X3FEE968F} }, +/**/ {{0XE075D95A, 0XBFC92078} }, +/**/ {{0X526793C4, 0XBFD00D60} }, +/**/ {{0X73842A52, 0X3FC5E610} }, +/**/ {{0XC5331D5A, 0X3FB66F49} } }, +/**/ {{{0XB44759F3, 0X3FCBFFF9} }, +/**/ {{0X5073A2A0, 0X3FCB90D1} }, +/**/ {{0X56598313, 0X3FEE89E7} }, +/**/ {{0XCFB9203D, 0XBFC98041} }, +/**/ {{0XBED91B37, 0XBFCFC2BC} }, +/**/ {{0X6D4FC2FC, 0X3FC61D19} }, +/**/ {{0X9411537E, 0X3FB5998C} } }, +/**/ {{{0X5568F3EC, 0X3FCC8007} }, +/**/ {{0X4A31DBE0, 0X3FCC0AEC} }, +/**/ {{0X18F270A8, 0X3FEE7D0E} }, +/**/ {{0XF522B132, 0XBFC9DF0E} }, +/**/ {{0X2179C242, 0XBFCF69D4} }, +/**/ {{0X36646FCD, 0X3FC65213} }, +/**/ {{0XDC699095, 0X3FB4C37C} } }, +/**/ {{{0X601A799F, 0X3FCCFFF8} }, +/**/ {{0X49DB66A0, 0X3FCC84B8} }, +/**/ {{0XA0EE780E, 0X3FEE7008} }, +/**/ {{0X3A403934, 0XBFCA3CBB} }, +/**/ {{0XD490BE32, 0XBFCF102F} }, +/**/ {{0X037D4137, 0X3FC684EA} }, +/**/ {{0XD9EC855A, 0X3FB3ED3C} } }, +/**/ {{{0X7BBF1497, 0X3FCD7FF9} }, +/**/ {{0X1E008CE0, 0X3FCCFE5F} }, +/**/ {{0XF04615C7, 0X3FEE62D2} }, +/**/ {{0X15AADE2C, 0XBFCA9965} }, +/**/ {{0X0B44B682, 0XBFCEB5B9} }, +/**/ {{0X92EC8D57, 0X3FC6B5AF} }, +/**/ {{0X60D831AE, 0X3FB316EE} } }, +/**/ {{{0X40209B20, 0X3FCE0008} }, +/**/ {{0XB145A760, 0X3FCD77DD} }, +/**/ {{0XBE1DFDF1, 0X3FEE556D} }, +/**/ {{0X2186AF0F, 0XBFCAF508} }, +/**/ {{0X9420489D, 0XBFCE5A79} }, +/**/ {{0X454FEB2C, 0X3FC6E462} }, +/**/ {{0XD2945A8C, 0X3FB240B2} } }, +/**/ {{{0XC0AE943C, 0X3FCE8000} }, +/**/ {{0X3CA10100, 0X3FCDF111} }, +/**/ {{0X59E7308B, 0X3FEE47DD} }, +/**/ {{0X9439F69F, 0XBFCB4F88} }, +/**/ {{0X798DE600, 0XBFCDFE93} }, +/**/ {{0X8F267389, 0X3FC710F5} }, +/**/ {{0X1A8A373E, 0X3FB16AAB} } }, +/**/ {{{0X6D532803, 0X3FCF0003} }, +/**/ {{0XCB4E5C80, 0X3FCE6A17} }, +/**/ {{0XE3D0F6C2, 0X3FEE3A1E} }, +/**/ {{0X6E31F768, 0XBFCBA8FB} }, +/**/ {{0XE6A382E3, 0XBFCDA1F7} }, +/**/ {{0XB36AC4C0, 0X3FC73B75} }, +/**/ {{0XA3470B0A, 0X3FB094F7} } }, +/**/ {{{0X48B8AFC3, 0X3FCF7FFA} }, +/**/ {{0XE1654560, 0X3FCEE2DB} }, +/**/ {{0X43F2AB37, 0X3FEE2C35} }, +/**/ {{0X598207D6, 0XBFCC014F} }, +/**/ {{0X1EFE809A, 0XBFCD44BF} }, +/**/ {{0X698A561E, 0X3FC763DC} }, +/**/ {{0XA7CF78A3, 0X3FAF7F70} } }, +/**/ {{{0XEB334FAE, 0X3FD00002} }, +/**/ {{0X77AB25E0, 0X3FCF5B7B} }, +/**/ {{0X78A5C127, 0X3FEE1E1D} }, +/**/ {{0XC555D571, 0XBFCC5898} }, +/**/ {{0XB706CF86, 0XBFCCE6D9} }, +/**/ {{0X0823F643, 0X3FC78A35} }, +/**/ {{0X0B9118E8, 0X3FADD619} } }, +/**/ {{{0XA8AF86FE, 0X3FD03FFC} }, +/**/ {{0XB53A0C00, 0X3FCFD3CB} }, +/**/ {{0XFDCBAC8B, 0X3FEE0FDC} }, +/**/ {{0X6C3246FF, 0XBFCCAEB7} }, +/**/ {{0XD6E19AD3, 0XBFCC8870} }, +/**/ {{0XD2C48E91, 0X3FC7AE73} }, +/**/ {{0X0510FDB0, 0X3FAC2E26} } }, +/**/ {{{0XD38984B7, 0X3FD07FFC} }, +/**/ {{0X5732D4A0, 0X3FD025F7} }, +/**/ {{0X49C17AB3, 0X3FEE0170} }, +/**/ {{0X9AFE5028, 0XBFCD03C2} }, +/**/ {{0X9A2C1833, 0XBFCC2971} }, +/**/ {{0X69041DCF, 0X3FC7D0A5} }, +/**/ {{0XF497C653, 0X3FAA87D3} } }, +/**/ {{{0X1ED2ADD7, 0X3FD0BFFF} }, +/**/ {{0XCD7F7420, 0X3FD061ED} }, +/**/ {{0XDA96B750, 0X3FEDF2D8} }, +/**/ {{0XC777881E, 0XBFCD57B2} }, +/**/ {{0X8692B503, 0XBFCBC9EA} }, +/**/ {{0X42ABF9E7, 0X3FC7F0C9} }, +/**/ {{0X04B42BB4, 0X3FA8E35E} } }, +/**/ {{{0XA8515CDA, 0X3FD10003} }, +/**/ {{0X027416A0, 0X3FD09DC9} }, +/**/ {{0X34899950, 0X3FEDE417} }, +/**/ {{0X7983EDE4, 0XBFCDAA86} }, +/**/ {{0X999706B6, 0XBFCB69E3} }, +/**/ {{0XB0F126DB, 0X3FC80EE1} }, +/**/ {{0X17EE9BAB, 0X3FA740FE} } }, +/**/ {{{0XF3AF9CC5, 0X3FD14001} }, +/**/ {{0XB6E1ABA0, 0X3FD0D980} }, +/**/ {{0XE0412681, 0X3FEDD52D} }, +/**/ {{0X6863B28B, 0XBFCDFC31} }, +/**/ {{0XC55B8D5A, 0XBFCB0971} }, +/**/ {{0XA6731AAC, 0X3FC82AED} }, +/**/ {{0XC73BD8F0, 0X3FA5A0EC} } }, +/**/ {{{0XB6122509, 0X3FD18003} }, +/**/ {{0XAA1E67A0, 0X3FD1151D} }, +/**/ {{0X2E0C1F32, 0X3FEDC61B} }, +/**/ {{0XB9BA6B7E, 0XBFCE4CBE} }, +/**/ {{0X90C2431C, 0XBFCAA88E} }, +/**/ {{0X8BCBDA5E, 0X3FC844F4} }, +/**/ {{0X50E585FF, 0X3FA40361} } }, +/**/ {{{0XA6A2A153, 0X3FD1BFFF} }, +/**/ {{0XE7A18DC0, 0X3FD15096} }, +/**/ {{0XE1218F3F, 0X3FEDB6E1} }, +/**/ {{0X9621D6A2, 0XBFCE9C21} }, +/**/ {{0X22627B04, 0XBFCA4750} }, +/**/ {{0XFF8B908E, 0X3FC85CF5} }, +/**/ {{0X9833C0D6, 0X3FA26891} } }, +/**/ {{{0X2D345AAF, 0X3FD1FFFD} }, +/**/ {{0X053BF760, 0X3FD18BF3} }, +/**/ {{0XCC3ACB29, 0X3FEDA780} }, +/**/ {{0X2AA756AE, 0XBFCEEA62} }, +/**/ {{0X47ED9793, 0XBFC9E5B3} }, +/**/ {{0X87AB542A, 0X3FC872F8} }, +/**/ {{0X158E9E9A, 0X3FA0D0B2} } }, +/**/ {{{0XF14CF05A, 0X3FD23FFC} }, +/**/ {{0X4D568460, 0X3FD1C732} }, +/**/ {{0X55F32D3D, 0X3FED97F8} }, +/**/ {{0X21D457C8, 0XBFCF3780} }, +/**/ {{0XF065B845, 0XBFC983BE} }, +/**/ {{0XFBA70CD8, 0X3FC886FF} }, +/**/ {{0XAEB85CCC, 0X3F9E77EB} } }, +/**/ {{{0X0BAE6FC9, 0X3FD27FFE} }, +/**/ {{0X9A27C160, 0X3FD20253} }, +/**/ {{0X4619176E, 0X3FED8849} }, +/**/ {{0X5C0AC9EC, 0XBFCF8379} }, +/**/ {{0X5E645195, 0XBFC9217C} }, +/**/ {{0XF4264515, 0X3FC8990F} }, +/**/ {{0XE6B92E65, 0X3F9B551C} } }, +/**/ {{{0XA297A7DE, 0X3FD2C001} }, +/**/ {{0XACB927C0, 0X3FD23D57} }, +/**/ {{0XE4958FB6, 0X3FED7873} }, +/**/ {{0X43572249, 0XBFCFCE4E} }, +/**/ {{0X9F3560F3, 0XBFC8BEF1} }, +/**/ {{0XDF7F0E5B, 0X3FC8A92C} }, +/**/ {{0X116F3B19, 0X3F983958} } }, +/**/ {{{0X7267616A, 0X3FD2FFFE} }, +/**/ {{0XB2F378C0, 0X3FD27835} }, +/**/ {{0X13906586, 0X3FED687B} }, +/**/ {{0XAFDA1A0F, 0XBFD00BF9} }, +/**/ {{0XC197AD7D, 0XBFC85C34} }, +/**/ {{0X1E99F0A7, 0X3FC8B759} }, +/**/ {{0X6525C365, 0X3F9524FA} } }, +/**/ {{{0X48153B20, 0X3FD33FFE} }, +/**/ {{0X6A2FDCC0, 0X3FD2B2F6} }, +/**/ {{0XF827FBE4, 0X3FED585C} }, +/**/ {{0XB45A6918, 0XBFD03039} }, +/**/ {{0X5DFC3F72, 0XBFC7F93E} }, +/**/ {{0XC5210022, 0X3FC8C39B} }, +/**/ {{0X168FB62E, 0X3F92185E} } }, +/**/ {{{0X8122579A, 0X3FD38003} }, +/**/ {{0XAF6EC1E0, 0X3FD2ED9B} }, +/**/ {{0X872F20D3, 0X3FED4819} }, +/**/ {{0X1F4C1031, 0XBFD053E8} }, +/**/ {{0X621FFD79, 0XBFC79612} }, +/**/ {{0XDB9D9DFC, 0X3FC8CDF9} }, +/**/ {{0X80C6852F, 0X3F8E27B4} } }, +/**/ {{{0X3EF39141, 0X3FD3C003} }, +/**/ {{0X4668C700, 0X3FD3281B} }, +/**/ {{0X18590D1A, 0X3FED37B4} }, +/**/ {{0XA3EF2560, 0XBFD076FE} }, +/**/ {{0X3033287A, 0XBFC732C9} }, +/**/ {{0XCA2E5458, 0X3FC8D676} }, +/**/ {{0XD80944B1, 0X3F882F85} } }, +/**/ {{{0X63FA0E31, 0X3FD40001} }, +/**/ {{0X7B565000, 0X3FD36278} }, +/**/ {{0X47A813DA, 0X3FED272C} }, +/**/ {{0X493B9D88, 0XBFD0997F} }, +/**/ {{0X3DA9FE3C, 0XBFC6CF64} }, +/**/ {{0XC1CD3331, 0X3FC8DD18} }, +/**/ {{0XF70F6E07, 0X3F8248D1} } }, +/**/ {{{0X74071092, 0X3FD44003} }, +/**/ {{0X0F0A4000, 0X3FD39CB8} }, +/**/ {{0X3BA47A6B, 0X3FED1681} }, +/**/ {{0XD8788947, 0XBFD0BB6C} }, +/**/ {{0X589596A6, 0XBFC66BE2} }, +/**/ {{0XC9B3EC1E, 0X3FC8E1E5} }, +/**/ {{0XD20FAB86, 0X3F78E868} } }, +/**/ {{{0XC880F200, 0X3FD48000} }, +/**/ {{0XDEFFB460, 0X3FD3D6D1} }, +/**/ {{0XCADC576C, 0X3FED05B5} }, +/**/ {{0XA1D352C2, 0XBFD0DCC2} }, +/**/ {{0X3D7D2574, 0XBFC60858} }, +/**/ {{0X03208BC0, 0X3FC8E4E3} }, +/**/ {{0X6379E732, 0X3F6AC909} } }, +/**/ {{{0X4D97D2CB, 0X3FD4C000} }, +/**/ {{0XF3A2E220, 0X3FD410CB} }, +/**/ {{0XBB7ED511, 0X3FECF4C8} }, +/**/ {{0X37766A49, 0XBFD0FD84} }, +/**/ {{0X5AABC13C, 0XBFC5A4C2} }, +/**/ {{0XC80DAC4B, 0X3FC8E616} }, +/**/ {{0XB04695C2, 0X3F4038AA} } }, +/**/ {{{0X9397539F, 0X3FD4FFFD} }, +/**/ {{0X06A7DEC0, 0X3FD44AA2} }, +/**/ {{0XCF479DDE, 0X3FECE3BB} }, +/**/ {{0X4D122984, 0XBFD11DAF} }, +/**/ {{0XB1024DF0, 0XBFC5412E} }, +/**/ {{0X1B2C560D, 0X3FC8E587} }, +/**/ {{0X951C088D, 0XBF625DA8} } }, +/**/ {{{0XF304715F, 0X3FD53FFF} }, +/**/ {{0X791F3900, 0X3FD4845A} }, +/**/ {{0XA45E0FD8, 0X3FECD28D} }, +/**/ {{0X8D61F221, 0XBFD13D47} }, +/**/ {{0XD3E9BB99, 0XBFC4DD98} }, +/**/ {{0X0F181507, 0X3FC8E33A} }, +/**/ {{0XD08BD25C, 0XBF743C33} } }, +/**/ {{{0XE88EA386, 0X3FD58002} }, +/**/ {{0XF575D6C0, 0X3FD4BDF0} }, +/**/ {{0X02035609, 0X3FECC140} }, +/**/ {{0XB808071E, 0XBFD15C4A} }, +/**/ {{0XB2945FCF, 0XBFC47A0E} }, +/**/ {{0XFC056447, 0X3FC8DF35} }, +/**/ {{0XB00A45CD, 0XBF7F2011} } }, +/**/ {{{0X70F4D590, 0X3FD5BFFD} }, +/**/ {{0X284D7AE0, 0X3FD4F75D} }, +/**/ {{0XF2DE98B6, 0X3FECAFD5} }, +/**/ {{0XA2B42F42, 0XBFD17AB4} }, +/**/ {{0X1C285A92, 0XBFC416A5} }, +/**/ {{0X511D6C5A, 0X3FC8D982} }, +/**/ {{0X77008605, 0XBF84ECC1} } }, +/**/ {{{0XB70D6E53, 0X3FD5FFFD} }, +/**/ {{0X8E2FF500, 0X3FD530AB} }, +/**/ {{0X32D2429D, 0X3FEC9E4C} }, +/**/ {{0X35190681, 0XBFD1988C} }, +/**/ {{0XBF748319, 0XBFC3B34C} }, +/**/ {{0X98D3A613, 0X3FC8D224} }, +/**/ {{0XAA295F9F, 0XBF8A33D4} } }, +/**/ {{{0X5C7399E2, 0X3FD63FFC} }, +/**/ {{0X4F022E80, 0X3FD569D5} }, +/**/ {{0X58DD180F, 0X3FEC8CA5} }, +/**/ {{0X1D701DE4, 0XBFD1B5CE} }, +/**/ {{0XA7806A5A, 0XBFC35017} }, +/**/ {{0X56C01CF9, 0X3FC8C924} }, +/**/ {{0X942059E1, 0XBF8F64D9} } }, +/**/ {{{0X9A1AC7D2, 0X3FD67FFD} }, +/**/ {{0XF50031E0, 0X3FD5A2DD} }, +/**/ {{0XCEFF6DEB, 0X3FEC7AE0} }, +/**/ {{0X7C8C245B, 0XBFD1D27C} }, +/**/ {{0XC6AA933F, 0XBFC2ED05} }, +/**/ {{0XDDC5CF1F, 0X3FC8BE87} }, +/**/ {{0XD594386F, 0XBF923FB6} } }, +/**/ {{{0X6F7B9353, 0X3FD6BFFD} }, +/**/ {{0XB4E066C0, 0X3FD5DBC1} }, +/**/ {{0X456B591A, 0X3FEC6900} }, +/**/ {{0XC2D6D0AA, 0XBFD1EE95} }, +/**/ {{0XB11086F7, 0XBFC28A23} }, +/**/ {{0XDDE22D5A, 0X3FC8B256} }, +/**/ {{0X489D85A4, 0XBF94C19A} } }, +/**/ {{{0XF02A83E4, 0X3FD6FFFB} }, +/**/ {{0X6A237DC0, 0X3FD61480} }, +/**/ {{0X4CC81773, 0X3FEC5704} }, +/**/ {{0X4B9029CA, 0XBFD20A1A} }, +/**/ {{0X89F5FB1C, 0XBFC22777} }, +/**/ {{0X9B09E911, 0X3FC8A498} }, +/**/ {{0X130D419A, 0XBF9737EC} } }, +/**/ {{{0X128C213A, 0X3FD73FFE} }, +/**/ {{0X42499480, 0X3FD64D1E} }, +/**/ {{0X129C0D30, 0X3FEC44EC} }, +/**/ {{0X83787259, 0XBFD2250C} }, +/**/ {{0XD55BE4FC, 0XBFC1C4FF} }, +/**/ {{0X36B2D603, 0X3FC89553} }, +/**/ {{0X2E43DF46, 0XBF99A284} } }, +/**/ {{{0XEA0CDC7A, 0X3FD77FFB} }, +/**/ {{0X05B0E220, 0X3FD68594} }, +/**/ {{0X687132C0, 0X3FEC32BA} }, +/**/ {{0X7273497E, 0XBFD23F69} }, +/**/ {{0XCD39B037, 0XBFC162CE} }, +/**/ {{0XFA930AAF, 0X3FC8848F} }, +/**/ {{0XA4554412, 0XBF9C013D} } }, +/**/ {{{0XF18EDAB8, 0X3FD7C003} }, +/**/ {{0X4127BEE0, 0X3FD6BDEE} }, +/**/ {{0XC01607BD, 0X3FEC206B} }, +/**/ {{0X5FEE2F42, 0XBFD25937} }, +/**/ {{0X307761E1, 0XBFC100D4} }, +/**/ {{0X5DFEC556, 0X3FC87252} }, +/**/ {{0X7958F973, 0XBF9E53F6} } }, +/**/ {{{0X41F35C4C, 0X3FD7FFFD} }, +/**/ {{0XDA6607A0, 0X3FD6F616} }, +/**/ {{0XCDDC8437, 0X3FEC0E07} }, +/**/ {{0XBFB4DAEA, 0XBFD2726C} }, +/**/ {{0XE0DB1472, 0XBFC09F3B} }, +/**/ {{0X2A95AA1B, 0X3FC85EA9} }, +/**/ {{0XD872CFA2, 0XBFA04D47} } }, +/**/ {{{0X26C7C46B, 0X3FD84003} }, +/**/ {{0X96B8BE00, 0X3FD72E25} }, +/**/ {{0X4CDEDF38, 0X3FEBFB87} }, +/**/ {{0XD09404F3, 0XBFD28B14} }, +/**/ {{0XE7FB61F2, 0XBFC03DE1} }, +/**/ {{0XACB33BE9, 0X3FC84993} }, +/**/ {{0X9B1DE607, 0XBFA16A76} } }, +/**/ {{{0XCA90B179, 0X3FD88003} }, +/**/ {{0XA104A220, 0X3FD7660A} }, +/**/ {{0XF236E2F6, 0X3FEBE8EF} }, +/**/ {{0X19A94DDF, 0XBFD2A329} }, +/**/ {{0X0856A081, 0XBFBFB9CE} }, +/**/ {{0X33F70280, 0X3FC8331F} }, +/**/ {{0XF01308CC, 0XBFA2817A} } }, +/**/ {{{0XE9692FD5, 0X3FD8C003} }, +/**/ {{0XF0B2CB00, 0X3FD79DC9} }, +/**/ {{0XF2966495, 0X3FEBD640} }, +/**/ {{0XFD6EC2EA, 0XBFD2BAAB} }, +/**/ {{0XE08E9C2D, 0XBFBEF892} }, +/**/ {{0X031873E3, 0X3FC81B52} }, +/**/ {{0XAC12113D, 0XBFA39249} } }, +/**/ {{{0X35BE5C5F, 0X3FD8FFFE} }, +/**/ {{0XBDCCDFC0, 0X3FD7D55E} }, +/**/ {{0X6EABCF77, 0X3FEBC37C} }, +/**/ {{0X2D74F445, 0XBFD2D19C} }, +/**/ {{0XE63F2CDB, 0XBFBE382C} }, +/**/ {{0X0E6FE2AE, 0X3FC80236} }, +/**/ {{0X0E66AB41, 0XBFA49CD9} } }, +/**/ {{{0XAA8974CD, 0X3FD94002} }, +/**/ {{0XB8AFD880, 0X3FD80CD6} }, +/**/ {{0X4468CCBA, 0X3FEBB09E} }, +/**/ {{0XEC84E686, 0XBFD2E7FF} }, +/**/ {{0X88C659E8, 0XBFBD7876} }, +/**/ {{0XC2F15460, 0X3FC7E7CC} }, +/**/ {{0XB410D3ED, 0XBFA5A120} } }, +/**/ {{{0XE08EFDEA, 0X3FD98002} }, +/**/ {{0X34856920, 0X3FD84425} }, +/**/ {{0X3F290478, 0X3FEB9DAB} }, +/**/ {{0XBB81EDEF, 0XBFD2FDD2} }, +/**/ {{0X31E68398, 0XBFBCB9A5} }, +/**/ {{0XC2DBB11B, 0X3FC7CC23} }, +/**/ {{0X98467E78, 0XBFA69F19} } }, +/**/ {{{0X75294B6B, 0X3FD9C002} }, +/**/ {{0X299F6200, 0X3FD87B4D} }, +/**/ {{0XDE96CF1F, 0X3FEB8AA2} }, +/**/ {{0X8C4D45D2, 0XBFD31316} }, +/**/ {{0XEDCE4DBA, 0XBFBBFBB7} }, +/**/ {{0X8907FEC9, 0X3FC7AF41} }, +/**/ {{0X07419F55, 0XBFA796BE} } }, +/**/ {{{0XF3E490EC, 0X3FDA0002} }, +/**/ {{0XC21A4500, 0X3FD8B24F} }, +/**/ {{0X3B5EF7DD, 0X3FEB7785} }, +/**/ {{0X8EAE70CD, 0XBFD327CC} }, +/**/ {{0XD49E40DA, 0XBFBB3EB3} }, +/**/ {{0X4D93F7EA, 0X3FC7912D} }, +/**/ {{0X9E21606A, 0XBFA88809} } }, +/**/ {{{0X458461B6, 0X3FDA3FFF} }, +/**/ {{0X7754D2C0, 0X3FD8E928} }, +/**/ {{0X6A0DAF0E, 0X3FEB6454} }, +/**/ {{0XDC2A9A3F, 0XBFD33BF3} }, +/**/ {{0X4917D003, 0XBFBA82B1} }, +/**/ {{0X7C7566CF, 0X3FC771F1} }, +/**/ {{0X3D700DD8, 0XBFA972F9} } }, +/**/ {{{0X87E12AAE, 0X3FDA8002} }, +/**/ {{0XA5DFD000, 0X3FD91FE0} }, +/**/ {{0XA0D82E05, 0X3FEB510D} }, +/**/ {{0XA76AD312, 0XBFD34F90} }, +/**/ {{0XDEEC35AD, 0XBFB9C798} }, +/**/ {{0X8A0EF43E, 0X3FC75190} }, +/**/ {{0X0872EFC8, 0XBFAA578B} } }, +/**/ {{{0X49A86C84, 0X3FDAC001} }, +/**/ {{0X5C4516E0, 0X3FD9566E} }, +/**/ {{0XDD03F6B6, 0X3FEB3DB4} }, +/**/ {{0X291C1F82, 0XBFD362A0} }, +/**/ {{0X03F6DF60, 0XBFB90D95} }, +/**/ {{0X25091E92, 0X3FC73018} }, +/**/ {{0X577A022B, 0XBFAB35BE} } }, +/**/ {{{0X2F4CC2E1, 0X3FDAFFFF} }, +/**/ {{0X94226540, 0X3FD98CD4} }, +/**/ {{0X9297200A, 0X3FEB2A49} }, +/**/ {{0X5153FD01, 0XBFD37524} }, +/**/ {{0XAE3DE27E, 0XBFB854A3} }, +/**/ {{0X7EB3F331, 0X3FC70D8E} }, +/**/ {{0XB6AD570E, 0XBFAC0D93} } }, +/**/ {{{0XC2F3711E, 0X3FDB4000} }, +/**/ {{0X01CDC4C0, 0X3FD9C317} }, +/**/ {{0XEA63781B, 0X3FEB16CA} }, +/**/ {{0X3665B649, 0XBFD3871F} }, +/**/ {{0X3F70FBC6, 0XBFB79CC0} }, +/**/ {{0X061DFC2E, 0X3FC6E9F9} }, +/**/ {{0XD837F9C3, 0XBFACDF0C} } }, +/**/ {{{0XA777E180, 0X3FDB8000} }, +/**/ {{0XF3748F20, 0X3FD9F930} }, +/**/ {{0X0FB0162A, 0X3FEB033B} }, +/**/ {{0X25978CAB, 0XBFD39890} }, +/**/ {{0X5C765AAB, 0XBFB6E602} }, +/**/ {{0X9C16D678, 0X3FC6C562} }, +/**/ {{0X92A16EBF, 0XBFADAA2C} } }, +/**/ {{{0X087E14ED, 0X3FDBBFFD} }, +/**/ {{0XBF0DDB00, 0X3FDA2F20} }, +/**/ {{0X1CCE6E94, 0X3FEAEF9B} }, +/**/ {{0X8B73E3C3, 0XBFD3A977} }, +/**/ {{0X09EFD1CC, 0XBFB63077} }, +/**/ {{0X58408D3A, 0X3FC69FD4} }, +/**/ {{0XD2E48013, 0XBFAE6EF6} } }, +/**/ {{{0XF0086783, 0X3FDC0000} }, +/**/ {{0X8D448080, 0X3FDA64EF} }, +/**/ {{0X35990B5A, 0X3FEADBE8} }, +/**/ {{0X27241B86, 0XBFD3B9D9} }, +/**/ {{0XC20E4001, 0XBFB57C06} }, +/**/ {{0X90E6C8AB, 0X3FC6794F} }, +/**/ {{0X9A630A27, 0XBFAF2D70} } }, +/**/ {{{0X863E58F8, 0X3FDC4001} }, +/**/ {{0X1C3A1BA0, 0X3FDA9A94} }, +/**/ {{0X35ED7DD2, 0X3FEAC826} }, +/**/ {{0X0C075B50, 0XBFD3C9B3} }, +/**/ {{0XA429793C, 0XBFB4C8D7} }, +/**/ {{0X95903C22, 0X3FC651E2} }, +/**/ {{0XF0F8B649, 0XBFAFE59F} } }, +/**/ {{{0X6C62C3BF, 0X3FDC7FFC} }, +/**/ {{0X580A5840, 0X3FDAD00C} }, +/**/ {{0X62D1D808, 0X3FEAB456} }, +/**/ {{0XACBB06EC, 0XBFD3D905} }, +/**/ {{0X421E42DC, 0XBFB416F7} }, +/**/ {{0XE5608EFD, 0X3FC62996} }, +/**/ {{0XF14B649A, 0XBFB04BC5} } }, +/**/ {{{0X34B2A209, 0X3FDCC002} }, +/**/ {{0XF68F3B40, 0X3FDB0565} }, +/**/ {{0X1E3DC946, 0X3FEAA074} }, +/**/ {{0XE2DB674E, 0XBFD3E7D5} }, +/**/ {{0XA4833FFE, 0XBFB3663E} }, +/**/ {{0XC4F0392B, 0X3FC60069} }, +/**/ {{0X38B10201, 0XBFB0A19E} } }, +/**/ {{{0XAAC5F9F9, 0X3FDCFFFC} }, +/**/ {{0X59C45CC0, 0X3FDB3A8E} }, +/**/ {{0XD2389C24, 0X3FEA8C86} }, +/**/ {{0X8362B2CB, 0XBFD3F61F} }, +/**/ {{0XC6C746A6, 0XBFB2B6F1} }, +/**/ {{0X426D2946, 0X3FC5D671} }, +/**/ {{0X4981CE75, 0XBFB0F45D} } }, +/**/ {{{0X0D800C64, 0X3FDD4004} }, +/**/ {{0X88AF6580, 0X3FDB6F99} }, +/**/ {{0X7498CED2, 0X3FEA7887} }, +/**/ {{0XEF8975C0, 0XBFD403E8} }, +/**/ {{0XBEA81E2B, 0XBFB208D4} }, +/**/ {{0X283FFA4E, 0X3FC5ABA5} }, +/**/ {{0X11705130, 0XBFB14408} } }, +/**/ {{{0XB0E64500, 0X3FDD7FFE} }, +/**/ {{0X2324E140, 0X3FDBA472} }, +/**/ {{0X8C5AD680, 0X3FEA647E} }, +/**/ {{0XA03F042D, 0XBFD4112D} }, +/**/ {{0X9580389C, 0XBFB15C33} }, +/**/ {{0X49D9889E, 0X3FC5801E} }, +/**/ {{0XEF96554F, 0XBFB190A3} } }, +/**/ {{{0X2DFCF4EB, 0X3FDDBFFE} }, +/**/ {{0X9F1D27A0, 0X3FDBD926} }, +/**/ {{0X1AC286CA, 0X3FEA5067} }, +/**/ {{0X590A4DE1, 0XBFD41DF2} }, +/**/ {{0X8BD1EFA5, 0XBFB0B0E4} }, +/**/ {{0X702506D0, 0X3FC553D8} }, +/**/ {{0XADA415A6, 0XBFB1DA36} } }, +/**/ {{{0X8A34BBC2, 0X3FDDFFFD} }, +/**/ {{0XC4F7A2C0, 0X3FDC0DB2} }, +/**/ {{0X2EF70BB3, 0X3FEA3C43} }, +/**/ {{0X16EE647C, 0XBFD42A37} }, +/**/ {{0XDB6270BB, 0XBFB006FA} }, +/**/ {{0X86F08DE6, 0X3FC526DE} }, +/**/ {{0X7E5061FB, 0XBFB220C6} } }, +/**/ {{{0XD26415C0, 0X3FDE3FFD} }, +/**/ {{0X58282940, 0X3FDC4217} }, +/**/ {{0XF391DDCB, 0X3FEA2812} }, +/**/ {{0X18EDDF0A, 0XBFD435FD} }, +/**/ {{0X88A589AF, 0XBFAEBCF2} }, +/**/ {{0X4CF96163, 0X3FC4F937} }, +/**/ {{0XF6A18481, 0XBFB26459} } }, +/**/ {{{0X37F72672, 0X3FDE7FFF} }, +/**/ {{0X67AA3DC0, 0X3FDC7654} }, +/**/ {{0XD6CE86B3, 0X3FEA13D6} }, +/**/ {{0X74037E91, 0XBFD44145} }, +/**/ {{0X3B2CC445, 0XBFAD6EC9} }, +/**/ {{0X0564F101, 0X3FC4CAEA} }, +/**/ {{0X0C49CD64, 0XBFB2A4F8} } }, +/**/ {{{0XA11BC00F, 0X3FDEBFFD} }, +/**/ {{0X85E23660, 0X3FDCAA66} }, +/**/ {{0XA25C2396, 0X3FE9FF90} }, +/**/ {{0X8A64724F, 0XBFD44C10} }, +/**/ {{0X2F871E82, 0XBFAC2399} }, +/**/ {{0X0AFBFB85, 0X3FC49C01} }, +/**/ {{0X0F0FF3FE, 0XBFB2E2A8} } }, +/**/ {{{0X3313756D, 0X3FDEFFFF} }, +/**/ {{0X9D30CC20, 0X3FDCDE52} }, +/**/ {{0XDFF9491F, 0X3FE9EB3E} }, +/**/ {{0X7E6ABAAE, 0XBFD45660} }, +/**/ {{0X3E8AA98D, 0XBFAADB4C} }, +/**/ {{0X25D8FF7D, 0X3FC46C7F} }, +/**/ {{0XA71D448D, 0XBFB31D71} } }, +/**/ {{{0X914B856E, 0X3FDF4001} }, +/**/ {{0XAAC1BB20, 0X3FDD1216} }, +/**/ {{0XC9BC4315, 0X3FE9D6E2} }, +/**/ {{0X004E7E91, 0XBFD46036} }, +/**/ {{0XFB901F89, 0XBFA995F7} }, +/**/ {{0X3F5BE04A, 0X3FC43C6D} }, +/**/ {{0XCE8ABF92, 0XBFB3555C} } }, +/**/ {{{0XCD144428, 0X3FDF8003} }, +/**/ {{0XD93E9640, 0X3FDD45B1} }, +/**/ {{0X256FDFEB, 0X3FE9C27D} }, +/**/ {{0X09F7C145, 0XBFD46992} }, +/**/ {{0XED521174, 0XBFA853A9} }, +/**/ {{0X2B27751F, 0X3FC40BD3} }, +/**/ {{0XCFA5C5F2, 0XBFB38A71} } }, +/**/ {{{0X00545BD9, 0X3FDFC002} }, +/**/ {{0XF536D960, 0X3FDD7920} }, +/**/ {{0XAAE99EA5, 0X3FE9AE0F} }, +/**/ {{0X38DD66F4, 0XBFD47275} }, +/**/ {{0XB5484F74, 0XBFA7147D} }, +/**/ {{0XF8EFC373, 0X3FC3DABA} }, +/**/ {{0X3EA6B864, 0XBFB3BCB9} } }, +/**/ {{{0XDA6F2AA8, 0X3FDFFFFB} }, +/**/ {{0XB420FAA0, 0X3FDDAC63} }, +/**/ {{0XED4D0CAB, 0X3FE9999A} }, +/**/ {{0XBFCC6072, 0XBFD47AE0} }, +/**/ {{0X25BF7A4A, 0XBFA5D87C} }, +/**/ {{0XF5999EE5, 0X3FC3A92B} }, +/**/ {{0XF7F09D08, 0XBFB3EC3B} } }, +/**/ {{{0XA65118C8, 0X3FE01FFF} }, +/**/ {{0X2BF70C00, 0X3FDDDF85} }, +/**/ {{0XECD72AE5, 0X3FE9851A} }, +/**/ {{0X8F5794C5, 0XBFD482D7} }, +/**/ {{0X2E4A020B, 0XBFA49F68} }, +/**/ {{0X25A156DA, 0X3FC37722} }, +/**/ {{0X19F58064, 0XBFB41903} } }, +/**/ {{{0X9C0B0556, 0X3FE04001} }, +/**/ {{0XFA2BA200, 0X3FDE127D} }, +/**/ {{0X08C17A55, 0X3FE97093} }, +/**/ {{0X957A7EFD, 0XBFD48A59} }, +/**/ {{0X2648F2BB, 0XBFA36976} }, +/**/ {{0X592569B1, 0X3FC344AB} }, +/**/ {{0X03752DDB, 0XBFB44318} } }, +/**/ {{{0XC24501DB, 0X3FE05FFF} }, +/**/ {{0XA495BCC0, 0X3FDE4547} }, +/**/ {{0X4F225B79, 0X3FE95C06} }, +/**/ {{0X2163F5B8, 0XBFD49167} }, +/**/ {{0X4B79B89F, 0XBFA236D3} }, +/**/ {{0XB530B7BE, 0X3FC311D4} }, +/**/ {{0X4D931476, 0XBFB46A84} } }, +/**/ {{{0X865125FC, 0X3FE07FFE} }, +/**/ {{0X2A5FAD60, 0X3FDE77E9} }, +/**/ {{0X5C13B0EA, 0X3FE94772} }, +/**/ {{0X6F33ABCA, 0XBFD49802} }, +/**/ {{0XDE947C6B, 0XBFA1075A} }, +/**/ {{0XD8D5E01B, 0X3FC2DE9D} }, +/**/ {{0XCA17CA60, 0XBFB48F51} } }, +/**/ {{{0X107EAC25, 0X3FE0A002} }, +/**/ {{0X08243180, 0X3FDEAA69} }, +/**/ {{0XF339824B, 0X3FE932D4} }, +/**/ {{0X7145F475, 0XBFD49E2D} }, +/**/ {{0X00571424, 0XBF9FB5D8} }, +/**/ {{0X85D1CF84, 0X3FC2AB06} }, +/**/ {{0X7DBBBABE, 0XBFB4B18A} } }, +/**/ {{{0X7376E5D4, 0X3FE0BFFF} }, +/**/ {{0XF79FF560, 0X3FDEDCB5} }, +/**/ {{0X8EE1B492, 0X3FE91E35} }, +/**/ {{0X49498453, 0XBFD4A3E7} }, +/**/ {{0XBE685C6F, 0XBF9D63E4} }, +/**/ {{0XC4B1F032, 0X3FC27726} }, +/**/ {{0X9E6ECC3A, 0XBFB4D138} } }, +/**/ {{{0X1715EE2E, 0X3FE0DFFE} }, +/**/ {{0X9BE1BB80, 0X3FDF0EDB} }, +/**/ {{0XD993BD60, 0X3FE9098F} }, +/**/ {{0X9B84E907, 0XBFD4A932} }, +/**/ {{0XE07DBA5E, 0XBF9B185A} }, +/**/ {{0XF2D7A804, 0X3FC242F8} }, +/**/ {{0X8DDAA340, 0XBFB4EE66} } }, +/**/ {{{0X7F3D776C, 0X3FE10001} }, +/**/ {{0X6119E100, 0X3FDF40DF} }, +/**/ {{0XFB44BCFB, 0X3FE8F4E1} }, +/**/ {{0X16E3467E, 0XBFD4AE11} }, +/**/ {{0XCF368422, 0XBF98D304} }, +/**/ {{0X736708AE, 0X3FC20E7D} }, +/**/ {{0XD7B3658D, 0XBFB5091E} } }, +/**/ {{{0XFD8C7B65, 0X3FE11FFE} }, +/**/ {{0X8FD21560, 0X3FDF72B0} }, +/**/ {{0X4770FB0A, 0X3FE8E033} }, +/**/ {{0X5C0F6783, 0XBFD4B282} }, +/**/ {{0X7FFE0364, 0XBF9694AC} }, +/**/ {{0XE529BF4C, 0X3FC1D9CB} }, +/**/ {{0X2C73E5F0, 0XBFB5216C} } }, +/**/ {{{0XAFA3EE71, 0X3FE14000} }, +/**/ {{0XE3324D60, 0X3FDFA45E} }, +/**/ {{0X9FF684DF, 0X3FE8CB7D} }, +/**/ {{0X17ADD34D, 0XBFD4B689} }, +/**/ {{0X67276E70, 0XBF945CA3} }, +/**/ {{0XA1FBF3B1, 0X3FC1A4D9} }, +/**/ {{0X5FBA2374, 0XBFB53759} } }, +/**/ {{{0X73336187, 0X3FE15FFF} }, +/**/ {{0X3DE48D00, 0X3FDFD5DF} }, +/**/ {{0X0CBE3546, 0X3FE8B6C6} }, +/**/ {{0X9B291BCB, 0XBFD4BA25} }, +/**/ {{0X5FB712CC, 0XBF922B6F} }, +/**/ {{0X55E28B0B, 0X3FC16FB8} }, +/**/ {{0X633F423C, 0XBFB54AF1} } }, +/**/ {{{0X6C447B82, 0X3FE17FFF} }, +/**/ {{0X0208ECC0, 0X3FE0039C} }, +/**/ {{0X48F15926, 0X3FE8A20A} }, +/**/ {{0XA5808AC3, 0XBFD4BD59} }, +/**/ {{0X5EEF6F2A, 0XBF9000CD} }, +/**/ {{0XEBE54AA7, 0X3FC13A66} }, +/**/ {{0X45420CE4, 0XBFB55C3F} } }, +/**/ {{{0XAE932B61, 0X3FE19FFF} }, +/**/ {{0XE0091BC0, 0X3FE01C33} }, +/**/ {{0X55664E00, 0X3FE88D4B} }, +/**/ {{0X579F5ABB, 0XBFD4C026} }, +/**/ {{0X8797C32A, 0XBF8BB9A6} }, +/**/ {{0X95D4F64E, 0X3FC104EC} }, +/**/ {{0X2BBC325E, 0XBFB56B4E} } }, +/**/ {{{0XBA12AE50, 0X3FE1BFFF} }, +/**/ {{0XD3ABA020, 0X3FE034B6} }, +/**/ {{0XEBDCCF04, 0X3FE87889} }, +/**/ {{0XE6D463C1, 0XBFD4C28C} }, +/**/ {{0XB36211FC, 0XBF877F1C} }, +/**/ {{0XB90B11E7, 0X3FC0CF4F} }, +/**/ {{0X52DCBE1A, 0XBFB57829} } }, +/**/ {{{0X4B459E41, 0X3FE1E001} }, +/**/ {{0X2DC05800, 0X3FE04D26} }, +/**/ {{0X51625B6A, 0X3FE863C5} }, +/**/ {{0XAFFDD399, 0XBFD4C48E} }, +/**/ {{0X603059CA, 0XBF8351CB} }, +/**/ {{0XDE65D0D9, 0X3FC09992} }, +/**/ {{0X087BB367, 0XBFB582DC} } }, +/**/ {{{0X32306F33, 0X3FE20000} }, +/**/ {{0XBAFB6CE0, 0X3FE0657E} }, +/**/ {{0XA1E2EEC3, 0X3FE84F00} }, +/**/ {{0XB79EC8C6, 0XBFD4C62C} }, +/**/ {{0XD95DE8D1, 0XBF7E6488} }, +/**/ {{0X661DF241, 0X3FC063C2} }, +/**/ {{0XAAA63BAD, 0XBFB58B71} } }, +/**/ {{{0XD30A486C, 0X3FE22000} }, +/**/ {{0XD2165080, 0X3FE07DC3} }, +/**/ {{0X66B3E5BF, 0X3FE83A39} }, +/**/ {{0X7DE04DEE, 0XBFD4C768} }, +/**/ {{0X800F052F, 0XBF763FF7} }, +/**/ {{0X28F35EDD, 0X3FC02DDC} }, +/**/ {{0XA351CF91, 0XBFB591F5} } }, +/**/ {{{0X215E03FC, 0X3FE23FFE} }, +/**/ {{0X9F380A00, 0X3FE095F1} }, +/**/ {{0X48BE5F3F, 0X3FE82573} }, +/**/ {{0X1B793F77, 0XBFD4C843} }, +/**/ {{0X625993B8, 0XBF6C6E63} }, +/**/ {{0X8C5E4B3B, 0X3FBFEFDB} }, +/**/ {{0X66FE9CA7, 0XBFB59673} } }, +/**/ {{{0X6833D65D, 0X3FE26000} }, +/**/ {{0X6496A8C0, 0X3FE0AE0E} }, +/**/ {{0X45B44AA3, 0X3FE810A9} }, +/**/ {{0X055B407A, 0XBFD4C8BE} }, +/**/ {{0XAE83F0A4, 0XBF5920A7} }, +/**/ {{0X860A6A5E, 0X3FBF83DC} }, +/**/ {{0X70D98EE7, 0XBFB598F6} } }, +/**/ {{{0XE82D4D50, 0X3FE28000} }, +/**/ {{0X095F5300, 0X3FE0C615} }, +/**/ {{0X1E9337B7, 0X3FE7FBE0} }, +/**/ {{0X573C6F6A, 0XBFD4C8DA} }, +/**/ {{0XC50F565D, 0X3F38B6C7} }, +/**/ {{0XC9C4B6CA, 0X3FBF17DB} }, +/**/ {{0X45D6DAE0, 0XBFB5998A} } }, +/**/ {{{0X203B6A0B, 0X3FE29FFF} }, +/**/ {{0X30852720, 0X3FE0DE05} }, +/**/ {{0X8520538D, 0X3FE7E718} }, +/**/ {{0X668C6963, 0XBFD4C899} }, +/**/ {{0XBECA8AB0, 0X3F6286EC} }, +/**/ {{0X9B6AC5BD, 0X3FBEABE4} }, +/**/ {{0X575A9684, 0XBFB5983A} } }, +/**/ {{{0XE91A9D93, 0X3FE2C001} }, +/**/ {{0XF7817A20, 0X3FE0F5E3} }, +/**/ {{0X63A45D97, 0X3FE7D24E} }, +/**/ {{0X5F83C46D, 0XBFD4C7FC} }, +/**/ {{0X5D9C800A, 0X3F70E199} }, +/**/ {{0X3721A8E0, 0X3FBE3FE9} }, +/**/ {{0X377DA840, 0XBFB59512} } }, +/**/ {{{0XC6FB4948, 0X3FE2DFFF} }, +/**/ {{0X4CE36040, 0X3FE10DAA} }, +/**/ {{0X3E39011F, 0X3FE7BD88} }, +/**/ {{0XB5EAE11F, 0XBFD4C704} }, +/**/ {{0X192C622B, 0X3F786398} }, +/**/ {{0XB62BA357, 0X3FBDD412} }, +/**/ {{0X5F0E020E, 0XBFB5901D} } }, +/**/ {{{0X39CB4EED, 0X3FE2FFFF} }, +/**/ {{0X0970AD60, 0X3FE1255D} }, +/**/ {{0X365B7A9B, 0X3FE7A8C2} }, +/**/ {{0X8925F532, 0XBFD4C5B3} }, +/**/ {{0X785E3070, 0X3F7FCB03} }, +/**/ {{0X0EEDF3B3, 0X3FBD6854} }, +/**/ {{0X479C252A, 0XBFB58967} } }, +/**/ {{{0X002E31CB, 0X3FE31FFE} }, +/**/ {{0X81FD3780, 0X3FE13CFA} }, +/**/ {{0X1BBE9667, 0X3FE793FE} }, +/**/ {{0X3046F4C7, 0XBFD4C40A} }, +/**/ {{0X8F5E6BF1, 0X3F838BAE} }, +/**/ {{0X83775C98, 0X3FBCFCBD} }, +/**/ {{0X62E887AB, 0XBFB580FB} } }, +/**/ {{{0XEDC7BFFD, 0X3FE34000} }, +/**/ {{0X44D05200, 0X3FE15486} }, +/**/ {{0X244A1DA5, 0X3FE77F39} }, +/**/ {{0X9FB764C1, 0XBFD4C209} }, +/**/ {{0X851B0BE5, 0X3F8724E2} }, +/**/ {{0X507C76E0, 0X3FBC9147} }, +/**/ {{0X19C7F0AB, 0XBFB576E5} } }, +/**/ {{{0XCE042830, 0X3FE36001} }, +/**/ {{0XC1656AE0, 0X3FE16BFB} }, +/**/ {{0XAD3B2B77, 0X3FE76A77} }, +/**/ {{0X74AAC296, 0XBFD4BFB3} }, +/**/ {{0X05B229C2, 0X3F8AB070} }, +/**/ {{0X87DCA54B, 0X3FBC260E} }, +/**/ {{0XC90DF763, 0XBFB56B2F} } }, +/**/ {{{0X89B8FC54, 0X3FE37FFE} }, +/**/ {{0X77D0BA80, 0X3FE18359} }, +/**/ {{0X660CAA3D, 0X3FE755BB} }, +/**/ {{0X308BB975, 0XBFD4BD09} }, +/**/ {{0XFE0A1240, 0X3F8E2E26} }, +/**/ {{0X18790F26, 0X3FBBBB22} }, +/**/ {{0XC094F3DA, 0XBFB55DE6} } }, +/**/ {{{0X9B4DA842, 0X3FE3A001} }, +/**/ {{0X100CD140, 0X3FE19AA7} }, +/**/ {{0XD801F889, 0X3FE740FD} }, +/**/ {{0X2C32C656, 0XBFD4BA0B} }, +/**/ {{0X8ECA44A2, 0X3F90CF99} }, +/**/ {{0XC9863443, 0X3FBB5066} }, +/**/ {{0X406672B5, 0XBFB54F15} } }, +/**/ {{{0XCE6B63E8, 0X3FE3C000} }, +/**/ {{0X1D0B0AE0, 0X3FE1B1DD} }, +/**/ {{0XF28670E6, 0X3FE72C45} }, +/**/ {{0X92422E2E, 0XBFD4B6BB} }, +/**/ {{0XA0D32146, 0X3F928141} }, +/**/ {{0X37452321, 0X3FBAE606} }, +/**/ {{0X77D91F56, 0XBFB53EC6} } }, +/**/ {{{0X114A2607, 0X3FE3DFFF} }, +/**/ {{0XC6FF6F20, 0X3FE1C8FD} }, +/**/ {{0X206847A7, 0X3FE71792} }, +/**/ {{0X669BD306, 0XBFD4B31B} }, +/**/ {{0X04FFD28A, 0X3F942C3A} }, +/**/ {{0XE7FC0825, 0X3FBA7BFD} }, +/**/ {{0X82F471BA, 0XBFB52D05} } }, +/**/ {{{0XC1DA9B7D, 0X3FE3FFFF} }, +/**/ {{0X7F2E8840, 0X3FE1E00B} }, +/**/ {{0X84371133, 0X3FE702E0} }, +/**/ {{0X8012FBE4, 0XBFD4AF2B} }, +/**/ {{0XBFC47F4B, 0X3F95D0B4} }, +/**/ {{0XD80AB6C5, 0X3FBA1249} }, +/**/ {{0X69A4108D, 0XBFB519DD} } }, +/**/ {{{0XE11D9C33, 0X3FE41FFE} }, +/**/ {{0X67C3EC20, 0X3FE1F703} }, +/**/ {{0X026A76A0, 0X3FE6EE34} }, +/**/ {{0X96514B12, 0XBFD4AAED} }, +/**/ {{0X07BA2905, 0X3F976E83} }, +/**/ {{0X261A1221, 0X3FB9A8FE} }, +/**/ {{0X1D552BA0, 0XBFB50559} } }, +/**/ {{{0XFA174676, 0X3FE43FFF} }, +/**/ {{0X0FAFF860, 0X3FE20DE8} }, +/**/ {{0X9EA6D162, 0X3FE6D98A} }, +/**/ {{0X6B927B3B, 0XBFD4A662} }, +/**/ {{0XF84ADBB0, 0X3F9905D8} }, +/**/ {{0XDD484DB5, 0X3FB94015} }, +/**/ {{0X783EEF44, 0XBFB4EF83} } }, +/**/ {{{0X0D457FA4, 0X3FE45FFF} }, +/**/ {{0X9F675300, 0X3FE224B6} }, +/**/ {{0X3A093351, 0X3FE6C4E7} }, +/**/ {{0XCBF2BFF8, 0XBFD4A18B} }, +/**/ {{0X84BB8C16, 0X3F9A968A} }, +/**/ {{0X93FBB975, 0X3FB8D7A4} }, +/**/ {{0X3B37E4FB, 0XBFB4D867} } }, +/**/ {{{0X8F910E57, 0X3FE47FFE} }, +/**/ {{0XDD92B840, 0X3FE23B70} }, +/**/ {{0X89B04359, 0X3FE6B048} }, +/**/ {{0X974B07FF, 0XBFD49C6A} }, +/**/ {{0X25F20251, 0X3F9C20BE} }, +/**/ {{0X82E9673D, 0X3FB86FA8} }, +/**/ {{0X0D12F550, 0XBFB4C00F} } }, +/**/ {{{0X7323FC6B, 0X3FE4A001} }, +/**/ {{0XE34E3420, 0X3FE25218} }, +/**/ {{0XF277FE27, 0X3FE69BAC} }, +/**/ {{0X7F856ABA, 0XBFD496FF} }, +/**/ {{0X9928150C, 0X3F9DA49E} }, +/**/ {{0X3EB66A26, 0X3FB8081E} }, +/**/ {{0X78AB06C5, 0XBFB4A685} } }, +/**/ {{{0XB1BF0500, 0X3FE4C000} }, +/**/ {{0XBD8B2C80, 0X3FE268A9} }, +/**/ {{0X42ABBD42, 0X3FE68719} }, +/**/ {{0XEC74E64A, 0XBFD4914C} }, +/**/ {{0XD0C3EEEC, 0X3F9F21DE} }, +/**/ {{0X5B30AA05, 0X3FB7A122} }, +/**/ {{0XEC53EF43, 0XBFB48BD4} } }, +/**/ {{{0X1D07207B, 0X3FE4E001} }, +/**/ {{0XDA64F7A0, 0X3FE27F26} }, +/**/ {{0XA7CFBEB2, 0X3FE6728A} }, +/**/ {{0X3FCBB247, 0XBFD48B53} }, +/**/ {{0XA7354A41, 0X3FA04C60} }, +/**/ {{0XEFF6F27A, 0X3FB73AAA} }, +/**/ {{0XB81A6BB2, 0XBFB47007} } }, +/**/ {{{0X5F36EB46, 0X3FE4FFFE} }, +/**/ {{0X35DDD180, 0X3FE2958D} }, +/**/ {{0X307B6AF3, 0X3FE65E04} }, +/**/ {{0X828BB6E6, 0XBFD48514} }, +/**/ {{0X48993ED9, 0X3FA1048E} }, +/**/ {{0X468D7C59, 0X3FB6D4CB} }, +/**/ {{0X0D484989, 0XBFB45328} } }, +/**/ {{{0X2AFDF759, 0X3FE52001} }, +/**/ {{0XEB1C3280, 0X3FE2ABE2} }, +/**/ {{0X8DC5DAAD, 0X3FE64980} }, +/**/ {{0X2C11E3B7, 0XBFD47E90} }, +/**/ {{0X88E1B343, 0X3FA1B9AE} }, +/**/ {{0XFF4501BF, 0X3FB66F6C} }, +/**/ {{0XFCD6B8DE, 0XBFB4353F} } }, +/**/ {{{0XDFDB2423, 0X3FE54001} }, +/**/ {{0XAB0402C0, 0X3FE2C222} }, +/**/ {{0XE7E657FB, 0X3FE63504} }, +/**/ {{0XEEE53FA9, 0XBFD477C8} }, +/**/ {{0X696CD845, 0X3FA26B9A} }, +/**/ {{0X6A3AA6EF, 0X3FB60AAD} }, +/**/ {{0X7704E1F4, 0XBFB41659} } }, +/**/ {{{0X72D2A74F, 0X3FE55FFE} }, +/**/ {{0X16BE7240, 0X3FE2D84B} }, +/**/ {{0XCE54AEDE, 0X3FE62092} }, +/**/ {{0X7B764156, 0XBFD470C0} }, +/**/ {{0X4D9ABEE7, 0X3FA31A4C} }, +/**/ {{0XA899A63D, 0X3FB5A697} }, +/**/ {{0X49FA7FB1, 0XBFB3F67E} } }, +/**/ {{{0XEE716C33, 0X3FE58000} }, +/**/ {{0X284F3FE0, 0X3FE2EE63} }, +/**/ {{0X181C5720, 0X3FE60C24} }, +/**/ {{0XC383B0C1, 0XBFD46975} }, +/**/ {{0XC40A1A5A, 0X3FA3C5FF} }, +/**/ {{0X0B7B3B72, 0X3FB54311} }, +/**/ {{0X21700401, 0XBFB3D5B8} } }, +/**/ {{{0X9825CD2A, 0X3FE59FFF} }, +/**/ {{0X2DEFCF40, 0X3FE30464} }, +/**/ {{0X3C14A317, 0X3FE5F7BF} }, +/**/ {{0X227A4CDE, 0XBFD461EC} }, +/**/ {{0X6DA8D837, 0X3FA46E85} }, +/**/ {{0X6162F4C8, 0X3FB4E03C} }, +/**/ {{0X857F5976, 0XBFB3B410} } }, +/**/ {{{0XFE2A42CD, 0X3FE5BFFD} }, +/**/ {{0XA5110DC0, 0X3FE31A50} }, +/**/ {{0X33CF1268, 0X3FE5E362} }, +/**/ {{0XF68B7DBC, 0XBFD45A23} }, +/**/ {{0XDE40F0E9, 0X3FA513F5} }, +/**/ {{0XDE05901E, 0X3FB47E12} }, +/**/ {{0XDA5CABB5, 0XBFB39190} } }, +/**/ {{{0X57330799, 0X3FE5E000} }, +/**/ {{0X75253480, 0X3FE3302B} }, +/**/ {{0X901DA45A, 0X3FE5CF0A} }, +/**/ {{0X552754CF, 0XBFD4521D} }, +/**/ {{0XBBF000BB, 0X3FA5B66B} }, +/**/ {{0XD2BAF7B2, 0X3FB41C8B} }, +/**/ {{0X5F53241A, 0XBFB36E42} } }, +/**/ {{{0X4D6055DA, 0X3FE60001} }, +/**/ {{0XFF2EDA60, 0X3FE345F0} }, +/**/ {{0XF2EA5900, 0X3FE5BABB} }, +/**/ {{0XB2008754, 0XBFD449DA} }, +/**/ {{0X18F56FBB, 0X3FA655D1} }, +/**/ {{0X89A0C1B2, 0X3FB3BBBB} }, +/**/ {{0X2E8D60FC, 0XBFB34A2E} } }, +/**/ {{{0X2C3809CB, 0X3FE62001} }, +/**/ {{0X812D5040, 0X3FE35BA1} }, +/**/ {{0X671E49E9, 0X3FE5A676} }, +/**/ {{0X230E6216, 0XBFD4415D} }, +/**/ {{0X6B05C7F7, 0X3FA6F22D} }, +/**/ {{0XCFE6B72B, 0X3FB35BA4} }, +/**/ {{0X3C3BFA3B, 0XBFB3255D} } }, +/**/ {{{0X87B47ECC, 0X3FE64000} }, +/**/ {{0X69715580, 0X3FE3713D} }, +/**/ {{0XC8FB0E69, 0X3FE59239} }, +/**/ {{0XA5BD1F6E, 0XBFD438A5} }, +/**/ {{0X7F9B13CF, 0X3FA78B89} }, +/**/ {{0X74F57C8F, 0X3FB2FC49} }, +/**/ {{0X566CAACA, 0XBFB2FFD8} } }, +/**/ {{{0XA746397F, 0X3FE66000} }, +/**/ {{0X9D968940, 0X3FE386C5} }, +/**/ {{0X83073C58, 0X3FE57E05} }, +/**/ {{0XFE3D0083, 0XBFD42FB4} }, +/**/ {{0X4B9E1EEB, 0X3FA821F1} }, +/**/ {{0X1952EE82, 0X3FB29DA9} }, +/**/ {{0X245866A8, 0XBFB2D9A8} } }, +/**/ {{{0XE4E3094B, 0X3FE68000} }, +/**/ {{0XB5FE3900, 0X3FE39C39} }, +/**/ {{0X36DD131E, 0X3FE569DA} }, +/**/ {{0X74778FE0, 0XBFD4268C} }, +/**/ {{0X9AB0310F, 0X3FA8B567} }, +/**/ {{0XF2E43205, 0X3FB23FC8} }, +/**/ {{0X26483573, 0XBFB2B2D5} } }, +/**/ {{{0XE2E37787, 0X3FE6A001} }, +/**/ {{0X27D52620, 0X3FE3B19A} }, +/**/ {{0XB5D865CD, 0X3FE555B7} }, +/**/ {{0XF1600CD3, 0XBFD41D2C} }, +/**/ {{0X4B79E859, 0X3FA945F5} }, +/**/ {{0X46A0B02D, 0X3FB1E2AA} }, +/**/ {{0XB508A35B, 0XBFB28B67} } }, +/**/ {{{0X0DF4BBFB, 0X3FE6BFFE} }, +/**/ {{0X46F2B6E0, 0X3FE3C6E3} }, +/**/ {{0XB658AFBE, 0X3FE541A1} }, +/**/ {{0X388DA137, 0XBFD41399} }, +/**/ {{0XE5B3C2BA, 0X3FA9D387} }, +/**/ {{0X173397F9, 0X3FB18660} }, +/**/ {{0X01DB4945, 0XBFB26368} } }, +/**/ {{{0XEA406CEA, 0X3FE6DFFF} }, +/**/ {{0X1BB3D400, 0X3FE3DC1C} }, +/**/ {{0XD33FFE8E, 0X3FE52D91} }, +/**/ {{0X36BCFFE9, 0XBFD409CF} }, +/**/ {{0X174405AF, 0X3FAA5E54} }, +/**/ {{0XDC041806, 0X3FB12ACE} }, +/**/ {{0X160D6557, 0XBFB23ADE} } }, +/**/ {{{0XED01EA65, 0X3FE70000} }, +/**/ {{0X54E51400, 0X3FE3F140} }, +/**/ {{0X5C8B9119, 0X3FE5198C} }, +/**/ {{0XF2EA4FF7, 0XBFD3FFD1} }, +/**/ {{0X308C81CD, 0X3FAAE643} }, +/**/ {{0X1960AAF7, 0X3FB0D00C} }, +/**/ {{0XD2F50D25, 0XBFB211D1} } }, +/**/ {{{0X00D515EB, 0X3FE72002} }, +/**/ {{0X983BB3E0, 0X3FE40650} }, +/**/ {{0XF2175C71, 0X3FE50590} }, +/**/ {{0X361BB15C, 0XBFD3F5A2} }, +/**/ {{0X9B536AFC, 0X3FAB6B5F} }, +/**/ {{0XA731624D, 0X3FB07617} }, +/**/ {{0XF1A8C054, 0XBFB1E84A} } }, +/**/ {{{0X1323DE6D, 0X3FE74001} }, +/**/ {{0X9483E720, 0X3FE41B4B} }, +/**/ {{0X1027BA01, 0X3FE4F1A1} }, +/**/ {{0XBB978C8F, 0XBFD3EB41} }, +/**/ {{0X7765626A, 0X3FABEDA7} }, +/**/ {{0X97F58C8A, 0X3FB01CF9} }, +/**/ {{0X03074348, 0XBFB1BE51} } }, +/**/ {{{0X25CAB4CA, 0X3FE75FFF} }, +/**/ {{0X0001D5C0, 0X3FE43032} }, +/**/ {{0X4573FB6C, 0X3FE4DDBC} }, +/**/ {{0X41F21D2A, 0XBFD3E0B1} }, +/**/ {{0XD1BDA00F, 0X3FAC6D25} }, +/**/ {{0X5935EE68, 0X3FAF8962} }, +/**/ {{0X6F8E0689, 0XBFB193EB} } }, +/**/ {{{0X90921F76, 0X3FE77FFE} }, +/**/ {{0X6CC6AF00, 0X3FE44505} }, +/**/ {{0X4CFFBDAE, 0X3FE4C9E1} }, +/**/ {{0X0B247EC4, 0XBFD3D5F1} }, +/**/ {{0X943F4516, 0X3FACE9EA} }, +/**/ {{0XF24A8AF1, 0X3FAEDA73} }, +/**/ {{0X776AAC42, 0XBFB16921} } }, +/**/ {{{0X47B2F83B, 0X3FE79FFE} }, +/**/ {{0X35C19F20, 0X3FE459C5} }, +/**/ {{0XFC8F20BD, 0X3FE4B610} }, +/**/ {{0X73DF2A0D, 0XBFD3CB02} }, +/**/ {{0X23C5D6DE, 0X3FAD63F8} }, +/**/ {{0X9C5116AB, 0X3FAE2D31} }, +/**/ {{0X326E2972, 0XBFB13DFA} } }, +/**/ {{{0X2F1E79A9, 0X3FE7BFFF} }, +/**/ {{0XF84DF5C0, 0X3FE46E71} }, +/**/ {{0XF586B1BD, 0X3FE4A24A} }, +/**/ {{0X2EF81E5B, 0XBFD3BFE6} }, +/**/ {{0X738896F0, 0X3FADDB58} }, +/**/ {{0X2515DE78, 0X3FAD819A} }, +/**/ {{0X9026FDD0, 0XBFB1127C} } }, +/**/ {{{0X973C8D05, 0X3FE7E001} }, +/**/ {{0XF0FB9580, 0X3FE4830B} }, +/**/ {{0X3466B08E, 0X3FE48E8F} }, +/**/ {{0X1C53A01A, 0XBFD3B49D} }, +/**/ {{0X25103EED, 0X3FAE5013} }, +/**/ {{0X5290F4AF, 0X3FACD7AF} }, +/**/ {{0X57EF003B, 0XBFB0E6AF} } }, +/**/ {{{0X69EFC092, 0X3FE7FFFF} }, +/**/ {{0X431C3800, 0X3FE4978F} }, +/**/ {{0XA3E1064A, 0X3FE47AE1} }, +/**/ {{0X666C50C4, 0XBFD3A92A} }, +/**/ {{0X4098A4BE, 0X3FAEC219} }, +/**/ {{0X2EEE57E0, 0X3FAC2F94} }, +/**/ {{0X290D5730, 0XBFB0BA99} } }, +/**/ {{{0XC52B5232, 0X3FE82001} }, +/**/ {{0XD2B83340, 0X3FE4AC01} }, +/**/ {{0XD31B7CF5, 0X3FE4673C} }, +/**/ {{0XC67D05F0, 0XBFD39D8B} }, +/**/ {{0X2A81B5D5, 0X3FAF3192} }, +/**/ {{0X8AA20E90, 0X3FAB891B} }, +/**/ {{0X7ADCEFD6, 0XBFB08E40} } }, +/**/ {{{0XBD4D4E3F, 0X3FE84000} }, +/**/ {{0X9B1DBC60, 0X3FE4C05E} }, +/**/ {{0XC8D629F7, 0X3FE453A5} }, +/**/ {{0X13E9EF47, 0XBFD391C5} }, +/**/ {{0X17383D6B, 0X3FAF9E69} }, +/**/ {{0X278E21B9, 0X3FAAE471} }, +/**/ {{0X9CF54D10, 0XBFB061AB} } }, +/**/ {{{0X8C869CBD, 0X3FE86001} }, +/**/ {{0XFD2285A0, 0X3FE4D4A8} }, +/**/ {{0X79B82471, 0X3FE44019} }, +/**/ {{0X5C3E2929, 0XBFD385D5} }, +/**/ {{0X7B2C8FF2, 0X3FB0045B} }, +/**/ {{0X39D7CA4F, 0X3FAA417C} }, +/**/ {{0XB767B7D4, 0XBFB034E0} } }, +/**/ {{{0XB5DB3710, 0X3FE87FFE} }, +/**/ {{0X8B93BCA0, 0X3FE4E8DD} }, +/**/ {{0X66C6E6BF, 0X3FE42C9B} }, +/**/ {{0XA32EE2A1, 0XBFD379BF} }, +/**/ {{0X6187FE0F, 0X3FB03838} }, +/**/ {{0X8B3A0B33, 0X3FA9A05A} }, +/**/ {{0XCAEE03A9, 0XBFB007E5} } }, +/**/ {{{0X863C77E3, 0X3FE8A000} }, +/**/ {{0X8FCD1E80, 0X3FE4FD01} }, +/**/ {{0XA8A8093F, 0X3FE41926} }, +/**/ {{0XB5EE344D, 0XBFD36D81} }, +/**/ {{0X2841F292, 0X3FB06ADC} }, +/**/ {{0X2484560B, 0X3FA900E4} }, +/**/ {{0X62792F0A, 0XBFAFB581} } }, +/**/ {{{0X0ED982AF, 0X3FE8BFFF} }, +/**/ {{0X16E28AC0, 0X3FE51110} }, +/**/ {{0X389112EE, 0X3FE405C0} }, +/**/ {{0X89D38DC7, 0XBFD3611F} }, +/**/ {{0XB450B9F7, 0X3FB09C3D} }, +/**/ {{0X312D0C4A, 0X3FA86342} }, +/**/ {{0X3A6CA012, 0XBFAF5AEE} } }, +/**/ {{{0X02C3AEAE, 0X3FE8E000} }, +/**/ {{0XC0AB0A40, 0X3FE5250C} }, +/**/ {{0XC65593C5, 0X3FE3F264} }, +/**/ {{0XD82BE900, 0XBFD35497} }, +/**/ {{0X68546D39, 0X3FB0CC69} }, +/**/ {{0XDB8499FD, 0X3FA7C759} }, +/**/ {{0X36A32337, 0XBFAF001D} } }, +/**/ {{{0XECBFA97B, 0X3FE90000} }, +/**/ {{0X0E8D4EE0, 0X3FE538F6} }, +/**/ {{0XF4119333, 0X3FE3DF15} }, +/**/ {{0X7D2149F4, 0XBFD347EC} }, +/**/ {{0XFA921D3C, 0X3FB0FB5E} }, +/**/ {{0X69693E89, 0X3FA72D38} }, +/**/ {{0X23A0F5F3, 0XBFAEA519} } }, +/**/ {{{0XD251C01C, 0X3FE91FFF} }, +/**/ {{0XD3F3BD20, 0X3FE54CCA} }, +/**/ {{0X1554DD15, 0X3FE3CBD5} }, +/**/ {{0X2BC94245, 0XBFD33B1F} }, +/**/ {{0X2FC4C3F6, 0X3FB1291F} }, +/**/ {{0X1B7A765C, 0X3FA694E8} }, +/**/ {{0X826E86F6, 0XBFAE49EC} } }, +/**/ {{{0XD90AF4E6, 0X3FE94001} }, +/**/ {{0X4D4EC640, 0X3FE5608E} }, +/**/ {{0X3445EF72, 0X3FE3B89F} }, +/**/ {{0XB7BBD79A, 0XBFD32E2E} }, +/**/ {{0XE401D071, 0X3FB155B4} }, +/**/ {{0X3A256F1C, 0X3FA5FE51} }, +/**/ {{0X890FF662, 0XBFADEEA1} } }, +/**/ {{{0X04FD6C17, 0X3FE96001} }, +/**/ {{0XD5673C20, 0X3FE5743C} }, +/**/ {{0X09EBC6E2, 0X3FE3A578} }, +/**/ {{0X6DA5039C, 0XBFD3211E} }, +/**/ {{0X4E62286B, 0X3FB1811B} }, +/**/ {{0X71BECE9D, 0X3FA56990} }, +/**/ {{0X23911641, 0XBFAD9342} } }, +/**/ {{{0X2D214B82, 0X3FE98000} }, +/**/ {{0X3B0D6120, 0X3FE587D8} }, +/**/ {{0X01EAAC3E, 0X3FE3925E} }, +/**/ {{0X08425504, 0XBFD313EE} }, +/**/ {{0X02BDB571, 0X3FB1AB5A} }, +/**/ {{0X9EBD70B8, 0X3FA4D698} }, +/**/ {{0XF482965A, 0XBFAD37D7} } }, +/**/ {{{0XEB980651, 0X3FE99FFD} }, +/**/ {{0XB16BA7A0, 0X3FE59B5F} }, +/**/ {{0X10B1AB7A, 0X3FE37F52} }, +/**/ {{0XF993D676, 0XBFD3069E} }, +/**/ {{0XCDED25A8, 0X3FB1D472} }, +/**/ {{0X2D0ABD9A, 0X3FA44570} }, +/**/ {{0X56221AA1, 0XBFACDC6C} } }, +/**/ {{{0XE5504053, 0X3FE9BFFF} }, +/**/ {{0XB55DE6A0, 0X3FE5AED6} }, +/**/ {{0XFA91C51E, 0X3FE36C50} }, +/**/ {{0XBE311E56, 0XBFD2F92F} }, +/**/ {{0X5BE3AF05, 0X3FB1FC70} }, +/**/ {{0XACD5CDC7, 0X3FA3B5FD} }, +/**/ {{0X5ADBB9B8, 0XBFAC8108} } }, +/**/ {{{0X6E60A234, 0X3FE9E001} }, +/**/ {{0X79ACD480, 0X3FE5C23A} }, +/**/ {{0XA5FAB2EA, 0X3FE3595D} }, +/**/ {{0X1DDECEEA, 0XBFD2EBA3} }, +/**/ {{0X35736518, 0X3FB22350} }, +/**/ {{0X22F9FD28, 0X3FA32856} }, +/**/ {{0XCE8B2259, 0XBFAC25B4} } }, +/**/ {{{0XB685741B, 0X3FE9FFFF} }, +/**/ {{0X5AD40460, 0X3FE5D589} }, +/**/ {{0XD832B8D3, 0X3FE34679} }, +/**/ {{0X230EDA41, 0XBFD2DDFB} }, +/**/ {{0XB23C0BA2, 0X3FB24912} }, +/**/ {{0X4C4E86DA, 0X3FA29C85} }, +/**/ {{0X37002A55, 0XBFABCA7A} } }, +/**/ {{{0X9D59B943, 0X3FEA2001} }, +/**/ {{0X8C187EA0, 0X3FE5E8C7} }, +/**/ {{0X9EDE2183, 0X3FE333A1} }, +/**/ {{0XB0043779, 0XBFD2D035} }, +/**/ {{0X7AB9110C, 0X3FB26DC3} }, +/**/ {{0X959CFC0E, 0X3FA2126C} }, +/**/ {{0XD556233E, 0XBFAB6F60} } }, +/**/ {{{0XBE9E153F, 0X3FEA3FFF} }, +/**/ {{0XA9C08AE0, 0X3FE5FBF0} }, +/**/ {{0X6F7861AA, 0X3FE320D9} }, +/**/ {{0XC2200F18, 0XBFD2C256} }, +/**/ {{0XA6795293, 0X3FB2915D} }, +/**/ {{0X256A8FDE, 0X3FA18A2B} }, +/**/ {{0XA67A4E89, 0XBFAB1470} } }, +/**/ {{{0X7A23A1CE, 0X3FEA5FFE} }, +/**/ {{0X63200600, 0X3FE60F07} }, +/**/ {{0XD13D395E, 0X3FE30E1E} }, +/**/ {{0X44403932, 0XBFD2B45D} }, +/**/ {{0XC967F013, 0X3FB2B3E9} }, +/**/ {{0X35D002B8, 0X3FA103AD} }, +/**/ {{0X6496A8F1, 0XBFAAB9B1} } }, +/**/ {{{0X57F250B8, 0X3FEA8001} }, +/**/ {{0XDD6453A0, 0X3FE6220D} }, +/**/ {{0XCFFFCC1E, 0X3FE2FB6F} }, +/**/ {{0X6F8D8291, 0XBFD2A648} }, +/**/ {{0X03654CC3, 0X3FB2D56F} }, +/**/ {{0X4BB6E7A6, 0X3FA07EE3} }, +/**/ {{0X87992F03, 0XBFAA5F2A} } }, +/**/ {{{0XDD839D49, 0X3FEAA000} }, +/**/ {{0XB412C9A0, 0X3FE634FF} }, +/**/ {{0XE2D59E01, 0X3FE2E8D0} }, +/**/ {{0X5467CFDD, 0XBFD2981C} }, +/**/ {{0XFF1FADB5, 0X3FB2F5E8} }, +/**/ {{0XA3BA803C, 0X3F9FF7D6} }, +/**/ {{0X46AF8DB7, 0XBFAA04E3} } }, +/**/ {{{0X770DF220, 0X3FEAC000} }, +/**/ {{0XFEF70020, 0X3FE647DE} }, +/**/ {{0X220AFF7F, 0X3FE2D640} }, +/**/ {{0X36F9E74F, 0XBFD289D8} }, +/**/ {{0XE509140A, 0X3FB3155E} }, +/**/ {{0X61AB0B7F, 0X3F9EF56B} }, +/**/ {{0X98CE391F, 0XBFA9AAE2} } }, +/**/ {{{0X125BBE48, 0X3FEAE001} }, +/**/ {{0X57A24D20, 0X3FE65AAC} }, +/**/ {{0X1BFB3559, 0X3FE2C3BD} }, +/**/ {{0X6DDE55DD, 0XBFD27B7C} }, +/**/ {{0X15C4C270, 0X3FB333D5} }, +/**/ {{0X9BAC4ECF, 0X3F9DF67A} }, +/**/ {{0X363A972B, 0XBFA9512F} } }, +/**/ {{{0X7C321839, 0X3FEAFFFE} }, +/**/ {{0X569B83C0, 0X3FE66D65} }, +/**/ {{0X53FBF8D9, 0X3FE2B14A} }, +/**/ {{0X9CFA03CE, 0XBFD26D0B} }, +/**/ {{0X2CAA2E0C, 0X3FB3514B} }, +/**/ {{0X4597BE9A, 0X3F9CFB22} }, +/**/ {{0X99110022, 0XBFA8F7CF} } }, +/**/ {{{0X75486924, 0X3FEB1FFE} }, +/**/ {{0X68CEFB40, 0X3FE6800D} }, +/**/ {{0X8E6AA814, 0X3FE29EE4} }, +/**/ {{0XE8AFA7EB, 0XBFD25E83} }, +/**/ {{0XFB0E8AC8, 0X3FB36DC9} }, +/**/ {{0XAD5D66CA, 0X3F9C0331} }, +/**/ {{0XFEDB1E8B, 0XBFA89EC9} } }, +/**/ {{{0X5FB8DEB8, 0X3FEB4001} }, +/**/ {{0XD137C500, 0X3FE692A4} }, +/**/ {{0XABFF668E, 0X3FE28C8B} }, +/**/ {{0XD8E71E0A, 0XBFD24FE5} }, +/**/ {{0X1297317A, 0X3FB38955} }, +/**/ {{0X1D844655, 0X3F9B0EA3} }, +/**/ {{0X6914067D, 0XBFA84624} } }, +/**/ {{{0X386C27B9, 0X3FEB6000} }, +/**/ {{0X8CDF6FC0, 0X3FE6A527} }, +/**/ {{0XC5758DB8, 0X3FE27A43} }, +/**/ {{0X59CADCE0, 0XBFD24135} }, +/**/ {{0XEE34AE91, 0X3FB3A3E9} }, +/**/ {{0X1C5FFF05, 0X3F9A1DA8} }, +/**/ {{0X9EC8AAC6, 0XBFA7EDE4} } }, +/**/ {{{0XD1EFDDB3, 0X3FEB8000} }, +/**/ {{0X0ACCB660, 0X3FE6B799} }, +/**/ {{0X9983AAB2, 0X3FE26809} }, +/**/ {{0X76047E08, 0XBFD23270} }, +/**/ {{0XF132139B, 0X3FB3BD90} }, +/**/ {{0X58DEB3E1, 0X3F993010} }, +/**/ {{0X2D194CE9, 0XBFA79610} } }, +/**/ {{{0X42CC4047, 0X3FEB9FFE} }, +/**/ {{0X86445E60, 0X3FE6C9F6} }, +/**/ {{0X069F871F, 0X3FE255E0} }, +/**/ {{0X25461639, 0XBFD2239A} }, +/**/ {{0XA926C127, 0X3FB3D649} }, +/**/ {{0XC5A21F70, 0X3F9845FB} }, +/**/ {{0X68E20BE6, 0XBFA73EAC} } }, +/**/ {{{0X951AEAAD, 0X3FEBC001} }, +/**/ {{0X3C4E45A0, 0X3FE6DC45} }, +/**/ {{0XFF6573B0, 0X3FE243C1} }, +/**/ {{0XE38FA7E7, 0XBFD214AE} }, +/**/ {{0X5EA1330F, 0X3FB3EE1E} }, +/**/ {{0X2BCCE6DF, 0X3F975F24} }, +/**/ {{0X6F3902C5, 0XBFA6E7BE} } }, +/**/ {{{0X6616FE11, 0X3FEBDFFE} }, +/**/ {{0X27106FE0, 0X3FE6EE7E} }, +/**/ {{0X97B587F0, 0X3FE231B6} }, +/**/ {{0X240FEF32, 0XBFD205B5} }, +/**/ {{0X44EB818C, 0X3FB40509} }, +/**/ {{0X108160F9, 0X3F967BDE} }, +/**/ {{0X271D18AD, 0XBFA6914B} } }, +/**/ {{{0X54511C72, 0X3FEBFFFF} }, +/**/ {{0X643BBB40, 0X3FE700A7} }, +/**/ {{0XE1823C8B, 0X3FE21FB7} }, +/**/ {{0X9A854F7A, 0XBFD1F6A8} }, +/**/ {{0X71F04837, 0X3FB41B15} }, +/**/ {{0XBBD10F7C, 0X3F959BD8} }, +/**/ {{0X41F03711, 0XBFA63B57} } }, +/**/ {{{0XC537593E, 0X3FEC2000} }, +/**/ {{0XF36D6400, 0X3FE712BE} }, +/**/ {{0XF754B2D5, 0X3FE20DC7} }, +/**/ {{0X9D24DBED, 0XBFD1E78B} }, +/**/ {{0X94F485E0, 0X3FB43043} }, +/**/ {{0X122A6884, 0X3F94BF29} }, +/**/ {{0X3D2AA4E9, 0XBFA5E5E7} } }, +/**/ {{{0XDDD35719, 0X3FEC4000} }, +/**/ {{0XD7FA3000, 0X3FE724C3} }, +/**/ {{0XF2A8B1BF, 0X3FE1FBE7} }, +/**/ {{0XB25DDDF6, 0XBFD1D85F} }, +/**/ {{0XD2E3B20F, 0X3FB44495} }, +/**/ {{0X7FCC1B30, 0X3F93E5D6} }, +/**/ {{0X62D0D00F, 0XBFA590FF} } }, +/**/ {{{0X402375B6, 0X3FEC6000} }, +/**/ {{0X7DFF3720, 0X3FE736B6} }, +/**/ {{0X86C92387, 0X3FE1EA17} }, +/**/ {{0X31DDFC58, 0XBFD1C925} }, +/**/ {{0XF8B6CBC2, 0X3FB4580F} }, +/**/ {{0X00CE998E, 0X3F930FD7} }, +/**/ {{0XCB299E5F, 0XBFA53CA3} } }, +/**/ {{{0X19904FE4, 0X3FEC7FFF} }, +/**/ {{0X0F395860, 0X3FE74897} }, +/**/ {{0XA825BA33, 0X3FE1D856} }, +/**/ {{0XA75E0FC5, 0XBFD1B9DC} }, +/**/ {{0X79F8FD7D, 0X3FB46AB5} }, +/**/ {{0XA5A90AFE, 0X3F923D23} }, +/**/ {{0X5D2F574B, 0XBFA4E8D8} } }, +/**/ {{{0XF9E2409D, 0X3FEC9FFE} }, +/**/ {{0X79E7F1C0, 0X3FE75A66} }, +/**/ {{0X8740D2E9, 0X3FE1C6A4} }, +/**/ {{0XF198392C, 0XBFD1AA85} }, +/**/ {{0X808C583A, 0X3FB47C8A} }, +/**/ {{0X857F2526, 0X3F916DAC} }, +/**/ {{0XD0477576, 0XBFA495A0} } }, +/**/ {{{0XE038EF72, 0X3FECC001} }, +/**/ {{0XE6815140, 0X3FE76C25} }, +/**/ {{0X19BDADF8, 0X3FE1B500} }, +/**/ {{0XB4A469AE, 0XBFD19B20} }, +/**/ {{0X42387EA2, 0X3FB48D93} }, +/**/ {{0X7305BAF5, 0X3F90A15F} }, +/**/ {{0XACAE4E17, 0XBFA44300} } }, +/**/ {{{0XEB72037F, 0X3FECDFFE} }, +/**/ {{0X7A7A4AA0, 0X3FE77DD0} }, +/**/ {{0X4F1F6702, 0X3FE1A36E} }, +/**/ {{0XD0992CF8, 0XBFD18BB1} }, +/**/ {{0X5AA4990D, 0X3FB49DCE} }, +/**/ {{0X63759665, 0X3F8FB0DD} }, +/**/ {{0X4D2F0C0F, 0XBFA3F0FB} } }, +/**/ {{{0XEA4839ED, 0X3FECFFFF} }, +/**/ {{0XB17088C0, 0X3FE78F6B} }, +/**/ {{0XCF32122F, 0X3FE191E9} }, +/**/ {{0X220400AC, 0XBFD17C35} }, +/**/ {{0X0A159641, 0X3FB4AD44} }, +/**/ {{0X80894CA9, 0X3F8E252C} }, +/**/ {{0XDF89C265, 0XBFA39F93} } }, +/**/ {{{0XEC3EC8B2, 0X3FED1FFD} }, +/**/ {{0XC8C6C880, 0X3FE7A0F3} }, +/**/ {{0X729F01D6, 0X3FE18076} }, +/**/ {{0X98515540, 0XBFD16CAE} }, +/**/ {{0X1B0933FF, 0X3FB4BBF4} }, +/**/ {{0XE09A60CD, 0X3F8C9FF5} }, +/**/ {{0X662A5704, 0XBFA34ECD} } }, +/**/ {{{0X7084EDD4, 0X3FED3FFF} }, +/**/ {{0X5F02F220, 0X3FE7B26C} }, +/**/ {{0XB9973206, 0X3FE16F10} }, +/**/ {{0X9E1E0A54, 0XBFD15D1B} }, +/**/ {{0XAC2C9A30, 0X3FB4C9E4} }, +/**/ {{0XEFCE76CC, 0X3F8B20DD} }, +/**/ {{0XB888BC37, 0XBFA2FEAA} } }, +/**/ {{{0X8D728E7C, 0X3FED5FFE} }, +/**/ {{0X488D7E80, 0X3FE7C3D2} }, +/**/ {{0XE622A5A7, 0X3FE15DBB} }, +/**/ {{0XA305CEB2, 0XBFD14D7F} }, +/**/ {{0X417BF1C7, 0X3FB4D716} }, +/**/ {{0XE19FE239, 0X3F89A81E} }, +/**/ {{0X84DDAD07, 0XBFA2AF2E} } }, +/**/ {{{0X70AA3B03, 0X3FED7FFF} }, +/**/ {{0XDB239580, 0X3FE7D527} }, +/**/ {{0XBE4FEA01, 0X3FE14C75} }, +/**/ {{0X2AD706AA, 0XBFD13DD9} }, +/**/ {{0XB49D32AA, 0X3FB4E38D} }, +/**/ {{0X37DF2B6D, 0X3F88357A} }, +/**/ {{0X507CD77B, 0XBFA2605B} } }, +/**/ {{{0X1434FBA3, 0X3FED9FFF} }, +/**/ {{0X82C8A720, 0X3FE7E66B} }, +/**/ {{0XED9B7FED, 0X3FE13B3F} }, +/**/ {{0X3AC9D646, 0XBFD12E2A} }, +/**/ {{0XE7B01CF5, 0X3FB4EF4C} }, +/**/ {{0XD25FD52D, 0X3F86C905} }, +/**/ {{0X798666EF, 0XBFA21233} } }, +/**/ {{{0XA8C8DE8C, 0X3FEDBFFE} }, +/**/ {{0XF4A0A520, 0X3FE7F79D} }, +/**/ {{0XD7FC2119, 0X3FE12A19} }, +/**/ {{0XC6BE19DF, 0XBFD11E72} }, +/**/ {{0X634E1B91, 0X3FB4FA57} }, +/**/ {{0X47F96DF5, 0X3F8562A6} }, +/**/ {{0X373AF599, 0XBFA1C4B9} } }, +/**/ {{{0X26573DF5, 0X3FEDE000} }, +/**/ {{0X4DBCB960, 0X3FE808C0} }, +/**/ {{0X7903E4B9, 0X3FE11902} }, +/**/ {{0X5CDFED06, 0XBFD10EB2} }, +/**/ {{0XCCA681FA, 0X3FB504B0} }, +/**/ {{0X6F3CDE09, 0X3F840238} }, +/**/ {{0X9BA8FA6A, 0XBFA177EE} } }, +/**/ {{{0X35009B66, 0X3FEDFFFE} }, +/**/ {{0XC2CB5340, 0X3FE819CF} }, +/**/ {{0XB1C942B5, 0X3FE107FC} }, +/**/ {{0X230D7D92, 0XBFD0FEEC} }, +/**/ {{0X75C5B4F1, 0X3FB50E5A} }, +/**/ {{0XE3C139D8, 0X3F82A7E8} }, +/**/ {{0X93FA642B, 0XBFA12BD5} } }, +/**/ {{{0X492D4C68, 0X3FEE2000} }, +/**/ {{0X5CCB8680, 0X3FE82AD0} }, +/**/ {{0X928E55DF, 0X3FE0F704} }, +/**/ {{0XEE0B0721, 0XBFD0EF1C} }, +/**/ {{0X937BFB74, 0X3FB51759} }, +/**/ {{0X2BC9FDDB, 0X3F815359} }, +/**/ {{0XEA1D1824, 0XBFA0E06F} } }, +/**/ {{{0X9412BB65, 0X3FEE4000} }, +/**/ {{0X14001A60, 0X3FE83BBF} }, +/**/ {{0X37F485DA, 0X3FE0E61D} }, +/**/ {{0X1B2BD37D, 0XBFD0DF48} }, +/**/ {{0X64024D14, 0X3FB51FAF} }, +/**/ {{0X9B849698, 0X3F8004B9} }, +/**/ {{0X450A2434, 0XBFA095BF} } }, +/**/ {{{0X4758EF2F, 0X3FEE5FFF} }, +/**/ {{0X1531C180, 0X3FE84C9C} }, +/**/ {{0X8B7FECE7, 0X3FE0D546} }, +/**/ {{0X105BFE1E, 0XBFD0CF6E} }, +/**/ {{0XF9C5E03A, 0X3FB5275E} }, +/**/ {{0X17AA1137, 0X3F7D77F2} }, +/**/ {{0X2A6891E1, 0XBFA04BC5} } }, +/**/ {{{0X380F819F, 0X3FEE8000} }, +/**/ {{0X74CCC060, 0X3FE85D69} }, +/**/ {{0X8F1DA5B5, 0X3FE0C47E} }, +/**/ {{0X62AD700F, 0XBFD0BF8D} }, +/**/ {{0X1F3FBC2B, 0X3FB52E6C} }, +/**/ {{0XEE24AD7D, 0X3F7AF1C3} }, +/**/ {{0XFECE26C9, 0XBFA00282} } }, +/**/ {{{0XA6D8CB7B, 0X3FEEA000} }, +/**/ {{0XD00E3A60, 0X3FE86E25} }, +/**/ {{0XBA314D62, 0X3FE0B3C6} }, +/**/ {{0XE7CB2D84, 0XBFD0AFA7} }, +/**/ {{0X08E9071F, 0X3FB534D9} }, +/**/ {{0X4CE5E5C9, 0X3F787704} }, +/**/ {{0X0EB7C9D5, 0XBF9F73F4} } }, +/**/ {{{0X5A13BA60, 0X3FEEC000} }, +/**/ {{0X19B163E0, 0X3FE87ED1} }, +/**/ {{0X2EBB7AD7, 0X3FE0A31F} }, +/**/ {{0X33A3FCE1, 0XBFD09FBE} }, +/**/ {{0X89D9AF5D, 0X3FB53AA8} }, +/**/ {{0XF7F7040B, 0X3F760799} }, +/**/ {{0XD3F0B3FB, 0XBF9EE456} } }, +/**/ {{{0X58F8DD18, 0X3FEEDFFF} }, +/**/ {{0X6681CA80, 0X3FE88F6B} }, +/**/ {{0XEC4360B3, 0X3FE09287} }, +/**/ {{0XB7CE07E5, 0XBFD08FD0} }, +/**/ {{0X7BDEDD3F, 0X3FB53FDD} }, +/**/ {{0X70C52E66, 0X3F73A366} }, +/**/ {{0X5DCA7315, 0XBF9E5630} } }, +/**/ {{{0XBE033400, 0X3FEEFFFF} }, +/**/ {{0XDD4D7960, 0X3FE89FF5} }, +/**/ {{0XDFFE15BD, 0X3FE081FF} }, +/**/ {{0XDAE56C0F, 0XBFD07FDE} }, +/**/ {{0XF84D6F5D, 0X3FB5447A} }, +/**/ {{0X7982941E, 0X3F714A24} }, +/**/ {{0X81E68835, 0XBF9DC982} } }, +/**/ {{{0XE6B5125D, 0X3FEF2001} }, +/**/ {{0XBBE88160, 0X3FE8B070} }, +/**/ {{0XDF7122E2, 0X3FE07186} }, +/**/ {{0XDE905325, 0XBFD06FE8} }, +/**/ {{0XB5DEEC7A, 0X3FB54883} }, +/**/ {{0XB4A186D5, 0X3F6DF762} }, +/**/ {{0XDE20F495, 0XBF9D3E4E} } }, +/**/ {{{0XF770E0DB, 0X3FEF3FFD} }, +/**/ {{0X09E96380, 0X3FE8C0D8} }, +/**/ {{0XF5A576A9, 0X3FE06120} }, +/**/ {{0X1D2912FF, 0XBFD05FF3} }, +/**/ {{0X8CD1001F, 0X3FB54BF9} }, +/**/ {{0X6E90DC16, 0X3F6970FC} }, +/**/ {{0XD8EB587E, 0XBF9CB496} } }, +/**/ {{{0X4E16DA33, 0X3FEF5FFE} }, +/**/ {{0X29BCCDC0, 0X3FE8D131} }, +/**/ {{0XD33BA4E9, 0X3FE050C8} }, +/**/ {{0XD74C83D2, 0XBFD04FF8} }, +/**/ {{0X592BB252, 0X3FB54EE0} }, +/**/ {{0X7193EEB5, 0X3F64FF61} }, +/**/ {{0XA459AC86, 0XBF9C2C5B} } }, +/**/ {{{0X4576FF2E, 0X3FEF8000} }, +/**/ {{0XCCE443A0, 0X3FE8E17A} }, +/**/ {{0XD8A97B6C, 0X3FE0407F} }, +/**/ {{0XC91B3E55, 0XBFD03FFB} }, +/**/ {{0X5F3357F7, 0X3FB5513A} }, +/**/ {{0X14C92B53, 0X3F60A2BA} }, +/**/ {{0X3E70DF71, 0XBF9BA59E} } }, +/**/ {{{0X39B6A330, 0X3FEF9FFF} }, +/**/ {{0XA7F515A0, 0X3FE8F1B2} }, +/**/ {{0X63064158, 0X3FE03048} }, +/**/ {{0XACBAADA8, 0XBFD02FFE} }, +/**/ {{0XF27448C0, 0X3FB55309} }, +/**/ {{0X4850006B, 0X3F58B6D6} }, +/**/ {{0X742323DF, 0XBF9B205F} } }, +/**/ {{{0XAA76C0B9, 0X3FEFC001} }, +/**/ {{0X15D66D80, 0X3FE901DC} }, +/**/ {{0X28D9B4AA, 0X3FE0201F} }, +/**/ {{0XA98D4C38, 0XBFD01FFE} }, +/**/ {{0X089780F8, 0X3FB55452} }, +/**/ {{0X7F35C5BB, 0X3F5050B5} }, +/**/ {{0XE19247AF, 0XBF9A9C9F} } }, +/**/ {{{0X39A592CA, 0X3FEFDFFE} }, +/**/ {{0X6D88A780, 0X3FE911F2} }, +/**/ {{0XE40C6538, 0X3FE01008} }, +/**/ {{0XD31688DE, 0XBFD01000} }, +/**/ {{0XE32F1816, 0X3FB55514} }, +/**/ {{0X4E1628D2, 0X3F402A15} }, +/**/ {{0XF4FAF5A0, 0XBF9A1A5F} } }, +/**/ {{{0X8E92D1B0, 0X3FEFF801} }, +/**/ {{0X9BB4BF00, 0X3FE91DFB} }, +/**/ {{0XB884C5A9, 0X3FE003FF} }, +/**/ {{0X3876A954, 0XBFD003FF} }, +/**/ {{0X5539DDFB, 0X3FB55551} }, +/**/ {{0X7B95E6C2, 0X3F2007E7} }, +/**/ {{0X18A3BA58, 0XBF99B9A7} } }, + }; + + static const number + hij[241][16] = { /* x0,hij for (1/16,1) */ +/**/ {{{0x00000000, 0x3fb04000} }, +/**/ {{0x1c06693d, 0x3fb03a6d} }, +/**/ {{0xd4e7f128, 0xbc428a02} }, +/**/ {{0xe92592ae, 0x3fefdf1f} }, +/**/ {{0xb5490162, 0x3c88bfc0} }, +/**/ {{0x8f7e4151, 0xbfb01ead} }, +/**/ {{0x0b64d205, 0xbc5395e8} }, +/**/ {{0x433dd49b, 0xbfd4d29f} }, +/**/ {{0x4aa42633, 0xbc75b19d} }, +/**/ {{0xce35961d, 0x3fafda41} }, +/**/ {{0x425d7696, 0x3c4e6a5f} }, +/**/ {{0x6c1bb5e2, 0x3fc814dd} }, +/**/ {{0x2b33739f, 0xbfaf4cb7} }, +/**/ {{0xc267d8ec, 0xbfc048b2} }, +/**/ {{0xe8ababc6, 0x3fae9649} }, +/**/ {{0xfe802692, 0x3fb78293} } }, +/**/ {{{0x00000000, 0x3fb10000} }, +/**/ {{0xa71d52a7, 0x3fb0f99e} }, +/**/ {{0xeec3624f, 0xbc22069f} }, +/**/ {{0x9a49d2a9, 0x3fefdc08} }, +/**/ {{0x68b2ce25, 0x3c7780f7} }, +/**/ {{0x9da73e1d, 0xbfb0d9de} }, +/**/ {{0xa1a487bf, 0x3c4ebf46} }, +/**/ {{0xd13ea108, 0xbfd4c669} }, +/**/ {{0xebb4528c, 0x3c7354bc} }, +/**/ {{0x789374c1, 0x3fb0a137} }, +/**/ {{0xc3f2c5c2, 0xbc56c223} }, +/**/ {{0x79c60cda, 0x3fc7f0e7} }, +/**/ {{0xcdcc7b81, 0xbfb05062} }, +/**/ {{0xc5266783, 0xbfc019e4} }, +/**/ {{0xf2540289, 0x3fafd0b2} }, +/**/ {{0xf6d3cd8a, 0x3fb71107} } }, +/**/ {{{0x00000000, 0x3fb20000} }, +/**/ {{0xbf082d59, 0x3fb1f86d} }, +/**/ {{0x7732ef81, 0xbc4095dc} }, +/**/ {{0x01722b81, 0x3fefd7b3} }, +/**/ {{0x8a212e02, 0xbc5e618c} }, +/**/ {{0xee4e9cfa, 0xbfb1d2c5} }, +/**/ {{0x29abece0, 0x3c426273} }, +/**/ {{0x37eb7f46, 0xbfd4b551} }, +/**/ {{0x01d8bf12, 0x3c73b360} }, +/**/ {{0x6adb6a7c, 0x3fb18fa7} }, +/**/ {{0x398999ad, 0xbc5c00d8} }, +/**/ {{0xf4a7cff3, 0x3fc7bea5} }, +/**/ {{0x61f84829, 0xbfb13008} }, +/**/ {{0xa8e135a1, 0xbfbfb14f} }, +/**/ {{0x4324f177, 0x3fb0b532} }, +/**/ {{0x3498dd9d, 0x3fb6734a} } }, +/**/ {{{0x00000000, 0x3fb30000} }, +/**/ {{0x318a4a9a, 0x3fb2f719} }, +/**/ {{0x79b9801f, 0x3c03fd17} }, +/**/ {{0x48e238fe, 0x3fefd31f} }, +/**/ {{0xd8c45327, 0xbc876a7a} }, +/**/ {{0x852096e2, 0xbfb2cada} }, +/**/ {{0x11efd787, 0x3c460860} }, +/**/ {{0x2e476a39, 0xbfd4a34b} }, +/**/ {{0xeb11ee51, 0x3c7254f2} }, +/**/ {{0xc54ae225, 0x3fb27c13} }, +/**/ {{0x4ae66f0c, 0x3c513096} }, +/**/ {{0xef0d59d0, 0x3fc789ca} }, +/**/ {{0x6d9aaa8c, 0xbfb20c06} }, +/**/ {{0x846ba912, 0xbfbf2885} }, +/**/ {{0xc697ef5e, 0x3fb17c5f} }, +/**/ {{0xcad31e6e, 0x3fb5ce93} } }, +/**/ {{{0x00000000, 0x3fb40000} }, +/**/ {{0x0e7c559d, 0x3fb3f59f} }, +/**/ {{0x285df847, 0x3c5ac4ce} }, +/**/ {{0xa6ab93e9, 0x3fefce4d} }, +/**/ {{0x18a97736, 0xbc6be46b} }, +/**/ {{0x4d22b635, 0xbfb3c211} }, +/**/ {{0x6950679f, 0x3c42033c} }, +/**/ {{0xc4d74033, 0xbfd49059} }, +/**/ {{0xd7e376aa, 0x3c57dd7c} }, +/**/ {{0xc0896a7c, 0x3fb36662} }, +/**/ {{0xd79232cf, 0xbc36cf6a} }, +/**/ {{0xa13a97a2, 0x3fc75261} }, +/**/ {{0x5fdd1509, 0xbfb2e431} }, +/**/ {{0x6e52db32, 0xbfbe9999} }, +/**/ {{0xb0a71e9f, 0x3fb23da4} }, +/**/ {{0xe3bc8178, 0x3fb52335} } }, +/**/ {{{0x00000000, 0x3fb50000} }, +/**/ {{0x677292fb, 0x3fb4f3fd} }, +/**/ {{0x6264979e, 0x3c4008d3} }, +/**/ {{0x53a1ee0d, 0x3fefc93e} }, +/**/ {{0x20fd2bdf, 0xbc64421a} }, +/**/ {{0x4aba88e3, 0xbfb4b85f} }, +/**/ {{0x3c9d1e89, 0x3c54f184} }, +/**/ {{0x25ae4668, 0xbfd47c7f} }, +/**/ {{0x816630d1, 0xbc7d7581} }, +/**/ {{0x07f85056, 0x3fb44e7b} }, +/**/ {{0x910bdf4f, 0x3c56d63c} }, +/**/ {{0xc439029c, 0x3fc71875} }, +/**/ {{0xf2bcfa10, 0xbfb3b85e} }, +/**/ {{0x9707b205, 0xbfbe04bb} }, +/**/ {{0x95e3e0cc, 0x3fb2f8c6} }, +/**/ {{0x8093431b, 0x3fb47184} } }, +/**/ {{{0x00000000, 0x3fb60000} }, +/**/ {{0x4fd2d7b2, 0x3fb5f232} }, +/**/ {{0x4401318e, 0x3c58a8da} }, +/**/ {{0x8b549418, 0x3fefc3f1} }, +/**/ {{0x836f8130, 0x3c34d896} }, +/**/ {{0x9cdd92e7, 0xbfb5adb9} }, +/**/ {{0xeb397cc3, 0x3c4d4161} }, +/**/ {{0x93f8f1dc, 0xbfd467bd} }, +/**/ {{0xffc760ad, 0xbc609d7b} }, +/**/ {{0xbea6b2fe, 0x3fb53443} }, +/**/ {{0x4b24f5db, 0x3c5eb03c} }, +/**/ {{0x8de3d005, 0x3fc6dc13} }, +/**/ {{0x37d2d99d, 0xbfb48866} }, +/**/ {{0xf6663fcb, 0xbfbd6a1d} }, +/**/ {{0x0adff464, 0x3fb3ad8e} }, +/**/ {{0x4159c223, 0x3fb3b9d6} } }, +/**/ {{{0x00000000, 0x3fb70000} }, +/**/ {{0xdcea4b0d, 0x3fb6f03b} }, +/**/ {{0x512fa17d, 0xbc33f00e} }, +/**/ {{0x8c07a436, 0x3fefbe67} }, +/**/ {{0x46250d6f, 0xbc84baaa} }, +/**/ {{0x7e3ba4c7, 0xbfb6a215} }, +/**/ {{0x54503f8d, 0xbc3504e7} }, +/**/ {{0x6b82d03a, 0xbfd45217} }, +/**/ {{0xbebdd1db, 0x3c7d1f0d} }, +/**/ {{0x841d5604, 0x3fb617a4} }, +/**/ {{0x6681c436, 0xbc47168b} }, +/**/ {{0xaccec6ce, 0x3fc69d47} }, +/**/ {{0xa4715800, 0xbfb5541f} }, +/**/ {{0x335a1c1b, 0xbfbcc9f4} }, +/**/ {{0xbac0061f, 0x3fb45bc6} }, +/**/ {{0x2b3853b6, 0x3fb2fc84} } }, +/**/ {{{0x00000000, 0x3fb80000} }, +/**/ {{0x2602f10f, 0x3fb7ee18} }, +/**/ {{0x4c0c3d98, 0xbc5cfb65} }, +/**/ {{0x96acfacc, 0x3fefb8a0} }, +/**/ {{0x18495af3, 0xbc82962e} }, +/**/ {{0x46635c89, 0xbfb79568} }, +/**/ {{0xa6bfd498, 0x3c5ac468} }, +/**/ {{0x2037b997, 0xbfd43b8f} }, +/**/ {{0xe2f12373, 0xbc72ad53} }, +/**/ {{0x7900c4ee, 0x3fb6f885} }, +/**/ {{0x0aef1f9d, 0x3c53145d} }, +/**/ {{0x4409ba0e, 0x3fc65c1f} }, +/**/ {{0x1d176e0c, 0xbfb61b65} }, +/**/ {{0x8ad65152, 0xbfbc2473} }, +/**/ {{0x7bc246c1, 0x3fb5033f} }, +/**/ {{0x6db30b46, 0x3fb239e9} } }, +/**/ {{{0x00000000, 0x3fb90000} }, +/**/ {{0x4478fb28, 0x3fb8ebc5} }, +/**/ {{0x0cad24cc, 0x3c473288} }, +/**/ {{0xeedcd6d7, 0x3fefb29c} }, +/**/ {{0x23ea50f0, 0x3c8efa9e} }, +/**/ {{0x6ae09982, 0xbfb887a7} }, +/**/ {{0x53801511, 0x3c5b2275} }, +/**/ {{0x3da0757c, 0xbfd42427} }, +/**/ {{0x311c7ac8, 0xbc7199e5} }, +/**/ {{0x4388717b, 0x3fb7d6cf} }, +/**/ {{0x3dd070b4, 0xbc5c4eb2} }, +/**/ {{0xe6c2b5f3, 0x3fc618a7} }, +/**/ {{0x00313569, 0xbfb6de12} }, +/**/ {{0xb6316619, 0xbfbb79d2} }, +/**/ {{0x61af5c21, 0x3fb5a3ca} }, +/**/ {{0x26e60289, 0x3fb17263} } }, +/**/ {{{0x00000000, 0x3fba0000} }, +/**/ {{0x53cfdcf1, 0x3fb9e941} }, +/**/ {{0x1d69c47e, 0x3c5a332e} }, +/**/ {{0xdace3776, 0x3fefac5c} }, +/**/ {{0x1ad91ab5, 0xbc8c9a78} }, +/**/ {{0x8054ad75, 0xbfb978c8} }, +/**/ {{0x8ed66c17, 0xbc5e35b8} }, +/**/ {{0x665afed1, 0xbfd40be2} }, +/**/ {{0x08ef10fb, 0x3c62eeef} }, +/**/ {{0x13c989d2, 0x3fb8b26b} }, +/**/ {{0xbfeab3ba, 0x3c329f11} }, +/**/ {{0x93c8f97c, 0x3fc5d2ef} }, +/**/ {{0x30234881, 0xbfb79c03} }, +/**/ {{0xd0f650c8, 0xbfbaca49} }, +/**/ {{0xce2dcccc, 0x3fb63d3c} }, +/**/ {{0x26fb0af2, 0x3fb0a650} } }, +/**/ {{{0x00000000, 0x3fbb0000} }, +/**/ {{0x71c722b8, 0x3fbae68a} }, +/**/ {{0x6910b9db, 0x3c4c014e} }, +/**/ {{0xa34ef42b, 0x3fefa5e0} }, +/**/ {{0xeb56d5b9, 0xbc836583} }, +/**/ {{0x3b881779, 0xbfba68c1} }, +/**/ {{0x13a09314, 0xbc473a0d} }, +/**/ {{0x538e939c, 0xbfd3f2c3} }, +/**/ {{0xee53e648, 0xbc68ed49} }, +/**/ {{0xa7d45973, 0x3fb98b42} }, +/**/ {{0x461ca7c4, 0xbc523943} }, +/**/ {{0xb0f2e2bb, 0x3fc58b04} }, +/**/ {{0x1c9d23dc, 0xbfb85517} }, +/**/ {{0x3e3b5a66, 0xbfba1612} }, +/**/ {{0x7ef1d0b9, 0x3fb6cf6f} }, +/**/ {{0x6617b315, 0x3fafac21} } }, +/**/ {{{0x00000000, 0x3fbc0000} }, +/**/ {{0xbe6f07c3, 0x3fbbe39e} }, +/**/ {{0x29a05987, 0x3c5f7b8f} }, +/**/ {{0x93bb9192, 0x3fef9f28} }, +/**/ {{0x7cd1bdab, 0x3c78260b} }, +/**/ {{0x72759741, 0xbfbb5787} }, +/**/ {{0xa6767247, 0x3c52f93f} }, +/**/ {{0xd45bbe91, 0xbfd3d8cc} }, +/**/ {{0x2edc0762, 0x3c664839} }, +/**/ {{0x4fa31d26, 0x3fba6140} }, +/**/ {{0x97891510, 0x3c400647} }, +/**/ {{0x0668fd66, 0x3fc540f6} }, +/**/ {{0xcb2f6e8f, 0xbfb9092d} }, +/**/ {{0x8d902073, 0xbfb95d66} }, +/**/ {{0x99c53d16, 0x3fb75a3e} }, +/**/ {{0x8f475e61, 0x3fae040c} } }, +/**/ {{{0x00000000, 0x3fbd0000} }, +/**/ {{0x5c3cca32, 0x3fbce07c} }, +/**/ {{0x425918a7, 0x3c4138e6} }, +/**/ {{0xf9f6d421, 0x3fef9834} }, +/**/ {{0x8c22a239, 0x3c6f3089} }, +/**/ {{0x1d4e69a5, 0xbfbc4511} }, +/**/ {{0xd2083ce8, 0x3c254c0f} }, +/**/ {{0xcd488978, 0xbfd3be01} }, +/**/ {{0x6362ec0f, 0x3c5612db} }, +/**/ {{0xf0d94873, 0x3fbb344e} }, +/**/ {{0xfdf7db72, 0xbc182beb} }, +/**/ {{0xb9d86c04, 0x3fc4f4d2} }, +/**/ {{0xdf238807, 0xbfb9b828} }, +/**/ {{0x5f93ffd6, 0xbfb8a082} }, +/**/ {{0xb6650b0c, 0x3fb7dd89} }, +/**/ {{0xb62676ef, 0x3fac5526} } }, +/**/ {{{0x00000000, 0x3fbe0000} }, +/**/ {{0x701eba6e, 0x3fbddd21} }, +/**/ {{0xcd76fe58, 0x3c594eff} }, +/**/ {{0x266112ba, 0x3fef9106} }, +/**/ {{0x6b7e18b1, 0x3c74c302} }, +/**/ {{0x5777816c, 0xbfbd3154} }, +/**/ {{0x1f9dbddd, 0x3c5dc7e4} }, +/**/ {{0x37a90881, 0xbfd3a265} }, +/**/ {{0xeb7ba840, 0xbc75bd61} }, +/**/ {{0x0a52514b, 0x3fbc045a} }, +/**/ {{0xcff49a99, 0xbc35ca88} }, +/**/ {{0x498eeb56, 0x3fc4a6aa} }, +/**/ {{0xa09232cf, 0xbfba61eb} }, +/**/ {{0x4a464027, 0xbfb7dfa2} }, +/**/ {{0xe633c053, 0x3fb85933} }, +/**/ {{0x3f920107, 0x3faaa036} } }, +/**/ {{{0x00000000, 0x3fbf0000} }, +/**/ {{0x2190043b, 0x3fbed98c} }, +/**/ {{0x592c7b13, 0xbc23a598} }, +/**/ {{0x6bcf4ad8, 0x3fef899c} }, +/**/ {{0x912c09b0, 0x3c55fd73} }, +/**/ {{0x607f91a0, 0xbfbe1c47} }, +/**/ {{0x5b5db022, 0x3c576677} }, +/**/ {{0x21046f5f, 0xbfd385fa} }, +/**/ {{0x4487f4b8, 0x3c7f01c3} }, +/**/ {{0xb77f2d51, 0x3fbcd14d} }, +/**/ {{0x30a2ccfe, 0x3c57a86d} }, +/**/ {{0x8782b530, 0x3fc4568c} }, +/**/ {{0x02b7ad2d, 0xbfbb065b} }, +/**/ {{0xbd215555, 0xbfb71b03} }, +/**/ {{0xb9c1c1de, 0x3fb8cd23} }, +/**/ {{0x8dbfa69b, 0x3fa8e602} } }, +/**/ {{{0x00000000, 0x3fc00000} }, +/**/ {{0x9aac2f6e, 0x3fbfd5ba} }, +/**/ {{0x86760c17, 0xbc4cd376} }, +/**/ {{0x1f81f820, 0x3fef81f8} }, +/**/ {{0x1f81f820, 0xbc8f81f8} }, +/**/ {{0x9d0dc11b, 0xbfbf05e0} }, +/**/ {{0x1d821725, 0xbc35a199} }, +/**/ {{0xaa76e1d7, 0xbfd368c3} }, +/**/ {{0xc796f8cd, 0xbc672d4c} }, +/**/ {{0xb391c2e3, 0x3fbd9b16} }, +/**/ {{0x8086c51d, 0x3c58051b} }, +/**/ {{0x94488c86, 0x3fc40489} }, +/**/ {{0xa98401c8, 0xbfbba55d} }, +/**/ {{0xe5127e64, 0xbfb652e4} }, +/**/ {{0x442e53ae, 0x3fb93943} }, +/**/ {{0x86286f75, 0x3fa72753} } }, +/**/ {{{0x00000000, 0x3fc08000} }, +/**/ {{0x84212b3e, 0x3fc068d5} }, +/**/ {{0x83019bfd, 0xbc69e2d2} }, +/**/ {{0x991bb133, 0x3fef7a19} }, +/**/ {{0x66627723, 0x3c7a956a} }, +/**/ {{0x97c8e137, 0xbfbfee16} }, +/**/ {{0x66dbe7af, 0x3c4d9399} }, +/**/ {{0x0810323a, 0xbfd34ac5} }, +/**/ {{0x6bc6c512, 0x3c6a1a57} }, +/**/ {{0x5c75a6f9, 0x3fbe61a2} }, +/**/ {{0xd75c8f85, 0xbc492b99} }, +/**/ {{0xd9fa3f20, 0x3fc3b0b1} }, +/**/ {{0xee66d309, 0xbfbc3edb} }, +/**/ {{0x905eeb33, 0xbfb58784} }, +/**/ {{0x1c65bb14, 0x3fb99d80} }, +/**/ {{0x18a09884, 0x3fa564f1} } }, +/**/ {{{0x00000000, 0x3fc10000} }, +/**/ {{0xccf40882, 0x3fc0e6ad} }, +/**/ {{0x1bb98d0d, 0xbc6d71a3} }, +/**/ {{0x32978bad, 0x3fef7201} }, +/**/ {{0x599381e9, 0x3c816476} }, +/**/ {{0x011b81fd, 0xbfc06a70} }, +/**/ {{0x9ba697ca, 0xbc422f5d} }, +/**/ {{0x802fc0a5, 0xbfd32c01} }, +/**/ {{0x08a20868, 0x3c7d8e47} }, +/**/ {{0xb59597fe, 0x3fbf24de} }, +/**/ {{0x410d31eb, 0xbc43288f} }, +/**/ {{0x070feb24, 0x3fc35b16} }, +/**/ {{0xe4565b78, 0xbfbcd2bf} }, +/**/ {{0x128768c6, 0xbfb4b922} }, +/**/ {{0x5c42a097, 0x3fb9f9cb} }, +/**/ {{0xc7f97f2e, 0x3fa39fa2} } }, +/**/ {{{0x00000000, 0x3fc18000} }, +/**/ {{0x41060850, 0x3fc16465} }, +/**/ {{0x8ae7ea92, 0x3c66bcee} }, +/**/ {{0x483f492b, 0x3fef69af} }, +/**/ {{0x57db963e, 0xbc6e3280} }, +/**/ {{0xdacaa844, 0xbfc0dd19} }, +/**/ {{0xad7fc21e, 0xbc6133c7} }, +/**/ {{0x6addaea8, 0xbfd30c7c} }, +/**/ {{0x89161c76, 0xbc71443d} }, +/**/ {{0x6a6d3cd2, 0x3fbfe4ba} }, +/**/ {{0x423ee67a, 0x3c50d4b8} }, +/**/ {{0x092e569a, 0x3fc303c7} }, +/**/ {{0x5b11d3b6, 0xbfbd60f5} }, +/**/ {{0x283b5c55, 0xbfb3e7fd} }, +/**/ {{0x9d9a6ab7, 0x3fba4e19} }, +/**/ {{0x3487cc29, 0x3fa1d82f} } }, +/**/ {{{0x00000000, 0x3fc20000} }, +/**/ {{0xfb043727, 0x3fc1e1fa} }, +/**/ {{0x14dacf8c, 0xbc4b4859} }, +/**/ {{0x38a14f5e, 0x3fef6124} }, +/**/ {{0x001f6124, 0x3c798e9e} }, +/**/ {{0x59d3fb7c, 0xbfc14f04} }, +/**/ {{0x4cc99cb2, 0x3c531efa} }, +/**/ {{0x31219b34, 0xbfd2ec39} }, +/**/ {{0x6e004611, 0xbc618697} }, +/**/ {{0x68736312, 0x3fc05092} }, +/**/ {{0x8a06e4b5, 0x3c67aad4} }, +/**/ {{0x07eca5ec, 0x3fc2aad6} }, +/**/ {{0xe19fe31c, 0xbfbde969} }, +/**/ {{0xdb6b9127, 0xbfb31455} }, +/**/ {{0xf53dd9ee, 0x3fba9a62} }, +/**/ {{0xa8e4ede0, 0x3fa00f5b} } }, +/**/ {{{0x00000000, 0x3fc28000} }, +/**/ {{0x171a535c, 0x3fc25f6e} }, +/**/ {{0xbde1a310, 0x3c67c6d7} }, +/**/ {{0x64866d22, 0x3fef5860} }, +/**/ {{0xd1f6326c, 0x3c88c6ff} }, +/**/ {{0x13c11396, 0xbfc1c02b} }, +/**/ {{0xffeb1a0f, 0xbc51b469} }, +/**/ {{0x4c571b0f, 0xbfd2cb3b} }, +/**/ {{0x2fb0b163, 0x3c6e4f76} }, +/**/ {{0xf5c213ab, 0x3fc0ad06} }, +/**/ {{0xabea9e66, 0x3c625bf2} }, +/**/ {{0x5f93bbb2, 0x3fc25054} }, +/**/ {{0xc80a32c8, 0xbfbe6c0c} }, +/**/ {{0x678d0d1e, 0xbfb23e6c} }, +/**/ {{0xebf8ae4b, 0x3fbadea2} }, +/**/ {{0x527f133b, 0x3f9c8bd7} } }, +/**/ {{{0x00000000, 0x3fc30000} }, +/**/ {{0xb2fba1ff, 0x3fc2dcbd} }, +/**/ {{0x05561534, 0x3c58f287} }, +/**/ {{0x2ee76e94, 0x3fef4f64} }, +/**/ {{0xc6da5865, 0x3c80ec89} }, +/**/ {{0xb322f867, 0xbfc23089} }, +/**/ {{0x5fcd0d6f, 0x3c4c2b54} }, +/**/ {{0x45802261, 0xbfd2a986} }, +/**/ {{0x5ae78b8a, 0xbc79a132} }, +/**/ {{0x35a9d974, 0x3fc107b3} }, +/**/ {{0xb725e335, 0x3c5ef22d} }, +/**/ {{0x9bd98832, 0x3fc1f453} }, +/**/ {{0x2057aad4, 0xbfbee8cf} }, +/**/ {{0x1e1bc3a1, 0xbfb16681} }, +/**/ {{0x759c8f58, 0x3fbb1ad8} }, +/**/ {{0x0b15b4aa, 0x3f98f941} } }, +/**/ {{{0x00000000, 0x3fc38000} }, +/**/ {{0xedeb99a4, 0x3fc359e8} }, +/**/ {{0x4e4604c6, 0xbc6a5fd7} }, +/**/ {{0xfce28238, 0x3fef462f} }, +/**/ {{0xd90595d1, 0x3c83dc01} }, +/**/ {{0xf7edfa6d, 0xbfc2a01b} }, +/**/ {{0x4a3b5c9a, 0xbc6b11fb} }, +/**/ {{0xb4959402, 0xbfd2871d} }, +/**/ {{0x2fcf7ea3, 0xbc4a3702} }, +/**/ {{0xd8d7fe8c, 0x3fc1608f} }, +/**/ {{0xf8f1d41c, 0x3c61ac60} }, +/**/ {{0x729a89ca, 0x3fc196e5} }, +/**/ {{0xbec74f31, 0xbfbf5fa3} }, +/**/ {{0x4b6c9767, 0xbfb08cd4} }, +/**/ {{0xe624ce15, 0x3fbb4f05} }, +/**/ {{0xddb2020c, 0x3f956871} } }, +/**/ {{{0x00000000, 0x3fc40000} }, +/**/ {{0xe8c6626c, 0x3fc3d6ee} }, +/**/ {{0x0ce9281b, 0x3c661a3b} }, +/**/ {{0x35b0713c, 0x3fef3cc4} }, +/**/ {{0xe69ea094, 0x3c81d0a7} }, +/**/ {{0xb7d169f0, 0xbfc30edd} }, +/**/ {{0xae999b97, 0x3c6b3394} }, +/**/ {{0x3fd62b3c, 0xbfd26405} }, +/**/ {{0xc0736df9, 0x3c73e339} }, +/**/ {{0xe8e57ee3, 0x3fc1b795} }, +/**/ {{0x0a42c7f6, 0xbc6130dc} }, +/**/ {{0xbe93b8e5, 0x3fc1381b} }, +/**/ {{0x394e1bf7, 0xbfbfd07f} }, +/**/ {{0x37bb5315, 0xbfaf634c} }, +/**/ {{0xe501e57b, 0x3fbb7b30} }, +/**/ {{0x20503792, 0x3f91dae1} } }, +/**/ {{{0x00000000, 0x3fc48000} }, +/**/ {{0xc6092a9e, 0x3fc453ce} }, +/**/ {{0xb3a5a78b, 0x3c61f653} }, +/**/ {{0x4299ace8, 0x3fef3321} }, +/**/ {{0x3a742b30, 0xbc87414c} }, +/**/ {{0xde8b2323, 0xbfc37cca} }, +/**/ {{0x7b50aedf, 0x3c649378} }, +/**/ {{0x9b13f4d0, 0xbfd24040} }, +/**/ {{0xb7dc85c0, 0x3c7e271f} }, +/**/ {{0xc9024068, 0x3fc20cbe} }, +/**/ {{0x88ef3da7, 0x3c50921f} }, +/**/ {{0x7a1f1270, 0x3fc0d808} }, +/**/ {{0xf32d5436, 0xbfc01dab} }, +/**/ {{0x02e6f09c, 0xbfadaa6d} }, +/**/ {{0x5e9cd766, 0x3fbb9f62} }, +/**/ {{0xab964c04, 0x3f8ca3fe} } }, +/**/ {{{0x00000000, 0x3fc50000} }, +/**/ {{0xa9da4f17, 0x3fc4d087} }, +/**/ {{0xf1adf158, 0x3c61f323} }, +/**/ {{0x8eeb3352, 0x3fef2947} }, +/**/ {{0x8799a164, 0x3c871eb0} }, +/**/ {{0x6e36e75c, 0xbfc3e9df} }, +/**/ {{0x4e37666f, 0x3c541555} }, +/**/ {{0x87008bd0, 0xbfd21bd3} }, +/**/ {{0xc24ff75f, 0xbc609e14} }, +/**/ {{0x36860504, 0x3fc26004} }, +/**/ {{0x1ebc8c40, 0xbc58f8ca} }, +/**/ {{0xb9f4ead3, 0x3fc076bd} }, +/**/ {{0xed70ddd5, 0xbfc05012} }, +/**/ {{0x33e194b1, 0xbfabef8a} }, +/**/ {{0x7423a91f, 0x3fbbbba6} }, +/**/ {{0xdd99da12, 0x3f859e6a} } }, +/**/ {{{0x00000000, 0x3fc58000} }, +/**/ {{0xba11570a, 0x3fc54d18} }, +/**/ {{0xf2884073, 0x3c618282} }, +/**/ {{0x87eb4d7d, 0x3fef1f37} }, +/**/ {{0xedda13e6, 0x3c8476f0} }, +/**/ {{0x7f997c7c, 0xbfc45617} }, +/**/ {{0x6423ceda, 0xbc46bf5b} }, +/**/ {{0xd0784ec7, 0xbfd1f6c1} }, +/**/ {{0xd106a8e0, 0xbc74ec12} }, +/**/ {{0x4967338d, 0x3fc2b160} }, +/**/ {{0x61339c25, 0x3c5309c0} }, +/**/ {{0xa7f42962, 0x3fc0144d} }, +/**/ {{0x73dbaeec, 0xbfc07f71} }, +/**/ {{0x2aeda9a4, 0xbfaa3322} }, +/**/ {{0x69b152b3, 0x3fbbd00c} }, +/**/ {{0x4c782821, 0x3f7d4f90} } }, +/**/ {{{0x00000000, 0x3fc60000} }, +/**/ {{0x1e3ec26a, 0x3fc5c981} }, +/**/ {{0x2c010f3d, 0xbc5054ab} }, +/**/ {{0x9cce28eb, 0x3fef14f1} }, +/**/ {{0x2708cd6e, 0xbc8b7c25} }, +/**/ {{0x42678d07, 0xbfc4c16f} }, +/**/ {{0xc1560017, 0x3c5f55ba} }, +/**/ {{0x4fccc153, 0xbfd1d10f} }, +/**/ {{0x1bcc361d, 0x3c529588} }, +/**/ {{0x74979f8c, 0x3fc300cd} }, +/**/ {{0x0bc1e891, 0xbc6b1da5} }, +/**/ {{0xfbe70208, 0x3fbf6194} }, +/**/ {{0x4b1c266f, 0xbfc0abc5} }, +/**/ {{0x3b74e858, 0xbfa875b2} }, +/**/ {{0x92e46f11, 0x3fbbdca6} }, +/**/ {{0x9de94aef, 0x3f6f0b17} } }, +/**/ {{{0x00000000, 0x3fc68000} }, +/**/ {{0xffb3aa74, 0x3fc645bf} }, +/**/ {{0x677c2cb4, 0xbc3f536b} }, +/**/ {{0x3eaa4ed6, 0x3fef0a76} }, +/**/ {{0x0b06c761, 0x3c888c52} }, +/**/ {{0xfd884489, 0xbfc52be2} }, +/**/ {{0xbe5c728a, 0x3c67ec59} }, +/**/ {{0xe80e4e0a, 0xbfd1aabf} }, +/**/ {{0xe90c909e, 0xbc71320e} }, +/**/ {{0x864781ca, 0x3fc34e46} }, +/**/ {{0x126138ee, 0x3c42fcb3} }, +/**/ {{0x013b5d4f, 0x3fbe988d} }, +/**/ {{0x122409a2, 0xbfc0d50d} }, +/**/ {{0x7bb562c1, 0xbfa6b7b6} }, +/**/ {{0x3df8dee8, 0x3fbbe18a} }, +/**/ {{0x8809e1ef, 0x3f3e4009} } }, +/**/ {{{0x00000000, 0x3fc70000} }, +/**/ {{0x898933d9, 0x3fc6c1d4} }, +/**/ {{0x7603c427, 0xbc52954a} }, +/**/ {{0xe06cfb34, 0x3feeffc5} }, +/**/ {{0x379877c2, 0xbc85c037} }, +/**/ {{0x0f53a52c, 0xbfc5956f} }, +/**/ {{0xe566376c, 0x3c4d46a2} }, +/**/ {{0x86559c11, 0xbfd183d7} }, +/**/ {{0x64734c7f, 0x3c7d2520} }, +/**/ {{0xa80eddd5, 0x3fc399c6} }, +/**/ {{0x40fbef6f, 0x3c616c26} }, +/**/ {{0xf4b571a7, 0x3fbdcda7} }, +/**/ {{0x3fd42996, 0xbfc0fb48} }, +/**/ {{0x95c85118, 0xbfa4f9a9} }, +/**/ {{0x9d795df4, 0x3fbbdecf} }, +/**/ {{0xb85bf719, 0xbf672003} } }, +/**/ {{{0x00000000, 0x3fc78000} }, +/**/ {{0xe8a7d202, 0x3fc73dbd} }, +/**/ {{0x6d4a665d, 0xbc55ad0f} }, +/**/ {{0xf6ce5590, 0x3feef4e0} }, +/**/ {{0x556900ef, 0xbc833df6} }, +/**/ {{0xedcc9488, 0xbfc5fe0f} }, +/**/ {{0xd2b9e35c, 0x3c5078de} }, +/**/ {{0x210cab36, 0xbfd15c5a} }, +/**/ {{0xf55e532a, 0x3c67fa93} }, +/**/ {{0x5efd9a41, 0x3fc3e349} }, +/**/ {{0xc8573a12, 0xbc6cf709} }, +/**/ {{0x6c903aef, 0x3fbd010a} }, +/**/ {{0x20571328, 0xbfc11e77} }, +/**/ {{0x9a1875dd, 0xbfa33c04} }, +/**/ {{0xb09ec0ce, 0x3fbbd491} }, +/**/ {{0x35537a65, 0xbf78d197} } }, +/**/ {{{0x00000000, 0x3fc80000} }, +/**/ {{0x4bce5b02, 0x3fc7b97b} }, +/**/ {{0xb4f881ca, 0x3c5347b0} }, +/**/ {{0xf8458e02, 0x3feee9c7} }, +/**/ {{0x7ba71fe1, 0xbc616380} }, +/**/ {{0x26d69eeb, 0xbfc665c2} }, +/**/ {{0xfdb5eea8, 0xbc572a33} }, +/**/ {{0xb737e8f3, 0xbfd1344b} }, +/**/ {{0x62badf41, 0xbc757b70} }, +/**/ {{0x8b929b0b, 0x3fc42aca} }, +/**/ {{0x7a8b7d91, 0x3c43cdb5} }, +/**/ {{0xf683981c, 0x3fbc32d8} }, +/**/ {{0xd22d5ecc, 0xbfc13e9a} }, +/**/ {{0xd35c8c33, 0xbfa17f3e} }, +/**/ {{0x2a73307e, 0x3fbbc2ee} }, +/**/ {{0x2bddc834, 0xbf82ee04} } }, +/**/ {{{0x00000000, 0x3fc88000} }, +/**/ {{0xe398ebc8, 0x3fc8350b} }, +/**/ {{0x32b9c90d, 0xbc55a913} }, +/**/ {{0x5cfce04c, 0x3feede7b} }, +/**/ {{0x3b51a72f, 0x3c8507c2} }, +/**/ {{0x6067718b, 0xbfc6cc82} }, +/**/ {{0xdbfc430f, 0x3c6d00ca} }, +/**/ {{0x4fbf6fe8, 0xbfd10bb0} }, +/**/ {{0x53749c72, 0x3c321748} }, +/**/ {{0x699a36ad, 0x3fc47046} }, +/**/ {{0x3994d40c, 0xbc63924c} }, +/**/ {{0x0dfb7483, 0x3fbb6338} }, +/**/ {{0x42ee5820, 0xbfc15bb5} }, +/**/ {{0x385194fc, 0xbf9f879b} }, +/**/ {{0x57d040e9, 0x3fbbaa05} }, +/**/ {{0xada71ca0, 0xbf895566} } }, +/**/ {{{0x00000000, 0x3fc90000} }, +/**/ {{0xe2879c29, 0x3fc8b06e} }, +/**/ {{0x30308c4f, 0xbc6118cd} }, +/**/ {{0x9ec57f51, 0x3feed2fb} }, +/**/ {{0xc0d106ba, 0xbc83fdc5} }, +/**/ {{0x58b40d27, 0xbfc7324d} }, +/**/ {{0xfc062163, 0x3c68e240} }, +/**/ {{0xf8b8a2bf, 0xbfd0e28b} }, +/**/ {{0x64c55b39, 0xbc7b8d8a} }, +/**/ {{0x8ff46730, 0x3fc4b3b9} }, +/**/ {{0x988563da, 0xbc5af146} }, +/**/ {{0x1277a10d, 0x3fba924c} }, +/**/ {{0x2bbfd54d, 0xbfc175c9} }, +/**/ {{0x6c522340, 0xbf9c1448} }, +/**/ {{0x044f2f6b, 0x3fbb89fa} }, +/**/ {{0xaaecc742, 0xbf8f9cc7} } }, +/**/ {{{0x00000000, 0x3fc98000} }, +/**/ {{0x7d050272, 0x3fc92ba3} }, +/**/ {{0xd0ff4764, 0xbc60d3de} }, +/**/ {{0x390b6afe, 0x3feec749} }, +/**/ {{0x4e3659ca, 0xbc5c3d17} }, +/**/ {{0xe659b3de, 0xbfc7971f} }, +/**/ {{0x373f554d, 0x3c4cab11} }, +/**/ {{0xc6b052a4, 0xbfd0b8e2} }, +/**/ {{0x6f3b74bc, 0x3c7da014} }, +/**/ {{0xf0432146, 0x3fc4f520} }, +/**/ {{0xa8027290, 0xbc6769ad} }, +/**/ {{0x3e17b570, 0x3fb9c039} }, +/**/ {{0x0d8833a4, 0xbfc18cda} }, +/**/ {{0x4627d340, 0xbf98a567} }, +/**/ {{0x5e42eff7, 0x3fbb62f1} }, +/**/ {{0x7ee3bed3, 0xbf92e10a} } }, +/**/ {{{0x00000000, 0x3fca0000} }, +/**/ {{0xe96c8626, 0x3fc9a6a8} }, +/**/ {{0xe7b4348e, 0x3c4cf601} }, +/**/ {{0xa8c932d7, 0x3feebb64} }, +/**/ {{0x79aae302, 0x3c20538d} }, +/**/ {{0xf88295fe, 0xbfc7faf6} }, +/**/ {{0x932909e9, 0xbc687a81} }, +/**/ {{0xd3f5a07b, 0xbfd08eb8} }, +/**/ {{0xfb7d6aaa, 0xbc620a05} }, +/**/ {{0xd6814372, 0x3fc53479} }, +/**/ {{0x0a0c6620, 0xbc53c682} }, +/**/ {{0x9c562d77, 0x3fb8ed23} }, +/**/ {{0x2cdd89fd, 0xbfc1a0ec} }, +/**/ {{0xfec9df82, 0xbf953bd4} }, +/**/ {{0xd9d3f0f6, 0x3fbb3512} }, +/**/ {{0x4534ccf5, 0xbf95e1ab} } }, +/**/ {{{0x00000000, 0x3fca8000} }, +/**/ {{0x601081a6, 0x3fca217e} }, +/**/ {{0xa60af374, 0xbc60def8} }, +/**/ {{0x6c7ba732, 0x3feeaf4e} }, +/**/ {{0xe91fffe1, 0x3c89fa72} }, +/**/ {{0x970642c3, 0xbfc85dcf} }, +/**/ {{0x5b7f0ad0, 0xbc5732c2} }, +/**/ {{0x3fe5c74d, 0xbfd06412} }, +/**/ {{0x4a82f9b1, 0xbc7d0053} }, +/**/ {{0xe882973d, 0x3fc571c1} }, +/**/ {{0x9090f12c, 0x3c59d9a3} }, +/**/ {{0x00f5d0e0, 0x3fb8192f} }, +/**/ {{0x8db53983, 0xbfc1b204} }, +/**/ {{0xbdd7b47e, 0xbf91d869} }, +/**/ {{0x1355a903, 0x3fbb0088} }, +/**/ {{0x724a2ad9, 0xbf98cf57} } }, +/**/ {{{0x00000000, 0x3fcb0000} }, +/**/ {{0x1b403279, 0x3fca9c23} }, +/**/ {{0xe89cca85, 0x3c60e8bb} }, +/**/ {{0x04157b4f, 0x3feea307} }, +/**/ {{0xfd8bf1f0, 0x3c8ad743} }, +/**/ {{0xe285e2fd, 0xbfc8bfa6} }, +/**/ {{0x9c834c8f, 0xbc6ce765} }, +/**/ {{0x2e38fd26, 0xbfd038f3} }, +/**/ {{0xef212a80, 0x3c6a42ec} }, +/**/ {{0x255d65d5, 0x3fc5acf7} }, +/**/ {{0xbe486771, 0xbc619fba} }, +/**/ {{0xff244e15, 0x3fb7447e} }, +/**/ {{0xeed71b69, 0xbfc1c028} }, +/**/ {{0xaceecf68, 0xbf8cf7f0} }, +/**/ {{0xb0ee161b, 0x3fbac57c} }, +/**/ {{0xefc8f53e, 0xbf9ba92d} } }, +/**/ {{{0x00000000, 0x3fcb8000} }, +/**/ {{0x574d780c, 0x3fcb1696} }, +/**/ {{0xfc15a673, 0xbc585ab8} }, +/**/ {{0xf0f2da5a, 0x3fee968e} }, +/**/ {{0x69710f0d, 0xbc6fffe1} }, +/**/ {{0x148444b5, 0xbfc9207a} }, +/**/ {{0x1802fa91, 0xbc66661a} }, +/**/ {{0xc65096ca, 0xbfd00d5f} }, +/**/ {{0x8920e744, 0x3c7f2a2e} }, +/**/ {{0xe4be288d, 0x3fc5e617} }, +/**/ {{0x99be934f, 0x3c67fa48} }, +/**/ {{0xe0d4c87a, 0x3fb66f36} }, +/**/ {{0xc5179ce8, 0xbfc1cb5f} }, +/**/ {{0x1011bb6c, 0xbf864e9c} }, +/**/ {{0x43a75476, 0x3fba841e} }, +/**/ {{0x845fc859, 0xbf9e6e5b} } }, +/**/ {{{0x00000000, 0x3fcc0000} }, +/**/ {{0x529260a2, 0x3fcb90d7} }, +/**/ {{0xd2e0e5ab, 0x3c217b10} }, +/**/ {{0xb5ccf172, 0x3fee89e6} }, +/**/ {{0x153be26a, 0x3c820357} }, +/**/ {{0x7f79bfd6, 0xbfc98046} }, +/**/ {{0xf5d60955, 0xbc0799ee} }, +/**/ {{0x650d32f4, 0xbfcfc2b8} }, +/**/ {{0x4d01b49e, 0xbc6b59de} }, +/**/ {{0xd625e475, 0x3fc61d22} }, +/**/ {{0xe23c6105, 0xbc68013f} }, +/**/ {{0x9e54f300, 0x3fb59979} }, +/**/ {{0x365c2b85, 0xbfc1d3b0} }, +/**/ {{0x0afb6b97, 0xbf7f6cc9} }, +/**/ {{0x28035c12, 0x3fba3c9c} }, +/**/ {{0x8331488a, 0xbfa08f0d} } }, +/**/ {{{0x00000000, 0x3fcc8000} }, +/**/ {{0x4d768467, 0x3fcc0ae5} }, +/**/ {{0xf55f26dc, 0xbc604cdb} }, +/**/ {{0xd6ad70cb, 0x3fee7d0e} }, +/**/ {{0xee20d17d, 0x3c8e6761} }, +/**/ {{0x8ee3fcf8, 0xbfc9df09} }, +/**/ {{0xed723e81, 0x3c62daa3} }, +/**/ {{0x3efdc9b4, 0xbfcf69d9} }, +/**/ {{0x85a20110, 0x3c6c7b6f} }, +/**/ {{0x0013c661, 0x3fc65217} }, +/**/ {{0xab1387be, 0xbc678a0c} }, +/**/ {{0xd61f268e, 0x3fb4c369} }, +/**/ {{0x146d6110, 0xbfc1d922} }, +/**/ {{0xc0b0ed0a, 0xbf726199} }, +/**/ {{0x6629c856, 0x3fb9ef27} }, +/**/ {{0xc1ea955d, 0xbfa1dbda} } }, +/**/ {{{0x00000000, 0x3fcd0000} }, +/**/ {{0x8a742e6e, 0x3fcc84bf} }, +/**/ {{0x0682ea26, 0xbc595bdd} }, +/**/ {{0xd8e205ea, 0x3fee7007} }, +/**/ {{0x7b2991c1, 0x3c816199} }, +/**/ {{0xc751a854, 0xbfca3cc0} }, +/**/ {{0x4efbc78c, 0xbc66a2fd} }, +/**/ {{0x76f43baa, 0xbfcf102a} }, +/**/ {{0x38d996b1, 0x3c6cfc38} }, +/**/ {{0xbf1a9ad6, 0x3fc684f3} }, +/**/ {{0x7c3b6690, 0x3c52eaf7} }, +/**/ {{0xc4ebba84, 0x3fb3ed29} }, +/**/ {{0xd79a6a53, 0xbfc1dbbd} }, +/**/ {{0xfd09510e, 0xbf55fa5b} }, +/**/ {{0x91c74d50, 0x3fb99bf2} }, +/**/ {{0x3002c38b, 0xbfa31d41} } }, +/**/ {{{0x00000000, 0x3fcd8000} }, +/**/ {{0x4e1d5395, 0x3fccfe65} }, +/**/ {{0x3f71eafb, 0x3c647b9a} }, +/**/ {{0x42efd10e, 0x3fee62d2} }, +/**/ {{0xa021973e, 0x3c850a65} }, +/**/ {{0xc66a1be4, 0xbfca9969} }, +/**/ {{0x3753f036, 0x3c326164} }, +/**/ {{0x6b550477, 0xbfceb5b4} }, +/**/ {{0xa3ef610f, 0xbc64cacb} }, +/**/ {{0xc4e2c295, 0x3fc6b5b8} }, +/**/ {{0x98b2ac7f, 0x3c66b228} }, +/**/ {{0x3e03bb80, 0x3fb316db} }, +/**/ {{0x99312ba1, 0xbfc1db8c} }, +/**/ {{0x8536556f, 0x3f5ce5b0} }, +/**/ {{0xa9b62abf, 0x3fb94331} }, +/**/ {{0xb36f42fc, 0xbfa452f3} } }, +/**/ {{{0x00000000, 0x3fce0000} }, +/**/ {{0xdf205736, 0x3fcd77d5} }, +/**/ {{0x1534597e, 0x3c6c648d} }, +/**/ {{0x9c86d7c6, 0x3fee556e} }, +/**/ {{0x34c9abfd, 0xbc830c25} }, +/**/ {{0x42f10c89, 0xbfcaf502} }, +/**/ {{0xf8576d95, 0xbc411261} }, +/**/ {{0x7b1596d9, 0xbfce5a7f} }, +/**/ {{0x78f7ae18, 0x3c574baa} }, +/**/ {{0x171949b1, 0x3fc6e466} }, +/**/ {{0x52f9c399, 0xbc6ff86b} }, +/**/ {{0xa3d6f244, 0x3fb2409f} }, +/**/ {{0x0dceacbf, 0xbfc1d898} }, +/**/ {{0xdc715080, 0x3f73c3b6} }, +/**/ {{0xf78687ab, 0x3fb8e519} }, +/**/ {{0x6b1251ec, 0xbfa57cac} } }, +/**/ {{{0x00000000, 0x3fce8000} }, +/**/ {{0x864c9d9e, 0x3fcdf110} }, +/**/ {{0x53bf4781, 0xbc35818b} }, +/**/ {{0x6e7576a6, 0x3fee47dd} }, +/**/ {{0x24b84595, 0x3c89d322} }, +/**/ {{0x0cc64717, 0xbfcb4f88} }, +/**/ {{0x44bb97a3, 0xbc624035} }, +/**/ {{0x046e8a3b, 0xbfcdfe94} }, +/**/ {{0xd278da00, 0xbc6078ee} }, +/**/ {{0x0e4ccbb7, 0x3fc710fc} }, +/**/ {{0x1da51f71, 0xbc58c89c} }, +/**/ {{0xe0d7022a, 0x3fb16a97} }, +/**/ {{0x7f8b58f8, 0xbfc1d2ea} }, +/**/ {{0xaf259d18, 0x3f800ed5} }, +/**/ {{0xeefd29c7, 0x3fb881e1} }, +/**/ {{0xae6aa0c1, 0xbfa69a2c} } }, +/**/ {{{0x00000000, 0x3fcf0000} }, +/**/ {{0x8e96ec4d, 0x3fce6a14} }, +/**/ {{0x2029f765, 0x3c6866b2} }, +/**/ {{0x429bd423, 0x3fee3a1f} }, +/**/ {{0x48961291, 0xbc86174a} }, +/**/ {{0x0ce18ad9, 0xbfcba8f9} }, +/**/ {{0xb50eb15d, 0x3c62e3e9} }, +/**/ {{0x63927806, 0xbfcda1fa} }, +/**/ {{0x8073bacf, 0xbbed7b15} }, +/**/ {{0x54b8d3bb, 0x3fc73b7b} }, +/**/ {{0x74869c1c, 0x3c602afb} }, +/**/ {{0x60993bd6, 0x3fb094e4} }, +/**/ {{0xc806a157, 0xbfc1ca8e} }, +/**/ {{0xa854d278, 0x3f862263} }, +/**/ {{0x0d9e7452, 0x3fb819c1} }, +/**/ {{0x08743869, 0xbfa7ab3d} } }, +/**/ {{{0x00000000, 0x3fcf8000} }, +/**/ {{0x451d980d, 0x3fcee2e1} }, +/**/ {{0x8c46ba91, 0xbc59a770} }, +/**/ {{0xa3df5666, 0x3fee2c34} }, +/**/ {{0x19a92865, 0xbc8ef949} }, +/**/ {{0x454a9009, 0xbfcc0153} }, +/**/ {{0xda1123ca, 0x3c5572bf} }, +/**/ {{0xf169cd42, 0xbfcd44ba} }, +/**/ {{0xf1052e0a, 0xbc6db0f2} }, +/**/ {{0xe5006ad1, 0x3fc763e4} }, +/**/ {{0x3e902796, 0x3c66e21a} }, +/**/ {{0x12812c7d, 0x3faf7f4a} }, +/**/ {{0x4a558d9d, 0xbfc1bf90} }, +/**/ {{0x2be7fbfd, 0x3f8c1b52} }, +/**/ {{0xba5b0263, 0x3fb7acef} }, +/**/ {{0x2dddf4e5, 0xbfa8afad} } }, +/**/ {{{0x00000000, 0x3fd00000} }, +/**/ {{0xf92c80dd, 0x3fcf5b75} }, +/**/ {{0x3cf7afbd, 0x3c68ab6e} }, +/**/ {{0x1e1e1e1e, 0x3fee1e1e} }, +/**/ {{0x1e1e1e1e, 0x3c6e1e1e} }, +/**/ {{0xd10d4986, 0xbfcc5894} }, +/**/ {{0xc4a6886a, 0x3c5f00e2} }, +/**/ {{0x0253d27e, 0xbfcce6de} }, +/**/ {{0x3c5fce89, 0xbc65d764} }, +/**/ {{0x08d88b02, 0x3fc78a3a} }, +/**/ {{0x32bd57e4, 0x3c4fc5d6} }, +/**/ {{0x6a622b44, 0x3fadd5f2} }, +/**/ {{0xecd7c4e0, 0xbfc1b1fa} }, +/**/ {{0x1fc8b549, 0x3f90fc3e} }, +/**/ {{0x25728acf, 0x3fb73ba7} }, +/**/ {{0xeeba051f, 0xbfa9a753} } }, +/**/ {{{0x00000000, 0x3fd04000} }, +/**/ {{0xfc40dbe4, 0x3fcfd3d1} }, +/**/ {{0xf3a1c5ea, 0x3c437146} }, +/**/ {{0x3e228818, 0x3fee0fdc} }, +/**/ {{0x8c042ef5, 0xbc62e075} }, +/**/ {{0xe42a71b9, 0xbfccaebb} }, +/**/ {{0x8025fd1d, 0xbc69fa0a} }, +/**/ {{0xe4ed28e5, 0xbfcc886b} }, +/**/ {{0x7604b95a, 0xbc59ccc3} }, +/**/ {{0x57a32fb9, 0x3fc7ae7c} }, +/**/ {{0xe36848c2, 0x3c67393b} }, +/**/ {{0x5a1b7b6f, 0x3fac2dff} }, +/**/ {{0x12f690d4, 0xbfc1a1db} }, +/**/ {{0xa575dc1d, 0x3f93dc65} }, +/**/ {{0x28a107f6, 0x3fb6c621} }, +/**/ {{0x23d2c35f, 0xbfaa920f} } }, +/**/ {{{0x00000000, 0x3fd08000} }, +/**/ {{0x510665b6, 0x3fd025fa} }, +/**/ {{0x6832fa48, 0xbc7672df} }, +/**/ {{0x9196b776, 0x3fee016f} }, +/**/ {{0xb14efc08, 0x3c81da3a} }, +/**/ {{0xcb847375, 0xbfcd03c6} }, +/**/ {{0xfc4c6f52, 0xbc6819f2} }, +/**/ {{0xe0dbf8a5, 0xbfcc296c} }, +/**/ {{0x27fb1c17, 0xbc55cc84} }, +/**/ {{0xb4fbbf40, 0x3fc7d0ad} }, +/**/ {{0x41b71641, 0x3c6378b3} }, +/**/ {{0x440404cd, 0x3faa87ad} }, +/**/ {{0x96d156a8, 0xbfc18f3d} }, +/**/ {{0x9ef40490, 0x3f96ad9b} }, +/**/ {{0x27a95e14, 0x3fb64c98} }, +/**/ {{0x97cfdce0, 0xbfab6fc3} } }, +/**/ {{{0x00000000, 0x3fd0c000} }, +/**/ {{0xa03d6291, 0x3fd061ee} }, +/**/ {{0xdb154301, 0xbc45f760} }, +/**/ {{0xa6f82a61, 0x3fedf2d8} }, +/**/ {{0x560866af, 0xbc6cedbb} }, +/**/ {{0xecc8c02c, 0xbfcd57b3} }, +/**/ {{0x85b9541c, 0x3c641512} }, +/**/ {{0x35a209c0, 0xbfcbc9e9} }, +/**/ {{0x4914a5d1, 0x3c65bfd8} }, +/**/ {{0x4f358b07, 0x3fc7f0d0} }, +/**/ {{0x3f47a5cc, 0xbc60dc70} }, +/**/ {{0x50af01c1, 0x3fa8e337} }, +/**/ {{0xc2daf61b, 0xbfc17a2f} }, +/**/ {{0x57b649f0, 0x3f996f63} }, +/**/ {{0xf14fef28, 0x3fb5cf46} }, +/**/ {{0xec5a22c2, 0xbfac405c} } }, +/**/ {{{0x00000000, 0x3fd10000} }, +/**/ {{0x97d86362, 0x3fd09dc5} }, +/**/ {{0x390cb865, 0x3c762e47} }, +/**/ {{0x0d8b5ae6, 0x3fede418} }, +/**/ {{0x23f66cf0, 0x3c719298} }, +/**/ {{0xc655a596, 0xbfcdaa81} }, +/**/ {{0x6a90480b, 0x3c666d0d} }, +/**/ {{0x1974fd6c, 0xbfcb69e9} }, +/**/ {{0xec28723f, 0xbc68e199} }, +/**/ {{0x9dcd2641, 0x3fc80ee6} }, +/**/ {{0x45b4bb82, 0x3c37ccfe} }, +/**/ {{0x64b143be, 0x3fa740d7} }, +/**/ {{0x4b6b7330, 0xbfc162bf} }, +/**/ {{0x7a20d203, 0x3f9c2147} }, +/**/ {{0xa0d6b625, 0x3fb54e68} }, +/**/ {{0x7b6e81ad, 0xbfad03cd} } }, +/**/ {{{0x00000000, 0x3fd14000} }, +/**/ {{0xe509acb3, 0x3fd0d97e} }, +/**/ {{0x7bd5a3eb, 0x3c747c31} }, +/**/ {{0x554f6dcf, 0x3fedd52e} }, +/**/ {{0xddcd060b, 0xbc75c686} }, +/**/ {{0xef1cb578, 0xbfcdfc2e} }, +/**/ {{0xd1677d50, 0xbc46ae20} }, +/**/ {{0xb81cdb34, 0xbfcb0974} }, +/**/ {{0xda61c86c, 0x3c36ed8e} }, +/**/ {{0x5fcd53c1, 0x3fc82af3} }, +/**/ {{0x57b559e7, 0xbc424fe5} }, +/**/ {{0x17013aef, 0x3fa5a0c6} }, +/**/ {{0x484940dd, 0xbfc148fa} }, +/**/ {{0x1737ca6d, 0x3f9ec2da} }, +/**/ {{0x800ba495, 0x3fb4ca38} }, +/**/ {{0x35128042, 0xbfadba0e} } }, +/**/ {{{0x00000000, 0x3fd18000} }, +/**/ {{0x362431ca, 0x3fd1151a} }, +/**/ {{0xc9077b9f, 0xbc74dc8d} }, +/**/ {{0x0ef1f116, 0x3fedc61c} }, +/**/ {{0x2d41c166, 0xbc8fe39f} }, +/**/ {{0x1681d2c9, 0xbfce4cba} }, +/**/ {{0x369a3c18, 0x3c340fb4} }, +/**/ {{0x31d921e2, 0xbfcaa894} }, +/**/ {{0x64c48da4, 0x3c6bf59e} }, +/**/ {{0x9a284cea, 0x3fc844f9} }, +/**/ {{0x629cfeb8, 0xbc563be0} }, +/**/ {{0xa7f26285, 0x3fa4033a} }, +/**/ {{0x2e2d72ea, 0xbfc12cef} }, +/**/ {{0x554d151d, 0x3fa0a9da} }, +/**/ {{0xe9f9174f, 0x3fb442f1} }, +/**/ {{0x799e467c, 0xbfae631e} } }, +/**/ {{{0x00000000, 0x3fd1c000} }, +/**/ {{0x3a9ce547, 0x3fd15097} }, +/**/ {{0x7f9ca328, 0xbc7796ba} }, +/**/ {{0xcbc2abaa, 0x3fedb6e1} }, +/**/ {{0xc39a4e7c, 0xbc823b7a} }, +/**/ {{0x0436f806, 0xbfce9c22} }, +/**/ {{0x885803cb, 0xbc64a5ec} }, +/**/ {{0x9a4c8963, 0xbfca474f} }, +/**/ {{0x6793b663, 0x3c671cf3} }, +/**/ {{0x9606243b, 0x3fc85cfc} }, +/**/ {{0x1dcd45ed, 0x3c5fd2b2} }, +/**/ {{0xf8cc655f, 0x3fa2686a} }, +/**/ {{0xc8460b94, 0xbfc10eac} }, +/**/ {{0x0d6eb5ba, 0x3fa1e9bc} }, +/**/ {{0x2e4749c2, 0x3fb3b8d0} }, +/**/ {{0xf0d19201, 0xbfaeff03} } }, +/**/ {{{0x00000000, 0x3fd20000} }, +/**/ {{0xa30bf178, 0x3fd18bf5} }, +/**/ {{0x748b1bf9, 0x3c630ca4} }, +/**/ {{0x1da7801e, 0x3feda780} }, +/**/ {{0x961ff896, 0xbc861ff8} }, +/**/ {{0x9814cb11, 0xbfceea65} }, +/**/ {{0x34cb01ca, 0xbc5f9845} }, +/**/ {{0xf76f9fa1, 0xbfc9e5ae} }, +/**/ {{0xa3ee6a86, 0x3c688b7a} }, +/**/ {{0xdf090624, 0x3fc872ff} }, +/**/ {{0x6fbad4bb, 0x3c31016f} }, +/**/ {{0x83fe02bc, 0x3fa0d08b} }, +/**/ {{0x31b98637, 0xbfc0ee42} }, +/**/ {{0x5b309f28, 0x3fa320e6} }, +/**/ {{0x755cbc43, 0x3fb32c0e} }, +/**/ {{0x5dea1ddb, 0xbfaf8dca} } }, +/**/ {{{0x00000000, 0x3fd24000} }, +/**/ {{0x212dd884, 0x3fd1c735} }, +/**/ {{0x78cb2f2e, 0xbc67d9ac} }, +/**/ {{0x971063d2, 0x3fed97f7} }, +/**/ {{0xc8b326b7, 0x3c67a20b} }, +/**/ {{0xc9f01359, 0xbfcf3783} }, +/**/ {{0xd0a651ad, 0x3c4a8b96} }, +/**/ {{0x408a6757, 0xbfc983ba} }, +/**/ {{0xe6424f06, 0x3c6dfff9} }, +/**/ {{0x41881aad, 0x3fc88707} }, +/**/ {{0x2204fd29, 0xbc63baf9} }, +/**/ {{0xabd6e10d, 0x3f9e779e} }, +/**/ {{0xcf2eab41, 0xbfc0cbbe} }, +/**/ {{0x1659f377, 0x3fa44f31} }, +/**/ {{0xa54a8a94, 0x3fb29ce7} }, +/**/ {{0xb87973d7, 0xbfb007c1} } }, +/**/ {{{0x00000000, 0x3fd28000} }, +/**/ {{0x67e47c96, 0x3fd20255} }, +/**/ {{0x28f4290e, 0xbc618323} }, +/**/ {{0xcaeb6c2a, 0x3fed8848} }, +/**/ {{0xa08296a2, 0x3c81e70d} }, +/**/ {{0xa96c2792, 0xbfcf837b} }, +/**/ {{0xc6884369, 0xbc6ab5ce} }, +/**/ {{0x5d351cdb, 0xbfc92179} }, +/**/ {{0x68719d81, 0x3c617000} }, +/**/ {{0xc8c1ca07, 0x3fc89916} }, +/**/ {{0x18b0f81b, 0xbc6a3339} }, +/**/ {{0x0caf6121, 0x3f9b54d0} }, +/**/ {{0x485ba392, 0xbfc0a732} }, +/**/ {{0xc250c31e, 0x3fa57477} }, +/**/ {{0x4790b4a8, 0x3fb20b96} }, +/**/ {{0x4ac23178, 0xbfb04223} } }, +/**/ {{{0x00000000, 0x3fd2c000} }, +/**/ {{0x2b381042, 0x3fd23d56} }, +/**/ {{0x16200088, 0xbc5c5317} }, +/**/ {{0x4c98f347, 0x3fed7874} }, +/**/ {{0x9a72647e, 0xbc8a7dac} }, +/**/ {{0x5dca68a2, 0xbfcfce4c} }, +/**/ {{0x8fb9ffdd, 0x3c6433de} }, +/**/ {{0x246041ce, 0xbfc8bef4} }, +/**/ {{0x1fb39160, 0xbc66c620} }, +/**/ {{0xbd062535, 0x3fc8a932} }, +/**/ {{0xfbc3a86c, 0xbc6e24c7} }, +/**/ {{0x64d0109d, 0x3f98390b} }, +/**/ {{0x819f2998, 0xbfc080ac} }, +/**/ {{0x8784ffb8, 0x3fa69099} }, +/**/ {{0x6fc55e9b, 0x3fb17854} }, +/**/ {{0x5f970a81, 0xbfb07618} } }, +/**/ {{{0x00000000, 0x3fd30000} }, +/**/ {{0x2057ef46, 0x3fd27837} }, +/**/ {{0xd36dfc81, 0xbc7077cd} }, +/**/ {{0xafdfd5ba, 0x3fed687a} }, +/**/ {{0xe19d8d3d, 0xbc782e68} }, +/**/ {{0x92db6fdb, 0xbfd00bfa} }, +/**/ {{0xc0af523f, 0x3c7854cd} }, +/**/ {{0x5b640da2, 0xbfc85c32} }, +/**/ {{0x5e6f23d6, 0x3c5d5bdd} }, +/**/ {{0xa1da32d2, 0x3fc8b75f} }, +/**/ {{0x29860bfe, 0x3c2788df} }, +/**/ {{0xee810d60, 0x3f9524ad} }, +/**/ {{0x95a69dea, 0xbfc0583d} }, +/**/ {{0x2b4d3dec, 0x3fa7a379} }, +/**/ {{0xa3290dfe, 0x3fb0e35b} }, +/**/ {{0x19e12287, 0xbfb0a3b2} } }, +/**/ {{{0x00000000, 0x3fd34000} }, +/**/ {{0xfd9b5fe2, 0x3fd2b2f7} }, +/**/ {{0xc1c2d443, 0x3c2423cf} }, +/**/ {{0x88e1caa2, 0x3fed585c} }, +/**/ {{0x01239e18, 0xbc2c8af2} }, +/**/ {{0xab890af7, 0xbfd0303a} }, +/**/ {{0x726290e6, 0x3c7d42bf} }, +/**/ {{0xb5175de0, 0xbfc7f93b} }, +/**/ {{0xe0ddc367, 0x3c5d5d4b} }, +/**/ {{0x3414de7c, 0x3fc8c3a2} }, +/**/ {{0xba92bfce, 0x3c5ade9b} }, +/**/ {{0xda70853d, 0x3f921811} }, +/**/ {{0xcf23aaf0, 0xbfc02df5} }, +/**/ {{0x06445ff8, 0x3fa8acfd} }, +/**/ {{0xc130eba4, 0x3fb04ce4} }, +/**/ {{0x29de3135, 0xbfb0cb04} } }, +/**/ {{{0x00000000, 0x3fd38000} }, +/**/ {{0x7a823cfe, 0x3fd2ed98} }, +/**/ {{0x8ea012ca, 0x3c6b9125} }, +/**/ {{0x6c0fd782, 0x3fed481a} }, +/**/ {{0x85ff74ea, 0x3c82dda4} }, +/**/ {{0x2f5c1e18, 0xbfd053e6} }, +/**/ {{0x8ec637b8, 0xbc679cf2} }, +/**/ {{0xd0ee3e3b, 0xbfc79617} }, +/**/ {{0x732049a6, 0xbc4e91e0} }, +/**/ {{0x67f6478d, 0x3fc8cdff} }, +/**/ {{0xf5079e63, 0xbc5cb659} }, +/**/ {{0x8e8ef686, 0x3f8e271c} }, +/**/ {{0xa2940881, 0xbfc001e5} }, +/**/ {{0xf937caae, 0x3fa9ad0e} }, +/**/ {{0xda1e257f, 0x3faf6a4f} }, +/**/ {{0xb07d42be, 0xbfb0ec24} } }, +/**/ {{{0x00000000, 0x3fd3c000} }, +/**/ {{0x4fb58952, 0x3fd32818} }, +/**/ {{0xa9939f2f, 0xbc7a95f0} }, +/**/ {{0xee1ee130, 0x3fed37b4} }, +/**/ {{0x6fbb1f2d, 0x3c747541} }, +/**/ {{0xe022dd0d, 0xbfd076fc} }, +/**/ {{0x5534523a, 0x3c6d8659} }, +/**/ {{0x3a201d6b, 0xbfc732ce} }, +/**/ {{0xc98a3a62, 0xbc56a551} }, +/**/ {{0x673a29b8, 0x3fc8d67c} }, +/**/ {{0xff95efe6, 0xbc54ae9d} }, +/**/ {{0x74ce6814, 0x3f882eee} }, +/**/ {{0x503ba8f4, 0xbfbfa83b} }, +/**/ {{0x60b63f75, 0x3faaa39c} }, +/**/ {{0xf07ff274, 0x3fae38b8} }, +/**/ {{0x2200fe4d, 0xbfb1072c} } }, +/**/ {{{0x00000000, 0x3fd40000} }, +/**/ {{0x3707ebcc, 0x3fd36277} }, +/**/ {{0x44b672d8, 0xbc6963a5} }, +/**/ {{0xa3fc5b1a, 0x3fed272c} }, +/**/ {{0x272ca3fc, 0x3c8ae01d} }, +/**/ {{0x8aec9d8e, 0xbfd0997e} }, +/**/ {{0x72595f36, 0x3c74aeda} }, +/**/ {{0x66d5c0ff, 0xbfc6cf66} }, +/**/ {{0x3ca66cc1, 0x3c410e2a} }, +/**/ {{0x8f2617b5, 0x3fc8dd1e} }, +/**/ {{0x4facfb67, 0xbc6d173e} }, +/**/ {{0x33966883, 0x3f82483b} }, +/**/ {{0x2b05b16b, 0xbfbf495d} }, +/**/ {{0x074fdeaf, 0x3fab9096} }, +/**/ {{0x9c4605c9, 0x3fad0571} }, +/**/ {{0x280318fd, 0xbfb11c35} } }, +/**/ {{{0x00000000, 0x3fd44000} }, +/**/ {{0xeb76157c, 0x3fd39cb4} }, +/**/ {{0x5a214713, 0xbc72f4da} }, +/**/ {{0x22c31625, 0x3fed1682} }, +/**/ {{0xd5e51b41, 0x3c8ac111} }, +/**/ {{0x07e9a89a, 0xbfd0bb6b} }, +/**/ {{0x7faa1dda, 0x3c76fb53} }, +/**/ {{0xb75f0772, 0xbfc66be7} }, +/**/ {{0xee6d618b, 0xbc69a77d} }, +/**/ {{0x6e943d69, 0x3fc8e1eb} }, +/**/ {{0xc5ec9ebe, 0xbc6982c4} }, +/**/ {{0x9c2d3c0c, 0x3f78e73c} }, +/**/ {{0x7059f387, 0xbfbee752} }, +/**/ {{0x16982f58, 0x3fac73f0} }, +/**/ {{0xc146b407, 0x3fabd0e4} }, +/**/ {{0x82f43254, 0xbfb12b5c} } }, +/**/ {{{0x00000000, 0x3fd48000} }, +/**/ {{0x29271134, 0x3fd3d6d1} }, +/**/ {{0x41cc958a, 0x3c7137ca} }, +/**/ {{0xffb0304c, 0x3fed05b5} }, +/**/ {{0x33e896e5, 0xbc8fc921} }, +/**/ {{0x3a49e254, 0xbfd0dcc2} }, +/**/ {{0x925cb599, 0x3c704578} }, +/**/ {{0x75708502, 0xbfc60859} }, +/**/ {{0x9feebe6c, 0xbc5f88bc} }, +/**/ {{0xc3fb5c1c, 0x3fc8e4e8} }, +/**/ {{0xd6b77a05, 0x3c6de114} }, +/**/ {{0xdbc6c857, 0x3f6ac6b3} }, +/**/ {{0xdeabd793, 0xbfbe823c} }, +/**/ {{0x06fb52a7, 0x3fad4da2} }, +/**/ {{0x2bea698c, 0x3faa9b7b} }, +/**/ {{0xeb32d745, 0xbfb134c0} } }, +/**/ {{{0x00000000, 0x3fd4c000} }, +/**/ {{0xad6c7d33, 0x3fd410cb} }, +/**/ {{0xae13b512, 0xbc7b0c8b} }, +/**/ {{0xd0182625, 0x3fecf4c8} }, +/**/ {{0xf4103798, 0x3c8e6308} }, +/**/ {{0x101a5438, 0xbfd0fd84} }, +/**/ {{0x7d2e3e34, 0x3c425fcd} }, +/**/ {{0xd36904f6, 0xbfc5a4c2} }, +/**/ {{0x54f27bb6, 0x3c5d3583} }, +/**/ {{0x7b74b00c, 0x3fc8e61c} }, +/**/ {{0xefe568b6, 0x3c32f7ad} }, +/**/ {{0xaa3667f2, 0x3f402f60} }, +/**/ {{0x4c9859c0, 0xbfbe1a3e} }, +/**/ {{0x8e77c589, 0x3fae1da6} }, +/**/ {{0x6ed5823e, 0x3fa9659b} }, +/**/ {{0xf1d3d420, 0xbfb13882} } }, +/**/ {{{0x00000000, 0x3fd50000} }, +/**/ {{0x36c2af0a, 0x3fd44aa4} }, +/**/ {{0x3c55b3ba, 0xbc75d5e4} }, +/**/ {{0x295c0773, 0x3fece3bb} }, +/**/ {{0x91851b41, 0xbc826fd5} }, +/**/ {{0x8221a582, 0xbfd11db0} }, +/**/ {{0xa9f31d11, 0x3c7e9654} }, +/**/ {{0xeb9ef661, 0xbfc5412a} }, +/**/ {{0x5e60433c, 0x3c573faf} }, +/**/ {{0xacc06b3a, 0x3fc8e58c} }, +/**/ {{0x64dd81ed, 0xbc5dba9a} }, +/**/ {{0xcfe3f01e, 0xbf625ff7} }, +/**/ {{0x9dae4b1c, 0xbfbdaf78} }, +/**/ {{0x8e4e3e16, 0x3faee3fb} }, +/**/ {{0xc2c60fed, 0x3fa82fa9} }, +/**/ {{0xe13555d9, 0xbfb136c4} } }, +/**/ {{{0x00000000, 0x3fd54000} }, +/**/ {{0x84d0c21b, 0x3fd4845a} }, +/**/ {{0x7563c6a6, 0x3c71e28a} }, +/**/ {{0xa0decfad, 0x3fecd28d} }, +/**/ {{0x49610c12, 0xbc72b2c8} }, +/**/ {{0x93bb8da8, 0xbfd13d47} }, +/**/ {{0x1b48d912, 0x3c5df07a} }, +/**/ {{0xbfb5c8b7, 0xbfc4dd98} }, +/**/ {{0x39a108d7, 0x3c58a9ff} }, +/**/ {{0x99496dc4, 0x3fc8e33f} }, +/**/ {{0x19d3995c, 0x3c380d8b} }, +/**/ {{0xba1bc2d2, 0xbf743d59} }, +/**/ {{0xb77862a1, 0xbfbd420d} }, +/**/ {{0xffb9511c, 0x3fafa0a1} }, +/**/ {{0xe8a86cad, 0x3fa6fa07} }, +/**/ {{0x9d75a109, 0xbfb12faa} } }, +/**/ {{{0x00000000, 0x3fd58000} }, +/**/ {{0x586890e7, 0x3fd4bdee} }, +/**/ {{0x7c22a757, 0xbc6e4dc7} }, +/**/ {{0xcbfae3a7, 0x3fecc140} }, +/**/ {{0xd8b6f9b9, 0xbc41045d} }, +/**/ {{0x52b34cdc, 0xbfd15c49} }, +/**/ {{0x2daa60ac, 0x3c729992} }, +/**/ {{0x37fb39ef, 0xbfc47a13} }, +/**/ {{0x3482d371, 0x3c5cb3b2} }, +/**/ {{0xaa28e022, 0x3fc8df3b} }, +/**/ {{0x969a5447, 0xbc61a8ab} }, +/**/ {{0xc651ecb4, 0xbf7f2135} }, +/**/ {{0x76cc63f7, 0xbfbcd21f} }, +/**/ {{0xefdf4de1, 0x3fb029ce} }, +/**/ {{0x0de3bf96, 0x3fa5c515} }, +/**/ {{0x84e55ab4, 0xbfb12359} } }, +/**/ {{{0x00000000, 0x3fd5c000} }, +/**/ {{0x73869979, 0x3fd4f75f} }, +/**/ {{0xf7ff1108, 0xbc595a1c} }, +/**/ {{0x3ff7b52c, 0x3fecafd5} }, +/**/ {{0x684b6314, 0x3c86e099} }, +/**/ {{0xd71d366e, 0xbfd17ab5} }, +/**/ {{0xae2f7b71, 0x3c602f2c} }, +/**/ {{0x22cc956f, 0xbfc416a1} }, +/**/ {{0xe98c24c1, 0x3c61d29e} }, +/**/ {{0x6e2a4f9f, 0x3fc8d987} }, +/**/ {{0x4a6a7880, 0xbc60de73} }, +/**/ {{0x909e42ec, 0xbf84ed52} }, +/**/ {{0xa56263a8, 0xbfbc5fcf} }, +/**/ {{0x0d159803, 0x3fb07e7b} }, +/**/ {{0xb2ddf20b, 0x3fa4912d} }, +/**/ {{0x508c8585, 0xbfb111f8} } }, +/**/ {{{0x00000000, 0x3fd60000} }, +/**/ {{0x9951cd4a, 0x3fd530ad} }, +/**/ {{0x80884082, 0xbc625664} }, +/**/ {{0x91ff8d87, 0x3fec9e4b} }, +/**/ {{0x1b0da370, 0xbc7723ff} }, +/**/ {{0x432f5908, 0xbfd1988d} }, +/**/ {{0xf8714cda, 0x3c7d065e} }, +/**/ {{0x3403e07c, 0xbfc3b349} }, +/**/ {{0x2717fbb0, 0x3c6b571d} }, +/**/ {{0x97d0e938, 0x3fc8d229} }, +/**/ {{0xb08a0625, 0x3c66b228} }, +/**/ {{0xc2fe9cde, 0xbf8a3464} }, +/**/ {{0xefb6f244, 0xbfbbeb3f} }, +/**/ {{0x39e67c0b, 0x3fb0ce5a} }, +/**/ {{0x93b4fb73, 0x3fa35eab} }, +/**/ {{0xf4d86f78, 0xbfb0fbae} } }, +/**/ {{{0x00000000, 0x3fd64000} }, +/**/ {{0x8e1b4cd8, 0x3fd569d8} }, +/**/ {{0xe713cfe2, 0xbc6fec61} }, +/**/ {{0x57157fc9, 0x3fec8ca4} }, +/**/ {{0x515734ba, 0x3c70da14} }, +/**/ {{0xc3195094, 0xbfd1b5cf} }, +/**/ {{0xa9537e45, 0x3c740cce} }, +/**/ {{0x046cee83, 0xbfc35012} }, +/**/ {{0xe446fd10, 0xbc651b6c} }, +/**/ {{0xfb5e6a95, 0x3fc8c928} }, +/**/ {{0x82469bf3, 0x3c656cd2} }, +/**/ {{0xa4afbb1b, 0xbf8f6568} }, +/**/ {{0xdb3aba50, 0xbfbb7491} }, +/**/ {{0xb9fd56ec, 0x3fb11972} }, +/**/ {{0x9329e15e, 0x3fa22de5} }, +/**/ {{0x8287d93d, 0xbfb0e0a6} } }, +/**/ {{{0x00000000, 0x3fd68000} }, +/**/ {{0x175e0f4e, 0x3fd5a2e0} }, +/**/ {{0x8f82e457, 0x3c713b7a} }, +/**/ {{0x240b83ae, 0x3fec7ae0} }, +/**/ {{0x10d398ed, 0xbc885b56} }, +/**/ {{0x8cdb4db0, 0xbfd1d27d} }, +/**/ {{0x2db0447f, 0x3c11d95f} }, +/**/ {{0x11425541, 0xbfc2ed02} }, +/**/ {{0x6b2cbaa3, 0xbc11d124} }, +/**/ {{0x8cdc5c4d, 0x3fc8be8c} }, +/**/ {{0x794444b0, 0xbc542511} }, +/**/ {{0xd25a5415, 0xbf923ffd} }, +/**/ {{0xbcd1df44, 0xbfbafbe6} }, +/**/ {{0x26bdf05c, 0x3fb15fcc} }, +/**/ {{0xa7b853e6, 0x3fa0ff2f} }, +/**/ {{0x07e9a35f, 0xbfb0c109} } }, +/**/ {{{0x00000000, 0x3fd6c000} }, +/**/ {{0xfbbe768d, 0x3fd5dbc3} }, +/**/ {{0x1b76f7da, 0x3c6ea0ec} }, +/**/ {{0x8d78b9ce, 0x3fec68ff} }, +/**/ {{0x4cb5a0c3, 0xbc83ab41} }, +/**/ {{0xe01c5e6e, 0xbfd1ee96} }, +/**/ {{0xfb76d8dd, 0x3c73922c} }, +/**/ {{0xbbb23677, 0xbfc28a1f} }, +/**/ {{0x288601f2, 0x3c6e592a} }, +/**/ {{0x5e282403, 0x3fc8b25b} }, +/**/ {{0x707e09fa, 0xbbef7d58} }, +/**/ {{0xb65add31, 0xbf94c1e0} }, +/**/ {{0xafa52f1b, 0xbfba815f} }, +/**/ {{0x63712acc, 0x3fb1a16f} }, +/**/ {{0x95a8d3ad, 0x3f9fa5b5} }, +/**/ {{0x72814750, 0xbfb09d01} } }, +/**/ {{{0x00000000, 0x3fd70000} }, +/**/ {{0x0309cfe2, 0x3fd61484} }, +/**/ {{0x15711f00, 0xbc7a7257} }, +/**/ {{0x27afd9eb, 0x3fec5703} }, +/**/ {{0xb32c1d72, 0x3c63c2ab} }, +/**/ {{0x06000419, 0xbfd20a1c} }, +/**/ {{0xf51a3a28, 0xbc7b5fe7} }, +/**/ {{0x486ad2c8, 0xbfc22771} }, +/**/ {{0xf84a7eae, 0xbc499ab5} }, +/**/ {{0x9d027817, 0x3fc8a49c} }, +/**/ {{0x2e376ecc, 0xbc53fcab} }, +/**/ {{0xeaabcb23, 0xbf973831} }, +/**/ {{0x8c46fbce, 0xbfba051d} }, +/**/ {{0x9132e9cc, 0x3fb1de66} }, +/**/ {{0xd48d5d65, 0x3f9d5269} }, +/**/ {{0x712354a4, 0xbfb074bb} } }, +/**/ {{{0x00000000, 0x3fd74000} }, +/**/ {{0xf635c1c6, 0x3fd64d1f} }, +/**/ {{0xe7c0fdbe, 0xbc7fa403} }, +/**/ {{0x86b5cbf8, 0x3fec44eb} }, +/**/ {{0xbc5b562d, 0xbc6a4101} }, +/**/ {{0x50fb21ad, 0xbfd2250d} }, +/**/ {{0xa39bdc1a, 0xbc750066} }, +/**/ {{0xdf2ed728, 0xbfc1c4fc} }, +/**/ {{0x006772e9, 0x3c6a87bb} }, +/**/ {{0x9122b9b7, 0x3fc89557} }, +/**/ {{0x45b04f75, 0xbc05454e} }, +/**/ {{0x6c7888f1, 0xbf99a2c9} }, +/**/ {{0xe02d36ad, 0xbfb98740} }, +/**/ {{0x02a99665, 0x3fb216bd} }, +/**/ {{0xb73aeccb, 0x3f9b0511} }, +/**/ {{0x569b1738, 0xbfb04863} } }, +/**/ {{{0x00000000, 0x3fd78000} }, +/**/ {{0x9f5fa6fe, 0x3fd68597} }, +/**/ {{0x4d1ada9c, 0xbc425781} }, +/**/ {{0x3e386c7f, 0x3fec32b9} }, +/**/ {{0x8cbaa5bf, 0x3c756033} }, +/**/ {{0x1ca84e79, 0xbfd23f6b} }, +/**/ {{0xf123d574, 0x3c604cc0} }, +/**/ {{0x8a715435, 0xbfc162c8} }, +/**/ {{0x454fb8fd, 0x3c5cf6db} }, +/**/ {{0x9a4eb534, 0x3fc88493} }, +/**/ {{0x42b959b0, 0xbc668a5c} }, +/**/ {{0x42580bb5, 0xbf9c0182} }, +/**/ {{0xe5822d56, 0xbfb907e9} }, +/**/ {{0x2f8f8273, 0x3fb24a7f} }, +/**/ {{0xa3527f46, 0x3f98be3c} }, +/**/ {{0xfce97270, 0xbfb01825} } }, +/**/ {{{0x00000000, 0x3fd7c000} }, +/**/ {{0xc9cbd76d, 0x3fd6bdea} }, +/**/ {{0x3e6de828, 0xbc5a5c56} }, +/**/ {{0xe1857d04, 0x3fec206c} }, +/**/ {{0xf5c83872, 0xbc80439f} }, +/**/ {{0xcd9b9870, 0xbfd25935} }, +/**/ {{0xf1ec7306, 0x3c6aaf98} }, +/**/ {{0x36f94d02, 0xbfc100da} }, +/**/ {{0xd96d84ff, 0xbc6e72ca} }, +/**/ {{0x2e774351, 0x3fc87258} }, +/**/ {{0xb8860ef0, 0x3c6c50a2} }, +/**/ {{0x741ef0ec, 0xbf9e543a} }, +/**/ {{0x7b4d0ec2, 0xbfb88738} }, +/**/ {{0xa8164103, 0x3fb279ba} }, +/**/ {{0xa7f1ae35, 0x3f967e73} }, +/**/ {{0x5257c3de, 0xbfafc861} } }, +/**/ {{{0x00000000, 0x3fd80000} }, +/**/ {{0x41e4def1, 0x3fd6f619} }, +/**/ {{0xe6f6e918, 0xbc7c63aa} }, +/**/ {{0x0381c0e0, 0x3fec0e07} }, +/**/ {{0x0381c0e0, 0x3c8c0e07} }, +/**/ {{0xd135c174, 0xbfd2726d} }, +/**/ {{0xe0951cf8, 0xbc2d352d} }, +/**/ {{0xb38cc8cf, 0xbfc09f37} }, +/**/ {{0xae75327f, 0xbc69db81} }, +/**/ {{0xd7da413c, 0x3fc85eac} }, +/**/ {{0x6ebae2bc, 0x3c5b1a89} }, +/**/ {{0x80fcc815, 0xbfa04d69} }, +/**/ {{0x1df326f9, 0xbfb8054c} }, +/**/ {{0x082bda60, 0x3fb2a47e} }, +/**/ {{0x7091d5a4, 0x3f944639} }, +/**/ {{0xe072e48c, 0xbfaf5961} } }, +/**/ {{{0x00000000, 0x3fd84000} }, +/**/ {{0xd53aa2aa, 0x3fd72e22} }, +/**/ {{0x4e79f27c, 0xbc7d9c93} }, +/**/ {{0x36a04729, 0x3febfb88} }, +/**/ {{0x9ac2ea21, 0xbc872745} }, +/**/ {{0x9d7702cf, 0xbfd28b13} }, +/**/ {{0x4be8bff6, 0x3c7819b9} }, +/**/ {{0xb0a35176, 0xbfc03de6} }, +/**/ {{0xc83347af, 0x3c5dbfb0} }, +/**/ {{0x332a4f86, 0x3fc84999} }, +/**/ {{0x0a22d12d, 0x3c5d304e} }, +/**/ {{0xed6b2d30, 0xbfa16a97} }, +/**/ {{0xe0128950, 0xbfb78243} }, +/**/ {{0xeaa98f57, 0x3fb2cad8} }, +/**/ {{0x3bb39c5b, 0x3f92160a} }, +/**/ {{0x3804caa3, 0xbfaee3a9} } }, +/**/ {{{0x00000000, 0x3fd88000} }, +/**/ {{0x52817502, 0x3fd76607} }, +/**/ {{0x91cc7600, 0xbc4dd117} }, +/**/ {{0x0cd9e1fe, 0x3febe8f1} }, +/**/ {{0xa21e102a, 0xbc7a9688} }, +/**/ {{0xb0d161e9, 0xbfd2a327} }, +/**/ {{0x14b44140, 0xbc60a2a9} }, +/**/ {{0x803f8d3b, 0xbfbfb9d9} }, +/**/ {{0x2a5c4097, 0x3c5e5779} }, +/**/ {{0xedbcc363, 0x3fc83324} }, +/**/ {{0xa0442744, 0x3c651fbc} }, +/**/ {{0xe91477c3, 0xbfa2819b} }, +/**/ {{0x63b6abf0, 0xbfb6fe3e} }, +/**/ {{0xdc73a89a, 0x3fb2ecdb} }, +/**/ {{0xaa755298, 0x3f8fdcb7} }, +/**/ {{0x237c2f3d, 0xbfae6793} } }, +/**/ {{{0x00000000, 0x3fd8c000} }, +/**/ {{0x899118d1, 0x3fd79dc6} }, +/**/ {{0xa0ef606d, 0x3c2b7413} }, +/**/ {{0x17a4cbc3, 0x3febd642} }, +/**/ {{0x3200a548, 0xbc55ee5d} }, +/**/ {{0x91faa133, 0xbfd2baaa} }, +/**/ {{0xfaf41548, 0xbc6bd391} }, +/**/ {{0xaa22d832, 0xbfbef89e} }, +/**/ {{0xc874fdb9, 0x3c413b3b} }, +/**/ {{0xc3be300a, 0x3fc81b57} }, +/**/ {{0xc01a615f, 0x3c6baf9b} }, +/**/ {{0x4a872ec7, 0xbfa3926a} }, +/**/ {{0xd3e743cd, 0xbfb67959} }, +/**/ {{0x4f919505, 0x3fb30a98} }, +/**/ {{0x28b78b08, 0x3f8b9f3b} }, +/**/ {{0x71e33e9d, 0xbfade57b} } }, +/**/ {{{0x00000000, 0x3fd90000} }, +/**/ {{0x4b63b3f7, 0x3fd7d560} }, +/**/ {{0x5c2b249a, 0x3c769c88} }, +/**/ {{0xe7ec7a8d, 0x3febc37b} }, +/**/ {{0x2b0e2727, 0xbc6f1246} }, +/**/ {{0xcfbdd7fa, 0xbfd2d19c} }, +/**/ {{0x5e00c582, 0x3c7d0b11} }, +/**/ {{0x86f8309b, 0xbfbe3827} }, +/**/ {{0xfa6c56a7, 0x3c5d64e9} }, +/**/ {{0x7e6de8de, 0x3fc80239} }, +/**/ {{0x7776e849, 0x3c68d62f} }, +/**/ {{0x4f6d8017, 0xbfa49cf9} }, +/**/ {{0xde917e27, 0xbfb5f3b3} }, +/**/ {{0x8e455cc2, 0x3fb32420} }, +/**/ {{0xb9fc88fe, 0x3f877470} }, +/**/ {{0xc6b10536, 0xbfad5dbd} } }, +/**/ {{{0x00000000, 0x3fd94000} }, +/**/ {{0x6a14b1d1, 0x3fd80cd4} }, +/**/ {{0x9684fa19, 0xbc7e79f9} }, +/**/ {{0x0e09a222, 0x3febb09f} }, +/**/ {{0x7e047edd, 0x3c85748e} }, +/**/ {{0x00ccbbc8, 0xbfd2e7ff} }, +/**/ {{0x96875561, 0xbc78eb0a} }, +/**/ {{0x804ecc06, 0xbfbd787e} }, +/**/ {{0x2e4351f8, 0xbc27263b} }, +/**/ {{0xf260d7b4, 0x3fc7e7d1} }, +/**/ {{0x8ed258e3, 0xbc430525} }, +/**/ {{0x968d3d02, 0xbfa5a140} }, +/**/ {{0xaecb845e, 0xbfb56d69} }, +/**/ {{0xae292f95, 0x3fb33987} }, +/**/ {{0x48e09ecd, 0x3f835d1d} }, +/**/ {{0x6b6f9aca, 0xbfacd0b5} } }, +/**/ {{{0x00000000, 0x3fd98000} }, +/**/ {{0xb8df95d7, 0x3fd84422} }, +/**/ {{0x299b41b6, 0x3c7d76a0} }, +/**/ {{0x19ba64d6, 0x3feb9dac} }, +/**/ {{0xa13ee09f, 0xbc4f643a} }, +/**/ {{0xc390a5c9, 0xbfd2fdd1} }, +/**/ {{0xaa856fcc, 0x3c575152} }, +/**/ {{0xc0e99751, 0xbfbcb9ad} }, +/**/ {{0x1347a357, 0x3c4e2d44} }, +/**/ {{0xfdcbfd40, 0x3fc7cc28} }, +/**/ {{0xe516db08, 0x3c60dc32} }, +/**/ {{0x19851d86, 0xbfa69f39} }, +/**/ {{0xe772087d, 0xbfb4e697} }, +/**/ {{0x835992de, 0x3fb34ae1} }, +/**/ {{0xe5326389, 0x3f7eb3f1} }, +/**/ {{0x234575e8, 0xbfac3ebd} } }, +/**/ {{{0x00000000, 0x3fd9c000} }, +/**/ {{0x0c1ebedc, 0x3fd87b4b} }, +/**/ {{0xa2fa470f, 0xbc76dcfa} }, +/**/ {{0x9a1ab378, 0x3feb8aa3} }, +/**/ {{0xb797ab93, 0x3c8efdb0} }, +/**/ {{0xbdfb5e5a, 0xbfd31315} }, +/**/ {{0x862f0c0d, 0x3c5813a8} }, +/**/ {{0x3478f169, 0xbfbbfbbf} }, +/**/ {{0xd9e52582, 0xbc51e810} }, +/**/ {{0x86d6ec76, 0x3fc7af46} }, +/**/ {{0x3c13b159, 0xbc6336de} }, +/**/ {{0x264b8050, 0xbfa796dd} }, +/**/ {{0x9e1f6bef, 0xbfb45f5a} }, +/**/ {{0x93b26fc1, 0x3fb35842} }, +/**/ {{0x39bc3abf, 0x3f76d75e} }, +/**/ {{0x006e38b2, 0xbfaba82f} } }, +/**/ {{{0x00000000, 0x3fda0000} }, +/**/ {{0x394a1b25, 0x3fd8b24d} }, +/**/ {{0xa3748fa8, 0x3c7b6d0b} }, +/**/ {{0x1d9cdc98, 0x3feb7786} }, +/**/ {{0x345bd7a8, 0xbc62e22c} }, +/**/ {{0x9d57b8f5, 0xbfd327cb} }, +/**/ {{0x753cc4f1, 0xbc135343} }, +/**/ {{0x8761b154, 0xbfbb3ebc} }, +/**/ {{0x8c168fdd, 0x3c5abeec} }, +/**/ {{0x79f68c54, 0x3fc79132} }, +/**/ {{0xd8d15eda, 0xbc658ab9} }, +/**/ {{0x5872d73c, 0xbfa88828} }, +/**/ {{0x567be750, 0xbfb3d7cd} }, +/**/ {{0x0a24fc71, 0x3fb361c0} }, +/**/ {{0x46aa98b6, 0x3f6e4b7a} }, +/**/ {{0x3bad3a76, 0xbfab0d64} } }, +/**/ {{{0x00000000, 0x3fda4000} }, +/**/ {{0x16f5cde8, 0x3fd8e929} }, +/**/ {{0xe12bfafb, 0x3c74c0a7} }, +/**/ {{0x32024b37, 0x3feb6454} }, +/**/ {{0x69cc9b53, 0xbc7987f7} }, +/**/ {{0x161a0a40, 0xbfd33bf4} }, +/**/ {{0x83ff46db, 0x3c7a2321} }, +/**/ {{0x26913418, 0xbfba82af} }, +/**/ {{0x10a559fe, 0x3c3c4c62} }, +/**/ {{0xc8506679, 0x3fc771f4} }, +/**/ {{0x63c7ccc3, 0xbc54aaed} }, +/**/ {{0x9237e7ff, 0xbfa97317} }, +/**/ {{0xfde5f112, 0xbfb3500a} }, +/**/ {{0xaa2c3459, 0x3fb3676f} }, +/**/ {{0x04721907, 0x3f5e80cd} }, +/**/ {{0x0dc212a5, 0xbfaa6eb5} } }, +/**/ {{{0x00000000, 0x3fda8000} }, +/**/ {{0x7cd0c662, 0x3fd91fde} }, +/**/ {{0x88054b53, 0x3c710741} }, +/**/ {{0x6454751c, 0x3feb510e} }, +/**/ {{0x7e0f2dca, 0xbc199bfd} }, +/**/ {{0xe3b081f4, 0xbfd34f8f} }, +/**/ {{0x3e2c0515, 0x3c7d7209} }, +/**/ {{0x3f5e2d2f, 0xbfb9c7a0} }, +/**/ {{0xea3bd312, 0xbc20b02e} }, +/**/ {{0x6626c39a, 0x3fc75195} }, +/**/ {{0xb4219a8a, 0x3c6f30d2} }, +/**/ {{0xf55dfea5, 0xbfaa57a8} }, +/**/ {{0xe771fa17, 0xbfb2c82d} }, +/**/ {{0xc3654ab4, 0x3fb36967} }, +/**/ {{0xa23eb6eb, 0x3f11f322} }, +/**/ {{0x8ae579b1, 0xbfa9cc78} } }, +/**/ {{{0x00000000, 0x3fdac000} }, +/**/ {{0x43a34907, 0x3fd9566d} }, +/**/ {{0x37e0af2b, 0x3c69b015} }, +/**/ {{0x40ddf8d3, 0x3feb3db5} }, +/**/ {{0x793c10b8, 0xbc616f46} }, +/**/ {{0xc8537217, 0xbfd3629f} }, +/**/ {{0x38143614, 0x3c505738} }, +/**/ {{0xbf75f20a, 0xbfb90d98} }, +/**/ {{0x6b842647, 0x3c4dc715} }, +/**/ {{0x494dd1e6, 0x3fc7301c} }, +/**/ {{0xf49f85b4, 0x3c5ec3d6} }, +/**/ {{0xdbdd23b1, 0xbfab35db} }, +/**/ {{0xc8407216, 0xbfb2404f} }, +/**/ {{0x255139f9, 0x3fb367bf} }, +/**/ {{0x65acd6da, 0xbf5b8a0d} }, +/**/ {{0x8052f51d, 0xbfa92704} } }, +/**/ {{{0x00000000, 0x3fdb0000} }, +/**/ {{0x454d6b18, 0x3fd98cd5} }, +/**/ {{0x88fd0a77, 0x3c79e6c9} }, +/**/ {{0x5323eb6a, 0x3feb2a49} }, +/**/ {{0x70cc9678, 0xbc572202} }, +/**/ {{0x8cd58cc4, 0xbfd37524} }, +/**/ {{0xda42aa4e, 0x3c6978a3} }, +/**/ {{0x54d5f784, 0xbfb854a1} }, +/**/ {{0xb33b3d0d, 0xbc5e9a15} }, +/**/ {{0x67aa0c46, 0x3fc70d91} }, +/**/ {{0xa4ac9df8, 0xbc6aa72f} }, +/**/ {{0xd0665a46, 0xbfac0db0} }, +/**/ {{0xb428e30d, 0xbfb1b889} }, +/**/ {{0x134448b0, 0x3fb3628d} }, +/**/ {{0x67619c9c, 0xbf6bbbc1} }, +/**/ {{0x53e1f653, 0xbfa87ead} } }, +/**/ {{{0x00000000, 0x3fdb4000} }, +/**/ {{0x5cc58107, 0x3fd9c316} }, +/**/ {{0x02250cfb, 0x3c4b6696} }, +/**/ {{0x25df55f4, 0x3feb16cb} }, +/**/ {{0xf48e26bc, 0xbc653abc} }, +/**/ {{0x00742189, 0xbfd3871f} }, +/**/ {{0xc05df451, 0xbc725ae2} }, +/**/ {{0x6dd13675, 0xbfb79cc2} }, +/**/ {{0x991905e4, 0x3be1d4e0} }, +/**/ {{0xb5b8147e, 0x3fc6e9fc} }, +/**/ {{0xa57d4eca, 0x3c46463b} }, +/**/ {{0x86c1db89, 0xbfacdf29} }, +/**/ {{0x1ab8d1c4, 0xbfb130f4} }, +/**/ {{0x38881228, 0x3fb359e9} }, +/**/ {{0x53bec2ff, 0xbf74a987} }, +/**/ {{0xe5af58b6, 0xbfa7d3c5} } }, +/**/ {{{0x00000000, 0x3fdb8000} }, +/**/ {{0x66168002, 0x3fd9f930} }, +/**/ {{0x47c9439a, 0xbc7c8270} }, +/**/ {{0x42f6e2c9, 0x3feb033b} }, +/**/ {{0xc48702a7, 0xbc6eb80c} }, +/**/ {{0xf8a76337, 0xbfd3988f} }, +/**/ {{0x5b1bb38a, 0xbc636968} }, +/**/ {{0x39212b04, 0xbfb6e604} }, +/**/ {{0xba255e71, 0xbc3c2e20} }, +/**/ {{0x251e2d41, 0x3fc6c566} }, +/**/ {{0x47236369, 0x3c230ab3} }, +/**/ {{0xd40b3417, 0xbfadaa48} }, +/**/ {{0xc484f2cc, 0xbfb0a9a6} }, +/**/ {{0x9cb4573e, 0x3fb34deb} }, +/**/ {{0x1def6f17, 0xbf7b44ca} }, +/**/ {{0x73d683b8, 0xbfa7269f} } }, +/**/ {{{0x00000000, 0x3fdbc000} }, +/**/ {{0x3e5e530b, 0x3fda2f23} }, +/**/ {{0xf797086b, 0x3c5814d5} }, +/**/ {{0x3378ba79, 0x3feaef9a} }, +/**/ {{0x4476e241, 0x3c7da16a} }, +/**/ {{0x50f2beab, 0xbfd3a978} }, +/**/ {{0xad5a31ea, 0x3c7b7e7f} }, +/**/ {{0xa602212f, 0xbfb6306e} }, +/**/ {{0x9ec38d55, 0xbc31ec15} }, +/**/ {{0xa3477c6a, 0x3fc69fd5} }, +/**/ {{0xb2996038, 0x3c571f2f} }, +/**/ {{0xa6cf162d, 0xbfae6f12} }, +/**/ {{0xd0cb2655, 0xbfb022b8} }, +/**/ {{0x9842912f, 0x3fb33eac} }, +/**/ {{0x4919e78d, 0xbf80d789} }, +/**/ {{0x8037e242, 0xbfa67789} } }, +/**/ {{{0x00000000, 0x3fdc0000} }, +/**/ {{0xc3cc23fd, 0x3fda64ee} }, +/**/ {{0x1b50b7ff, 0xbc724dec} }, +/**/ {{0x7f94905e, 0x3feadbe8} }, +/**/ {{0x7f94905e, 0x3c2adbe8} }, +/**/ {{0xeab54af9, 0xbfd3b9d8} }, +/**/ {{0x54fd0941, 0x3c75b97d} }, +/**/ {{0x645a7f9e, 0xbfb57c09} }, +/**/ {{0x09320811, 0xbc5e79f6} }, +/**/ {{0x180938f2, 0x3fc67953} }, +/**/ {{0xe7aee726, 0x3c6246f2} }, +/**/ {{0xff0ea012, 0xbfaf2d8b} }, +/**/ {{0x66c7250c, 0xbfaf3881} }, +/**/ {{0xc95ff694, 0x3fb32c44} }, +/**/ {{0x25d7ff49, 0xbf83f3f0} }, +/**/ {{0xb848e1d1, 0xbfa5c6d1} } }, +/**/ {{{0x00000000, 0x3fdc4000} }, +/**/ {{0xd59e98cf, 0x3fda9a92} }, +/**/ {{0xff75d817, 0x3c42e42d} }, +/**/ {{0xae95dea9, 0x3feac826} }, +/**/ {{0x633dec57, 0xbc534eec} }, +/**/ {{0xacfa5b18, 0xbfd3c9b2} }, +/**/ {{0x6c4d8d27, 0x3c7a7e0c} }, +/**/ {{0xe4ecc0f6, 0xbfb4c8db} }, +/**/ {{0xc0c32772, 0xbc534990} }, +/**/ {{0x6451e377, 0x3fc651e6} }, +/**/ {{0x2a9bb1f1, 0xbc6ea814} }, +/**/ {{0xe62bc1b2, 0xbfafe5ba} }, +/**/ {{0x65fe3642, 0xbfae2ca8} }, +/**/ {{0x09015968, 0x3fb316cd} }, +/**/ {{0x3ce97a26, 0xbf86f764} }, +/**/ {{0xdee8421b, 0xbfa514c3} } }, +/**/ {{{0x00000000, 0x3fdc8000} }, +/**/ {{0x5422058b, 0x3fdad00f} }, +/**/ {{0x3891d2e8, 0x3c7fc4c3} }, +/**/ {{0x46de51cf, 0x3feab455} }, +/**/ {{0xdbc38cc9, 0xbc5b834a} }, +/**/ {{0x844a38eb, 0xbfd3d906} }, +/**/ {{0xbc44eee8, 0x3c6198e5} }, +/**/ {{0x5993cade, 0xbfb416ed} }, +/**/ {{0xfa289b6c, 0xbc235ccb} }, +/**/ {{0x60e2a3af, 0x3fc62997} }, +/**/ {{0xcf7bda0e, 0xbc69a660} }, +/**/ {{0x33612b72, 0xbfb04bd3} }, +/**/ {{0xcf62bcd9, 0xbfad2210} }, +/**/ {{0x603bfc37, 0x3fb2fe5e} }, +/**/ {{0xa9bce7ec, 0xbf89e1ba} }, +/**/ {{0xb83029d5, 0xbfa461a9} } }, +/**/ {{{0x00000000, 0x3fdcc000} }, +/**/ {{0x20ae9344, 0x3fdb0564} }, +/**/ {{0x46363455, 0xbc793139} }, +/**/ {{0xcde0631f, 0x3feaa074} }, +/**/ {{0x143fe6d4, 0x3c84b49a} }, +/**/ {{0x627b115b, 0xbfd3e7d5} }, +/**/ {{0x332989c0, 0x3c77a502} }, +/**/ {{0xb589513f, 0xbfb36644} }, +/**/ {{0x105eec96, 0x3c3abdc9} }, +/**/ {{0xdd12e0be, 0x3fc6006d} }, +/**/ {{0x5d67cb35, 0xbc4f0281} }, +/**/ {{0x4238ba83, 0xbfb0a1ab} }, +/**/ {{0x73889526, 0xbfac18e3} }, +/**/ {{0xfde6351a, 0x3fb2e311} }, +/**/ {{0xc256833f, 0xbf8cb2d2} }, +/**/ {{0xf73e36f0, 0xbfa3adca} } }, +/**/ {{{0x00000000, 0x3fdd0000} }, +/**/ {{0x1da65c6c, 0x3fdb3a91} }, +/**/ {{0xb1ca5040, 0x3c7ae187} }, +/**/ {{0xc81a2254, 0x3fea8c85} }, +/**/ {{0x8d67728b, 0xbc83c191} }, +/**/ {{0x3e8218e0, 0xbfd3f620} }, +/**/ {{0x52bd43ef, 0xbc72bf32} }, +/**/ {{0xadb5f398, 0xbfb2b6e8} }, +/**/ {{0x6b74d451, 0x3c340287} }, +/**/ {{0x9d9e25fc, 0x3fc5d671} }, +/**/ {{0x518d7a71, 0x3c639669} }, +/**/ {{0x19cc29a0, 0xbfb0f46a} }, +/**/ {{0xc1a69750, 0xbfab1147} }, +/**/ {{0x2c826e6b, 0x3fb2c501} }, +/**/ {{0xcbc1b186, 0xbf8f6a95} }, +/**/ {{0x2de89811, 0xbfa2f96d} } }, +/**/ {{{0x00000000, 0x3fdd4000} }, +/**/ {{0x2e737efc, 0x3fdb6f96} }, +/**/ {{0x64981e71, 0xbc5ca534} }, +/**/ {{0xb9102ddc, 0x3fea7888} }, +/**/ {{0x3c46d7d5, 0xbc7791b2} }, +/**/ {{0x1444efb5, 0xbfd403e8} }, +/**/ {{0x4f3d22a6, 0xbc6047c5} }, +/**/ {{0xb90ac1cc, 0xbfb208df} }, +/**/ {{0x2d2115d8, 0x3c4078b1} }, +/**/ {{0x5b7c61a2, 0x3fc5abaa} }, +/**/ {{0x2bd2d19a, 0x3c3eef6a} }, +/**/ {{0xa8850e1a, 0xbfb14414} }, +/**/ {{0xc6580343, 0xbfaa0b63} }, +/**/ {{0x4876cfdf, 0x3fb2a445} }, +/**/ {{0x562d0829, 0xbf91047b} }, +/**/ {{0xbe562a83, 0xbfa244d3} } }, +/**/ {{{0x00000000, 0x3fdd8000} }, +/**/ {{0x378624a5, 0x3fdba473} }, +/**/ {{0xb46e4aff, 0x3c7519a1} }, +/**/ {{0x2348d9a3, 0x3fea647e} }, +/**/ {{0x9156e59f, 0xbc84f6c2} }, +/**/ {{0xe46b4c91, 0xbfd4112d} }, +/**/ {{0x110fe0b7, 0xbc78c11d} }, +/**/ {{0x10e3d572, 0xbfb15c30} }, +/**/ {{0x4427c00b, 0x3c53b45b} }, +/**/ {{0xc2c486ae, 0x3fc5801f} }, +/**/ {{0xc20ced8b, 0xbc49bb5e} }, +/**/ {{0x4cddef65, 0xbfb190b0} }, +/**/ {{0x2ae4bcd0, 0xbfa9075c} }, +/**/ {{0xb69396b9, 0x3fb280f7} }, +/**/ {{0xce179ccb, 0xbf9246f8} }, +/**/ {{0xce6e9b2b, 0xbfa1903f} } }, +/**/ {{{0x00000000, 0x3fddc000} }, +/**/ {{0x1e528192, 0x3fdbd928} }, +/**/ {{0x39af6b66, 0xbc74b154} }, +/**/ {{0x88478403, 0x3fea5066} }, +/**/ {{0xbe71620f, 0xbc85c7e8} }, +/**/ {{0xb430f4ac, 0xbfd41df2} }, +/**/ {{0xe79c7595, 0xbc55db82} }, +/**/ {{0xb173ac76, 0xbfb0b0df} }, +/**/ {{0xe4738d25, 0x3c57f440} }, +/**/ {{0x7199976b, 0x3fc553d9} }, +/**/ {{0x2a872a12, 0x3c54990c} }, +/**/ {{0xd137dd01, 0xbfb1da42} }, +/**/ {{0x350bfdb5, 0xbfa80554} }, +/**/ {{0xdae9e17f, 0x3fb25b31} }, +/**/ {{0xe9e265b4, 0xbf937cc5} }, +/**/ {{0x3d16a202, 0xbfa0dbf0} } }, +/**/ {{{0x00000000, 0x3fde0000} }, +/**/ {{0xc94ec9f0, 0x3fdc0db4} }, +/**/ {{0x70934c34, 0xbc7cc1ce} }, +/**/ {{0x68881898, 0x3fea3c42} }, +/**/ {{0xe5c3bd97, 0x3c8f907f} }, +/**/ {{0x8d38076d, 0xbfd42a37} }, +/**/ {{0x7e19d62d, 0xbc6b8354} }, +/**/ {{0x5a36f1bd, 0xbfb006f4} }, +/**/ {{0xca398c09, 0xbc41701e} }, +/**/ {{0xf7221a2a, 0x3fc526de} }, +/**/ {{0x8041247e, 0xbc211868} }, +/**/ {{0x67b0229a, 0xbfb220d2} }, +/**/ {{0xc74d0c66, 0xbfa7056d} }, +/**/ {{0x0ff472e2, 0x3fb2330d} }, +/**/ {{0x9cb74216, 0xbf94a5e9} }, +/**/ {{0x992b9e1f, 0xbfa02821} } }, +/**/ {{{0x00000000, 0x3fde4000} }, +/**/ {{0x1ff11eb7, 0x3fdc4219} }, +/**/ {{0x434b3eee, 0xbc7b17df} }, +/**/ {{0x437ac09e, 0x3fea2812} }, +/**/ {{0xf9618c21, 0xbc540368} }, +/**/ {{0x7d5ba406, 0xbfd435fd} }, +/**/ {{0x5e0a732a, 0x3c75605b} }, +/**/ {{0x1ce0c104, 0xbfaebce7} }, +/**/ {{0xd4eb3297, 0xbc446d02} }, +/**/ {{0xd289f60b, 0x3fc4f937} }, +/**/ {{0xe736fa8b, 0x3c5b88b7} }, +/**/ {{0xa5f78db4, 0xbfb26465} }, +/**/ {{0x61a972db, 0xbfa607c9} }, +/**/ {{0x9e13b088, 0x3fb208a2} }, +/**/ {{0x06c33653, 0xbf95c26f} }, +/**/ {{0x346237b1, 0xbf9eea1c} } }, +/**/ {{{0x00000000, 0x3fde8000} }, +/**/ {{0x0aad71f9, 0x3fdc7655} }, +/**/ {{0xff7043e4, 0xbc774b8b} }, +/**/ {{0x977fc070, 0x3fea13d6} }, +/**/ {{0xd9440881, 0xbc86c451} }, +/**/ {{0x9682eee2, 0xbfd44145} }, +/**/ {{0xb13901b4, 0x3c74156f} }, +/**/ {{0x2b58de73, 0xbfad6ec5} }, +/**/ {{0xdf653988, 0x3c2ced26} }, +/**/ {{0x720eb232, 0x3fc4caeb} }, +/**/ {{0x92f3f809, 0x3c614246} }, +/**/ {{0x812caa81, 0xbfb2a503} }, +/**/ {{0x22dc20a7, 0xbfa50c86} }, +/**/ {{0xb35de59d, 0x3fb1dc0b} }, +/**/ {{0x4adc8c38, 0xbf96d265} }, +/**/ {{0x35444e0c, 0xbf9d85db} } }, +/**/ {{{0x00000000, 0x3fdec000} }, +/**/ {{0x72f3631b, 0x3fdcaa68} }, +/**/ {{0x81636f48, 0x3c295067} }, +/**/ {{0xe1e381db, 0x3fe9ff8f} }, +/**/ {{0x00701e1c, 0xbc6fffe6} }, +/**/ {{0xee747cac, 0xbfd44c10} }, +/**/ {{0xced401ad, 0xbc7a7f22} }, +/**/ {{0xf898de26, 0xbfac238c} }, +/**/ {{0xdaa7d32f, 0x3c1eb191} }, +/**/ {{0x32160e42, 0x3fc49c01} }, +/**/ {{0x03d0023c, 0x3c649f02} }, +/**/ {{0x49ba4fb7, 0xbfb2e2b3} }, +/**/ {{0xca00d6c7, 0xbfa413c1} }, +/**/ {{0x5bc495cf, 0x3fb1ad61} }, +/**/ {{0x63d0ff69, 0xbf97d5df} }, +/**/ {{0x27af7010, 0xbf9c23eb} } }, +/**/ {{{0x00000000, 0x3fdf0000} }, +/**/ {{0x432c1351, 0x3fdcde53} }, +/**/ {{0x4418f1ad, 0xbc7a2cfa} }, +/**/ {{0x9edacacc, 0x3fe9eb3e} }, +/**/ {{0x87d23ca5, 0xbc8942c5} }, +/**/ {{0x9eaa285d, 0xbfd45660} }, +/**/ {{0x52cf85b4, 0x3c4fe8e6} }, +/**/ {{0x28319af3, 0xbfaadb48} }, +/**/ {{0x31b456b0, 0xbc207b46} }, +/**/ {{0x5c4ee7c2, 0x3fc46c80} }, +/**/ {{0xb4443c76, 0x3c4bdfc1} }, +/**/ {{0xa73bc33f, 0xbfb31d7c} }, +/**/ {{0xb8a731f5, 0xbfa31d98} }, +/**/ {{0x798f7481, 0x3fb17cbc} }, +/**/ {{0xf977e9ca, 0xbf98ccf3} }, +/**/ {{0x36ea1578, 0xbf9ac4b2} } }, +/**/ {{{0x00000000, 0x3fdf4000} }, +/**/ {{0x66b7f2ad, 0x3fdd1215} }, +/**/ {{0x35886c30, 0x3c7be678} }, +/**/ {{0x497f1fed, 0x3fe9d6e3} }, +/**/ {{0x9a35c454, 0xbc8ec056} }, +/**/ {{0xc4255988, 0xbfd46035} }, +/**/ {{0x7144427c, 0x3c7ddb7b} }, +/**/ {{0xe9b44acd, 0xbfa995ff} }, +/**/ {{0xb529cf65, 0x3c3c9d56} }, +/**/ {{0x26dc5cda, 0x3fc43c70} }, +/**/ {{0xfde6cd82, 0x3c6d6ee6} }, +/**/ {{0x9467b39a, 0xbfb35567} }, +/**/ {{0xf54ca1ba, 0xbfa22a25} }, +/**/ {{0xbe2d5d2d, 0x3fb14a35} }, +/**/ {{0x35a34e74, 0xbf99b7bd} }, +/**/ {{0xc4948489, 0xbf996891} } }, +/**/ {{{0x00000000, 0x3fdf8000} }, +/**/ {{0xc9ec862b, 0x3fdd45ae} }, +/**/ {{0x163ef92d, 0x3c689421} }, +/**/ {{0x5bcb52c7, 0x3fe9c27e} }, +/**/ {{0xf148a350, 0xbc892d91} }, +/**/ {{0x7f43bff0, 0xbfd46991} }, +/**/ {{0x8da13c27, 0xbc738b23} }, +/**/ {{0xf9f19dcd, 0xbfa853bc} }, +/**/ {{0x2433c5cf, 0x3c2ea7a9} }, +/**/ {{0xb38b19e0, 0x3fc40bd7} }, +/**/ {{0x1c2a2863, 0xbc5d466e} }, +/**/ {{0x5b0333a7, 0xbfb38a7c} }, +/**/ {{0x2e3896d7, 0xbfa13983} }, +/**/ {{0xa35b7545, 0x3fb115e5} }, +/**/ {{0x99098556, 0xbf9a9658} }, +/**/ {{0x693ac59e, 0xbf980fe6} } }, +/**/ {{{0x00000000, 0x3fdfc000} }, +/**/ {{0x5a1226f5, 0x3fdd791f} }, +/**/ {{0xa5b64a76, 0xbc64017e} }, +/**/ {{0x4e983ae9, 0x3fe9ae10} }, +/**/ {{0x52b783d7, 0xbc8d45ed} }, +/**/ {{0xf394891f, 0xbfd47274} }, +/**/ {{0x22e08713, 0xbc7cd478} }, +/**/ {{0xa445379d, 0xbfa71487} }, +/**/ {{0x831d87b7, 0x3c1569aa} }, +/**/ {{0x0f10bc36, 0x3fc3dabe} }, +/**/ {{0x1cb9bbe6, 0x3bd8df2b} }, +/**/ {{0x8fddd862, 0xbfb3bcc3} }, +/**/ {{0xbcb632d9, 0xbfa04bc8} }, +/**/ {{0x64a26d77, 0x3fb0dfe4} }, +/**/ {{0xd04027d1, 0xbf9b68e6} }, +/**/ {{0xf792c5d9, 0xbf96bb07} } }, +/**/ {{{0x00000000, 0x3fe00000} }, +/**/ {{0x0561bb4f, 0x3fddac67} }, +/**/ {{0x222f65e2, 0x3c7a2b7f} }, +/**/ {{0x9999999a, 0x3fe99999} }, +/**/ {{0x9999999a, 0xbc899999} }, +/**/ {{0x47ae147b, 0xbfd47ae1} }, +/**/ {{0xeb851eb8, 0x3c5eb851} }, +/**/ {{0xc3ece2a5, 0xbfa5d867} }, +/**/ {{0xd7b900af, 0xbc3a485c} }, +/**/ {{0x30553261, 0x3fc3a92a} }, +/**/ {{0x94467382, 0x3c6f06f6} }, +/**/ {{0x0ed80a18, 0xbfb3ec46} }, +/**/ {{0x514d88d8, 0xbf9ec21b} }, +/**/ {{0xf929a833, 0x3fb0a849} }, +/**/ {{0x88dfb80c, 0xbf9c2f8b} }, +/**/ {{0x8245bf09, 0xbf956a49} } }, +/**/ {{{0x00000000, 0x3fe02000} }, +/**/ {{0xbb026974, 0x3fdddf85} }, +/**/ {{0x0c0a1226, 0x3c643bbb} }, +/**/ {{0xb35b2797, 0x3fe9851a} }, +/**/ {{0x18a8fead, 0x3c89cd14} }, +/**/ {{0xa5042a2d, 0xbfd482d7} }, +/**/ {{0xa8224d16, 0x3c0dbc04} }, +/**/ {{0xc56ade02, 0xbfa49f64} }, +/**/ {{0x47da7eea, 0x3c451e52} }, +/**/ {{0xf7c5fe7d, 0x3fc37722} }, +/**/ {{0xd22c4b5c, 0xbc5165be} }, +/**/ {{0xf6f48c5d, 0xbfb4190c} }, +/**/ {{0x58d0c132, 0xbf9cf2cf} }, +/**/ {{0x0ddfdd74, 0x3fb06f2e} }, +/**/ {{0x46e65336, 0xbf9cea6d} }, +/**/ {{0x6423af3b, 0xbf941df9} } }, +/**/ {{{0x00000000, 0x3fe04000} }, +/**/ {{0x6b0744b0, 0x3fde127b} }, +/**/ {{0x6398d4ab, 0xbc52b098} }, +/**/ {{0x113dcc5a, 0x3fe97094} }, +/**/ {{0x4de8c575, 0xbc842780} }, +/**/ {{0x37beb8e5, 0xbfd48a59} }, +/**/ {{0x9dc7541e, 0xbc601dd2} }, +/**/ {{0xa7f2a8fe, 0xbfa36985} }, +/**/ {{0x7437d42d, 0xbc45e414} }, +/**/ {{0x2eb33dd6, 0x3fc344af} }, +/**/ {{0xe3a3193c, 0xbc6d66e9} }, +/**/ {{0xa6763232, 0xbfb44321} }, +/**/ {{0x7217dfc9, 0xbf9b29d6} }, +/**/ {{0xfff8a866, 0x3fb034a7} }, +/**/ {{0x3a6e931d, 0xbf9d99b5} }, +/**/ {{0x4a9f7e19, 0xbf92d661} } }, +/**/ {{{0x00000000, 0x3fe06000} }, +/**/ {{0x066cf51a, 0x3fde4548} }, +/**/ {{0x12ce98f2, 0x3c43a3aa} }, +/**/ {{0x2774fe53, 0x3fe95c06} }, +/**/ {{0x3b851412, 0x3c810dfd} }, +/**/ {{0x2e911e43, 0xbfd49167} }, +/**/ {{0x09466fcd, 0xbc7f6506} }, +/**/ {{0xfedfb0c1, 0xbfa236d0} }, +/**/ {{0x79cb63a9, 0xbc3f6870} }, +/**/ {{0x86b6561c, 0x3fc311d5} }, +/**/ {{0x9543fc9a, 0x3c561982} }, +/**/ {{0xb70aa5a7, 0xbfb46a8d} }, +/**/ {{0xf5ac1efc, 0xbf996756} }, +/**/ {{0xaf7c84b3, 0x3faff19d} }, +/**/ {{0x15ce96b8, 0xbf9e3d8f} }, +/**/ {{0x42726021, 0xbf9193c6} } }, +/**/ {{{0x00000000, 0x3fe08000} }, +/**/ {{0x7f175a34, 0x3fde77eb} }, +/**/ {{0xc1bf3435, 0x3c70e53d} }, +/**/ {{0x69044ba4, 0x3fe94771} }, +/**/ {{0x92d5fbc1, 0xbc7d53e2} }, +/**/ {{0xba91fd89, 0xbfd49802} }, +/**/ {{0xc3c8c4f3, 0x3c71963e} }, +/**/ {{0xf33546d5, 0xbfa1074c} }, +/**/ {{0xc71ad288, 0x3c4bc296} }, +/**/ {{0x99222665, 0x3fc2de9c} }, +/**/ {{0x28dadb64, 0x3c6e4a10} }, +/**/ {{0xfa031cb1, 0xbfb48f5a} }, +/**/ {{0xbc0c6420, 0xbf97ab74} }, +/**/ {{0x876d0f75, 0x3faf7772} }, +/**/ {{0xe431fc96, 0xbf9ed628} }, +/**/ {{0xc64515ec, 0xbf905668} } }, +/**/ {{{0x00000000, 0x3fe0a000} }, +/**/ {{0xc7cf28c4, 0x3fdeaa65} }, +/**/ {{0xeca3bf05, 0x3c62fb2c} }, +/**/ {{0x47bd0aaa, 0x3fe932d6} }, +/**/ {{0x697b6e3c, 0x3c6bdfec} }, +/**/ {{0x0f13a7e8, 0xbfd49e2d} }, +/**/ {{0x20412940, 0x3c6198c5} }, +/**/ {{0x8a4e92df, 0xbf9fb5fe} }, +/**/ {{0x6309a51a, 0xbc3cbb58} }, +/**/ {{0xe67c9829, 0x3fc2ab0a} }, +/**/ {{0x06a4c4ef, 0xbc647643} }, +/**/ {{0x749bc711, 0xbfb4b193} }, +/**/ {{0x27bef265, 0xbf95f651} }, +/**/ {{0x28347ebf, 0x3faefafb} }, +/**/ {{0xe0c06e2f, 0xbf9f63b2} }, +/**/ {{0x9e7b9dd7, 0xbf8e3d09} } }, +/**/ {{{0x00000000, 0x3fe0c000} }, +/**/ {{0xd43f8435, 0x3fdedcb6} }, +/**/ {{0x330884e4, 0xbc5fc976} }, +/**/ {{0x343c31e5, 0x3fe91e35} }, +/**/ {{0x9bb96799, 0xbc8fd46f} }, +/**/ {{0x617d19a1, 0xbfd4a3e7} }, +/**/ {{0xea58b250, 0xbc7d7303} }, +/**/ {{0x9b55d156, 0xbf9d63da} }, +/**/ {{0xd5b4cc6c, 0xbc14bf72} }, +/**/ {{0xd6016a7c, 0x3fc27726} }, +/**/ {{0x435ec4b4, 0x3c4eba22} }, +/**/ {{0x5c52b3c6, 0xbfb4d141} }, +/**/ {{0x2fdd9fbd, 0xbf94480b} }, +/**/ {{0x6d3af4b6, 0x3fae7c63} }, +/**/ {{0x4e61315b, 0xbf9fe65f} }, +/**/ {{0xcea37283, 0xbf8bd8a3} } }, +/**/ {{{0x00000000, 0x3fe0e000} }, +/**/ {{0x98f393d0, 0x3fdf0ede} }, +/**/ {{0x87cb1894, 0xbc72f40a} }, +/**/ {{0x9de85688, 0x3fe9098e} }, +/**/ {{0xa3791e64, 0xbc7c2de1} }, +/**/ {{0xe9238ed7, 0xbfd4a932} }, +/**/ {{0x28864386, 0xbc67a1bb} }, +/**/ {{0x001dec68, 0xbf9b1838} }, +/**/ {{0x8f0ffbdd, 0xbc33ee0e} }, +/**/ {{0xb52e1005, 0x3fc242f6} }, +/**/ {{0x371fd2c1, 0xbc5476eb} }, +/**/ {{0x134edf2d, 0xbfb4ee6f} }, +/**/ {{0x6b13becc, 0xbf92a0bf} }, +/**/ {{0x650f859c, 0x3fadfbd6} }, +/**/ {{0x281586f4, 0xbfa02f31} }, +/**/ {{0x7a73449e, 0xbf898006} } }, +/**/ {{{0x00000000, 0x3fe10000} }, +/**/ {{0x0b541418, 0x3fdf40dd} }, +/**/ {{0xdc382a23, 0xbc6a3992} }, +/**/ {{0xf2efd135, 0x3fe8f4e2} }, +/**/ {{0xd4218911, 0xbc74c3c0} }, +/**/ {{0xdf24b2d1, 0xbfd4ae10} }, +/**/ {{0x79d0ac37, 0x3c713b12} }, +/**/ {{0xd7365f3f, 0xbf98d31f} }, +/**/ {{0x62531dc5, 0xbc18bf3b} }, +/**/ {{0xb7567664, 0x3fc20e80} }, +/**/ {{0xd450197f, 0xbc54a699} }, +/**/ {{0x24d80ddd, 0xbfb50927} }, +/**/ {{0x1b0516ab, 0xbf910088} }, +/**/ {{0x4a356567, 0x3fad797e} }, +/**/ {{0xe14758ed, 0xbfa065f8} }, +/**/ {{0x73d2f6bb, 0xbf87338f} } }, +/**/ {{{0x00000000, 0x3fe12000} }, +/**/ {{0x21a4e495, 0x3fdf72b2} }, +/**/ {{0x0f7eb740, 0x3c5489c2} }, +/**/ {{0xa0470831, 0x3fe8e032} }, +/**/ {{0xe75570cd, 0xbc8c154a} }, +/**/ {{0x7e416c35, 0xbfd4b282} }, +/**/ {{0x60646afd, 0xbc7f1837} }, +/**/ {{0x7a6bec27, 0xbf96949a} }, +/**/ {{0xe6b77ba9, 0x3c38238f} }, +/**/ {{0xf5428c61, 0x3fc1d9ca} }, +/**/ {{0xcd7881aa, 0x3c6a968d} }, +/**/ {{0x41e00b6e, 0xbfb52174} }, +/**/ {{0x702ad3de, 0xbf8ecefa} }, +/**/ {{0x7c8ae0dc, 0x3facf584} }, +/**/ {{0x8aa44fa8, 0xbfa097a2} }, +/**/ {{0x2ed63408, 0xbf84f394} } }, +/**/ {{{0x00000000, 0x3fe14000} }, +/**/ {{0xd3029259, 0x3fdfa45d} }, +/**/ {{0xdc28d8b5, 0xbc7ca563} }, +/**/ {{0x11a6de80, 0x3fe8cb7e} }, +/**/ {{0xac22b8f8, 0x3c610be6} }, +/**/ {{0x02b9488a, 0xbfd4b689} }, +/**/ {{0xaf91d442, 0x3c5ea0bd} }, +/**/ {{0x821fd17e, 0xbf945caf} }, +/**/ {{0x0e51a049, 0x3c38e464} }, +/**/ {{0x6cd45aad, 0x3fc1a4db} }, +/**/ {{0xf4200d5e, 0x3c2288e0} }, +/**/ {{0x3d9dd7c4, 0xbfb53761} }, +/**/ {{0xfb107457, 0xbf8bab68} }, +/**/ {{0x7b46ebd1, 0x3fac7011} }, +/**/ {{0x93134a8f, 0xbfa0c44a} }, +/**/ {{0xf1fa4589, 0xbf82c061} } }, +/**/ {{{0x00000000, 0x3fe16000} }, +/**/ {{0x175fdf83, 0x3fdfd5e0} }, +/**/ {{0x1ec49b15, 0x3c63a87b} }, +/**/ {{0xb18b4749, 0x3fe8b6c5} }, +/**/ {{0xb7d58c0a, 0xbc5fabb8} }, +/**/ {{0xaa26890c, 0xbfd4ba25} }, +/**/ {{0x0ef9b688, 0x3c50e395} }, +/**/ {{0xc8a9b4c0, 0xbf922b65} }, +/**/ {{0xd319146f, 0x3c2835ee} }, +/**/ {{0x00b681bd, 0x3fc16fb8} }, +/**/ {{0x279133b0, 0x3c1df633} }, +/**/ {{0x0a3b410c, 0xbfb54af9} }, +/**/ {{0xebe14682, 0xbf889682} }, +/**/ {{0xdf89e086, 0x3fabe94c} }, +/**/ {{0x0e55a6f8, 0xbfa0ec0e} }, +/**/ {{0x08af68f3, 0xbf809a3e} } }, +/**/ {{{0x00000000, 0x3fe18000} }, +/**/ {{0x73c1a40c, 0x3fe0039c} }, +/**/ {{0x49c9d593, 0xbc8b32c9} }, +/**/ {{0xe931fcd3, 0x3fe8a209} }, +/**/ {{0x8e68c94c, 0x3c6cb8f0} }, +/**/ {{0xb35ad2d8, 0xbfd4bd59} }, +/**/ {{0xcaa606b4, 0xbc61ac1a} }, +/**/ {{0x6dc339ef, 0xbf9000c3} }, +/**/ {{0xaeaeaa73, 0x3c2c62e2} }, +/**/ {{0x7812ee2d, 0x3fc13a66} }, +/**/ {{0x948ffe5b, 0x3c6a8cc2} }, +/**/ {{0xb5955c9c, 0xbfb55c46} }, +/**/ {{0x0fd2b503, 0xbf85906b} }, +/**/ {{0x577de2da, 0x3fab615d} }, +/**/ {{0xa34d31ec, 0xbfa10f0a} }, +/**/ {{0xefe48ad0, 0xbf7d02cb} } }, +/**/ {{{0x00000000, 0x3fe1a000} }, +/**/ {{0x1e82422d, 0x3fe01c34} }, +/**/ {{0xfcca90ee, 0x3c83db44} }, +/**/ {{0x20995a88, 0x3fe88d4b} }, +/**/ {{0x1e42e681, 0x3c802777} }, +/**/ {{0x5e3c840f, 0xbfd4c026} }, +/**/ {{0x3800420d, 0x3c7d7c65} }, +/**/ {{0xb3f88703, 0xbf8bb99b} }, +/**/ {{0x4bf63e82, 0x3c1f62ec} }, +/**/ {{0x7e5193ee, 0x3fc104ec} }, +/**/ {{0xbae4e07d, 0xbc27771e} }, +/**/ {{0x66104515, 0xbfb56b55} }, +/**/ {{0x061a20d1, 0xbf829940} }, +/**/ {{0xa20334d9, 0x3faad868} }, +/**/ {{0x7aba8ee6, 0xbfa12d5e} }, +/**/ {{0x69774b8d, 0xbf78ec1f} } }, +/**/ {{{0x00000000, 0x3fe1c000} }, +/**/ {{0x09250488, 0x3fe034b7} }, +/**/ {{0x8d855410, 0x3c78f9b3} }, +/**/ {{0xbe7f594b, 0x3fe87889} }, +/**/ {{0xc826e7a3, 0xbc7530e1} }, +/**/ {{0xeba4af80, 0xbfd4c28c} }, +/**/ {{0xe6a95faa, 0x3c7104a9} }, +/**/ {{0x846dba10, 0xbf877f13} }, +/**/ {{0x4abd0010, 0x3c2bc924} }, +/**/ {{0xa2deff9f, 0x3fc0cf4f} }, +/**/ {{0xa013c015, 0xbc67d17e} }, +/**/ {{0x577e7899, 0xbfb57830} }, +/**/ {{0xb49ea16d, 0xbf7f6238} }, +/**/ {{0x8ae4a926, 0x3faa4e93} }, +/**/ {{0x2e77f633, 0xbfa14728} }, +/**/ {{0xb81c893e, 0xbf74f0d3} } }, +/**/ {{{0x00000000, 0x3fe1e000} }, +/**/ {{0x314342e6, 0x3fe04d25} }, +/**/ {{0x6442c767, 0xbc81c863} }, +/**/ {{0x2860ad7e, 0x3fe863c6} }, +/**/ {{0x137a2d8f, 0xbc81dcb2} }, +/**/ {{0x9d3dc03a, 0xbfd4c48e} }, +/**/ {{0x197b1db9, 0xbc7d92af} }, +/**/ {{0x5653b1a7, 0xbf8351f6} }, +/**/ {{0x2127dea7, 0xbbe368b4} }, +/**/ {{0x58fa8ca4, 0x3fc09995} }, +/**/ {{0x530429e5, 0xbc446391} }, +/**/ {{0xd81c26eb, 0xbfb582e2} }, +/**/ {{0x3e63c109, 0xbf79b02d} }, +/**/ {{0xe7904294, 0x3fa9c401} }, +/**/ {{0xb933b0f3, 0xbfa15c86} }, +/**/ {{0xd8d860e1, 0xbf711137} } }, +/**/ {{{0x00000000, 0x3fe20000} }, +/**/ {{0x94db30d0, 0x3fe0657e} }, +/**/ {{0x5f6349e6, 0xbc7d5b49} }, +/**/ {{0xc2780614, 0x3fe84f00} }, +/**/ {{0xff3d87fa, 0xbc7fe7b0} }, +/**/ {{0xb562c625, 0xbfd4c62c} }, +/**/ {{0xa78e848c, 0x3c77b2c3} }, +/**/ {{0xb3a4bcb7, 0xbf7e6495} }, +/**/ {{0xe3f2b0a5, 0x3c14eb89} }, +/**/ {{0xf78c0dc4, 0x3fc063c2} }, +/**/ {{0x7539dc13, 0xbc6badf0} }, +/**/ {{0x459eb443, 0xbfb58b78} }, +/**/ {{0x1386e6b4, 0xbf741c83} }, +/**/ {{0x944ff706, 0x3fa938d6} }, +/**/ {{0x66ad4037, 0xbfa16d99} }, +/**/ {{0x01fc736a, 0xbf6a9b1a} } }, +/**/ {{{0x00000000, 0x3fe22000} }, +/**/ {{0x324e9b38, 0x3fe07dc3} }, +/**/ {{0xe04450ac, 0x3c7b70c9} }, +/**/ {{0xefbd6bfe, 0x3fe83a39} }, +/**/ {{0x21f5de26, 0xbc7b2885} }, +/**/ {{0x76ff6c9e, 0xbfd4c768} }, +/**/ {{0xdebc1603, 0x3c56a2c0} }, +/**/ {{0xd9cccfd7, 0xbf76402c} }, +/**/ {{0x4e9786c1, 0xbc1b39c0} }, +/**/ {{0xb900b57a, 0x3fc02ddd} }, +/**/ {{0xea88a215, 0x3c45d916} }, +/**/ {{0x0a58ab40, 0xbfb591fc} }, +/**/ {{0x32a37ac9, 0xbf6d4eb0} }, +/**/ {{0x71fe75f8, 0x3fa8ad33} }, +/**/ {{0xc477a855, 0xbfa17a7f} }, +/**/ {{0x2b035011, 0xbf634c0e} } }, +/**/ {{{0x00000000, 0x3fe24000} }, +/**/ {{0x0861a590, 0x3fe095f3} }, +/**/ {{0x0a15a9f3, 0xbc7121b2} }, +/**/ {{0x11e5c14d, 0x3fe82572} }, +/**/ {{0xacd80b09, 0xbc7df9fc} }, +/**/ {{0x25709bff, 0xbfd4c843} }, +/**/ {{0x1790f484, 0x3c7a9ef6} }, +/**/ {{0x8a0def34, 0xbf6c6d74} }, +/**/ {{0x2a8142d7, 0xbc051e57} }, +/**/ {{0x765e156b, 0x3fbfefd5} }, +/**/ {{0xf0e29c9e, 0xbc3e6048} }, +/**/ {{0x9a724e28, 0xbfb59679} }, +/**/ {{0xcf13e192, 0xbf62a185} }, +/**/ {{0x6433c13f, 0x3fa82139} }, +/**/ {{0x9342e95d, 0xbfa18359} }, +/**/ {{0x8f974107, 0xbf586b34} } }, +/**/ {{{0x00000000, 0x3fe26000} }, +/**/ {{0x1639866c, 0x3fe0ae0e} }, +/**/ {{0xf2de445a, 0x3c7075ab} }, +/**/ {{0x89625f5d, 0x3fe810a9} }, +/**/ {{0x0fcf7262, 0xbc8e4bea} }, +/**/ {{0x0465c69b, 0xbfd4c8be} }, +/**/ {{0xd7f7f89c, 0x3c462ef4} }, +/**/ {{0x4de612d5, 0xbf59210e} }, +/**/ {{0xba53898d, 0xbbf43659} }, +/**/ {{0xfe836c69, 0x3fbf83dd} }, +/**/ {{0x27f5499a, 0xbc36cb56} }, +/**/ {{0x7136edda, 0xbfb598fc} }, +/**/ {{0x00013fb7, 0xbf50634c} }, +/**/ {{0x4fe557c2, 0x3fa79508} }, +/**/ {{0xb8ae41dc, 0xbfa18846} }, +/**/ {{0xe36bd239, 0xbf455fce} } }, +/**/ {{{0x00000000, 0x3fe28000} }, +/**/ {{0x5b5b43da, 0x3fe0c614} }, +/**/ {{0x13b5404f, 0x3c5974fa} }, +/**/ {{0xb560d35c, 0x3fe7fbe0} }, +/**/ {{0xae5a0887, 0xbc84f066} }, +/**/ {{0x57c2e1cb, 0xbfd4c8da} }, +/**/ {{0xe0a3774c, 0x3c73de0e} }, +/**/ {{0x61c69f3c, 0x3f38b341} }, +/**/ {{0x7b200371, 0x3bd7b2e2} }, +/**/ {{0xd351e8ed, 0x3fbf17de} }, +/**/ {{0x650c5a9c, 0x3c5bce38} }, +/**/ {{0x0e77234c, 0xbfb59990} }, +/**/ {{0x99f594ee, 0x3f3006ef} }, +/**/ {{0x1a75a6cc, 0x3fa708bf} }, +/**/ {{0x31a471d5, 0xbfa18967} }, +/**/ {{0x59bf0521, 0x3f24cc7e} } }, +/**/ {{{0x00000000, 0x3fe2a000} }, +/**/ {{0xd7aa6f7d, 0x3fe0de05} }, +/**/ {{0xb1c529ab, 0xbc783684} }, +/**/ {{0xf3cab884, 0x3fe7e717} }, +/**/ {{0x3b1fa4c7, 0x3c7e1b21} }, +/**/ {{0x63830b4b, 0xbfd4c899} }, +/**/ {{0xae3ffeff, 0xbc7b6e32} }, +/**/ {{0xfc06cc4f, 0x3f628757} }, +/**/ {{0x56f01f66, 0xbbb4c155} }, +/**/ {{0x8424efd8, 0x3fbeabe1} }, +/**/ {{0x6e5604ea, 0x3bdf5129} }, +/**/ {{0xf3ffff64, 0xbfb5983f} }, +/**/ {{0x1f564189, 0x3f57ec04} }, +/**/ {{0xa92e6e68, 0x3fa67c7b} }, +/**/ {{0x0542d0ff, 0xbfa186db} }, +/**/ {{0x11a37bde, 0x3f4ee247} } }, +/**/ {{{0x00000000, 0x3fe2c000} }, +/**/ {{0x8b67e295, 0x3fe0f5e2} }, +/**/ {{0x7ec990d0, 0x3be311b1} }, +/**/ {{0xa145af59, 0x3fe7d24f} }, +/**/ {{0xabdb623b, 0xbc83c6d1} }, +/**/ {{0x6b9bdb30, 0xbfd4c7fc} }, +/**/ {{0xd3bbb84b, 0x3c7c2fae} }, +/**/ {{0xc729b366, 0x3f70e125} }, +/**/ {{0x7a19993c, 0x3c1291fb} }, +/**/ {{0x66cf0dd8, 0x3fbe3fef} }, +/**/ {{0xcd5e7640, 0xbc5428b7} }, +/**/ {{0xa3273c21, 0xbfb59517} }, +/**/ {{0x36891acb, 0x3f65adcf} }, +/**/ {{0xe121c017, 0x3fa5f05a} }, +/**/ {{0x384bad65, 0xbfa180c2} }, +/**/ {{0xd31e02a7, 0x3f5bd6f1} } }, +/**/ {{{0x00000000, 0x3fe2e000} }, +/**/ {{0x77307a0d, 0x3fe10daa} }, +/**/ {{0xd44c7b05, 0x3c869c33} }, +/**/ {{0x19337139, 0x3fe7bd88} }, +/**/ {{0x00e777ef, 0xbc7fd248} }, +/**/ {{0xb3e16264, 0xbfd4c704} }, +/**/ {{0xd46ed4e3, 0xbc7ed720} }, +/**/ {{0x62c1daf7, 0x3f7863a5} }, +/**/ {{0x30cc82d1, 0x3c155e73} }, +/**/ {{0x97a241da, 0x3fbdd411} }, +/**/ {{0x9ac44edd, 0x3c27a15a} }, +/**/ {{0x9a6c71a6, 0xbfb59022} }, +/**/ {{0xb5534ebe, 0x3f6f285a} }, +/**/ {{0xa76d3cf7, 0x3fa56478} }, +/**/ {{0xc1240db6, 0xbfa1773c} }, +/**/ {{0x3891a70c, 0x3f63e5a1} } }, +/**/ {{{0x00000000, 0x3fe30000} }, +/**/ {{0x9bfbd2a9, 0x3fe1255d} }, +/**/ {{0xe1c0ee35, 0xbc52bdae} }, +/**/ {{0xb5b1ffa1, 0x3fe7a8c1} }, +/**/ {{0x4e005ea3, 0x3c873e4a} }, +/**/ {{0x7fead5b8, 0xbfd4c5b3} }, +/**/ {{0x55abc25a, 0x3c77958e} }, +/**/ {{0x01e4c970, 0x3f7fcb31} }, +/**/ {{0xc5337fda, 0xbc1ad968} }, +/**/ {{0xf983ecf1, 0x3fbd6850} }, +/**/ {{0x02ed6910, 0xbc3e45e6} }, +/**/ {{0x532f49b6, 0xbfb5896c} }, +/**/ {{0xeaefcf7f, 0x3f7432e2} }, +/**/ {{0xe1db38f0, 0x3fa4d8ef} }, +/**/ {{0x7c5c9def, 0xbfa16a6a} }, +/**/ {{0x7b6fe5d0, 0x3f69a742} } }, +/**/ {{{0x00000000, 0x3fe32000} }, +/**/ {{0xfb1b056e, 0x3fe13cfb} }, +/**/ {{0x6fc3ed38, 0x3c83110e} }, +/**/ {{0xcf9bee6c, 0x3fe793fc} }, +/**/ {{0xd8d91b6c, 0xbc8dc7d2} }, +/**/ {{0x12f7e51f, 0xbfd4c40a} }, +/**/ {{0x0d5d686d, 0x3c7d1e10} }, +/**/ {{0x839d28fa, 0x3f838be8} }, +/**/ {{0x52131640, 0x3c13427a} }, +/**/ {{0x360bfed5, 0x3fbcfcb6} }, +/**/ {{0xa36f599f, 0xbc5e3cb4} }, +/**/ {{0x3f7aa463, 0xbfb58100} }, +/**/ {{0xb76f2bc0, 0x3f78b31e} }, +/**/ {{0x77dd6b80, 0x3fa44dda} }, +/**/ {{0x21c53ca9, 0xbfa15a6b} }, +/**/ {{0x6cd99ed4, 0x3f6f30a7} } }, +/**/ {{{0x00000000, 0x3fe34000} }, +/**/ {{0x9637646a, 0x3fe15485} }, +/**/ {{0x548bf3c3, 0xbc84ba7c} }, +/**/ {{0xbe88c85e, 0x3fe77f39} }, +/**/ {{0x9b6750c8, 0xbc6a983f} }, +/**/ {{0xafd6bee5, 0xbfd4c209} }, +/**/ {{0x5e73e93a, 0x3c7d21ef} }, +/**/ {{0xfc556ca7, 0x3f8724c7} }, +/**/ {{0x42e5673e, 0xbc23cef2} }, +/**/ {{0xbdaef67d, 0x3fbc9149} }, +/**/ {{0x3f04fcdc, 0xbc1e549c} }, +/**/ {{0xc7e4996a, 0xbfb576e9} }, +/**/ {{0xba6ceedb, 0x3f7d14fc} }, +/**/ {{0x53dcdc4a, 0x3fa3c351} }, +/**/ {{0x3a0a53a1, 0xbfa1475e} }, +/**/ {{0x62102619, 0x3f724116} } }, +/**/ {{{0x00000000, 0x3fe36000} }, +/**/ {{0x6f5137e1, 0x3fe16bfa} }, +/**/ {{0xe141bd35, 0x3c79606f} }, +/**/ {{0xd8cd8d65, 0x3fe76a78} }, +/**/ {{0xddf1f71f, 0x3c854a99} }, +/**/ {{0x98cabe40, 0xbfd4bfb3} }, +/**/ {{0x9ef99598, 0xbc61e24d} }, +/**/ {{0x388e6864, 0x3f8ab03d} }, +/**/ {{0xc340d113, 0x3c210541} }, +/**/ {{0xc7f24ec4, 0x3fbc2613} }, +/**/ {{0x0a59af31, 0x3c54042a} }, +/**/ {{0x49833ac1, 0xbfb56b34} }, +/**/ {{0x22f6cd28, 0x3f80ac4f} }, +/**/ {{0x64dac153, 0x3fa3396c} }, +/**/ {{0x14dadf32, 0xbfa13163} }, +/**/ {{0x21aeee27, 0x3f74ce20} } }, +/**/ {{{0x00000000, 0x3fe38000} }, +/**/ {{0x88be7c13, 0x3fe1835a} }, +/**/ {{0xec00c301, 0x3c8c621c} }, +/**/ {{0x737d49ca, 0x3fe755ba} }, +/**/ {{0xd4cb44c6, 0xbc8abaf3} }, +/**/ {{0x0f73c4b3, 0xbfd4bd09} }, +/**/ {{0xa9936e0b, 0x3c3e9ebf} }, +/**/ {{0x8920477f, 0x3f8e2e4f} }, +/**/ {{0x0360e009, 0xbc0889e3} }, +/**/ {{0x53aaefa0, 0x3fbbbb1c} }, +/**/ {{0xa1007b7f, 0xbc5edb26} }, +/**/ {{0x13f5f619, 0xbfb55deb} }, +/**/ {{0xe675741e, 0x3f82bf14} }, +/**/ {{0xa05e0ebf, 0x3fa2b042} }, +/**/ {{0xbf95c5c1, 0xbfa11898} }, +/**/ {{0xe421ee51, 0x3f773faf} } }, +/**/ {{{0x00000000, 0x3fe3a000} }, +/**/ {{0xe5299f9a, 0x3fe19aa5} }, +/**/ {{0x2c58f835, 0xbc8a606c} }, +/**/ {{0xe269c5b3, 0x3fe740fe} }, +/**/ {{0x4c82509c, 0x3c873eff} }, +/**/ {{0x54b63d79, 0xbfd4ba0b} }, +/**/ {{0x75bceeff, 0xbc51d68a} }, +/**/ {{0x9d9b3eb0, 0x3f90cf83} }, +/**/ {{0x68a7ca2f, 0xbc107399} }, +/**/ {{0x27453d35, 0x3fbb506b} }, +/**/ {{0x00bdfedd, 0x3c326b36} }, +/**/ {{0x67836cef, 0xbfb54f19} }, +/**/ {{0x567ed6e8, 0x3f84c2e5} }, +/**/ {{0x04a983e8, 0x3fa227ea} }, +/**/ {{0xfc7ce22f, 0xbfa0fd1d} }, +/**/ {{0x2ffea71d, 0x3f79960c} } }, +/**/ {{{0x00000000, 0x3fe3c000} }, +/**/ {{0x87904285, 0x3fe1b1dc} }, +/**/ {{0x8aef8f29, 0xbc621e8c} }, +/**/ {{0x78244c5a, 0x3fe72c46} }, +/**/ {{0xe664f3a2, 0x3c888c36} }, +/**/ {{0xa8a3ca2f, 0xbfd4b6bb} }, +/**/ {{0x1e1f3e19, 0xbc778793} }, +/**/ {{0xc8a3d8bb, 0x3f928136} }, +/**/ {{0x140daf1c, 0x3c3dc4d8} }, +/**/ {{0xd1165ef3, 0x3fbae607} }, +/**/ {{0x6305876c, 0xbc5fbfaa} }, +/**/ {{0x734b94bd, 0xbfb53eca} }, +/**/ {{0x7c458eb1, 0x3f86b7d8} }, +/**/ {{0x9b360f57, 0x3fa1a077} }, +/**/ {{0x3a6beabd, 0xbfa0df11} }, +/**/ {{0xaf42dc87, 0x3f7bd182} } }, +/**/ {{{0x00000000, 0x3fe3e000} }, +/**/ {{0x7341f64f, 0x3fe1c8fe} }, +/**/ {{0x9d5e792a, 0x3c728bbc} }, +/**/ {{0x85fe8a32, 0x3fe71791} }, +/**/ {{0xe8bbb0d0, 0x3c8f15bd} }, +/**/ {{0x4a6497be, 0xbfd4b31b} }, +/**/ {{0x782968f7, 0x3c737223} }, +/**/ {{0x5e0c3122, 0x3f942c46} }, +/**/ {{0x86422b13, 0xbc33e26a} }, +/**/ {{0xa7b659b8, 0x3fba7bf9} }, +/**/ {{0x25381986, 0xbc3cdf63} }, +/**/ {{0x538deb45, 0xbfb52d09} }, +/**/ {{0xa0c1f425, 0x3f889e08} }, +/**/ {{0x7b6d72e6, 0x3fa119ff} }, +/**/ {{0x8d11287b, 0xbfa0be90} }, +/**/ {{0xbce83ad4, 0x3f7df267} } }, +/**/ {{{0x00000000, 0x3fe40000} }, +/**/ {{0xabdefeb4, 0x3fe1e00b} }, +/**/ {{0x287a668f, 0xbc5928df} }, +/**/ {{0x5c0b8170, 0x3fe702e0} }, +/**/ {{0x5c0b8170, 0x3c7702e0} }, +/**/ {{0x78215a76, 0xbfd4af2b} }, +/**/ {{0xab3a13d8, 0xbc581c2e} }, +/**/ {{0xe9e4a9d0, 0x3f95d0b7} }, +/**/ {{0xebf91fc7, 0xbc3aa02a} }, +/**/ {{0xca629942, 0x3fba1247} }, +/**/ {{0xc245db83, 0xbc46961a} }, +/**/ {{0x100385b4, 0xbfb519e1} }, +/**/ {{0x32616ed8, 0x3f8a7592} }, +/**/ {{0xcda1223a, 0x3fa09494} }, +/**/ {{0xa5a5c251, 0xbfa09bb9} }, +/**/ {{0xf489d8ba, 0x3f7ff915} } }, +/**/ {{{0x00000000, 0x3fe42000} }, +/**/ {{0x3557138a, 0x3fe1f704} }, +/**/ {{0xf6d7dd47, 0x3c76c659} }, +/**/ {{0x4920943e, 0x3fe6ee33} }, +/**/ {{0x61a3a541, 0xbc62723e} }, +/**/ {{0x6eedf042, 0xbfd4aaed} }, +/**/ {{0xe7561ed4, 0x3c5b337a} }, +/**/ {{0x68796803, 0x3f976e91} }, +/**/ {{0x44d1db93, 0xbc0e806f} }, +/**/ {{0x21688625, 0x3fb9a8f9} }, +/**/ {{0xb1ec0554, 0x3c540185} }, +/**/ {{0x9a4cbc61, 0xbfb5055c} }, +/**/ {{0xab0be204, 0x3f8c3e93} }, +/**/ {{0xce3968a1, 0x3fa01049} }, +/**/ {{0xcc2331ba, 0xbfa076a9} }, +/**/ {{0xe220db7e, 0x3f80f2f6} } }, +/**/ {{{0x00000000, 0x3fe44000} }, +/**/ {{0x13e823b2, 0x3fe20de8} }, +/**/ {{0x53ebb744, 0xbc8791d7} }, +/**/ {{0x9ad6a3fd, 0x3fe6d98a} }, +/**/ {{0xc4e69862, 0xbc808110} }, +/**/ {{0x6ab4a79d, 0xbfd4a662} }, +/**/ {{0x9fc1cc2b, 0x3c52ed25} }, +/**/ {{0x42e6dc28, 0x3f9905d9} }, +/**/ {{0xe39b7707, 0xbc228c79} }, +/**/ {{0x5e97c6f4, 0x3fb94014} }, +/**/ {{0xf8779202, 0xbc52b822} }, +/**/ {{0xcc723054, 0xbfb4ef86} }, +/**/ {{0x76852811, 0x3f8df92d} }, +/**/ {{0xa231ee3f, 0x3f9f1a5f} }, +/**/ {{0xd8f34e77, 0xbfa04f7d} }, +/**/ {{0x80706a34, 0x3f81dcaa} } }, +/**/ {{{0x00000000, 0x3fe46000} }, +/**/ {{0x4c1d192a, 0x3fe224b7} }, +/**/ {{0xf88a60c4, 0x3c8d6d3d} }, +/**/ {{0x9d8b44ec, 0x3fe6c4e6} }, +/**/ {{0x4ed04ec2, 0xbc589d5c} }, +/**/ {{0xa6222a08, 0xbfd4a18b} }, +/**/ {{0xd3867dbd, 0xbc66c919} }, +/**/ {{0x4bb5a8a0, 0x3f9a9696} }, +/**/ {{0x927bb5bd, 0x3c36698e} }, +/**/ {{0xfdbbcc76, 0x3fb8d79f} }, +/**/ {{0x4efb71a1, 0x3c2578bd} }, +/**/ {{0x6778e363, 0xbfb4d86a} }, +/**/ {{0xd930230d, 0x3f8fa581} }, +/**/ {{0x8a6221aa, 0x3f9e16ae} }, +/**/ {{0x2f183972, 0xbfa02652} }, +/**/ {{0x3e507f4f, 0x3f82b9db} } }, +/**/ {{{0x00000000, 0x3fe48000} }, +/**/ {{0xe2cc9e6a, 0x3fe23b71} }, +/**/ {{0x9f38224e, 0x3c6c421c} }, +/**/ {{0x9c620595, 0x3fe6b047} }, +/**/ {{0x07d7f0c2, 0x3c8867df} }, +/**/ {{0x5a920887, 0xbfd49c6a} }, +/**/ {{0x37bcc433, 0xbc764547} }, +/**/ {{0xbb7e5931, 0x3f9c20cf} }, +/**/ {{0x4db6bef2, 0xbc3d86f5} }, +/**/ {{0x451c4a5d, 0x3fb86fa2} }, +/**/ {{0x15afb52c, 0xbc475142} }, +/**/ {{0x120917da, 0xbfb4c012} }, +/**/ {{0x6b9c3fad, 0x3f90a1da} }, +/**/ {{0x708543e5, 0x3f9d159f} }, +/**/ {{0x6d929bce, 0xbf9ff685} }, +/**/ {{0xd0361a66, 0x3f838ac0} } }, +/**/ {{{0x00000000, 0x3fe4a000} }, +/**/ {{0xdd17e501, 0x3fe25217} }, +/**/ {{0x8c1b679c, 0x3c856aa8} }, +/**/ {{0xe145c95d, 0x3fe69bad} }, +/**/ {{0x5605046d, 0xbc873257} }, +/**/ {{0xbffbe8a8, 0xbfd496ff} }, +/**/ {{0xc7b45e6f, 0x3c36a5c5} }, +/**/ {{0x2d9556eb, 0x3f9da48d} }, +/**/ {{0x1871a19d, 0x3c3ff0e8} }, +/**/ {{0x46043f42, 0x3fb80821} }, +/**/ {{0xe660cfa1, 0x3c550eec} }, +/**/ {{0x5727a8cb, 0xbfb4a688} }, +/**/ {{0x0e13efbc, 0x3f9169f6} }, +/**/ {{0xb59149dd, 0x3f9c174f} }, +/**/ {{0xb10444dd, 0xbf9f9cd5} }, +/**/ {{0x03e91dd9, 0x3f844f95} } }, +/**/ {{{0x00000000, 0x3fe4c000} }, +/**/ {{0x40696da6, 0x3fe268a9} }, +/**/ {{0xa04c73cc, 0x3c5d1348} }, +/**/ {{0xb4ea3592, 0x3fe68719} }, +/**/ {{0x088ed284, 0xbc7ecf86} }, +/**/ {{0x0ce1507d, 0xbfd4914d} }, +/**/ {{0x4dff2946, 0xbc6410ef} }, +/**/ {{0x9cbf7eb7, 0x3f9f21d6} }, +/**/ {{0xeaaad7e2, 0x3c39bc22} }, +/**/ {{0xdd4f3070, 0x3fb7a122} }, +/**/ {{0x1cfe44af, 0x3c50d950} }, +/**/ {{0xa50188df, 0xbfb48bd7} }, +/**/ {{0x71756204, 0x3f922b27} }, +/**/ {{0x0810a33a, 0x3f9b1bdb} }, +/**/ {{0xf1011313, 0xbf9f3fca} }, +/**/ {{0x8fe0f49b, 0x3f850893} } }, +/**/ {{{0x00000000, 0x3fe4e000} }, +/**/ {{0x1273d1b3, 0x3fe27f26} }, +/**/ {{0x6151dd9f, 0x3c843bf3} }, +/**/ {{0x5ecd3069, 0x3fe6728b} }, +/**/ {{0x539f23ff, 0x3c67417b} }, +/**/ {{0x763c0fe8, 0xbfd48b53} }, +/**/ {{0x6027975c, 0xbc677a1a} }, +/**/ {{0x2ff7dd6a, 0x3fa04c5a} }, +/**/ {{0x496202e8, 0xbc40808e} }, +/**/ {{0xb3fc3f7c, 0x3fb73aac} }, +/**/ {{0x86b114ff, 0x3c4b58cb} }, +/**/ {{0x4bc91249, 0xbfb4700a} }, +/**/ {{0xef2490f8, 0x3f92e582} }, +/**/ {{0x6c875580, 0x3f9a235b} }, +/**/ {{0xe55cd596, 0xbf9edf99} }, +/**/ {{0xe40c5a18, 0x3f85b5f9} } }, +/**/ {{{0x00000000, 0x3fe50000} }, +/**/ {{0x59308e31, 0x3fe2958e} }, +/**/ {{0xb0c6c087, 0xbc709e73} }, +/**/ {{0x2538713c, 0x3fe65e03} }, +/**/ {{0x42c09163, 0xbc601392} }, +/**/ {{0x2f6d4575, 0xbfd48514} }, +/**/ {{0x4568af3f, 0xbc356341} }, +/**/ {{0x9386fd1d, 0x3fa10497} }, +/**/ {{0x230a452f, 0xbc4a756a} }, +/**/ {{0x3fc6c180, 0x3fb6d4c4} }, +/**/ {{0xdb3fe137, 0x3c5ab2b9} }, +/**/ {{0x7ca4cfd0, 0xbfb4532a} }, +/**/ {{0x90eb1d30, 0x3f93991d} }, +/**/ {{0x46163051, 0x3f992de9} }, +/**/ {{0x2de874ff, 0xbf9e7c76} }, +/**/ {{0xfc0c1cb2, 0x3f865806} } }, +/**/ {{{0x00000000, 0x3fe52000} }, +/**/ {{0x1aded073, 0x3fe2abe2} }, +/**/ {{0x01ad022e, 0x3c8c28c0} }, +/**/ {{0x4d432177, 0x3fe64981} }, +/**/ {{0x055e240c, 0x3c83f41b} }, +/**/ {{0x6a2cfd01, 0xbfd47e90} }, +/**/ {{0xf152d080, 0x3c628585} }, +/**/ {{0xfbe3ed9e, 0x3fa1b9a7} }, +/**/ {{0xf259fe04, 0xbc18a085} }, +/**/ {{0xc3c40175, 0x3fb66f6e} }, +/**/ {{0xb0fda762, 0x3c41d80a} }, +/**/ {{0x48af643a, 0xbfb43542} }, +/**/ {{0x05ad7652, 0x3f94460d} }, +/**/ {{0x5f55ab26, 0x3f983b9b} }, +/**/ {{0x4be18b23, 0xbf9e1692} }, +/**/ {{0x32e755a3, 0x3f86eefb} } }, +/**/ {{{0x00000000, 0x3fe54000} }, +/**/ {{0x5e024466, 0x3fe2c221} }, +/**/ {{0xda3a4be1, 0xbc44b810} }, +/**/ {{0x1ad38da0, 0x3fe63506} }, +/**/ {{0x94ec14b0, 0xbc67f12a} }, +/**/ {{0x567a6652, 0xbfd477c9} }, +/**/ {{0xbbb9df88, 0x3c7be71c} }, +/**/ {{0x1535acb9, 0x3fa26b90} }, +/**/ {{0xff041454, 0xbc30ff6c} }, +/**/ {{0x5105d8fa, 0x3fb60ab1} }, +/**/ {{0x3f2d6492, 0x3c535a89} }, +/**/ {{0xa0083319, 0xbfb4165b} }, +/**/ {{0x965eb0a7, 0x3f94ec67} }, +/**/ {{0xf36231e5, 0x3f974c86} }, +/**/ {{0x9c25f4a4, 0xbf9dae1f} }, +/**/ {{0x183e42dc, 0x3f877b18} } }, +/**/ {{{0x00000000, 0x3fe56000} }, +/**/ {{0x2961e48c, 0x3fe2d84c} }, +/**/ {{0x0a36e506, 0xbc7f2542} }, +/**/ {{0xd0a0e5d4, 0x3fe62091} }, +/**/ {{0xcccb008e, 0x3c82a27d} }, +/**/ {{0x228ca1b6, 0xbfd470c0} }, +/**/ {{0x32884415, 0xbc788e9b} }, +/**/ {{0xb365e4d9, 0x3fa31a54} }, +/**/ {{0xda0f99ae, 0x3c3e6e70} }, +/**/ {{0xc741ccb7, 0x3fb5a690} }, +/**/ {{0x6508ffe1, 0xbc383905} }, +/**/ {{0x50f46c17, 0xbfb3f680} }, +/**/ {{0x1b344c30, 0x3f958c44} }, +/**/ {{0xb713db8a, 0x3f9660bf} }, +/**/ {{0x5224992a, 0xbf9d434e} }, +/**/ {{0x46ffb16e, 0x3f87fca0} } }, +/**/ {{{0x00000000, 0x3fe58000} }, +/**/ {{0x8406cbca, 0x3fe2ee62} }, +/**/ {{0x9ff0cf8d, 0x3c8c5d5e} }, +/**/ {{0xb0350d38, 0x3fe60c24} }, +/**/ {{0xf3db4fcb, 0x3c81ffe9} }, +/**/ {{0xfac420bd, 0xbfd46975} }, +/**/ {{0x850528a0, 0x3c7e6994} }, +/**/ {{0xd098b4ee, 0x3fa3c5fa} }, +/**/ {{0xaa6a6874, 0x3c353c41} }, +/**/ {{0xd57c5b53, 0x3fb54311} }, +/**/ {{0x72d146e0, 0x3c50d02e} }, +/**/ {{0x071017e0, 0xbfb3d5ba} }, +/**/ {{0xf11b08a7, 0x3f9625b9} }, +/**/ {{0xe25bbc6f, 0x3f957857} }, +/**/ {{0x7384981f, 0xbf9cd64d} }, +/**/ {{0x3da3b8d5, 0x3f8873d7} } }, +/**/ {{{0x00000000, 0x3fe5a000} }, +/**/ {{0x753b090b, 0x3fe30464} }, +/**/ {{0x61da18f3, 0xbc73e712} }, +/**/ {{0xf9ee77b6, 0x3fe5f7be} }, +/**/ {{0x854f9928, 0x3c8949f7} }, +/**/ {{0x099c98f6, 0xbfd461ec} }, +/**/ {{0x3eafe889, 0x3c5da491} }, +/**/ {{0x8ba9e286, 0x3fa46e87} }, +/**/ {{0x5377a1a9, 0x3c42573a} }, +/**/ {{0xfab82ffb, 0x3fb4e038} }, +/**/ {{0x402ef939, 0xbc414e45} }, +/**/ {{0x4a8ec478, 0xbfb3b412} }, +/**/ {{0xef6dba07, 0x3f96b8e0} }, +/**/ {{0x39c13c6e, 0x3f949360} }, +/**/ {{0xd47bfddb, 0xbf9c674a} }, +/**/ {{0x37ed6935, 0x3f88e101} } }, +/**/ {{{0x00000000, 0x3fe5c000} }, +/**/ {{0x048874be, 0x3fe31a52} }, +/**/ {{0x87a7ac24, 0x3c840cab} }, +/**/ {{0xed021586, 0x3fe5e360} }, +/**/ {{0xb32ab7e4, 0x3c86a444} }, +/**/ {{0x779f86c4, 0xbfd45a23} }, +/**/ {{0x6b782501, 0xbc75b9dc} }, +/**/ {{0x26af940c, 0x3fa51400} }, +/**/ {{0xf9ce64e2, 0x3c4f700e} }, +/**/ {{0x86a8eb42, 0x3fb47e0a} }, +/**/ {{0x36377584, 0xbc5a4df9} }, +/**/ {{0x7f8b6d42, 0xbfb39192} }, +/**/ {{0x5deeeabc, 0x3f9745d1} }, +/**/ {{0x17fa1033, 0x3f93b1e8} }, +/**/ {{0x14cf2061, 0xbf9bf673} }, +/**/ {{0x0a340016, 0x3f894463} } }, +/**/ {{{0x00000000, 0x3fe5e000} }, +/**/ {{0x39b78856, 0x3fe3302b} }, +/**/ {{0xd87ba82b, 0x3c85dd2e} }, +/**/ {{0xc77d4bea, 0x3fe5cf0a} }, +/**/ {{0x0d42ab66, 0xbc8684ab} }, +/**/ {{0x6b573e11, 0xbfd4521d} }, +/**/ {{0xb90c9c27, 0xbc7601b9} }, +/**/ {{0x0582aeaa, 0x3fa5b66a} }, +/**/ {{0x8cc985ad, 0x3c281575} }, +/**/ {{0x9a69373d, 0x3fb41c8a} }, +/**/ {{0x25ea8f67, 0xbc33df07} }, +/**/ {{0xe5673a18, 0xbfb36e43} }, +/**/ {{0xeb05f3bc, 0x3f97cca3} }, +/**/ {{0x7797abe9, 0x3f92d3fd} }, +/**/ {{0x9d71c254, 0xbf9b83f1} }, +/**/ {{0xfe333861, 0x3f899e41} } }, +/**/ {{{0x00000000, 0x3fe60000} }, +/**/ {{0x1cce37bb, 0x3fe345f0} }, +/**/ {{0x37c71102, 0x3c810211} }, +/**/ {{0xc647fa91, 0x3fe5babc} }, +/**/ {{0x8056eaf3, 0x3c84339b} }, +/**/ {{0x094286d0, 0xbfd449db} }, +/**/ {{0x512b1c7b, 0x3c75e178} }, +/**/ {{0xac4cf102, 0x3fa655ca} }, +/**/ {{0x61e8206a, 0xbc27a1e4} }, +/**/ {{0x2933dd9c, 0x3fb3bbbd} }, +/**/ {{0xbd42c006, 0xbc517633} }, +/**/ {{0x9636afc9, 0xbfb34a2f} }, +/**/ {{0xa2400f6f, 0x3f984d71} }, +/**/ {{0xfcc53cab, 0x3f91f9ac} }, +/**/ {{0x9ec31ef1, 0xbf9b0ff0} }, +/**/ {{0xb1615b05, 0x3f89eee3} } }, +/**/ {{{0x00000000, 0x3fe62000} }, +/**/ {{0xb60eccce, 0x3fe35ba0} }, +/**/ {{0x9b9368b9, 0x3c8e3ba1} }, +/**/ {{0x25268d22, 0x3fe5a677} }, +/**/ {{0xaf72cee6, 0x3c7bc76e} }, +/**/ {{0x73c8c31c, 0xbfd4415d} }, +/**/ {{0xe00e5645, 0xbc3e5b3c} }, +/**/ {{0xbe1ce1b6, 0x3fa6f227} }, +/**/ {{0xe699fcac, 0xbc04a922} }, +/**/ {{0xf91f9885, 0x3fb35ba5} }, +/**/ {{0x418827b3, 0xbc43f8be} }, +/**/ {{0x863cebc9, 0xbfb3255e} }, +/**/ {{0xe315ca66, 0x3f98c853} }, +/**/ {{0xff116cac, 0x3f912301} }, +/**/ {{0x0f5e09c2, 0xbf9a9a99} }, +/**/ {{0xf4c8d587, 0x3f8a368d} } }, +/**/ {{{0x00000000, 0x3fe64000} }, +/**/ {{0x0df6c504, 0x3fe3713d} }, +/**/ {{0xe031606d, 0xbc54f789} }, +/**/ {{0x1ebc184f, 0x3fe5923a} }, +/**/ {{0xbe5956dd, 0x3c829fe8} }, +/**/ {{0xcb2e9cc9, 0xbfd438a5} }, +/**/ {{0x7d6ce3eb, 0xbc7c1839} }, +/**/ {{0xfb7fa678, 0x3fa78b86} }, +/**/ {{0xd082025e, 0x3befb53e} }, +/**/ {{0xa3dd5905, 0x3fb2fc48} }, +/**/ {{0x06b78682, 0x3c5fd567} }, +/**/ {{0x8374843c, 0xbfb2ffd9} }, +/**/ {{0x57f51471, 0x3f993d64} }, +/**/ {{0x933f6cc5, 0x3f905006} }, +/**/ {{0xab7658df, 0xbf9a2412} }, +/**/ {{0xae624ab4, 0x3f8a7586} } }, +/**/ {{{0x00000000, 0x3fe66000} }, +/**/ {{0x2d3db11f, 0x3fe386c5} }, +/**/ {{0xcbebe6a0, 0xbc8b78e1} }, +/**/ {{0xec8c8203, 0x3fe57e05} }, +/**/ {{0x5e7f92dc, 0x3c8ea585} }, +/**/ {{0x2d8b381e, 0xbfd42fb5} }, +/**/ {{0x5cff451e, 0xbc63afe6} }, +/**/ {{0x4120d643, 0x3fa821ee} }, +/**/ {{0xcbc4d2dc, 0xbc3e664f} }, +/**/ {{0x9778bfdb, 0x3fb29da8} }, +/**/ {{0x7c2057a5, 0x3c3760dd} }, +/**/ {{0x3525a55a, 0xbfb2d9a9} }, +/**/ {{0xed9015c8, 0x3f99acbc} }, +/**/ {{0x2a35e7d2, 0x3f8f0187} }, +/**/ {{0xf4bcdfc7, 0xbf99ac83} }, +/**/ {{0xbbeb4f11, 0x3f8aac13} } }, +/**/ {{{0x00000000, 0x3fe68000} }, +/**/ {{0x1cd4171a, 0x3fe39c39} }, +/**/ {{0x31d8bf46, 0xbc823043} }, +/**/ {{0xc6feb417, 0x3fe569da} }, +/**/ {{0x0625e450, 0x3c803ce5} }, +/**/ {{0xb6bde980, 0xbfd4268c} }, +/**/ {{0xe8258561, 0xbc6e8f76} }, +/**/ {{0x86705749, 0x3fa8b563} }, +/**/ {{0xe6172281, 0x3c418e14} }, +/**/ {{0x171a8768, 0x3fb23fc9} }, +/**/ {{0x3225d825, 0xbc562184} }, +/**/ {{0x1b8904fd, 0xbfb2b2d6} }, +/**/ {{0xca70ce88, 0x3f9a1677} }, +/**/ {{0x62963581, 0x3f8d6a81} }, +/**/ {{0x32c353bb, 0xbf993412} }, +/**/ {{0xd7354ec0, 0x3f8ada7a} } }, +/**/ {{{0x00000000, 0x3fe6a000} }, +/**/ {{0xe5e2564b, 0x3fe3b198} }, +/**/ {{0x1f0752ac, 0xbc72f922} }, +/**/ {{0xe55ed910, 0x3fe555b8} }, +/**/ {{0x656f2eb2, 0xbc5615bc} }, +/**/ {{0x80646bca, 0xbfd41d2d} }, +/**/ {{0x1ff3506f, 0xbc75d1d6} }, +/**/ {{0xdc4e5727, 0x3fa945ec} }, +/**/ {{0x18968922, 0x3c213c8e} }, +/**/ {{0x3bcc9fa4, 0x3fb1e2ad} }, +/**/ {{0x0a43c591, 0x3c2b899c} }, +/**/ {{0x8f774533, 0xbfb28b68} }, +/**/ {{0x46d16acc, 0x3f9a7aaf} }, +/**/ {{0xde405cc6, 0x3f8bdb08} }, +/**/ {{0x73d9884b, 0xbf98bae1} }, +/**/ {{0x7be7742a, 0x3f8b0101} } }, +/**/ {{{0x00000000, 0x3fe6c000} }, +/**/ {{0x91c78dc5, 0x3fe3c6e4} }, +/**/ {{0x94fd0ba7, 0xbc8e1450} }, +/**/ {{0x7de0a269, 0x3fe541a0} }, +/**/ {{0x163b639c, 0x3c8b9072} }, +/**/ {{0xa1d194fc, 0xbfd41398} }, +/**/ {{0x8629402d, 0xbc7ef191} }, +/**/ {{0x6bbd69eb, 0x3fa9d390} }, +/**/ {{0xd2c4a6a5, 0x3c488aec} }, +/**/ {{0xf53fbee6, 0x3fb18657} }, +/**/ {{0x0104d1dd, 0x3c54e6aa} }, +/**/ {{0xc2245ee6, 0xbfb26368} }, +/**/ {{0xe4b91b16, 0x3f9ad97d} }, +/**/ {{0x74b192c7, 0x3f8a5328} }, +/**/ {{0x8e5d8b31, 0xbf984114} }, +/**/ {{0xceadce82, 0x3f8b1fec} } }, +/**/ {{{0x00000000, 0x3fe6e000} }, +/**/ {{0x2a188504, 0x3fe3dc1c} }, +/**/ {{0x70f4e971, 0x3c82ce63} }, +/**/ {{0xc5a197ed, 0x3fe52d91} }, +/**/ {{0x1baab820, 0xbc804b92} }, +/**/ {{0x300486f8, 0xbfd409cf} }, +/**/ {{0xae804189, 0xbc6d3bb8} }, +/**/ {{0x749adab8, 0x3faa5e54} }, +/**/ {{0xc631cfd3, 0x3c20b0d5} }, +/**/ {{0x0a922c54, 0x3fb12acc} }, +/**/ {{0x7cbc4417, 0x3c521a06} }, +/**/ {{0xbce6ae05, 0xbfb23ade} }, +/**/ {{0x485d279b, 0x3f9b32fe} }, +/**/ {{0xd9b56b96, 0x3f88d2e8} }, +/**/ {{0x227841f4, 0xbf97c6cd} }, +/**/ {{0x85cf6ba0, 0x3f8b3781} } }, +/**/ {{{0x00000000, 0x3fe70000} }, +/**/ {{0xb89e96f4, 0x3fe3f13f} }, +/**/ {{0x492644f0, 0x3c7ecf8b} }, +/**/ {{0xf0ab6f99, 0x3fe5198c} }, +/**/ {{0x5e1ffaba, 0x3c71b875} }, +/**/ {{0x3da059f4, 0xbfd3ffd2} }, +/**/ {{0x77eee53d, 0x3c5bba8e} }, +/**/ {{0x4c5d36dc, 0x3faae63f} }, +/**/ {{0x2a3994d6, 0xbc4e6e4e} }, +/**/ {{0x1b178ada, 0x3fb0d00c} }, +/**/ {{0xb3e710cc, 0x3c4b94c3} }, +/**/ {{0x61093929, 0xbfb211d2} }, +/**/ {{0x30c5dd59, 0x3f9b874b} }, +/**/ {{0xb0b899ed, 0x3f875a50} }, +/**/ {{0x9c404912, 0xbf974c2b} }, +/**/ {{0xd3249a4d, 0x3f8b4803} } }, +/**/ {{{0x00000000, 0x3fe72000} }, +/**/ {{0x47569f49, 0x3fe4064f} }, +/**/ {{0xf91bf2b2, 0xbc8aad88} }, +/**/ {{0x31f66da7, 0x3fe50592} }, +/**/ {{0x134b7507, 0xbc8837f1} }, +/**/ {{0xdae43e4d, 0xbfd3f5a2} }, +/**/ {{0xdc59e382, 0xbc7f29b0} }, +/**/ {{0x5cd91a8c, 0x3fab6b57} }, +/**/ {{0xd6ab0dfc, 0xbc225bf7} }, +/**/ {{0x9f216d7a, 0x3fb0761a} }, +/**/ {{0xe546203e, 0x3c577818} }, +/**/ {{0x67a8cf31, 0xbfb1e84b} }, +/**/ {{0x70b6dd6f, 0x3f9bd67f} }, +/**/ {{0x9ff677e5, 0x3f85e964} }, +/**/ {{0x363cf426, 0xbf96d14f} }, +/**/ {{0x4f6617de, 0x3f8b51b7} } }, +/**/ {{{0x00000000, 0x3fe74000} }, +/**/ {{0xe06fea41, 0x3fe41b4a} }, +/**/ {{0x53277652, 0x3c63d60a} }, +/**/ {{0xbb6bcc2c, 0x3fe4f1a1} }, +/**/ {{0x7c81f558, 0x3c5c8d69} }, +/**/ {{0x15a41364, 0xbfd3eb42} }, +/**/ {{0x617c316a, 0x3c728a9c} }, +/**/ {{0x230c44b8, 0x3fabeda3} }, +/**/ {{0x50d9e9da, 0x3c41fa15} }, +/**/ {{0xe8c87fc3, 0x3fb01cf9} }, +/**/ {{0xa175df34, 0x3c410990} }, +/**/ {{0x619b963c, 0xbfb1be51} }, +/**/ {{0xe7da421c, 0x3f9c20b5} }, +/**/ {{0x637b86b0, 0x3f848027} }, +/**/ {{0xfc436ff1, 0xbf965655} }, +/**/ {{0xe6cd859f, 0x3f8b54de} } }, +/**/ {{{0x00000000, 0x3fe76000} }, +/**/ {{0x8e4b26d6, 0x3fe43032} }, +/**/ {{0x1070b99f, 0xbc813159} }, +/**/ {{0xbde829f5, 0x3fe4ddbb} }, +/**/ {{0xb6d17615, 0xbc735ff2} }, +/**/ {{0xf941711a, 0xbfd3e0b0} }, +/**/ {{0xe9027227, 0x3c7d3454} }, +/**/ {{0x2deef5c2, 0x3fac6d29} }, +/**/ {{0x0ba13bb6, 0x3c476533} }, +/**/ {{0x496c1e5e, 0x3faf8958} }, +/**/ {{0xe1abdf2f, 0x3c49ebf2} }, +/**/ {{0xb762a82c, 0xbfb193eb} }, +/**/ {{0x7c2df93f, 0x3f9c6609} }, +/**/ {{0xdff7724a, 0x3f831e99} }, +/**/ {{0xcea82a5a, 0xbf95db5c} }, +/**/ {{0xc6ff27bb, 0x3f8b51bc} } }, +/**/ {{{0x00000000, 0x3fe78000} }, +/**/ {{0x5b795b56, 0x3fe44506} }, +/**/ {{0x163f79c8, 0xbc7f76d0} }, +/**/ {{0x693e0015, 0x3fe4c9e0} }, +/**/ {{0x60fff59b, 0xbc7b0fcb} }, +/**/ {{0x8ea521a8, 0xbfd3d5f0} }, +/**/ {{0xb5bcc402, 0x3c561573} }, +/**/ {{0x1d4b9b62, 0x3face9f0} }, +/**/ {{0xf2c93cfb, 0x3c481226} }, +/**/ {{0xb5db8847, 0x3faeda66} }, +/**/ {{0x3a386670, 0xbc44ec99} }, +/**/ {{0xa92559e3, 0xbfb16921} }, +/**/ {{0x13b2a17d, 0x3f9ca695} }, +/**/ {{0x355982b3, 0x3f81c4bb} }, +/**/ {{0x65bec936, 0xbf95607f} }, +/**/ {{0x4e349f67, 0x3f8b4892} } }, +/**/ {{{0x00000000, 0x3fe7a000} }, +/**/ {{0x52badc7f, 0x3fe459c6} }, +/**/ {{0x8e8e135c, 0x3c819969} }, +/**/ {{0xec381dcb, 0x3fe4b60f} }, +/**/ {{0x4724e4f2, 0xbc6b9874} }, +/**/ {{0xdc390960, 0xbfd3cb01} }, +/**/ {{0x7ba1320c, 0xbc7243b1} }, +/**/ {{0xa09cca72, 0x3fad63fe} }, +/**/ {{0xe5ab8d04, 0x3c48308c} }, +/**/ {{0xdf2eb652, 0x3fae2d22} }, +/**/ {{0x4eb29ad3, 0xbc4988a3} }, +/**/ {{0x4eb5cb96, 0xbfb13dfa} }, +/**/ {{0x8e5b2657, 0x3f9ce273} }, +/**/ {{0xd132be74, 0x3f807288} }, +/**/ {{0x55a31e9e, 0xbf94e5d8} }, +/**/ {{0xfba00cb2, 0x3f8b399f} } }, +/**/ {{{0x00000000, 0x3fe7c000} }, +/**/ {{0x7efe4716, 0x3fe46e72} }, +/**/ {{0x1b844cc9, 0xbc639b9b} }, +/**/ {{0x749c2a47, 0x3fe4a24a} }, +/**/ {{0x82d8a2e5, 0xbc8f9d05} }, +/**/ {{0xe5e27a03, 0xbfd3bfe5} }, +/**/ {{0xb30f6d58, 0xbc5047da} }, +/**/ {{0x75f185ec, 0x3faddb5b} }, +/**/ {{0x23d5084a, 0x3c43b680} }, +/**/ {{0x479061d2, 0x3fad8190} }, +/**/ {{0x602d3547, 0xbbf4565c} }, +/**/ {{0x979e619e, 0xbfb1127c} }, +/**/ {{0xc03c4720, 0x3f9d19bf} }, +/**/ {{0x01b2b45f, 0x3f7e4ffd} }, +/**/ {{0x1245b0bb, 0xbf946b81} }, +/**/ {{0x60fec8ec, 0x3f8b2525} } }, +/**/ {{{0x00000000, 0x3fe7e000} }, +/**/ {{0xeb5f7bfe, 0x3fe4830a} }, +/**/ {{0x66764a73, 0xbc5a2656} }, +/**/ {{0x2f2d2be4, 0x3fe48e90} }, +/**/ {{0x969bba3b, 0x3c810a8e} }, +/**/ {{0xacfcef4d, 0xbfd3b49d} }, +/**/ {{0xb7a61548, 0xbc6a4f98} }, +/**/ {{0x68d7d101, 0x3fae500d} }, +/**/ {{0x04860c21, 0xbc305c3e} }, +/**/ {{0x2c98ea9c, 0x3facd7b2} }, +/**/ {{0xd46adca0, 0x3c48692b} }, +/**/ {{0x4b37c6a5, 0xbfb0e6af} }, +/**/ {{0x6bfb2662, 0x3f9d4c94} }, +/**/ {{0x0692cc75, 0x3f7bca2d} }, +/**/ {{0xf3b69312, 0xbf93f191} }, +/**/ {{0x1552b8ee, 0x3f8b0b61} } }, +/**/ {{{0x00000000, 0x3fe80000} }, +/**/ {{0xa3269ee1, 0x3fe4978f} }, +/**/ {{0x87f2a458, 0x3c72419a} }, +/**/ {{0x47ae147b, 0x3fe47ae1} }, +/**/ {{0xeb851eb8, 0xbc6eb851} }, +/**/ {{0x30553261, 0xbfd3a92a} }, +/**/ {{0x94467382, 0xbc7f06f6} }, +/**/ {{0x514d88d8, 0x3faec21b} }, +/**/ {{0xf45873a6, 0x3c3cd061} }, +/**/ {{0x88dfb80c, 0x3fac2f8b} }, +/**/ {{0x53add20b, 0xbc14fcbc} }, +/**/ {{0x08c71945, 0xbfb0ba99} }, +/**/ {{0x3d79f13f, 0x3f9d7b0c} }, +/**/ {{0x357dfc67, 0x3f795393} }, +/**/ {{0x3aa97829, 0xbf937822} }, +/**/ {{0xa8b90db0, 0x3f8aec90} } }, +/**/ {{{0x00000000, 0x3fe82000} }, +/**/ {{0xb1c71762, 0x3fe4ac00} }, +/**/ {{0x2382b900, 0x3c8b20e7} }, +/**/ {{0xe8e45252, 0x3fe4673d} }, +/**/ {{0x67458f9c, 0x3c57d208} }, +/**/ {{0x6c24e1b3, 0xbfd39d8c} }, +/**/ {{0x973c6d15, 0xbc7830c5} }, +/**/ {{0x12b78147, 0x3faf318c} }, +/**/ {{0xd318184c, 0xbc4fa440} }, +/**/ {{0x158b44e7, 0x3fab891f} }, +/**/ {{0x45d7f1f3, 0x3c4d5f9f} }, +/**/ {{0x47a3e8ba, 0xbfb08e40} }, +/**/ {{0xc4c1a21a, 0x3f9da541} }, +/**/ {{0x3c0d1d71, 0x3f76ec1e} }, +/**/ {{0x152e0bfc, 0xbf92ff48} }, +/**/ {{0x9955298f, 0x3f8ac8f0} } }, +/**/ {{{0x00000000, 0x3fe84000} }, +/**/ {{0x22de94e5, 0x3fe4c05e} }, +/**/ {{0xf09f2edf, 0xbc8c0ac1} }, +/**/ {{0x3c9a6560, 0x3fe453a6} }, +/**/ {{0x828bba02, 0x3c77a95f} }, +/**/ {{0x5a0e5b1c, 0xbfd391c5} }, +/**/ {{0xcd3f76d2, 0x3c7d553d} }, +/**/ {{0x9adede86, 0x3faf9e66} }, +/**/ {{0xd6d2bac0, 0xbc225e54} }, +/**/ {{0x4bdf89d7, 0x3faae46f} }, +/**/ {{0x2b25b8d9, 0x3c39c98c} }, +/**/ {{0x5765a5c1, 0xbfb061ab} }, +/**/ {{0x7127d649, 0x3f9dcb4f} }, +/**/ {{0x13002646, 0x3f7493ba} }, +/**/ {{0xa397d1a6, 0xbf928718} }, +/**/ {{0x494648b5, 0x3f8aa0bc} } }, +/**/ {{{0x00000000, 0x3fe86000} }, +/**/ {{0x023414e8, 0x3fe4d4a8} }, +/**/ {{0x1daa88b0, 0x3c6e3a89} }, +/**/ {{0x6ba2786e, 0x3fe4401a} }, +/**/ {{0xe3b5f317, 0xbc4b8213} }, +/**/ {{0xf11905c0, 0xbfd385d5} }, +/**/ {{0xa2f42dd1, 0xbc72a1e9} }, +/**/ {{0xf07a526f, 0x3fb00458} }, +/**/ {{0xac5fd817, 0xbc14f965} }, +/**/ {{0x66ca7da2, 0x3faa417e} }, +/**/ {{0xa050b433, 0x3c4b1e1a} }, +/**/ {{0x60182e4f, 0xbfb034e0} }, +/**/ {{0x8cafa41b, 0x3f9ded4f} }, +/**/ {{0x1fa4f037, 0x3f724a50} }, +/**/ {{0xfd90e915, 0xbf920fa7} }, +/**/ {{0xf59e7acf, 0x3f8a742d} } }, +/**/ {{{0x00000000, 0x3fe88000} }, +/**/ {{0x5bb6ec04, 0x3fe4e8de} }, +/**/ {{0xbeb3796c, 0x3c84a33d} }, +/**/ {{0x9dd8fdc1, 0x3fe42c9a} }, +/**/ {{0xaf80050b, 0x3c5192da} }, +/**/ {{0x25adf97f, 0xbfd379bf} }, +/**/ {{0x20cd3651, 0xbc774019} }, +/**/ {{0x724dbb01, 0x3fb0383a} }, +/**/ {{0xeb93e538, 0x3c5c4e67} }, +/**/ {{0x646e65df, 0x3fa9a04e} }, +/**/ {{0x894a6b77, 0x3c21a7cb} }, +/**/ {{0x62771c79, 0xbfb007e5} }, +/**/ {{0x37a45544, 0x3f9e0b5c} }, +/**/ {{0x54993092, 0x3f700fc7} }, +/**/ {{0x37534c25, 0xbf919909} }, +/**/ {{0xae51732a, 0x3f8a437e} } }, +/**/ {{{0x00000000, 0x3fe8a000} }, +/**/ {{0x3b7dd17e, 0x3fe4fd01} }, +/**/ {{0x3e7c24b5, 0x3c7d513f} }, +/**/ {{0xfa274ef1, 0x3fe41926} }, +/**/ {{0x4d72ecb3, 0x3c8ad830} }, +/**/ {{0xe995018a, 0xbfd36d81} }, +/**/ {{0x6fd6094d, 0x3c7e7ec5} }, +/**/ {{0x567bb975, 0x3fb06adb} }, +/**/ {{0xf0d7364f, 0x3c5212c1} }, +/**/ {{0x07a9b624, 0x3fa900e1} }, +/**/ {{0xc16bcc85, 0xbc4e5b5b} }, +/**/ {{0x705f052b, 0xbfafb580} }, +/**/ {{0x646ce12e, 0x3f9e258f} }, +/**/ {{0xa3c63841, 0x3f6bc808} }, +/**/ {{0x67043d41, 0xbf91234e} }, +/**/ {{0x4f11b221, 0x3f8a0ee6} } }, +/**/ {{{0x00000000, 0x3fe8c000} }, +/**/ {{0xadc5ed81, 0x3fe51110} }, +/**/ {{0x6832a63e, 0x3c723dcd} }, +/**/ {{0xa6864f90, 0x3fe405bf} }, +/**/ {{0x662cd5df, 0xbc7419c5} }, +/**/ {{0x2bf1f7e4, 0xbfd3611f} }, +/**/ {{0x65483b78, 0xbc6e94dd} }, +/**/ {{0x23e21be9, 0x3fb09c3f} }, +/**/ {{0xcaca858d, 0x3c22db63} }, +/**/ {{0xd99c3f1d, 0x3fa86337} }, +/**/ {{0xdc0a6dfc, 0x3c034382} }, +/**/ {{0x284f8093, 0xbfaf5aed} }, +/**/ {{0xd396fb43, 0x3f9e3c02} }, +/**/ {{0x08b96150, 0x3f678dd3} }, +/**/ {{0xaa2dcc3a, 0xbf90ae88} }, +/**/ {{0x79128ee7, 0x3f89d69b} } }, +/**/ {{{0x00000000, 0x3fe8e000} }, +/**/ {{0xbef1e9fb, 0x3fe5250c} }, +/**/ {{0xa3228870, 0xbc5539b7} }, +/**/ {{0xc8011245, 0x3fe3f264} }, +/**/ {{0x44cc720b, 0xbc6641f1} }, +/**/ {{0xd942778a, 0xbfd35497} }, +/**/ {{0x9bd7dbd6, 0x3c750a5a} }, +/**/ {{0x6438739e, 0x3fb0cc69} }, +/**/ {{0x435f798d, 0x3bf5d933} }, +/**/ {{0x2b29722f, 0x3fa7c754} }, +/**/ {{0x5b3af27b, 0xbbe736fe} }, +/**/ {{0x059a3c24, 0xbfaf001c} }, +/**/ {{0x101882b0, 0x3f9e4ed0} }, +/**/ {{0x88dc4269, 0x3f6370ae} }, +/**/ {{0x2b5280b6, 0xbf903ac8} }, +/**/ {{0x8da5b2ad, 0x3f899ad3} } }, +/**/ {{{0x00000000, 0x3fe90000} }, +/**/ {{0x7b89061f, 0x3fe538f5} }, +/**/ {{0xabda520c, 0xbc81bb74} }, +/**/ {{0x82b78014, 0x3fe3df16} }, +/**/ {{0xa43ff610, 0xbc7074be} }, +/**/ {{0xdb5be2e4, 0xbfd347ec} }, +/**/ {{0x8a0e9303, 0x3c7848c8} }, +/**/ {{0xa3a11be4, 0x3fb0fb5d} }, +/**/ {{0x09dd0d69, 0x3c3d68f2} }, +/**/ {{0x16778170, 0x3fa72d37} }, +/**/ {{0x2200d1d4, 0xbc4ea85d} }, +/**/ {{0xd4cdbd49, 0xbfaea517} }, +/**/ {{0x6bc61b6f, 0x3f9e5e10} }, +/**/ {{0xd0517524, 0x3f5ee0af} }, +/**/ {{0x4f2ec799, 0xbf8f9038} }, +/**/ {{0xa9aaa5bb, 0x3f895bc2} } }, +/**/ {{{0x00000000, 0x3fe92000} }, +/**/ {{0xf0362c8f, 0x3fe54cca} }, +/**/ {{0x7f8f43c1, 0x3c88a324} }, +/**/ {{0xf9e1016e, 0x3fe3cbd4} }, +/**/ {{0x431b67e7, 0xbc88dea6} }, +/**/ {{0x1969bc63, 0xbfd33b1f} }, +/**/ {{0x5f3d8fd8, 0x3c6ef16e} }, +/**/ {{0x703d3bf6, 0x3fb1291f} }, +/**/ {{0xb04e0672, 0xbc566e82} }, +/**/ {{0x806b26f2, 0x3fa694e1} }, +/**/ {{0xafcee740, 0x3c302819} }, +/**/ {{0x16dcee96, 0xbfae49eb} }, +/**/ {{0xfbfdb35f, 0x3f9e69dc} }, +/**/ {{0x70c48510, 0x3f571910} }, +/**/ {{0xe90198c8, 0xbf8ead25} }, +/**/ {{0xa1c723cb, 0x3f89199b} } }, +/**/ {{{0x00000000, 0x3fe94000} }, +/**/ {{0x29c70c34, 0x3fe5608d} }, +/**/ {{0xf0de8088, 0x3c89939c} }, +/**/ {{0x4fcf28c3, 0x3fe3b8a0} }, +/**/ {{0xcb80013c, 0xbc469c2b} }, +/**/ {{0x77ec4ef9, 0xbfd32e2f} }, +/**/ {{0xc61f7341, 0x3c7f9d06} }, +/**/ {{0x59c3bcdf, 0x3fb155b2} }, +/**/ {{0x3583c01b, 0xbc2d692e} }, +/**/ {{0x1a1fe15d, 0x3fa5fe54} }, +/**/ {{0x5d9bad81, 0x3c430dc5} }, +/**/ {{0x01d944a8, 0xbfadeea0} }, +/**/ {{0x9683b244, 0x3f9e724e} }, +/**/ {{0x491379ef, 0x3f4f13d4} }, +/**/ {{0x0b7cf74b, 0xbf8dcc74} }, +/**/ {{0xff5f0625, 0x3f88d48f} } }, +/**/ {{{0x00000000, 0x3fe96000} }, +/**/ {{0x352b33ba, 0x3fe5743c} }, +/**/ {{0x34c87ea6, 0xbc8ea00d} }, +/**/ {{0xa5f05e48, 0x3fe3a578} }, +/**/ {{0x00e4639b, 0xbc8ba1ec} }, +/**/ {{0xd8b7a43f, 0xbfd3211e} }, +/**/ {{0x676e23a8, 0xbc6d4b54} }, +/**/ {{0xf11b2c2d, 0x3fb18119} }, +/**/ {{0x3a3bf5fa, 0x3c34855b} }, +/**/ {{0x625c76bf, 0x3fa5698f} }, +/**/ {{0xbedb0264, 0xbc2f758a} }, +/**/ {{0x81b60103, 0xbfad9340} }, +/**/ {{0xce91900f, 0x3f9e777d} }, +/**/ {{0x34fddb2f, 0x3f406543} }, +/**/ {{0xe6077f81, 0xbf8cee3b} }, +/**/ {{0xfe42afde, 0x3f888ccf} } }, +/**/ {{{0x00000000, 0x3fe98000} }, +/**/ {{0x1f732fbb, 0x3fe587d8} }, +/**/ {{0xd8c5a950, 0xbc75e5c9} }, +/**/ {{0x1cd28c98, 0x3fe3925e} }, +/**/ {{0x1ffec6da, 0x3c8c8443} }, +/**/ {{0x1af2c622, 0xbfd313ee} }, +/**/ {{0xbc3f7ac8, 0x3c0a0e9b} }, +/**/ {{0xc7f683c3, 0x3fb1ab59} }, +/**/ {{0x12c04500, 0x3c5eaf17} }, +/**/ {{0xa7039179, 0x3fa4d693} }, +/**/ {{0xa4ce58a2, 0xbc4c8d74} }, +/**/ {{0x391400b3, 0xbfad37d6} }, +/**/ {{0xf2148a36, 0x3f9e7982} }, +/**/ {{0xb6df63ca, 0x3f112956} }, +/**/ {{0xfbd0f7ee, 0xbf8c1294} }, +/**/ {{0x8b0b0a0e, 0x3f88428a} } }, +/**/ {{{0x00000000, 0x3fe9a000} }, +/**/ {{0xf5cfab9e, 0x3fe59b60} }, +/**/ {{0x41026bc5, 0xbc81b04c} }, +/**/ {{0xd425cdfc, 0x3fe37f50} }, +/**/ {{0x518aef64, 0x3c865633} }, +/**/ {{0x1b1749db, 0xbfd3069e} }, +/**/ {{0xa119d9bc, 0xbc311c20} }, +/**/ {{0x7074cee3, 0x3fb1d475} }, +/**/ {{0x4ff61e2c, 0xbc5102e0} }, +/**/ {{0x06804def, 0x3fa44561} }, +/**/ {{0xc3865804, 0x3c4e829f} }, +/**/ {{0x82158836, 0xbfacdc6a} }, +/**/ {{0x071b2eec, 0x3f9e7876} }, +/**/ {{0xf17c4beb, 0xbf375b85} }, +/**/ {{0x2fa03971, 0xbf8b3995} }, +/**/ {{0x421a433b, 0x3f87f5ed} } }, +/**/ {{{0x00000000, 0x3fe9c000} }, +/**/ {{0xc5909517, 0x3fe5aed6} }, +/**/ {{0x714a9436, 0x3c87312f} }, +/**/ {{0xeabf19f5, 0x3fe36c50} }, +/**/ {{0x52485cca, 0x3c70d1dc} }, +/**/ {{0xb2f12226, 0xbfd2f92f} }, +/**/ {{0x3e5d3d61, 0x3c5400ba} }, +/**/ {{0x7cc3a41b, 0x3fb1fc70} }, +/**/ {{0x8819ff5b, 0x3c4b58e7} }, +/**/ {{0x712e9269, 0x3fa3b5f7} }, +/**/ {{0x7879d8ab, 0xbc4e436a} }, +/**/ {{0x6f398221, 0xbfac8106} }, +/**/ {{0xc97073c7, 0x3f9e746e} }, +/**/ {{0xecfc2d6a, 0xbf4914de} }, +/**/ {{0xcfa74bd5, 0xbf8a6350} }, +/**/ {{0x6f38ad9e, 0x3f87a724} } }, +/**/ {{{0x00000000, 0x3fe9e000} }, +/**/ {{0x9c244261, 0x3fe5c239} }, +/**/ {{0xe9e56b35, 0xbc831bd4} }, +/**/ {{0x7e9af2dc, 0x3fe3595e} }, +/**/ {{0x9dc90e6a, 0x3c81ef2d} }, +/**/ {{0xb99eb689, 0xbfd2eba3} }, +/**/ {{0x6a2f2701, 0xbc7b12ef} }, +/**/ {{0x7ec46b9b, 0x3fb2234e} }, +/**/ {{0x8d415d66, 0x3c59f30c} }, +/**/ {{0xaabf0d26, 0x3fa32856} }, +/**/ {{0x3f33d7ea, 0xbc122571} }, +/**/ {{0xcc3da9ce, 0xbfac25b2} }, +/**/ {{0xa8630cad, 0x3f9e6d84} }, +/**/ {{0xbeba707a, 0xbf5308c5} }, +/**/ {{0xa1585fd1, 0xbf898fda} }, +/**/ {{0x0dc54356, 0x3f87565b} } }, +/**/ {{{0x00000000, 0x3fea0000} }, +/**/ {{0x87169b18, 0x3fe5d589} }, +/**/ {{0x4bc5e7ca, 0x3c60028e} }, +/**/ {{0xace01346, 0x3fe34679} }, +/**/ {{0x04d19e6b, 0x3c8e6b38} }, +/**/ {{0x03913da2, 0xbfd2ddfb} }, +/**/ {{0x9a19adbd, 0xbc763ec8} }, +/**/ {{0x07b46905, 0x3fb24913} }, +/**/ {{0xd6f0307f, 0xbc4e7be8} }, +/**/ {{0x4b96b773, 0x3fa29c7e} }, +/**/ {{0x9182d783, 0xbc24c2cd} }, +/**/ {{0x1f071f44, 0xbfabca78} }, +/**/ {{0xc4b7b7c4, 0x3f9e63ce} }, +/**/ {{0x125f35b0, 0xbf59529a} }, +/**/ {{0xed369b2b, 0xbf88bf43} }, +/**/ {{0xc97185cd, 0x3f8703ba} } }, +/**/ {{{0x00000000, 0x3fea2000} }, +/**/ {{0x941043d0, 0x3fe5e8c6} }, +/**/ {{0xbe451e70, 0xbc70bf75} }, +/**/ {{0x91e21aec, 0x3fe333a2} }, +/**/ {{0x7acfc84f, 0x3c7ae035} }, +/**/ {{0x628d5861, 0xbfd2d036} }, +/**/ {{0xe463d006, 0x3c67c5fb} }, +/**/ {{0xa7d77fb2, 0x3fb26dc1} }, +/**/ {{0xc47ba861, 0xbc5432bd} }, +/**/ {{0xc229bece, 0x3fa2126d} }, +/**/ {{0x1da8ed9e, 0xbc4be1bf} }, +/**/ {{0xa890e568, 0xbfab6f5e} }, +/**/ {{0xeec5339a, 0x3f9e5763} }, +/**/ {{0x5274aa52, 0xbf5f68a6} }, +/**/ {{0x8a9df558, 0xbf87f19c} }, +/**/ {{0xff809dc5, 0x3f86af6b} } }, +/**/ {{{0x00000000, 0x3fea4000} }, +/**/ {{0xd0d5cc4a, 0x3fe5fbf0} }, +/**/ {{0x000b7158, 0xbc5b4cfd} }, +/**/ {{0x49243ad8, 0x3fe320d9} }, +/**/ {{0x433f7be5, 0xbc8ce5e0} }, +/**/ {{0xa5abec2f, 0xbfd2c256} }, +/**/ {{0x04494dc1, 0xbc68785b} }, +/**/ {{0xee25a81c, 0x3fb2915d} }, +/**/ {{0x68b37e8b, 0x3c3e7045} }, +/**/ {{0x5451b7d2, 0x3fa18a24} }, +/**/ {{0x79d21dd5, 0xbc3b2d29} }, +/**/ {{0x65dfcf66, 0xbfab146e} }, +/**/ {{0xa4b895b9, 0x3f9e485a} }, +/**/ {{0x14770b65, 0xbf62a5d4} }, +/**/ {{0xeb7dab0f, 0xbf8726f2} }, +/**/ {{0xc081d40d, 0x3f865995} } }, +/**/ {{{0x00000000, 0x3fea6000} }, +/**/ {{0x4b46e05f, 0x3fe60f08} }, +/**/ {{0x99945193, 0xbc8dbb86} }, +/**/ {{0xed5be099, 0x3fe30e1d} }, +/**/ {{0x373fae45, 0x3c6c6e78} }, +/**/ {{0x995b3a02, 0xbfd2b45c} }, +/**/ {{0xe7cea2ad, 0x3c7cb97b} }, +/**/ {{0x67fb0cde, 0x3fb2b3eb} }, +/**/ {{0x4920d50b, 0xbc402927} }, +/**/ {{0x209f00e4, 0x3fa103a1} }, +/**/ {{0xecac275a, 0xbc36fb57} }, +/**/ {{0x10fb6629, 0xbfaab9af} }, +/**/ {{0x1100b94a, 0x3f9e36c9} }, +/**/ {{0x58620e6c, 0xbf657e30} }, +/**/ {{0x2801158e, 0xbf865f54} }, +/**/ {{0xd27eaf07, 0x3f86025d} } }, +/**/ {{{0x00000000, 0x3fea8000} }, +/**/ {{0x115d7b8e, 0x3fe6220d} }, +/**/ {{0x350ee8c1, 0xbc62b785} }, +/**/ {{0x98736048, 0x3fe2fb70} }, +/**/ {{0x4df7c4fa, 0x3c87a751} }, +/**/ {{0x07603054, 0xbfd2a649} }, +/**/ {{0xf564247c, 0x3c7c41eb} }, +/**/ {{0xa0cac592, 0x3fb2d56d} }, +/**/ {{0x4e757ddf, 0x3c333138} }, +/**/ {{0x1fa53ce5, 0x3fa07ee3} }, +/**/ {{0x28113a76, 0xbc41bd0c} }, +/**/ {{0x21eb5271, 0xbfaa5f28} }, +/**/ {{0x08df7f4f, 0x3f9e22c5} }, +/**/ {{0x107b528f, 0xbf683dca} }, +/**/ {{0x0a22f693, 0xbf859acc} }, +/**/ {{0xb39536ba, 0x3f85a9e8} } }, +/**/ {{{0x00000000, 0x3feaa000} }, +/**/ {{0x312d1f3b, 0x3fe634ff} }, +/**/ {{0x15f2b598, 0x3c89d2f3} }, +/**/ {{0x638c9d15, 0x3fe2e8d1} }, +/**/ {{0xfe1a437d, 0x3c831ae5} }, +/**/ {{0xb6d7f622, 0xbfd2981c} }, +/**/ {{0x86e9fe4d, 0xbc53da87} }, +/**/ {{0x21d425b2, 0x3fb2f5e8} }, +/**/ {{0xae2616cb, 0xbc186482} }, +/**/ {{0x4a85a0e4, 0x3f9ff7d2} }, +/**/ {{0xe2d9205b, 0xbc294288} }, +/**/ {{0xcfb8dc09, 0xbfaa04e0} }, +/**/ {{0x0b1f9c73, 0x3f9e0c64} }, +/**/ {{0xbd3845d8, 0xbf6ae504} }, +/**/ {{0x19278cae, 0xbf84d965} }, +/**/ {{0x9cf7183b, 0x3f855059} } }, +/**/ {{{0x00000000, 0x3feac000} }, +/**/ {{0xb8e20b90, 0x3fe647de} }, +/**/ {{0x023a51cf, 0xbc5eca04} }, +/**/ {{0x6703b033, 0x3fe2d640} }, +/**/ {{0x38039b02, 0x3c870ae6} }, +/**/ {{0x6c39acf5, 0xbfd289d8} }, +/**/ {{0x0238a7ee, 0xbc71f038} }, +/**/ {{0x71da955f, 0x3fb3155e} }, +/**/ {{0xd41f84df, 0xbc5faa02} }, +/**/ {{0xc3c69caa, 0x3f9ef563} }, +/**/ {{0x75403dbd, 0x3c331d29} }, +/**/ {{0x1174124f, 0xbfa9aae0} }, +/**/ {{0x3eedb30b, 0x3f9df3bb} }, +/**/ {{0x1c632765, 0xbf6d7445} }, +/**/ {{0xa4fa03e7, 0xbf841b28} }, +/**/ {{0x8646990d, 0x3f84f5d2} } }, +/**/ {{{0x00000000, 0x3feae000} }, +/**/ {{0xb6c07b03, 0x3fe65aab} }, +/**/ {{0x3af32729, 0xbc67939b} }, +/**/ {{0xba718de8, 0x3fe2c3bd} }, +/**/ {{0xc4990a2b, 0xbc82d2fc} }, +/**/ {{0xe9586818, 0xbfd27b7c} }, +/**/ {{0x880839ca, 0x3c780d5e} }, +/**/ {{0x14dfe9e3, 0x3fb333d4} }, +/**/ {{0xbce74cae, 0x3c536469} }, +/**/ {{0xc77983b8, 0x3f9df677} }, +/**/ {{0xb42f53aa, 0x3c373272} }, +/**/ {{0x9f3c360e, 0xbfa9512c} }, +/**/ {{0x72d37b24, 0x3f9dd8df} }, +/**/ {{0x02e417f5, 0xbf6febf1} }, +/**/ {{0xd16a1579, 0xbf83601e} }, +/**/ {{0x294a83e4, 0x3f849a74} } }, +/**/ {{{0x00000000, 0x3feb0000} }, +/**/ {{0x3923e087, 0x3fe66d66} }, +/**/ {{0xebe8bbba, 0xbc76ea6f} }, +/**/ {{0x74aea886, 0x3fe2b149} }, +/**/ {{0xa9d6d16a, 0x3c868ffd} }, +/**/ {{0xed65571e, 0xbfd26d0a} }, +/**/ {{0x476fb5f2, 0x3c6cf972} }, +/**/ {{0x8be1339f, 0x3fb3514c} }, +/**/ {{0x3f722216, 0x3c5c8c0f} }, +/**/ {{0x300f8f9b, 0x3f9cfb0b} }, +/**/ {{0x38d1c932, 0xbc0edd81} }, +/**/ {{0xf34b004f, 0xbfa8f7cc} }, +/**/ {{0x1bd3bde0, 0x3f9dbbe5} }, +/**/ {{0x9bf7dceb, 0xbf712637} }, +/**/ {{0xa146e5b2, 0xbf82a84e} }, +/**/ {{0x05f2718e, 0x3f843e5e} } }, +/**/ {{{0x00000000, 0x3feb2000} }, +/**/ {{0x4e7e2858, 0x3fe6800e} }, +/**/ {{0x1b3e90f0, 0xbc58ea6a} }, +/**/ {{0xabd5912c, 0x3fe29ee3} }, +/**/ {{0xb17c28e3, 0xbc61b3cd} }, +/**/ {{0x34f221eb, 0xbfd25e83} }, +/**/ {{0xfa300585, 0xbc74c483} }, +/**/ {{0x5495f6e3, 0x3fb36dcb} }, +/**/ {{0x311973fe, 0x3c59b55b} }, +/**/ {{0x9864d139, 0x3f9c031a} }, +/**/ {{0xbd00e171, 0x3c28fdf3} }, +/**/ {{0x4b026585, 0xbfa89ec7} }, +/**/ {{0x54a5ed3d, 0x3f9d9ce0} }, +/**/ {{0xa8cb6dfc, 0xbf724b13} }, +/**/ {{0x015469a9, 0xbf81f3be} }, +/**/ {{0x66a50a89, 0x3f83e1ae} } }, +/**/ {{{0x00000000, 0x3feb4000} }, +/**/ {{0x0556fb6a, 0x3fe692a4} }, +/**/ {{0x5a8ea2cc, 0x3c8d94b9} }, +/**/ {{0x75459603, 0x3fe28c8c} }, +/**/ {{0x2945fc08, 0x3c8b1c3b} }, +/**/ {{0x79f37468, 0xbfd24fe6} }, +/**/ {{0x0ec1ef94, 0xbc4e3751} }, +/**/ {{0xe931c53b, 0x3fb38953} }, +/**/ {{0x16d80688, 0xbc3b108d} }, +/**/ {{0x5e1b50b5, 0x3f9b0ea2} }, +/**/ {{0x63fd1067, 0x3c0074c0} }, +/**/ {{0xa7fc7800, 0xbfa84621} }, +/**/ {{0xdd10256e, 0x3f9d7be4} }, +/**/ {{0xc9592c5e, 0xbf7364c0} }, +/**/ {{0xd318d707, 0xbf814271} }, +/**/ {{0x64d217b8, 0x3f838482} } }, +/**/ {{{0x00000000, 0x3feb6000} }, +/**/ {{0x6c4b0576, 0x3fe6a527} }, +/**/ {{0x9c46a69e, 0xbc8f6b65} }, +/**/ {{0xe5a55de9, 0x3fe27a43} }, +/**/ {{0xedc25d49, 0x3c66846e} }, +/**/ {{0x73c3b821, 0xbfd24135} }, +/**/ {{0x56ab5808, 0xbc79202a} }, +/**/ {{0xc0282c84, 0x3fb3a3e9} }, +/**/ {{0x03d25dab, 0x3c4057ca} }, +/**/ {{0xa3eb854d, 0x3f9a1d9e} }, +/**/ {{0xf03e2fb1, 0xbc3775ed} }, +/**/ {{0xd11d1043, 0xbfa7ede1} }, +/**/ {{0x195e6961, 0x3f9d5906} }, +/**/ {{0x65130256, 0xbf747373} }, +/**/ {{0xf77fd664, 0xbf80946d} }, +/**/ {{0xedc272c2, 0x3f8326f5} } }, +/**/ {{{0x00000000, 0x3feb8000} }, +/**/ {{0x920b3d99, 0x3fe6b798} }, +/**/ {{0x6188c50e, 0xbc8a8038} }, +/**/ {{0x10e5813e, 0x3fe2680a} }, +/**/ {{0x2242a6bc, 0xbc8f5497} }, +/**/ {{0xd725fa1c, 0xbfd23270} }, +/**/ {{0x5c781b14, 0x3c757282} }, +/**/ {{0x4bf2f124, 0x3fb3bd90} }, +/**/ {{0x6a14ed74, 0x3c31ae9c} }, +/**/ {{0x53ea1533, 0x3f99300b} }, +/**/ {{0x68f98d7e, 0x3c2a8d88} }, +/**/ {{0x53a4e537, 0xbfa7960d} }, +/**/ {{0x11f5f086, 0x3f9d3457} }, +/**/ {{0x19baa1da, 0xbf757760} }, +/**/ {{0xb2a2ca7e, 0xbf7fd36a} }, +/**/ {{0xc7a02081, 0x3f82c923} } }, +/**/ {{{0x00000000, 0x3feba000} }, +/**/ {{0x855c3198, 0x3fe6c9f7} }, +/**/ {{0x29bd280d, 0x3c7c09de} }, +/**/ {{0x0a431fbd, 0x3fe255df} }, +/**/ {{0xf09a745d, 0x3c8d9866} }, +/**/ {{0x5648fb1f, 0xbfd22399} }, +/**/ {{0xb4df0b3e, 0x3c412100} }, +/**/ {{0xfada8899, 0x3fb3d64a} }, +/**/ {{0x659c4346, 0x3c3dd891} }, +/**/ {{0x21c2d0a1, 0x3f9845e4} }, +/**/ {{0xf397827c, 0x3c28c6b1} }, +/**/ {{0x8445c1cc, 0xbfa73ea9} }, +/**/ {{0x730360f8, 0x3f9d0dea} }, +/**/ {{0xac51ce30, 0xbf7670bb} }, +/**/ {{0xeef50deb, 0xbf7e8493} }, +/**/ {{0x96b119a9, 0x3f826b25} } }, +/**/ {{{0x00000000, 0x3febc000} }, +/**/ {{0x551553af, 0x3fe6dc44} }, +/**/ {{0x3573828e, 0xbc5bf886} }, +/**/ {{0xe44a7335, 0x3fe243c2} }, +/**/ {{0x65d1ffd7, 0xbc667287} }, +/**/ {{0xa0ca68d3, 0xbfd214af} }, +/**/ {{0x88820895, 0xbc71296c} }, +/**/ {{0x36c0c9a2, 0x3fb3ee1d} }, +/**/ {{0x831dfabe, 0x3c540bf6} }, +/**/ {{0x8ce8de84, 0x3f975f24} }, +/**/ {{0x43eb5853, 0xbc125368} }, +/**/ {{0x803788f8, 0xbfa6e7bb} }, +/**/ {{0x8c42d5f9, 0x3f9ce5d2} }, +/**/ {{0xfaadb3ab, 0xbf775fba} }, +/**/ {{0xde4c28da, 0xbf7d3c59} }, +/**/ {{0xe2bf7ef5, 0x3f820d13} } }, +/**/ {{{0x00000000, 0x3febe000} }, +/**/ {{0x10204aef, 0x3fe6ee7f} }, +/**/ {{0xa3066272, 0x3c8692ee} }, +/**/ {{0xb0d95ee5, 0x3fe231b5} }, +/**/ {{0x1eb505b6, 0x3c7aae7e} }, +/**/ {{0x63ba3e08, 0xbfd205b4} }, +/**/ {{0xb975517d, 0x3c71c6d1} }, +/**/ {{0x64edc729, 0x3fb4050a} }, +/**/ {{0x715db809, 0x3c4960ed} }, +/**/ {{0xe2bc143b, 0x3f967bc7} }, +/**/ {{0xf0823143, 0xbc2cbf17} }, +/**/ {{0x2e4dbc47, 0xbfa69148} }, +/**/ {{0x50e0982e, 0x3f9cbc21} }, +/**/ {{0xedaa432a, 0xbf784492} }, +/**/ {{0x0b4850f3, 0xbf7bfabd} }, +/**/ {{0x1caa2f2c, 0x3f81af06} } }, +/**/ {{{0x00000000, 0x3fec0000} }, +/**/ {{0xc5784634, 0x3fe700a7} }, +/**/ {{0x25aadef6, 0xbc78c34d} }, +/**/ {{0x8121fb78, 0x3fe21fb7} }, +/**/ {{0x8121fb78, 0x3c621fb7} }, +/**/ {{0x499e4889, 0xbfd1f6a8} }, +/**/ {{0x6d4e0249, 0xbc60e934} }, +/**/ {{0xe5decb17, 0x3fb41b15} }, +/**/ {{0xab3541e6, 0x3c5194f4} }, +/**/ {{0x40a374b5, 0x3f959bc9} }, +/**/ {{0x54be0e10, 0xbc39dc6e} }, +/**/ {{0x400d3c9a, 0xbfa63b54} }, +/**/ {{0x57717232, 0x3f9c90e8} }, +/**/ {{0x6bfa704e, 0xbf791f78} }, +/**/ {{0x643da6dd, 0xbf7abfbc} }, +/**/ {{0xa418ed31, 0x3f815112} } }, +/**/ {{{0x00000000, 0x3fec2000} }, +/**/ {{0x84295198, 0x3fe712be} }, +/**/ {{0x337d8881, 0x3c85cd90} }, +/**/ {{0x65ad1f5b, 0x3fe20dc8} }, +/**/ {{0xd7b50d48, 0xbc88102a} }, +/**/ {{0xfa75d2f4, 0xbfd1e78b} }, +/**/ {{0x619624d2, 0x3c723734} }, +/**/ {{0x1517663e, 0x3fb43043} }, +/**/ {{0xe5e1ddf1, 0xbc4af8a4} }, +/**/ {{0x961cd605, 0x3f94bf23} }, +/**/ {{0x5ca14507, 0xbc26e86e} }, +/**/ {{0x32c1ffd7, 0xbfa5e5e4} }, +/**/ {{0xda0191cd, 0x3f9c6438} }, +/**/ {{0x4d921d2b, 0xbf79f0a0} }, +/**/ {{0x4e35d54e, 0xbf798b55} }, +/**/ {{0xcd4f7bfd, 0x3f80f34e} } }, +/**/ {{{0x00000000, 0x3fec4000} }, +/**/ {{0x5b4fae7b, 0x3fe724c3} }, +/**/ {{0x2db3499b, 0x3c5948b3} }, +/**/ {{0x6e5ce35d, 0x3fe1fbe8} }, +/**/ {{0x561e27a3, 0x3c8101d1} }, +/**/ {{0x1bbd70f4, 0xbfd1d860} }, +/**/ {{0xfa32c4d1, 0xbc7b4c97} }, +/**/ {{0x48f48a77, 0x3fb44495} }, +/**/ {{0xb47fdf89, 0xbc2ccfed} }, +/**/ {{0xa6c1af2c, 0x3f93e5d1} }, +/**/ {{0xc3b5a19b, 0xbc14af58} }, +/**/ {{0x5094795f, 0xbfa590fc} }, +/**/ {{0xb638ebc2, 0x3f9c3623} }, +/**/ {{0x4fa66d0e, 0xbf7ab83f} }, +/**/ {{0xb787e297, 0xbf785d83} }, +/**/ {{0xe71b4cea, 0x3f8095ce} } }, +/**/ {{{0x00000000, 0x3fec6000} }, +/**/ {{0x5a172dff, 0x3fe736b6} }, +/**/ {{0x06a892d1, 0x3c7775fd} }, +/**/ {{0xaa6f2377, 0x3fe1ea17} }, +/**/ {{0xcb44ec07, 0xbc8395a8} }, +/**/ {{0x5072ec76, 0xbfd1c925} }, +/**/ {{0xf650d5de, 0xbc6e11b3} }, +/**/ {{0xd281a42b, 0x3fb4580f} }, +/**/ {{0xf63226cb, 0xbc55bbce} }, +/**/ {{0x0c411254, 0x3f930fce} }, +/**/ {{0xc9852726, 0x3c3a4412} }, +/**/ {{0xb19e766e, 0xbfa53ca0} }, +/**/ {{0x6d941dd5, 0x3f9c06b9} }, +/**/ {{0x094128b2, 0xbf7b768a} }, +/**/ {{0x2a047c42, 0xbf773642} }, +/**/ {{0x40d7925f, 0x3f8038a6} } }, +/**/ {{{0x00000000, 0x3fec8000} }, +/**/ {{0x8fba8e0f, 0x3fe74897} }, +/**/ {{0x165884a1, 0x3c47b2a6} }, +/**/ {{0x287ffb8a, 0x3fe1d856} }, +/**/ {{0xfee27a9d, 0xbc658a1f} }, +/**/ {{0x39195240, 0xbfd1b9dc} }, +/**/ {{0x551dc6bf, 0x3c604646} }, +/**/ {{0xfd4fa866, 0x3fb46ab5} }, +/**/ {{0xc2febe43, 0x3c5f62a7} }, +/**/ {{0x384eda2c, 0x3f923d13} }, +/**/ {{0x1dfd9f34, 0x3c3b9a7c} }, +/**/ {{0x3cff324c, 0xbfa4e8d5} }, +/**/ {{0x25b0d0ad, 0x3f9bd60a} }, +/**/ {{0xe063d1e6, 0xbf7c2bb4} }, +/**/ {{0xdcb54dd5, 0xbf761589} }, +/**/ {{0x61077b85, 0x3f7fb7ce} } }, +/**/ {{{0x00000000, 0x3feca000} }, +/**/ {{0x0b82d8d8, 0x3fe75a67} }, +/**/ {{0x4c729087, 0x3c8ee4ac} }, +/**/ {{0xf68c4011, 0x3fe1c6a3} }, +/**/ {{0x32671c29, 0xbc8e54e4} }, +/**/ {{0x73bd1c8f, 0xbfd1aa85} }, +/**/ {{0x41d7bd80, 0x3c7525ad} }, +/**/ {{0x0f4e0cc0, 0x3fb47c8b} }, +/**/ {{0xd854875c, 0x3c2efdd1} }, +/**/ {{0x7688134d, 0x3f916d9b} }, +/**/ {{0x42a6f922, 0xbc1abef6} }, +/**/ {{0xa9ee694e, 0xbfa4959d} }, +/**/ {{0xa8aca118, 0x3f9ba425} }, +/**/ {{0xffb6fa1f, 0xbf7cd7f3} }, +/**/ {{0xc52e395a, 0xbf74fb52} }, +/**/ {{0x31d14661, 0x3f7eff46} } }, +/**/ {{{0x00000000, 0x3fecc000} }, +/**/ {{0xdcc6c6c0, 0x3fe76c24} }, +/**/ {{0x51adc83d, 0x3c819525} }, +/**/ {{0x21f3f28c, 0x3fe1b501} }, +/**/ {{0x5f1d67b6, 0xbc45712f} }, +/**/ {{0x9bf87a43, 0xbfd19b21} }, +/**/ {{0xb2071e48, 0xbc64520a} }, +/**/ {{0x48a59e43, 0x3fb48d92} }, +/**/ {{0x42014b8b, 0x3c5f8e56} }, +/**/ {{0xee4caccb, 0x3f90a160} }, +/**/ {{0x7b6daa67, 0x3c2bd92b} }, +/**/ {{0x80ce3489, 0xbfa442fd} }, +/**/ {{0x65959e45, 0x3f9b711b} }, +/**/ {{0x4cc2673a, 0xbf7d7b7b} }, +/**/ {{0xa86f8a8e, 0xbf73e793} }, +/**/ {{0xdf91602d, 0x3f7e47d4} } }, +/**/ {{{0x00000000, 0x3fece000} }, +/**/ {{0x12ea22c7, 0x3fe77dd1} }, +/**/ {{0x8fc10d3d, 0x3c873260} }, +/**/ {{0xb77cb1a2, 0x3fe1a36d} }, +/**/ {{0x6e625be9, 0xbc42c20d} }, +/**/ {{0x4af7b13c, 0xbfd18bb1} }, +/**/ {{0xbc063e5a, 0xbc68446b} }, +/**/ {{0xe3952cbb, 0x3fb49dce} }, +/**/ {{0x58cf9123, 0x3c588e60} }, +/**/ {{0x491cfa44, 0x3f8fb0bb} }, +/**/ {{0x0e3f2a43, 0x3c1534fc} }, +/**/ {{0x1c3b7aca, 0xbfa3f0f8} }, +/**/ {{0x70eb708a, 0x3f9b3cfa} }, +/**/ {{0x5eaa8b7f, 0xbf7e167e} }, +/**/ {{0x2b587c04, 0xbf72da42} }, +/**/ {{0x882fa65b, 0x3f7d9199} } }, +/**/ {{{0x00000000, 0x3fed0000} }, +/**/ {{0xbd5d315e, 0x3fe78f6b} }, +/**/ {{0x89803740, 0x3c8406a0} }, +/**/ {{0xc35424ca, 0x3fe191e9} }, +/**/ {{0xf4be863f, 0xbc8fa3c1} }, +/**/ {{0x177d9a85, 0xbfd17c35} }, +/**/ {{0x6a99d546, 0xbc717b81} }, +/**/ {{0x144fffae, 0x3fb4ad44} }, +/**/ {{0xdccca2a3, 0x3c3538b3} }, +/**/ {{0xfb2b5523, 0x3f8e2516} }, +/**/ {{0x60181bd9, 0x3c0f7c11} }, +/**/ {{0xaa1cc641, 0xbfa39f90} }, +/**/ {{0x85304289, 0x3f9b07d1} }, +/**/ {{0x756fd193, 0xbf7ea930} }, +/**/ {{0xe2a9a0de, 0xbf71d352} }, +/**/ {{0x886fc912, 0x3f7cdcb1} } }, +/**/ {{{0x00000000, 0x3fed2000} }, +/**/ {{0xeb9c19a2, 0x3fe7a0f4} }, +/**/ {{0xcd815f57, 0x3c613c67} }, +/**/ {{0x5112636f, 0x3fe18075} }, +/**/ {{0x7a335b20, 0x3c80a172} }, +/**/ {{0x95e83705, 0xbfd16cad} }, +/**/ {{0x7b21d5e1, 0x3c62a94b} }, +/**/ {{0x08de0a7c, 0x3fb4bbf5} }, +/**/ {{0x057457a0, 0x3c3570d0} }, +/**/ {{0x7d750fdf, 0x3f8c9fc8} }, +/**/ {{0xfe4cff3c, 0x3c2900a7} }, +/**/ {{0x2caf50ea, 0xbfa34eca} }, +/**/ {{0x03888c77, 0x3f9ad1af} }, +/**/ {{0x71ac3a86, 0xbf7f33c4} }, +/**/ {{0x6296fd58, 0xbf70d2b9} }, +/**/ {{0x886d16b8, 0x3f7c2938} } }, +/**/ {{{0x00000000, 0x3fed4000} }, +/**/ {{0xad2e50fe, 0x3fe7b26c} }, +/**/ {{0xf30411fb, 0xbc8ce80d} }, +/**/ {{0x6bbc577a, 0x3fe16f10} }, +/**/ {{0xbd8abf47, 0xbc7d0db6} }, +/**/ {{0x58355b5f, 0xbfd15d1b} }, +/**/ {{0xbcc70038, 0xbc5b5457} }, +/**/ {{0xe8fdd51d, 0x3fb4c9e4} }, +/**/ {{0x28ac9383, 0x3c462959} }, +/**/ {{0x2029f143, 0x3f8b20c3} }, +/**/ {{0x2b420400, 0xbc2f8a44} }, +/**/ {{0x7b921c49, 0xbfa2fea7} }, +/**/ {{0xf468e79e, 0x3f9a9aa0} }, +/**/ {{0xcccbcb4f, 0xbf7fb66c} }, +/**/ {{0x9bd39a5f, 0xbf6fb0d0} }, +/**/ {{0x8813998f, 0x3f7b7748} } }, +/**/ {{{0x00000000, 0x3fed6000} }, +/**/ {{0x11a6092b, 0x3fe7c3d3} }, +/**/ {{0x2d303288, 0x3c8bb3cb} }, +/**/ {{0x1dc61b17, 0x3fe15dbb} }, +/**/ {{0xbb77dc56, 0xbc8f0487} }, +/**/ {{0xee0771ca, 0xbfd14d7e} }, +/**/ {{0xdc2fcbd0, 0x3c72d38b} }, +/**/ {{0xd6080f0e, 0x3fb4d716} }, +/**/ {{0xa9fbc2c3, 0xbc5cb5bc} }, +/**/ {{0xfc42e02f, 0x3f89a7f9} }, +/**/ {{0x857be8a4, 0xbc201eec} }, +/**/ {{0x44ceebb3, 0xbfa2af2b} }, +/**/ {{0x08511639, 0x3f9a62b5} }, +/**/ {{0xc8de23de, 0xbf8018ad} }, +/**/ {{0xc964501a, 0xbf6dc8a2} }, +/**/ {{0xeb913697, 0x3f7ac6f9} } }, +/**/ {{{0x00000000, 0x3fed8000} }, +/**/ {{0x289fa093, 0x3fe7d528} }, +/**/ {{0x1e2f3aa9, 0x3c856082} }, +/**/ {{0x711551bb, 0x3fe14c75} }, +/**/ {{0x71970f2c, 0xbc80c88e} }, +/**/ {{0xe4aa5095, 0xbfd13dd8} }, +/**/ {{0xb4b7ae12, 0x3c66dd31} }, +/**/ {{0xead4c211, 0x3fb4e38d} }, +/**/ {{0xe392a31e, 0x3c513fb0} }, +/**/ {{0xf6b74576, 0x3f88355f} }, +/**/ {{0xf3561ab7, 0x3ba8cb44} }, +/**/ {{0x0de0faaa, 0xbfa26058} }, +/**/ {{0x989371f0, 0x3f9a29f8} }, +/**/ {{0x2b085d9a, 0xbf805261} }, +/**/ {{0x2511c555, 0xbf6beccb} }, +/**/ {{0x87b9d333, 0x3f7a1863} } }, +/**/ {{{0x00000000, 0x3feda000} }, +/**/ {{0x01c114fe, 0x3fe7e66c} }, +/**/ {{0x8b760b8d, 0xbc8c82b8} }, +/**/ {{0x6f037c44, 0x3fe13b3f} }, +/**/ {{0x8562c8c0, 0xbc635393} }, +/**/ {{0xc7182435, 0xbfd12e29} }, +/**/ {{0x0d0fda95, 0xbc73da80} }, +/**/ {{0x3ba21a8b, 0x3fb4ef4d} }, +/**/ {{0x9aa41146, 0xbc17c450} }, +/**/ {{0xc39dff46, 0x3f86c8e7} }, +/**/ {{0x800ba9ae, 0x3c1ddd70} }, +/**/ {{0x34b94b56, 0xbfa21230} }, +/**/ {{0xa827f95a, 0x3f99f078} }, +/**/ {{0x19caa997, 0xbf808869} }, +/**/ {{0xf8c46d26, 0xbf6a1d29} }, +/**/ {{0xae59da17, 0x3f796b9a} } }, +/**/ {{{0x00000000, 0x3fedc000} }, +/**/ {{0xacb97898, 0x3fe7f79e} }, +/**/ {{0x80ead221, 0x3c8fd5ca} }, +/**/ {{0x20604825, 0x3fe12a19} }, +/**/ {{0xa18970f8, 0xbc5cc7d6} }, +/**/ {{0x1dfe6ba4, 0xbfd11e72} }, +/**/ {{0x9d653d1c, 0x3c706717} }, +/**/ {{0xd5fcbb3b, 0x3fb4fa57} }, +/**/ {{0x5f50bc06, 0x3c1922c8} }, +/**/ {{0xe93a179f, 0x3f856283} }, +/**/ {{0x5ea7135a, 0xbc01c2ec} }, +/**/ {{0xf0c06b4f, 0xbfa1c4b5} }, +/**/ {{0xe48a3b04, 0x3f99b641} }, +/**/ {{0xe1280a21, 0xbf80badd} }, +/**/ {{0x1be3c5dd, 0xbf68599e} }, +/**/ {{0x3a72c8e6, 0x3f78c0b3} } }, +/**/ {{{0x00000000, 0x3fede000} }, +/**/ {{0x3940694b, 0x3fe808c0} }, +/**/ {{0x7715f6a5, 0xbc800f32} }, +/**/ {{0x8d73d98e, 0x3fe11902} }, +/**/ {{0x30f8e290, 0x3c71d158} }, +/**/ {{0x6fc305eb, 0xbfd10eb2} }, +/**/ {{0x3858c4b7, 0xbc7fd2e3} }, +/**/ {{0xc0a99255, 0x3fb504b0} }, +/**/ {{0x142e134f, 0x3c55c054} }, +/**/ {{0xc2f371cf, 0x3f840226} }, +/**/ {{0xfc7d6225, 0xbbfc85b0} }, +/**/ {{0x53d58f53, 0xbfa177eb} }, +/**/ {{0xa6a1627d, 0x3f997b60} }, +/**/ {{0x89757c78, 0xbf80e9d7} }, +/**/ {{0x0d433cd6, 0xbf66a205} }, +/**/ {{0x9c5dbd9f, 0x3f7817bf} } }, +/**/ {{{0x00000000, 0x3fee0000} }, +/**/ {{0xb7158a4d, 0x3fe819d0} }, +/**/ {{0x29d3b917, 0xbc7bf762} }, +/**/ {{0xbe011080, 0x3fe107fb} }, +/**/ {{0xbe011080, 0xbc8107fb} }, +/**/ {{0x40894fcd, 0xbfd0feeb} }, +/**/ {{0xc155af9a, 0x3c76fbb9} }, +/**/ {{0xfb9125f7, 0x3fb50e5a} }, +/**/ {{0x2f3313b0, 0x3c357762} }, +/**/ {{0x843ba55a, 0x3f82a7c2} }, +/**/ {{0x3fc197b7, 0x3c1f4994} }, +/**/ {{0x4b4ae875, 0xbfa12bd2} }, +/**/ {{0xf3b1b1ee, 0x3f993fe0} }, +/**/ {{0xd4c2083b, 0xbf81156d} }, +/**/ {{0x0c35aa9c, 0xbf64f63b} }, +/**/ {{0xe5d0462f, 0x3f7770d0} } }, +/**/ {{{0x00000000, 0x3fee2000} }, +/**/ {{0x36000005, 0x3fe82ad0} }, +/**/ {{0xce924d24, 0x3c74592f} }, +/**/ {{0xb947c8b7, 0x3fe0f704} }, +/**/ {{0x48a651b3, 0x3c436cd7} }, +/**/ {{0x1237505b, 0xbfd0ef1d} }, +/**/ {{0x1b86b9d1, 0x3c69239b} }, +/**/ {{0x7fac4e21, 0x3fb51759} }, +/**/ {{0xbfce0e36, 0xbc42a8cc} }, +/**/ {{0x3b5f3edd, 0x3f815349} }, +/**/ {{0x88c702d9, 0xbc25e1f1} }, +/**/ {{0xa0df17a9, 0xbfa0e06c} }, +/**/ {{0x7e56b8b1, 0x3f9903ce} }, +/**/ {{0x3c701e30, 0xbf813db8} }, +/**/ {{0x30c99e47, 0xbf63561b} }, +/**/ {{0xd5bffce0, 0x3f76cbf6} } }, +/**/ {{{0x00000000, 0x3fee4000} }, +/**/ {{0xc5cdee22, 0x3fe83bbe} }, +/**/ {{0x04ffc6c3, 0x3c631071} }, +/**/ {{0x86071468, 0x3fe0e61d} }, +/**/ {{0x59be09c9, 0xbc70ccc4} }, +/**/ {{0x647af38b, 0xbfd0df48} }, +/**/ {{0x427c295b, 0x3c7dd47c} }, +/**/ {{0x3ef25277, 0x3fb51faf} }, +/**/ {{0xa81026a7, 0x3bdf056a} }, +/**/ {{0xd443a18b, 0x3f8004ac} }, +/**/ {{0x8178f329, 0x3c027610} }, +/**/ {{0xfbb3a658, 0xbfa095bb} }, +/**/ {{0xa7859d46, 0x3f98c734} }, +/**/ {{0xeefe9a81, 0xbf8162cd} }, +/**/ {{0x8330eac0, 0xbf61c17f} }, +/**/ {{0xe421c20a, 0x3f76293f} } }, +/**/ {{{0x00000000, 0x3fee6000} }, +/**/ {{0x7653f7eb, 0x3fe84c9c} }, +/**/ {{0xfe0a3e8f, 0xbc383611} }, +/**/ {{0x2a7f71b5, 0x3fe0d546} }, +/**/ {{0x596848c6, 0x3c757061} }, +/**/ {{0xb4cf51a6, 0xbfd0cf6d} }, +/**/ {{0x5b18bb8c, 0x3c4c99ab} }, +/**/ {{0x24486227, 0x3fb5275f} }, +/**/ {{0xbb1f4f56, 0x3c5b4a59} }, +/**/ {{0x36238bb2, 0x3f7d77be} }, +/**/ {{0xcaec6ba2, 0x3c1ddbd1} }, +/**/ {{0xe1406cd0, 0xbfa04bc1} }, +/**/ {{0x7f96d6ca, 0x3f988a1e} }, +/**/ {{0xcdffc380, 0xbf8184c5} }, +/**/ {{0x12561f8b, 0xbf603841} }, +/**/ {{0x4d81a668, 0x3f7588b9} } }, +/**/ {{{0x00000000, 0x3fee8000} }, +/**/ {{0x576cc2c5, 0x3fe85d69} }, +/**/ {{0x7fc8b8c3, 0x3c66b66e} }, +/**/ {{0xac74fadc, 0x3fe0c47e} }, +/**/ {{0x77bb1887, 0xbc8035f8} }, +/**/ {{0x7e8202a9, 0xbfd0bf8d} }, +/**/ {{0x1f4d2357, 0x3c798048} }, +/**/ {{0x13725c73, 0x3fb52e6c} }, +/**/ {{0xf5b19ded, 0xbc34c3af} }, +/**/ {{0x7d9c2711, 0x3f7af1a3} }, +/**/ {{0x1af1098d, 0x3bea7ec7} }, +/**/ {{0xb643d11f, 0xbfa0027f} }, +/**/ {{0xc756b7d7, 0x3f984c96} }, +/**/ {{0x6c3ca3ae, 0xbf81a3b6} }, +/**/ {{0x13459246, 0xbf5d7470} }, +/**/ {{0x1e70d9a4, 0x3f74ea6f} } }, +/**/ {{{0x00000000, 0x3feea000} }, +/**/ {{0x78f87ae5, 0x3fe86e25} }, +/**/ {{0x375cfe34, 0x3c8022b1} }, +/**/ {{0x11319104, 0x3fe0b3c7} }, +/**/ {{0x25152519, 0x3c8ac394} }, +/**/ {{0x3ab87c8a, 0xbfd0afa8} }, +/**/ {{0x27b31384, 0x3c724f26} }, +/**/ {{0xe904e078, 0x3fb534d8} }, +/**/ {{0xf8948323, 0xbc55bfde} }, +/**/ {{0xa7bb2dfb, 0x3f7876ec} }, +/**/ {{0x8a87be50, 0xbc197116} }, +/**/ {{0x7f5f95b4, 0xbf9f73ed} }, +/**/ {{0xf11c3266, 0x3f980ea7} }, +/**/ {{0x0c032389, 0xbf81bfb6} }, +/**/ {{0x8bf305a1, 0xbf5a8e77} }, +/**/ {{0x3ec72e6d, 0x3f744e6c} } }, +/**/ {{{0x00000000, 0x3feec000} }, +/**/ {{0xeadc5a2a, 0x3fe87ed0} }, +/**/ {{0xd957f4bc, 0x3c70af5a} }, +/**/ {{0x5d8701b3, 0x3fe0a31f} }, +/**/ {{0x263ce937, 0xbc869b25} }, +/**/ {{0x60757b83, 0xbfd09fbe} }, +/**/ {{0xa96db9ef, 0x3c767aff} }, +/**/ {{0x7a589afb, 0x3fb53aa8} }, +/**/ {{0x0844ff86, 0xbc4b7e8e} }, +/**/ {{0xacf1a65c, 0x3f76077c} }, +/**/ {{0xb13331a9, 0xbc19a3b2} }, +/**/ {{0x472733eb, 0xbf9ee450} }, +/**/ {{0x21e541d7, 0x3f97d05c} }, +/**/ {{0x9d9d4dfc, 0xbf81d8da} }, +/**/ {{0xd3ce1b4a, 0xbf57be45} }, +/**/ {{0x7cb60047, 0x3f73b4ba} } }, +/**/ {{{0x00000000, 0x3feee000} }, +/**/ {{0xbd023119, 0x3fe88f6b} }, +/**/ {{0x25aba660, 0xbc532d1d} }, +/**/ {{0x95d126c6, 0x3fe09287} }, +/**/ {{0xeccc37a6, 0x3c85aad3} }, +/**/ {{0x649e7367, 0xbfd08fd0} }, +/**/ {{0xed21a127, 0x3c71e96c} }, +/**/ {{0x957ec910, 0x3fb53fdd} }, +/**/ {{0xaf97a601, 0xbc339c23} }, +/**/ {{0x5a18e5a2, 0x3f73a336} }, +/**/ {{0x477571de, 0xbc1f7225} }, +/**/ {{0xd4044135, 0xbf9e5629} }, +/**/ {{0x32786dc4, 0x3f9791bd} }, +/**/ {{0xbdf030c4, 0xbf81ef39} }, +/**/ {{0xe21b8bcb, 0xbf550386} }, +/**/ {{0x97aa7fb2, 0x3f731d62} } }, +/**/ {{{0x00000000, 0x3fef0000} }, +/**/ {{0xff57f1f8, 0x3fe89ff5} }, +/**/ {{0x5e177a1b, 0xbc855b9a} }, +/**/ {{0xbdf80108, 0x3fe081ff} }, +/**/ {{0x80108200, 0x3c6ffbdf} }, +/**/ {{0xba010928, 0xbfd07fde} }, +/**/ {{0x7bae0295, 0x3c38d37f} }, +/**/ {{0x0136e69f, 0x3fb5447b} }, +/**/ {{0x0dda278d, 0x3c50316a} }, +/**/ {{0x55103947, 0x3f7149fc} }, +/**/ {{0x849e505f, 0x3c176e96} }, +/**/ {{0xfbe9a2ee, 0xbf9dc97b} }, +/**/ {{0xb08adda9, 0x3f9752d4} }, +/**/ {{0xb540d106, 0xbf8202e8} }, +/**/ {{0x859de3e9, 0xbf525de5} }, +/**/ {{0x4afd9f21, 0x3f72886c} } }, +/**/ {{{0x00000000, 0x3fef2000} }, +/**/ {{0xc1cf3dff, 0x3fe8b06f} }, +/**/ {{0x2656db6d, 0xbc80fb31} }, +/**/ {{0xd971cd38, 0x3fe07187} }, +/**/ {{0x202c20ac, 0x3c89baa4} }, +/**/ {{0xd15893ab, 0xbfd06fe9} }, +/**/ {{0xdc0cb586, 0xbc7a864b} }, +/**/ {{0x7ce57fed, 0x3fb54883} }, +/**/ {{0x294f4b18, 0xbc49498e} }, +/**/ {{0x426ebecc, 0x3f6df762} }, +/**/ {{0xf28644c0, 0xbc022f08} }, +/**/ {{0x5c564b44, 0xbf9d3e48} }, +/**/ {{0xdfea7acf, 0x3f9713ab} }, +/**/ {{0x761db35c, 0xbf8213fc} }, +/**/ {{0x10d60f49, 0xbf4f9a17} }, +/**/ {{0x58700e9b, 0x3f71f5de} } }, +/**/ {{{0x00000000, 0x3fef4000} }, +/**/ {{0x145cf49d, 0x3fe8c0d9} }, +/**/ {{0x76dc4333, 0x3c8bea40} }, +/**/ {{0xeb45139a, 0x3fe0611f} }, +/**/ {{0x65aadb1f, 0x3c7e4998} }, +/**/ {{0x1953a316, 0xbfd05ff2} }, +/**/ {{0xa1b67b0f, 0x3c759922} }, +/**/ {{0xc08c1d66, 0x3fb54bf9} }, +/**/ {{0xd220330c, 0x3c5b9353} }, +/**/ {{0x478cb604, 0x3f69706e} }, +/**/ {{0xa22fd45a, 0xbbfdb6d3} }, +/**/ {{0x5c0d1d38, 0xbf9cb490} }, +/**/ {{0xbbaba2f2, 0x3f96d44b} }, +/**/ {{0x9c6b7de1, 0xbf822289} }, +/**/ {{0xa49803b6, 0xbf4aa143} }, +/**/ {{0x9270e49e, 0x3f7165be} } }, +/**/ {{{0x00000000, 0x3fef6000} }, +/**/ {{0x06f8c4cb, 0x3fe8d132} }, +/**/ {{0xbaa89a8b, 0xbc7b018c} }, +/**/ {{0xf60ab1f4, 0x3fe050c7} }, +/**/ {{0xc6cf5796, 0x3c63f8e2} }, +/**/ {{0xfe998dc0, 0xbfd04ff7} }, +/**/ {{0x7dc56419, 0x3c77873c} }, +/**/ {{0x7cc24121, 0x3fb54ee0} }, +/**/ {{0x8e5c84c5, 0x3c313117} }, +/**/ {{0x50066301, 0x3f64fee1} }, +/**/ {{0x017261a1, 0x3c043698} }, +/**/ {{0x2cc5b4f1, 0xbf9c2c55} }, +/**/ {{0xf759f369, 0x3f9694bc} }, +/**/ {{0x6c93426a, 0xbf822ea4} }, +/**/ {{0x135d6c51, 0xbf45d0a1} }, +/**/ {{0xe62dc18f, 0x3f70d811} } }, +/**/ {{{0x00000000, 0x3fef8000} }, +/**/ {{0xa99cc05e, 0x3fe8e17a} }, +/**/ {{0xab042f61, 0xbc7ec182} }, +/**/ {{0xfbefe001, 0x3fe0407f} }, +/**/ {{0xfbf80041, 0x3c401ffe} }, +/**/ {{0xebd00209, 0xbfd03ffb} }, +/**/ {{0xb9004112, 0xbc53ff3c} }, +/**/ {{0x5aaf6d91, 0x3fb5513a} }, +/**/ {{0xc0516ddb, 0x3c54a20d} }, +/**/ {{0xc6ac4038, 0x3f60a27f} }, +/**/ {{0x2a340912, 0x3bf06bee} }, +/**/ {{0xccd6032a, 0xbf9ba597} }, +/**/ {{0x002bb974, 0x3f965508} }, +/**/ {{0xd2d1068b, 0xbf823860} }, +/**/ {{0x666265bc, 0xbf41277e} }, +/**/ {{0x656b66ea, 0x3f704cdc} } }, +/**/ {{{0x00000000, 0x3fefa000} }, +/**/ {{0x0c44f167, 0x3fe8f1b3} }, +/**/ {{0xb93933fd, 0x3c6dd1ca} }, +/**/ {{0xfeb82e4e, 0x3fe03047} }, +/**/ {{0x5272e5ac, 0x3c69ee56} }, +/**/ {{0x49a09c45, 0xbfd02ffe} }, +/**/ {{0xb26267bb, 0xbc700a59} }, +/**/ {{0xfc062d2f, 0x3fb55309} }, +/**/ {{0xb11938e0, 0x3c5dba48} }, +/**/ {{0xe4f365be, 0x3f58b61b} }, +/**/ {{0xa79ad31a, 0x3bf8b585} }, +/**/ {{0x08d4ad17, 0xbf9b2059} }, +/**/ {{0xfe379940, 0x3f961534} }, +/**/ {{0x62a1270e, 0xbf823fd2} }, +/**/ {{0x3f3a0aec, 0xbf394a53} }, +/**/ {{0xa04bcae2, 0x3f6f8842} } }, +/**/ {{{0x00000000, 0x3fefc000} }, +/**/ {{0x3eeef187, 0x3fe901db} }, +/**/ {{0xe5603c8f, 0x3c868665} }, +/**/ {{0xffbf7f80, 0x3fe0201f} }, +/**/ {{0xffbf7f80, 0x3c20201f} }, +/**/ {{0x7ebe8004, 0xbfd01fff} }, +/**/ {{0xcf979001, 0xbc4213ff} }, +/**/ {{0xfb0012db, 0x3fb55451} }, +/**/ {{0xf73aa59f, 0xbc395606} }, +/**/ {{0xfc757100, 0x3f50509f} }, +/**/ {{0xfee554d0, 0x3bebc7da} }, +/**/ {{0x7d3424d0, 0xbf9a9c99} }, +/**/ {{0xd5ac0217, 0x3f95d54b} }, +/**/ {{0x564b3c49, 0xbf82450c} }, +/**/ {{0xe6d3e986, 0xbf3091df} }, +/**/ {{0x3bef5a22, 0x3f6e7bc6} } }, +/**/ {{{0x00000000, 0x3fefe000} }, +/**/ {{0x5199833b, 0x3fe911f3} }, +/**/ {{0x0edbf522, 0x3c63ae8a} }, +/**/ {{0xfffbfbfe, 0x3fe01007} }, +/**/ {{0xfffbfbfe, 0x3ba01007} }, +/**/ {{0xefebf400, 0xbfd00fff} }, +/**/ {{0xfff9f97d, 0xbc401209} }, +/**/ {{0xea5aaaf6, 0x3fb55514} }, +/**/ {{0xb5b7b240, 0xbc529baa} }, +/**/ {{0xffc7abc4, 0x3f402827} }, +/**/ {{0xbfee6ab3, 0x3b5ba3d6} }, +/**/ {{0x97d67093, 0xbf9a1a59} }, +/**/ {{0x28080aaf, 0x3f959554} }, +/**/ {{0x8e892ce2, 0xbf824821} }, +/**/ {{0xfe70a2a6, 0xbf204877} }, +/**/ {{0x0e8ddd67, 0x3f6d7447} } }, +/**/ {{{0x00000000, 0x3feff800} }, +/**/ {{0xd439826e, 0x3fe91dfa} }, +/**/ {{0x6df48d55, 0xbc786a19} }, +/**/ {{0x7ffffbff, 0x3fe00400} }, +/**/ {{0xffbff800, 0xbbeffffe} }, +/**/ {{0xffbfebfd, 0xbfd003ff} }, +/**/ {{0x9ffff9fe, 0xbb600480} }, +/**/ {{0x53aa5aab, 0x3fb55551} }, +/**/ {{0x9baaab5b, 0xbc542a4a} }, +/**/ {{0x7fffc7eb, 0x3f200a02} }, +/**/ {{0x4770e940, 0xbb7dfffe} }, +/**/ {{0x9997d8d0, 0xbf99b9a5} }, +/**/ {{0x50a80a03, 0x3f956555} }, +/**/ {{0x86456493, 0xbf824914} }, +/**/ {{0x7ffe7329, 0xbf001207} }, +/**/ {{0x1c63fe2a, 0x3f6cb1ef} } }, + }; + +#endif +#endif diff --git a/libgcc-math/dbl-64/uexp.h b/libgcc-math/dbl-64/uexp.h new file mode 100644 index 00000000000..de6f4f8cee7 --- /dev/null +++ b/libgcc-math/dbl-64/uexp.h @@ -0,0 +1,70 @@ +/* + * IBM Accurate Mathematical Library + * Written by International Business Machines Corp. + * Copyright (C) 2001 Free Software Foundation, Inc. + * + * This program is free software; you can redistribute it and/or modify + * it under the terms of the GNU Lesser General Public License as published by + * the Free Software Foundation; either version 2.1 of the License, or + * (at your option) any later version. + * + * This program is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU Lesser General Public License for more details. + * + * You should have received a copy of the GNU Lesser General Public License + * along with this program; if not, write to the Free Software + * Foundation, Inc., 59 Temple Place - Suite 330, Boston, MA 02111-1307, USA. + */ + +/******************************************************************/ +/* */ +/* MODULE_NAME:uexp.h */ +/* */ +/* common data and variables prototype and definition */ +/******************************************************************/ + +#ifndef UEXP_H +#define UEXP_H + +#include "mydefs.h" + +const static double one = 1.0, zero = 0.0, hhuge = 1.0e300, tiny = 1.0e-300, +err_0 = 1.000014, err_1 = 0.000016; +const static int4 bigint = 0x40862002, + badint = 0x40876000,smallint = 0x3C8fffff; +const static int4 hugeint = 0x7FFFFFFF, infint = 0x7ff00000; + +#ifdef BIG_ENDI +const static mynumber inf = {{0x7FF00000, 0}}; /* inf */ +const static mynumber t256 = {{0x4ff00000, 0}}; /* 2^256 */ + +const static mynumber ln_two1 = {{0x3FE62E42, 0xFEFA3800}};/*0.69314718055989033 */ +const static mynumber ln_two2 = {{0x3D2EF357, 0x93C76730}};/*5.4979230187083712e-14*/ +const static mynumber log2e = {{0x3FF71547, 0x652B82FE}};/* 1.4426950408889634 */ + +const static mynumber p2 = {{0x3FE00000, 0x000004DC}};/* 0.50000000000013811 */ +const static mynumber p3 = {{0x3FC55555, 0x55555A0F}};/* 0.16666666666670024 */ + +const static mynumber three33 = {{0x42180000, 0}}; /* 25769803776 */ +const static mynumber three51 = {{0x43380000, 0}}; /* 6755399441055744 */ + +#else +#ifdef LITTLE_ENDI + const static mynumber inf = {{0, 0x7FF00000}}; /* inf */ + const static mynumber t256 = {{0, 0x4ff00000}}; /* 2^256 */ + + const static mynumber ln_two1 = {{0xFEFA3800, 0x3FE62E42}};/*0.69314718055989033 */ + const static mynumber ln_two2 = {{0x93C76730, 0x3D2EF357}};/*5.4979230187083712e-14*/ + const static mynumber log2e = {{0x652B82FE, 0x3FF71547}};/* 1.4426950408889634 */ + + const static mynumber p2 = {{0x000004DC, 0x3FE00000}};/* 0.50000000000013811 */ + const static mynumber p3 = {{0x55555A0F, 0x3FC55555}};/* 0.16666666666670024 */ + + const static mynumber three33 = {{0, 0x42180000}}; /* 25769803776 */ + const static mynumber three51 = {{0, 0x43380000}}; /* 6755399441055744 */ + +#endif +#endif +#endif diff --git a/libgcc-math/dbl-64/uexp.tbl b/libgcc-math/dbl-64/uexp.tbl new file mode 100644 index 00000000000..f2e8e8f559c --- /dev/null +++ b/libgcc-math/dbl-64/uexp.tbl @@ -0,0 +1,1787 @@ +/* + * IBM Accurate Mathematical Library + * Written by International Business Machines Corp. + * Copyright (C) 2001 Free Software Foundation, Inc. + * + * This program is free software; you can redistribute it and/or modify + * it under the terms of the GNU Lesser General Public License as published by + * the Free Software Foundation; either version 2.1 of the License, or + * (at your option) any later version. + * + * This program is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU Lesser General Public License for more details. + * + * You should have received a copy of the GNU Lesser General Public License + * along with this program; if not, write to the Free Software + * Foundation, Inc., 59 Temple Place - Suite 330, Boston, MA 02111-1307, USA. + */ + +/****************************************************************/ +/* TABLES FOR THE ulog() FUNCTION */ +/****************************************************************/ + +#ifdef BIG_ENDI + +static const union { + int i[1424]; + double x[712]; +} coar = { .i = { + 0x3FE69A59, 0xC8000000, 0x3DF22D4D, 0x6079C9F7, + 0x3FE6A5A9, 0xC8000000, 0x3E19882D, 0x25AF6823, + 0x3FE6B0FF, 0x74000000, 0xBE221476, 0x31DABF59, + 0x3FE6BC5A, 0xC8000000, 0x3E2312AC, 0x99A2DC0A, + 0x3FE6C7BB, 0xD0000000, 0xBE265926, 0xCE9F9355, + 0x3FE6D322, 0x84000000, 0x3E2F2C26, 0x2D298DED, + 0x3FE6DE8E, 0xF4000000, 0xBE2EC28E, 0x1E748D2F, + 0x3FE6EA01, 0x14000000, 0x3E2D8C6D, 0xC68CB7E5, + 0x3FE6F578, 0xF4000000, 0x3DEE1A9E, 0x419FE2F0, + 0x3FE700F6, 0x90000000, 0xBDFF1AFD, 0xDEAEAE34, + 0x3FE70C79, 0xEC000000, 0xBE0730FE, 0x558B7122, + 0x3FE71803, 0x0C000000, 0xBE25CB85, 0x2D280C3B, + 0x3FE72391, 0xF0000000, 0xBE06F2CE, 0x337B7B54, + 0x3FE72F26, 0x9C000000, 0x3E289BCA, 0x45C02B72, + 0x3FE73AC1, 0x18000000, 0xBE18DEA6, 0x5039F1CA, + 0x3FE74661, 0x60000000, 0xBE09D090, 0x86CE0538, + 0x3FE75207, 0x78000000, 0x3E290E79, 0xCFCE5DDB, + 0x3FE75DB3, 0x68000000, 0x3DD61DF0, 0xB249A17C, + 0x3FE76965, 0x2C000000, 0x3E2F22F7, 0xE13445F7, + 0x3FE7751C, 0xD0000000, 0xBE2CD454, 0x874E75CE, + 0x3FE780DA, 0x4C000000, 0xBE0159CE, 0xDF43E3BC, + 0x3FE78C9D, 0xA8000000, 0x3E279291, 0x699A1332, + 0x3FE79866, 0xEC000000, 0xBE2A0BCD, 0x2DD98C6C, + 0x3FE7A436, 0x10000000, 0x3E25F375, 0x15AC979E, + 0x3FE7B00B, 0x20000000, 0x3E26CCF5, 0x2FEAFCF6, + 0x3FE7BBE6, 0x1C000000, 0x3E27D4F4, 0x53ADAD67, + 0x3FE7C7C7, 0x08000000, 0x3E10EEC7, 0x7FBD9566, + 0x3FE7D3AD, 0xE4000000, 0x3E2837F0, 0x9A831D86, + 0x3FE7DF9A, 0xB8000000, 0xBE129BE0, 0x5CB4C35B, + 0x3FE7EB8D, 0x80000000, 0x3E23990A, 0x0234F04D, + 0x3FE7F786, 0x44000000, 0x3E2EB807, 0x64D5C842, + 0x3FE80385, 0x08000000, 0x3E0FC86F, 0x02B4E9E8, + 0x3FE80F89, 0xCC000000, 0xBDD7B5B3, 0x7B4274BF, + 0x3FE81B94, 0x94000000, 0xBE16888B, 0xB899B00F, + 0x3FE827A5, 0x60000000, 0x3E288971, 0x5E94D155, + 0x3FE833BC, 0x38000000, 0x3E2AEEB2, 0x099F3E5E, + 0x3FE83FD9, 0x20000000, 0xBE23B922, 0x3FF60B7C, + 0x3FE84BFC, 0x14000000, 0xBDF7D3B1, 0x2DBD8012, + 0x3FE85825, 0x1C000000, 0xBDF24BA3, 0xA8872BEB, + 0x3FE86454, 0x38000000, 0x3E2EFE04, 0x01AA18A7, + 0x3FE87089, 0x70000000, 0x3E21986C, 0x944496A2, + 0x3FE87CC4, 0xC4000000, 0x3E096A8B, 0xB71FFAFF, + 0x3FE88906, 0x38000000, 0xBE21CE0A, 0xBC4C7AC5, + 0x3FE8954D, 0xCC000000, 0xBE076F45, 0xBAC02491, + 0x3FE8A19B, 0x84000000, 0x3E2B4FA2, 0xD922B925, + 0x3FE8ADEF, 0x68000000, 0x3DF759DB, 0x641863AF, + 0x3FE8BA49, 0x78000000, 0xBE2DB97C, 0xC6AB5E04, + 0x3FE8C6A9, 0xB4000000, 0xBE25364C, 0xE2156713, + 0x3FE8D310, 0x20000000, 0x3E1BEB7C, 0x862BEFF7, + 0x3FE8DF7C, 0xC4000000, 0xBDF4DD0C, 0x1CEA33A5, + 0x3FE8EBEF, 0xA0000000, 0xBE2537DF, 0x51797D47, + 0x3FE8F868, 0xB4000000, 0x3E0FB1C4, 0xF0107B28, + 0x3FE904E8, 0x08000000, 0x3E0AD6A1, 0xE01B68BD, + 0x3FE9116D, 0x9C000000, 0x3E292117, 0x1F78D9D9, + 0x3FE91DF9, 0x78000000, 0xBE1D75DA, 0x4F50E5CF, + 0x3FE92A8B, 0x98000000, 0x3DE5102B, 0x74959E58, + 0x3FE93724, 0x04000000, 0xBE01CA50, 0xD2216C35, + 0x3FE943C2, 0xBC000000, 0x3E225BFD, 0xB0B05884, + 0x3FE95067, 0xC8000000, 0xBE0F2183, 0x60B7C5C1, + 0x3FE95D13, 0x24000000, 0x3E2FB47A, 0xB5860441, + 0x3FE969C4, 0xDC000000, 0xBE01FFD2, 0xE2D4059E, + 0x3FE9767C, 0xEC000000, 0xBDE9ED72, 0x12BB6A8D, + 0x3FE9833B, 0x58000000, 0x3E2B3815, 0x43BFFB24, + 0x3FE99000, 0x28000000, 0x3E03FA22, 0xEE9EAD1E, + 0x3FE99CCB, 0x5C000000, 0xBE213841, 0x377138F7, + 0x3FE9A99C, 0xF4000000, 0x3E178105, 0xDB636C94, + 0x3FE9B674, 0xF8000000, 0x3E1E5E7A, 0xF5720122, + 0x3FE9C353, 0x6C000000, 0xBE238BFF, 0xA2AC5AAE, + 0x3FE9D038, 0x4C000000, 0x3E270893, 0xF93BDBD8, + 0x3FE9DD23, 0xA4000000, 0x3DF40420, 0x354B86CF, + 0x3FE9EA15, 0x74000000, 0xBE2D76D3, 0x88CB06B7, + 0x3FE9F70D, 0xBC000000, 0xBE251639, 0x9ED0EC60, + 0x3FEA040C, 0x80000000, 0x3E1F06E9, 0xE2DDE506, + 0x3FEA1111, 0xC8000000, 0x3E014549, 0x8E6DB477, + 0x3FEA1E1D, 0x94000000, 0xBDF4BC17, 0xF8716509, + 0x3FEA2B2F, 0xE8000000, 0xBE2107DB, 0xDA723A49, + 0x3FEA3848, 0xC4000000, 0x3E1A932A, 0x986AA369, + 0x3FEA4568, 0x30000000, 0x3E198092, 0x41592CDB, + 0x3FEA528E, 0x30000000, 0xBE2E260F, 0x676BCAB8, + 0x3FEA5FBA, 0xC0000000, 0x3DE2E821, 0x2D5D5610, + 0x3FEA6CED, 0xE8000000, 0x3E2F7046, 0x7DA20167, + 0x3FEA7A27, 0xB0000000, 0xBE1D2832, 0xF9FAAD30, + 0x3FEA8768, 0x14000000, 0xBE23F788, 0x43FA6C45, + 0x3FEA94AF, 0x18000000, 0x3E011E27, 0xAA082732, + 0x3FEAA1FC, 0xC4000000, 0xBE20BACB, 0xC682F0BF, + 0x3FEAAF51, 0x18000000, 0xBE2DC7DD, 0x7BD08C78, + 0x3FEABCAC, 0x14000000, 0x3E2271A2, 0xA3B10F9A, + 0x3FEACA0D, 0xC4000000, 0xBE15449C, 0x7966F94C, + 0x3FEAD776, 0x24000000, 0x3DD06137, 0x6FD8F3EE, + 0x3FEAE4E5, 0x3C000000, 0xBE267CD1, 0x8C5A144A, + 0x3FEAF25B, 0x0C000000, 0xBE29E584, 0xB59DA94B, + 0x3FEAFFD7, 0x98000000, 0xBE23DFCF, 0x7B52192F, + 0x3FEB0D5A, 0xE4000000, 0xBE1CF2FE, 0x78A76B45, + 0x3FEB1AE4, 0xF4000000, 0xBE23A561, 0x7EC80FF6, + 0x3FEB2875, 0xC8000000, 0x3E22C4C9, 0x932EED68, + 0x3FEB360D, 0x68000000, 0x3E2B085C, 0xB5833C97, + 0x3FEB43AB, 0xD8000000, 0xBE01F093, 0x93B9319A, + 0x3FEB5151, 0x18000000, 0xBE254F01, 0xFABCE670, + 0x3FEB5EFD, 0x28000000, 0x3E2F24C2, 0x627ABFB0, + 0x3FEB6CB0, 0x14000000, 0x3E1F1EEC, 0xE6AC0B48, + 0x3FEB7A69, 0xDC000000, 0xBE1A8671, 0x127F9ABC, + 0x3FEB882A, 0x80000000, 0xBDCB0C28, 0xC87C73B3, + 0x3FEB95F2, 0x08000000, 0xBE22E8DD, 0x7F2B5A97, + 0x3FEBA3C0, 0x74000000, 0xBE1B3645, 0x2D22A9D5, + 0x3FEBB195, 0xC8000000, 0x3E0ADACA, 0x428F8B88, + 0x3FEBBF72, 0x0C000000, 0xBE2E9E07, 0xCDF9F681, + 0x3FEBCD55, 0x3C000000, 0xBE08A127, 0x7FA54ACF, + 0x3FEBDB3F, 0x60000000, 0x3E0E92CE, 0x8225B385, + 0x3FEBE930, 0x7C000000, 0x3DF38C2A, 0x7BB09485, + 0x3FEBF728, 0x94000000, 0xBE2DFD64, 0xF681FA5F, + 0x3FEC0527, 0xA4000000, 0x3E2E384D, 0xDCE88BD2, + 0x3FEC132D, 0xBC000000, 0xBE20F111, 0xFE46A893, + 0x3FEC213A, 0xD4000000, 0x3E193DA1, 0xB189BFDA, + 0x3FEC2F4E, 0xF8000000, 0xBE20E3A1, 0x0E39FB00, + 0x3FEC3D6A, 0x24000000, 0x3E1DB044, 0x30F0FAC5, + 0x3FEC4B8C, 0x64000000, 0xBE2BC12C, 0x97446B17, + 0x3FEC59B5, 0xB4000000, 0xBE282696, 0x963F4150, + 0x3FEC67E6, 0x18000000, 0x3E224D26, 0x3049824B, + 0x3FEC761D, 0x98000000, 0x3E2C5BA5, 0x87F84C7D, + 0x3FEC845C, 0x38000000, 0xBDE1D14D, 0xC4852339, + 0x3FEC92A1, 0xF8000000, 0xBE1A451E, 0x5588D9E1, + 0x3FECA0EE, 0xDC000000, 0xBE1D3B96, 0x68BFF457, + 0x3FECAF42, 0xE8000000, 0xBE18B670, 0x4DADF774, + 0x3FECBD9E, 0x20000000, 0xBE1A1548, 0x7FB1FC01, + 0x3FECCC00, 0x88000000, 0xBE273F2E, 0x78FC5AF0, + 0x3FECDA6A, 0x20000000, 0x3E1D218F, 0xA6F4A841, + 0x3FECE8DA, 0xF0000000, 0x3E2E0BA9, 0x4D002CA0, + 0x3FECF752, 0xFC000000, 0x3E20F4BB, 0x065EF979, + 0x3FED05D2, 0x48000000, 0xBE2ED3D5, 0x11793B33, + 0x3FED1458, 0xD0000000, 0x3E115E3C, 0x913341B3, + 0x3FED22E6, 0xA0000000, 0x3DE97C02, 0xB3546109, + 0x3FED317B, 0xB8000000, 0x3E087540, 0x1BF898EF, + 0x3FED4018, 0x1C000000, 0x3E209430, 0x346F9641, + 0x3FED4EBB, 0xD0000000, 0x3E2B6DF4, 0x88F4B20B, + 0x3FED5D66, 0xDC000000, 0xBE2EC68F, 0x0CB26035, + 0x3FED6C19, 0x38000000, 0x3E2CA2C8, 0x1F44D9C3, + 0x3FED7AD2, 0xF4000000, 0x3E10E6F4, 0x41704EE0, + 0x3FED8994, 0x0C000000, 0x3E2F9273, 0x25F8F0E2, + 0x3FED985C, 0x88000000, 0x3E2D041A, 0x318798DE, + 0x3FEDA72C, 0x6C000000, 0xBE005680, 0x9349CF58, + 0x3FEDB603, 0xB8000000, 0xBE10F665, 0xCF0C934D, + 0x3FEDC4E2, 0x70000000, 0x3E166124, 0x19461C64, + 0x3FEDD3C8, 0x9C000000, 0xBE1B2ED6, 0x405624C8, + 0x3FEDE2B6, 0x3C000000, 0xBE273A7F, 0x62171501, + 0x3FEDF1AB, 0x54000000, 0xBE26022B, 0xE36E1450, + 0x3FEE00A7, 0xE8000000, 0xBE1C341E, 0x2E07AE15, + 0x3FEE0FAB, 0xFC000000, 0xBDFC7EAE, 0x18D0E701, + 0x3FEE1EB7, 0x94000000, 0x3E06B34F, 0xECD1FF8B, + 0x3FEE2DCA, 0xB4000000, 0x3E1394A3, 0x6813A649, + 0x3FEE3CE5, 0x60000000, 0x3E045496, 0xC1754D14, + 0x3FEE4C07, 0x9C000000, 0xBE180FFF, 0xF5C6087C, + 0x3FEE5B31, 0x68000000, 0x3E22FBCD, 0xADD9A300, + 0x3FEE6A62, 0xCC000000, 0x3E2EC7C7, 0xAF0289E5, + 0x3FEE799B, 0xCC000000, 0x3E242182, 0x3FB3EDD4, + 0x3FEE88DC, 0x6C000000, 0xBE201304, 0x04E39885, + 0x3FEE9824, 0xAC000000, 0xBE20D352, 0xE6831D31, + 0x3FEEA774, 0x90000000, 0x3E1E032D, 0x618DFCEB, + 0x3FEEB6CC, 0x20000000, 0x3E1956A3, 0xF9BB457E, + 0x3FEEC62B, 0x60000000, 0xBE2A77E0, 0x50845DB2, + 0x3FEED592, 0x4C000000, 0x3E2714F7, 0x47C43858, + 0x3FEEE500, 0xF0000000, 0x3E2EED96, 0x71813A66, + 0x3FEEF477, 0x50000000, 0xBE04CDBE, 0x4FB4AA34, + 0x3FEF03F5, 0x6C000000, 0xBE2774A2, 0x86EB4FF5, + 0x3FEF137B, 0x48000000, 0xBE29DD95, 0xAD43B2D2, + 0x3FEF2308, 0xE8000000, 0xBE1CADB0, 0xAC16E506, + 0x3FEF329E, 0x50000000, 0x3E12AC33, 0x58745C7B, + 0x3FEF423B, 0x88000000, 0xBE248118, 0x6EC2D854, + 0x3FEF51E0, 0x8C000000, 0x3E26986B, 0x304ACE08, + 0x3FEF618D, 0x68000000, 0x3E126D81, 0x3B09354E, + 0x3FEF7142, 0x1C000000, 0x3DF06AAE, 0x773C23B3, + 0x3FEF80FE, 0xAC000000, 0xBDA105B6, 0xD82EF423, + 0x3FEF90C3, 0x1C000000, 0x3DECDEED, 0x465499B8, + 0x3FEFA08F, 0x70000000, 0x3E0AEFD4, 0xE2EF03AE, + 0x3FEFB063, 0xAC000000, 0x3E1BD4C0, 0x0567B2E7, + 0x3FEFC03F, 0xD4000000, 0x3E26AA22, 0x4F97FCBF, + 0x3FEFD023, 0xF0000000, 0xBE2F9420, 0x5E4E88D1, + 0x3FEFE00F, 0xFC000000, 0xBE254004, 0x438E52E2, + 0x3FEFF004, 0x00000000, 0xBE1552AA, 0xEEE93EFC, + 0x3FF00000, 0x00000000, 0x00000000, 0x00000000, + 0x3FF00802, 0x00000000, 0x3E155800, 0x4449F507, + 0x3FF01008, 0x04000000, 0xBE354AA8, 0x882D75D6, + 0x3FF01812, 0x08000000, 0x3E303610, 0x3740DE56, + 0x3FF02020, 0x14000000, 0x3E360044, 0x5B0C3264, + 0x3FF02832, 0x28000000, 0x3E3C4C26, 0x0197EDC3, + 0x3FF03048, 0x48000000, 0x3E0B103B, 0x5046CA09, + 0x3FF03862, 0x74000000, 0xBE34659C, 0xF9A62624, + 0x3FF04080, 0xAC000000, 0xBE254438, 0xDD0A8F37, + 0x3FF048A2, 0xF4000000, 0x3DF256C2, 0x97AFB6E2, + 0x3FF050C9, 0x50000000, 0xBE3085DF, 0x923D25E1, + 0x3FF058F3, 0xC0000000, 0xBE3F0A93, 0x5EA3B091, + 0x3FF06122, 0x44000000, 0xBE237DE4, 0x5D63534C, + 0x3FF06954, 0xE0000000, 0x3E301719, 0xFF0C58B7, + 0x3FF0718B, 0x98000000, 0x3E2E8410, 0x9DF7B665, + 0x3FF079C6, 0x6C000000, 0x3E349CB9, 0x3B127222, + 0x3FF08205, 0x60000000, 0x3DF127EC, 0x98E0BD08, + 0x3FF08A48, 0x74000000, 0xBE24C1B6, 0x706CC41F, + 0x3FF0928F, 0xA8000000, 0x3E334EF9, 0x093044EF, + 0x3FF09ADB, 0x04000000, 0xBE1304B1, 0x56BC6C83, + 0x3FF0A32A, 0x84000000, 0x3E2D383E, 0xB028B984, + 0x3FF0AB7E, 0x30000000, 0xBE315B1E, 0x64E7A202, + 0x3FF0B3D6, 0x04000000, 0xBE0AC1E6, 0xC678291E, + 0x3FF0BC32, 0x04000000, 0x3E3A0418, 0x2F12FFE2, + 0x3FF0C492, 0x38000000, 0xBE37D617, 0x43D6D302, + 0x3FF0CCF6, 0x98000000, 0x3E2133F2, 0x152CC8FA, + 0x3FF0D55F, 0x2C000000, 0x3E3CE5D1, 0xE966E6B7, + 0x3FF0DDCB, 0xF8000000, 0x3E1ABF24, 0x7BCACA64, + 0x3FF0E63C, 0xFC000000, 0xBE3854F6, 0x2E8CDBED, + 0x3FF0EEB2, 0x38000000, 0xBE3E6463, 0x0C32156B, + 0x3FF0F72B, 0xAC000000, 0x3E365671, 0xB69772CC, + 0x3FF0FFA9, 0x64000000, 0xBE383E9A, 0x02B1201A, + 0x3FF1082B, 0x58000000, 0xBE205962, 0x50549CC0, + 0x3FF110B1, 0x90000000, 0xBE376BFE, 0xFFDACA72, + 0x3FF1193C, 0x08000000, 0x3E3C1C59, 0x5C43E2F3, + 0x3FF121CA, 0xCC000000, 0xBE26D374, 0xF7067C8B, + 0x3FF12A5D, 0xD4000000, 0x3E343CCC, 0x4DDAFE1D, + 0x3FF132F5, 0x28000000, 0x3E3D5C16, 0x58EBCB7F, + 0x3FF13B90, 0xCC000000, 0xBE2B5D12, 0xB66E8B53, + 0x3FF14430, 0xBC000000, 0xBE24E919, 0xB326B482, + 0x3FF14CD4, 0xFC000000, 0x3E23139A, 0xC8AABD43, + 0x3FF1557D, 0x90000000, 0x3E30DD8B, 0x16743B55, + 0x3FF15E2A, 0x7C000000, 0xBE31D701, 0x35904C50, + 0x3FF166DB, 0xBC000000, 0x3E107F42, 0x30E0CA83, + 0x3FF16F91, 0x58000000, 0xBE24F1F2, 0xDA1B7123, + 0x3FF1784B, 0x50000000, 0xBE3ACAF2, 0x0DC79E23, + 0x3FF18109, 0xA4000000, 0xBE23DC79, 0x609374EE, + 0x3FF189CC, 0x58000000, 0x3E262CF7, 0x3A40C3B7, + 0x3FF19293, 0x70000000, 0x3E1D3833, 0x5A24F463, + 0x3FF19B5E, 0xEC000000, 0x3E2BA9AD, 0x8A2E4440, + 0x3FF1A42E, 0xD0000000, 0x3DFD8CBC, 0x61C41828, + 0x3FF1AD03, 0x1C000000, 0x3E1A65E6, 0x5A4DDF0D, + 0x3FF1B5DB, 0xD4000000, 0xBDE2FDBB, 0x9F828DB5, + 0x3FF1BEB8, 0xF8000000, 0x3E2F4EE8, 0xB79B700F, + 0x3FF1C79A, 0x8C000000, 0x3E3ACC35, 0x0DE1D7E8, + 0x3FF1D080, 0x94000000, 0x3E11729E, 0xFF9E20A0, + 0x3FF1D96B, 0x10000000, 0xBE300F18, 0x6C2EA70B, + 0x3FF1E25A, 0x00000000, 0x3DF32E02, 0xCE425A35, + 0x3FF1EB4D, 0x68000000, 0x3E3BDE56, 0x9A322D12, + 0x3FF1F445, 0x50000000, 0xBE3C3F0D, 0xBA737AEF, + 0x3FF1FD41, 0xB0000000, 0xBE0A2DD0, 0xC896DB7A, + 0x3FF20642, 0x90000000, 0x3E2577B0, 0xF8B782F6, + 0x3FF20F47, 0xF4000000, 0xBE2C6DA3, 0x73607FC8, + 0x3FF21851, 0xD8000000, 0x3E35F7D1, 0xC8917348, + 0x3FF22160, 0x44000000, 0x3E3B6F5C, 0xCF9CED69, + 0x3FF22A73, 0x3C000000, 0xBE39967E, 0x85775C2E, + 0x3FF2338A, 0xB8000000, 0x3E3B3213, 0x497226D4, + 0x3FF23CA6, 0xC4000000, 0x3E3E2710, 0x30733227, + 0x3FF245C7, 0x60000000, 0x3E33B8A9, 0xAF215A72, + 0x3FF24EEC, 0x90000000, 0xBE3F96B2, 0x1365623F, + 0x3FF25816, 0x50000000, 0xBE37324F, 0x27DEE202, + 0x3FF26144, 0xA4000000, 0x3E318CD5, 0x4E484D87, + 0x3FF26A77, 0x94000000, 0xBDE3FD37, 0xA94519E8, + 0x3FF273AF, 0x1C000000, 0x3E37132F, 0xEE788C29, + 0x3FF27CEB, 0x44000000, 0xBE03DDB7, 0xE842E5C0, + 0x3FF2862C, 0x08000000, 0x3E37A3FB, 0xE17C9693, + 0x3FF28F71, 0x70000000, 0x3E24EABF, 0xAEB3D9A0, + 0x3FF298BB, 0x7C000000, 0xBE13C7B6, 0x853B0733, + 0x3FF2A20A, 0x2C000000, 0x3E2D2C80, 0xC7B588B5, + 0x3FF2AB5D, 0x88000000, 0xBE35B750, 0x708F3912, + 0x3FF2B4B5, 0x8C000000, 0xBE291A70, 0xD5FD9130, + 0x3FF2BE12, 0x3C000000, 0x3E2EE937, 0x0CCF9F73, + 0x3FF2C773, 0xA0000000, 0xBE3C3F0C, 0xD42CF76C, + 0x3FF2D0D9, 0xB0000000, 0x3E35DD54, 0x60763D61, + 0x3FF2DA44, 0x78000000, 0x3E26C418, 0xE7D6AA3B, + 0x3FF2E3B3, 0xF8000000, 0xBE3605C6, 0x6FB9B7A8, + 0x3FF2ED28, 0x2C000000, 0x3E3763D4, 0x24DCDDF5, + 0x3FF2F6A1, 0x20000000, 0xBE1A411E, 0xA8EC1AA8, + 0x3FF3001E, 0xD0000000, 0xBE23FCA1, 0x1FE8546F, + 0x3FF309A1, 0x40000000, 0xBE29DF0D, 0x3AAEE75E, + 0x3FF31328, 0x70000000, 0x3E36A5D6, 0x3C2C4206, + 0x3FF31CB4, 0x68000000, 0x3E1B7A3E, 0xB4C979B0, + 0x3FF32645, 0x28000000, 0xBE36157D, 0x706CD593, + 0x3FF32FDA, 0xB0000000, 0xBE39F357, 0x8DA4C646, + 0x3FF33975, 0x04000000, 0xBE3E64DE, 0xD575FE6F, + 0x3FF34314, 0x24000000, 0x3E07F9E3, 0x44D008E0, + 0x3FF34CB8, 0x18000000, 0xBE2E94F9, 0x5A563E77, + 0x3FF35660, 0xDC000000, 0x3E314DC2, 0x2475EF19, + 0x3FF3600E, 0x78000000, 0x3E26D623, 0xA33AC606, + 0x3FF369C0, 0xEC000000, 0x3E170F86, 0xC05B3160, + 0x3FF37378, 0x3C000000, 0xBE38DDFE, 0xDB0AE31A, + 0x3FF37D34, 0x64000000, 0x3E3662A9, 0x5706B570, + 0x3FF386F5, 0x70000000, 0xBE1625E4, 0x6770731E, + 0x3FF390BB, 0x5C000000, 0xBE1678F1, 0x62971091, + 0x3FF39A86, 0x2C000000, 0xBE061F7C, 0xD045CB0C, + 0x3FF3A455, 0xE4000000, 0xBE35CF51, 0x568B1CA2, + 0x3FF3AE2A, 0x84000000, 0xBE378185, 0x7FB61F58, + 0x3FF3B804, 0x0C000000, 0x3E3F77F4, 0x4FA133AF, + 0x3FF3C1E2, 0x88000000, 0xBE22F96A, 0xB00B73FE, + 0x3FF3CBC5, 0xF0000000, 0x3E351A64, 0x1EB4CE2F, + 0x3FF3D5AE, 0x50000000, 0xBE3D3516, 0xD3755639, + 0x3FF3DF9B, 0xA0000000, 0x3E1CD938, 0x43E8C10E, + 0x3FF3E98D, 0xEC000000, 0xBE35EE23, 0x455C8842, + 0x3FF3F385, 0x30000000, 0xBE29B282, 0x96C9F4ED, + 0x3FF3FD81, 0x70000000, 0x3E24A40E, 0x3168CC0B, + 0x3FF40782, 0xB0000000, 0x3E3784BC, 0x86C72839, + 0x3FF41188, 0xF4000000, 0x3E061F19, 0x0785D847, + 0x3FF41B94, 0x3C000000, 0xBE27AEF2, 0xE654A9C9, + 0x3FF425A4, 0x88000000, 0x3E33DFC3, 0xF9E4C1BA, + 0x3FF42FB9, 0xE0000000, 0x3E2455A8, 0x593D0C75, + 0x3FF439D4, 0x44000000, 0xBDE41D4E, 0x238B65D1, + 0x3FF443F3, 0xB4000000, 0x3E3BE616, 0x454CBECB, + 0x3FF44E18, 0x38000000, 0x3E207B3C, 0x931C5332, + 0x3FF45841, 0xD0000000, 0xBE330846, 0x7615DCC9, + 0x3FF46270, 0x7C000000, 0xBE2A8A7B, 0xE497F84E, + 0x3FF46CA4, 0x40000000, 0x3E020B50, 0xF737AF78, + 0x3FF476DD, 0x20000000, 0x3E116B19, 0xE34AFBD3, + 0x3FF4811B, 0x20000000, 0xBE3E15A7, 0x841EDB52, + 0x3FF48B5E, 0x3C000000, 0x3E0F40C3, 0x33B3DE1E, + 0x3FF495A6, 0x7C000000, 0x3E33607F, 0x92EFEE02, + 0x3FF49FF3, 0xE4000000, 0xBE1A2DB5, 0x14F7E168, + 0x3FF4AA46, 0x70000000, 0x3E3F59EC, 0x3EBA1C94, + 0x3FF4B49E, 0x2C000000, 0xBE31A539, 0x8B9AE885, + 0x3FF4BEFB, 0x10000000, 0x3E2FAC0B, 0xF13C8C95, + 0x3FF4C95D, 0x28000000, 0xBE32C0BB, 0xF8B74775, + 0x3FF4D3C4, 0x70000000, 0xBE2FC24E, 0x4F9474BB, + 0x3FF4DE30, 0xEC000000, 0x3E008F30, 0x09DA911F, + 0x3FF4E8A2, 0xA0000000, 0x3E2994C1, 0xBAF8D98B, + 0x3FF4F319, 0x90000000, 0xBE17C38C, 0x18648D0A, + 0x3FF4FD95, 0xBC000000, 0xBE288852, 0xF22F8698, + 0x3FF50817, 0x28000000, 0xBE3C3EC3, 0x30A2C153, + 0x3FF5129D, 0xD4000000, 0xBE27B606, 0x968492AA, + 0x3FF51D29, 0xC4000000, 0x3E2E0396, 0x61101629, + 0x3FF527BA, 0xFC000000, 0x3E3E876F, 0xDAEEAB38, + 0x3FF53251, 0x80000000, 0x3E29F59E, 0xED945B30, + 0x3FF53CED, 0x50000000, 0x3E12D7DA, 0x0B4AE3F1, + 0x3FF5478E, 0x70000000, 0xBE2FAFB8, 0x5FB946D0, + 0x3FF55234, 0xE0000000, 0xBE18A8B3, 0x87D80C66, + 0x3FF55CE0, 0xA4000000, 0x3E28B18F, 0x764CF85C, + 0x3FF56791, 0xC0000000, 0x3E326017, 0x2BDBC6F4, + 0x3FF57248, 0x38000000, 0xBE229F98, 0x53D523FE, + 0x3FF57D04, 0x0C000000, 0xBE3BDD08, 0x4D9B8720, + 0x3FF587C5, 0x3C000000, 0x3E169EBC, 0x09D8749E, + 0x3FF5928B, 0xD0000000, 0x3E190C8C, 0x339C2080, + 0x3FF59D57, 0xC8000000, 0x3E310FA4, 0xDE75E9CA, + 0x3FF5A829, 0x28000000, 0x3E313D18, 0x1097F186, + 0x3FF5B2FF, 0xF4000000, 0xBE2BDE04, 0xD51C23F6, + 0x3FF5BDDC, 0x28000000, 0x3E3EE67E, 0x8938C386, + 0x3FF5C8BD, 0xD0000000, 0x3E0973B8, 0x47DF6575, + 0x3FF5D3A4, 0xE8000000, 0x3E24DF02, 0x1DB97781, + 0x3FF5DE91, 0x78000000, 0xBE3FBA00, 0xAC4AECDC, + 0x3FF5E983, 0x7C000000, 0xBE2F37AF, 0x939F646A, + 0x3FF5F47A, 0xFC000000, 0xBE396DEF, 0x58A6EEE9, + 0x3FF5FF77, 0xF8000000, 0xBE315248, 0xE3613C7B, + 0x3FF60A7A, 0x74000000, 0xBE26A9E2, 0xF1553706, + 0x3FF61582, 0x74000000, 0xBE3B6BF6, 0xAE4D7CB6, + 0x3FF6208F, 0xF8000000, 0xBE35775B, 0x9EB5EBA5, + 0x3FF62BA3, 0x04000000, 0xBE2A821B, 0xC1E43506, + 0x3FF636BB, 0x9C000000, 0xBE367CDA, 0x7B2D8CF4, + 0x3FF641D9, 0xC0000000, 0xBE13218B, 0x3E907A1D, + 0x3FF64CFD, 0x74000000, 0x3E3454EE, 0x7BF5DFE4, + 0x3FF65826, 0xC0000000, 0xBE3E960F, 0x6366C5FD, + 0x3FF66355, 0x9C000000, 0x3E2E378F, 0x8B43C17E, + 0x3FF66E8A, 0x14000000, 0x3E244BE0, 0xA4306535, + 0x3FF679C4, 0x28000000, 0xBDE4B6C1, 0x8DF63D6E, + 0x3FF68503, 0xD8000000, 0x3E3BA122, 0xE6A239CF, + 0x3FF69049, 0x2C000000, 0x3E27F286, 0x59FB5F30, + 0x3FF69B94, 0x24000000, 0xBE044041, 0x971D3970 } }; + +static const union { + int4 i[2048]; + double x[1024]; +} fine = { .i = { + 0x3FF00000, 0x00000000, 0x00000000, 0x00000000, + 0x3FF00004, 0x00000000, 0x3DA00001, 0x55556AAB, + 0x3FF00008, 0x00000000, 0x3DC00002, 0xAAAB0000, + 0x3FF0000C, 0x00000000, 0x3DD20004, 0x8000D800, + 0x3FF00010, 0x00000000, 0x3DE00005, 0x5556AAAB, + 0x3FF00014, 0x00000000, 0x3DE9000A, 0x6AADEC01, + 0x3FF00018, 0x00000000, 0x3DF20009, 0x00036001, + 0x3FF0001C, 0x00000000, 0x3DF8800E, 0x4AB0EB58, + 0x3FF00020, 0x00000000, 0x3E00000A, 0xAAB00002, + 0x3FF00024, 0x00000000, 0x3E04400F, 0x30088B04, + 0x3FF00028, 0x00000000, 0x3E090014, 0xD5625AB1, + 0x3FF0002C, 0x00000000, 0x3E0E401B, 0xBABDBB0A, + 0x3FF00030, 0x00000000, 0x3E120012, 0x000D8008, + 0x3FF00034, 0x00000000, 0x3E152016, 0xE2BD42E1, + 0x3FF00038, 0x00000000, 0x3E18801C, 0x956E5812, + 0x3FF0003C, 0x00000000, 0x3E1C2023, 0x2820F599, + 0x3FF00040, 0x00000000, 0x3E200015, 0x556AAABC, + 0x3FF00044, 0x00000000, 0x3E221019, 0x96C5DAD7, + 0x3FF00048, 0x00000000, 0x3E24401E, 0x60222C1F, + 0x3FF0004C, 0x00000000, 0x3E269023, 0xB97FC193, + 0x3FF00050, 0x00000000, 0x3E290029, 0xAADEC034, + 0x3FF00054, 0x00000000, 0x3E2B9030, 0x3C3F4F02, + 0x3FF00058, 0x00000000, 0x3E2E4037, 0x75A196FF, + 0x3FF0005C, 0x00000000, 0x3E30881F, 0xAF82E194, + 0x3FF00060, 0x00000000, 0x3E320024, 0x00360041, + 0x3FF00064, 0x00000000, 0x3E338828, 0xB0EA3F05, + 0x3FF00068, 0x00000000, 0x3E35202D, 0xC59FB661, + 0x3FF0006C, 0x00000000, 0x3E36C833, 0x42567FD5, + 0x3FF00070, 0x00000000, 0x3E388039, 0x2B0EB5E1, + 0x3FF00074, 0x00000000, 0x3E3A483F, 0x83C87407, + 0x3FF00078, 0x00000000, 0x3E3C2046, 0x5083D6C6, + 0x3FF0007C, 0x00000000, 0x3E3E084D, 0x9540FB9E, + 0x3FF00080, 0x04000000, 0xBE3FFFAA, 0xA9FFFEEF, + 0x3FF00084, 0x04000000, 0xBE3DF7A2, 0x693EF962, + 0x3FF00088, 0x04000000, 0xBE3BDF99, 0xA47BD339, + 0x3FF0008C, 0x04000000, 0xBE39B790, 0x57B66AF5, + 0x3FF00090, 0x04000000, 0xBE377F86, 0x7EEE9E14, + 0x3FF00094, 0x04000000, 0xBE35377C, 0x16244916, + 0x3FF00098, 0x04000000, 0xBE32DF71, 0x1957477B, + 0x3FF0009C, 0x04000000, 0xBE307765, 0x848773C2, + 0x3FF000A0, 0x04000000, 0xBE2BFEB2, 0xA7694ED3, + 0x3FF000A4, 0x04000000, 0xBE26EE99, 0x05BD75E2, + 0x3FF000A8, 0x04000000, 0xBE21BE7E, 0x1C0B0BB1, + 0x3FF000AC, 0x04000000, 0xBE18DCC3, 0xC4A37A79, + 0x3FF000B0, 0x04000000, 0xBE0BF911, 0x4244D60F, + 0x3FF000B4, 0x04000000, 0xBDE6E255, 0xEC91D848, + 0x3FF000B8, 0x04000000, 0x3E0107EB, 0xEC1B8F0C, + 0x3FF000BC, 0x04000000, 0x3E142439, 0x89BE52AA, + 0x3FF000C0, 0x04000000, 0x3E200240, 0x06C01033, + 0x3FF000C4, 0x04000000, 0x3E261264, 0xC8A9F760, + 0x3FF000C8, 0x04000000, 0x3E2C428B, 0x129D3FDE, + 0x3FF000CC, 0x04000000, 0x3E314959, 0x764D2658, + 0x3FF000D0, 0x04000000, 0x3E34816E, 0x2F50C16C, + 0x3FF000D4, 0x04000000, 0x3E37C983, 0xB859A4AB, + 0x3FF000D8, 0x04000000, 0x3E3B219A, 0x15680499, + 0x3FF000DC, 0x04000000, 0x3E3E89B1, 0x4A7C16B5, + 0x3FF000E0, 0x08000000, 0xBE3DFE36, 0xA469EE7E, + 0x3FF000E4, 0x08000000, 0xBE3A761D, 0xB349D37F, + 0x3FF000E8, 0x08000000, 0xBE36DE03, 0xDE235FCD, + 0x3FF000EC, 0x08000000, 0xBE3335E9, 0x20F659E6, + 0x3FF000F0, 0x08000000, 0xBE2EFB9A, 0xEF850E8F, + 0x3FF000F4, 0x08000000, 0xBE276B61, 0xBD0F58E2, + 0x3FF000F8, 0x08000000, 0xBE1F764D, 0x45163381, + 0x3FF000FC, 0x08000000, 0xBE0FABA6, 0x5FDF589A, + 0x3FF00100, 0x08000000, 0x3D8555AA, 0xABBBBE94, + 0x3FF00104, 0x08000000, 0x3E102B2C, 0xDABB690B, + 0x3FF00108, 0x08000000, 0x3E2045D9, 0x7820FBA0, + 0x3FF0010C, 0x08000000, 0x3E28961E, 0x92F54742, + 0x3FF00110, 0x08000000, 0x3E308332, 0xE2ED8E39, + 0x3FF00114, 0x08000000, 0x3E34CB57, 0x8C698119, + 0x3FF00118, 0x08000000, 0x3E39237D, 0x49EEC0C4, + 0x3FF0011C, 0x08000000, 0x3E3D8BA4, 0x1F7D92BC, + 0x3FF00120, 0x0C000000, 0xBE3DFC33, 0xEEE9C27D, + 0x3FF00124, 0x0C000000, 0xBE39740A, 0xDD46F763, + 0x3FF00128, 0x0C000000, 0xBE34DBE0, 0xA799C375, + 0x3FF0012C, 0x0C000000, 0xBE3033B5, 0x49E1DD2F, + 0x3FF00130, 0x0C000000, 0xBE26F711, 0x803DF41F, + 0x3FF00134, 0x0C000000, 0xBE1ACD6C, 0x19433A4C, + 0x3FF00138, 0x0C000000, 0xBDFDB2C1, 0x8770E36F, + 0x3FF0013C, 0x0C000000, 0x3E086820, 0x6B74A43E, + 0x3FF00140, 0x0C000000, 0x3E200A6A, 0xDEC0D058, + 0x3FF00144, 0x0C000000, 0x3E2A1AD0, 0x22BD7872, + 0x3FF00148, 0x0C000000, 0x3E32259B, 0xF769E132, + 0x3FF0014C, 0x0C000000, 0x3E374DD1, 0x2582289A, + 0x3FF00150, 0x0C000000, 0x3E3C8607, 0x9FA7E4F4, + 0x3FF00154, 0x10000000, 0xBE3E31C0, 0x9624963C, + 0x3FF00158, 0x10000000, 0xBE38D987, 0x77E2F472, + 0x3FF0015C, 0x10000000, 0xBE33714D, 0x0192E02C, + 0x3FF00160, 0x10000000, 0xBE2BF222, 0x5E6805CB, + 0x3FF00164, 0x10000000, 0xBE20E1A7, 0xF98C0A34, + 0x3FF00168, 0x10000000, 0xBE06C4AB, 0x32447238, + 0x3FF0016C, 0x10000000, 0x3E067D54, 0xC225D8C1, + 0x3FF00170, 0x10000000, 0x3E210FD8, 0x05C4630F, + 0x3FF00174, 0x10000000, 0x3E2CA05D, 0xBB206115, + 0x3FF00178, 0x10000000, 0x3E342873, 0x2C4F14A6, + 0x3FF0017C, 0x10000000, 0x3E3A10B8, 0xF31F3B5E, + 0x3FF00180, 0x14000000, 0xBE3FF6FF, 0xC9FEFCC9, + 0x3FF00184, 0x14000000, 0xBE39EEB7, 0x070B344A, + 0x3FF00188, 0x14000000, 0xBE33D66C, 0xC0050AA2, + 0x3FF0018C, 0x14000000, 0xBE2B5C41, 0xE1D83C97, + 0x3FF00190, 0x14000000, 0xBE1DD74E, 0x57003305, + 0x3FF00194, 0x14000000, 0xBDF2D84A, 0xA80727F1, + 0x3FF00198, 0x14000000, 0x3E14AB2F, 0x534C5401, + 0x3FF0019C, 0x14000000, 0x3E27263B, 0xD875DE83, + 0x3FF001A0, 0x14000000, 0x3E320B71, 0x9FB782CA, + 0x3FF001A4, 0x14000000, 0x3E3893C6, 0xF349371F, + 0x3FF001A8, 0x14000000, 0x3E3F2C1D, 0xEAF074C6, + 0x3FF001AC, 0x18000000, 0xBE3A2B89, 0x75525ABC, + 0x3FF001B0, 0x18000000, 0xBE33732F, 0x297ECCE2, + 0x3FF001B4, 0x18000000, 0xBE2955A6, 0x5B28EC49, + 0x3FF001B8, 0x18000000, 0xBE1749D5, 0xF64BA7FD, + 0x3FF001BC, 0x18000000, 0x3DF15E9E, 0xA8645141, + 0x3FF001C0, 0x18000000, 0x3E201C96, 0x1D6F0B37, + 0x3FF001C4, 0x18000000, 0x3E2E2D5B, 0xE6028E39, + 0x3FF001C8, 0x18000000, 0x3E362F12, 0x9B63FA1E, + 0x3FF001CC, 0x18000000, 0x3E3D5779, 0x0BE01026, + 0x3FF001D0, 0x1C000000, 0xBE3B701E, 0xB78A0445, + 0x3FF001D4, 0x1C000000, 0xBE3427B4, 0xAAD9CF9D, + 0x3FF001D8, 0x1C000000, 0xBE299E91, 0x941DBAB5, + 0x3FF001DC, 0x1C000000, 0xBE159B6C, 0x44A2DFDD, + 0x3FF001E0, 0x1C000000, 0x3E008CA4, 0x1EC8B89C, + 0x3FF001E4, 0x1C000000, 0x3E23340B, 0xF1EE0E9A, + 0x3FF001E8, 0x1C000000, 0x3E313279, 0x5231913C, + 0x3FF001EC, 0x1C000000, 0x3E38DAEE, 0x93892E68, + 0x3FF001F0, 0x20000000, 0xBE3F6C9A, 0x3F01A6A8, + 0x3FF001F4, 0x20000000, 0xBE37A421, 0x216E726C, + 0x3FF001F8, 0x20000000, 0xBE2F974C, 0x1F7970B9, + 0x3FF001FC, 0x20000000, 0xBE1F8CA4, 0x17AFEBC8, + 0x3FF00200, 0x20000000, 0x3DB55600, 0x04445B06, + 0x3FF00204, 0x20000000, 0x3E203BAE, 0x0C290A26, + 0x3FF00208, 0x20000000, 0x3E30365A, 0x104547BD, + 0x3FF0020C, 0x20000000, 0x3E385EDF, 0x22970DE3, + 0x3FF00210, 0x24000000, 0xBE3F6899, 0xBEF5A5F4, + 0x3FF00214, 0x24000000, 0xBE372010, 0x90605040, + 0x3FF00218, 0x24000000, 0xBE2D8F0A, 0x9B50D8EE, + 0x3FF0021C, 0x24000000, 0xBE197BDF, 0xCB35D444, + 0x3FF00220, 0x24000000, 0x3E00CCBC, 0x2188E3D5, + 0x3FF00224, 0x24000000, 0x3E254452, 0x36A79F6A, + 0x3FF00228, 0x24000000, 0x3E333ABC, 0xD69B2D28, + 0x3FF0022C, 0x24000000, 0x3E3BE352, 0xBA07BE5B, + 0x3FF00230, 0x28000000, 0xBE3B6415, 0x3665F227, + 0x3FF00234, 0x28000000, 0xBE329B7A, 0xF6AD58D5, + 0x3FF00238, 0x28000000, 0xBE2385BD, 0x059BD24A, + 0x3FF0023C, 0x28000000, 0xBDEB47FA, 0xD8E2B1B4, + 0x3FF00240, 0x28000000, 0x3E203CC2, 0x22CF60F6, + 0x3FF00244, 0x28000000, 0x3E312704, 0x39BEF87F, + 0x3FF00248, 0x28000000, 0x3E3A3FA9, 0xA63F5309, + 0x3FF0024C, 0x2C000000, 0xBE3C97AE, 0xA516AE5E, + 0x3FF00250, 0x2C000000, 0xBE335F04, 0xA442792A, + 0x3FF00254, 0x2C000000, 0xBE242CB0, 0xA686F3A2, + 0x3FF00258, 0x2C000000, 0xBDE7B535, 0xC3237903, + 0x3FF0025C, 0x2C000000, 0x3E21560E, 0x9E7A6CF7, + 0x3FF00260, 0x2C000000, 0x3E3223BA, 0xA8C01385, + 0x3FF00264, 0x2C000000, 0x3E3BAC70, 0x627012DF, + 0x3FF00268, 0x30000000, 0xBE3ABAD7, 0x7FB232EA, + 0x3FF0026C, 0x30000000, 0xBE31121C, 0xF9A6244B, + 0x3FF00270, 0x30000000, 0xBE1D6580, 0x1DAC9AE4, + 0x3FF00274, 0x30000000, 0x3E037AFA, 0xD7FB0AC3, + 0x3FF00278, 0x30000000, 0x3E289042, 0x633420EB, + 0x3FF0027C, 0x30000000, 0x3E3630E5, 0x8065842A, + 0x3FF00280, 0x34000000, 0xBE3FD653, 0xB49DA4FF, + 0x3FF00284, 0x34000000, 0xBE35CD8A, 0x696ECB76, + 0x3FF00288, 0x34000000, 0xBE27697D, 0x341A9D63, + 0x3FF0028C, 0x34000000, 0xBDF8BF04, 0x2788D238, + 0x3FF00290, 0x34000000, 0x3E2159C1, 0x42A03782, + 0x3FF00294, 0x34000000, 0x3E32F5B4, 0x154D4F89, + 0x3FF00298, 0x34000000, 0x3E3D4E8A, 0x1D7FB2C1, + 0x3FF0029C, 0x38000000, 0xBE38489D, 0x42181508, + 0x3FF002A0, 0x38000000, 0xBE2B9F84, 0x0AF2C28C, + 0x3FF002A4, 0x38000000, 0xBE0A3721, 0x451C5357, + 0x3FF002A8, 0x38000000, 0x3E1D47F1, 0x61A8605E, + 0x3FF002AC, 0x38000000, 0x3E31FADF, 0x81B02FCF, + 0x3FF002B0, 0x38000000, 0x3E3CB3C5, 0x572F674A, + 0x3FF002B4, 0x3C000000, 0xBE388352, 0x231795EA, + 0x3FF002B8, 0x3C000000, 0xBE2B54CD, 0xD248367A, + 0x3FF002BC, 0x3C000000, 0xBE060BC7, 0xB7ABD90D, + 0x3FF002C0, 0x3C000000, 0x3E206EEF, 0x6EE9F1EF, + 0x3FF002C4, 0x3C000000, 0x3E33406B, 0x261BF09E, + 0x3FF002C8, 0x3C000000, 0x3E3E5961, 0x59001C60, + 0x3FF002CC, 0x40000000, 0xBE367DA5, 0xABDDD232, + 0x3FF002D0, 0x40000000, 0xBE268953, 0xC8FA5113, + 0x3FF002D4, 0x40000000, 0x3D9152CC, 0x8B33A701, + 0x3FF002D8, 0x40000000, 0x3E26BAAC, 0x3E058570, + 0x3FF002DC, 0x40000000, 0x3E36C65A, 0x63236E71, + 0x3FF002E0, 0x44000000, 0xBE3DC09E, 0x7C7A795C, + 0x3FF002E4, 0x44000000, 0xBE323794, 0x7BD63D1D, + 0x3FF002E8, 0x44000000, 0xBE1A7A1E, 0x5BBC9105, + 0x3FF002EC, 0x44000000, 0x3E142A20, 0xD8EE2B1B, + 0x3FF002F0, 0x44000000, 0x3E30C39A, 0xEFAA8A8D, + 0x3FF002F4, 0x44000000, 0x3E3C8CB0, 0x995E96A2, + 0x3FF002F8, 0x48000000, 0xBE379A36, 0xC8A79469, + 0x3FF002FC, 0x48000000, 0xBE276236, 0x64CE7203, + 0x3FF00300, 0x48000000, 0x3DD200D8, 0x0819DA68, + 0x3FF00304, 0x48000000, 0x3E28A249, 0xE5E018D4, + 0x3FF00308, 0x48000000, 0x3E386A49, 0x8A087692, + 0x3FF0030C, 0x4C000000, 0xBE3B6C8E, 0xD695988B, + 0x3FF00310, 0x4C000000, 0xBE2E66C8, 0x55D2BCBA, + 0x3FF00314, 0x4C000000, 0xBE0751B3, 0x7790BA7A, + 0x3FF00318, 0x4C000000, 0x3E22DDF4, 0xC2A20261, + 0x3FF0031C, 0x4C000000, 0x3E35D82E, 0x49E0B0B5, + 0x3FF00320, 0x50000000, 0xBE3DAE9A, 0xB142422E, + 0x3FF00324, 0x50000000, 0xBE312560, 0x8C170FE6, + 0x3FF00328, 0x50000000, 0xBE12308D, 0x0A73BF77, + 0x3FF0032C, 0x50000000, 0x3E203A3A, 0x5E59CEFA, + 0x3FF00330, 0x50000000, 0x3E34D660, 0xCD4740BF, + 0x3FF00334, 0x54000000, 0xBE3E6058, 0x644D1883, + 0x3FF00338, 0x54000000, 0xBE31870E, 0x618F57B6, + 0x3FF0033C, 0x54000000, 0xBE127704, 0x99FABD0F, + 0x3FF00340, 0x54000000, 0x3E20B71E, 0xA1CB5ECF, + 0x3FF00344, 0x54000000, 0x3E3564E3, 0x089E93E1, + 0x3FF00348, 0x58000000, 0xBE3D81C5, 0xFB533142, + 0x3FF0034C, 0x58000000, 0xBE30586B, 0xB6EECE6C, + 0x3FF00350, 0x58000000, 0xBE08F871, 0x319B883E, + 0x3FF00354, 0x58000000, 0x3E2454A5, 0x75BF7503, + 0x3FF00358, 0x58000000, 0x3E3783B6, 0xF04B88C5, + 0x3FF0035C, 0x5C000000, 0xBE3B12E1, 0x81EF30A7, + 0x3FF00360, 0x5C000000, 0xBE2B32ED, 0x2F9F3657, + 0x3FF00364, 0x5C000000, 0xBDB0084D, 0x54DF31BC, + 0x3FF00368, 0x5C000000, 0x3E2B12D2, 0xC303B7B9, + 0x3FF0036C, 0x5C000000, 0x3E3B32DE, 0x78B56F97, + 0x3FF00370, 0x60000000, 0xBE3713A9, 0x03B9496C, + 0x3FF00374, 0x60000000, 0xBE22945A, 0x1F92E726, + 0x3FF00378, 0x60000000, 0x3E123D49, 0x621736DF, + 0x3FF0037C, 0x60000000, 0x3E3278D5, 0x3935580D, + 0x3FF00380, 0x64000000, 0xBE3F8DA4, 0x69B9F5FB, + 0x3FF00384, 0x64000000, 0xBE31841A, 0x8C473CC8, + 0x3FF00388, 0x64000000, 0xBE0B5469, 0x538CDE07, + 0x3FF0038C, 0x64000000, 0x3E257E07, 0x7F8F9D65, + 0x3FF00390, 0x64000000, 0x3E38F898, 0x3665E52B, + 0x3FF00394, 0x68000000, 0xBE38BDCF, 0xC29674BD, + 0x3FF00398, 0x68000000, 0xBE24C868, 0x4E58B4D9, + 0x3FF0039C, 0x68000000, 0x3E1015AC, 0x329466D7, + 0x3FF003A0, 0x68000000, 0x3E327F0D, 0xDCDECE44, + 0x3FF003A4, 0x6C000000, 0xBE3EF74B, 0xB27E5528, + 0x3FF003A8, 0x6C000000, 0xBE305DA1, 0x9D7167F2, + 0x3FF003AC, 0x6C000000, 0xBDFB3F3D, 0xFF980820, + 0x3FF003B0, 0x6C000000, 0x3E2A0B7B, 0x13D49789, + 0x3FF003B4, 0x6C000000, 0x3E3BCF72, 0xA43AE87C, + 0x3FF003B8, 0x70000000, 0xBE3556D4, 0x8D06BDC0, + 0x3FF003BC, 0x70000000, 0xBE19B460, 0x1766E54D, + 0x3FF003C0, 0x70000000, 0x3E211950, 0x7B85C8BA, + 0x3FF003C4, 0x70000000, 0x3E37966C, 0x41D00AED, + 0x3FF003C8, 0x74000000, 0xBE394FCB, 0xF5B15507, + 0x3FF003CC, 0x74000000, 0xBE244C00, 0xC98093C4, + 0x3FF003D0, 0x74000000, 0x3E144F3B, 0xE2907BDF, + 0x3FF003D4, 0x74000000, 0x3E345DA2, 0x267CD924, + 0x3FF003D8, 0x78000000, 0xBE3C4886, 0xD73526C0, + 0x3FF003DC, 0x78000000, 0xBE29BD57, 0xF8E1D62E, + 0x3FF003E0, 0x78000000, 0x3E04D995, 0xD65415E1, + 0x3FF003E4, 0x78000000, 0x3E322515, 0x527E1A58, + 0x3FF003E8, 0x7C000000, 0xBE3E4104, 0x31552BA5, + 0x3FF003EC, 0x7C000000, 0xBE2D2E33, 0x995CAB3B, + 0x3FF003F0, 0x7C000000, 0x3DF22D48, 0x473970DC, + 0x3FF003F4, 0x7C000000, 0x3E30ECC6, 0xC61195FC, + 0x3FF003F8, 0x80000000, 0xBE3F3943, 0x03D35C34, + 0x3FF003FC, 0x80000000, 0xBE2E9E91, 0xAA7483C7, + 0x3FF00400, 0x80000000, 0x3DE556AA, 0xBBBC71CE, + 0x3FF00404, 0x80000000, 0x3E30B4B7, 0x817613C1, + 0x3FF00408, 0x84000000, 0xBE3F3142, 0x4E70B0AC, + 0x3FF0040C, 0x84000000, 0xBE2E0E70, 0x2BAAD02F, + 0x3FF00410, 0x84000000, 0x3DF32D62, 0xF48F01F2, + 0x3FF00414, 0x84000000, 0x3E317CE8, 0x84EB5B98, + 0x3FF00418, 0x88000000, 0xBE3E2901, 0x10ED210B, + 0x3FF0041C, 0x88000000, 0xBE2B7DCD, 0x1C7F0051, + 0x3FF00420, 0x88000000, 0x3E05D9C0, 0x87AA2706, + 0x3FF00424, 0x88000000, 0x3E33455A, 0xD0B235B3, + 0x3FF00428, 0x8C000000, 0xBE3C207E, 0x4B07A510, + 0x3FF0042C, 0x8C000000, 0xBE26ECA6, 0x7C6E838B, + 0x3FF00430, 0x8C000000, 0x3E150F6F, 0xEC91A8D5, + 0x3FF00434, 0x8C000000, 0x3E360E0F, 0x650C6A83, + 0x3FF00438, 0x90000000, 0xBE3917B8, 0xFC7E3439, + 0x3FF0043C, 0x90000000, 0xBE205AFA, 0x4AF4C8B6, + 0x3FF00440, 0x90000000, 0x3E219985, 0xDC31D181, + 0x3FF00444, 0x90000000, 0x3E39D707, 0x423CC2BE, + 0x3FF00448, 0x94000000, 0xBE350EB0, 0x250DC5BF, + 0x3FF0044C, 0x94000000, 0xBE0F231A, 0x1E2CF893, + 0x3FF00450, 0x94000000, 0x3E2AABDB, 0xD42C92D4, + 0x3FF00454, 0x94000000, 0x3E3EA043, 0x6887075B, + 0x3FF00458, 0x98000000, 0xBE300562, 0xC472509B, + 0x3FF0045C, 0x98000000, 0x3DF64FB6, 0x72B572E0, + 0x3FF00460, 0x98000000, 0x3E32DF5D, 0xEF61155C, + 0x3FF00464, 0x9C000000, 0xBE3B963B, 0x27CFFE6A, + 0x3FF00468, 0x9C000000, 0xBE23F79F, 0xB4CD96FE, + 0x3FF0046C, 0x9C000000, 0x3E1EBA7F, 0x6E771F13, + 0x3FF00470, 0x9C000000, 0x3E396913, 0xFE3ED608, + 0x3FF00474, 0xA0000000, 0xBE34CC73, 0x6E82850F, + 0x3FF00478, 0xA0000000, 0xBE078FB3, 0x352966B7, + 0x3FF0047C, 0xA0000000, 0x3E2DF116, 0x33AFF8AE, + 0x3FF00480, 0xA4000000, 0xBE3F0CEE, 0xE909EADD, + 0x3FF00484, 0xA4000000, 0xBE2A04C8, 0xD6938597, + 0x3FF00488, 0xA4000000, 0x3E1460AA, 0x5C6654D8, + 0x3FF0048C, 0xA4000000, 0x3E3742BE, 0x22213ECF, + 0x3FF00490, 0xA8000000, 0xBE3682A9, 0xC631A356, + 0x3FF00494, 0xA8000000, 0xBE10E034, 0x7777B644, + 0x3FF00498, 0xA8000000, 0x3E2C4528, 0x3E3B0991, + 0x3FF0049C, 0xAC000000, 0xBE3F72C6, 0x0B3E269F, + 0x3FF004A0, 0xAC000000, 0xBE29F037, 0x31DF923B, + 0x3FF004A4, 0xAC000000, 0x3E164A4D, 0xE82713DE, + 0x3FF004A8, 0xAC000000, 0x3E382D47, 0x31AFAC4B, + 0x3FF004AC, 0xB0000000, 0xBE352800, 0x6DFCE978, + 0x3FF004B0, 0xB0000000, 0xBE036A1B, 0x07D68D27, + 0x3FF004B4, 0xB0000000, 0x3E305D7E, 0x5CB71F6F, + 0x3FF004B8, 0xB4000000, 0xBE3CC7BB, 0x30E5E990, + 0x3FF004BC, 0xB4000000, 0xBE23B9E0, 0x0BA17DEA, + 0x3FF004C0, 0xB4000000, 0x3E223BBF, 0xC3EF9BD8, + 0x3FF004C4, 0xB4000000, 0x3E3C28B4, 0x8A74ECC0, + 0x3FF004C8, 0xB8000000, 0xBE30BC72, 0x085831CA, + 0x3FF004CC, 0xB8000000, 0x3E037361, 0x6C8D1FC8, + 0x3FF004D0, 0xB8000000, 0x3E35A94F, 0x3033A0B8, + 0x3FF004D4, 0xBC000000, 0xBE370BC8, 0xFC7107DE, + 0x3FF004D8, 0xBC000000, 0xBE0D86E2, 0xA2D908DA, + 0x3FF004DC, 0xBC000000, 0x3E2F742A, 0x58ED155E, + 0x3FF004E0, 0xC0000000, 0xBE3CCAF4, 0x75FACDD0, + 0x3FF004E4, 0xC0000000, 0xBE227FF2, 0x6F5BE5D3, + 0x3FF004E8, 0xC0000000, 0x3E24B60D, 0xD6BCA827, + 0x3FF004EC, 0xC0000000, 0x3E3E060B, 0xF72B40D6, + 0x3FF004F0, 0xC4000000, 0xBE2C7DD4, 0x208BE3E3, + 0x3FF004F4, 0xC4000000, 0x3E163093, 0x642FDDB8, + 0x3FF004F8, 0xC4000000, 0x3E396738, 0xB72239A5, + 0x3FF004FC, 0xC8000000, 0xBE32ADAE, 0x7201ED9B, + 0x3FF00500, 0xC8000000, 0x3DF4D6F6, 0x1A0C05F3, + 0x3FF00504, 0xC8000000, 0x3E355892, 0x360B8346, + 0x3FF00508, 0xCC000000, 0xBE368C45, 0xF0C06435, + 0x3FF0050C, 0xCC000000, 0xBE0308C8, 0x760DA2F6, + 0x3FF00510, 0xCC000000, 0x3E31DA18, 0xE008D57B, + 0x3FF00514, 0xD0000000, 0xBE39DAB0, 0x205F82F4, + 0x3FF00518, 0xD0000000, 0xBE15FDD0, 0x2FE5E3E3, + 0x3FF0051C, 0xD0000000, 0x3E2DD79A, 0x42787241, + 0x3FF00520, 0xD4000000, 0xBE3C98EC, 0x94BD25F4, + 0x3FF00524, 0xD4000000, 0xBE201B42, 0x53C89D03, + 0x3FF00528, 0xD4000000, 0x3E291B5E, 0xCB901057, + 0x3FF0052C, 0xD8000000, 0xBE3EC6FA, 0xE1B6D837, + 0x3FF00530, 0xD8000000, 0xBE24173F, 0xF8BF49E7, + 0x3FF00534, 0xD8000000, 0x3E257F80, 0x339DDB57, + 0x3FF00538, 0xD8000000, 0x3E3F9B25, 0x64D62C5C, + 0x3FF0053C, 0xDC000000, 0xBE26F2E0, 0x2E913659, + 0x3FF00540, 0xDC000000, 0x3E2303FF, 0x52E7CB93, + 0x3FF00544, 0xDC000000, 0x3E3E8D74, 0xAB0CFEF5, + 0x3FF00548, 0xE0000000, 0xBE28AE22, 0x1CF7FDE6, + 0x3FF0054C, 0xE0000000, 0x3E21A8DD, 0x01B47B93, + 0x3FF00550, 0xE0000000, 0x3E3E0FF3, 0x5D1107E2, + 0x3FF00554, 0xE4000000, 0xBE294904, 0xEBAC99E1, + 0x3FF00558, 0xE4000000, 0x3E216E1A, 0x184B2814, + 0x3FF0055C, 0xE4000000, 0x3E3E22A1, 0xE706008B, + 0x3FF00560, 0xE8000000, 0xBE28C387, 0xC267616A, + 0x3FF00564, 0xE8000000, 0x3E2253B7, 0x6EF3B008, + 0x3FF00568, 0xE8000000, 0x3E3EC580, 0xB50FF371, + 0x3FF0056C, 0xEC000000, 0xBE271DA9, 0xC8E0096B, + 0x3FF00570, 0xEC000000, 0x3E2459B5, 0xDDF69498, + 0x3FF00574, 0xEC000000, 0x3E3FF890, 0x33533C31, + 0x3FF00578, 0xF0000000, 0xBE24576A, 0x26CDA497, + 0x3FF0057C, 0xF0000000, 0x3E278016, 0x3D9CF923, + 0x3FF00580, 0xF4000000, 0xBE3E442F, 0x320B787B, + 0x3FF00584, 0xF4000000, 0xBE2070C8, 0x03E6A36B, + 0x3FF00588, 0xF4000000, 0x3E2BC6D9, 0x6630A33F, + 0x3FF0058C, 0xF8000000, 0xBE3BF0BD, 0x0EE72CBF, + 0x3FF00590, 0xF8000000, 0xBE16D385, 0x0FC1A853, + 0x3FF00594, 0xF8000000, 0x3E309700, 0x17FDFD5D, + 0x3FF00598, 0xFC000000, 0xBE390D18, 0xF71A91AC, + 0x3FF0059C, 0xFC000000, 0xBE050963, 0x69C58B86, + 0x3FF005A0, 0xFC000000, 0x3E33DAC5, 0xB9A504CD, + 0x3FF005A5, 0x00000000, 0xBE359942, 0x7E800734, + 0x3FF005A9, 0x00000000, 0x3DF02BAE, 0xE59934CD, + 0x3FF005AD, 0x00000000, 0x3E37AEBE, 0x04333E0E, + 0x3FF005B1, 0x04000000, 0xBE319539, 0x38F19C2F, + 0x3FF005B5, 0x04000000, 0x3E14DB54, 0xEBB1C157, + 0x3FF005B9, 0x04000000, 0x3E3C12E9, 0x63CED05D, + 0x3FF005BD, 0x08000000, 0xBE2A01F9, 0x74921CAF, + 0x3FF005C1, 0x08000000, 0x3E23F645, 0xC94C85F2, + 0x3FF005C5, 0x0C000000, 0xBE3EF8B7, 0xBB61CBEE, + 0x3FF005C9, 0x0C000000, 0xBE1F7232, 0x597F2931, + 0x3FF005CD, 0x0C000000, 0x3E2E9F48, 0xAF5B7345, + 0x3FF005D1, 0x10000000, 0xBE397424, 0xED37CD5F, + 0x3FF005D5, 0x10000000, 0xBE013F43, 0x08775C6B, + 0x3FF005D9, 0x10000000, 0x3E35345A, 0x0029D3DB, + 0x3FF005DD, 0x14000000, 0xBE335F5D, 0xC58C1962, + 0x3FF005E1, 0x14000000, 0x3E1073C1, 0x47430E04, + 0x3FF005E5, 0x14000000, 0x3E3BA944, 0x4A41E248, + 0x3FF005E9, 0x18000000, 0xBE2974C3, 0xB06E888E, + 0x3FF005ED, 0x18000000, 0x3E25E3FB, 0xDCCD9333, + 0x3FF005F1, 0x1C000000, 0xBE3D519C, 0x5DE27951, + 0x3FF005F5, 0x1C000000, 0xBE1614C2, 0xE4464502, + 0x3FF005F9, 0x1C000000, 0x3E325740, 0xE0DAFE93, + 0x3FF005FD, 0x20000000, 0xBE35BC47, 0x8C1B4C10, + 0x3FF00601, 0x20000000, 0x3E0201B0, 0x20686CE9, + 0x3FF00605, 0x20000000, 0x3E3A4CB9, 0x95558B63, + 0x3FF00609, 0x24000000, 0xBE2B2D79, 0xA880A3EB, + 0x3FF0060D, 0x24000000, 0x3E252BA5, 0x9699EEB7, + 0x3FF00611, 0x28000000, 0xBE3D2D97, 0x880115E1, + 0x3FF00615, 0x28000000, 0xBE1383EF, 0x28A3D788, + 0x3FF00619, 0x28000000, 0x3E337BA6, 0x08D6DC23, + 0x3FF0061D, 0x2C000000, 0xBE3417B2, 0x0B001A08, + 0x3FF00621, 0x2C000000, 0x3E1193EF, 0xF94EB99A, + 0x3FF00625, 0x2C000000, 0x3E3CF1B0, 0x28D3BD3B, + 0x3FF00629, 0x30000000, 0xBE24E32B, 0x0EFCC982, + 0x3FF0062D, 0x30000000, 0x3E2C7655, 0xE2BDA47F, + 0x3FF00631, 0x34000000, 0xBE39080E, 0x689312F8, + 0x3FF00635, 0x34000000, 0xBDCDA0C8, 0xA9444DB4, + 0x3FF00639, 0x34000000, 0x3E38A191, 0x7B21FE23, + 0x3FF0063D, 0x38000000, 0xBE2CE32A, 0x7E67E1E1, + 0x3FF00641, 0x38000000, 0x3E251694, 0x875A71F0, + 0x3FF00645, 0x3C000000, 0xBE3C67CF, 0xF838F455, + 0x3FF00649, 0x3C000000, 0xBE0A571F, 0x77274052, + 0x3FF0064D, 0x3C000000, 0x3E35E20E, 0x63AAEFA8, + 0x3FF00651, 0x40000000, 0xBE30E0F8, 0xFC87DA70, + 0x3FF00655, 0x40000000, 0x3E20D80B, 0xE9089AFD, + 0x3FF00659, 0x44000000, 0xBE3E36F4, 0xC52F03BD, + 0x3FF0065D, 0x44000000, 0xBE1327A4, 0x9680E14E, + 0x3FF00661, 0x44000000, 0x3E34B328, 0xD732468D, + 0x3FF00665, 0x48000000, 0xBE31BFBE, 0xCAB5EF4A, + 0x3FF00669, 0x48000000, 0x3E1F757F, 0xE2A2FBE1, + 0x3FF0066D, 0x4C000000, 0xBE3E757A, 0xDAB014DA, + 0x3FF00671, 0x4C000000, 0xBE12E13D, 0x02FB3FBB, + 0x3FF00675, 0x4C000000, 0x3E3514E2, 0xCA7E298D, + 0x3FF00679, 0x50000000, 0xBE310DE4, 0xB4F78B94, + 0x3FF0067D, 0x50000000, 0x3E21BEB4, 0x89C35D05, + 0x3FF00681, 0x54000000, 0xBE3D2360, 0x43F4895C, + 0x3FF00685, 0x54000000, 0xBE08B0A2, 0x5BC49ADF, + 0x3FF00689, 0x54000000, 0x3E37073E, 0x32573159, + 0x3FF0068D, 0x58000000, 0xBE2D96D1, 0x8D0732D2, + 0x3FF00691, 0x58000000, 0x3E26E3ED, 0x9BF15E67, + 0x3FF00695, 0x5C000000, 0xBE3A40A3, 0x0C3250FB, + 0x3FF00699, 0x5C000000, 0x3DBCC9AE, 0xFD0AE214, + 0x3FF0069D, 0x5C000000, 0x3E3A8A3D, 0x038868A1, + 0x3FF006A1, 0x60000000, 0xBE25F092, 0x151D21CE, + 0x3FF006A5, 0x60000000, 0x3E2F2A6F, 0x11738C43, + 0x3FF006A9, 0x64000000, 0xBE35CD41, 0x3E9CE96D, + 0x3FF006AD, 0x64000000, 0x3E138132, 0x8DBC2918, + 0x3FF006B1, 0x64000000, 0x3E3F9DE1, 0x32DF4C13, + 0x3FF006B5, 0x68000000, 0xBE16520E, 0x3129E0B2, + 0x3FF006B9, 0x68000000, 0x3E35491E, 0x69F36A61, + 0x3FF006BD, 0x6C000000, 0xBE2F9271, 0xCCCABCD4, + 0x3FF006C1, 0x6C000000, 0x3E2668ED, 0x0D59B899, + 0x3FF006C5, 0x70000000, 0xBE39BDD3, 0x4AD435A0, + 0x3FF006C9, 0x70000000, 0x3DF5FE9A, 0x9191CABB, + 0x3FF006CD, 0x70000000, 0x3E3C8DAD, 0x6676850B, + 0x3FF006D1, 0x74000000, 0xBE206910, 0x1D74934A, + 0x3FF006D5, 0x74000000, 0x3E331949, 0x4D886478, + 0x3FF006D9, 0x78000000, 0xBE3188DE, 0x80BFBBC2, + 0x3FF006DD, 0x78000000, 0x3E23CA01, 0x14DE1719, + 0x3FF006E1, 0x7C000000, 0xBE3A9D19, 0x8CE98EC0, + 0x3FF006E5, 0x7C000000, 0x3DEE1A67, 0xA705A6E7, + 0x3FF006E9, 0x7C000000, 0x3E3C8EC6, 0xECD5F851, + 0x3FF006ED, 0x80000000, 0xBE1F0CF9, 0xE839CE4D, + 0x3FF006F1, 0x80000000, 0x3E33FAC3, 0x0C8CA46A, + 0x3FF006F5, 0x84000000, 0xBE303734, 0x7B5703D8, + 0x3FF006F9, 0x84000000, 0x3E274DB5, 0xE490A112, + 0x3FF006FD, 0x88000000, 0xBE386B0E, 0xA693A093, + 0x3FF00701, 0x88000000, 0x3E0C9875, 0xF0B73DAA, + 0x3FF00705, 0x88000000, 0x3E3FA133, 0x2449A944, + 0x3FF00709, 0x8C000000, 0xBE110285, 0xBFE66C14, + 0x3FF0070D, 0x8C000000, 0x3E37ED91, 0x054EDCBD, + 0x3FF00711, 0x90000000, 0xBE27A86A, 0xEFB65924, + 0x3FF00715, 0x90000000, 0x3E307A0B, 0x1C8A0CF1, + 0x3FF00719, 0x94000000, 0xBE3327AD, 0x397FB1D6, + 0x3FF0071D, 0x94000000, 0x3E228D43, 0x1412B9FB, + 0x3FF00721, 0x98000000, 0xBE3A3B08, 0x94D8FFB0, + 0x3FF00725, 0x98000000, 0x3E029AA3, 0x6ED80040, + 0x3FF00729, 0x98000000, 0x3E3EF1B8, 0x9627250A, + 0x3FF0072D, 0x9C000000, 0xBE117F70, 0x5FCB1B09, + 0x3FF00731, 0x9C000000, 0x3E385E96, 0x678F0789, + 0x3FF00735, 0xA0000000, 0xBE25A5DF, 0xCEA3485B, + 0x3FF00739, 0xA0000000, 0x3E320B90, 0xFF6D0303, + 0x3FF0073D, 0xA4000000, 0xBE3105E6, 0xE03334FF, + 0x3FF00741, 0xA4000000, 0x3E27F150, 0xFB9F056D, + 0x3FF00745, 0xA8000000, 0xBE36F8C0, 0xE28905F4, + 0x3FF00749, 0xA8000000, 0x3E189774, 0x0B1407AA, + 0x3FF0074D, 0xAC000000, 0xBE3CAB7D, 0xCE4493C4, + 0x3FF00751, 0xAC000000, 0x3DE265D5, 0xCB817D78, + 0x3FF00755, 0xAC000000, 0x3E3DE1E2, 0x7CA8B4E3, + 0x3FF00759, 0xB0000000, 0xBE12FD89, 0x7D730FC6, + 0x3FF0075D, 0xB0000000, 0x3E38AF60, 0x1E4D7759, + 0x3FF00761, 0xB4000000, 0xBE23A3AC, 0x0CAD84A2, + 0x3FF00765, 0xB4000000, 0x3E33BCFB, 0x36B866FD, + 0x3FF00769, 0xB8000000, 0xBE2D4858, 0x4D0667A1, + 0x3FF0076D, 0xB8000000, 0x3E2E1567, 0xCBF08E6A, + 0x3FF00771, 0xBC000000, 0xBE333664, 0x9FD34D05, + 0x3FF00775, 0xBC000000, 0x3E253114, 0x9837D6E0, + 0x3FF00779, 0xC0000000, 0xBE37887F, 0x5238327D, + 0x3FF0077D, 0xC0000000, 0x3E1999FA, 0x24C8DC90, + 0x3FF00781, 0xC4000000, 0xBE3B9A7C, 0x1DA2F8BE, + 0x3FF00785, 0xC4000000, 0x3E03A485, 0xEA50EE6A, + 0x3FF00789, 0xC8000000, 0xBE3F6C5A, 0xE204A449, + 0x3FF0078D, 0xC8000000, 0xBDF3D3EF, 0x78D5D0F3, + 0x3FF00791, 0xC8000000, 0x3E3D01E4, 0x80B1D66C, + 0x3FF00795, 0xCC000000, 0xBE12BBC1, 0xD5149796, + 0x3FF00799, 0xCC000000, 0x3E39B042, 0x2A8F92F0, + 0x3FF0079D, 0xD0000000, 0xBE1F820E, 0x6F386487, + 0x3FF007A1, 0xD0000000, 0x3E369EBE, 0x3BA3BCDA, + 0x3FF007A5, 0xD4000000, 0xBE25A3F0, 0x96320652, + 0x3FF007A9, 0xD4000000, 0x3E33CD58, 0xD3FD8FCA, + 0x3FF007AD, 0xD8000000, 0xBE2B069C, 0xC62D40B1, + 0x3FF007B1, 0xD8000000, 0x3E313C12, 0x13AC5766, + 0x3FF007B5, 0xDC000000, 0xBE2FE90B, 0x876F3A0B, + 0x3FF007B9, 0xDC000000, 0x3E2DD5D4, 0x357EDEB8, + 0x3FF007BD, 0xE0000000, 0xBE32259E, 0x4CEC957E, + 0x3FF007C1, 0xE0000000, 0x3E29B3C2, 0x128C86C6, + 0x3FF007C5, 0xE4000000, 0xBE341697, 0xDEA61608, + 0x3FF007C9, 0xE4000000, 0x3E2611ED, 0xFEA09E70, + 0x3FF007CD, 0xE8000000, 0xBE35C772, 0x58D49AE3, + 0x3FF007D1, 0xE8000000, 0x3E22F058, 0x39DA3D42, + 0x3FF007D5, 0xEC000000, 0xBE37382D, 0x9B689043, + 0x3FF007D9, 0xEC000000, 0x3E204F01, 0x04589AD6, + 0x3FF007DD, 0xF0000000, 0xBE3868C9, 0x86525259, + 0x3FF007E1, 0xF0000000, 0x3E1C5BD1, 0x3C761DAC, + 0x3FF007E5, 0xF4000000, 0xBE395945, 0xF9822D4C, + 0x3FF007E9, 0xF4000000, 0x3E191A1E, 0x8F4221F9, + 0x3FF007ED, 0xF8000000, 0xBE3A09A2, 0xD4E85D3A, + 0x3FF007F1, 0xF8000000, 0x3E16D8EA, 0x81547225, + 0x3FF007F5, 0xFC000000, 0xBE3A79DF, 0xF8750E3B, + 0x3FF007F9, 0xFC000000, 0x3E159835, 0x92EC7DE3, + 0x3FF007FE, 0x00000000, 0xBE3AA9FD, 0x44185C5D } }; + +#else +#ifdef LITTLE_ENDI + +static const union { + int i[1424]; + double x[712]; +} coar = { .i = { + 0xC8000000, 0x3FE69A59, 0x6079C9F7, 0x3DF22D4D, + 0xC8000000, 0x3FE6A5A9, 0x25AF6823, 0x3E19882D, + 0x74000000, 0x3FE6B0FF, 0x31DABF59, 0xBE221476, + 0xC8000000, 0x3FE6BC5A, 0x99A2DC0A, 0x3E2312AC, + 0xD0000000, 0x3FE6C7BB, 0xCE9F9355, 0xBE265926, + 0x84000000, 0x3FE6D322, 0x2D298DED, 0x3E2F2C26, + 0xF4000000, 0x3FE6DE8E, 0x1E748D2F, 0xBE2EC28E, + 0x14000000, 0x3FE6EA01, 0xC68CB7E5, 0x3E2D8C6D, + 0xF4000000, 0x3FE6F578, 0x419FE2F0, 0x3DEE1A9E, + 0x90000000, 0x3FE700F6, 0xDEAEAE34, 0xBDFF1AFD, + 0xEC000000, 0x3FE70C79, 0x558B7122, 0xBE0730FE, + 0x0C000000, 0x3FE71803, 0x2D280C3B, 0xBE25CB85, + 0xF0000000, 0x3FE72391, 0x337B7B54, 0xBE06F2CE, + 0x9C000000, 0x3FE72F26, 0x45C02B72, 0x3E289BCA, + 0x18000000, 0x3FE73AC1, 0x5039F1CA, 0xBE18DEA6, + 0x60000000, 0x3FE74661, 0x86CE0538, 0xBE09D090, + 0x78000000, 0x3FE75207, 0xCFCE5DDB, 0x3E290E79, + 0x68000000, 0x3FE75DB3, 0xB249A17C, 0x3DD61DF0, + 0x2C000000, 0x3FE76965, 0xE13445F7, 0x3E2F22F7, + 0xD0000000, 0x3FE7751C, 0x874E75CE, 0xBE2CD454, + 0x4C000000, 0x3FE780DA, 0xDF43E3BC, 0xBE0159CE, + 0xA8000000, 0x3FE78C9D, 0x699A1332, 0x3E279291, + 0xEC000000, 0x3FE79866, 0x2DD98C6C, 0xBE2A0BCD, + 0x10000000, 0x3FE7A436, 0x15AC979E, 0x3E25F375, + 0x20000000, 0x3FE7B00B, 0x2FEAFCF6, 0x3E26CCF5, + 0x1C000000, 0x3FE7BBE6, 0x53ADAD67, 0x3E27D4F4, + 0x08000000, 0x3FE7C7C7, 0x7FBD9566, 0x3E10EEC7, + 0xE4000000, 0x3FE7D3AD, 0x9A831D86, 0x3E2837F0, + 0xB8000000, 0x3FE7DF9A, 0x5CB4C35B, 0xBE129BE0, + 0x80000000, 0x3FE7EB8D, 0x0234F04D, 0x3E23990A, + 0x44000000, 0x3FE7F786, 0x64D5C842, 0x3E2EB807, + 0x08000000, 0x3FE80385, 0x02B4E9E8, 0x3E0FC86F, + 0xCC000000, 0x3FE80F89, 0x7B4274BF, 0xBDD7B5B3, + 0x94000000, 0x3FE81B94, 0xB899B00F, 0xBE16888B, + 0x60000000, 0x3FE827A5, 0x5E94D155, 0x3E288971, + 0x38000000, 0x3FE833BC, 0x099F3E5E, 0x3E2AEEB2, + 0x20000000, 0x3FE83FD9, 0x3FF60B7C, 0xBE23B922, + 0x14000000, 0x3FE84BFC, 0x2DBD8012, 0xBDF7D3B1, + 0x1C000000, 0x3FE85825, 0xA8872BEB, 0xBDF24BA3, + 0x38000000, 0x3FE86454, 0x01AA18A7, 0x3E2EFE04, + 0x70000000, 0x3FE87089, 0x944496A2, 0x3E21986C, + 0xC4000000, 0x3FE87CC4, 0xB71FFAFF, 0x3E096A8B, + 0x38000000, 0x3FE88906, 0xBC4C7AC5, 0xBE21CE0A, + 0xCC000000, 0x3FE8954D, 0xBAC02491, 0xBE076F45, + 0x84000000, 0x3FE8A19B, 0xD922B925, 0x3E2B4FA2, + 0x68000000, 0x3FE8ADEF, 0x641863AF, 0x3DF759DB, + 0x78000000, 0x3FE8BA49, 0xC6AB5E04, 0xBE2DB97C, + 0xB4000000, 0x3FE8C6A9, 0xE2156713, 0xBE25364C, + 0x20000000, 0x3FE8D310, 0x862BEFF7, 0x3E1BEB7C, + 0xC4000000, 0x3FE8DF7C, 0x1CEA33A5, 0xBDF4DD0C, + 0xA0000000, 0x3FE8EBEF, 0x51797D47, 0xBE2537DF, + 0xB4000000, 0x3FE8F868, 0xF0107B28, 0x3E0FB1C4, + 0x08000000, 0x3FE904E8, 0xE01B68BD, 0x3E0AD6A1, + 0x9C000000, 0x3FE9116D, 0x1F78D9D9, 0x3E292117, + 0x78000000, 0x3FE91DF9, 0x4F50E5CF, 0xBE1D75DA, + 0x98000000, 0x3FE92A8B, 0x74959E58, 0x3DE5102B, + 0x04000000, 0x3FE93724, 0xD2216C35, 0xBE01CA50, + 0xBC000000, 0x3FE943C2, 0xB0B05884, 0x3E225BFD, + 0xC8000000, 0x3FE95067, 0x60B7C5C1, 0xBE0F2183, + 0x24000000, 0x3FE95D13, 0xB5860441, 0x3E2FB47A, + 0xDC000000, 0x3FE969C4, 0xE2D4059E, 0xBE01FFD2, + 0xEC000000, 0x3FE9767C, 0x12BB6A8D, 0xBDE9ED72, + 0x58000000, 0x3FE9833B, 0x43BFFB24, 0x3E2B3815, + 0x28000000, 0x3FE99000, 0xEE9EAD1E, 0x3E03FA22, + 0x5C000000, 0x3FE99CCB, 0x377138F7, 0xBE213841, + 0xF4000000, 0x3FE9A99C, 0xDB636C94, 0x3E178105, + 0xF8000000, 0x3FE9B674, 0xF5720122, 0x3E1E5E7A, + 0x6C000000, 0x3FE9C353, 0xA2AC5AAE, 0xBE238BFF, + 0x4C000000, 0x3FE9D038, 0xF93BDBD8, 0x3E270893, + 0xA4000000, 0x3FE9DD23, 0x354B86CF, 0x3DF40420, + 0x74000000, 0x3FE9EA15, 0x88CB06B7, 0xBE2D76D3, + 0xBC000000, 0x3FE9F70D, 0x9ED0EC60, 0xBE251639, + 0x80000000, 0x3FEA040C, 0xE2DDE506, 0x3E1F06E9, + 0xC8000000, 0x3FEA1111, 0x8E6DB477, 0x3E014549, + 0x94000000, 0x3FEA1E1D, 0xF8716509, 0xBDF4BC17, + 0xE8000000, 0x3FEA2B2F, 0xDA723A49, 0xBE2107DB, + 0xC4000000, 0x3FEA3848, 0x986AA369, 0x3E1A932A, + 0x30000000, 0x3FEA4568, 0x41592CDB, 0x3E198092, + 0x30000000, 0x3FEA528E, 0x676BCAB8, 0xBE2E260F, + 0xC0000000, 0x3FEA5FBA, 0x2D5D5610, 0x3DE2E821, + 0xE8000000, 0x3FEA6CED, 0x7DA20167, 0x3E2F7046, + 0xB0000000, 0x3FEA7A27, 0xF9FAAD30, 0xBE1D2832, + 0x14000000, 0x3FEA8768, 0x43FA6C45, 0xBE23F788, + 0x18000000, 0x3FEA94AF, 0xAA082732, 0x3E011E27, + 0xC4000000, 0x3FEAA1FC, 0xC682F0BF, 0xBE20BACB, + 0x18000000, 0x3FEAAF51, 0x7BD08C78, 0xBE2DC7DD, + 0x14000000, 0x3FEABCAC, 0xA3B10F9A, 0x3E2271A2, + 0xC4000000, 0x3FEACA0D, 0x7966F94C, 0xBE15449C, + 0x24000000, 0x3FEAD776, 0x6FD8F3EE, 0x3DD06137, + 0x3C000000, 0x3FEAE4E5, 0x8C5A144A, 0xBE267CD1, + 0x0C000000, 0x3FEAF25B, 0xB59DA94B, 0xBE29E584, + 0x98000000, 0x3FEAFFD7, 0x7B52192F, 0xBE23DFCF, + 0xE4000000, 0x3FEB0D5A, 0x78A76B45, 0xBE1CF2FE, + 0xF4000000, 0x3FEB1AE4, 0x7EC80FF6, 0xBE23A561, + 0xC8000000, 0x3FEB2875, 0x932EED68, 0x3E22C4C9, + 0x68000000, 0x3FEB360D, 0xB5833C97, 0x3E2B085C, + 0xD8000000, 0x3FEB43AB, 0x93B9319A, 0xBE01F093, + 0x18000000, 0x3FEB5151, 0xFABCE670, 0xBE254F01, + 0x28000000, 0x3FEB5EFD, 0x627ABFB0, 0x3E2F24C2, + 0x14000000, 0x3FEB6CB0, 0xE6AC0B48, 0x3E1F1EEC, + 0xDC000000, 0x3FEB7A69, 0x127F9ABC, 0xBE1A8671, + 0x80000000, 0x3FEB882A, 0xC87C73B3, 0xBDCB0C28, + 0x08000000, 0x3FEB95F2, 0x7F2B5A97, 0xBE22E8DD, + 0x74000000, 0x3FEBA3C0, 0x2D22A9D5, 0xBE1B3645, + 0xC8000000, 0x3FEBB195, 0x428F8B88, 0x3E0ADACA, + 0x0C000000, 0x3FEBBF72, 0xCDF9F681, 0xBE2E9E07, + 0x3C000000, 0x3FEBCD55, 0x7FA54ACF, 0xBE08A127, + 0x60000000, 0x3FEBDB3F, 0x8225B385, 0x3E0E92CE, + 0x7C000000, 0x3FEBE930, 0x7BB09485, 0x3DF38C2A, + 0x94000000, 0x3FEBF728, 0xF681FA5F, 0xBE2DFD64, + 0xA4000000, 0x3FEC0527, 0xDCE88BD2, 0x3E2E384D, + 0xBC000000, 0x3FEC132D, 0xFE46A893, 0xBE20F111, + 0xD4000000, 0x3FEC213A, 0xB189BFDA, 0x3E193DA1, + 0xF8000000, 0x3FEC2F4E, 0x0E39FB00, 0xBE20E3A1, + 0x24000000, 0x3FEC3D6A, 0x30F0FAC5, 0x3E1DB044, + 0x64000000, 0x3FEC4B8C, 0x97446B17, 0xBE2BC12C, + 0xB4000000, 0x3FEC59B5, 0x963F4150, 0xBE282696, + 0x18000000, 0x3FEC67E6, 0x3049824B, 0x3E224D26, + 0x98000000, 0x3FEC761D, 0x87F84C7D, 0x3E2C5BA5, + 0x38000000, 0x3FEC845C, 0xC4852339, 0xBDE1D14D, + 0xF8000000, 0x3FEC92A1, 0x5588D9E1, 0xBE1A451E, + 0xDC000000, 0x3FECA0EE, 0x68BFF457, 0xBE1D3B96, + 0xE8000000, 0x3FECAF42, 0x4DADF774, 0xBE18B670, + 0x20000000, 0x3FECBD9E, 0x7FB1FC01, 0xBE1A1548, + 0x88000000, 0x3FECCC00, 0x78FC5AF0, 0xBE273F2E, + 0x20000000, 0x3FECDA6A, 0xA6F4A841, 0x3E1D218F, + 0xF0000000, 0x3FECE8DA, 0x4D002CA0, 0x3E2E0BA9, + 0xFC000000, 0x3FECF752, 0x065EF979, 0x3E20F4BB, + 0x48000000, 0x3FED05D2, 0x11793B33, 0xBE2ED3D5, + 0xD0000000, 0x3FED1458, 0x913341B3, 0x3E115E3C, + 0xA0000000, 0x3FED22E6, 0xB3546109, 0x3DE97C02, + 0xB8000000, 0x3FED317B, 0x1BF898EF, 0x3E087540, + 0x1C000000, 0x3FED4018, 0x346F9641, 0x3E209430, + 0xD0000000, 0x3FED4EBB, 0x88F4B20B, 0x3E2B6DF4, + 0xDC000000, 0x3FED5D66, 0x0CB26035, 0xBE2EC68F, + 0x38000000, 0x3FED6C19, 0x1F44D9C3, 0x3E2CA2C8, + 0xF4000000, 0x3FED7AD2, 0x41704EE0, 0x3E10E6F4, + 0x0C000000, 0x3FED8994, 0x25F8F0E2, 0x3E2F9273, + 0x88000000, 0x3FED985C, 0x318798DE, 0x3E2D041A, + 0x6C000000, 0x3FEDA72C, 0x9349CF58, 0xBE005680, + 0xB8000000, 0x3FEDB603, 0xCF0C934D, 0xBE10F665, + 0x70000000, 0x3FEDC4E2, 0x19461C64, 0x3E166124, + 0x9C000000, 0x3FEDD3C8, 0x405624C8, 0xBE1B2ED6, + 0x3C000000, 0x3FEDE2B6, 0x62171501, 0xBE273A7F, + 0x54000000, 0x3FEDF1AB, 0xE36E1450, 0xBE26022B, + 0xE8000000, 0x3FEE00A7, 0x2E07AE15, 0xBE1C341E, + 0xFC000000, 0x3FEE0FAB, 0x18D0E701, 0xBDFC7EAE, + 0x94000000, 0x3FEE1EB7, 0xECD1FF8B, 0x3E06B34F, + 0xB4000000, 0x3FEE2DCA, 0x6813A649, 0x3E1394A3, + 0x60000000, 0x3FEE3CE5, 0xC1754D14, 0x3E045496, + 0x9C000000, 0x3FEE4C07, 0xF5C6087C, 0xBE180FFF, + 0x68000000, 0x3FEE5B31, 0xADD9A300, 0x3E22FBCD, + 0xCC000000, 0x3FEE6A62, 0xAF0289E5, 0x3E2EC7C7, + 0xCC000000, 0x3FEE799B, 0x3FB3EDD4, 0x3E242182, + 0x6C000000, 0x3FEE88DC, 0x04E39885, 0xBE201304, + 0xAC000000, 0x3FEE9824, 0xE6831D31, 0xBE20D352, + 0x90000000, 0x3FEEA774, 0x618DFCEB, 0x3E1E032D, + 0x20000000, 0x3FEEB6CC, 0xF9BB457E, 0x3E1956A3, + 0x60000000, 0x3FEEC62B, 0x50845DB2, 0xBE2A77E0, + 0x4C000000, 0x3FEED592, 0x47C43858, 0x3E2714F7, + 0xF0000000, 0x3FEEE500, 0x71813A66, 0x3E2EED96, + 0x50000000, 0x3FEEF477, 0x4FB4AA34, 0xBE04CDBE, + 0x6C000000, 0x3FEF03F5, 0x86EB4FF5, 0xBE2774A2, + 0x48000000, 0x3FEF137B, 0xAD43B2D2, 0xBE29DD95, + 0xE8000000, 0x3FEF2308, 0xAC16E506, 0xBE1CADB0, + 0x50000000, 0x3FEF329E, 0x58745C7B, 0x3E12AC33, + 0x88000000, 0x3FEF423B, 0x6EC2D854, 0xBE248118, + 0x8C000000, 0x3FEF51E0, 0x304ACE08, 0x3E26986B, + 0x68000000, 0x3FEF618D, 0x3B09354E, 0x3E126D81, + 0x1C000000, 0x3FEF7142, 0x773C23B3, 0x3DF06AAE, + 0xAC000000, 0x3FEF80FE, 0xD82EF423, 0xBDA105B6, + 0x1C000000, 0x3FEF90C3, 0x465499B8, 0x3DECDEED, + 0x70000000, 0x3FEFA08F, 0xE2EF03AE, 0x3E0AEFD4, + 0xAC000000, 0x3FEFB063, 0x0567B2E7, 0x3E1BD4C0, + 0xD4000000, 0x3FEFC03F, 0x4F97FCBF, 0x3E26AA22, + 0xF0000000, 0x3FEFD023, 0x5E4E88D1, 0xBE2F9420, + 0xFC000000, 0x3FEFE00F, 0x438E52E2, 0xBE254004, + 0x00000000, 0x3FEFF004, 0xEEE93EFC, 0xBE1552AA, + 0x00000000, 0x3FF00000, 0x00000000, 0x00000000, + 0x00000000, 0x3FF00802, 0x4449F507, 0x3E155800, + 0x04000000, 0x3FF01008, 0x882D75D6, 0xBE354AA8, + 0x08000000, 0x3FF01812, 0x3740DE56, 0x3E303610, + 0x14000000, 0x3FF02020, 0x5B0C3264, 0x3E360044, + 0x28000000, 0x3FF02832, 0x0197EDC3, 0x3E3C4C26, + 0x48000000, 0x3FF03048, 0x5046CA09, 0x3E0B103B, + 0x74000000, 0x3FF03862, 0xF9A62624, 0xBE34659C, + 0xAC000000, 0x3FF04080, 0xDD0A8F37, 0xBE254438, + 0xF4000000, 0x3FF048A2, 0x97AFB6E2, 0x3DF256C2, + 0x50000000, 0x3FF050C9, 0x923D25E1, 0xBE3085DF, + 0xC0000000, 0x3FF058F3, 0x5EA3B091, 0xBE3F0A93, + 0x44000000, 0x3FF06122, 0x5D63534C, 0xBE237DE4, + 0xE0000000, 0x3FF06954, 0xFF0C58B7, 0x3E301719, + 0x98000000, 0x3FF0718B, 0x9DF7B665, 0x3E2E8410, + 0x6C000000, 0x3FF079C6, 0x3B127222, 0x3E349CB9, + 0x60000000, 0x3FF08205, 0x98E0BD08, 0x3DF127EC, + 0x74000000, 0x3FF08A48, 0x706CC41F, 0xBE24C1B6, + 0xA8000000, 0x3FF0928F, 0x093044EF, 0x3E334EF9, + 0x04000000, 0x3FF09ADB, 0x56BC6C83, 0xBE1304B1, + 0x84000000, 0x3FF0A32A, 0xB028B984, 0x3E2D383E, + 0x30000000, 0x3FF0AB7E, 0x64E7A202, 0xBE315B1E, + 0x04000000, 0x3FF0B3D6, 0xC678291E, 0xBE0AC1E6, + 0x04000000, 0x3FF0BC32, 0x2F12FFE2, 0x3E3A0418, + 0x38000000, 0x3FF0C492, 0x43D6D302, 0xBE37D617, + 0x98000000, 0x3FF0CCF6, 0x152CC8FA, 0x3E2133F2, + 0x2C000000, 0x3FF0D55F, 0xE966E6B7, 0x3E3CE5D1, + 0xF8000000, 0x3FF0DDCB, 0x7BCACA64, 0x3E1ABF24, + 0xFC000000, 0x3FF0E63C, 0x2E8CDBED, 0xBE3854F6, + 0x38000000, 0x3FF0EEB2, 0x0C32156B, 0xBE3E6463, + 0xAC000000, 0x3FF0F72B, 0xB69772CC, 0x3E365671, + 0x64000000, 0x3FF0FFA9, 0x02B1201A, 0xBE383E9A, + 0x58000000, 0x3FF1082B, 0x50549CC0, 0xBE205962, + 0x90000000, 0x3FF110B1, 0xFFDACA72, 0xBE376BFE, + 0x08000000, 0x3FF1193C, 0x5C43E2F3, 0x3E3C1C59, + 0xCC000000, 0x3FF121CA, 0xF7067C8B, 0xBE26D374, + 0xD4000000, 0x3FF12A5D, 0x4DDAFE1D, 0x3E343CCC, + 0x28000000, 0x3FF132F5, 0x58EBCB7F, 0x3E3D5C16, + 0xCC000000, 0x3FF13B90, 0xB66E8B53, 0xBE2B5D12, + 0xBC000000, 0x3FF14430, 0xB326B482, 0xBE24E919, + 0xFC000000, 0x3FF14CD4, 0xC8AABD43, 0x3E23139A, + 0x90000000, 0x3FF1557D, 0x16743B55, 0x3E30DD8B, + 0x7C000000, 0x3FF15E2A, 0x35904C50, 0xBE31D701, + 0xBC000000, 0x3FF166DB, 0x30E0CA83, 0x3E107F42, + 0x58000000, 0x3FF16F91, 0xDA1B7123, 0xBE24F1F2, + 0x50000000, 0x3FF1784B, 0x0DC79E23, 0xBE3ACAF2, + 0xA4000000, 0x3FF18109, 0x609374EE, 0xBE23DC79, + 0x58000000, 0x3FF189CC, 0x3A40C3B7, 0x3E262CF7, + 0x70000000, 0x3FF19293, 0x5A24F463, 0x3E1D3833, + 0xEC000000, 0x3FF19B5E, 0x8A2E4440, 0x3E2BA9AD, + 0xD0000000, 0x3FF1A42E, 0x61C41828, 0x3DFD8CBC, + 0x1C000000, 0x3FF1AD03, 0x5A4DDF0D, 0x3E1A65E6, + 0xD4000000, 0x3FF1B5DB, 0x9F828DB5, 0xBDE2FDBB, + 0xF8000000, 0x3FF1BEB8, 0xB79B700F, 0x3E2F4EE8, + 0x8C000000, 0x3FF1C79A, 0x0DE1D7E8, 0x3E3ACC35, + 0x94000000, 0x3FF1D080, 0xFF9E20A0, 0x3E11729E, + 0x10000000, 0x3FF1D96B, 0x6C2EA70B, 0xBE300F18, + 0x00000000, 0x3FF1E25A, 0xCE425A35, 0x3DF32E02, + 0x68000000, 0x3FF1EB4D, 0x9A322D12, 0x3E3BDE56, + 0x50000000, 0x3FF1F445, 0xBA737AEF, 0xBE3C3F0D, + 0xB0000000, 0x3FF1FD41, 0xC896DB7A, 0xBE0A2DD0, + 0x90000000, 0x3FF20642, 0xF8B782F6, 0x3E2577B0, + 0xF4000000, 0x3FF20F47, 0x73607FC8, 0xBE2C6DA3, + 0xD8000000, 0x3FF21851, 0xC8917348, 0x3E35F7D1, + 0x44000000, 0x3FF22160, 0xCF9CED69, 0x3E3B6F5C, + 0x3C000000, 0x3FF22A73, 0x85775C2E, 0xBE39967E, + 0xB8000000, 0x3FF2338A, 0x497226D4, 0x3E3B3213, + 0xC4000000, 0x3FF23CA6, 0x30733227, 0x3E3E2710, + 0x60000000, 0x3FF245C7, 0xAF215A72, 0x3E33B8A9, + 0x90000000, 0x3FF24EEC, 0x1365623F, 0xBE3F96B2, + 0x50000000, 0x3FF25816, 0x27DEE202, 0xBE37324F, + 0xA4000000, 0x3FF26144, 0x4E484D87, 0x3E318CD5, + 0x94000000, 0x3FF26A77, 0xA94519E8, 0xBDE3FD37, + 0x1C000000, 0x3FF273AF, 0xEE788C29, 0x3E37132F, + 0x44000000, 0x3FF27CEB, 0xE842E5C0, 0xBE03DDB7, + 0x08000000, 0x3FF2862C, 0xE17C9693, 0x3E37A3FB, + 0x70000000, 0x3FF28F71, 0xAEB3D9A0, 0x3E24EABF, + 0x7C000000, 0x3FF298BB, 0x853B0733, 0xBE13C7B6, + 0x2C000000, 0x3FF2A20A, 0xC7B588B5, 0x3E2D2C80, + 0x88000000, 0x3FF2AB5D, 0x708F3912, 0xBE35B750, + 0x8C000000, 0x3FF2B4B5, 0xD5FD9130, 0xBE291A70, + 0x3C000000, 0x3FF2BE12, 0x0CCF9F73, 0x3E2EE937, + 0xA0000000, 0x3FF2C773, 0xD42CF76C, 0xBE3C3F0C, + 0xB0000000, 0x3FF2D0D9, 0x60763D61, 0x3E35DD54, + 0x78000000, 0x3FF2DA44, 0xE7D6AA3B, 0x3E26C418, + 0xF8000000, 0x3FF2E3B3, 0x6FB9B7A8, 0xBE3605C6, + 0x2C000000, 0x3FF2ED28, 0x24DCDDF5, 0x3E3763D4, + 0x20000000, 0x3FF2F6A1, 0xA8EC1AA8, 0xBE1A411E, + 0xD0000000, 0x3FF3001E, 0x1FE8546F, 0xBE23FCA1, + 0x40000000, 0x3FF309A1, 0x3AAEE75E, 0xBE29DF0D, + 0x70000000, 0x3FF31328, 0x3C2C4206, 0x3E36A5D6, + 0x68000000, 0x3FF31CB4, 0xB4C979B0, 0x3E1B7A3E, + 0x28000000, 0x3FF32645, 0x706CD593, 0xBE36157D, + 0xB0000000, 0x3FF32FDA, 0x8DA4C646, 0xBE39F357, + 0x04000000, 0x3FF33975, 0xD575FE6F, 0xBE3E64DE, + 0x24000000, 0x3FF34314, 0x44D008E0, 0x3E07F9E3, + 0x18000000, 0x3FF34CB8, 0x5A563E77, 0xBE2E94F9, + 0xDC000000, 0x3FF35660, 0x2475EF19, 0x3E314DC2, + 0x78000000, 0x3FF3600E, 0xA33AC606, 0x3E26D623, + 0xEC000000, 0x3FF369C0, 0xC05B3160, 0x3E170F86, + 0x3C000000, 0x3FF37378, 0xDB0AE31A, 0xBE38DDFE, + 0x64000000, 0x3FF37D34, 0x5706B570, 0x3E3662A9, + 0x70000000, 0x3FF386F5, 0x6770731E, 0xBE1625E4, + 0x5C000000, 0x3FF390BB, 0x62971091, 0xBE1678F1, + 0x2C000000, 0x3FF39A86, 0xD045CB0C, 0xBE061F7C, + 0xE4000000, 0x3FF3A455, 0x568B1CA2, 0xBE35CF51, + 0x84000000, 0x3FF3AE2A, 0x7FB61F58, 0xBE378185, + 0x0C000000, 0x3FF3B804, 0x4FA133AF, 0x3E3F77F4, + 0x88000000, 0x3FF3C1E2, 0xB00B73FE, 0xBE22F96A, + 0xF0000000, 0x3FF3CBC5, 0x1EB4CE2F, 0x3E351A64, + 0x50000000, 0x3FF3D5AE, 0xD3755639, 0xBE3D3516, + 0xA0000000, 0x3FF3DF9B, 0x43E8C10E, 0x3E1CD938, + 0xEC000000, 0x3FF3E98D, 0x455C8842, 0xBE35EE23, + 0x30000000, 0x3FF3F385, 0x96C9F4ED, 0xBE29B282, + 0x70000000, 0x3FF3FD81, 0x3168CC0B, 0x3E24A40E, + 0xB0000000, 0x3FF40782, 0x86C72839, 0x3E3784BC, + 0xF4000000, 0x3FF41188, 0x0785D847, 0x3E061F19, + 0x3C000000, 0x3FF41B94, 0xE654A9C9, 0xBE27AEF2, + 0x88000000, 0x3FF425A4, 0xF9E4C1BA, 0x3E33DFC3, + 0xE0000000, 0x3FF42FB9, 0x593D0C75, 0x3E2455A8, + 0x44000000, 0x3FF439D4, 0x238B65D1, 0xBDE41D4E, + 0xB4000000, 0x3FF443F3, 0x454CBECB, 0x3E3BE616, + 0x38000000, 0x3FF44E18, 0x931C5332, 0x3E207B3C, + 0xD0000000, 0x3FF45841, 0x7615DCC9, 0xBE330846, + 0x7C000000, 0x3FF46270, 0xE497F84E, 0xBE2A8A7B, + 0x40000000, 0x3FF46CA4, 0xF737AF78, 0x3E020B50, + 0x20000000, 0x3FF476DD, 0xE34AFBD3, 0x3E116B19, + 0x20000000, 0x3FF4811B, 0x841EDB52, 0xBE3E15A7, + 0x3C000000, 0x3FF48B5E, 0x33B3DE1E, 0x3E0F40C3, + 0x7C000000, 0x3FF495A6, 0x92EFEE02, 0x3E33607F, + 0xE4000000, 0x3FF49FF3, 0x14F7E168, 0xBE1A2DB5, + 0x70000000, 0x3FF4AA46, 0x3EBA1C94, 0x3E3F59EC, + 0x2C000000, 0x3FF4B49E, 0x8B9AE885, 0xBE31A539, + 0x10000000, 0x3FF4BEFB, 0xF13C8C95, 0x3E2FAC0B, + 0x28000000, 0x3FF4C95D, 0xF8B74775, 0xBE32C0BB, + 0x70000000, 0x3FF4D3C4, 0x4F9474BB, 0xBE2FC24E, + 0xEC000000, 0x3FF4DE30, 0x09DA911F, 0x3E008F30, + 0xA0000000, 0x3FF4E8A2, 0xBAF8D98B, 0x3E2994C1, + 0x90000000, 0x3FF4F319, 0x18648D0A, 0xBE17C38C, + 0xBC000000, 0x3FF4FD95, 0xF22F8698, 0xBE288852, + 0x28000000, 0x3FF50817, 0x30A2C153, 0xBE3C3EC3, + 0xD4000000, 0x3FF5129D, 0x968492AA, 0xBE27B606, + 0xC4000000, 0x3FF51D29, 0x61101629, 0x3E2E0396, + 0xFC000000, 0x3FF527BA, 0xDAEEAB38, 0x3E3E876F, + 0x80000000, 0x3FF53251, 0xED945B30, 0x3E29F59E, + 0x50000000, 0x3FF53CED, 0x0B4AE3F1, 0x3E12D7DA, + 0x70000000, 0x3FF5478E, 0x5FB946D0, 0xBE2FAFB8, + 0xE0000000, 0x3FF55234, 0x87D80C66, 0xBE18A8B3, + 0xA4000000, 0x3FF55CE0, 0x764CF85C, 0x3E28B18F, + 0xC0000000, 0x3FF56791, 0x2BDBC6F4, 0x3E326017, + 0x38000000, 0x3FF57248, 0x53D523FE, 0xBE229F98, + 0x0C000000, 0x3FF57D04, 0x4D9B8720, 0xBE3BDD08, + 0x3C000000, 0x3FF587C5, 0x09D8749E, 0x3E169EBC, + 0xD0000000, 0x3FF5928B, 0x339C2080, 0x3E190C8C, + 0xC8000000, 0x3FF59D57, 0xDE75E9CA, 0x3E310FA4, + 0x28000000, 0x3FF5A829, 0x1097F186, 0x3E313D18, + 0xF4000000, 0x3FF5B2FF, 0xD51C23F6, 0xBE2BDE04, + 0x28000000, 0x3FF5BDDC, 0x8938C386, 0x3E3EE67E, + 0xD0000000, 0x3FF5C8BD, 0x47DF6575, 0x3E0973B8, + 0xE8000000, 0x3FF5D3A4, 0x1DB97781, 0x3E24DF02, + 0x78000000, 0x3FF5DE91, 0xAC4AECDC, 0xBE3FBA00, + 0x7C000000, 0x3FF5E983, 0x939F646A, 0xBE2F37AF, + 0xFC000000, 0x3FF5F47A, 0x58A6EEE9, 0xBE396DEF, + 0xF8000000, 0x3FF5FF77, 0xE3613C7B, 0xBE315248, + 0x74000000, 0x3FF60A7A, 0xF1553706, 0xBE26A9E2, + 0x74000000, 0x3FF61582, 0xAE4D7CB6, 0xBE3B6BF6, + 0xF8000000, 0x3FF6208F, 0x9EB5EBA5, 0xBE35775B, + 0x04000000, 0x3FF62BA3, 0xC1E43506, 0xBE2A821B, + 0x9C000000, 0x3FF636BB, 0x7B2D8CF4, 0xBE367CDA, + 0xC0000000, 0x3FF641D9, 0x3E907A1D, 0xBE13218B, + 0x74000000, 0x3FF64CFD, 0x7BF5DFE4, 0x3E3454EE, + 0xC0000000, 0x3FF65826, 0x6366C5FD, 0xBE3E960F, + 0x9C000000, 0x3FF66355, 0x8B43C17E, 0x3E2E378F, + 0x14000000, 0x3FF66E8A, 0xA4306535, 0x3E244BE0, + 0x28000000, 0x3FF679C4, 0x8DF63D6E, 0xBDE4B6C1, + 0xD8000000, 0x3FF68503, 0xE6A239CF, 0x3E3BA122, + 0x2C000000, 0x3FF69049, 0x59FB5F30, 0x3E27F286, + 0x24000000, 0x3FF69B94, 0x971D3970, 0xBE044041 } }; + +static const union { + int4 i[2048]; + double x[1024]; +} fine = { .i = { + 0x00000000, 0x3FF00000, 0x00000000, 0x00000000, + 0x00000000, 0x3FF00004, 0x55556AAB, 0x3DA00001, + 0x00000000, 0x3FF00008, 0xAAAB0000, 0x3DC00002, + 0x00000000, 0x3FF0000C, 0x8000D800, 0x3DD20004, + 0x00000000, 0x3FF00010, 0x5556AAAB, 0x3DE00005, + 0x00000000, 0x3FF00014, 0x6AADEC01, 0x3DE9000A, + 0x00000000, 0x3FF00018, 0x00036001, 0x3DF20009, + 0x00000000, 0x3FF0001C, 0x4AB0EB58, 0x3DF8800E, + 0x00000000, 0x3FF00020, 0xAAB00002, 0x3E00000A, + 0x00000000, 0x3FF00024, 0x30088B04, 0x3E04400F, + 0x00000000, 0x3FF00028, 0xD5625AB1, 0x3E090014, + 0x00000000, 0x3FF0002C, 0xBABDBB0A, 0x3E0E401B, + 0x00000000, 0x3FF00030, 0x000D8008, 0x3E120012, + 0x00000000, 0x3FF00034, 0xE2BD42E1, 0x3E152016, + 0x00000000, 0x3FF00038, 0x956E5812, 0x3E18801C, + 0x00000000, 0x3FF0003C, 0x2820F599, 0x3E1C2023, + 0x00000000, 0x3FF00040, 0x556AAABC, 0x3E200015, + 0x00000000, 0x3FF00044, 0x96C5DAD7, 0x3E221019, + 0x00000000, 0x3FF00048, 0x60222C1F, 0x3E24401E, + 0x00000000, 0x3FF0004C, 0xB97FC193, 0x3E269023, + 0x00000000, 0x3FF00050, 0xAADEC034, 0x3E290029, + 0x00000000, 0x3FF00054, 0x3C3F4F02, 0x3E2B9030, + 0x00000000, 0x3FF00058, 0x75A196FF, 0x3E2E4037, + 0x00000000, 0x3FF0005C, 0xAF82E194, 0x3E30881F, + 0x00000000, 0x3FF00060, 0x00360041, 0x3E320024, + 0x00000000, 0x3FF00064, 0xB0EA3F05, 0x3E338828, + 0x00000000, 0x3FF00068, 0xC59FB661, 0x3E35202D, + 0x00000000, 0x3FF0006C, 0x42567FD5, 0x3E36C833, + 0x00000000, 0x3FF00070, 0x2B0EB5E1, 0x3E388039, + 0x00000000, 0x3FF00074, 0x83C87407, 0x3E3A483F, + 0x00000000, 0x3FF00078, 0x5083D6C6, 0x3E3C2046, + 0x00000000, 0x3FF0007C, 0x9540FB9E, 0x3E3E084D, + 0x04000000, 0x3FF00080, 0xA9FFFEEF, 0xBE3FFFAA, + 0x04000000, 0x3FF00084, 0x693EF962, 0xBE3DF7A2, + 0x04000000, 0x3FF00088, 0xA47BD339, 0xBE3BDF99, + 0x04000000, 0x3FF0008C, 0x57B66AF5, 0xBE39B790, + 0x04000000, 0x3FF00090, 0x7EEE9E14, 0xBE377F86, + 0x04000000, 0x3FF00094, 0x16244916, 0xBE35377C, + 0x04000000, 0x3FF00098, 0x1957477B, 0xBE32DF71, + 0x04000000, 0x3FF0009C, 0x848773C2, 0xBE307765, + 0x04000000, 0x3FF000A0, 0xA7694ED3, 0xBE2BFEB2, + 0x04000000, 0x3FF000A4, 0x05BD75E2, 0xBE26EE99, + 0x04000000, 0x3FF000A8, 0x1C0B0BB1, 0xBE21BE7E, + 0x04000000, 0x3FF000AC, 0xC4A37A79, 0xBE18DCC3, + 0x04000000, 0x3FF000B0, 0x4244D60F, 0xBE0BF911, + 0x04000000, 0x3FF000B4, 0xEC91D848, 0xBDE6E255, + 0x04000000, 0x3FF000B8, 0xEC1B8F0C, 0x3E0107EB, + 0x04000000, 0x3FF000BC, 0x89BE52AA, 0x3E142439, + 0x04000000, 0x3FF000C0, 0x06C01033, 0x3E200240, + 0x04000000, 0x3FF000C4, 0xC8A9F760, 0x3E261264, + 0x04000000, 0x3FF000C8, 0x129D3FDE, 0x3E2C428B, + 0x04000000, 0x3FF000CC, 0x764D2658, 0x3E314959, + 0x04000000, 0x3FF000D0, 0x2F50C16C, 0x3E34816E, + 0x04000000, 0x3FF000D4, 0xB859A4AB, 0x3E37C983, + 0x04000000, 0x3FF000D8, 0x15680499, 0x3E3B219A, + 0x04000000, 0x3FF000DC, 0x4A7C16B5, 0x3E3E89B1, + 0x08000000, 0x3FF000E0, 0xA469EE7E, 0xBE3DFE36, + 0x08000000, 0x3FF000E4, 0xB349D37F, 0xBE3A761D, + 0x08000000, 0x3FF000E8, 0xDE235FCD, 0xBE36DE03, + 0x08000000, 0x3FF000EC, 0x20F659E6, 0xBE3335E9, + 0x08000000, 0x3FF000F0, 0xEF850E8F, 0xBE2EFB9A, + 0x08000000, 0x3FF000F4, 0xBD0F58E2, 0xBE276B61, + 0x08000000, 0x3FF000F8, 0x45163381, 0xBE1F764D, + 0x08000000, 0x3FF000FC, 0x5FDF589A, 0xBE0FABA6, + 0x08000000, 0x3FF00100, 0xABBBBE94, 0x3D8555AA, + 0x08000000, 0x3FF00104, 0xDABB690B, 0x3E102B2C, + 0x08000000, 0x3FF00108, 0x7820FBA0, 0x3E2045D9, + 0x08000000, 0x3FF0010C, 0x92F54742, 0x3E28961E, + 0x08000000, 0x3FF00110, 0xE2ED8E39, 0x3E308332, + 0x08000000, 0x3FF00114, 0x8C698119, 0x3E34CB57, + 0x08000000, 0x3FF00118, 0x49EEC0C4, 0x3E39237D, + 0x08000000, 0x3FF0011C, 0x1F7D92BC, 0x3E3D8BA4, + 0x0C000000, 0x3FF00120, 0xEEE9C27D, 0xBE3DFC33, + 0x0C000000, 0x3FF00124, 0xDD46F763, 0xBE39740A, + 0x0C000000, 0x3FF00128, 0xA799C375, 0xBE34DBE0, + 0x0C000000, 0x3FF0012C, 0x49E1DD2F, 0xBE3033B5, + 0x0C000000, 0x3FF00130, 0x803DF41F, 0xBE26F711, + 0x0C000000, 0x3FF00134, 0x19433A4C, 0xBE1ACD6C, + 0x0C000000, 0x3FF00138, 0x8770E36F, 0xBDFDB2C1, + 0x0C000000, 0x3FF0013C, 0x6B74A43E, 0x3E086820, + 0x0C000000, 0x3FF00140, 0xDEC0D058, 0x3E200A6A, + 0x0C000000, 0x3FF00144, 0x22BD7872, 0x3E2A1AD0, + 0x0C000000, 0x3FF00148, 0xF769E132, 0x3E32259B, + 0x0C000000, 0x3FF0014C, 0x2582289A, 0x3E374DD1, + 0x0C000000, 0x3FF00150, 0x9FA7E4F4, 0x3E3C8607, + 0x10000000, 0x3FF00154, 0x9624963C, 0xBE3E31C0, + 0x10000000, 0x3FF00158, 0x77E2F472, 0xBE38D987, + 0x10000000, 0x3FF0015C, 0x0192E02C, 0xBE33714D, + 0x10000000, 0x3FF00160, 0x5E6805CB, 0xBE2BF222, + 0x10000000, 0x3FF00164, 0xF98C0A34, 0xBE20E1A7, + 0x10000000, 0x3FF00168, 0x32447238, 0xBE06C4AB, + 0x10000000, 0x3FF0016C, 0xC225D8C1, 0x3E067D54, + 0x10000000, 0x3FF00170, 0x05C4630F, 0x3E210FD8, + 0x10000000, 0x3FF00174, 0xBB206115, 0x3E2CA05D, + 0x10000000, 0x3FF00178, 0x2C4F14A6, 0x3E342873, + 0x10000000, 0x3FF0017C, 0xF31F3B5E, 0x3E3A10B8, + 0x14000000, 0x3FF00180, 0xC9FEFCC9, 0xBE3FF6FF, + 0x14000000, 0x3FF00184, 0x070B344A, 0xBE39EEB7, + 0x14000000, 0x3FF00188, 0xC0050AA2, 0xBE33D66C, + 0x14000000, 0x3FF0018C, 0xE1D83C97, 0xBE2B5C41, + 0x14000000, 0x3FF00190, 0x57003305, 0xBE1DD74E, + 0x14000000, 0x3FF00194, 0xA80727F1, 0xBDF2D84A, + 0x14000000, 0x3FF00198, 0x534C5401, 0x3E14AB2F, + 0x14000000, 0x3FF0019C, 0xD875DE83, 0x3E27263B, + 0x14000000, 0x3FF001A0, 0x9FB782CA, 0x3E320B71, + 0x14000000, 0x3FF001A4, 0xF349371F, 0x3E3893C6, + 0x14000000, 0x3FF001A8, 0xEAF074C6, 0x3E3F2C1D, + 0x18000000, 0x3FF001AC, 0x75525ABC, 0xBE3A2B89, + 0x18000000, 0x3FF001B0, 0x297ECCE2, 0xBE33732F, + 0x18000000, 0x3FF001B4, 0x5B28EC49, 0xBE2955A6, + 0x18000000, 0x3FF001B8, 0xF64BA7FD, 0xBE1749D5, + 0x18000000, 0x3FF001BC, 0xA8645141, 0x3DF15E9E, + 0x18000000, 0x3FF001C0, 0x1D6F0B37, 0x3E201C96, + 0x18000000, 0x3FF001C4, 0xE6028E39, 0x3E2E2D5B, + 0x18000000, 0x3FF001C8, 0x9B63FA1E, 0x3E362F12, + 0x18000000, 0x3FF001CC, 0x0BE01026, 0x3E3D5779, + 0x1C000000, 0x3FF001D0, 0xB78A0445, 0xBE3B701E, + 0x1C000000, 0x3FF001D4, 0xAAD9CF9D, 0xBE3427B4, + 0x1C000000, 0x3FF001D8, 0x941DBAB5, 0xBE299E91, + 0x1C000000, 0x3FF001DC, 0x44A2DFDD, 0xBE159B6C, + 0x1C000000, 0x3FF001E0, 0x1EC8B89C, 0x3E008CA4, + 0x1C000000, 0x3FF001E4, 0xF1EE0E9A, 0x3E23340B, + 0x1C000000, 0x3FF001E8, 0x5231913C, 0x3E313279, + 0x1C000000, 0x3FF001EC, 0x93892E68, 0x3E38DAEE, + 0x20000000, 0x3FF001F0, 0x3F01A6A8, 0xBE3F6C9A, + 0x20000000, 0x3FF001F4, 0x216E726C, 0xBE37A421, + 0x20000000, 0x3FF001F8, 0x1F7970B9, 0xBE2F974C, + 0x20000000, 0x3FF001FC, 0x17AFEBC8, 0xBE1F8CA4, + 0x20000000, 0x3FF00200, 0x04445B06, 0x3DB55600, + 0x20000000, 0x3FF00204, 0x0C290A26, 0x3E203BAE, + 0x20000000, 0x3FF00208, 0x104547BD, 0x3E30365A, + 0x20000000, 0x3FF0020C, 0x22970DE3, 0x3E385EDF, + 0x24000000, 0x3FF00210, 0xBEF5A5F4, 0xBE3F6899, + 0x24000000, 0x3FF00214, 0x90605040, 0xBE372010, + 0x24000000, 0x3FF00218, 0x9B50D8EE, 0xBE2D8F0A, + 0x24000000, 0x3FF0021C, 0xCB35D444, 0xBE197BDF, + 0x24000000, 0x3FF00220, 0x2188E3D5, 0x3E00CCBC, + 0x24000000, 0x3FF00224, 0x36A79F6A, 0x3E254452, + 0x24000000, 0x3FF00228, 0xD69B2D28, 0x3E333ABC, + 0x24000000, 0x3FF0022C, 0xBA07BE5B, 0x3E3BE352, + 0x28000000, 0x3FF00230, 0x3665F227, 0xBE3B6415, + 0x28000000, 0x3FF00234, 0xF6AD58D5, 0xBE329B7A, + 0x28000000, 0x3FF00238, 0x059BD24A, 0xBE2385BD, + 0x28000000, 0x3FF0023C, 0xD8E2B1B4, 0xBDEB47FA, + 0x28000000, 0x3FF00240, 0x22CF60F6, 0x3E203CC2, + 0x28000000, 0x3FF00244, 0x39BEF87F, 0x3E312704, + 0x28000000, 0x3FF00248, 0xA63F5309, 0x3E3A3FA9, + 0x2C000000, 0x3FF0024C, 0xA516AE5E, 0xBE3C97AE, + 0x2C000000, 0x3FF00250, 0xA442792A, 0xBE335F04, + 0x2C000000, 0x3FF00254, 0xA686F3A2, 0xBE242CB0, + 0x2C000000, 0x3FF00258, 0xC3237903, 0xBDE7B535, + 0x2C000000, 0x3FF0025C, 0x9E7A6CF7, 0x3E21560E, + 0x2C000000, 0x3FF00260, 0xA8C01385, 0x3E3223BA, + 0x2C000000, 0x3FF00264, 0x627012DF, 0x3E3BAC70, + 0x30000000, 0x3FF00268, 0x7FB232EA, 0xBE3ABAD7, + 0x30000000, 0x3FF0026C, 0xF9A6244B, 0xBE31121C, + 0x30000000, 0x3FF00270, 0x1DAC9AE4, 0xBE1D6580, + 0x30000000, 0x3FF00274, 0xD7FB0AC3, 0x3E037AFA, + 0x30000000, 0x3FF00278, 0x633420EB, 0x3E289042, + 0x30000000, 0x3FF0027C, 0x8065842A, 0x3E3630E5, + 0x34000000, 0x3FF00280, 0xB49DA4FF, 0xBE3FD653, + 0x34000000, 0x3FF00284, 0x696ECB76, 0xBE35CD8A, + 0x34000000, 0x3FF00288, 0x341A9D63, 0xBE27697D, + 0x34000000, 0x3FF0028C, 0x2788D238, 0xBDF8BF04, + 0x34000000, 0x3FF00290, 0x42A03782, 0x3E2159C1, + 0x34000000, 0x3FF00294, 0x154D4F89, 0x3E32F5B4, + 0x34000000, 0x3FF00298, 0x1D7FB2C1, 0x3E3D4E8A, + 0x38000000, 0x3FF0029C, 0x42181508, 0xBE38489D, + 0x38000000, 0x3FF002A0, 0x0AF2C28C, 0xBE2B9F84, + 0x38000000, 0x3FF002A4, 0x451C5357, 0xBE0A3721, + 0x38000000, 0x3FF002A8, 0x61A8605E, 0x3E1D47F1, + 0x38000000, 0x3FF002AC, 0x81B02FCF, 0x3E31FADF, + 0x38000000, 0x3FF002B0, 0x572F674A, 0x3E3CB3C5, + 0x3C000000, 0x3FF002B4, 0x231795EA, 0xBE388352, + 0x3C000000, 0x3FF002B8, 0xD248367A, 0xBE2B54CD, + 0x3C000000, 0x3FF002BC, 0xB7ABD90D, 0xBE060BC7, + 0x3C000000, 0x3FF002C0, 0x6EE9F1EF, 0x3E206EEF, + 0x3C000000, 0x3FF002C4, 0x261BF09E, 0x3E33406B, + 0x3C000000, 0x3FF002C8, 0x59001C60, 0x3E3E5961, + 0x40000000, 0x3FF002CC, 0xABDDD232, 0xBE367DA5, + 0x40000000, 0x3FF002D0, 0xC8FA5113, 0xBE268953, + 0x40000000, 0x3FF002D4, 0x8B33A701, 0x3D9152CC, + 0x40000000, 0x3FF002D8, 0x3E058570, 0x3E26BAAC, + 0x40000000, 0x3FF002DC, 0x63236E71, 0x3E36C65A, + 0x44000000, 0x3FF002E0, 0x7C7A795C, 0xBE3DC09E, + 0x44000000, 0x3FF002E4, 0x7BD63D1D, 0xBE323794, + 0x44000000, 0x3FF002E8, 0x5BBC9105, 0xBE1A7A1E, + 0x44000000, 0x3FF002EC, 0xD8EE2B1B, 0x3E142A20, + 0x44000000, 0x3FF002F0, 0xEFAA8A8D, 0x3E30C39A, + 0x44000000, 0x3FF002F4, 0x995E96A2, 0x3E3C8CB0, + 0x48000000, 0x3FF002F8, 0xC8A79469, 0xBE379A36, + 0x48000000, 0x3FF002FC, 0x64CE7203, 0xBE276236, + 0x48000000, 0x3FF00300, 0x0819DA68, 0x3DD200D8, + 0x48000000, 0x3FF00304, 0xE5E018D4, 0x3E28A249, + 0x48000000, 0x3FF00308, 0x8A087692, 0x3E386A49, + 0x4C000000, 0x3FF0030C, 0xD695988B, 0xBE3B6C8E, + 0x4C000000, 0x3FF00310, 0x55D2BCBA, 0xBE2E66C8, + 0x4C000000, 0x3FF00314, 0x7790BA7A, 0xBE0751B3, + 0x4C000000, 0x3FF00318, 0xC2A20261, 0x3E22DDF4, + 0x4C000000, 0x3FF0031C, 0x49E0B0B5, 0x3E35D82E, + 0x50000000, 0x3FF00320, 0xB142422E, 0xBE3DAE9A, + 0x50000000, 0x3FF00324, 0x8C170FE6, 0xBE312560, + 0x50000000, 0x3FF00328, 0x0A73BF77, 0xBE12308D, + 0x50000000, 0x3FF0032C, 0x5E59CEFA, 0x3E203A3A, + 0x50000000, 0x3FF00330, 0xCD4740BF, 0x3E34D660, + 0x54000000, 0x3FF00334, 0x644D1883, 0xBE3E6058, + 0x54000000, 0x3FF00338, 0x618F57B6, 0xBE31870E, + 0x54000000, 0x3FF0033C, 0x99FABD0F, 0xBE127704, + 0x54000000, 0x3FF00340, 0xA1CB5ECF, 0x3E20B71E, + 0x54000000, 0x3FF00344, 0x089E93E1, 0x3E3564E3, + 0x58000000, 0x3FF00348, 0xFB533142, 0xBE3D81C5, + 0x58000000, 0x3FF0034C, 0xB6EECE6C, 0xBE30586B, + 0x58000000, 0x3FF00350, 0x319B883E, 0xBE08F871, + 0x58000000, 0x3FF00354, 0x75BF7503, 0x3E2454A5, + 0x58000000, 0x3FF00358, 0xF04B88C5, 0x3E3783B6, + 0x5C000000, 0x3FF0035C, 0x81EF30A7, 0xBE3B12E1, + 0x5C000000, 0x3FF00360, 0x2F9F3657, 0xBE2B32ED, + 0x5C000000, 0x3FF00364, 0x54DF31BC, 0xBDB0084D, + 0x5C000000, 0x3FF00368, 0xC303B7B9, 0x3E2B12D2, + 0x5C000000, 0x3FF0036C, 0x78B56F97, 0x3E3B32DE, + 0x60000000, 0x3FF00370, 0x03B9496C, 0xBE3713A9, + 0x60000000, 0x3FF00374, 0x1F92E726, 0xBE22945A, + 0x60000000, 0x3FF00378, 0x621736DF, 0x3E123D49, + 0x60000000, 0x3FF0037C, 0x3935580D, 0x3E3278D5, + 0x64000000, 0x3FF00380, 0x69B9F5FB, 0xBE3F8DA4, + 0x64000000, 0x3FF00384, 0x8C473CC8, 0xBE31841A, + 0x64000000, 0x3FF00388, 0x538CDE07, 0xBE0B5469, + 0x64000000, 0x3FF0038C, 0x7F8F9D65, 0x3E257E07, + 0x64000000, 0x3FF00390, 0x3665E52B, 0x3E38F898, + 0x68000000, 0x3FF00394, 0xC29674BD, 0xBE38BDCF, + 0x68000000, 0x3FF00398, 0x4E58B4D9, 0xBE24C868, + 0x68000000, 0x3FF0039C, 0x329466D7, 0x3E1015AC, + 0x68000000, 0x3FF003A0, 0xDCDECE44, 0x3E327F0D, + 0x6C000000, 0x3FF003A4, 0xB27E5528, 0xBE3EF74B, + 0x6C000000, 0x3FF003A8, 0x9D7167F2, 0xBE305DA1, + 0x6C000000, 0x3FF003AC, 0xFF980820, 0xBDFB3F3D, + 0x6C000000, 0x3FF003B0, 0x13D49789, 0x3E2A0B7B, + 0x6C000000, 0x3FF003B4, 0xA43AE87C, 0x3E3BCF72, + 0x70000000, 0x3FF003B8, 0x8D06BDC0, 0xBE3556D4, + 0x70000000, 0x3FF003BC, 0x1766E54D, 0xBE19B460, + 0x70000000, 0x3FF003C0, 0x7B85C8BA, 0x3E211950, + 0x70000000, 0x3FF003C4, 0x41D00AED, 0x3E37966C, + 0x74000000, 0x3FF003C8, 0xF5B15507, 0xBE394FCB, + 0x74000000, 0x3FF003CC, 0xC98093C4, 0xBE244C00, + 0x74000000, 0x3FF003D0, 0xE2907BDF, 0x3E144F3B, + 0x74000000, 0x3FF003D4, 0x267CD924, 0x3E345DA2, + 0x78000000, 0x3FF003D8, 0xD73526C0, 0xBE3C4886, + 0x78000000, 0x3FF003DC, 0xF8E1D62E, 0xBE29BD57, + 0x78000000, 0x3FF003E0, 0xD65415E1, 0x3E04D995, + 0x78000000, 0x3FF003E4, 0x527E1A58, 0x3E322515, + 0x7C000000, 0x3FF003E8, 0x31552BA5, 0xBE3E4104, + 0x7C000000, 0x3FF003EC, 0x995CAB3B, 0xBE2D2E33, + 0x7C000000, 0x3FF003F0, 0x473970DC, 0x3DF22D48, + 0x7C000000, 0x3FF003F4, 0xC61195FC, 0x3E30ECC6, + 0x80000000, 0x3FF003F8, 0x03D35C34, 0xBE3F3943, + 0x80000000, 0x3FF003FC, 0xAA7483C7, 0xBE2E9E91, + 0x80000000, 0x3FF00400, 0xBBBC71CE, 0x3DE556AA, + 0x80000000, 0x3FF00404, 0x817613C1, 0x3E30B4B7, + 0x84000000, 0x3FF00408, 0x4E70B0AC, 0xBE3F3142, + 0x84000000, 0x3FF0040C, 0x2BAAD02F, 0xBE2E0E70, + 0x84000000, 0x3FF00410, 0xF48F01F2, 0x3DF32D62, + 0x84000000, 0x3FF00414, 0x84EB5B98, 0x3E317CE8, + 0x88000000, 0x3FF00418, 0x10ED210B, 0xBE3E2901, + 0x88000000, 0x3FF0041C, 0x1C7F0051, 0xBE2B7DCD, + 0x88000000, 0x3FF00420, 0x87AA2706, 0x3E05D9C0, + 0x88000000, 0x3FF00424, 0xD0B235B3, 0x3E33455A, + 0x8C000000, 0x3FF00428, 0x4B07A510, 0xBE3C207E, + 0x8C000000, 0x3FF0042C, 0x7C6E838B, 0xBE26ECA6, + 0x8C000000, 0x3FF00430, 0xEC91A8D5, 0x3E150F6F, + 0x8C000000, 0x3FF00434, 0x650C6A83, 0x3E360E0F, + 0x90000000, 0x3FF00438, 0xFC7E3439, 0xBE3917B8, + 0x90000000, 0x3FF0043C, 0x4AF4C8B6, 0xBE205AFA, + 0x90000000, 0x3FF00440, 0xDC31D181, 0x3E219985, + 0x90000000, 0x3FF00444, 0x423CC2BE, 0x3E39D707, + 0x94000000, 0x3FF00448, 0x250DC5BF, 0xBE350EB0, + 0x94000000, 0x3FF0044C, 0x1E2CF893, 0xBE0F231A, + 0x94000000, 0x3FF00450, 0xD42C92D4, 0x3E2AABDB, + 0x94000000, 0x3FF00454, 0x6887075B, 0x3E3EA043, + 0x98000000, 0x3FF00458, 0xC472509B, 0xBE300562, + 0x98000000, 0x3FF0045C, 0x72B572E0, 0x3DF64FB6, + 0x98000000, 0x3FF00460, 0xEF61155C, 0x3E32DF5D, + 0x9C000000, 0x3FF00464, 0x27CFFE6A, 0xBE3B963B, + 0x9C000000, 0x3FF00468, 0xB4CD96FE, 0xBE23F79F, + 0x9C000000, 0x3FF0046C, 0x6E771F13, 0x3E1EBA7F, + 0x9C000000, 0x3FF00470, 0xFE3ED608, 0x3E396913, + 0xA0000000, 0x3FF00474, 0x6E82850F, 0xBE34CC73, + 0xA0000000, 0x3FF00478, 0x352966B7, 0xBE078FB3, + 0xA0000000, 0x3FF0047C, 0x33AFF8AE, 0x3E2DF116, + 0xA4000000, 0x3FF00480, 0xE909EADD, 0xBE3F0CEE, + 0xA4000000, 0x3FF00484, 0xD6938597, 0xBE2A04C8, + 0xA4000000, 0x3FF00488, 0x5C6654D8, 0x3E1460AA, + 0xA4000000, 0x3FF0048C, 0x22213ECF, 0x3E3742BE, + 0xA8000000, 0x3FF00490, 0xC631A356, 0xBE3682A9, + 0xA8000000, 0x3FF00494, 0x7777B644, 0xBE10E034, + 0xA8000000, 0x3FF00498, 0x3E3B0991, 0x3E2C4528, + 0xAC000000, 0x3FF0049C, 0x0B3E269F, 0xBE3F72C6, + 0xAC000000, 0x3FF004A0, 0x31DF923B, 0xBE29F037, + 0xAC000000, 0x3FF004A4, 0xE82713DE, 0x3E164A4D, + 0xAC000000, 0x3FF004A8, 0x31AFAC4B, 0x3E382D47, + 0xB0000000, 0x3FF004AC, 0x6DFCE978, 0xBE352800, + 0xB0000000, 0x3FF004B0, 0x07D68D27, 0xBE036A1B, + 0xB0000000, 0x3FF004B4, 0x5CB71F6F, 0x3E305D7E, + 0xB4000000, 0x3FF004B8, 0x30E5E990, 0xBE3CC7BB, + 0xB4000000, 0x3FF004BC, 0x0BA17DEA, 0xBE23B9E0, + 0xB4000000, 0x3FF004C0, 0xC3EF9BD8, 0x3E223BBF, + 0xB4000000, 0x3FF004C4, 0x8A74ECC0, 0x3E3C28B4, + 0xB8000000, 0x3FF004C8, 0x085831CA, 0xBE30BC72, + 0xB8000000, 0x3FF004CC, 0x6C8D1FC8, 0x3E037361, + 0xB8000000, 0x3FF004D0, 0x3033A0B8, 0x3E35A94F, + 0xBC000000, 0x3FF004D4, 0xFC7107DE, 0xBE370BC8, + 0xBC000000, 0x3FF004D8, 0xA2D908DA, 0xBE0D86E2, + 0xBC000000, 0x3FF004DC, 0x58ED155E, 0x3E2F742A, + 0xC0000000, 0x3FF004E0, 0x75FACDD0, 0xBE3CCAF4, + 0xC0000000, 0x3FF004E4, 0x6F5BE5D3, 0xBE227FF2, + 0xC0000000, 0x3FF004E8, 0xD6BCA827, 0x3E24B60D, + 0xC0000000, 0x3FF004EC, 0xF72B40D6, 0x3E3E060B, + 0xC4000000, 0x3FF004F0, 0x208BE3E3, 0xBE2C7DD4, + 0xC4000000, 0x3FF004F4, 0x642FDDB8, 0x3E163093, + 0xC4000000, 0x3FF004F8, 0xB72239A5, 0x3E396738, + 0xC8000000, 0x3FF004FC, 0x7201ED9B, 0xBE32ADAE, + 0xC8000000, 0x3FF00500, 0x1A0C05F3, 0x3DF4D6F6, + 0xC8000000, 0x3FF00504, 0x360B8346, 0x3E355892, + 0xCC000000, 0x3FF00508, 0xF0C06435, 0xBE368C45, + 0xCC000000, 0x3FF0050C, 0x760DA2F6, 0xBE0308C8, + 0xCC000000, 0x3FF00510, 0xE008D57B, 0x3E31DA18, + 0xD0000000, 0x3FF00514, 0x205F82F4, 0xBE39DAB0, + 0xD0000000, 0x3FF00518, 0x2FE5E3E3, 0xBE15FDD0, + 0xD0000000, 0x3FF0051C, 0x42787241, 0x3E2DD79A, + 0xD4000000, 0x3FF00520, 0x94BD25F4, 0xBE3C98EC, + 0xD4000000, 0x3FF00524, 0x53C89D03, 0xBE201B42, + 0xD4000000, 0x3FF00528, 0xCB901057, 0x3E291B5E, + 0xD8000000, 0x3FF0052C, 0xE1B6D837, 0xBE3EC6FA, + 0xD8000000, 0x3FF00530, 0xF8BF49E7, 0xBE24173F, + 0xD8000000, 0x3FF00534, 0x339DDB57, 0x3E257F80, + 0xD8000000, 0x3FF00538, 0x64D62C5C, 0x3E3F9B25, + 0xDC000000, 0x3FF0053C, 0x2E913659, 0xBE26F2E0, + 0xDC000000, 0x3FF00540, 0x52E7CB93, 0x3E2303FF, + 0xDC000000, 0x3FF00544, 0xAB0CFEF5, 0x3E3E8D74, + 0xE0000000, 0x3FF00548, 0x1CF7FDE6, 0xBE28AE22, + 0xE0000000, 0x3FF0054C, 0x01B47B93, 0x3E21A8DD, + 0xE0000000, 0x3FF00550, 0x5D1107E2, 0x3E3E0FF3, + 0xE4000000, 0x3FF00554, 0xEBAC99E1, 0xBE294904, + 0xE4000000, 0x3FF00558, 0x184B2814, 0x3E216E1A, + 0xE4000000, 0x3FF0055C, 0xE706008B, 0x3E3E22A1, + 0xE8000000, 0x3FF00560, 0xC267616A, 0xBE28C387, + 0xE8000000, 0x3FF00564, 0x6EF3B008, 0x3E2253B7, + 0xE8000000, 0x3FF00568, 0xB50FF371, 0x3E3EC580, + 0xEC000000, 0x3FF0056C, 0xC8E0096B, 0xBE271DA9, + 0xEC000000, 0x3FF00570, 0xDDF69498, 0x3E2459B5, + 0xEC000000, 0x3FF00574, 0x33533C31, 0x3E3FF890, + 0xF0000000, 0x3FF00578, 0x26CDA497, 0xBE24576A, + 0xF0000000, 0x3FF0057C, 0x3D9CF923, 0x3E278016, + 0xF4000000, 0x3FF00580, 0x320B787B, 0xBE3E442F, + 0xF4000000, 0x3FF00584, 0x03E6A36B, 0xBE2070C8, + 0xF4000000, 0x3FF00588, 0x6630A33F, 0x3E2BC6D9, + 0xF8000000, 0x3FF0058C, 0x0EE72CBF, 0xBE3BF0BD, + 0xF8000000, 0x3FF00590, 0x0FC1A853, 0xBE16D385, + 0xF8000000, 0x3FF00594, 0x17FDFD5D, 0x3E309700, + 0xFC000000, 0x3FF00598, 0xF71A91AC, 0xBE390D18, + 0xFC000000, 0x3FF0059C, 0x69C58B86, 0xBE050963, + 0xFC000000, 0x3FF005A0, 0xB9A504CD, 0x3E33DAC5, + 0x00000000, 0x3FF005A5, 0x7E800734, 0xBE359942, + 0x00000000, 0x3FF005A9, 0xE59934CD, 0x3DF02BAE, + 0x00000000, 0x3FF005AD, 0x04333E0E, 0x3E37AEBE, + 0x04000000, 0x3FF005B1, 0x38F19C2F, 0xBE319539, + 0x04000000, 0x3FF005B5, 0xEBB1C157, 0x3E14DB54, + 0x04000000, 0x3FF005B9, 0x63CED05D, 0x3E3C12E9, + 0x08000000, 0x3FF005BD, 0x74921CAF, 0xBE2A01F9, + 0x08000000, 0x3FF005C1, 0xC94C85F2, 0x3E23F645, + 0x0C000000, 0x3FF005C5, 0xBB61CBEE, 0xBE3EF8B7, + 0x0C000000, 0x3FF005C9, 0x597F2931, 0xBE1F7232, + 0x0C000000, 0x3FF005CD, 0xAF5B7345, 0x3E2E9F48, + 0x10000000, 0x3FF005D1, 0xED37CD5F, 0xBE397424, + 0x10000000, 0x3FF005D5, 0x08775C6B, 0xBE013F43, + 0x10000000, 0x3FF005D9, 0x0029D3DB, 0x3E35345A, + 0x14000000, 0x3FF005DD, 0xC58C1962, 0xBE335F5D, + 0x14000000, 0x3FF005E1, 0x47430E04, 0x3E1073C1, + 0x14000000, 0x3FF005E5, 0x4A41E248, 0x3E3BA944, + 0x18000000, 0x3FF005E9, 0xB06E888E, 0xBE2974C3, + 0x18000000, 0x3FF005ED, 0xDCCD9333, 0x3E25E3FB, + 0x1C000000, 0x3FF005F1, 0x5DE27951, 0xBE3D519C, + 0x1C000000, 0x3FF005F5, 0xE4464502, 0xBE1614C2, + 0x1C000000, 0x3FF005F9, 0xE0DAFE93, 0x3E325740, + 0x20000000, 0x3FF005FD, 0x8C1B4C10, 0xBE35BC47, + 0x20000000, 0x3FF00601, 0x20686CE9, 0x3E0201B0, + 0x20000000, 0x3FF00605, 0x95558B63, 0x3E3A4CB9, + 0x24000000, 0x3FF00609, 0xA880A3EB, 0xBE2B2D79, + 0x24000000, 0x3FF0060D, 0x9699EEB7, 0x3E252BA5, + 0x28000000, 0x3FF00611, 0x880115E1, 0xBE3D2D97, + 0x28000000, 0x3FF00615, 0x28A3D788, 0xBE1383EF, + 0x28000000, 0x3FF00619, 0x08D6DC23, 0x3E337BA6, + 0x2C000000, 0x3FF0061D, 0x0B001A08, 0xBE3417B2, + 0x2C000000, 0x3FF00621, 0xF94EB99A, 0x3E1193EF, + 0x2C000000, 0x3FF00625, 0x28D3BD3B, 0x3E3CF1B0, + 0x30000000, 0x3FF00629, 0x0EFCC982, 0xBE24E32B, + 0x30000000, 0x3FF0062D, 0xE2BDA47F, 0x3E2C7655, + 0x34000000, 0x3FF00631, 0x689312F8, 0xBE39080E, + 0x34000000, 0x3FF00635, 0xA9444DB4, 0xBDCDA0C8, + 0x34000000, 0x3FF00639, 0x7B21FE23, 0x3E38A191, + 0x38000000, 0x3FF0063D, 0x7E67E1E1, 0xBE2CE32A, + 0x38000000, 0x3FF00641, 0x875A71F0, 0x3E251694, + 0x3C000000, 0x3FF00645, 0xF838F455, 0xBE3C67CF, + 0x3C000000, 0x3FF00649, 0x77274052, 0xBE0A571F, + 0x3C000000, 0x3FF0064D, 0x63AAEFA8, 0x3E35E20E, + 0x40000000, 0x3FF00651, 0xFC87DA70, 0xBE30E0F8, + 0x40000000, 0x3FF00655, 0xE9089AFD, 0x3E20D80B, + 0x44000000, 0x3FF00659, 0xC52F03BD, 0xBE3E36F4, + 0x44000000, 0x3FF0065D, 0x9680E14E, 0xBE1327A4, + 0x44000000, 0x3FF00661, 0xD732468D, 0x3E34B328, + 0x48000000, 0x3FF00665, 0xCAB5EF4A, 0xBE31BFBE, + 0x48000000, 0x3FF00669, 0xE2A2FBE1, 0x3E1F757F, + 0x4C000000, 0x3FF0066D, 0xDAB014DA, 0xBE3E757A, + 0x4C000000, 0x3FF00671, 0x02FB3FBB, 0xBE12E13D, + 0x4C000000, 0x3FF00675, 0xCA7E298D, 0x3E3514E2, + 0x50000000, 0x3FF00679, 0xB4F78B94, 0xBE310DE4, + 0x50000000, 0x3FF0067D, 0x89C35D05, 0x3E21BEB4, + 0x54000000, 0x3FF00681, 0x43F4895C, 0xBE3D2360, + 0x54000000, 0x3FF00685, 0x5BC49ADF, 0xBE08B0A2, + 0x54000000, 0x3FF00689, 0x32573159, 0x3E37073E, + 0x58000000, 0x3FF0068D, 0x8D0732D2, 0xBE2D96D1, + 0x58000000, 0x3FF00691, 0x9BF15E67, 0x3E26E3ED, + 0x5C000000, 0x3FF00695, 0x0C3250FB, 0xBE3A40A3, + 0x5C000000, 0x3FF00699, 0xFD0AE214, 0x3DBCC9AE, + 0x5C000000, 0x3FF0069D, 0x038868A1, 0x3E3A8A3D, + 0x60000000, 0x3FF006A1, 0x151D21CE, 0xBE25F092, + 0x60000000, 0x3FF006A5, 0x11738C43, 0x3E2F2A6F, + 0x64000000, 0x3FF006A9, 0x3E9CE96D, 0xBE35CD41, + 0x64000000, 0x3FF006AD, 0x8DBC2918, 0x3E138132, + 0x64000000, 0x3FF006B1, 0x32DF4C13, 0x3E3F9DE1, + 0x68000000, 0x3FF006B5, 0x3129E0B2, 0xBE16520E, + 0x68000000, 0x3FF006B9, 0x69F36A61, 0x3E35491E, + 0x6C000000, 0x3FF006BD, 0xCCCABCD4, 0xBE2F9271, + 0x6C000000, 0x3FF006C1, 0x0D59B899, 0x3E2668ED, + 0x70000000, 0x3FF006C5, 0x4AD435A0, 0xBE39BDD3, + 0x70000000, 0x3FF006C9, 0x9191CABB, 0x3DF5FE9A, + 0x70000000, 0x3FF006CD, 0x6676850B, 0x3E3C8DAD, + 0x74000000, 0x3FF006D1, 0x1D74934A, 0xBE206910, + 0x74000000, 0x3FF006D5, 0x4D886478, 0x3E331949, + 0x78000000, 0x3FF006D9, 0x80BFBBC2, 0xBE3188DE, + 0x78000000, 0x3FF006DD, 0x14DE1719, 0x3E23CA01, + 0x7C000000, 0x3FF006E1, 0x8CE98EC0, 0xBE3A9D19, + 0x7C000000, 0x3FF006E5, 0xA705A6E7, 0x3DEE1A67, + 0x7C000000, 0x3FF006E9, 0xECD5F851, 0x3E3C8EC6, + 0x80000000, 0x3FF006ED, 0xE839CE4D, 0xBE1F0CF9, + 0x80000000, 0x3FF006F1, 0x0C8CA46A, 0x3E33FAC3, + 0x84000000, 0x3FF006F5, 0x7B5703D8, 0xBE303734, + 0x84000000, 0x3FF006F9, 0xE490A112, 0x3E274DB5, + 0x88000000, 0x3FF006FD, 0xA693A093, 0xBE386B0E, + 0x88000000, 0x3FF00701, 0xF0B73DAA, 0x3E0C9875, + 0x88000000, 0x3FF00705, 0x2449A944, 0x3E3FA133, + 0x8C000000, 0x3FF00709, 0xBFE66C14, 0xBE110285, + 0x8C000000, 0x3FF0070D, 0x054EDCBD, 0x3E37ED91, + 0x90000000, 0x3FF00711, 0xEFB65924, 0xBE27A86A, + 0x90000000, 0x3FF00715, 0x1C8A0CF1, 0x3E307A0B, + 0x94000000, 0x3FF00719, 0x397FB1D6, 0xBE3327AD, + 0x94000000, 0x3FF0071D, 0x1412B9FB, 0x3E228D43, + 0x98000000, 0x3FF00721, 0x94D8FFB0, 0xBE3A3B08, + 0x98000000, 0x3FF00725, 0x6ED80040, 0x3E029AA3, + 0x98000000, 0x3FF00729, 0x9627250A, 0x3E3EF1B8, + 0x9C000000, 0x3FF0072D, 0x5FCB1B09, 0xBE117F70, + 0x9C000000, 0x3FF00731, 0x678F0789, 0x3E385E96, + 0xA0000000, 0x3FF00735, 0xCEA3485B, 0xBE25A5DF, + 0xA0000000, 0x3FF00739, 0xFF6D0303, 0x3E320B90, + 0xA4000000, 0x3FF0073D, 0xE03334FF, 0xBE3105E6, + 0xA4000000, 0x3FF00741, 0xFB9F056D, 0x3E27F150, + 0xA8000000, 0x3FF00745, 0xE28905F4, 0xBE36F8C0, + 0xA8000000, 0x3FF00749, 0x0B1407AA, 0x3E189774, + 0xAC000000, 0x3FF0074D, 0xCE4493C4, 0xBE3CAB7D, + 0xAC000000, 0x3FF00751, 0xCB817D78, 0x3DE265D5, + 0xAC000000, 0x3FF00755, 0x7CA8B4E3, 0x3E3DE1E2, + 0xB0000000, 0x3FF00759, 0x7D730FC6, 0xBE12FD89, + 0xB0000000, 0x3FF0075D, 0x1E4D7759, 0x3E38AF60, + 0xB4000000, 0x3FF00761, 0x0CAD84A2, 0xBE23A3AC, + 0xB4000000, 0x3FF00765, 0x36B866FD, 0x3E33BCFB, + 0xB8000000, 0x3FF00769, 0x4D0667A1, 0xBE2D4858, + 0xB8000000, 0x3FF0076D, 0xCBF08E6A, 0x3E2E1567, + 0xBC000000, 0x3FF00771, 0x9FD34D05, 0xBE333664, + 0xBC000000, 0x3FF00775, 0x9837D6E0, 0x3E253114, + 0xC0000000, 0x3FF00779, 0x5238327D, 0xBE37887F, + 0xC0000000, 0x3FF0077D, 0x24C8DC90, 0x3E1999FA, + 0xC4000000, 0x3FF00781, 0x1DA2F8BE, 0xBE3B9A7C, + 0xC4000000, 0x3FF00785, 0xEA50EE6A, 0x3E03A485, + 0xC8000000, 0x3FF00789, 0xE204A449, 0xBE3F6C5A, + 0xC8000000, 0x3FF0078D, 0x78D5D0F3, 0xBDF3D3EF, + 0xC8000000, 0x3FF00791, 0x80B1D66C, 0x3E3D01E4, + 0xCC000000, 0x3FF00795, 0xD5149796, 0xBE12BBC1, + 0xCC000000, 0x3FF00799, 0x2A8F92F0, 0x3E39B042, + 0xD0000000, 0x3FF0079D, 0x6F386487, 0xBE1F820E, + 0xD0000000, 0x3FF007A1, 0x3BA3BCDA, 0x3E369EBE, + 0xD4000000, 0x3FF007A5, 0x96320652, 0xBE25A3F0, + 0xD4000000, 0x3FF007A9, 0xD3FD8FCA, 0x3E33CD58, + 0xD8000000, 0x3FF007AD, 0xC62D40B1, 0xBE2B069C, + 0xD8000000, 0x3FF007B1, 0x13AC5766, 0x3E313C12, + 0xDC000000, 0x3FF007B5, 0x876F3A0B, 0xBE2FE90B, + 0xDC000000, 0x3FF007B9, 0x357EDEB8, 0x3E2DD5D4, + 0xE0000000, 0x3FF007BD, 0x4CEC957E, 0xBE32259E, + 0xE0000000, 0x3FF007C1, 0x128C86C6, 0x3E29B3C2, + 0xE4000000, 0x3FF007C5, 0xDEA61608, 0xBE341697, + 0xE4000000, 0x3FF007C9, 0xFEA09E70, 0x3E2611ED, + 0xE8000000, 0x3FF007CD, 0x58D49AE3, 0xBE35C772, + 0xE8000000, 0x3FF007D1, 0x39DA3D42, 0x3E22F058, + 0xEC000000, 0x3FF007D5, 0x9B689043, 0xBE37382D, + 0xEC000000, 0x3FF007D9, 0x04589AD6, 0x3E204F01, + 0xF0000000, 0x3FF007DD, 0x86525259, 0xBE3868C9, + 0xF0000000, 0x3FF007E1, 0x3C761DAC, 0x3E1C5BD1, + 0xF4000000, 0x3FF007E5, 0xF9822D4C, 0xBE395945, + 0xF4000000, 0x3FF007E9, 0x8F4221F9, 0x3E191A1E, + 0xF8000000, 0x3FF007ED, 0xD4E85D3A, 0xBE3A09A2, + 0xF8000000, 0x3FF007F1, 0x81547225, 0x3E16D8EA, + 0xFC000000, 0x3FF007F5, 0xF8750E3B, 0xBE3A79DF, + 0xFC000000, 0x3FF007F9, 0x92EC7DE3, 0x3E159835, + 0x00000000, 0x3FF007FE, 0x44185C5D, 0xBE3AA9FD } }; + +#endif +#endif diff --git a/libgcc-math/dbl-64/ulog.h b/libgcc-math/dbl-64/ulog.h new file mode 100644 index 00000000000..0ba6b7bb531 --- /dev/null +++ b/libgcc-math/dbl-64/ulog.h @@ -0,0 +1,200 @@ +/* + * IBM Accurate Mathematical Library + * Written by International Business Machines Corp. + * Copyright (C) 2001 Free Software Foundation, Inc. + * + * This program is free software; you can redistribute it and/or modify + * it under the terms of the GNU Lesser General Public License as published by + * the Free Software Foundation; either version 2.1 of the License, or + * (at your option) any later version. + * + * This program is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU Lesser General Public License for more details. + * + * You should have received a copy of the GNU Lesser General Public License + * along with this program; if not, write to the Free Software + * Foundation, Inc., 59 Temple Place - Suite 330, Boston, MA 02111-1307, USA. + */ + +/******************************************************************/ +/* */ +/* MODULE_NAME:ulog.h */ +/* */ +/* common data and variables prototype and definition */ +/******************************************************************/ + +#ifndef ULOG_H +#define ULOG_H + +#ifdef BIG_ENDI + static const number + /* polynomial I */ +/**/ a2 = {{0xbfe00000, 0x0001aa8f} }, /* -0.500... */ +/**/ a3 = {{0x3fd55555, 0x55588d2e} }, /* 0.333... */ + /* polynomial II */ +/**/ b0 = {{0x3fd55555, 0x55555555} }, /* 0.333... */ +/**/ b1 = {{0xbfcfffff, 0xffffffbb} }, /* -0.249... */ +/**/ b2 = {{0x3fc99999, 0x9999992f} }, /* 0.199... */ +/**/ b3 = {{0xbfc55555, 0x556503fd} }, /* -0.166... */ +/**/ b4 = {{0x3fc24924, 0x925b3d62} }, /* 0.142... */ +/**/ b5 = {{0xbfbffffe, 0x160472fc} }, /* -0.124... */ +/**/ b6 = {{0x3fbc71c5, 0x25db58ac} }, /* 0.111... */ +/**/ b7 = {{0xbfb9a4ac, 0x11a2a61c} }, /* -0.100... */ +/**/ b8 = {{0x3fb75077, 0x0df2b591} }, /* 0.091... */ + /* polynomial III */ +#if 0 +/**/ c1 = {{0x3ff00000, 0x00000000} }, /* 1 */ +#endif +/**/ c2 = {{0xbfe00000, 0x00000000} }, /* -1/2 */ +/**/ c3 = {{0x3fd55555, 0x55555555} }, /* 1/3 */ +/**/ c4 = {{0xbfd00000, 0x00000000} }, /* -1/4 */ +/**/ c5 = {{0x3fc99999, 0x9999999a} }, /* 1/5 */ + /* polynomial IV */ +/**/ d2 = {{0xbfe00000, 0x00000000} }, /* -1/2 */ +/**/ dd2 = {{0x00000000, 0x00000000} }, /* -1/2-d2 */ +/**/ d3 = {{0x3fd55555, 0x55555555} }, /* 1/3 */ +/**/ dd3 = {{0x3c755555, 0x55555555} }, /* 1/3-d3 */ +/**/ d4 = {{0xbfd00000, 0x00000000} }, /* -1/4 */ +/**/ dd4 = {{0x00000000, 0x00000000} }, /* -1/4-d4 */ +/**/ d5 = {{0x3fc99999, 0x9999999a} }, /* 1/5 */ +/**/ dd5 = {{0xbc699999, 0x9999999a} }, /* 1/5-d5 */ +/**/ d6 = {{0xbfc55555, 0x55555555} }, /* -1/6 */ +/**/ dd6 = {{0xbc655555, 0x55555555} }, /* -1/6-d6 */ +/**/ d7 = {{0x3fc24924, 0x92492492} }, /* 1/7 */ +/**/ dd7 = {{0x3c624924, 0x92492492} }, /* 1/7-d7 */ +/**/ d8 = {{0xbfc00000, 0x00000000} }, /* -1/8 */ +/**/ dd8 = {{0x00000000, 0x00000000} }, /* -1/8-d8 */ +/**/ d9 = {{0x3fbc71c7, 0x1c71c71c} }, /* 1/9 */ +/**/ dd9 = {{0x3c5c71c7, 0x1c71c71c} }, /* 1/9-d9 */ +/**/ d10 = {{0xbfb99999, 0x9999999a} }, /* -1/10 */ +/**/ dd10 = {{0x3c599999, 0x9999999a} }, /* -1/10-d10 */ +/**/ d11 = {{0x3fb745d1, 0x745d1746} }, /* 1/11 */ +/**/ d12 = {{0xbfb55555, 0x55555555} }, /* -1/12 */ +/**/ d13 = {{0x3fb3b13b, 0x13b13b14} }, /* 1/13 */ +/**/ d14 = {{0xbfb24924, 0x92492492} }, /* -1/14 */ +/**/ d15 = {{0x3fb11111, 0x11111111} }, /* 1/15 */ +/**/ d16 = {{0xbfb00000, 0x00000000} }, /* -1/16 */ +/**/ d17 = {{0x3fae1e1e, 0x1e1e1e1e} }, /* 1/17 */ +/**/ d18 = {{0xbfac71c7, 0x1c71c71c} }, /* -1/18 */ +/**/ d19 = {{0x3faaf286, 0xbca1af28} }, /* 1/19 */ +/**/ d20 = {{0xbfa99999, 0x9999999a} }, /* -1/20 */ + /* constants */ +/**/ zero = {{0x00000000, 0x00000000} }, /* 0 */ +/**/ one = {{0x3ff00000, 0x00000000} }, /* 1 */ +/**/ half = {{0x3fe00000, 0x00000000} }, /* 1/2 */ +/**/ mhalf = {{0xbfe00000, 0x00000000} }, /* -1/2 */ +/**/ sqrt_2 = {{0x3ff6a09e, 0x667f3bcc} }, /* sqrt(2) */ +/**/ h1 = {{0x3fd2e000, 0x00000000} }, /* 151/2**9 */ +/**/ h2 = {{0x3f669000, 0x00000000} }, /* 361/2**17 */ +/**/ delu = {{0x3f700000, 0x00000000} }, /* 1/2**8 */ +/**/ delv = {{0x3ef00000, 0x00000000} }, /* 1/2**16 */ +/**/ ln2a = {{0x3fe62e42, 0xfefa3800} }, /* ln(2) 43 bits */ +/**/ ln2b = {{0x3d2ef357, 0x93c76730} }, /* ln(2)-ln2a */ +/**/ e1 = {{0x3bbcc868, 0x00000000} }, /* 6.095e-21 */ +/**/ e2 = {{0x3c1138ce, 0x00000000} }, /* 2.334e-19 */ +/**/ e3 = {{0x3aa1565d, 0x00000000} }, /* 2.801e-26 */ +/**/ e4 = {{0x39809d88, 0x00000000} }, /* 1.024e-31 */ +/**/ e[M] ={{{0x37da223a, 0x00000000} }, /* 1.2e-39 */ +/**/ {{0x35c851c4, 0x00000000} }, /* 1.3e-49 */ +/**/ {{0x2ab85e51, 0x00000000} }, /* 6.8e-103 */ +/**/ {{0x17383827, 0x00000000} }},/* 8.1e-197 */ +/**/ two54 = {{0x43500000, 0x00000000} }, /* 2**54 */ +/**/ u03 = {{0x3f9eb851, 0xeb851eb8} }; /* 0.03 */ + +#else +#ifdef LITTLE_ENDI + static const number + /* polynomial I */ +/**/ a2 = {{0x0001aa8f, 0xbfe00000} }, /* -0.500... */ +/**/ a3 = {{0x55588d2e, 0x3fd55555} }, /* 0.333... */ + /* polynomial II */ +/**/ b0 = {{0x55555555, 0x3fd55555} }, /* 0.333... */ +/**/ b1 = {{0xffffffbb, 0xbfcfffff} }, /* -0.249... */ +/**/ b2 = {{0x9999992f, 0x3fc99999} }, /* 0.199... */ +/**/ b3 = {{0x556503fd, 0xbfc55555} }, /* -0.166... */ +/**/ b4 = {{0x925b3d62, 0x3fc24924} }, /* 0.142... */ +/**/ b5 = {{0x160472fc, 0xbfbffffe} }, /* -0.124... */ +/**/ b6 = {{0x25db58ac, 0x3fbc71c5} }, /* 0.111... */ +/**/ b7 = {{0x11a2a61c, 0xbfb9a4ac} }, /* -0.100... */ +/**/ b8 = {{0x0df2b591, 0x3fb75077} }, /* 0.091... */ + /* polynomial III */ +#if 0 +/**/ c1 = {{0x00000000, 0x3ff00000} }, /* 1 */ +#endif +/**/ c2 = {{0x00000000, 0xbfe00000} }, /* -1/2 */ +/**/ c3 = {{0x55555555, 0x3fd55555} }, /* 1/3 */ +/**/ c4 = {{0x00000000, 0xbfd00000} }, /* -1/4 */ +/**/ c5 = {{0x9999999a, 0x3fc99999} }, /* 1/5 */ + /* polynomial IV */ +/**/ d2 = {{0x00000000, 0xbfe00000} }, /* -1/2 */ +/**/ dd2 = {{0x00000000, 0x00000000} }, /* -1/2-d2 */ +/**/ d3 = {{0x55555555, 0x3fd55555} }, /* 1/3 */ +/**/ dd3 = {{0x55555555, 0x3c755555} }, /* 1/3-d3 */ +/**/ d4 = {{0x00000000, 0xbfd00000} }, /* -1/4 */ +/**/ dd4 = {{0x00000000, 0x00000000} }, /* -1/4-d4 */ +/**/ d5 = {{0x9999999a, 0x3fc99999} }, /* 1/5 */ +/**/ dd5 = {{0x9999999a, 0xbc699999} }, /* 1/5-d5 */ +/**/ d6 = {{0x55555555, 0xbfc55555} }, /* -1/6 */ +/**/ dd6 = {{0x55555555, 0xbc655555} }, /* -1/6-d6 */ +/**/ d7 = {{0x92492492, 0x3fc24924} }, /* 1/7 */ +/**/ dd7 = {{0x92492492, 0x3c624924} }, /* 1/7-d7 */ +/**/ d8 = {{0x00000000, 0xbfc00000} }, /* -1/8 */ +/**/ dd8 = {{0x00000000, 0x00000000} }, /* -1/8-d8 */ +/**/ d9 = {{0x1c71c71c, 0x3fbc71c7} }, /* 1/9 */ +/**/ dd9 = {{0x1c71c71c, 0x3c5c71c7} }, /* 1/9-d9 */ +/**/ d10 = {{0x9999999a, 0xbfb99999} }, /* -1/10 */ +/**/ dd10 = {{0x9999999a, 0x3c599999} }, /* -1/10-d10 */ +/**/ d11 = {{0x745d1746, 0x3fb745d1} }, /* 1/11 */ +/**/ d12 = {{0x55555555, 0xbfb55555} }, /* -1/12 */ +/**/ d13 = {{0x13b13b14, 0x3fb3b13b} }, /* 1/13 */ +/**/ d14 = {{0x92492492, 0xbfb24924} }, /* -1/14 */ +/**/ d15 = {{0x11111111, 0x3fb11111} }, /* 1/15 */ +/**/ d16 = {{0x00000000, 0xbfb00000} }, /* -1/16 */ +/**/ d17 = {{0x1e1e1e1e, 0x3fae1e1e} }, /* 1/17 */ +/**/ d18 = {{0x1c71c71c, 0xbfac71c7} }, /* -1/18 */ +/**/ d19 = {{0xbca1af28, 0x3faaf286} }, /* 1/19 */ +/**/ d20 = {{0x9999999a, 0xbfa99999} }, /* -1/20 */ + /* constants */ +/**/ zero = {{0x00000000, 0x00000000} }, /* 0 */ +/**/ one = {{0x00000000, 0x3ff00000} }, /* 1 */ +/**/ half = {{0x00000000, 0x3fe00000} }, /* 1/2 */ +/**/ mhalf = {{0x00000000, 0xbfe00000} }, /* -1/2 */ +/**/ sqrt_2 = {{0x667f3bcc, 0x3ff6a09e} }, /* sqrt(2) */ +/**/ h1 = {{0x00000000, 0x3fd2e000} }, /* 151/2**9 */ +/**/ h2 = {{0x00000000, 0x3f669000} }, /* 361/2**17 */ +/**/ delu = {{0x00000000, 0x3f700000} }, /* 1/2**8 */ +/**/ delv = {{0x00000000, 0x3ef00000} }, /* 1/2**16 */ +/**/ ln2a = {{0xfefa3800, 0x3fe62e42} }, /* ln(2) 43 bits */ +/**/ ln2b = {{0x93c76730, 0x3d2ef357} }, /* ln(2)-ln2a */ +/**/ e1 = {{0x00000000, 0x3bbcc868} }, /* 6.095e-21 */ +/**/ e2 = {{0x00000000, 0x3c1138ce} }, /* 2.334e-19 */ +/**/ e3 = {{0x00000000, 0x3aa1565d} }, /* 2.801e-26 */ +/**/ e4 = {{0x00000000, 0x39809d88} }, /* 1.024e-31 */ +/**/ e[M] ={{{0x00000000, 0x37da223a} }, /* 1.2e-39 */ +/**/ {{0x00000000, 0x35c851c4} }, /* 1.3e-49 */ +/**/ {{0x00000000, 0x2ab85e51} }, /* 6.8e-103 */ +/**/ {{0x00000000, 0x17383827} }},/* 8.1e-197 */ +/**/ two54 = {{0x00000000, 0x43500000} }, /* 2**54 */ +/**/ u03 = {{0xeb851eb8, 0x3f9eb851} }; /* 0.03 */ + +#endif +#endif + +#define ZERO zero.d +#define ONE one.d +#define HALF half.d +#define MHALF mhalf.d +#define SQRT_2 sqrt_2.d +#define DEL_U delu.d +#define DEL_V delv.d +#define LN2A ln2a.d +#define LN2B ln2b.d +#define E1 e1.d +#define E2 e2.d +#define E3 e3.d +#define E4 e4.d +#define U03 u03.d + +#endif diff --git a/libgcc-math/dbl-64/ulog.tbl b/libgcc-math/dbl-64/ulog.tbl new file mode 100644 index 00000000000..41aed931fb4 --- /dev/null +++ b/libgcc-math/dbl-64/ulog.tbl @@ -0,0 +1,3327 @@ +/* + * IBM Accurate Mathematical Library + * Written by International Business Machines Corp. + * Copyright (C) 2001 Free Software Foundation, Inc. + * + * This program is free software; you can redistribute it and/or modify + * it under the terms of the GNU Lesser General Public License as published by + * the Free Software Foundation; either version 2.1 of the License, or + * (at your option) any later version. + * + * This program is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU Lesser General Public License for more details. + * + * You should have received a copy of the GNU Lesser General Public License + * along with this program; if not, write to the Free Software + * Foundation, Inc., 59 Temple Place - Suite 330, Boston, MA 02111-1307, USA. + */ + +/****************************************************************/ +/* TABLES FOR THE ulog() FUNCTION */ +/****************************************************************/ + +#ifdef BIG_ENDI + static const number + Iu[182] = { /* 1/ui */ +/**/ {{0x3ff6a13c, 0xd1537290} }, +/**/ {{0x3ff68168, 0x16816817} }, +/**/ {{0x3ff661ec, 0x6a5122f9} }, +/**/ {{0x3ff642c8, 0x590b2164} }, +/**/ {{0x3ff623fa, 0x77016240} }, +/**/ {{0x3ff60581, 0x60581606} }, +/**/ {{0x3ff5e75b, 0xb8d015e7} }, +/**/ {{0x3ff5c988, 0x2b931057} }, +/**/ {{0x3ff5ac05, 0x6b015ac0} }, +/**/ {{0x3ff58ed2, 0x308158ed} }, +/**/ {{0x3ff571ed, 0x3c506b3a} }, +/**/ {{0x3ff55555, 0x55555555} }, +/**/ {{0x3ff53909, 0x48f40feb} }, +/**/ {{0x3ff51d07, 0xeae2f815} }, +/**/ {{0x3ff50150, 0x15015015} }, +/**/ {{0x3ff4e5e0, 0xa72f0539} }, +/**/ {{0x3ff4cab8, 0x8725af6e} }, +/**/ {{0x3ff4afd6, 0xa052bf5b} }, +/**/ {{0x3ff49539, 0xe3b2d067} }, +/**/ {{0x3ff47ae1, 0x47ae147b} }, +/**/ {{0x3ff460cb, 0xc7f5cf9a} }, +/**/ {{0x3ff446f8, 0x6562d9fb} }, +/**/ {{0x3ff42d66, 0x25d51f87} }, +/**/ {{0x3ff41414, 0x14141414} }, +/**/ {{0x3ff3fb01, 0x3fb013fb} }, +/**/ {{0x3ff3e22c, 0xbce4a902} }, +/**/ {{0x3ff3c995, 0xa47babe7} }, +/**/ {{0x3ff3b13b, 0x13b13b14} }, +/**/ {{0x3ff3991c, 0x2c187f63} }, +/**/ {{0x3ff38138, 0x13813814} }, +/**/ {{0x3ff3698d, 0xf3de0748} }, +/**/ {{0x3ff3521c, 0xfb2b78c1} }, +/**/ {{0x3ff33ae4, 0x5b57bcb2} }, +/**/ {{0x3ff323e3, 0x4a2b10bf} }, +/**/ {{0x3ff30d19, 0x0130d190} }, +/**/ {{0x3ff2f684, 0xbda12f68} }, +/**/ {{0x3ff2e025, 0xc04b8097} }, +/**/ {{0x3ff2c9fb, 0x4d812ca0} }, +/**/ {{0x3ff2b404, 0xad012b40} }, +/**/ {{0x3ff29e41, 0x29e4129e} }, +/**/ {{0x3ff288b0, 0x1288b013} }, +/**/ {{0x3ff27350, 0xb8812735} }, +/**/ {{0x3ff25e22, 0x708092f1} }, +/**/ {{0x3ff24924, 0x92492492} }, +/**/ {{0x3ff23456, 0x789abcdf} }, +/**/ {{0x3ff21fb7, 0x8121fb78} }, +/**/ {{0x3ff20b47, 0x0c67c0d9} }, +/**/ {{0x3ff1f704, 0x7dc11f70} }, +/**/ {{0x3ff1e2ef, 0x3b3fb874} }, +/**/ {{0x3ff1cf06, 0xada2811d} }, +/**/ {{0x3ff1bb4a, 0x4046ed29} }, +/**/ {{0x3ff1a7b9, 0x611a7b96} }, +/**/ {{0x3ff19453, 0x808ca29c} }, +/**/ {{0x3ff18118, 0x11811812} }, +/**/ {{0x3ff16e06, 0x89427379} }, +/**/ {{0x3ff15b1e, 0x5f75270d} }, +/**/ {{0x3ff1485f, 0x0e0acd3b} }, +/**/ {{0x3ff135c8, 0x1135c811} }, +/**/ {{0x3ff12358, 0xe75d3033} }, +/**/ {{0x3ff11111, 0x11111111} }, +/**/ {{0x3ff0fef0, 0x10fef011} }, +/**/ {{0x3ff0ecf5, 0x6be69c90} }, +/**/ {{0x3ff0db20, 0xa88f4696} }, +/**/ {{0x3ff0c971, 0x4fbcda3b} }, +/**/ {{0x3ff0b7e6, 0xec259dc8} }, +/**/ {{0x3ff0a681, 0x0a6810a7} }, +/**/ {{0x3ff0953f, 0x39010954} }, +/**/ {{0x3ff08421, 0x08421084} }, +/**/ {{0x3ff07326, 0x0a47f7c6} }, +/**/ {{0x3ff0624d, 0xd2f1a9fc} }, +/**/ {{0x3ff05197, 0xf7d73404} }, +/**/ {{0x3ff04104, 0x10410410} }, +/**/ {{0x3ff03091, 0xb51f5e1a} }, +/**/ {{0x3ff02040, 0x81020408} }, +/**/ {{0x3ff01010, 0x10101010} }, +/**/ {{0x3ff00000, 0x00000000} }, +/**/ {{0x3fefe01f, 0xe01fe020} }, +/**/ {{0x3fefc07f, 0x01fc07f0} }, +/**/ {{0x3fefa11c, 0xaa01fa12} }, +/**/ {{0x3fef81f8, 0x1f81f820} }, +/**/ {{0x3fef6310, 0xaca0dbb5} }, +/**/ {{0x3fef4465, 0x9e4a4271} }, +/**/ {{0x3fef25f6, 0x44230ab5} }, +/**/ {{0x3fef07c1, 0xf07c1f08} }, +/**/ {{0x3feee9c7, 0xf8458e02} }, +/**/ {{0x3feecc07, 0xb301ecc0} }, +/**/ {{0x3feeae80, 0x7aba01eb} }, +/**/ {{0x3fee9131, 0xabf0b767} }, +/**/ {{0x3fee741a, 0xa59750e4} }, +/**/ {{0x3fee573a, 0xc901e574} }, +/**/ {{0x3fee3a91, 0x79dc1a73} }, +/**/ {{0x3fee1e1e, 0x1e1e1e1e} }, +/**/ {{0x3fee01e0, 0x1e01e01e} }, +/**/ {{0x3fede5d6, 0xe3f8868a} }, +/**/ {{0x3fedca01, 0xdca01dca} }, +/**/ {{0x3fedae60, 0x76b981db} }, +/**/ {{0x3fed92f2, 0x231e7f8a} }, +/**/ {{0x3fed77b6, 0x54b82c34} }, +/**/ {{0x3fed5cac, 0x807572b2} }, +/**/ {{0x3fed41d4, 0x1d41d41d} }, +/**/ {{0x3fed272c, 0xa3fc5b1a} }, +/**/ {{0x3fed0cb5, 0x8f6ec074} }, +/**/ {{0x3fecf26e, 0x5c44bfc6} }, +/**/ {{0x3fecd856, 0x89039b0b} }, +/**/ {{0x3fecbe6d, 0x9601cbe7} }, +/**/ {{0x3feca4b3, 0x055ee191} }, +/**/ {{0x3fec8b26, 0x5afb8a42} }, +/**/ {{0x3fec71c7, 0x1c71c71c} }, +/**/ {{0x3fec5894, 0xd10d4986} }, +/**/ {{0x3fec3f8f, 0x01c3f8f0} }, +/**/ {{0x3fec26b5, 0x392ea01c} }, +/**/ {{0x3fec0e07, 0x0381c0e0} }, +/**/ {{0x3febf583, 0xee868d8b} }, +/**/ {{0x3febdd2b, 0x899406f7} }, +/**/ {{0x3febc4fd, 0x65883e7b} }, +/**/ {{0x3febacf9, 0x14c1bad0} }, +/**/ {{0x3feb951e, 0x2b18ff23} }, +/**/ {{0x3feb7d6c, 0x3dda338b} }, +/**/ {{0x3feb65e2, 0xe3beee05} }, +/**/ {{0x3feb4e81, 0xb4e81b4f} }, +/**/ {{0x3feb3748, 0x4ad806ce} }, +/**/ {{0x3feb2036, 0x406c80d9} }, +/**/ {{0x3feb094b, 0x31d922a4} }, +/**/ {{0x3feaf286, 0xbca1af28} }, +/**/ {{0x3feadbe8, 0x7f94905e} }, +/**/ {{0x3feac570, 0x1ac5701b} }, +/**/ {{0x3feaaf1d, 0x2f87ebfd} }, +/**/ {{0x3fea98ef, 0x606a63be} }, +/**/ {{0x3fea82e6, 0x5130e159} }, +/**/ {{0x3fea6d01, 0xa6d01a6d} }, +/**/ {{0x3fea5741, 0x07688a4a} }, +/**/ {{0x3fea41a4, 0x1a41a41a} }, +/**/ {{0x3fea2c2a, 0x87c51ca0} }, +/**/ {{0x3fea16d3, 0xf97a4b02} }, +/**/ {{0x3fea01a0, 0x1a01a01a} }, +/**/ {{0x3fe9ec8e, 0x951033d9} }, +/**/ {{0x3fe9d79f, 0x176b682d} }, +/**/ {{0x3fe9c2d1, 0x4ee4a102} }, +/**/ {{0x3fe9ae24, 0xea5510da} }, +/**/ {{0x3fe99999, 0x9999999a} }, +/**/ {{0x3fe9852f, 0x0d8ec0ff} }, +/**/ {{0x3fe970e4, 0xf80cb872} }, +/**/ {{0x3fe95cbb, 0x0be377ae} }, +/**/ {{0x3fe948b0, 0xfcd6e9e0} }, +/**/ {{0x3fe934c6, 0x7f9b2ce6} }, +/**/ {{0x3fe920fb, 0x49d0e229} }, +/**/ {{0x3fe90d4f, 0x120190d5} }, +/**/ {{0x3fe8f9c1, 0x8f9c18fa} }, +/**/ {{0x3fe8e652, 0x7af1373f} }, +/**/ {{0x3fe8d301, 0x8d3018d3} }, +/**/ {{0x3fe8bfce, 0x8062ff3a} }, +/**/ {{0x3fe8acb9, 0x0f6bf3aa} }, +/**/ {{0x3fe899c0, 0xf601899c} }, +/**/ {{0x3fe886e5, 0xf0abb04a} }, +/**/ {{0x3fe87427, 0xbcc092b9} }, +/**/ {{0x3fe86186, 0x18618618} }, +/**/ {{0x3fe84f00, 0xc2780614} }, +/**/ {{0x3fe83c97, 0x7ab2bedd} }, +/**/ {{0x3fe82a4a, 0x0182a4a0} }, +/**/ {{0x3fe81818, 0x18181818} }, +/**/ {{0x3fe80601, 0x80601806} }, +/**/ {{0x3fe7f405, 0xfd017f40} }, +/**/ {{0x3fe7e225, 0x515a4f1d} }, +/**/ {{0x3fe7d05f, 0x417d05f4} }, +/**/ {{0x3fe7beb3, 0x922e017c} }, +/**/ {{0x3fe7ad22, 0x08e0ecc3} }, +/**/ {{0x3fe79baa, 0x6bb6398b} }, +/**/ {{0x3fe78a4c, 0x8178a4c8} }, +/**/ {{0x3fe77908, 0x119ac60d} }, +/**/ {{0x3fe767dc, 0xe434a9b1} }, +/**/ {{0x3fe756ca, 0xc201756d} }, +/**/ {{0x3fe745d1, 0x745d1746} }, +/**/ {{0x3fe734f0, 0xc541fe8d} }, +/**/ {{0x3fe72428, 0x7f46debc} }, +/**/ {{0x3fe71378, 0x6d9c7c09} }, +/**/ {{0x3fe702e0, 0x5c0b8170} }, +/**/ {{0x3fe6f260, 0x16f26017} }, +/**/ {{0x3fe6e1f7, 0x6b4337c7} }, +/**/ {{0x3fe6d1a6, 0x2681c861} }, +/**/ {{0x3fe6c16c, 0x16c16c17} }, +/**/ {{0x3fe6b149, 0x0aa31a3d} }, +/**/ {{0x3fe6a13c, 0xd1537290} }, + }; + + static const number + Iv[362] = { /* 1/vj */ +/**/ {{0x3ff00b47, 0xee93bfe3} }, +/**/ {{0x3ff00b37, 0xd80c106f} }, +/**/ {{0x3ff00b27, 0xc1a4a47a} }, +/**/ {{0x3ff00b17, 0xab5d7ba2} }, +/**/ {{0x3ff00b07, 0x95369587} }, +/**/ {{0x3ff00af7, 0x7f2ff1c6} }, +/**/ {{0x3ff00ae7, 0x69499000} }, +/**/ {{0x3ff00ad7, 0x53836fd3} }, +/**/ {{0x3ff00ac7, 0x3ddd90dd} }, +/**/ {{0x3ff00ab7, 0x2857f2bf} }, +/**/ {{0x3ff00aa7, 0x12f29517} }, +/**/ {{0x3ff00a96, 0xfdad7784} }, +/**/ {{0x3ff00a86, 0xe88899a5} }, +/**/ {{0x3ff00a76, 0xd383fb19} }, +/**/ {{0x3ff00a66, 0xbe9f9b7f} }, +/**/ {{0x3ff00a56, 0xa9db7a76} }, +/**/ {{0x3ff00a46, 0x9537979d} }, +/**/ {{0x3ff00a36, 0x80b3f293} }, +/**/ {{0x3ff00a26, 0x6c508af8} }, +/**/ {{0x3ff00a16, 0x580d606a} }, +/**/ {{0x3ff00a06, 0x43ea7288} }, +/**/ {{0x3ff009f6, 0x2fe7c0f1} }, +/**/ {{0x3ff009e6, 0x1c054b44} }, +/**/ {{0x3ff009d6, 0x08431122} }, +/**/ {{0x3ff009c5, 0xf4a11227} }, +/**/ {{0x3ff009b5, 0xe11f4df4} }, +/**/ {{0x3ff009a5, 0xcdbdc428} }, +/**/ {{0x3ff00995, 0xba7c7462} }, +/**/ {{0x3ff00985, 0xa75b5e40} }, +/**/ {{0x3ff00975, 0x945a8162} }, +/**/ {{0x3ff00965, 0x8179dd68} }, +/**/ {{0x3ff00955, 0x6eb971ef} }, +/**/ {{0x3ff00945, 0x5c193e98} }, +/**/ {{0x3ff00935, 0x49994301} }, +/**/ {{0x3ff00925, 0x37397eca} }, +/**/ {{0x3ff00915, 0x24f9f192} }, +/**/ {{0x3ff00905, 0x12da9af7} }, +/**/ {{0x3ff008f5, 0x00db7a99} }, +/**/ {{0x3ff008e4, 0xeefc9018} }, +/**/ {{0x3ff008d4, 0xdd3ddb12} }, +/**/ {{0x3ff008c4, 0xcb9f5b26} }, +/**/ {{0x3ff008b4, 0xba210ff4} }, +/**/ {{0x3ff008a4, 0xa8c2f91a} }, +/**/ {{0x3ff00894, 0x97851639} }, +/**/ {{0x3ff00884, 0x866766ef} }, +/**/ {{0x3ff00874, 0x7569eadb} }, +/**/ {{0x3ff00864, 0x648ca19d} }, +/**/ {{0x3ff00854, 0x53cf8ad3} }, +/**/ {{0x3ff00844, 0x4332a61e} }, +/**/ {{0x3ff00834, 0x32b5f31b} }, +/**/ {{0x3ff00824, 0x2259716c} }, +/**/ {{0x3ff00814, 0x121d20ad} }, +/**/ {{0x3ff00804, 0x02010080} }, +/**/ {{0x3ff007f3, 0xf2051083} }, +/**/ {{0x3ff007e3, 0xe2295056} }, +/**/ {{0x3ff007d3, 0xd26dbf97} }, +/**/ {{0x3ff007c3, 0xc2d25de5} }, +/**/ {{0x3ff007b3, 0xb3572ae2} }, +/**/ {{0x3ff007a3, 0xa3fc262a} }, +/**/ {{0x3ff00793, 0x94c14f5f} }, +/**/ {{0x3ff00783, 0x85a6a61e} }, +/**/ {{0x3ff00773, 0x76ac2a08} }, +/**/ {{0x3ff00763, 0x67d1dabb} }, +/**/ {{0x3ff00753, 0x5917b7d7} }, +/**/ {{0x3ff00743, 0x4a7dc0fb} }, +/**/ {{0x3ff00733, 0x3c03f5c7} }, +/**/ {{0x3ff00723, 0x2daa55da} }, +/**/ {{0x3ff00713, 0x1f70e0d3} }, +/**/ {{0x3ff00703, 0x11579652} }, +/**/ {{0x3ff006f3, 0x035e75f5} }, +/**/ {{0x3ff006e2, 0xf5857f5d} }, +/**/ {{0x3ff006d2, 0xe7ccb228} }, +/**/ {{0x3ff006c2, 0xda340df6} }, +/**/ {{0x3ff006b2, 0xccbb9266} }, +/**/ {{0x3ff006a2, 0xbf633f18} }, +/**/ {{0x3ff00692, 0xb22b13ab} }, +/**/ {{0x3ff00682, 0xa5130fbe} }, +/**/ {{0x3ff00672, 0x981b32f1} }, +/**/ {{0x3ff00662, 0x8b437ce4} }, +/**/ {{0x3ff00652, 0x7e8bed35} }, +/**/ {{0x3ff00642, 0x71f48383} }, +/**/ {{0x3ff00632, 0x657d3f70} }, +/**/ {{0x3ff00622, 0x59262098} }, +/**/ {{0x3ff00612, 0x4cef269e} }, +/**/ {{0x3ff00602, 0x40d8511e} }, +/**/ {{0x3ff005f2, 0x34e19fba} }, +/**/ {{0x3ff005e2, 0x290b1211} }, +/**/ {{0x3ff005d2, 0x1d54a7c1} }, +/**/ {{0x3ff005c2, 0x11be606b} }, +/**/ {{0x3ff005b2, 0x06483bad} }, +/**/ {{0x3ff005a1, 0xfaf23928} }, +/**/ {{0x3ff00591, 0xefbc587b} }, +/**/ {{0x3ff00581, 0xe4a69945} }, +/**/ {{0x3ff00571, 0xd9b0fb25} }, +/**/ {{0x3ff00561, 0xcedb7dbc} }, +/**/ {{0x3ff00551, 0xc42620a9} }, +/**/ {{0x3ff00541, 0xb990e38b} }, +/**/ {{0x3ff00531, 0xaf1bc601} }, +/**/ {{0x3ff00521, 0xa4c6c7ac} }, +/**/ {{0x3ff00511, 0x9a91e82a} }, +/**/ {{0x3ff00501, 0x907d271c} }, +/**/ {{0x3ff004f1, 0x86888421} }, +/**/ {{0x3ff004e1, 0x7cb3fed8} }, +/**/ {{0x3ff004d1, 0x72ff96e0} }, +/**/ {{0x3ff004c1, 0x696b4bdb} }, +/**/ {{0x3ff004b1, 0x5ff71d66} }, +/**/ {{0x3ff004a1, 0x56a30b21} }, +/**/ {{0x3ff00491, 0x4d6f14ad} }, +/**/ {{0x3ff00481, 0x445b39a8} }, +/**/ {{0x3ff00471, 0x3b6779b3} }, +/**/ {{0x3ff00461, 0x3293d46c} }, +/**/ {{0x3ff00451, 0x29e04974} }, +/**/ {{0x3ff00441, 0x214cd869} }, +/**/ {{0x3ff00431, 0x18d980ed} }, +/**/ {{0x3ff00421, 0x1086429d} }, +/**/ {{0x3ff00411, 0x08531d1a} }, +/**/ {{0x3ff00401, 0x00401004} }, +/**/ {{0x3ff003f0, 0xf84d1afa} }, +/**/ {{0x3ff003e0, 0xf07a3d9b} }, +/**/ {{0x3ff003d0, 0xe8c77787} }, +/**/ {{0x3ff003c0, 0xe134c85f} }, +/**/ {{0x3ff003b0, 0xd9c22fc1} }, +/**/ {{0x3ff003a0, 0xd26fad4d} }, +/**/ {{0x3ff00390, 0xcb3d40a3} }, +/**/ {{0x3ff00380, 0xc42ae963} }, +/**/ {{0x3ff00370, 0xbd38a72c} }, +/**/ {{0x3ff00360, 0xb666799e} }, +/**/ {{0x3ff00350, 0xafb46058} }, +/**/ {{0x3ff00340, 0xa9225afa} }, +/**/ {{0x3ff00330, 0xa2b06925} }, +/**/ {{0x3ff00320, 0x9c5e8a77} }, +/**/ {{0x3ff00310, 0x962cbe90} }, +/**/ {{0x3ff00300, 0x901b0511} }, +/**/ {{0x3ff002f0, 0x8a295d98} }, +/**/ {{0x3ff002e0, 0x8457c7c6} }, +/**/ {{0x3ff002d0, 0x7ea6433a} }, +/**/ {{0x3ff002c0, 0x7914cf94} }, +/**/ {{0x3ff002b0, 0x73a36c73} }, +/**/ {{0x3ff002a0, 0x6e521978} }, +/**/ {{0x3ff00290, 0x6920d642} }, +/**/ {{0x3ff00280, 0x640fa271} }, +/**/ {{0x3ff00270, 0x5f1e7da5} }, +/**/ {{0x3ff00260, 0x5a4d677d} }, +/**/ {{0x3ff00250, 0x559c5f9a} }, +/**/ {{0x3ff00240, 0x510b659a} }, +/**/ {{0x3ff00230, 0x4c9a791f} }, +/**/ {{0x3ff00220, 0x484999c6} }, +/**/ {{0x3ff00210, 0x4418c732} }, +/**/ {{0x3ff00200, 0x40080100} }, +/**/ {{0x3ff001f0, 0x3c1746d2} }, +/**/ {{0x3ff001e0, 0x38469846} }, +/**/ {{0x3ff001d0, 0x3495f4fd} }, +/**/ {{0x3ff001c0, 0x31055c96} }, +/**/ {{0x3ff001b0, 0x2d94ceb2} }, +/**/ {{0x3ff001a0, 0x2a444af0} }, +/**/ {{0x3ff00190, 0x2713d0ef} }, +/**/ {{0x3ff00180, 0x24036051} }, +/**/ {{0x3ff00170, 0x2112f8b4} }, +/**/ {{0x3ff00160, 0x1e4299b9} }, +/**/ {{0x3ff00150, 0x1b9242ff} }, +/**/ {{0x3ff00140, 0x1901f427} }, +/**/ {{0x3ff00130, 0x1691acd0} }, +/**/ {{0x3ff00120, 0x14416c9a} }, +/**/ {{0x3ff00110, 0x12113324} }, +/**/ {{0x3ff00100, 0x10010010} }, +/**/ {{0x3ff000f0, 0x0e10d2fc} }, +/**/ {{0x3ff000e0, 0x0c40ab89} }, +/**/ {{0x3ff000d0, 0x0a908957} }, +/**/ {{0x3ff000c0, 0x09006c05} }, +/**/ {{0x3ff000b0, 0x07905334} }, +/**/ {{0x3ff000a0, 0x06403e82} }, +/**/ {{0x3ff00090, 0x05102d92} }, +/**/ {{0x3ff00080, 0x04002001} }, +/**/ {{0x3ff00070, 0x03101571} }, +/**/ {{0x3ff00060, 0x02400d80} }, +/**/ {{0x3ff00050, 0x019007d0} }, +/**/ {{0x3ff00040, 0x01000400} }, +/**/ {{0x3ff00030, 0x009001b0} }, +/**/ {{0x3ff00020, 0x00400080} }, +/**/ {{0x3ff00010, 0x00100010} }, +/**/ {{0x3ff00000, 0x00000000} }, +/**/ {{0x3fefffe0, 0x001fffe0} }, +/**/ {{0x3fefffc0, 0x007fff00} }, +/**/ {{0x3fefffa0, 0x011ffca0} }, +/**/ {{0x3fefff80, 0x01fff800} }, +/**/ {{0x3fefff60, 0x031ff060} }, +/**/ {{0x3fefff40, 0x047fe501} }, +/**/ {{0x3fefff20, 0x061fd521} }, +/**/ {{0x3fefff00, 0x07ffc002} }, +/**/ {{0x3feffee0, 0x0a1fa4e3} }, +/**/ {{0x3feffec0, 0x0c7f8305} }, +/**/ {{0x3feffea0, 0x0f1f59a7} }, +/**/ {{0x3feffe80, 0x11ff280a} }, +/**/ {{0x3feffe60, 0x151eed6e} }, +/**/ {{0x3feffe40, 0x187ea913} }, +/**/ {{0x3feffe20, 0x1c1e5a39} }, +/**/ {{0x3feffe00, 0x1ffe0020} }, +/**/ {{0x3feffde0, 0x241d9a09} }, +/**/ {{0x3feffdc0, 0x287d2733} }, +/**/ {{0x3feffda0, 0x2d1ca6e0} }, +/**/ {{0x3feffd80, 0x31fc184e} }, +/**/ {{0x3feffd60, 0x371b7abf} }, +/**/ {{0x3feffd40, 0x3c7acd72} }, +/**/ {{0x3feffd20, 0x421a0fa9} }, +/**/ {{0x3feffd00, 0x47f940a2} }, +/**/ {{0x3feffce0, 0x4e185f9f} }, +/**/ {{0x3feffcc0, 0x54776bdf} }, +/**/ {{0x3feffca0, 0x5b1664a3} }, +/**/ {{0x3feffc80, 0x61f5492c} }, +/**/ {{0x3feffc60, 0x691418b9} }, +/**/ {{0x3feffc40, 0x7072d28b} }, +/**/ {{0x3feffc20, 0x781175e3} }, +/**/ {{0x3feffc00, 0x7ff00200} }, +/**/ {{0x3feffbe0, 0x880e7623} }, +/**/ {{0x3feffbc0, 0x906cd18c} }, +/**/ {{0x3feffba0, 0x990b137c} }, +/**/ {{0x3feffb80, 0xa1e93b34} }, +/**/ {{0x3feffb60, 0xab0747f3} }, +/**/ {{0x3feffb40, 0xb46538fa} }, +/**/ {{0x3feffb20, 0xbe030d89} }, +/**/ {{0x3feffb00, 0xc7e0c4e1} }, +/**/ {{0x3feffae0, 0xd1fe5e43} }, +/**/ {{0x3feffac0, 0xdc5bd8ee} }, +/**/ {{0x3feffaa0, 0xe6f93424} }, +/**/ {{0x3feffa80, 0xf1d66f25} }, +/**/ {{0x3feffa60, 0xfcf38931} }, +/**/ {{0x3feffa41, 0x08508189} }, +/**/ {{0x3feffa21, 0x13ed576d} }, +/**/ {{0x3feffa01, 0x1fca0a1e} }, +/**/ {{0x3feff9e1, 0x2be698dd} }, +/**/ {{0x3feff9c1, 0x384302e9} }, +/**/ {{0x3feff9a1, 0x44df4785} }, +/**/ {{0x3feff981, 0x51bb65ef} }, +/**/ {{0x3feff961, 0x5ed75d6a} }, +/**/ {{0x3feff941, 0x6c332d34} }, +/**/ {{0x3feff921, 0x79ced490} }, +/**/ {{0x3feff901, 0x87aa52be} }, +/**/ {{0x3feff8e1, 0x95c5a6fe} }, +/**/ {{0x3feff8c1, 0xa420d091} }, +/**/ {{0x3feff8a1, 0xb2bbceb7} }, +/**/ {{0x3feff881, 0xc196a0b2} }, +/**/ {{0x3feff861, 0xd0b145c2} }, +/**/ {{0x3feff841, 0xe00bbd28} }, +/**/ {{0x3feff821, 0xefa60624} }, +/**/ {{0x3feff801, 0xff801ff8} }, +/**/ {{0x3feff7e2, 0x0f9a09e3} }, +/**/ {{0x3feff7c2, 0x1ff3c328} }, +/**/ {{0x3feff7a2, 0x308d4b05} }, +/**/ {{0x3feff782, 0x4166a0bd} }, +/**/ {{0x3feff762, 0x527fc390} }, +/**/ {{0x3feff742, 0x63d8b2bf} }, +/**/ {{0x3feff722, 0x75716d8b} }, +/**/ {{0x3feff702, 0x8749f334} }, +/**/ {{0x3feff6e2, 0x996242fb} }, +/**/ {{0x3feff6c2, 0xabba5c21} }, +/**/ {{0x3feff6a2, 0xbe523de8} }, +/**/ {{0x3feff682, 0xd129e78f} }, +/**/ {{0x3feff662, 0xe4415858} }, +/**/ {{0x3feff642, 0xf7988f84} }, +/**/ {{0x3feff623, 0x0b2f8c54} }, +/**/ {{0x3feff603, 0x1f064e08} }, +/**/ {{0x3feff5e3, 0x331cd3e1} }, +/**/ {{0x3feff5c3, 0x47731d21} }, +/**/ {{0x3feff5a3, 0x5c092908} }, +/**/ {{0x3feff583, 0x70def6d7} }, +/**/ {{0x3feff563, 0x85f485d0} }, +/**/ {{0x3feff543, 0x9b49d532} }, +/**/ {{0x3feff523, 0xb0dee440} }, +/**/ {{0x3feff503, 0xc6b3b23b} }, +/**/ {{0x3feff4e3, 0xdcc83e62} }, +/**/ {{0x3feff4c3, 0xf31c87f8} }, +/**/ {{0x3feff4a4, 0x09b08e3d} }, +/**/ {{0x3feff484, 0x20845073} }, +/**/ {{0x3feff464, 0x3797cdda} }, +/**/ {{0x3feff444, 0x4eeb05b4} }, +/**/ {{0x3feff424, 0x667df741} }, +/**/ {{0x3feff404, 0x7e50a1c3} }, +/**/ {{0x3feff3e4, 0x9663047b} }, +/**/ {{0x3feff3c4, 0xaeb51eaa} }, +/**/ {{0x3feff3a4, 0xc746ef91} }, +/**/ {{0x3feff384, 0xe0187672} }, +/**/ {{0x3feff364, 0xf929b28d} }, +/**/ {{0x3feff345, 0x127aa323} }, +/**/ {{0x3feff325, 0x2c0b4776} }, +/**/ {{0x3feff305, 0x45db9ec7} }, +/**/ {{0x3feff2e5, 0x5feba858} }, +/**/ {{0x3feff2c5, 0x7a3b6369} }, +/**/ {{0x3feff2a5, 0x94cacf3b} }, +/**/ {{0x3feff285, 0xaf99eb11} }, +/**/ {{0x3feff265, 0xcaa8b62a} }, +/**/ {{0x3feff245, 0xe5f72fc9} }, +/**/ {{0x3feff226, 0x0185572f} }, +/**/ {{0x3feff206, 0x1d532b9d} }, +/**/ {{0x3feff1e6, 0x3960ac54} }, +/**/ {{0x3feff1c6, 0x55add896} }, +/**/ {{0x3feff1a6, 0x723aafa3} }, +/**/ {{0x3feff186, 0x8f0730be} }, +/**/ {{0x3feff166, 0xac135b27} }, +/**/ {{0x3feff146, 0xc95f2e21} }, +/**/ {{0x3feff126, 0xe6eaa8eb} }, +/**/ {{0x3feff107, 0x04b5cac9} }, +/**/ {{0x3feff0e7, 0x22c092fb} }, +/**/ {{0x3feff0c7, 0x410b00c2} }, +/**/ {{0x3feff0a7, 0x5f951360} }, +/**/ {{0x3feff087, 0x7e5eca16} }, +/**/ {{0x3feff067, 0x9d682426} }, +/**/ {{0x3feff047, 0xbcb120d2} }, +/**/ {{0x3feff027, 0xdc39bf5a} }, +/**/ {{0x3feff007, 0xfc01ff00} }, +/**/ {{0x3fefefe8, 0x1c09df07} }, +/**/ {{0x3fefefc8, 0x3c515eae} }, +/**/ {{0x3fefefa8, 0x5cd87d38} }, +/**/ {{0x3fefef88, 0x7d9f39e6} }, +/**/ {{0x3fefef68, 0x9ea593fa} }, +/**/ {{0x3fefef48, 0xbfeb8ab5} }, +/**/ {{0x3fefef28, 0xe1711d5a} }, +/**/ {{0x3fefef09, 0x03364b28} }, +/**/ {{0x3fefeee9, 0x253b1363} }, +/**/ {{0x3fefeec9, 0x477f754b} }, +/**/ {{0x3fefeea9, 0x6a037022} }, +/**/ {{0x3fefee89, 0x8cc7032a} }, +/**/ {{0x3fefee69, 0xafca2da5} }, +/**/ {{0x3fefee49, 0xd30ceed4} }, +/**/ {{0x3fefee29, 0xf68f45f8} }, +/**/ {{0x3fefee0a, 0x1a513254} }, +/**/ {{0x3fefedea, 0x3e52b329} }, +/**/ {{0x3fefedca, 0x6293c7b8} }, +/**/ {{0x3fefedaa, 0x87146f44} }, +/**/ {{0x3fefed8a, 0xabd4a90e} }, +/**/ {{0x3fefed6a, 0xd0d47458} }, +/**/ {{0x3fefed4a, 0xf613d064} }, +/**/ {{0x3fefed2b, 0x1b92bc73} }, +/**/ {{0x3fefed0b, 0x415137c7} }, +/**/ {{0x3fefeceb, 0x674f41a2} }, +/**/ {{0x3fefeccb, 0x8d8cd945} }, +/**/ {{0x3fefecab, 0xb409fdf3} }, +/**/ {{0x3fefec8b, 0xdac6aeed} }, +/**/ {{0x3fefec6c, 0x01c2eb76} }, +/**/ {{0x3fefec4c, 0x28feb2ce} }, +/**/ {{0x3fefec2c, 0x507a0437} }, +/**/ {{0x3fefec0c, 0x7834def5} }, +/**/ {{0x3fefebec, 0xa02f4247} }, +/**/ {{0x3fefebcc, 0xc8692d71} }, +/**/ {{0x3fefebac, 0xf0e29fb4} }, +/**/ {{0x3fefeb8d, 0x199b9852} }, +/**/ {{0x3fefeb6d, 0x4294168d} }, +/**/ {{0x3fefeb4d, 0x6bcc19a7} }, +/**/ {{0x3fefeb2d, 0x9543a0e2} }, +/**/ {{0x3fefeb0d, 0xbefaab7f} }, +/**/ {{0x3fefeaed, 0xe8f138c2} }, +/**/ {{0x3fefeace, 0x132747ea} }, +/**/ {{0x3fefeaae, 0x3d9cd83c} }, +/**/ {{0x3fefea8e, 0x6851e8f7} }, +/**/ {{0x3fefea6e, 0x93467960} }, +/**/ {{0x3fefea4e, 0xbe7a88b7} }, +/**/ {{0x3fefea2e, 0xe9ee163f} }, +/**/ {{0x3fefea0f, 0x15a12139} }, +/**/ {{0x3fefe9ef, 0x4193a8e8} }, +/**/ {{0x3fefe9cf, 0x6dc5ac8e} }, +/**/ {{0x3fefe9af, 0x9a372b6d} }, +/**/ {{0x3fefe98f, 0xc6e824c6} }, +/**/ {{0x3fefe96f, 0xf3d897dd} }, + }; + + static const number + Lu[182][2] = { /* log(ui) */ +/**/ {{{0xbfd63003, 0x0b3aac49} }, +/**/ {{0xbc6dc18c, 0xe51fff99} },}, +/**/ {{{0xbfd5d5bd, 0xdf595f30} }, +/**/ {{0x3c765411, 0x48cbb8a2} },}, +/**/ {{{0xbfd57bf7, 0x53c8d1fb} }, +/**/ {{0x3c60908d, 0x15f88b63} },}, +/**/ {{{0xbfd522ae, 0x0738a3d8} }, +/**/ {{0x3c68f7e9, 0xb38a6979} },}, +/**/ {{{0xbfd4c9e0, 0x9e172c3c} }, +/**/ {{0x3c512361, 0x5b147a5d} },}, +/**/ {{{0xbfd4718d, 0xc271c41b} }, +/**/ {{0xbc38fb4c, 0x14c56eef} },}, +/**/ {{{0xbfd419b4, 0x23d5e8c7} }, +/**/ {{0xbc60dbb2, 0x43827392} },}, +/**/ {{{0xbfd3c252, 0x77333184} }, +/**/ {{0x3c72ad27, 0xe50a8ec6} },}, +/**/ {{{0xbfd36b67, 0x76be1117} }, +/**/ {{0x3c5324f0, 0xe883858e} },}, +/**/ {{{0xbfd314f1, 0xe1d35ce4} }, +/**/ {{0x3c73d699, 0x09e5c3dc} },}, +/**/ {{{0xbfd2bef0, 0x7cdc9354} }, +/**/ {{0x3c782dad, 0x7fd86088} },}, +/**/ {{{0xbfd26962, 0x1134db92} }, +/**/ {{0xbc7e0efa, 0xdd9db02b} },}, +/**/ {{{0xbfd21445, 0x6d0eb8d4} }, +/**/ {{0xbc6f7ae9, 0x1aeba60a} },}, +/**/ {{{0xbfd1bf99, 0x635a6b95} }, +/**/ {{0x3c612aeb, 0x84249223} },}, +/**/ {{{0xbfd16b5c, 0xcbacfb73} }, +/**/ {{0xbc766fbd, 0x28b40935} },}, +/**/ {{{0xbfd1178e, 0x8227e47c} }, +/**/ {{0x3c60e63a, 0x5f01c691} },}, +/**/ {{{0xbfd0c42d, 0x676162e3} }, +/**/ {{0xbc5162c7, 0x9d5d11ee} },}, +/**/ {{{0xbfd07138, 0x604d5862} }, +/**/ {{0xbc7cdb16, 0xed4e9138} },}, +/**/ {{{0xbfd01eae, 0x5626c691} }, +/**/ {{0x3c418290, 0xbd2932e2} },}, +/**/ {{{0xbfcf991c, 0x6cb3b379} }, +/**/ {{0xbc6f6650, 0x66f980a2} },}, +/**/ {{{0xbfcef5ad, 0xe4dcffe6} }, +/**/ {{0x3c508ab2, 0xddc708a0} },}, +/**/ {{{0xbfce530e, 0xffe71012} }, +/**/ {{0xbc422760, 0x41f43042} },}, +/**/ {{{0xbfcdb13d, 0xb0d48940} }, +/**/ {{0xbc5aa11d, 0x49f96cb9} },}, +/**/ {{{0xbfcd1037, 0xf2655e7b} }, +/**/ {{0xbc660629, 0x242471a2} },}, +/**/ {{{0xbfcc6ffb, 0xc6f00f71} }, +/**/ {{0x3c68e58b, 0x2c57a4a5} },}, +/**/ {{{0xbfcbd087, 0x383bd8ad} }, +/**/ {{0xbc3dd355, 0xf6a516d7} },}, +/**/ {{{0xbfcb31d8, 0x575bce3d} }, +/**/ {{0x3c66353a, 0xb386a94d} },}, +/**/ {{{0xbfca93ed, 0x3c8ad9e3} }, +/**/ {{0xbc6bcafa, 0x9de97203} },}, +/**/ {{{0xbfc9f6c4, 0x07089664} }, +/**/ {{0xbc435a19, 0x605e67ef} },}, +/**/ {{{0xbfc95a5a, 0xdcf7017f} }, +/**/ {{0xbc5142c5, 0x07fb7a3d} },}, +/**/ {{{0xbfc8beaf, 0xeb38fe8c} }, +/**/ {{0xbc555aa8, 0xb6997a40} },}, +/**/ {{{0xbfc823c1, 0x6551a3c2} }, +/**/ {{0x3c61232c, 0xe70be781} },}, +/**/ {{{0xbfc7898d, 0x85444c73} }, +/**/ {{0xbc5ef8f6, 0xebcfb201} },}, +/**/ {{{0xbfc6f012, 0x8b756abc} }, +/**/ {{0x3c68de59, 0xc21e166c} },}, +/**/ {{{0xbfc6574e, 0xbe8c133a} }, +/**/ {{0x3c3d34f0, 0xf4621bed} },}, +/**/ {{{0xbfc5bf40, 0x6b543db2} }, +/**/ {{0x3c21f5b4, 0x4c0df7e7} },}, +/**/ {{{0xbfc527e5, 0xe4a1b58d} }, +/**/ {{0x3c271a96, 0x82395bfd} },}, +/**/ {{{0xbfc4913d, 0x8333b561} }, +/**/ {{0x3c50d560, 0x4930f135} },}, +/**/ {{{0xbfc3fb45, 0xa59928cc} }, +/**/ {{0x3c6d87e6, 0xa354d056} },}, +/**/ {{{0xbfc365fc, 0xb0159016} }, +/**/ {{0xbc57d411, 0xa5b944ad} },}, +/**/ {{{0xbfc2d161, 0x0c86813a} }, +/**/ {{0x3c5499a3, 0xf25af95f} },}, +/**/ {{{0xbfc23d71, 0x2a49c202} }, +/**/ {{0x3c66e381, 0x61051d69} },}, +/**/ {{{0xbfc1aa2b, 0x7e23f72a} }, +/**/ {{0x3c4c6ef1, 0xd9b2ef7e} },}, +/**/ {{{0xbfc1178e, 0x8227e47c} }, +/**/ {{0x3c50e63a, 0x5f01c691} },}, +/**/ {{{0xbfc08598, 0xb59e3a07} }, +/**/ {{0x3c6dd700, 0x9902bf32} },}, +/**/ {{{0xbfbfe891, 0x39dbd566} }, +/**/ {{0x3c5ac9f4, 0x215f9393} },}, +/**/ {{{0xbfbec739, 0x830a1120} }, +/**/ {{0x3c4a2bf9, 0x91780d3f} },}, +/**/ {{{0xbfbda727, 0x638446a2} }, +/**/ {{0xbc5401fa, 0x71733019} },}, +/**/ {{{0xbfbc8858, 0x01bc4b23} }, +/**/ {{0xbc5a38cb, 0x559a6706} },}, +/**/ {{{0xbfbb6ac8, 0x8dad5b1c} }, +/**/ {{0x3c40057e, 0xed1ca59f} },}, +/**/ {{{0xbfba4e76, 0x40b1bc38} }, +/**/ {{0x3c55b5ca, 0x203e4259} },}, +/**/ {{{0xbfb9335e, 0x5d594989} }, +/**/ {{0x3c5478a8, 0x5704ccb7} },}, +/**/ {{{0xbfb8197e, 0x2f40e3f0} }, +/**/ {{0xbc3b9f2d, 0xffbeed43} },}, +/**/ {{{0xbfb700d3, 0x0aeac0e1} }, +/**/ {{0x3c272566, 0x212cdd05} },}, +/**/ {{{0xbfb5e95a, 0x4d9791cb} }, +/**/ {{0xbc5f3874, 0x5c5c450a} },}, +/**/ {{{0xbfb4d311, 0x5d207eac} }, +/**/ {{0xbc5769f4, 0x2c7842cc} },}, +/**/ {{{0xbfb3bdf5, 0xa7d1ee64} }, +/**/ {{0xbc47a976, 0xd3b5b45f} },}, +/**/ {{{0xbfb2aa04, 0xa44717a5} }, +/**/ {{0x3c5d15d3, 0x8d2fa3f7} },}, +/**/ {{{0xbfb1973b, 0xd1465567} }, +/**/ {{0x3c475583, 0x67a6acf6} },}, +/**/ {{{0xbfb08598, 0xb59e3a07} }, +/**/ {{0x3c5dd700, 0x9902bf32} },}, +/**/ {{{0xbfaeea31, 0xc006b87c} }, +/**/ {{0x3c43e4fc, 0x93b7b66c} },}, +/**/ {{{0xbfaccb73, 0xcdddb2cc} }, +/**/ {{0x3c4e48fb, 0x0500efd4} },}, +/**/ {{{0xbfaaaef2, 0xd0fb10fc} }, +/**/ {{0xbc2a353b, 0xb42e0add} },}, +/**/ {{{0xbfa894aa, 0x149fb343} }, +/**/ {{0xbc3a8be9, 0x7660a23d} },}, +/**/ {{{0xbfa67c94, 0xf2d4bb58} }, +/**/ {{0xbc40413e, 0x6505e603} },}, +/**/ {{{0xbfa466ae, 0xd42de3ea} }, +/**/ {{0x3c4cdd6f, 0x7f4a137e} },}, +/**/ {{{0xbfa252f3, 0x2f8d183f} }, +/**/ {{0x3c4947f7, 0x92615916} },}, +/**/ {{{0xbfa0415d, 0x89e74444} }, +/**/ {{0xbc4c05cf, 0x1d753622} },}, +/**/ {{{0xbf9c63d2, 0xec14aaf2} }, +/**/ {{0x3c3ce030, 0xa686bd86} },}, +/**/ {{{0xbf984925, 0x28c8cabf} }, +/**/ {{0x3c3d192d, 0x0619fa67} },}, +/**/ {{{0xbf9432a9, 0x25980cc1} }, +/**/ {{0x3c38cdaf, 0x39004192} },}, +/**/ {{{0xbf902056, 0x58935847} }, +/**/ {{0xbc327c8e, 0x8416e71f} },}, +/**/ {{{0xbf882448, 0xa388a2aa} }, +/**/ {{0xbc104b16, 0x137f09a0} },}, +/**/ {{{0xbf801015, 0x7588de71} }, +/**/ {{0xbc146662, 0xd417ced0} },}, +/**/ {{{0xbf700805, 0x59588b35} }, +/**/ {{0xbc1f9663, 0x8cf63677} },}, +/**/ {{{0x00000000, 0x00000000} }, +/**/ {{0x00000000, 0x00000000} },}, +/**/ {{{0x3f6ff00a, 0xa2b10bc0} }, +/**/ {{0x3c02821a, 0xd5a6d353} },}, +/**/ {{{0x3f7fe02a, 0x6b106789} }, +/**/ {{0xbbce44b7, 0xe3711ebf} },}, +/**/ {{{0x3f87dc47, 0x5f810a77} }, +/**/ {{0xbc116d76, 0x87d3df21} },}, +/**/ {{{0x3f8fc0a8, 0xb0fc03e4} }, +/**/ {{0xbc183092, 0xc59642a1} },}, +/**/ {{{0x3f93cea4, 0x4346a575} }, +/**/ {{0xbc10cb5a, 0x902b3a1c} },}, +/**/ {{{0x3f97b91b, 0x07d5b11b} }, +/**/ {{0xbc35b602, 0xace3a510} },}, +/**/ {{{0x3f9b9fc0, 0x27af9198} }, +/**/ {{0xbbf0ae69, 0x229dc868} },}, +/**/ {{{0x3f9f829b, 0x0e783300} }, +/**/ {{0x3c333e3f, 0x04f1ef23} },}, +/**/ {{{0x3fa1b0d9, 0x8923d980} }, +/**/ {{0xbc3e9ae8, 0x89bac481} },}, +/**/ {{{0x3fa39e87, 0xb9febd60} }, +/**/ {{0xbc45bfa9, 0x37f551bb} },}, +/**/ {{{0x3fa58a5b, 0xafc8e4d5} }, +/**/ {{0xbc4ce55c, 0x2b4e2b72} },}, +/**/ {{{0x3fa77458, 0xf632dcfc} }, +/**/ {{0x3c418d3c, 0xa87b9296} },}, +/**/ {{{0x3fa95c83, 0x0ec8e3eb} }, +/**/ {{0x3c4f5a0e, 0x80520bf2} },}, +/**/ {{{0x3fab42dd, 0x711971bf} }, +/**/ {{0xbc3eb975, 0x9c130499} },}, +/**/ {{{0x3fad276b, 0x8adb0b52} }, +/**/ {{0x3c21e3c5, 0x3257fd47} },}, +/**/ {{{0x3faf0a30, 0xc01162a6} }, +/**/ {{0x3c485f32, 0x5c5bbacd} },}, +/**/ {{{0x3fb07598, 0x3598e471} }, +/**/ {{0x3c480da5, 0x333c45b8} },}, +/**/ {{{0x3fb16536, 0xeea37ae1} }, +/**/ {{0xbc379da3, 0xe8c22cda} },}, +/**/ {{{0x3fb253f6, 0x2f0a1417} }, +/**/ {{0xbc1c1259, 0x63fc4cfd} },}, +/**/ {{{0x3fb341d7, 0x961bd1d1} }, +/**/ {{0xbc5b599f, 0x227becbb} },}, +/**/ {{{0x3fb42edc, 0xbea646f0} }, +/**/ {{0x3c4ddd4f, 0x935996c9} },}, +/**/ {{{0x3fb51b07, 0x3f06183f} }, +/**/ {{0x3c5a49e3, 0x9a1a8be4} },}, +/**/ {{{0x3fb60658, 0xa93750c4} }, +/**/ {{0xbc538845, 0x8ec21b6a} },}, +/**/ {{{0x3fb6f0d2, 0x8ae56b4c} }, +/**/ {{0xbc5906d9, 0x9184b992} },}, +/**/ {{{0x3fb7da76, 0x6d7b12cd} }, +/**/ {{0xbc5eeedf, 0xcdd94131} },}, +/**/ {{{0x3fb8c345, 0xd6319b21} }, +/**/ {{0xbc24a697, 0xab3424a9} },}, +/**/ {{{0x3fb9ab42, 0x462033ad} }, +/**/ {{0xbc42099e, 0x1c184e8e} },}, +/**/ {{{0x3fba926d, 0x3a4ad563} }, +/**/ {{0x3c5942f4, 0x8aa70ea9} },}, +/**/ {{{0x3fbb78c8, 0x2bb0eda1} }, +/**/ {{0x3c20878c, 0xf0327e21} },}, +/**/ {{{0x3fbc5e54, 0x8f5bc743} }, +/**/ {{0x3c35d617, 0xef8161b1} },}, +/**/ {{{0x3fbd4313, 0xd66cb35d} }, +/**/ {{0x3c5790dd, 0x951d90fa} },}, +/**/ {{{0x3fbe2707, 0x6e2af2e6} }, +/**/ {{0xbc361578, 0x001e0162} },}, +/**/ {{{0x3fbf0a30, 0xc01162a6} }, +/**/ {{0x3c585f32, 0x5c5bbacd} },}, +/**/ {{{0x3fbfec91, 0x31dbeabb} }, +/**/ {{0xbc55746b, 0x9981b36c} },}, +/**/ {{{0x3fc06715, 0x12ca596e} }, +/**/ {{0x3c550c64, 0x7eb86499} },}, +/**/ {{{0x3fc0d77e, 0x7cd08e59} }, +/**/ {{0x3c69a5dc, 0x5e9030ac} },}, +/**/ {{{0x3fc14785, 0x846742ac} }, +/**/ {{0x3c6a2881, 0x3e3a7f07} },}, +/**/ {{{0x3fc1b72a, 0xd52f67a0} }, +/**/ {{0x3c548302, 0x3472cd74} },}, +/**/ {{{0x3fc2266f, 0x190a5acb} }, +/**/ {{0x3c6f547b, 0xf1809e88} },}, +/**/ {{{0x3fc29552, 0xf81ff523} }, +/**/ {{0x3c630177, 0x1c407dbf} },}, +/**/ {{{0x3fc303d7, 0x18e47fd3} }, +/**/ {{0xbc06b9c7, 0xd96091fa} },}, +/**/ {{{0x3fc371fc, 0x201e8f74} }, +/**/ {{0x3c5de6cb, 0x62af18a0} },}, +/**/ {{{0x3fc3dfc2, 0xb0ecc62a} }, +/**/ {{0xbc5ab3a8, 0xe7d81017} },}, +/**/ {{{0x3fc44d2b, 0x6ccb7d1e} }, +/**/ {{0x3c69f4f6, 0x543e1f88} },}, +/**/ {{{0x3fc4ba36, 0xf39a55e5} }, +/**/ {{0x3c668981, 0xbcc36756} },}, +/**/ {{{0x3fc526e5, 0xe3a1b438} }, +/**/ {{0xbc6746ff, 0x8a470d3a} },}, +/**/ {{{0x3fc59338, 0xd9982086} }, +/**/ {{0xbc565d22, 0xaa8ad7cf} },}, +/**/ {{{0x3fc5ff30, 0x70a793d4} }, +/**/ {{0xbc5bc60e, 0xfafc6f6e} },}, +/**/ {{{0x3fc66acd, 0x4272ad51} }, +/**/ {{0xbc50900e, 0x4e1ea8b2} },}, +/**/ {{{0x3fc6d60f, 0xe719d21d} }, +/**/ {{0xbc6caae2, 0x68ecd179} },}, +/**/ {{{0x3fc740f8, 0xf54037a5} }, +/**/ {{0xbc5b2640, 0x62a84cdb} },}, +/**/ {{{0x3fc7ab89, 0x0210d909} }, +/**/ {{0x3c4be36b, 0x2d6a0608} },}, +/**/ {{{0x3fc815c0, 0xa14357eb} }, +/**/ {{0xbc54be48, 0x073a0564} },}, +/**/ {{{0x3fc87fa0, 0x6520c911} }, +/**/ {{0xbc6bf7fd, 0xbfa08d9a} },}, +/**/ {{{0x3fc8e928, 0xde886d41} }, +/**/ {{0xbc6569d8, 0x51a56770} },}, +/**/ {{{0x3fc9525a, 0x9cf456b4} }, +/**/ {{0x3c6d904c, 0x1d4e2e26} },}, +/**/ {{{0x3fc9bb36, 0x2e7dfb83} }, +/**/ {{0x3c6575e3, 0x1f003e0c} },}, +/**/ {{{0x3fca23bc, 0x1fe2b563} }, +/**/ {{0x3c493711, 0xb07a998c} },}, +/**/ {{{0x3fca8bec, 0xfc882f19} }, +/**/ {{0xbc5e8c37, 0x918c39eb} },}, +/**/ {{{0x3fcaf3c9, 0x4e80bff3} }, +/**/ {{0xbc5398cf, 0xf3641985} },}, +/**/ {{{0x3fcb5b51, 0x9e8fb5a4} }, +/**/ {{0x3c6ba27f, 0xdc19e1a0} },}, +/**/ {{{0x3fcbc286, 0x742d8cd6} }, +/**/ {{0x3c54fce7, 0x44870f55} },}, +/**/ {{{0x3fcc2968, 0x558c18c1} }, +/**/ {{0xbc673dee, 0x38a3fb6b} },}, +/**/ {{{0x3fcc8ff7, 0xc79a9a22} }, +/**/ {{0xbc64f689, 0xf8434012} },}, +/**/ {{{0x3fccf635, 0x4e09c5dc} }, +/**/ {{0x3c6239a0, 0x7d55b695} },}, +/**/ {{{0x3fcd5c21, 0x6b4fbb91} }, +/**/ {{0x3c66e443, 0x597e4d40} },}, +/**/ {{{0x3fcdc1bc, 0xa0abec7d} }, +/**/ {{0x3c6834c5, 0x1998b6fc} },}, +/**/ {{{0x3fce2707, 0x6e2af2e6} }, +/**/ {{0xbc461578, 0x001e0162} },}, +/**/ {{{0x3fce8c02, 0x52aa5a60} }, +/**/ {{0xbc46e03a, 0x39bfc89b} },}, +/**/ {{{0x3fcef0ad, 0xcbdc5936} }, +/**/ {{0x3c648637, 0x950dc20d} },}, +/**/ {{{0x3fcf550a, 0x564b7b37} }, +/**/ {{0x3c2c5f6d, 0xfd018c37} },}, +/**/ {{{0x3fcfb918, 0x6d5e3e2b} }, +/**/ {{0xbc6caaae, 0x64f21acb} },}, +/**/ {{{0x3fd00e6c, 0x45ad501d} }, +/**/ {{0xbc6cb956, 0x8ff6fead} },}, +/**/ {{{0x3fd04025, 0x94b4d041} }, +/**/ {{0xbc628ec2, 0x17a5022d} },}, +/**/ {{{0x3fd071b8, 0x5fcd590d} }, +/**/ {{0x3c5d1707, 0xf97bde80} },}, +/**/ {{{0x3fd0a324, 0xe27390e3} }, +/**/ {{0x3c77dcfd, 0xe8061c03} },}, +/**/ {{{0x3fd0d46b, 0x579ab74b} }, +/**/ {{0x3c603ec8, 0x1c3cbd92} },}, +/**/ {{{0x3fd1058b, 0xf9ae4ad5} }, +/**/ {{0x3c589fa0, 0xab4cb31d} },}, +/**/ {{{0x3fd13687, 0x0293a8b0} }, +/**/ {{0x3c77b662, 0x98edd24a} },}, +/**/ {{{0x3fd1675c, 0xababa60e} }, +/**/ {{0x3c2ce63e, 0xab883717} },}, +/**/ {{{0x3fd1980d, 0x2dd4236f} }, +/**/ {{0x3c79d3d1, 0xb0e4d147} },}, +/**/ {{{0x3fd1c898, 0xc16999fb} }, +/**/ {{0xbc30e5c6, 0x2aff1c44} },}, +/**/ {{{0x3fd1f8ff, 0x9e48a2f3} }, +/**/ {{0xbc7c9fdf, 0x9a0c4b07} },}, +/**/ {{{0x3fd22941, 0xfbcf7966} }, +/**/ {{0xbc776f5e, 0xb09628af} },}, +/**/ {{{0x3fd25960, 0x10df763a} }, +/**/ {{0xbc50f76c, 0x57075e9e} },}, +/**/ {{{0x3fd2895a, 0x13de86a3} }, +/**/ {{0x3c77ad24, 0xc13f040e} },}, +/**/ {{{0x3fd2b930, 0x3ab89d25} }, +/**/ {{0xbc7896b5, 0xfd852ad4} },}, +/**/ {{{0x3fd2e8e2, 0xbae11d31} }, +/**/ {{0xbc78f4cd, 0xb95ebdf9} },}, +/**/ {{{0x3fd31871, 0xc9544185} }, +/**/ {{0xbc351acc, 0x4c09b379} },}, +/**/ {{{0x3fd347dd, 0x9a987d55} }, +/**/ {{0xbc64dd4c, 0x580919f8} },}, +/**/ {{{0x3fd37726, 0x62bfd85b} }, +/**/ {{0xbc4b5629, 0xd8117de7} },}, +/**/ {{{0x3fd3a64c, 0x556945ea} }, +/**/ {{0xbc6c6865, 0x1945f97c} },}, +/**/ {{{0x3fd3d54f, 0xa5c1f710} }, +/**/ {{0xbc7e3265, 0xc6a1c98d} },}, +/**/ {{{0x3fd40430, 0x8686a7e4} }, +/**/ {{0xbc70bcfb, 0x6082ce6d} },}, +/**/ {{{0x3fd432ef, 0x2a04e814} }, +/**/ {{0xbc729931, 0x715ac903} },}, +/**/ {{{0x3fd4618b, 0xc21c5ec2} }, +/**/ {{0x3c7f42de, 0xcdeccf1d} },}, +/**/ {{{0x3fd49006, 0x804009d1} }, +/**/ {{0xbc69ffc3, 0x41f177dc} },}, +/**/ {{{0x3fd4be5f, 0x957778a1} }, +/**/ {{0xbc6259b3, 0x5b04813d} },}, +/**/ {{{0x3fd4ec97, 0x3260026a} }, +/**/ {{0xbc742a87, 0xd977dc5e} },}, +/**/ {{{0x3fd51aad, 0x872df82d} }, +/**/ {{0x3c43927a, 0xc19f55e3} },}, +/**/ {{{0x3fd548a2, 0xc3add263} }, +/**/ {{0xbc6819cf, 0x7e308ddb} },}, +/**/ {{{0x3fd57677, 0x17455a6c} }, +/**/ {{0x3c7526ad, 0xb283660c} },}, +/**/ {{{0x3fd5a42a, 0xb0f4cfe2} }, +/**/ {{0xbc78ebcb, 0x7dee9a3d} },}, +/**/ {{{0x3fd5d1bd, 0xbf5809ca} }, +/**/ {{0x3c742363, 0x83dc7fe1} },}, +/**/ {{{0x3fd5ff30, 0x70a793d4} }, +/**/ {{0xbc6bc60e, 0xfafc6f6e} },}, +/**/ {{{0x3fd62c82, 0xf2b9c795} }, +/**/ {{0x3c67b7af, 0x915300e5} },}, + }; + + static const number + Lv[362][2] = { /* log(vj) */ + +/**/ {{{0xbf6687ec, 0xb72daabf} }, +/**/ {{0x3c052c69, 0x0f13318f} },}, +/**/ {{{0xbf6667d6, 0x3767104f} }, +/**/ {{0x3bd3efa3, 0xd27a7bac} },}, +/**/ {{{0xbf6647bf, 0xd7cd64fb} }, +/**/ {{0x3c09b725, 0x55a89c36} },}, +/**/ {{{0xbf6627a9, 0x9860683b} }, +/**/ {{0x3bcbae22, 0xfebc844a} },}, +/**/ {{{0xbf660793, 0x791fd98a} }, +/**/ {{0xbbfe34af, 0x78fa1cb5} },}, +/**/ {{{0xbf65e77d, 0x7a0b7863} }, +/**/ {{0xbc02f1b1, 0xea78fdd0} },}, +/**/ {{{0xbf65c767, 0x9b230442} }, +/**/ {{0x3bf70d8c, 0x2202b2ca} },}, +/**/ {{{0xbf65a751, 0xdc663ca2} }, +/**/ {{0xbbfdc63d, 0xc3444e64} },}, +/**/ {{{0xbf65873c, 0x3dd4e102} }, +/**/ {{0x3c021b11, 0x370d69c3} },}, +/**/ {{{0xbf656726, 0xbf6eb0de} }, +/**/ {{0xbbfb6da8, 0x154dd8d8} },}, +/**/ {{{0xbf654711, 0x61336bb6} }, +/**/ {{0xbc0b12d2, 0xdf9a4709} },}, +/**/ {{{0xbf6526fc, 0x2322d10a} }, +/**/ {{0x3bf997f2, 0x68d1274f} },}, +/**/ {{{0xbf6506e7, 0x053ca059} }, +/**/ {{0x3c0c2a1f, 0xe70c852a} },}, +/**/ {{{0xbf64e6d2, 0x07809924} }, +/**/ {{0x3c04cc9e, 0xa808538f} },}, +/**/ {{{0xbf64c6bd, 0x29ee7aed} }, +/**/ {{0x3befe68c, 0x7797a4bd} },}, +/**/ {{{0xbf64a6a8, 0x6c860537} }, +/**/ {{0x3c06794d, 0x9efaae3d} },}, +/**/ {{{0xbf648693, 0xcf46f784} }, +/**/ {{0xbbfed318, 0xb2ddd9d1} },}, +/**/ {{{0xbf64667f, 0x5231115a} }, +/**/ {{0x3c061f62, 0x4643624b} },}, +/**/ {{{0xbf64466a, 0xf544123c} }, +/**/ {{0x3c0666a0, 0x9387f11e} },}, +/**/ {{{0xbf642656, 0xb87fb9b0} }, +/**/ {{0x3c0043b2, 0x116ec598} },}, +/**/ {{{0xbf640642, 0x9be3c73c} }, +/**/ {{0xbbfbd84d, 0xd2de6e3e} },}, +/**/ {{{0xbf63e62e, 0x9f6ffa68} }, +/**/ {{0xbbe9149b, 0x433d8c65} },}, +/**/ {{{0xbf63c61a, 0xc32412bb} }, +/**/ {{0xbbf6b88d, 0x08e5a7bb} },}, +/**/ {{{0xbf63a607, 0x06ffcfbe} }, +/**/ {{0xbb9f3c7a, 0xccfac9e2} },}, +/**/ {{{0xbf6385f3, 0x6b02f0fa} }, +/**/ {{0x3bee405c, 0xbec6f6e4} },}, +/**/ {{{0xbf6365df, 0xef2d35f9} }, +/**/ {{0x3bf02993, 0xaf0c0b4c} },}, +/**/ {{{0xbf6345cc, 0x937e5e46} }, +/**/ {{0x3bf9be97, 0xaa64716f} },}, +/**/ {{{0xbf6325b9, 0x57f6296c} }, +/**/ {{0xbbfdeb4d, 0xa2e863ae} },}, +/**/ {{{0xbf6305a6, 0x3c9456f9} }, +/**/ {{0x3c0f3c7f, 0x636d2b2c} },}, +/**/ {{{0xbf62e593, 0x4158a678} }, +/**/ {{0x3c01a8df, 0xb166ca7f} },}, +/**/ {{{0xbf62c580, 0x6642d778} }, +/**/ {{0x3c020ff1, 0x53a2d534} },}, +/**/ {{{0xbf62a56d, 0xab52a987} }, +/**/ {{0xbbe8fef1, 0x0412f1e7} },}, +/**/ {{{0xbf62855b, 0x1087dc35} }, +/**/ {{0xbbfcd17e, 0x4b7ac6c6} },}, +/**/ {{{0xbf626548, 0x95e22f12} }, +/**/ {{0xbbfbfc21, 0x9a8127bf} },}, +/**/ {{{0xbf624536, 0x3b6161af} }, +/**/ {{0x3bd7eda1, 0x66d42390} },}, +/**/ {{{0xbf622524, 0x0105339d} }, +/**/ {{0xbbdf374e, 0x77fedcad} },}, +/**/ {{{0xbf620511, 0xe6cd646f} }, +/**/ {{0x3be1d1fb, 0x52d05dea} },}, +/**/ {{{0xbf61e4ff, 0xecb9b3b8} }, +/**/ {{0x3c02c2fc, 0xffd8e706} },}, +/**/ {{{0xbf61c4ee, 0x12c9e10b} }, +/**/ {{0xbc02b4f8, 0xf1d5cc2c} },}, +/**/ {{{0xbf61a4dc, 0x58fdabfe} }, +/**/ {{0xbc0618c3, 0x1315b191} },}, +/**/ {{{0xbf6184ca, 0xbf54d426} }, +/**/ {{0xbc01f8d5, 0xcb3cdab0} },}, +/**/ {{{0xbf6164b9, 0x45cf1919} }, +/**/ {{0xbc014ff7, 0xc025605a} },}, +/**/ {{{0xbf6144a7, 0xec6c3a6e} }, +/**/ {{0xbbff04ff, 0x87cb08cd} },}, +/**/ {{{0xbf612496, 0xb32bf7bd} }, +/**/ {{0x3bee89b4, 0xe6af1b84} },}, +/**/ {{{0xbf610485, 0x9a0e109e} }, +/**/ {{0x3c07e99e, 0x35a60879} },}, +/**/ {{{0xbf60e474, 0xa11244aa} }, +/**/ {{0x3c04b698, 0x20f2325a} },}, +/**/ {{{0xbf60c463, 0xc838537b} }, +/**/ {{0x3bc0657e, 0x3617200d} },}, +/**/ {{{0xbf60a453, 0x0f7ffcac} }, +/**/ {{0xbc008feb, 0xa5080961} },}, +/**/ {{{0xbf608442, 0x76e8ffd9} }, +/**/ {{0x3bd13002, 0xbb5e1df7} },}, +/**/ {{{0xbf606431, 0xfe731c9d} }, +/**/ {{0xbc0509f3, 0x6e2858c0} },}, +/**/ {{{0xbf604421, 0xa61e1296} }, +/**/ {{0xbc04b556, 0x5f5d9695} },}, +/**/ {{{0xbf602411, 0x6de9a162} }, +/**/ {{0x3c042b89, 0xe79a4e00} },}, +/**/ {{{0xbf600401, 0x55d5889e} }, +/**/ {{0x3be8f98e, 0x1113f403} },}, +/**/ {{{0xbf5fc7e2, 0xbbc30fd4} }, +/**/ {{0xbbfc709b, 0x93382bc9} },}, +/**/ {{{0xbf5f87c3, 0x0c1abdcd} }, +/**/ {{0xbbf2a90d, 0x76a55d1c} },}, +/**/ {{{0xbf5f47a3, 0x9cb19a68} }, +/**/ {{0x3be1b815, 0x76e7826b} },}, +/**/ {{{0xbf5f0784, 0x6d8724e7} }, +/**/ {{0xbbe72d46, 0x2b63756d} },}, +/**/ {{{0xbf5ec765, 0x7e9adc90} }, +/**/ {{0x3beb1a66, 0x73bb17c5} },}, +/**/ {{{0xbf5e8746, 0xcfec40a8} }, +/**/ {{0x3bf11af5, 0xb5e5a553} },}, +/**/ {{{0xbf5e4728, 0x617ad077} }, +/**/ {{0x3bfb2cad, 0xf57dd14f} },}, +/**/ {{{0xbf5e070a, 0x33460b45} }, +/**/ {{0xbbf8db75, 0x4902c8d5} },}, +/**/ {{{0xbf5dc6ec, 0x454d705f} }, +/**/ {{0x3bef5cc6, 0xe8a41057} },}, +/**/ {{{0xbf5d86ce, 0x97907f0f} }, +/**/ {{0x3bed8277, 0xdf8672ef} },}, +/**/ {{{0xbf5d46b1, 0x2a0eb6a3} }, +/**/ {{0xbbc2f9c2, 0x3717e5ee} },}, +/**/ {{{0xbf5d0693, 0xfcc7966b} }, +/**/ {{0x3bf4deed, 0xab4852c6} },}, +/**/ {{{0xbf5cc677, 0x0fba9db6} }, +/**/ {{0xbbf3a2b4, 0x9db2a368} },}, +/**/ {{{0xbf5c865a, 0x62e74bd8} }, +/**/ {{0xbbd2c51d, 0x58fa0c24} },}, +/**/ {{{0xbf5c463d, 0xf64d2024} }, +/**/ {{0x3bf838ca, 0xe3a09391} },}, +/**/ {{{0xbf5c0621, 0xc9eb99ee} }, +/**/ {{0xbbdc2a9e, 0x61b7de71} },}, +/**/ {{{0xbf5bc605, 0xddc2388e} }, +/**/ {{0xbbea9808, 0x4accb195} },}, +/**/ {{{0xbf5b85ea, 0x31d07b5c} }, +/**/ {{0xbbd811a2, 0x032e030b} },}, +/**/ {{{0xbf5b45ce, 0xc615e1b1} }, +/**/ {{0xbbfd5427, 0x821e0b81} },}, +/**/ {{{0xbf5b05b3, 0x9a91eaea} }, +/**/ {{0x3bfffeba, 0x2619306b} },}, +/**/ {{{0xbf5ac598, 0xaf441661} }, +/**/ {{0x3bd22824, 0x9eac7d15} },}, +/**/ {{{0xbf5a857e, 0x042be376} }, +/**/ {{0x3bc20736, 0x24893f0e} },}, +/**/ {{{0xbf5a4563, 0x9948d188} }, +/**/ {{0xbbf58ab4, 0x04d734cd} },}, +/**/ {{{0xbf5a0549, 0x6e9a5ff9} }, +/**/ {{0xbbf22673, 0x5723a6c3} },}, +/**/ {{{0xbf59c52f, 0x84200e2c} }, +/**/ {{0x3bfc81da, 0xa538e8e1} },}, +/**/ {{{0xbf598515, 0xd9d95b83} }, +/**/ {{0xbbfa1a37, 0x2a8e3feb} },}, +/**/ {{{0xbf5944fc, 0x6fc5c767} }, +/**/ {{0x3bf8e1ce, 0x385159f9} },}, +/**/ {{{0xbf5904e3, 0x45e4d13c} }, +/**/ {{0xbbfc4737, 0x1567c7a7} },}, +/**/ {{{0xbf58c4ca, 0x5c35f86e} }, +/**/ {{0x3bf41581, 0x23c9ae0c} },}, +/**/ {{{0xbf5884b1, 0xb2b8bc65} }, +/**/ {{0x3bf70c2c, 0x2b66cfb6} },}, +/**/ {{{0xbf584499, 0x496c9c8d} }, +/**/ {{0xbbdb9042, 0xe5a11e3e} },}, +/**/ {{{0xbf580481, 0x20511854} }, +/**/ {{0xbbf9cf9d, 0x61bcb040} },}, +/**/ {{{0xbf57c469, 0x3765af29} }, +/**/ {{0xbbf65ceb, 0xe26a419b} },}, +/**/ {{{0xbf578451, 0x8ea9e07c} }, +/**/ {{0xbbf1c2f5, 0xb70a4088} },}, +/**/ {{{0xbf57443a, 0x261d2bbf} }, +/**/ {{0xbbbc7b8f, 0x29704ba7} },}, +/**/ {{{0xbf570422, 0xfdbf1065} }, +/**/ {{0x3bca0a54, 0x433ccb3b} },}, +/**/ {{{0xbf56c40c, 0x158f0de3} }, +/**/ {{0x3bd9e257, 0x207cde2d} },}, +/**/ {{{0xbf5683f5, 0x6d8ca3af} }, +/**/ {{0xbbef17a4, 0xf7b51b49} },}, +/**/ {{{0xbf5643df, 0x05b75142} }, +/**/ {{0x3be28239, 0x9d345bf8} },}, +/**/ {{{0xbf5603c8, 0xde0e9614} }, +/**/ {{0xbbde6c21, 0x0918d1bf} },}, +/**/ {{{0xbf55c3b2, 0xf691f1a1} }, +/**/ {{0x3bd37d78, 0x377de4c8} },}, +/**/ {{{0xbf55839d, 0x4f40e365} }, +/**/ {{0x3bf52b7d, 0xbbf7c9d1} },}, +/**/ {{{0xbf554387, 0xe81aeadd} }, +/**/ {{0xbbf0be6a, 0x679c3d9a} },}, +/**/ {{{0xbf550372, 0xc11f878a} }, +/**/ {{0xbbdd9e20, 0xb6cdd88e} },}, +/**/ {{{0xbf54c35d, 0xda4e38ec} }, +/**/ {{0xbbe3b1e7, 0x09302da0} },}, +/**/ {{{0xbf548349, 0x33a67e86} }, +/**/ {{0x3be8cba8, 0x085b922d} },}, +/**/ {{{0xbf544334, 0xcd27d7db} }, +/**/ {{0xbba5f2c9, 0xf024ab43} },}, +/**/ {{{0xbf540320, 0xa6d1c471} }, +/**/ {{0xbbeb31f3, 0xf686cf3d} },}, +/**/ {{{0xbf53c30c, 0xc0a3c3cf} }, +/**/ {{0xbbf74ffe, 0xd4ad32f6} },}, +/**/ {{{0xbf5382f9, 0x1a9d557e} }, +/**/ {{0x3bd2e555, 0x4acb368f} },}, +/**/ {{{0xbf5342e5, 0xb4bdf907} }, +/**/ {{0x3be13442, 0x07812806} },}, +/**/ {{{0xbf5302d2, 0x8f052df6} }, +/**/ {{0x3bf5f429, 0x70b1e756} },}, +/**/ {{{0xbf52c2bf, 0xa97273d7} }, +/**/ {{0xbbf20aa3, 0x43a03fff} },}, +/**/ {{{0xbf5282ad, 0x04054a3a} }, +/**/ {{0xbbed4d57, 0x8bebd7ad} },}, +/**/ {{{0xbf52429a, 0x9ebd30ae} }, +/**/ {{0xbbff9529, 0x5a71c5a4} },}, +/**/ {{{0xbf520288, 0x7999a6c6} }, +/**/ {{0x3bfb055a, 0x54100f9e} },}, +/**/ {{{0xbf51c276, 0x949a2c12} }, +/**/ {{0xbbff6978, 0xa2e9f1b4} },}, +/**/ {{{0xbf518264, 0xefbe402a} }, +/**/ {{0x3bf01fb9, 0xbc188323} },}, +/**/ {{{0xbf514253, 0x8b0562a1} }, +/**/ {{0xbbf7c87c, 0x957bf23a} },}, +/**/ {{{0xbf510242, 0x666f1311} }, +/**/ {{0x3bdc2cb9, 0xc8be6880} },}, +/**/ {{{0xbf50c231, 0x81fad111} }, +/**/ {{0xbbf59fc1, 0x07ba000d} },}, +/**/ {{{0xbf508220, 0xdda81c3d} }, +/**/ {{0xbbf06a0a, 0xbf5c8a0b} },}, +/**/ {{{0xbf504210, 0x79767431} }, +/**/ {{0x3bf3a6cf, 0xa9a705bc} },}, +/**/ {{{0xbf500200, 0x55655889} }, +/**/ {{0xbbe9abe6, 0xbf0fa436} },}, +/**/ {{{0xbf4f83e0, 0xe2e891cc} }, +/**/ {{0x3be4aa59, 0x1b81bf62} },}, +/**/ {{{0xbf4f03c1, 0x9b4589ce} }, +/**/ {{0xbbe60518, 0x8a47f50a} },}, +/**/ {{{0xbf4e83a2, 0xd3e0985f} }, +/**/ {{0x3bed32d8, 0x5ef17e96} },}, +/**/ {{{0xbf4e0384, 0x8cb8bcc3} }, +/**/ {{0xbbeb7b30, 0xf09afa4d} },}, +/**/ {{{0xbf4d8366, 0xc5ccf647} }, +/**/ {{0xbbd527fc, 0xf586cec2} },}, +/**/ {{{0xbf4d0349, 0x7f1c4437} }, +/**/ {{0x3bc2bcf0, 0x4a686886} },}, +/**/ {{{0xbf4c832c, 0xb8a5a5e3} }, +/**/ {{0x3bc98f93, 0x721c2ebe} },}, +/**/ {{{0xbf4c0310, 0x72681a9e} }, +/**/ {{0xbbe20f00, 0xb5308d22} },}, +/**/ {{{0xbf4b82f4, 0xac62a1bf} }, +/**/ {{0xbbe1edd0, 0x9737b561} },}, +/**/ {{{0xbf4b02d9, 0x66943a9f} }, +/**/ {{0xbbcc950b, 0x23f894a1} },}, +/**/ {{{0xbf4a82be, 0xa0fbe49a} }, +/**/ {{0xbb81da04, 0x866bc982} },}, +/**/ {{{0xbf4a02a4, 0x5b989f0f} }, +/**/ {{0xbbd9114d, 0x9d76196e} },}, +/**/ {{{0xbf49828a, 0x96696961} }, +/**/ {{0x3bc10d20, 0xd3292fd6} },}, +/**/ {{{0xbf490271, 0x516d42f4} }, +/**/ {{0xbbee53a3, 0x2e9a5dd5} },}, +/**/ {{{0xbf488258, 0x8ca32b32} }, +/**/ {{0xbbc55af5, 0xd18f8004} },}, +/**/ {{{0xbf480240, 0x480a2185} }, +/**/ {{0xbbb32d23, 0xa9b0178a} },}, +/**/ {{{0xbf478228, 0x83a1255c} }, +/**/ {{0x3be84cc3, 0x8152093a} },}, +/**/ {{{0xbf470211, 0x3f673627} }, +/**/ {{0xbbd0055a, 0xf4881c71} },}, +/**/ {{{0xbf4681fa, 0x7b5b535c} }, +/**/ {{0x3bd2b73f, 0xb98336ea} },}, +/**/ {{{0xbf4601e4, 0x377c7c71} }, +/**/ {{0xbbcdcbed, 0x2ed05089} },}, +/**/ {{{0xbf4581ce, 0x73c9b0e1} }, +/**/ {{0xbbdda0c2, 0x61414697} },}, +/**/ {{{0xbf4501b9, 0x3041f02a} }, +/**/ {{0x3bee5d53, 0x22f8b33c} },}, +/**/ {{{0xbf4481a4, 0x6ce439ca} }, +/**/ {{0xbbe5512f, 0x9c25c999} },}, +/**/ {{{0xbf440190, 0x29af8d47} }, +/**/ {{0x3b7f48c2, 0xa4df0dfd} },}, +/**/ {{{0xbf43817c, 0x66a2ea26} }, +/**/ {{0x3bd157c0, 0x517febd8} },}, +/**/ {{{0xbf430169, 0x23bd4ff0} }, +/**/ {{0xbbe2e229, 0x0176d244} },}, +/**/ {{{0xbf428156, 0x60fdbe33} }, +/**/ {{0x3be64664, 0x175812b3} },}, +/**/ {{{0xbf420144, 0x1e63347c} }, +/**/ {{0xbbe39ab4, 0xd9355524} },}, +/**/ {{{0xbf418132, 0x5becb260} }, +/**/ {{0x3be74b27, 0xb6e1edc9} },}, +/**/ {{{0xbf410121, 0x19993772} }, +/**/ {{0xbbaa390b, 0x393ab56a} },}, +/**/ {{{0xbf408110, 0x5767c34c} }, +/**/ {{0x3bd128e6, 0xf8c7783b} },}, +/**/ {{{0xbf400100, 0x15575589} }, +/**/ {{0x3bec8863, 0xf23ef222} },}, +/**/ {{{0xbf3f01e0, 0xa6cddb8d} }, +/**/ {{0x3b8a9419, 0xcdd29c3f} },}, +/**/ {{{0xbf3e01c2, 0x232b174e} }, +/**/ {{0xbbc7cf55, 0xd5f5b191} },}, +/**/ {{{0xbf3d01a4, 0x9fc45d9e} }, +/**/ {{0x3bddc58f, 0xb5038e7e} },}, +/**/ {{{0xbf3c0188, 0x1c97adca} }, +/**/ {{0x3bc0238d, 0xbb933e41} },}, +/**/ {{{0xbf3b016c, 0x99a30728} }, +/**/ {{0xbbabde04, 0xc3c43664} },}, +/**/ {{{0xbf3a0152, 0x16e46913} }, +/**/ {{0x3bafe081, 0x5adc3673} },}, +/**/ {{{0xbf390138, 0x9459d2eb} }, +/**/ {{0xbbd949da, 0xc2a33d26} },}, +/**/ {{{0xbf380120, 0x12014418} }, +/**/ {{0xbbd3acbc, 0xf76e0326} },}, +/**/ {{{0xbf370108, 0x8fd8bc07} }, +/**/ {{0x3bdbde09, 0x4cd6ce34} },}, +/**/ {{{0xbf3600f2, 0x0dde3a29} }, +/**/ {{0xbbb0bc28, 0x05442a35} },}, +/**/ {{{0xbf3500dc, 0x8c0fbdf9} }, +/**/ {{0x3bd21c68, 0x0908cbf7} },}, +/**/ {{{0xbf3400c8, 0x0a6b46f4} }, +/**/ {{0xbbdbd35e, 0x0f107564} },}, +/**/ {{{0xbf3300b4, 0x88eed4a1} }, +/**/ {{0xbbc22067, 0x49a3dcb8} },}, +/**/ {{{0xbf3200a2, 0x0798668a} }, +/**/ {{0x3bcdb7f0, 0xe7c5d0e5} },}, +/**/ {{{0xbf310090, 0x8665fc3f} }, +/**/ {{0xbbd00add, 0xc7f9d69c} },}, +/**/ {{{0xbf300080, 0x05559559} }, +/**/ {{0x3bddd332, 0xa0e20e2f} },}, +/**/ {{{0xbf2e00e1, 0x08ca62e5} }, +/**/ {{0xbbb15ff9, 0x3a04bb77} },}, +/**/ {{{0xbf2c00c4, 0x0725a061} }, +/**/ {{0x3bc88ab0, 0xcc052f3e} },}, +/**/ {{{0xbf2a00a9, 0x05b8e275} }, +/**/ {{0xbbcbba1a, 0xf5f3cbcf} },}, +/**/ {{{0xbf280090, 0x04802882} }, +/**/ {{0x3bcec900, 0xa5bd7bd0} },}, +/**/ {{{0xbf260079, 0x037771ef} }, +/**/ {{0x3bb77ea0, 0x9b7b54fa} },}, +/**/ {{{0xbf240064, 0x029abe33} }, +/**/ {{0xbbc1bbf0, 0x3ae68d18} },}, +/**/ {{{0xbf220051, 0x01e60cd1} }, +/**/ {{0x3bb1dcd9, 0x2b45cfcd} },}, +/**/ {{{0xbf200040, 0x01555d56} }, +/**/ {{0x3bcddd88, 0x863f53f6} },}, +/**/ {{{0xbf1c0062, 0x01c95eb7} }, +/**/ {{0x3bbd88f7, 0xaa4dfd9a} },}, +/**/ {{{0xbf180048, 0x01200510} }, +/**/ {{0xbb984d46, 0x4f3db50b} },}, +/**/ {{{0xbf140032, 0x00a6ad1c} }, +/**/ {{0x3bb2e44b, 0x28ff1135} },}, +/**/ {{{0xbf100020, 0x00555655} }, +/**/ {{0xbbb62224, 0xccd5f17f} },}, +/**/ {{{0xbf080024, 0x004800a2} }, +/**/ {{0xbb484d09, 0x8d690542} },}, +/**/ {{{0xbf000010, 0x00155575} }, +/**/ {{0xbba56222, 0x37779c0a} },}, +/**/ {{{0xbef00008, 0x00055559} }, +/**/ {{0xbb955622, 0x22cccd5f} },}, +/**/ {{{0x00000000, 0x00000000} }, +/**/ {{0x00000000, 0x00000000} },}, +/**/ {{{0x3eeffff0, 0x000aaaa3} }, +/**/ {{0xbb8553bb, 0xbd110fec} },}, +/**/ {{{0x3effffe0, 0x002aaa6b} }, +/**/ {{0xbb953bbb, 0xe6661d42} },}, +/**/ {{{0x3f07ffdc, 0x0047ff5e} }, +/**/ {{0x3b484c90, 0x0d69020e} },}, +/**/ {{{0x3f0fffc0, 0x00aaa8ab} }, +/**/ {{0xbba3bbc1, 0x10fec82c} },}, +/**/ {{{0x3f13ffce, 0x00a6a83a} }, +/**/ {{0xbbb2e45f, 0x81546808} },}, +/**/ {{{0x3f17ffb8, 0x011ffaf0} }, +/**/ {{0x3b984c53, 0x4f3d9b6a} },}, +/**/ {{{0x3f1bff9e, 0x01c94bf5} }, +/**/ {{0xbbbd8990, 0xdaa368ee} },}, +/**/ {{{0x3f1fff80, 0x02aa9aab} }, +/**/ {{0x3b910e66, 0x78af0afc} },}, +/**/ {{{0x3f21ffaf, 0x01e5f330} }, +/**/ {{0xbbb1df8d, 0x26467402} },}, +/**/ {{{0x3f23ff9c, 0x029a9723} }, +/**/ {{0x3bc1b965, 0x303b23b1} },}, +/**/ {{{0x3f25ff87, 0x037738be} }, +/**/ {{0xbbb787a3, 0x53d3dc06} },}, +/**/ {{{0x3f27ff70, 0x047fd782} }, +/**/ {{0xbbced098, 0xa5c0aff0} },}, +/**/ {{{0x3f29ff57, 0x05b872e4} }, +/**/ {{0x3bcbadd4, 0x81c30d42} },}, +/**/ {{{0x3f2bff3c, 0x07250a51} }, +/**/ {{0xbbc89dd6, 0xd6bad8c1} },}, +/**/ {{{0x3f2dff1f, 0x08c99d24} }, +/**/ {{0x3bb12609, 0xaede8ad0} },}, +/**/ {{{0x3f2fff00, 0x0aaa2ab1} }, +/**/ {{0x3ba0bbc0, 0x4dc4e3dc} },}, +/**/ {{{0x3f30ff6f, 0x8665591f} }, +/**/ {{0xbbd013d3, 0x80357b54} },}, +/**/ {{{0x3f31ff5e, 0x07979982} }, +/**/ {{0xbbce0e70, 0x4817ebcd} },}, +/**/ {{{0x3f32ff4b, 0x88edd619} }, +/**/ {{0xbbd72b9e, 0xc582abc3} },}, +/**/ {{{0x3f33ff38, 0x0a6a0e74} }, +/**/ {{0x3bdb81fc, 0xb95bc1fe} },}, +/**/ {{{0x3f34ff23, 0x8c0e4220} }, +/**/ {{0x3bcaed12, 0x9b549aae} },}, +/**/ {{{0x3f35ff0e, 0x0ddc70a1} }, +/**/ {{0x3bacf6f3, 0xd97a3c05} },}, +/**/ {{{0x3f36fef7, 0x8fd69976} }, +/**/ {{0x3bab2dcf, 0x6f810a3c} },}, +/**/ {{{0x3f37fee0, 0x11febc18} }, +/**/ {{0x3bd2b9bc, 0xf5d3f323} },}, +/**/ {{{0x3f38fec7, 0x9456d7fb} }, +/**/ {{0xbbbfb258, 0x6eaa1d6a} },}, +/**/ {{{0x3f39feae, 0x16e0ec8b} }, +/**/ {{0xbbb6137a, 0xceeb34b1} },}, +/**/ {{{0x3f3afe93, 0x999ef930} }, +/**/ {{0xbbde70e0, 0xdc639b08} },}, +/**/ {{{0x3f3bfe78, 0x1c92fd4a} }, +/**/ {{0xbbc4ed10, 0x713cc126} },}, +/**/ {{{0x3f3cfe5b, 0x9fbef835} }, +/**/ {{0xbb873d63, 0xcc0e81bd} },}, +/**/ {{{0x3f3dfe3e, 0x2324e946} }, +/**/ {{0x3bc09164, 0x62dd5deb} },}, +/**/ {{{0x3f3efe1f, 0xa6c6cfcc} }, +/**/ {{0x3bdac2da, 0x3512d15c} },}, +/**/ {{{0x3f3ffe00, 0x2aa6ab11} }, +/**/ {{0x3b999e2b, 0x62cc632d} },}, +/**/ {{{0x3f407eef, 0xd7633d2c} }, +/**/ {{0xbbebc98b, 0x63ff6024} },}, +/**/ {{{0x3f40fedf, 0x19941e6e} }, +/**/ {{0xbbb194c2, 0xe0aa6338} },}, +/**/ {{{0x3f417ecd, 0xdbe6f8eb} }, +/**/ {{0x3be4241b, 0x57b0f571} },}, +/**/ {{{0x3f41febc, 0x1e5ccc3c} }, +/**/ {{0x3bdc657d, 0x895d3592} },}, +/**/ {{{0x3f427ea9, 0xe0f697f6} }, +/**/ {{0x3be35a5d, 0x1c0ec17c} },}, +/**/ {{{0x3f42fe97, 0x23b55bac} }, +/**/ {{0x3bd6cfb7, 0x3e538464} },}, +/**/ {{{0x3f437e83, 0xe69a16ed} }, +/**/ {{0x3bee96f7, 0x7cef2478} },}, +/**/ {{{0x3f43fe70, 0x29a5c947} }, +/**/ {{0xbbd4d578, 0xbf46e36a} },}, +/**/ {{{0x3f447e5b, 0xecd97242} }, +/**/ {{0xbbc9eb66, 0x3ff7dd44} },}, +/**/ {{{0x3f44fe47, 0x30361165} }, +/**/ {{0x3be400d7, 0x7e93f2fd} },}, +/**/ {{{0x3f457e31, 0xf3bca635} }, +/**/ {{0xbbe0e2a2, 0xd375017f} },}, +/**/ {{{0x3f45fe1c, 0x376e3031} }, +/**/ {{0xbbd524eb, 0x8a5ae7f6} },}, +/**/ {{{0x3f467e05, 0xfb4baed7} }, +/**/ {{0x3be204fb, 0x4e85c4e9} },}, +/**/ {{{0x3f46fdef, 0x3f5621a3} }, +/**/ {{0xbbdf09d7, 0x34886d52} },}, +/**/ {{{0x3f477dd8, 0x038e880b} }, +/**/ {{0xbbb8900e, 0x14e596a3} },}, +/**/ {{{0x3f47fdc0, 0x47f5e185} }, +/**/ {{0xbbebfa5c, 0x57d202d3} },}, +/**/ {{{0x3f487da8, 0x0c8d2d81} }, +/**/ {{0x3be2f6ae, 0xd68c0614} },}, +/**/ {{{0x3f48fd8f, 0x51556b70} }, +/**/ {{0xbbd0f4f2, 0xe08fd201} },}, +/**/ {{{0x3f497d76, 0x164f9abc} }, +/**/ {{0x3b5296b7, 0xa871af60} },}, +/**/ {{{0x3f49fd5c, 0x5b7cbace} }, +/**/ {{0x3beb6ed4, 0x9f17d42d} },}, +/**/ {{{0x3f4a7d42, 0x20ddcb0d} }, +/**/ {{0xbbcb1149, 0x67c30397} },}, +/**/ {{{0x3f4afd27, 0x6673cada} }, +/**/ {{0x3bd32225, 0x45da594f} },}, +/**/ {{{0x3f4b7d0c, 0x2c3fb996} }, +/**/ {{0xbbb68893, 0x208d4630} },}, +/**/ {{{0x3f4bfcf0, 0x7242969d} }, +/**/ {{0x3bc5db4d, 0x2b3efe1c} },}, +/**/ {{{0x3f4c7cd4, 0x387d6149} }, +/**/ {{0x3be46eff, 0xed57d98a} },}, +/**/ {{{0x3f4cfcb7, 0x7ef118f1} }, +/**/ {{0x3becc554, 0x06f300fb} },}, +/**/ {{{0x3f4d7c9a, 0x459ebce9} }, +/**/ {{0x3be1d251, 0x13638eb6} },}, +/**/ {{{0x3f4dfc7c, 0x8c874c82} }, +/**/ {{0xbbe863e9, 0xd57a176f} },}, +/**/ {{{0x3f4e7c5e, 0x53abc708} }, +/**/ {{0x3be2d95c, 0x9528e50d} },}, +/**/ {{{0x3f4efc3f, 0x9b0d2bc8} }, +/**/ {{0x3bd1e8e8, 0xa5f5b8b7} },}, +/**/ {{{0x3f4f7c20, 0x62ac7a09} }, +/**/ {{0x3b5c8123, 0x17802a46} },}, +/**/ {{{0x3f4ffc00, 0xaa8ab110} }, +/**/ {{0xbbe0fecb, 0xeb9b6cdb} },}, +/**/ {{{0x3f503df0, 0x3954680f} }, +/**/ {{0x3bdac89b, 0x1c693678} },}, +/**/ {{{0x3f507ddf, 0xdd83eb3a} }, +/**/ {{0xbbf638f6, 0x0a75ad5f} },}, +/**/ {{{0x3f50bdcf, 0x41d461a5} }, +/**/ {{0x3bfd4bc9, 0x45f05b10} },}, +/**/ {{{0x3f50fdbe, 0x66464aef} }, +/**/ {{0xbbbd0554, 0x6abbf59c} },}, +/**/ {{{0x3f513dad, 0x4ada26b1} }, +/**/ {{0x3be38c65, 0x6036fe6f} },}, +/**/ {{{0x3f517d9b, 0xef907485} }, +/**/ {{0x3bfdc8a1, 0xf158bbc3} },}, +/**/ {{{0x3f51bd8a, 0x5469b404} }, +/**/ {{0xbbdea231, 0x55632e3f} },}, +/**/ {{{0x3f51fd78, 0x796664c3} }, +/**/ {{0xbbe00849, 0x2edb73c2} },}, +/**/ {{{0x3f523d66, 0x5e870657} }, +/**/ {{0x3bfba943, 0x0789343e} },}, +/**/ {{{0x3f527d54, 0x03cc1855} }, +/**/ {{0x3bc5f644, 0xeafafc52} },}, +/**/ {{{0x3f52bd41, 0x69361a4e} }, +/**/ {{0xbbf2f743, 0xa4a6e79f} },}, +/**/ {{{0x3f52fd2e, 0x8ec58bd2} }, +/**/ {{0xbbd4f786, 0x5ceb1abf} },}, +/**/ {{{0x3f533d1b, 0x747aec71} }, +/**/ {{0xbbf369e3, 0x49dc497d} },}, +/**/ {{{0x3f537d08, 0x1a56bbb8} }, +/**/ {{0xbbfc5e6f, 0x3726b14a} },}, +/**/ {{{0x3f53bcf4, 0x80597933} }, +/**/ {{0xbbfe8b82, 0x808f75a7} },}, +/**/ {{{0x3f53fce0, 0xa683a46c} }, +/**/ {{0x3be02719, 0x9cd06ae6} },}, +/**/ {{{0x3f543ccc, 0x8cd5bced} }, +/**/ {{0x3bf9f98d, 0x758f80f8} },}, +/**/ {{{0x3f547cb8, 0x3350423e} }, +/**/ {{0xbbd79c3d, 0x48401f45} },}, +/**/ {{{0x3f54bca3, 0x99f3b3e4} }, +/**/ {{0xbbf422b8, 0x2fba8948} },}, +/**/ {{{0x3f54fc8e, 0xc0c09163} }, +/**/ {{0x3bf32cc1, 0xf4044be8} },}, +/**/ {{{0x3f553c79, 0xa7b75a40} }, +/**/ {{0xbbe72cac, 0xf2249008} },}, +/**/ {{{0x3f557c64, 0x4ed88dfb} }, +/**/ {{0xbbe7183c, 0x459a204f} },}, +/**/ {{{0x3f55bc4e, 0xb624ac14} }, +/**/ {{0x3bf8aa64, 0xba26d3d7} },}, +/**/ {{{0x3f55fc38, 0xdd9c340b} }, +/**/ {{0x3bdbb2ff, 0x45fa193c} },}, +/**/ {{{0x3f563c22, 0xc53fa55c} }, +/**/ {{0x3bd67249, 0x0484397b} },}, +/**/ {{{0x3f567c0c, 0x6d0f7f83} }, +/**/ {{0xbbd183d7, 0xf1e73188} },}, +/**/ {{{0x3f56bbf5, 0xd50c41fa} }, +/**/ {{0xbbef433d, 0x4ab68187} },}, +/**/ {{{0x3f56fbde, 0xfd366c39} }, +/**/ {{0x3be796b8, 0x66e09e58} },}, +/**/ {{{0x3f573bc7, 0xe58e7db8} }, +/**/ {{0x3bf65ec5, 0x81e6e7e6} },}, +/**/ {{{0x3f577bb0, 0x8e14f5ed} }, +/**/ {{0xbbdb944d, 0xa9463a9c} },}, +/**/ {{{0x3f57bb98, 0xf6ca544b} }, +/**/ {{0xbbc396ec, 0xc5eda344} },}, +/**/ {{{0x3f57fb81, 0x1faf1845} }, +/**/ {{0x3beb9e6d, 0xbb624f97} },}, +/**/ {{{0x3f583b69, 0x08c3c14d} }, +/**/ {{0xbbe6ee13, 0xe6295bf2} },}, +/**/ {{{0x3f587b50, 0xb208ced1} }, +/**/ {{0x3bfcf1a5, 0x6ca19875} },}, +/**/ {{{0x3f58bb38, 0x1b7ec041} }, +/**/ {{0x3bf2d181, 0x07b4fc7e} },}, +/**/ {{{0x3f58fb1f, 0x45261509} }, +/**/ {{0x3bc419c5, 0x21bad336} },}, +/**/ {{{0x3f593b06, 0x2eff4c94} }, +/**/ {{0xbbdc2a4c, 0x700b305b} },}, +/**/ {{{0x3f597aec, 0xd90ae64c} }, +/**/ {{0xbbfc53d3, 0xa23f359c} },}, +/**/ {{{0x3f59bad3, 0x43496198} }, +/**/ {{0x3bf0c270, 0xaed6b50f} },}, +/**/ {{{0x3f59fab9, 0x6dbb3de1} }, +/**/ {{0xbbf11464, 0x7a8be031} },}, +/**/ {{{0x3f5a3a9f, 0x5860fa8a} }, +/**/ {{0x3beae9e7, 0x470dbe32} },}, +/**/ {{{0x3f5a7a85, 0x033b16f8} }, +/**/ {{0x3bfc4721, 0xda1f8579} },}, +/**/ {{{0x3f5aba6a, 0x6e4a128e} }, +/**/ {{0xbbf41852, 0x029258ce} },}, +/**/ {{{0x3f5afa4f, 0x998e6cab} }, +/**/ {{0xbbf28584, 0x2eb18782} },}, +/**/ {{{0x3f5b3a34, 0x8508a4af} }, +/**/ {{0xbbea7970, 0x23241a2c} },}, +/**/ {{{0x3f5b7a19, 0x30b939f8} }, +/**/ {{0xbbf1d8db, 0x600551b6} },}, +/**/ {{{0x3f5bb9fd, 0x9ca0abe2} }, +/**/ {{0xbbeaa412, 0x8c26cc71} },}, +/**/ {{{0x3f5bf9e1, 0xc8bf79c8} }, +/**/ {{0xbbe7f81b, 0x30427cfc} },}, +/**/ {{{0x3f5c39c5, 0xb5162303} }, +/**/ {{0x3bd9ec5f, 0xd1f134e1} },}, +/**/ {{{0x3f5c79a9, 0x61a526eb} }, +/**/ {{0x3bff0cb0, 0x8980e47d} },}, +/**/ {{{0x3f5cb98c, 0xce6d04d7} }, +/**/ {{0x3bf35aca, 0xe84ca4e2} },}, +/**/ {{{0x3f5cf96f, 0xfb6e3c1b} }, +/**/ {{0x3bf9b1b8, 0x1b0bd69f} },}, +/**/ {{{0x3f5d3952, 0xe8a94c0b} }, +/**/ {{0x3be21310, 0x3ce51832} },}, +/**/ {{{0x3f5d7935, 0x961eb3f8} }, +/**/ {{0x3bf90786, 0x840c58ce} },}, +/**/ {{{0x3f5db918, 0x03cef334} }, +/**/ {{0xbbfe0048, 0xf2dfb3f4} },}, +/**/ {{{0x3f5df8fa, 0x31ba890b} }, +/**/ {{0x3bfcf652, 0x3e295bec} },}, +/**/ {{{0x3f5e38dc, 0x1fe1f4ce} }, +/**/ {{0xbbfc5ebe, 0x151c9300} },}, +/**/ {{{0x3f5e78bd, 0xce45b5c6} }, +/**/ {{0xbbef2cc4, 0x8a25b9c7} },}, +/**/ {{{0x3f5eb89f, 0x3ce64b3e} }, +/**/ {{0x3bfe6d27, 0xa6fea7bd} },}, +/**/ {{{0x3f5ef880, 0x6bc43481} }, +/**/ {{0xbbf68037, 0x914a6dab} },}, +/**/ {{{0x3f5f3861, 0x5adff0d4} }, +/**/ {{0xbbf1d2f3, 0xf909e0e6} },}, +/**/ {{{0x3f5f7842, 0x0a39ff7e} }, +/**/ {{0xbbf64661, 0xff1e1f71} },}, +/**/ {{{0x3f5fb822, 0x79d2dfc3} }, +/**/ {{0xbbd76ce8, 0x5a6f9e9a} },}, +/**/ {{{0x3f5ff802, 0xa9ab10e6} }, +/**/ {{0x3bfe29e3, 0xa153e3b2} },}, +/**/ {{{0x3f601bf1, 0x4ce18915} }, +/**/ {{0xbbe57c28, 0xa3a73044} },}, +/**/ {{{0x3f603be1, 0x250db166} }, +/**/ {{0x3c0fd271, 0xc1ad9590} },}, +/**/ {{{0x3f605bd0, 0xdd5a4107} }, +/**/ {{0x3bfe4b5d, 0xc424c676} },}, +/**/ {{{0x3f607bc0, 0x75c77796} }, +/**/ {{0xbc068804, 0xc0eff1ba} },}, +/**/ {{{0x3f609baf, 0xee5594b0} }, +/**/ {{0xbc0ff798, 0x51dbded5} },}, +/**/ {{{0x3f60bb9f, 0x4704d7f2} }, +/**/ {{0xbbf70ef4, 0x2d5aba70} },}, +/**/ {{{0x3f60db8e, 0x7fd580f9} }, +/**/ {{0xbbeccb65, 0x7ae804b5} },}, +/**/ {{{0x3f60fb7d, 0x98c7cf60} }, +/**/ {{0x3bfede2f, 0x1775134d} },}, +/**/ {{{0x3f611b6c, 0x91dc02c3} }, +/**/ {{0xbc04d41e, 0x91ca4a67} },}, +/**/ {{{0x3f613b5b, 0x6b125aba} }, +/**/ {{0x3bfe6d0c, 0x4a12201d} },}, +/**/ {{{0x3f615b4a, 0x246b16e0} }, +/**/ {{0x3bfe507d, 0x4d4238d3} },}, +/**/ {{{0x3f617b38, 0xbde676cd} }, +/**/ {{0x3bfe0272, 0x0640462a} },}, +/**/ {{{0x3f619b27, 0x3784ba19} }, +/**/ {{0x3bd94ab3, 0x02285659} },}, +/**/ {{{0x3f61bb15, 0x9146205b} }, +/**/ {{0xbbff1e2e, 0x1cc35b7b} },}, +/**/ {{{0x3f61db03, 0xcb2ae929} }, +/**/ {{0xbc03ee8e, 0x12f6bf8d} },}, +/**/ {{{0x3f61faf1, 0xe5335418} }, +/**/ {{0x3c0bae5f, 0x7b7d619b} },}, +/**/ {{{0x3f621adf, 0xdf5fa0bf} }, +/**/ {{0xbbf5546a, 0xb3b731b0} },}, +/**/ {{{0x3f623acd, 0xb9b00eb0} }, +/**/ {{0xbbafb2b0, 0x105fd253} },}, +/**/ {{{0x3f625abb, 0x7424dd7f} }, +/**/ {{0x3c011647, 0xca53444b} },}, +/**/ {{{0x3f627aa9, 0x0ebe4cbf} }, +/**/ {{0x3c01678f, 0x592f3be8} },}, +/**/ {{{0x3f629a96, 0x897c9c02} }, +/**/ {{0xbbef2b12, 0x4347451d} },}, +/**/ {{{0x3f62ba83, 0xe4600ad8} }, +/**/ {{0x3bfb5bb7, 0xb2a477bc} },}, +/**/ {{{0x3f62da71, 0x1f68d8d3} }, +/**/ {{0xbc0590e1, 0x7a5822e4} },}, +/**/ {{{0x3f62fa5e, 0x3a974581} }, +/**/ {{0xbbf0f2e5, 0x53123101} },}, +/**/ {{{0x3f631a4b, 0x35eb9072} }, +/**/ {{0xbc018db4, 0x0e3f5fde} },}, +/**/ {{{0x3f633a38, 0x1165f933} }, +/**/ {{0x3c0921d5, 0x8d0afb38} },}, +/**/ {{{0x3f635a24, 0xcd06bf53} }, +/**/ {{0x3c01f6ba, 0xb5791b80} },}, +/**/ {{{0x3f637a11, 0x68ce225e} }, +/**/ {{0x3bde2af8, 0xa1894236} },}, +/**/ {{{0x3f6399fd, 0xe4bc61e0} }, +/**/ {{0xbc062a48, 0xd0f06ff3} },}, +/**/ {{{0x3f63b9ea, 0x40d1bd63} }, +/**/ {{0x3bffc80c, 0x4b4f9c11} },}, +/**/ {{{0x3f63d9d6, 0x7d0e7473} }, +/**/ {{0x3c02219b, 0x6a92c891} },}, +/**/ {{{0x3f63f9c2, 0x9972c699} }, +/**/ {{0x3c0d3590, 0x790ade9e} },}, +/**/ {{{0x3f6419ae, 0x95fef35f} }, +/**/ {{0xbc01c279, 0x792a458c} },}, +/**/ {{{0x3f64399a, 0x72b33a4b} }, +/**/ {{0x3c02ce64, 0x327bffae} },}, +/**/ {{{0x3f645986, 0x2f8fdae7} }, +/**/ {{0xbc070aec, 0xd231155c} },}, +/**/ {{{0x3f647971, 0xcc9514b7} }, +/**/ {{0x3c0f373d, 0xe4bbf776} },}, +/**/ {{{0x3f64995d, 0x49c32744} }, +/**/ {{0xbbf6d7e5, 0xbf22b2a7} },}, +/**/ {{{0x3f64b948, 0xa71a5211} }, +/**/ {{0xbbedec69, 0x64fe2936} },}, +/**/ {{{0x3f64d933, 0xe49ad4a3} }, +/**/ {{0x3bf5fc4b, 0xabee4257} },}, +/**/ {{{0x3f64f91f, 0x0244ee7e} }, +/**/ {{0x3c0c6fe3, 0x3cd1474f} },}, +/**/ {{{0x3f65190a, 0x0018df26} }, +/**/ {{0xbc023957, 0xd11e7fa5} },}, +/**/ {{{0x3f6538f4, 0xde16e61b} }, +/**/ {{0x3c006c31, 0x55380346} },}, +/**/ {{{0x3f6558df, 0x9c3f42e1} }, +/**/ {{0xbc09b7d4, 0xc4a5134c} },}, +/**/ {{{0x3f6578ca, 0x3a9234f7} }, +/**/ {{0xbc0e3f10, 0x2772c19c} },}, +/**/ {{{0x3f6598b4, 0xb90ffbdd} }, +/**/ {{0x3be6f110, 0x5592b468} },}, +/**/ {{{0x3f65b89f, 0x17b8d714} }, +/**/ {{0xbc0a5fea, 0xb251ace2} },}, +/**/ {{{0x3f65d889, 0x568d0619} }, +/**/ {{0xbc0aacc9, 0x315da285} },}, +/**/ {{{0x3f65f873, 0x758cc86a} }, +/**/ {{0xbbeb0782, 0xba64d81a} },}, +/**/ {{{0x3f66185d, 0x74b85d85} }, +/**/ {{0xbc09b459, 0x8e1eb3fa} },}, +/**/ {{{0x3f663847, 0x541004e5} }, +/**/ {{0x3bce9c22, 0x1d86e863} },}, +/**/ {{{0x3f665831, 0x1393fe07} }, +/**/ {{0xbbfbeb77, 0xcf37ee90} },}, +/**/ {{{0x3f66781a, 0xb3448865} }, +/**/ {{0xbc02dc68, 0xc252e3c9} },}, +/**/ {{{0x3f669804, 0x3321e379} }, +/**/ {{0xbbe73a0b, 0xb40b3741} },}, + }; + +#else +#ifdef LITTLE_ENDI + static const number + Iu[182] = { /* 1/ui */ +/**/ {{0xd1537290, 0x3ff6a13c} }, +/**/ {{0x16816817, 0x3ff68168} }, +/**/ {{0x6a5122f9, 0x3ff661ec} }, +/**/ {{0x590b2164, 0x3ff642c8} }, +/**/ {{0x77016240, 0x3ff623fa} }, +/**/ {{0x60581606, 0x3ff60581} }, +/**/ {{0xb8d015e7, 0x3ff5e75b} }, +/**/ {{0x2b931057, 0x3ff5c988} }, +/**/ {{0x6b015ac0, 0x3ff5ac05} }, +/**/ {{0x308158ed, 0x3ff58ed2} }, +/**/ {{0x3c506b3a, 0x3ff571ed} }, +/**/ {{0x55555555, 0x3ff55555} }, +/**/ {{0x48f40feb, 0x3ff53909} }, +/**/ {{0xeae2f815, 0x3ff51d07} }, +/**/ {{0x15015015, 0x3ff50150} }, +/**/ {{0xa72f0539, 0x3ff4e5e0} }, +/**/ {{0x8725af6e, 0x3ff4cab8} }, +/**/ {{0xa052bf5b, 0x3ff4afd6} }, +/**/ {{0xe3b2d067, 0x3ff49539} }, +/**/ {{0x47ae147b, 0x3ff47ae1} }, +/**/ {{0xc7f5cf9a, 0x3ff460cb} }, +/**/ {{0x6562d9fb, 0x3ff446f8} }, +/**/ {{0x25d51f87, 0x3ff42d66} }, +/**/ {{0x14141414, 0x3ff41414} }, +/**/ {{0x3fb013fb, 0x3ff3fb01} }, +/**/ {{0xbce4a902, 0x3ff3e22c} }, +/**/ {{0xa47babe7, 0x3ff3c995} }, +/**/ {{0x13b13b14, 0x3ff3b13b} }, +/**/ {{0x2c187f63, 0x3ff3991c} }, +/**/ {{0x13813814, 0x3ff38138} }, +/**/ {{0xf3de0748, 0x3ff3698d} }, +/**/ {{0xfb2b78c1, 0x3ff3521c} }, +/**/ {{0x5b57bcb2, 0x3ff33ae4} }, +/**/ {{0x4a2b10bf, 0x3ff323e3} }, +/**/ {{0x0130d190, 0x3ff30d19} }, +/**/ {{0xbda12f68, 0x3ff2f684} }, +/**/ {{0xc04b8097, 0x3ff2e025} }, +/**/ {{0x4d812ca0, 0x3ff2c9fb} }, +/**/ {{0xad012b40, 0x3ff2b404} }, +/**/ {{0x29e4129e, 0x3ff29e41} }, +/**/ {{0x1288b013, 0x3ff288b0} }, +/**/ {{0xb8812735, 0x3ff27350} }, +/**/ {{0x708092f1, 0x3ff25e22} }, +/**/ {{0x92492492, 0x3ff24924} }, +/**/ {{0x789abcdf, 0x3ff23456} }, +/**/ {{0x8121fb78, 0x3ff21fb7} }, +/**/ {{0x0c67c0d9, 0x3ff20b47} }, +/**/ {{0x7dc11f70, 0x3ff1f704} }, +/**/ {{0x3b3fb874, 0x3ff1e2ef} }, +/**/ {{0xada2811d, 0x3ff1cf06} }, +/**/ {{0x4046ed29, 0x3ff1bb4a} }, +/**/ {{0x611a7b96, 0x3ff1a7b9} }, +/**/ {{0x808ca29c, 0x3ff19453} }, +/**/ {{0x11811812, 0x3ff18118} }, +/**/ {{0x89427379, 0x3ff16e06} }, +/**/ {{0x5f75270d, 0x3ff15b1e} }, +/**/ {{0x0e0acd3b, 0x3ff1485f} }, +/**/ {{0x1135c811, 0x3ff135c8} }, +/**/ {{0xe75d3033, 0x3ff12358} }, +/**/ {{0x11111111, 0x3ff11111} }, +/**/ {{0x10fef011, 0x3ff0fef0} }, +/**/ {{0x6be69c90, 0x3ff0ecf5} }, +/**/ {{0xa88f4696, 0x3ff0db20} }, +/**/ {{0x4fbcda3b, 0x3ff0c971} }, +/**/ {{0xec259dc8, 0x3ff0b7e6} }, +/**/ {{0x0a6810a7, 0x3ff0a681} }, +/**/ {{0x39010954, 0x3ff0953f} }, +/**/ {{0x08421084, 0x3ff08421} }, +/**/ {{0x0a47f7c6, 0x3ff07326} }, +/**/ {{0xd2f1a9fc, 0x3ff0624d} }, +/**/ {{0xf7d73404, 0x3ff05197} }, +/**/ {{0x10410410, 0x3ff04104} }, +/**/ {{0xb51f5e1a, 0x3ff03091} }, +/**/ {{0x81020408, 0x3ff02040} }, +/**/ {{0x10101010, 0x3ff01010} }, +/**/ {{0x00000000, 0x3ff00000} }, +/**/ {{0xe01fe020, 0x3fefe01f} }, +/**/ {{0x01fc07f0, 0x3fefc07f} }, +/**/ {{0xaa01fa12, 0x3fefa11c} }, +/**/ {{0x1f81f820, 0x3fef81f8} }, +/**/ {{0xaca0dbb5, 0x3fef6310} }, +/**/ {{0x9e4a4271, 0x3fef4465} }, +/**/ {{0x44230ab5, 0x3fef25f6} }, +/**/ {{0xf07c1f08, 0x3fef07c1} }, +/**/ {{0xf8458e02, 0x3feee9c7} }, +/**/ {{0xb301ecc0, 0x3feecc07} }, +/**/ {{0x7aba01eb, 0x3feeae80} }, +/**/ {{0xabf0b767, 0x3fee9131} }, +/**/ {{0xa59750e4, 0x3fee741a} }, +/**/ {{0xc901e574, 0x3fee573a} }, +/**/ {{0x79dc1a73, 0x3fee3a91} }, +/**/ {{0x1e1e1e1e, 0x3fee1e1e} }, +/**/ {{0x1e01e01e, 0x3fee01e0} }, +/**/ {{0xe3f8868a, 0x3fede5d6} }, +/**/ {{0xdca01dca, 0x3fedca01} }, +/**/ {{0x76b981db, 0x3fedae60} }, +/**/ {{0x231e7f8a, 0x3fed92f2} }, +/**/ {{0x54b82c34, 0x3fed77b6} }, +/**/ {{0x807572b2, 0x3fed5cac} }, +/**/ {{0x1d41d41d, 0x3fed41d4} }, +/**/ {{0xa3fc5b1a, 0x3fed272c} }, +/**/ {{0x8f6ec074, 0x3fed0cb5} }, +/**/ {{0x5c44bfc6, 0x3fecf26e} }, +/**/ {{0x89039b0b, 0x3fecd856} }, +/**/ {{0x9601cbe7, 0x3fecbe6d} }, +/**/ {{0x055ee191, 0x3feca4b3} }, +/**/ {{0x5afb8a42, 0x3fec8b26} }, +/**/ {{0x1c71c71c, 0x3fec71c7} }, +/**/ {{0xd10d4986, 0x3fec5894} }, +/**/ {{0x01c3f8f0, 0x3fec3f8f} }, +/**/ {{0x392ea01c, 0x3fec26b5} }, +/**/ {{0x0381c0e0, 0x3fec0e07} }, +/**/ {{0xee868d8b, 0x3febf583} }, +/**/ {{0x899406f7, 0x3febdd2b} }, +/**/ {{0x65883e7b, 0x3febc4fd} }, +/**/ {{0x14c1bad0, 0x3febacf9} }, +/**/ {{0x2b18ff23, 0x3feb951e} }, +/**/ {{0x3dda338b, 0x3feb7d6c} }, +/**/ {{0xe3beee05, 0x3feb65e2} }, +/**/ {{0xb4e81b4f, 0x3feb4e81} }, +/**/ {{0x4ad806ce, 0x3feb3748} }, +/**/ {{0x406c80d9, 0x3feb2036} }, +/**/ {{0x31d922a4, 0x3feb094b} }, +/**/ {{0xbca1af28, 0x3feaf286} }, +/**/ {{0x7f94905e, 0x3feadbe8} }, +/**/ {{0x1ac5701b, 0x3feac570} }, +/**/ {{0x2f87ebfd, 0x3feaaf1d} }, +/**/ {{0x606a63be, 0x3fea98ef} }, +/**/ {{0x5130e159, 0x3fea82e6} }, +/**/ {{0xa6d01a6d, 0x3fea6d01} }, +/**/ {{0x07688a4a, 0x3fea5741} }, +/**/ {{0x1a41a41a, 0x3fea41a4} }, +/**/ {{0x87c51ca0, 0x3fea2c2a} }, +/**/ {{0xf97a4b02, 0x3fea16d3} }, +/**/ {{0x1a01a01a, 0x3fea01a0} }, +/**/ {{0x951033d9, 0x3fe9ec8e} }, +/**/ {{0x176b682d, 0x3fe9d79f} }, +/**/ {{0x4ee4a102, 0x3fe9c2d1} }, +/**/ {{0xea5510da, 0x3fe9ae24} }, +/**/ {{0x9999999a, 0x3fe99999} }, +/**/ {{0x0d8ec0ff, 0x3fe9852f} }, +/**/ {{0xf80cb872, 0x3fe970e4} }, +/**/ {{0x0be377ae, 0x3fe95cbb} }, +/**/ {{0xfcd6e9e0, 0x3fe948b0} }, +/**/ {{0x7f9b2ce6, 0x3fe934c6} }, +/**/ {{0x49d0e229, 0x3fe920fb} }, +/**/ {{0x120190d5, 0x3fe90d4f} }, +/**/ {{0x8f9c18fa, 0x3fe8f9c1} }, +/**/ {{0x7af1373f, 0x3fe8e652} }, +/**/ {{0x8d3018d3, 0x3fe8d301} }, +/**/ {{0x8062ff3a, 0x3fe8bfce} }, +/**/ {{0x0f6bf3aa, 0x3fe8acb9} }, +/**/ {{0xf601899c, 0x3fe899c0} }, +/**/ {{0xf0abb04a, 0x3fe886e5} }, +/**/ {{0xbcc092b9, 0x3fe87427} }, +/**/ {{0x18618618, 0x3fe86186} }, +/**/ {{0xc2780614, 0x3fe84f00} }, +/**/ {{0x7ab2bedd, 0x3fe83c97} }, +/**/ {{0x0182a4a0, 0x3fe82a4a} }, +/**/ {{0x18181818, 0x3fe81818} }, +/**/ {{0x80601806, 0x3fe80601} }, +/**/ {{0xfd017f40, 0x3fe7f405} }, +/**/ {{0x515a4f1d, 0x3fe7e225} }, +/**/ {{0x417d05f4, 0x3fe7d05f} }, +/**/ {{0x922e017c, 0x3fe7beb3} }, +/**/ {{0x08e0ecc3, 0x3fe7ad22} }, +/**/ {{0x6bb6398b, 0x3fe79baa} }, +/**/ {{0x8178a4c8, 0x3fe78a4c} }, +/**/ {{0x119ac60d, 0x3fe77908} }, +/**/ {{0xe434a9b1, 0x3fe767dc} }, +/**/ {{0xc201756d, 0x3fe756ca} }, +/**/ {{0x745d1746, 0x3fe745d1} }, +/**/ {{0xc541fe8d, 0x3fe734f0} }, +/**/ {{0x7f46debc, 0x3fe72428} }, +/**/ {{0x6d9c7c09, 0x3fe71378} }, +/**/ {{0x5c0b8170, 0x3fe702e0} }, +/**/ {{0x16f26017, 0x3fe6f260} }, +/**/ {{0x6b4337c7, 0x3fe6e1f7} }, +/**/ {{0x2681c861, 0x3fe6d1a6} }, +/**/ {{0x16c16c17, 0x3fe6c16c} }, +/**/ {{0x0aa31a3d, 0x3fe6b149} }, +/**/ {{0xd1537290, 0x3fe6a13c} }, + }; + + static const number + Iv[362] = { /* 1/vj */ +/**/ {{0xee93bfe3, 0x3ff00b47} }, +/**/ {{0xd80c106f, 0x3ff00b37} }, +/**/ {{0xc1a4a47a, 0x3ff00b27} }, +/**/ {{0xab5d7ba2, 0x3ff00b17} }, +/**/ {{0x95369587, 0x3ff00b07} }, +/**/ {{0x7f2ff1c6, 0x3ff00af7} }, +/**/ {{0x69499000, 0x3ff00ae7} }, +/**/ {{0x53836fd3, 0x3ff00ad7} }, +/**/ {{0x3ddd90dd, 0x3ff00ac7} }, +/**/ {{0x2857f2bf, 0x3ff00ab7} }, +/**/ {{0x12f29517, 0x3ff00aa7} }, +/**/ {{0xfdad7784, 0x3ff00a96} }, +/**/ {{0xe88899a5, 0x3ff00a86} }, +/**/ {{0xd383fb19, 0x3ff00a76} }, +/**/ {{0xbe9f9b7f, 0x3ff00a66} }, +/**/ {{0xa9db7a76, 0x3ff00a56} }, +/**/ {{0x9537979d, 0x3ff00a46} }, +/**/ {{0x80b3f293, 0x3ff00a36} }, +/**/ {{0x6c508af8, 0x3ff00a26} }, +/**/ {{0x580d606a, 0x3ff00a16} }, +/**/ {{0x43ea7288, 0x3ff00a06} }, +/**/ {{0x2fe7c0f1, 0x3ff009f6} }, +/**/ {{0x1c054b44, 0x3ff009e6} }, +/**/ {{0x08431122, 0x3ff009d6} }, +/**/ {{0xf4a11227, 0x3ff009c5} }, +/**/ {{0xe11f4df4, 0x3ff009b5} }, +/**/ {{0xcdbdc428, 0x3ff009a5} }, +/**/ {{0xba7c7462, 0x3ff00995} }, +/**/ {{0xa75b5e40, 0x3ff00985} }, +/**/ {{0x945a8162, 0x3ff00975} }, +/**/ {{0x8179dd68, 0x3ff00965} }, +/**/ {{0x6eb971ef, 0x3ff00955} }, +/**/ {{0x5c193e98, 0x3ff00945} }, +/**/ {{0x49994301, 0x3ff00935} }, +/**/ {{0x37397eca, 0x3ff00925} }, +/**/ {{0x24f9f192, 0x3ff00915} }, +/**/ {{0x12da9af7, 0x3ff00905} }, +/**/ {{0x00db7a99, 0x3ff008f5} }, +/**/ {{0xeefc9018, 0x3ff008e4} }, +/**/ {{0xdd3ddb12, 0x3ff008d4} }, +/**/ {{0xcb9f5b26, 0x3ff008c4} }, +/**/ {{0xba210ff4, 0x3ff008b4} }, +/**/ {{0xa8c2f91a, 0x3ff008a4} }, +/**/ {{0x97851639, 0x3ff00894} }, +/**/ {{0x866766ef, 0x3ff00884} }, +/**/ {{0x7569eadb, 0x3ff00874} }, +/**/ {{0x648ca19d, 0x3ff00864} }, +/**/ {{0x53cf8ad3, 0x3ff00854} }, +/**/ {{0x4332a61e, 0x3ff00844} }, +/**/ {{0x32b5f31b, 0x3ff00834} }, +/**/ {{0x2259716c, 0x3ff00824} }, +/**/ {{0x121d20ad, 0x3ff00814} }, +/**/ {{0x02010080, 0x3ff00804} }, +/**/ {{0xf2051083, 0x3ff007f3} }, +/**/ {{0xe2295056, 0x3ff007e3} }, +/**/ {{0xd26dbf97, 0x3ff007d3} }, +/**/ {{0xc2d25de5, 0x3ff007c3} }, +/**/ {{0xb3572ae2, 0x3ff007b3} }, +/**/ {{0xa3fc262a, 0x3ff007a3} }, +/**/ {{0x94c14f5f, 0x3ff00793} }, +/**/ {{0x85a6a61e, 0x3ff00783} }, +/**/ {{0x76ac2a08, 0x3ff00773} }, +/**/ {{0x67d1dabb, 0x3ff00763} }, +/**/ {{0x5917b7d7, 0x3ff00753} }, +/**/ {{0x4a7dc0fb, 0x3ff00743} }, +/**/ {{0x3c03f5c7, 0x3ff00733} }, +/**/ {{0x2daa55da, 0x3ff00723} }, +/**/ {{0x1f70e0d3, 0x3ff00713} }, +/**/ {{0x11579652, 0x3ff00703} }, +/**/ {{0x035e75f5, 0x3ff006f3} }, +/**/ {{0xf5857f5d, 0x3ff006e2} }, +/**/ {{0xe7ccb228, 0x3ff006d2} }, +/**/ {{0xda340df6, 0x3ff006c2} }, +/**/ {{0xccbb9266, 0x3ff006b2} }, +/**/ {{0xbf633f18, 0x3ff006a2} }, +/**/ {{0xb22b13ab, 0x3ff00692} }, +/**/ {{0xa5130fbe, 0x3ff00682} }, +/**/ {{0x981b32f1, 0x3ff00672} }, +/**/ {{0x8b437ce4, 0x3ff00662} }, +/**/ {{0x7e8bed35, 0x3ff00652} }, +/**/ {{0x71f48383, 0x3ff00642} }, +/**/ {{0x657d3f70, 0x3ff00632} }, +/**/ {{0x59262098, 0x3ff00622} }, +/**/ {{0x4cef269e, 0x3ff00612} }, +/**/ {{0x40d8511e, 0x3ff00602} }, +/**/ {{0x34e19fba, 0x3ff005f2} }, +/**/ {{0x290b1211, 0x3ff005e2} }, +/**/ {{0x1d54a7c1, 0x3ff005d2} }, +/**/ {{0x11be606b, 0x3ff005c2} }, +/**/ {{0x06483bad, 0x3ff005b2} }, +/**/ {{0xfaf23928, 0x3ff005a1} }, +/**/ {{0xefbc587b, 0x3ff00591} }, +/**/ {{0xe4a69945, 0x3ff00581} }, +/**/ {{0xd9b0fb25, 0x3ff00571} }, +/**/ {{0xcedb7dbc, 0x3ff00561} }, +/**/ {{0xc42620a9, 0x3ff00551} }, +/**/ {{0xb990e38b, 0x3ff00541} }, +/**/ {{0xaf1bc601, 0x3ff00531} }, +/**/ {{0xa4c6c7ac, 0x3ff00521} }, +/**/ {{0x9a91e82a, 0x3ff00511} }, +/**/ {{0x907d271c, 0x3ff00501} }, +/**/ {{0x86888421, 0x3ff004f1} }, +/**/ {{0x7cb3fed8, 0x3ff004e1} }, +/**/ {{0x72ff96e0, 0x3ff004d1} }, +/**/ {{0x696b4bdb, 0x3ff004c1} }, +/**/ {{0x5ff71d66, 0x3ff004b1} }, +/**/ {{0x56a30b21, 0x3ff004a1} }, +/**/ {{0x4d6f14ad, 0x3ff00491} }, +/**/ {{0x445b39a8, 0x3ff00481} }, +/**/ {{0x3b6779b3, 0x3ff00471} }, +/**/ {{0x3293d46c, 0x3ff00461} }, +/**/ {{0x29e04974, 0x3ff00451} }, +/**/ {{0x214cd869, 0x3ff00441} }, +/**/ {{0x18d980ed, 0x3ff00431} }, +/**/ {{0x1086429d, 0x3ff00421} }, +/**/ {{0x08531d1a, 0x3ff00411} }, +/**/ {{0x00401004, 0x3ff00401} }, +/**/ {{0xf84d1afa, 0x3ff003f0} }, +/**/ {{0xf07a3d9b, 0x3ff003e0} }, +/**/ {{0xe8c77787, 0x3ff003d0} }, +/**/ {{0xe134c85f, 0x3ff003c0} }, +/**/ {{0xd9c22fc1, 0x3ff003b0} }, +/**/ {{0xd26fad4d, 0x3ff003a0} }, +/**/ {{0xcb3d40a3, 0x3ff00390} }, +/**/ {{0xc42ae963, 0x3ff00380} }, +/**/ {{0xbd38a72c, 0x3ff00370} }, +/**/ {{0xb666799e, 0x3ff00360} }, +/**/ {{0xafb46058, 0x3ff00350} }, +/**/ {{0xa9225afa, 0x3ff00340} }, +/**/ {{0xa2b06925, 0x3ff00330} }, +/**/ {{0x9c5e8a77, 0x3ff00320} }, +/**/ {{0x962cbe90, 0x3ff00310} }, +/**/ {{0x901b0511, 0x3ff00300} }, +/**/ {{0x8a295d98, 0x3ff002f0} }, +/**/ {{0x8457c7c6, 0x3ff002e0} }, +/**/ {{0x7ea6433a, 0x3ff002d0} }, +/**/ {{0x7914cf94, 0x3ff002c0} }, +/**/ {{0x73a36c73, 0x3ff002b0} }, +/**/ {{0x6e521978, 0x3ff002a0} }, +/**/ {{0x6920d642, 0x3ff00290} }, +/**/ {{0x640fa271, 0x3ff00280} }, +/**/ {{0x5f1e7da5, 0x3ff00270} }, +/**/ {{0x5a4d677d, 0x3ff00260} }, +/**/ {{0x559c5f9a, 0x3ff00250} }, +/**/ {{0x510b659a, 0x3ff00240} }, +/**/ {{0x4c9a791f, 0x3ff00230} }, +/**/ {{0x484999c6, 0x3ff00220} }, +/**/ {{0x4418c732, 0x3ff00210} }, +/**/ {{0x40080100, 0x3ff00200} }, +/**/ {{0x3c1746d2, 0x3ff001f0} }, +/**/ {{0x38469846, 0x3ff001e0} }, +/**/ {{0x3495f4fd, 0x3ff001d0} }, +/**/ {{0x31055c96, 0x3ff001c0} }, +/**/ {{0x2d94ceb2, 0x3ff001b0} }, +/**/ {{0x2a444af0, 0x3ff001a0} }, +/**/ {{0x2713d0ef, 0x3ff00190} }, +/**/ {{0x24036051, 0x3ff00180} }, +/**/ {{0x2112f8b4, 0x3ff00170} }, +/**/ {{0x1e4299b9, 0x3ff00160} }, +/**/ {{0x1b9242ff, 0x3ff00150} }, +/**/ {{0x1901f427, 0x3ff00140} }, +/**/ {{0x1691acd0, 0x3ff00130} }, +/**/ {{0x14416c9a, 0x3ff00120} }, +/**/ {{0x12113324, 0x3ff00110} }, +/**/ {{0x10010010, 0x3ff00100} }, +/**/ {{0x0e10d2fc, 0x3ff000f0} }, +/**/ {{0x0c40ab89, 0x3ff000e0} }, +/**/ {{0x0a908957, 0x3ff000d0} }, +/**/ {{0x09006c05, 0x3ff000c0} }, +/**/ {{0x07905334, 0x3ff000b0} }, +/**/ {{0x06403e82, 0x3ff000a0} }, +/**/ {{0x05102d92, 0x3ff00090} }, +/**/ {{0x04002001, 0x3ff00080} }, +/**/ {{0x03101571, 0x3ff00070} }, +/**/ {{0x02400d80, 0x3ff00060} }, +/**/ {{0x019007d0, 0x3ff00050} }, +/**/ {{0x01000400, 0x3ff00040} }, +/**/ {{0x009001b0, 0x3ff00030} }, +/**/ {{0x00400080, 0x3ff00020} }, +/**/ {{0x00100010, 0x3ff00010} }, +/**/ {{0x00000000, 0x3ff00000} }, +/**/ {{0x001fffe0, 0x3fefffe0} }, +/**/ {{0x007fff00, 0x3fefffc0} }, +/**/ {{0x011ffca0, 0x3fefffa0} }, +/**/ {{0x01fff800, 0x3fefff80} }, +/**/ {{0x031ff060, 0x3fefff60} }, +/**/ {{0x047fe501, 0x3fefff40} }, +/**/ {{0x061fd521, 0x3fefff20} }, +/**/ {{0x07ffc002, 0x3fefff00} }, +/**/ {{0x0a1fa4e3, 0x3feffee0} }, +/**/ {{0x0c7f8305, 0x3feffec0} }, +/**/ {{0x0f1f59a7, 0x3feffea0} }, +/**/ {{0x11ff280a, 0x3feffe80} }, +/**/ {{0x151eed6e, 0x3feffe60} }, +/**/ {{0x187ea913, 0x3feffe40} }, +/**/ {{0x1c1e5a39, 0x3feffe20} }, +/**/ {{0x1ffe0020, 0x3feffe00} }, +/**/ {{0x241d9a09, 0x3feffde0} }, +/**/ {{0x287d2733, 0x3feffdc0} }, +/**/ {{0x2d1ca6e0, 0x3feffda0} }, +/**/ {{0x31fc184e, 0x3feffd80} }, +/**/ {{0x371b7abf, 0x3feffd60} }, +/**/ {{0x3c7acd72, 0x3feffd40} }, +/**/ {{0x421a0fa9, 0x3feffd20} }, +/**/ {{0x47f940a2, 0x3feffd00} }, +/**/ {{0x4e185f9f, 0x3feffce0} }, +/**/ {{0x54776bdf, 0x3feffcc0} }, +/**/ {{0x5b1664a3, 0x3feffca0} }, +/**/ {{0x61f5492c, 0x3feffc80} }, +/**/ {{0x691418b9, 0x3feffc60} }, +/**/ {{0x7072d28b, 0x3feffc40} }, +/**/ {{0x781175e3, 0x3feffc20} }, +/**/ {{0x7ff00200, 0x3feffc00} }, +/**/ {{0x880e7623, 0x3feffbe0} }, +/**/ {{0x906cd18c, 0x3feffbc0} }, +/**/ {{0x990b137c, 0x3feffba0} }, +/**/ {{0xa1e93b34, 0x3feffb80} }, +/**/ {{0xab0747f3, 0x3feffb60} }, +/**/ {{0xb46538fa, 0x3feffb40} }, +/**/ {{0xbe030d89, 0x3feffb20} }, +/**/ {{0xc7e0c4e1, 0x3feffb00} }, +/**/ {{0xd1fe5e43, 0x3feffae0} }, +/**/ {{0xdc5bd8ee, 0x3feffac0} }, +/**/ {{0xe6f93424, 0x3feffaa0} }, +/**/ {{0xf1d66f25, 0x3feffa80} }, +/**/ {{0xfcf38931, 0x3feffa60} }, +/**/ {{0x08508189, 0x3feffa41} }, +/**/ {{0x13ed576d, 0x3feffa21} }, +/**/ {{0x1fca0a1e, 0x3feffa01} }, +/**/ {{0x2be698dd, 0x3feff9e1} }, +/**/ {{0x384302e9, 0x3feff9c1} }, +/**/ {{0x44df4785, 0x3feff9a1} }, +/**/ {{0x51bb65ef, 0x3feff981} }, +/**/ {{0x5ed75d6a, 0x3feff961} }, +/**/ {{0x6c332d34, 0x3feff941} }, +/**/ {{0x79ced490, 0x3feff921} }, +/**/ {{0x87aa52be, 0x3feff901} }, +/**/ {{0x95c5a6fe, 0x3feff8e1} }, +/**/ {{0xa420d091, 0x3feff8c1} }, +/**/ {{0xb2bbceb7, 0x3feff8a1} }, +/**/ {{0xc196a0b2, 0x3feff881} }, +/**/ {{0xd0b145c2, 0x3feff861} }, +/**/ {{0xe00bbd28, 0x3feff841} }, +/**/ {{0xefa60624, 0x3feff821} }, +/**/ {{0xff801ff8, 0x3feff801} }, +/**/ {{0x0f9a09e3, 0x3feff7e2} }, +/**/ {{0x1ff3c328, 0x3feff7c2} }, +/**/ {{0x308d4b05, 0x3feff7a2} }, +/**/ {{0x4166a0bd, 0x3feff782} }, +/**/ {{0x527fc390, 0x3feff762} }, +/**/ {{0x63d8b2bf, 0x3feff742} }, +/**/ {{0x75716d8b, 0x3feff722} }, +/**/ {{0x8749f334, 0x3feff702} }, +/**/ {{0x996242fb, 0x3feff6e2} }, +/**/ {{0xabba5c21, 0x3feff6c2} }, +/**/ {{0xbe523de8, 0x3feff6a2} }, +/**/ {{0xd129e78f, 0x3feff682} }, +/**/ {{0xe4415858, 0x3feff662} }, +/**/ {{0xf7988f84, 0x3feff642} }, +/**/ {{0x0b2f8c54, 0x3feff623} }, +/**/ {{0x1f064e08, 0x3feff603} }, +/**/ {{0x331cd3e1, 0x3feff5e3} }, +/**/ {{0x47731d21, 0x3feff5c3} }, +/**/ {{0x5c092908, 0x3feff5a3} }, +/**/ {{0x70def6d7, 0x3feff583} }, +/**/ {{0x85f485d0, 0x3feff563} }, +/**/ {{0x9b49d532, 0x3feff543} }, +/**/ {{0xb0dee440, 0x3feff523} }, +/**/ {{0xc6b3b23b, 0x3feff503} }, +/**/ {{0xdcc83e62, 0x3feff4e3} }, +/**/ {{0xf31c87f8, 0x3feff4c3} }, +/**/ {{0x09b08e3d, 0x3feff4a4} }, +/**/ {{0x20845073, 0x3feff484} }, +/**/ {{0x3797cdda, 0x3feff464} }, +/**/ {{0x4eeb05b4, 0x3feff444} }, +/**/ {{0x667df741, 0x3feff424} }, +/**/ {{0x7e50a1c3, 0x3feff404} }, +/**/ {{0x9663047b, 0x3feff3e4} }, +/**/ {{0xaeb51eaa, 0x3feff3c4} }, +/**/ {{0xc746ef91, 0x3feff3a4} }, +/**/ {{0xe0187672, 0x3feff384} }, +/**/ {{0xf929b28d, 0x3feff364} }, +/**/ {{0x127aa323, 0x3feff345} }, +/**/ {{0x2c0b4776, 0x3feff325} }, +/**/ {{0x45db9ec7, 0x3feff305} }, +/**/ {{0x5feba858, 0x3feff2e5} }, +/**/ {{0x7a3b6369, 0x3feff2c5} }, +/**/ {{0x94cacf3b, 0x3feff2a5} }, +/**/ {{0xaf99eb11, 0x3feff285} }, +/**/ {{0xcaa8b62a, 0x3feff265} }, +/**/ {{0xe5f72fc9, 0x3feff245} }, +/**/ {{0x0185572f, 0x3feff226} }, +/**/ {{0x1d532b9d, 0x3feff206} }, +/**/ {{0x3960ac54, 0x3feff1e6} }, +/**/ {{0x55add896, 0x3feff1c6} }, +/**/ {{0x723aafa3, 0x3feff1a6} }, +/**/ {{0x8f0730be, 0x3feff186} }, +/**/ {{0xac135b27, 0x3feff166} }, +/**/ {{0xc95f2e21, 0x3feff146} }, +/**/ {{0xe6eaa8eb, 0x3feff126} }, +/**/ {{0x04b5cac9, 0x3feff107} }, +/**/ {{0x22c092fb, 0x3feff0e7} }, +/**/ {{0x410b00c2, 0x3feff0c7} }, +/**/ {{0x5f951360, 0x3feff0a7} }, +/**/ {{0x7e5eca16, 0x3feff087} }, +/**/ {{0x9d682426, 0x3feff067} }, +/**/ {{0xbcb120d2, 0x3feff047} }, +/**/ {{0xdc39bf5a, 0x3feff027} }, +/**/ {{0xfc01ff00, 0x3feff007} }, +/**/ {{0x1c09df07, 0x3fefefe8} }, +/**/ {{0x3c515eae, 0x3fefefc8} }, +/**/ {{0x5cd87d38, 0x3fefefa8} }, +/**/ {{0x7d9f39e6, 0x3fefef88} }, +/**/ {{0x9ea593fa, 0x3fefef68} }, +/**/ {{0xbfeb8ab5, 0x3fefef48} }, +/**/ {{0xe1711d5a, 0x3fefef28} }, +/**/ {{0x03364b28, 0x3fefef09} }, +/**/ {{0x253b1363, 0x3fefeee9} }, +/**/ {{0x477f754b, 0x3fefeec9} }, +/**/ {{0x6a037022, 0x3fefeea9} }, +/**/ {{0x8cc7032a, 0x3fefee89} }, +/**/ {{0xafca2da5, 0x3fefee69} }, +/**/ {{0xd30ceed4, 0x3fefee49} }, +/**/ {{0xf68f45f8, 0x3fefee29} }, +/**/ {{0x1a513254, 0x3fefee0a} }, +/**/ {{0x3e52b329, 0x3fefedea} }, +/**/ {{0x6293c7b8, 0x3fefedca} }, +/**/ {{0x87146f44, 0x3fefedaa} }, +/**/ {{0xabd4a90e, 0x3fefed8a} }, +/**/ {{0xd0d47458, 0x3fefed6a} }, +/**/ {{0xf613d064, 0x3fefed4a} }, +/**/ {{0x1b92bc73, 0x3fefed2b} }, +/**/ {{0x415137c7, 0x3fefed0b} }, +/**/ {{0x674f41a2, 0x3fefeceb} }, +/**/ {{0x8d8cd945, 0x3fefeccb} }, +/**/ {{0xb409fdf3, 0x3fefecab} }, +/**/ {{0xdac6aeed, 0x3fefec8b} }, +/**/ {{0x01c2eb76, 0x3fefec6c} }, +/**/ {{0x28feb2ce, 0x3fefec4c} }, +/**/ {{0x507a0437, 0x3fefec2c} }, +/**/ {{0x7834def5, 0x3fefec0c} }, +/**/ {{0xa02f4247, 0x3fefebec} }, +/**/ {{0xc8692d71, 0x3fefebcc} }, +/**/ {{0xf0e29fb4, 0x3fefebac} }, +/**/ {{0x199b9852, 0x3fefeb8d} }, +/**/ {{0x4294168d, 0x3fefeb6d} }, +/**/ {{0x6bcc19a7, 0x3fefeb4d} }, +/**/ {{0x9543a0e2, 0x3fefeb2d} }, +/**/ {{0xbefaab7f, 0x3fefeb0d} }, +/**/ {{0xe8f138c2, 0x3fefeaed} }, +/**/ {{0x132747ea, 0x3fefeace} }, +/**/ {{0x3d9cd83c, 0x3fefeaae} }, +/**/ {{0x6851e8f7, 0x3fefea8e} }, +/**/ {{0x93467960, 0x3fefea6e} }, +/**/ {{0xbe7a88b7, 0x3fefea4e} }, +/**/ {{0xe9ee163f, 0x3fefea2e} }, +/**/ {{0x15a12139, 0x3fefea0f} }, +/**/ {{0x4193a8e8, 0x3fefe9ef} }, +/**/ {{0x6dc5ac8e, 0x3fefe9cf} }, +/**/ {{0x9a372b6d, 0x3fefe9af} }, +/**/ {{0xc6e824c6, 0x3fefe98f} }, +/**/ {{0xf3d897dd, 0x3fefe96f} }, + }; + + static const number + Lu[182][2] = { /* log(ui) */ +/**/ {{{0x0b3aac49, 0xbfd63003} }, +/**/ {{0xe51fff99, 0xbc6dc18c} },}, +/**/ {{{0xdf595f30, 0xbfd5d5bd} }, +/**/ {{0x48cbb8a2, 0x3c765411} },}, +/**/ {{{0x53c8d1fb, 0xbfd57bf7} }, +/**/ {{0x15f88b63, 0x3c60908d} },}, +/**/ {{{0x0738a3d8, 0xbfd522ae} }, +/**/ {{0xb38a6979, 0x3c68f7e9} },}, +/**/ {{{0x9e172c3c, 0xbfd4c9e0} }, +/**/ {{0x5b147a5d, 0x3c512361} },}, +/**/ {{{0xc271c41b, 0xbfd4718d} }, +/**/ {{0x14c56eef, 0xbc38fb4c} },}, +/**/ {{{0x23d5e8c7, 0xbfd419b4} }, +/**/ {{0x43827392, 0xbc60dbb2} },}, +/**/ {{{0x77333184, 0xbfd3c252} }, +/**/ {{0xe50a8ec6, 0x3c72ad27} },}, +/**/ {{{0x76be1117, 0xbfd36b67} }, +/**/ {{0xe883858e, 0x3c5324f0} },}, +/**/ {{{0xe1d35ce4, 0xbfd314f1} }, +/**/ {{0x09e5c3dc, 0x3c73d699} },}, +/**/ {{{0x7cdc9354, 0xbfd2bef0} }, +/**/ {{0x7fd86088, 0x3c782dad} },}, +/**/ {{{0x1134db92, 0xbfd26962} }, +/**/ {{0xdd9db02b, 0xbc7e0efa} },}, +/**/ {{{0x6d0eb8d4, 0xbfd21445} }, +/**/ {{0x1aeba60a, 0xbc6f7ae9} },}, +/**/ {{{0x635a6b95, 0xbfd1bf99} }, +/**/ {{0x84249223, 0x3c612aeb} },}, +/**/ {{{0xcbacfb73, 0xbfd16b5c} }, +/**/ {{0x28b40935, 0xbc766fbd} },}, +/**/ {{{0x8227e47c, 0xbfd1178e} }, +/**/ {{0x5f01c691, 0x3c60e63a} },}, +/**/ {{{0x676162e3, 0xbfd0c42d} }, +/**/ {{0x9d5d11ee, 0xbc5162c7} },}, +/**/ {{{0x604d5862, 0xbfd07138} }, +/**/ {{0xed4e9138, 0xbc7cdb16} },}, +/**/ {{{0x5626c691, 0xbfd01eae} }, +/**/ {{0xbd2932e2, 0x3c418290} },}, +/**/ {{{0x6cb3b379, 0xbfcf991c} }, +/**/ {{0x66f980a2, 0xbc6f6650} },}, +/**/ {{{0xe4dcffe6, 0xbfcef5ad} }, +/**/ {{0xddc708a0, 0x3c508ab2} },}, +/**/ {{{0xffe71012, 0xbfce530e} }, +/**/ {{0x41f43042, 0xbc422760} },}, +/**/ {{{0xb0d48940, 0xbfcdb13d} }, +/**/ {{0x49f96cb9, 0xbc5aa11d} },}, +/**/ {{{0xf2655e7b, 0xbfcd1037} }, +/**/ {{0x242471a2, 0xbc660629} },}, +/**/ {{{0xc6f00f71, 0xbfcc6ffb} }, +/**/ {{0x2c57a4a5, 0x3c68e58b} },}, +/**/ {{{0x383bd8ad, 0xbfcbd087} }, +/**/ {{0xf6a516d7, 0xbc3dd355} },}, +/**/ {{{0x575bce3d, 0xbfcb31d8} }, +/**/ {{0xb386a94d, 0x3c66353a} },}, +/**/ {{{0x3c8ad9e3, 0xbfca93ed} }, +/**/ {{0x9de97203, 0xbc6bcafa} },}, +/**/ {{{0x07089664, 0xbfc9f6c4} }, +/**/ {{0x605e67ef, 0xbc435a19} },}, +/**/ {{{0xdcf7017f, 0xbfc95a5a} }, +/**/ {{0x07fb7a3d, 0xbc5142c5} },}, +/**/ {{{0xeb38fe8c, 0xbfc8beaf} }, +/**/ {{0xb6997a40, 0xbc555aa8} },}, +/**/ {{{0x6551a3c2, 0xbfc823c1} }, +/**/ {{0xe70be781, 0x3c61232c} },}, +/**/ {{{0x85444c73, 0xbfc7898d} }, +/**/ {{0xebcfb201, 0xbc5ef8f6} },}, +/**/ {{{0x8b756abc, 0xbfc6f012} }, +/**/ {{0xc21e166c, 0x3c68de59} },}, +/**/ {{{0xbe8c133a, 0xbfc6574e} }, +/**/ {{0xf4621bed, 0x3c3d34f0} },}, +/**/ {{{0x6b543db2, 0xbfc5bf40} }, +/**/ {{0x4c0df7e7, 0x3c21f5b4} },}, +/**/ {{{0xe4a1b58d, 0xbfc527e5} }, +/**/ {{0x82395bfd, 0x3c271a96} },}, +/**/ {{{0x8333b561, 0xbfc4913d} }, +/**/ {{0x4930f135, 0x3c50d560} },}, +/**/ {{{0xa59928cc, 0xbfc3fb45} }, +/**/ {{0xa354d056, 0x3c6d87e6} },}, +/**/ {{{0xb0159016, 0xbfc365fc} }, +/**/ {{0xa5b944ad, 0xbc57d411} },}, +/**/ {{{0x0c86813a, 0xbfc2d161} }, +/**/ {{0xf25af95f, 0x3c5499a3} },}, +/**/ {{{0x2a49c202, 0xbfc23d71} }, +/**/ {{0x61051d69, 0x3c66e381} },}, +/**/ {{{0x7e23f72a, 0xbfc1aa2b} }, +/**/ {{0xd9b2ef7e, 0x3c4c6ef1} },}, +/**/ {{{0x8227e47c, 0xbfc1178e} }, +/**/ {{0x5f01c691, 0x3c50e63a} },}, +/**/ {{{0xb59e3a07, 0xbfc08598} }, +/**/ {{0x9902bf32, 0x3c6dd700} },}, +/**/ {{{0x39dbd566, 0xbfbfe891} }, +/**/ {{0x215f9393, 0x3c5ac9f4} },}, +/**/ {{{0x830a1120, 0xbfbec739} }, +/**/ {{0x91780d3f, 0x3c4a2bf9} },}, +/**/ {{{0x638446a2, 0xbfbda727} }, +/**/ {{0x71733019, 0xbc5401fa} },}, +/**/ {{{0x01bc4b23, 0xbfbc8858} }, +/**/ {{0x559a6706, 0xbc5a38cb} },}, +/**/ {{{0x8dad5b1c, 0xbfbb6ac8} }, +/**/ {{0xed1ca59f, 0x3c40057e} },}, +/**/ {{{0x40b1bc38, 0xbfba4e76} }, +/**/ {{0x203e4259, 0x3c55b5ca} },}, +/**/ {{{0x5d594989, 0xbfb9335e} }, +/**/ {{0x5704ccb7, 0x3c5478a8} },}, +/**/ {{{0x2f40e3f0, 0xbfb8197e} }, +/**/ {{0xffbeed43, 0xbc3b9f2d} },}, +/**/ {{{0x0aeac0e1, 0xbfb700d3} }, +/**/ {{0x212cdd05, 0x3c272566} },}, +/**/ {{{0x4d9791cb, 0xbfb5e95a} }, +/**/ {{0x5c5c450a, 0xbc5f3874} },}, +/**/ {{{0x5d207eac, 0xbfb4d311} }, +/**/ {{0x2c7842cc, 0xbc5769f4} },}, +/**/ {{{0xa7d1ee64, 0xbfb3bdf5} }, +/**/ {{0xd3b5b45f, 0xbc47a976} },}, +/**/ {{{0xa44717a5, 0xbfb2aa04} }, +/**/ {{0x8d2fa3f7, 0x3c5d15d3} },}, +/**/ {{{0xd1465567, 0xbfb1973b} }, +/**/ {{0x67a6acf6, 0x3c475583} },}, +/**/ {{{0xb59e3a07, 0xbfb08598} }, +/**/ {{0x9902bf32, 0x3c5dd700} },}, +/**/ {{{0xc006b87c, 0xbfaeea31} }, +/**/ {{0x93b7b66c, 0x3c43e4fc} },}, +/**/ {{{0xcdddb2cc, 0xbfaccb73} }, +/**/ {{0x0500efd4, 0x3c4e48fb} },}, +/**/ {{{0xd0fb10fc, 0xbfaaaef2} }, +/**/ {{0xb42e0add, 0xbc2a353b} },}, +/**/ {{{0x149fb343, 0xbfa894aa} }, +/**/ {{0x7660a23d, 0xbc3a8be9} },}, +/**/ {{{0xf2d4bb58, 0xbfa67c94} }, +/**/ {{0x6505e603, 0xbc40413e} },}, +/**/ {{{0xd42de3ea, 0xbfa466ae} }, +/**/ {{0x7f4a137e, 0x3c4cdd6f} },}, +/**/ {{{0x2f8d183f, 0xbfa252f3} }, +/**/ {{0x92615916, 0x3c4947f7} },}, +/**/ {{{0x89e74444, 0xbfa0415d} }, +/**/ {{0x1d753622, 0xbc4c05cf} },}, +/**/ {{{0xec14aaf2, 0xbf9c63d2} }, +/**/ {{0xa686bd86, 0x3c3ce030} },}, +/**/ {{{0x28c8cabf, 0xbf984925} }, +/**/ {{0x0619fa67, 0x3c3d192d} },}, +/**/ {{{0x25980cc1, 0xbf9432a9} }, +/**/ {{0x39004192, 0x3c38cdaf} },}, +/**/ {{{0x58935847, 0xbf902056} }, +/**/ {{0x8416e71f, 0xbc327c8e} },}, +/**/ {{{0xa388a2aa, 0xbf882448} }, +/**/ {{0x137f09a0, 0xbc104b16} },}, +/**/ {{{0x7588de71, 0xbf801015} }, +/**/ {{0xd417ced0, 0xbc146662} },}, +/**/ {{{0x59588b35, 0xbf700805} }, +/**/ {{0x8cf63677, 0xbc1f9663} },}, +/**/ {{{0x00000000, 0x00000000} }, +/**/ {{0x00000000, 0x00000000} },}, +/**/ {{{0xa2b10bc0, 0x3f6ff00a} }, +/**/ {{0xd5a6d353, 0x3c02821a} },}, +/**/ {{{0x6b106789, 0x3f7fe02a} }, +/**/ {{0xe3711ebf, 0xbbce44b7} },}, +/**/ {{{0x5f810a77, 0x3f87dc47} }, +/**/ {{0x87d3df21, 0xbc116d76} },}, +/**/ {{{0xb0fc03e4, 0x3f8fc0a8} }, +/**/ {{0xc59642a1, 0xbc183092} },}, +/**/ {{{0x4346a575, 0x3f93cea4} }, +/**/ {{0x902b3a1c, 0xbc10cb5a} },}, +/**/ {{{0x07d5b11b, 0x3f97b91b} }, +/**/ {{0xace3a510, 0xbc35b602} },}, +/**/ {{{0x27af9198, 0x3f9b9fc0} }, +/**/ {{0x229dc868, 0xbbf0ae69} },}, +/**/ {{{0x0e783300, 0x3f9f829b} }, +/**/ {{0x04f1ef23, 0x3c333e3f} },}, +/**/ {{{0x8923d980, 0x3fa1b0d9} }, +/**/ {{0x89bac481, 0xbc3e9ae8} },}, +/**/ {{{0xb9febd60, 0x3fa39e87} }, +/**/ {{0x37f551bb, 0xbc45bfa9} },}, +/**/ {{{0xafc8e4d5, 0x3fa58a5b} }, +/**/ {{0x2b4e2b72, 0xbc4ce55c} },}, +/**/ {{{0xf632dcfc, 0x3fa77458} }, +/**/ {{0xa87b9296, 0x3c418d3c} },}, +/**/ {{{0x0ec8e3eb, 0x3fa95c83} }, +/**/ {{0x80520bf2, 0x3c4f5a0e} },}, +/**/ {{{0x711971bf, 0x3fab42dd} }, +/**/ {{0x9c130499, 0xbc3eb975} },}, +/**/ {{{0x8adb0b52, 0x3fad276b} }, +/**/ {{0x3257fd47, 0x3c21e3c5} },}, +/**/ {{{0xc01162a6, 0x3faf0a30} }, +/**/ {{0x5c5bbacd, 0x3c485f32} },}, +/**/ {{{0x3598e471, 0x3fb07598} }, +/**/ {{0x333c45b8, 0x3c480da5} },}, +/**/ {{{0xeea37ae1, 0x3fb16536} }, +/**/ {{0xe8c22cda, 0xbc379da3} },}, +/**/ {{{0x2f0a1417, 0x3fb253f6} }, +/**/ {{0x63fc4cfd, 0xbc1c1259} },}, +/**/ {{{0x961bd1d1, 0x3fb341d7} }, +/**/ {{0x227becbb, 0xbc5b599f} },}, +/**/ {{{0xbea646f0, 0x3fb42edc} }, +/**/ {{0x935996c9, 0x3c4ddd4f} },}, +/**/ {{{0x3f06183f, 0x3fb51b07} }, +/**/ {{0x9a1a8be4, 0x3c5a49e3} },}, +/**/ {{{0xa93750c4, 0x3fb60658} }, +/**/ {{0x8ec21b6a, 0xbc538845} },}, +/**/ {{{0x8ae56b4c, 0x3fb6f0d2} }, +/**/ {{0x9184b992, 0xbc5906d9} },}, +/**/ {{{0x6d7b12cd, 0x3fb7da76} }, +/**/ {{0xcdd94131, 0xbc5eeedf} },}, +/**/ {{{0xd6319b21, 0x3fb8c345} }, +/**/ {{0xab3424a9, 0xbc24a697} },}, +/**/ {{{0x462033ad, 0x3fb9ab42} }, +/**/ {{0x1c184e8e, 0xbc42099e} },}, +/**/ {{{0x3a4ad563, 0x3fba926d} }, +/**/ {{0x8aa70ea9, 0x3c5942f4} },}, +/**/ {{{0x2bb0eda1, 0x3fbb78c8} }, +/**/ {{0xf0327e21, 0x3c20878c} },}, +/**/ {{{0x8f5bc743, 0x3fbc5e54} }, +/**/ {{0xef8161b1, 0x3c35d617} },}, +/**/ {{{0xd66cb35d, 0x3fbd4313} }, +/**/ {{0x951d90fa, 0x3c5790dd} },}, +/**/ {{{0x6e2af2e6, 0x3fbe2707} }, +/**/ {{0x001e0162, 0xbc361578} },}, +/**/ {{{0xc01162a6, 0x3fbf0a30} }, +/**/ {{0x5c5bbacd, 0x3c585f32} },}, +/**/ {{{0x31dbeabb, 0x3fbfec91} }, +/**/ {{0x9981b36c, 0xbc55746b} },}, +/**/ {{{0x12ca596e, 0x3fc06715} }, +/**/ {{0x7eb86499, 0x3c550c64} },}, +/**/ {{{0x7cd08e59, 0x3fc0d77e} }, +/**/ {{0x5e9030ac, 0x3c69a5dc} },}, +/**/ {{{0x846742ac, 0x3fc14785} }, +/**/ {{0x3e3a7f07, 0x3c6a2881} },}, +/**/ {{{0xd52f67a0, 0x3fc1b72a} }, +/**/ {{0x3472cd74, 0x3c548302} },}, +/**/ {{{0x190a5acb, 0x3fc2266f} }, +/**/ {{0xf1809e88, 0x3c6f547b} },}, +/**/ {{{0xf81ff523, 0x3fc29552} }, +/**/ {{0x1c407dbf, 0x3c630177} },}, +/**/ {{{0x18e47fd3, 0x3fc303d7} }, +/**/ {{0xd96091fa, 0xbc06b9c7} },}, +/**/ {{{0x201e8f74, 0x3fc371fc} }, +/**/ {{0x62af18a0, 0x3c5de6cb} },}, +/**/ {{{0xb0ecc62a, 0x3fc3dfc2} }, +/**/ {{0xe7d81017, 0xbc5ab3a8} },}, +/**/ {{{0x6ccb7d1e, 0x3fc44d2b} }, +/**/ {{0x543e1f88, 0x3c69f4f6} },}, +/**/ {{{0xf39a55e5, 0x3fc4ba36} }, +/**/ {{0xbcc36756, 0x3c668981} },}, +/**/ {{{0xe3a1b438, 0x3fc526e5} }, +/**/ {{0x8a470d3a, 0xbc6746ff} },}, +/**/ {{{0xd9982086, 0x3fc59338} }, +/**/ {{0xaa8ad7cf, 0xbc565d22} },}, +/**/ {{{0x70a793d4, 0x3fc5ff30} }, +/**/ {{0xfafc6f6e, 0xbc5bc60e} },}, +/**/ {{{0x4272ad51, 0x3fc66acd} }, +/**/ {{0x4e1ea8b2, 0xbc50900e} },}, +/**/ {{{0xe719d21d, 0x3fc6d60f} }, +/**/ {{0x68ecd179, 0xbc6caae2} },}, +/**/ {{{0xf54037a5, 0x3fc740f8} }, +/**/ {{0x62a84cdb, 0xbc5b2640} },}, +/**/ {{{0x0210d909, 0x3fc7ab89} }, +/**/ {{0x2d6a0608, 0x3c4be36b} },}, +/**/ {{{0xa14357eb, 0x3fc815c0} }, +/**/ {{0x073a0564, 0xbc54be48} },}, +/**/ {{{0x6520c911, 0x3fc87fa0} }, +/**/ {{0xbfa08d9a, 0xbc6bf7fd} },}, +/**/ {{{0xde886d41, 0x3fc8e928} }, +/**/ {{0x51a56770, 0xbc6569d8} },}, +/**/ {{{0x9cf456b4, 0x3fc9525a} }, +/**/ {{0x1d4e2e26, 0x3c6d904c} },}, +/**/ {{{0x2e7dfb83, 0x3fc9bb36} }, +/**/ {{0x1f003e0c, 0x3c6575e3} },}, +/**/ {{{0x1fe2b563, 0x3fca23bc} }, +/**/ {{0xb07a998c, 0x3c493711} },}, +/**/ {{{0xfc882f19, 0x3fca8bec} }, +/**/ {{0x918c39eb, 0xbc5e8c37} },}, +/**/ {{{0x4e80bff3, 0x3fcaf3c9} }, +/**/ {{0xf3641985, 0xbc5398cf} },}, +/**/ {{{0x9e8fb5a4, 0x3fcb5b51} }, +/**/ {{0xdc19e1a0, 0x3c6ba27f} },}, +/**/ {{{0x742d8cd6, 0x3fcbc286} }, +/**/ {{0x44870f55, 0x3c54fce7} },}, +/**/ {{{0x558c18c1, 0x3fcc2968} }, +/**/ {{0x38a3fb6b, 0xbc673dee} },}, +/**/ {{{0xc79a9a22, 0x3fcc8ff7} }, +/**/ {{0xf8434012, 0xbc64f689} },}, +/**/ {{{0x4e09c5dc, 0x3fccf635} }, +/**/ {{0x7d55b695, 0x3c6239a0} },}, +/**/ {{{0x6b4fbb91, 0x3fcd5c21} }, +/**/ {{0x597e4d40, 0x3c66e443} },}, +/**/ {{{0xa0abec7d, 0x3fcdc1bc} }, +/**/ {{0x1998b6fc, 0x3c6834c5} },}, +/**/ {{{0x6e2af2e6, 0x3fce2707} }, +/**/ {{0x001e0162, 0xbc461578} },}, +/**/ {{{0x52aa5a60, 0x3fce8c02} }, +/**/ {{0x39bfc89b, 0xbc46e03a} },}, +/**/ {{{0xcbdc5936, 0x3fcef0ad} }, +/**/ {{0x950dc20d, 0x3c648637} },}, +/**/ {{{0x564b7b37, 0x3fcf550a} }, +/**/ {{0xfd018c37, 0x3c2c5f6d} },}, +/**/ {{{0x6d5e3e2b, 0x3fcfb918} }, +/**/ {{0x64f21acb, 0xbc6caaae} },}, +/**/ {{{0x45ad501d, 0x3fd00e6c} }, +/**/ {{0x8ff6fead, 0xbc6cb956} },}, +/**/ {{{0x94b4d041, 0x3fd04025} }, +/**/ {{0x17a5022d, 0xbc628ec2} },}, +/**/ {{{0x5fcd590d, 0x3fd071b8} }, +/**/ {{0xf97bde80, 0x3c5d1707} },}, +/**/ {{{0xe27390e3, 0x3fd0a324} }, +/**/ {{0xe8061c03, 0x3c77dcfd} },}, +/**/ {{{0x579ab74b, 0x3fd0d46b} }, +/**/ {{0x1c3cbd92, 0x3c603ec8} },}, +/**/ {{{0xf9ae4ad5, 0x3fd1058b} }, +/**/ {{0xab4cb31d, 0x3c589fa0} },}, +/**/ {{{0x0293a8b0, 0x3fd13687} }, +/**/ {{0x98edd24a, 0x3c77b662} },}, +/**/ {{{0xababa60e, 0x3fd1675c} }, +/**/ {{0xab883717, 0x3c2ce63e} },}, +/**/ {{{0x2dd4236f, 0x3fd1980d} }, +/**/ {{0xb0e4d147, 0x3c79d3d1} },}, +/**/ {{{0xc16999fb, 0x3fd1c898} }, +/**/ {{0x2aff1c44, 0xbc30e5c6} },}, +/**/ {{{0x9e48a2f3, 0x3fd1f8ff} }, +/**/ {{0x9a0c4b07, 0xbc7c9fdf} },}, +/**/ {{{0xfbcf7966, 0x3fd22941} }, +/**/ {{0xb09628af, 0xbc776f5e} },}, +/**/ {{{0x10df763a, 0x3fd25960} }, +/**/ {{0x57075e9e, 0xbc50f76c} },}, +/**/ {{{0x13de86a3, 0x3fd2895a} }, +/**/ {{0xc13f040e, 0x3c77ad24} },}, +/**/ {{{0x3ab89d25, 0x3fd2b930} }, +/**/ {{0xfd852ad4, 0xbc7896b5} },}, +/**/ {{{0xbae11d31, 0x3fd2e8e2} }, +/**/ {{0xb95ebdf9, 0xbc78f4cd} },}, +/**/ {{{0xc9544185, 0x3fd31871} }, +/**/ {{0x4c09b379, 0xbc351acc} },}, +/**/ {{{0x9a987d55, 0x3fd347dd} }, +/**/ {{0x580919f8, 0xbc64dd4c} },}, +/**/ {{{0x62bfd85b, 0x3fd37726} }, +/**/ {{0xd8117de7, 0xbc4b5629} },}, +/**/ {{{0x556945ea, 0x3fd3a64c} }, +/**/ {{0x1945f97c, 0xbc6c6865} },}, +/**/ {{{0xa5c1f710, 0x3fd3d54f} }, +/**/ {{0xc6a1c98d, 0xbc7e3265} },}, +/**/ {{{0x8686a7e4, 0x3fd40430} }, +/**/ {{0x6082ce6d, 0xbc70bcfb} },}, +/**/ {{{0x2a04e814, 0x3fd432ef} }, +/**/ {{0x715ac903, 0xbc729931} },}, +/**/ {{{0xc21c5ec2, 0x3fd4618b} }, +/**/ {{0xcdeccf1d, 0x3c7f42de} },}, +/**/ {{{0x804009d1, 0x3fd49006} }, +/**/ {{0x41f177dc, 0xbc69ffc3} },}, +/**/ {{{0x957778a1, 0x3fd4be5f} }, +/**/ {{0x5b04813d, 0xbc6259b3} },}, +/**/ {{{0x3260026a, 0x3fd4ec97} }, +/**/ {{0xd977dc5e, 0xbc742a87} },}, +/**/ {{{0x872df82d, 0x3fd51aad} }, +/**/ {{0xc19f55e3, 0x3c43927a} },}, +/**/ {{{0xc3add263, 0x3fd548a2} }, +/**/ {{0x7e308ddb, 0xbc6819cf} },}, +/**/ {{{0x17455a6c, 0x3fd57677} }, +/**/ {{0xb283660c, 0x3c7526ad} },}, +/**/ {{{0xb0f4cfe2, 0x3fd5a42a} }, +/**/ {{0x7dee9a3d, 0xbc78ebcb} },}, +/**/ {{{0xbf5809ca, 0x3fd5d1bd} }, +/**/ {{0x83dc7fe1, 0x3c742363} },}, +/**/ {{{0x70a793d4, 0x3fd5ff30} }, +/**/ {{0xfafc6f6e, 0xbc6bc60e} },}, +/**/ {{{0xf2b9c795, 0x3fd62c82} }, +/**/ {{0x915300e5, 0x3c67b7af} },}, + }; + + static const number + Lv[362][2] = { /* log(vj) */ + +/**/ {{{0xb72daabf, 0xbf6687ec} }, +/**/ {{0x0f13318f, 0x3c052c69} },}, +/**/ {{{0x3767104f, 0xbf6667d6} }, +/**/ {{0xd27a7bac, 0x3bd3efa3} },}, +/**/ {{{0xd7cd64fb, 0xbf6647bf} }, +/**/ {{0x55a89c36, 0x3c09b725} },}, +/**/ {{{0x9860683b, 0xbf6627a9} }, +/**/ {{0xfebc844a, 0x3bcbae22} },}, +/**/ {{{0x791fd98a, 0xbf660793} }, +/**/ {{0x78fa1cb5, 0xbbfe34af} },}, +/**/ {{{0x7a0b7863, 0xbf65e77d} }, +/**/ {{0xea78fdd0, 0xbc02f1b1} },}, +/**/ {{{0x9b230442, 0xbf65c767} }, +/**/ {{0x2202b2ca, 0x3bf70d8c} },}, +/**/ {{{0xdc663ca2, 0xbf65a751} }, +/**/ {{0xc3444e64, 0xbbfdc63d} },}, +/**/ {{{0x3dd4e102, 0xbf65873c} }, +/**/ {{0x370d69c3, 0x3c021b11} },}, +/**/ {{{0xbf6eb0de, 0xbf656726} }, +/**/ {{0x154dd8d8, 0xbbfb6da8} },}, +/**/ {{{0x61336bb6, 0xbf654711} }, +/**/ {{0xdf9a4709, 0xbc0b12d2} },}, +/**/ {{{0x2322d10a, 0xbf6526fc} }, +/**/ {{0x68d1274f, 0x3bf997f2} },}, +/**/ {{{0x053ca059, 0xbf6506e7} }, +/**/ {{0xe70c852a, 0x3c0c2a1f} },}, +/**/ {{{0x07809924, 0xbf64e6d2} }, +/**/ {{0xa808538f, 0x3c04cc9e} },}, +/**/ {{{0x29ee7aed, 0xbf64c6bd} }, +/**/ {{0x7797a4bd, 0x3befe68c} },}, +/**/ {{{0x6c860537, 0xbf64a6a8} }, +/**/ {{0x9efaae3d, 0x3c06794d} },}, +/**/ {{{0xcf46f784, 0xbf648693} }, +/**/ {{0xb2ddd9d1, 0xbbfed318} },}, +/**/ {{{0x5231115a, 0xbf64667f} }, +/**/ {{0x4643624b, 0x3c061f62} },}, +/**/ {{{0xf544123c, 0xbf64466a} }, +/**/ {{0x9387f11e, 0x3c0666a0} },}, +/**/ {{{0xb87fb9b0, 0xbf642656} }, +/**/ {{0x116ec598, 0x3c0043b2} },}, +/**/ {{{0x9be3c73c, 0xbf640642} }, +/**/ {{0xd2de6e3e, 0xbbfbd84d} },}, +/**/ {{{0x9f6ffa68, 0xbf63e62e} }, +/**/ {{0x433d8c65, 0xbbe9149b} },}, +/**/ {{{0xc32412bb, 0xbf63c61a} }, +/**/ {{0x08e5a7bb, 0xbbf6b88d} },}, +/**/ {{{0x06ffcfbe, 0xbf63a607} }, +/**/ {{0xccfac9e2, 0xbb9f3c7a} },}, +/**/ {{{0x6b02f0fa, 0xbf6385f3} }, +/**/ {{0xbec6f6e4, 0x3bee405c} },}, +/**/ {{{0xef2d35f9, 0xbf6365df} }, +/**/ {{0xaf0c0b4c, 0x3bf02993} },}, +/**/ {{{0x937e5e46, 0xbf6345cc} }, +/**/ {{0xaa64716f, 0x3bf9be97} },}, +/**/ {{{0x57f6296c, 0xbf6325b9} }, +/**/ {{0xa2e863ae, 0xbbfdeb4d} },}, +/**/ {{{0x3c9456f9, 0xbf6305a6} }, +/**/ {{0x636d2b2c, 0x3c0f3c7f} },}, +/**/ {{{0x4158a678, 0xbf62e593} }, +/**/ {{0xb166ca7f, 0x3c01a8df} },}, +/**/ {{{0x6642d778, 0xbf62c580} }, +/**/ {{0x53a2d534, 0x3c020ff1} },}, +/**/ {{{0xab52a987, 0xbf62a56d} }, +/**/ {{0x0412f1e7, 0xbbe8fef1} },}, +/**/ {{{0x1087dc35, 0xbf62855b} }, +/**/ {{0x4b7ac6c6, 0xbbfcd17e} },}, +/**/ {{{0x95e22f12, 0xbf626548} }, +/**/ {{0x9a8127bf, 0xbbfbfc21} },}, +/**/ {{{0x3b6161af, 0xbf624536} }, +/**/ {{0x66d42390, 0x3bd7eda1} },}, +/**/ {{{0x0105339d, 0xbf622524} }, +/**/ {{0x77fedcad, 0xbbdf374e} },}, +/**/ {{{0xe6cd646f, 0xbf620511} }, +/**/ {{0x52d05dea, 0x3be1d1fb} },}, +/**/ {{{0xecb9b3b8, 0xbf61e4ff} }, +/**/ {{0xffd8e706, 0x3c02c2fc} },}, +/**/ {{{0x12c9e10b, 0xbf61c4ee} }, +/**/ {{0xf1d5cc2c, 0xbc02b4f8} },}, +/**/ {{{0x58fdabfe, 0xbf61a4dc} }, +/**/ {{0x1315b191, 0xbc0618c3} },}, +/**/ {{{0xbf54d426, 0xbf6184ca} }, +/**/ {{0xcb3cdab0, 0xbc01f8d5} },}, +/**/ {{{0x45cf1919, 0xbf6164b9} }, +/**/ {{0xc025605a, 0xbc014ff7} },}, +/**/ {{{0xec6c3a6e, 0xbf6144a7} }, +/**/ {{0x87cb08cd, 0xbbff04ff} },}, +/**/ {{{0xb32bf7bd, 0xbf612496} }, +/**/ {{0xe6af1b84, 0x3bee89b4} },}, +/**/ {{{0x9a0e109e, 0xbf610485} }, +/**/ {{0x35a60879, 0x3c07e99e} },}, +/**/ {{{0xa11244aa, 0xbf60e474} }, +/**/ {{0x20f2325a, 0x3c04b698} },}, +/**/ {{{0xc838537b, 0xbf60c463} }, +/**/ {{0x3617200d, 0x3bc0657e} },}, +/**/ {{{0x0f7ffcac, 0xbf60a453} }, +/**/ {{0xa5080961, 0xbc008feb} },}, +/**/ {{{0x76e8ffd9, 0xbf608442} }, +/**/ {{0xbb5e1df7, 0x3bd13002} },}, +/**/ {{{0xfe731c9d, 0xbf606431} }, +/**/ {{0x6e2858c0, 0xbc0509f3} },}, +/**/ {{{0xa61e1296, 0xbf604421} }, +/**/ {{0x5f5d9695, 0xbc04b556} },}, +/**/ {{{0x6de9a162, 0xbf602411} }, +/**/ {{0xe79a4e00, 0x3c042b89} },}, +/**/ {{{0x55d5889e, 0xbf600401} }, +/**/ {{0x1113f403, 0x3be8f98e} },}, +/**/ {{{0xbbc30fd4, 0xbf5fc7e2} }, +/**/ {{0x93382bc9, 0xbbfc709b} },}, +/**/ {{{0x0c1abdcd, 0xbf5f87c3} }, +/**/ {{0x76a55d1c, 0xbbf2a90d} },}, +/**/ {{{0x9cb19a68, 0xbf5f47a3} }, +/**/ {{0x76e7826b, 0x3be1b815} },}, +/**/ {{{0x6d8724e7, 0xbf5f0784} }, +/**/ {{0x2b63756d, 0xbbe72d46} },}, +/**/ {{{0x7e9adc90, 0xbf5ec765} }, +/**/ {{0x73bb17c5, 0x3beb1a66} },}, +/**/ {{{0xcfec40a8, 0xbf5e8746} }, +/**/ {{0xb5e5a553, 0x3bf11af5} },}, +/**/ {{{0x617ad077, 0xbf5e4728} }, +/**/ {{0xf57dd14f, 0x3bfb2cad} },}, +/**/ {{{0x33460b45, 0xbf5e070a} }, +/**/ {{0x4902c8d5, 0xbbf8db75} },}, +/**/ {{{0x454d705f, 0xbf5dc6ec} }, +/**/ {{0xe8a41057, 0x3bef5cc6} },}, +/**/ {{{0x97907f0f, 0xbf5d86ce} }, +/**/ {{0xdf8672ef, 0x3bed8277} },}, +/**/ {{{0x2a0eb6a3, 0xbf5d46b1} }, +/**/ {{0x3717e5ee, 0xbbc2f9c2} },}, +/**/ {{{0xfcc7966b, 0xbf5d0693} }, +/**/ {{0xab4852c6, 0x3bf4deed} },}, +/**/ {{{0x0fba9db6, 0xbf5cc677} }, +/**/ {{0x9db2a368, 0xbbf3a2b4} },}, +/**/ {{{0x62e74bd8, 0xbf5c865a} }, +/**/ {{0x58fa0c24, 0xbbd2c51d} },}, +/**/ {{{0xf64d2024, 0xbf5c463d} }, +/**/ {{0xe3a09391, 0x3bf838ca} },}, +/**/ {{{0xc9eb99ee, 0xbf5c0621} }, +/**/ {{0x61b7de71, 0xbbdc2a9e} },}, +/**/ {{{0xddc2388e, 0xbf5bc605} }, +/**/ {{0x4accb195, 0xbbea9808} },}, +/**/ {{{0x31d07b5c, 0xbf5b85ea} }, +/**/ {{0x032e030b, 0xbbd811a2} },}, +/**/ {{{0xc615e1b1, 0xbf5b45ce} }, +/**/ {{0x821e0b81, 0xbbfd5427} },}, +/**/ {{{0x9a91eaea, 0xbf5b05b3} }, +/**/ {{0x2619306b, 0x3bfffeba} },}, +/**/ {{{0xaf441661, 0xbf5ac598} }, +/**/ {{0x9eac7d15, 0x3bd22824} },}, +/**/ {{{0x042be376, 0xbf5a857e} }, +/**/ {{0x24893f0e, 0x3bc20736} },}, +/**/ {{{0x9948d188, 0xbf5a4563} }, +/**/ {{0x04d734cd, 0xbbf58ab4} },}, +/**/ {{{0x6e9a5ff9, 0xbf5a0549} }, +/**/ {{0x5723a6c3, 0xbbf22673} },}, +/**/ {{{0x84200e2c, 0xbf59c52f} }, +/**/ {{0xa538e8e1, 0x3bfc81da} },}, +/**/ {{{0xd9d95b83, 0xbf598515} }, +/**/ {{0x2a8e3feb, 0xbbfa1a37} },}, +/**/ {{{0x6fc5c767, 0xbf5944fc} }, +/**/ {{0x385159f9, 0x3bf8e1ce} },}, +/**/ {{{0x45e4d13c, 0xbf5904e3} }, +/**/ {{0x1567c7a7, 0xbbfc4737} },}, +/**/ {{{0x5c35f86e, 0xbf58c4ca} }, +/**/ {{0x23c9ae0c, 0x3bf41581} },}, +/**/ {{{0xb2b8bc65, 0xbf5884b1} }, +/**/ {{0x2b66cfb6, 0x3bf70c2c} },}, +/**/ {{{0x496c9c8d, 0xbf584499} }, +/**/ {{0xe5a11e3e, 0xbbdb9042} },}, +/**/ {{{0x20511854, 0xbf580481} }, +/**/ {{0x61bcb040, 0xbbf9cf9d} },}, +/**/ {{{0x3765af29, 0xbf57c469} }, +/**/ {{0xe26a419b, 0xbbf65ceb} },}, +/**/ {{{0x8ea9e07c, 0xbf578451} }, +/**/ {{0xb70a4088, 0xbbf1c2f5} },}, +/**/ {{{0x261d2bbf, 0xbf57443a} }, +/**/ {{0x29704ba7, 0xbbbc7b8f} },}, +/**/ {{{0xfdbf1065, 0xbf570422} }, +/**/ {{0x433ccb3b, 0x3bca0a54} },}, +/**/ {{{0x158f0de3, 0xbf56c40c} }, +/**/ {{0x207cde2d, 0x3bd9e257} },}, +/**/ {{{0x6d8ca3af, 0xbf5683f5} }, +/**/ {{0xf7b51b49, 0xbbef17a4} },}, +/**/ {{{0x05b75142, 0xbf5643df} }, +/**/ {{0x9d345bf8, 0x3be28239} },}, +/**/ {{{0xde0e9614, 0xbf5603c8} }, +/**/ {{0x0918d1bf, 0xbbde6c21} },}, +/**/ {{{0xf691f1a1, 0xbf55c3b2} }, +/**/ {{0x377de4c8, 0x3bd37d78} },}, +/**/ {{{0x4f40e365, 0xbf55839d} }, +/**/ {{0xbbf7c9d1, 0x3bf52b7d} },}, +/**/ {{{0xe81aeadd, 0xbf554387} }, +/**/ {{0x679c3d9a, 0xbbf0be6a} },}, +/**/ {{{0xc11f878a, 0xbf550372} }, +/**/ {{0xb6cdd88e, 0xbbdd9e20} },}, +/**/ {{{0xda4e38ec, 0xbf54c35d} }, +/**/ {{0x09302da0, 0xbbe3b1e7} },}, +/**/ {{{0x33a67e86, 0xbf548349} }, +/**/ {{0x085b922d, 0x3be8cba8} },}, +/**/ {{{0xcd27d7db, 0xbf544334} }, +/**/ {{0xf024ab43, 0xbba5f2c9} },}, +/**/ {{{0xa6d1c471, 0xbf540320} }, +/**/ {{0xf686cf3d, 0xbbeb31f3} },}, +/**/ {{{0xc0a3c3cf, 0xbf53c30c} }, +/**/ {{0xd4ad32f6, 0xbbf74ffe} },}, +/**/ {{{0x1a9d557e, 0xbf5382f9} }, +/**/ {{0x4acb368f, 0x3bd2e555} },}, +/**/ {{{0xb4bdf907, 0xbf5342e5} }, +/**/ {{0x07812806, 0x3be13442} },}, +/**/ {{{0x8f052df6, 0xbf5302d2} }, +/**/ {{0x70b1e756, 0x3bf5f429} },}, +/**/ {{{0xa97273d7, 0xbf52c2bf} }, +/**/ {{0x43a03fff, 0xbbf20aa3} },}, +/**/ {{{0x04054a3a, 0xbf5282ad} }, +/**/ {{0x8bebd7ad, 0xbbed4d57} },}, +/**/ {{{0x9ebd30ae, 0xbf52429a} }, +/**/ {{0x5a71c5a4, 0xbbff9529} },}, +/**/ {{{0x7999a6c6, 0xbf520288} }, +/**/ {{0x54100f9e, 0x3bfb055a} },}, +/**/ {{{0x949a2c12, 0xbf51c276} }, +/**/ {{0xa2e9f1b4, 0xbbff6978} },}, +/**/ {{{0xefbe402a, 0xbf518264} }, +/**/ {{0xbc188323, 0x3bf01fb9} },}, +/**/ {{{0x8b0562a1, 0xbf514253} }, +/**/ {{0x957bf23a, 0xbbf7c87c} },}, +/**/ {{{0x666f1311, 0xbf510242} }, +/**/ {{0xc8be6880, 0x3bdc2cb9} },}, +/**/ {{{0x81fad111, 0xbf50c231} }, +/**/ {{0x07ba000d, 0xbbf59fc1} },}, +/**/ {{{0xdda81c3d, 0xbf508220} }, +/**/ {{0xbf5c8a0b, 0xbbf06a0a} },}, +/**/ {{{0x79767431, 0xbf504210} }, +/**/ {{0xa9a705bc, 0x3bf3a6cf} },}, +/**/ {{{0x55655889, 0xbf500200} }, +/**/ {{0xbf0fa436, 0xbbe9abe6} },}, +/**/ {{{0xe2e891cc, 0xbf4f83e0} }, +/**/ {{0x1b81bf62, 0x3be4aa59} },}, +/**/ {{{0x9b4589ce, 0xbf4f03c1} }, +/**/ {{0x8a47f50a, 0xbbe60518} },}, +/**/ {{{0xd3e0985f, 0xbf4e83a2} }, +/**/ {{0x5ef17e96, 0x3bed32d8} },}, +/**/ {{{0x8cb8bcc3, 0xbf4e0384} }, +/**/ {{0xf09afa4d, 0xbbeb7b30} },}, +/**/ {{{0xc5ccf647, 0xbf4d8366} }, +/**/ {{0xf586cec2, 0xbbd527fc} },}, +/**/ {{{0x7f1c4437, 0xbf4d0349} }, +/**/ {{0x4a686886, 0x3bc2bcf0} },}, +/**/ {{{0xb8a5a5e3, 0xbf4c832c} }, +/**/ {{0x721c2ebe, 0x3bc98f93} },}, +/**/ {{{0x72681a9e, 0xbf4c0310} }, +/**/ {{0xb5308d22, 0xbbe20f00} },}, +/**/ {{{0xac62a1bf, 0xbf4b82f4} }, +/**/ {{0x9737b561, 0xbbe1edd0} },}, +/**/ {{{0x66943a9f, 0xbf4b02d9} }, +/**/ {{0x23f894a1, 0xbbcc950b} },}, +/**/ {{{0xa0fbe49a, 0xbf4a82be} }, +/**/ {{0x866bc982, 0xbb81da04} },}, +/**/ {{{0x5b989f0f, 0xbf4a02a4} }, +/**/ {{0x9d76196e, 0xbbd9114d} },}, +/**/ {{{0x96696961, 0xbf49828a} }, +/**/ {{0xd3292fd6, 0x3bc10d20} },}, +/**/ {{{0x516d42f4, 0xbf490271} }, +/**/ {{0x2e9a5dd5, 0xbbee53a3} },}, +/**/ {{{0x8ca32b32, 0xbf488258} }, +/**/ {{0xd18f8004, 0xbbc55af5} },}, +/**/ {{{0x480a2185, 0xbf480240} }, +/**/ {{0xa9b0178a, 0xbbb32d23} },}, +/**/ {{{0x83a1255c, 0xbf478228} }, +/**/ {{0x8152093a, 0x3be84cc3} },}, +/**/ {{{0x3f673627, 0xbf470211} }, +/**/ {{0xf4881c71, 0xbbd0055a} },}, +/**/ {{{0x7b5b535c, 0xbf4681fa} }, +/**/ {{0xb98336ea, 0x3bd2b73f} },}, +/**/ {{{0x377c7c71, 0xbf4601e4} }, +/**/ {{0x2ed05089, 0xbbcdcbed} },}, +/**/ {{{0x73c9b0e1, 0xbf4581ce} }, +/**/ {{0x61414697, 0xbbdda0c2} },}, +/**/ {{{0x3041f02a, 0xbf4501b9} }, +/**/ {{0x22f8b33c, 0x3bee5d53} },}, +/**/ {{{0x6ce439ca, 0xbf4481a4} }, +/**/ {{0x9c25c999, 0xbbe5512f} },}, +/**/ {{{0x29af8d47, 0xbf440190} }, +/**/ {{0xa4df0dfd, 0x3b7f48c2} },}, +/**/ {{{0x66a2ea26, 0xbf43817c} }, +/**/ {{0x517febd8, 0x3bd157c0} },}, +/**/ {{{0x23bd4ff0, 0xbf430169} }, +/**/ {{0x0176d244, 0xbbe2e229} },}, +/**/ {{{0x60fdbe33, 0xbf428156} }, +/**/ {{0x175812b3, 0x3be64664} },}, +/**/ {{{0x1e63347c, 0xbf420144} }, +/**/ {{0xd9355524, 0xbbe39ab4} },}, +/**/ {{{0x5becb260, 0xbf418132} }, +/**/ {{0xb6e1edc9, 0x3be74b27} },}, +/**/ {{{0x19993772, 0xbf410121} }, +/**/ {{0x393ab56a, 0xbbaa390b} },}, +/**/ {{{0x5767c34c, 0xbf408110} }, +/**/ {{0xf8c7783b, 0x3bd128e6} },}, +/**/ {{{0x15575589, 0xbf400100} }, +/**/ {{0xf23ef222, 0x3bec8863} },}, +/**/ {{{0xa6cddb8d, 0xbf3f01e0} }, +/**/ {{0xcdd29c3f, 0x3b8a9419} },}, +/**/ {{{0x232b174e, 0xbf3e01c2} }, +/**/ {{0xd5f5b191, 0xbbc7cf55} },}, +/**/ {{{0x9fc45d9e, 0xbf3d01a4} }, +/**/ {{0xb5038e7e, 0x3bddc58f} },}, +/**/ {{{0x1c97adca, 0xbf3c0188} }, +/**/ {{0xbb933e41, 0x3bc0238d} },}, +/**/ {{{0x99a30728, 0xbf3b016c} }, +/**/ {{0xc3c43664, 0xbbabde04} },}, +/**/ {{{0x16e46913, 0xbf3a0152} }, +/**/ {{0x5adc3673, 0x3bafe081} },}, +/**/ {{{0x9459d2eb, 0xbf390138} }, +/**/ {{0xc2a33d26, 0xbbd949da} },}, +/**/ {{{0x12014418, 0xbf380120} }, +/**/ {{0xf76e0326, 0xbbd3acbc} },}, +/**/ {{{0x8fd8bc07, 0xbf370108} }, +/**/ {{0x4cd6ce34, 0x3bdbde09} },}, +/**/ {{{0x0dde3a29, 0xbf3600f2} }, +/**/ {{0x05442a35, 0xbbb0bc28} },}, +/**/ {{{0x8c0fbdf9, 0xbf3500dc} }, +/**/ {{0x0908cbf7, 0x3bd21c68} },}, +/**/ {{{0x0a6b46f4, 0xbf3400c8} }, +/**/ {{0x0f107564, 0xbbdbd35e} },}, +/**/ {{{0x88eed4a1, 0xbf3300b4} }, +/**/ {{0x49a3dcb8, 0xbbc22067} },}, +/**/ {{{0x0798668a, 0xbf3200a2} }, +/**/ {{0xe7c5d0e5, 0x3bcdb7f0} },}, +/**/ {{{0x8665fc3f, 0xbf310090} }, +/**/ {{0xc7f9d69c, 0xbbd00add} },}, +/**/ {{{0x05559559, 0xbf300080} }, +/**/ {{0xa0e20e2f, 0x3bddd332} },}, +/**/ {{{0x08ca62e5, 0xbf2e00e1} }, +/**/ {{0x3a04bb77, 0xbbb15ff9} },}, +/**/ {{{0x0725a061, 0xbf2c00c4} }, +/**/ {{0xcc052f3e, 0x3bc88ab0} },}, +/**/ {{{0x05b8e275, 0xbf2a00a9} }, +/**/ {{0xf5f3cbcf, 0xbbcbba1a} },}, +/**/ {{{0x04802882, 0xbf280090} }, +/**/ {{0xa5bd7bd0, 0x3bcec900} },}, +/**/ {{{0x037771ef, 0xbf260079} }, +/**/ {{0x9b7b54fa, 0x3bb77ea0} },}, +/**/ {{{0x029abe33, 0xbf240064} }, +/**/ {{0x3ae68d18, 0xbbc1bbf0} },}, +/**/ {{{0x01e60cd1, 0xbf220051} }, +/**/ {{0x2b45cfcd, 0x3bb1dcd9} },}, +/**/ {{{0x01555d56, 0xbf200040} }, +/**/ {{0x863f53f6, 0x3bcddd88} },}, +/**/ {{{0x01c95eb7, 0xbf1c0062} }, +/**/ {{0xaa4dfd9a, 0x3bbd88f7} },}, +/**/ {{{0x01200510, 0xbf180048} }, +/**/ {{0x4f3db50b, 0xbb984d46} },}, +/**/ {{{0x00a6ad1c, 0xbf140032} }, +/**/ {{0x28ff1135, 0x3bb2e44b} },}, +/**/ {{{0x00555655, 0xbf100020} }, +/**/ {{0xccd5f17f, 0xbbb62224} },}, +/**/ {{{0x004800a2, 0xbf080024} }, +/**/ {{0x8d690542, 0xbb484d09} },}, +/**/ {{{0x00155575, 0xbf000010} }, +/**/ {{0x37779c0a, 0xbba56222} },}, +/**/ {{{0x00055559, 0xbef00008} }, +/**/ {{0x22cccd5f, 0xbb955622} },}, +/**/ {{{0x00000000, 0x00000000} }, +/**/ {{0x00000000, 0x00000000} },}, +/**/ {{{0x000aaaa3, 0x3eeffff0} }, +/**/ {{0xbd110fec, 0xbb8553bb} },}, +/**/ {{{0x002aaa6b, 0x3effffe0} }, +/**/ {{0xe6661d42, 0xbb953bbb} },}, +/**/ {{{0x0047ff5e, 0x3f07ffdc} }, +/**/ {{0x0d69020e, 0x3b484c90} },}, +/**/ {{{0x00aaa8ab, 0x3f0fffc0} }, +/**/ {{0x10fec82c, 0xbba3bbc1} },}, +/**/ {{{0x00a6a83a, 0x3f13ffce} }, +/**/ {{0x81546808, 0xbbb2e45f} },}, +/**/ {{{0x011ffaf0, 0x3f17ffb8} }, +/**/ {{0x4f3d9b6a, 0x3b984c53} },}, +/**/ {{{0x01c94bf5, 0x3f1bff9e} }, +/**/ {{0xdaa368ee, 0xbbbd8990} },}, +/**/ {{{0x02aa9aab, 0x3f1fff80} }, +/**/ {{0x78af0afc, 0x3b910e66} },}, +/**/ {{{0x01e5f330, 0x3f21ffaf} }, +/**/ {{0x26467402, 0xbbb1df8d} },}, +/**/ {{{0x029a9723, 0x3f23ff9c} }, +/**/ {{0x303b23b1, 0x3bc1b965} },}, +/**/ {{{0x037738be, 0x3f25ff87} }, +/**/ {{0x53d3dc06, 0xbbb787a3} },}, +/**/ {{{0x047fd782, 0x3f27ff70} }, +/**/ {{0xa5c0aff0, 0xbbced098} },}, +/**/ {{{0x05b872e4, 0x3f29ff57} }, +/**/ {{0x81c30d42, 0x3bcbadd4} },}, +/**/ {{{0x07250a51, 0x3f2bff3c} }, +/**/ {{0xd6bad8c1, 0xbbc89dd6} },}, +/**/ {{{0x08c99d24, 0x3f2dff1f} }, +/**/ {{0xaede8ad0, 0x3bb12609} },}, +/**/ {{{0x0aaa2ab1, 0x3f2fff00} }, +/**/ {{0x4dc4e3dc, 0x3ba0bbc0} },}, +/**/ {{{0x8665591f, 0x3f30ff6f} }, +/**/ {{0x80357b54, 0xbbd013d3} },}, +/**/ {{{0x07979982, 0x3f31ff5e} }, +/**/ {{0x4817ebcd, 0xbbce0e70} },}, +/**/ {{{0x88edd619, 0x3f32ff4b} }, +/**/ {{0xc582abc3, 0xbbd72b9e} },}, +/**/ {{{0x0a6a0e74, 0x3f33ff38} }, +/**/ {{0xb95bc1fe, 0x3bdb81fc} },}, +/**/ {{{0x8c0e4220, 0x3f34ff23} }, +/**/ {{0x9b549aae, 0x3bcaed12} },}, +/**/ {{{0x0ddc70a1, 0x3f35ff0e} }, +/**/ {{0xd97a3c05, 0x3bacf6f3} },}, +/**/ {{{0x8fd69976, 0x3f36fef7} }, +/**/ {{0x6f810a3c, 0x3bab2dcf} },}, +/**/ {{{0x11febc18, 0x3f37fee0} }, +/**/ {{0xf5d3f323, 0x3bd2b9bc} },}, +/**/ {{{0x9456d7fb, 0x3f38fec7} }, +/**/ {{0x6eaa1d6a, 0xbbbfb258} },}, +/**/ {{{0x16e0ec8b, 0x3f39feae} }, +/**/ {{0xceeb34b1, 0xbbb6137a} },}, +/**/ {{{0x999ef930, 0x3f3afe93} }, +/**/ {{0xdc639b08, 0xbbde70e0} },}, +/**/ {{{0x1c92fd4a, 0x3f3bfe78} }, +/**/ {{0x713cc126, 0xbbc4ed10} },}, +/**/ {{{0x9fbef835, 0x3f3cfe5b} }, +/**/ {{0xcc0e81bd, 0xbb873d63} },}, +/**/ {{{0x2324e946, 0x3f3dfe3e} }, +/**/ {{0x62dd5deb, 0x3bc09164} },}, +/**/ {{{0xa6c6cfcc, 0x3f3efe1f} }, +/**/ {{0x3512d15c, 0x3bdac2da} },}, +/**/ {{{0x2aa6ab11, 0x3f3ffe00} }, +/**/ {{0x62cc632d, 0x3b999e2b} },}, +/**/ {{{0xd7633d2c, 0x3f407eef} }, +/**/ {{0x63ff6024, 0xbbebc98b} },}, +/**/ {{{0x19941e6e, 0x3f40fedf} }, +/**/ {{0xe0aa6338, 0xbbb194c2} },}, +/**/ {{{0xdbe6f8eb, 0x3f417ecd} }, +/**/ {{0x57b0f571, 0x3be4241b} },}, +/**/ {{{0x1e5ccc3c, 0x3f41febc} }, +/**/ {{0x895d3592, 0x3bdc657d} },}, +/**/ {{{0xe0f697f6, 0x3f427ea9} }, +/**/ {{0x1c0ec17c, 0x3be35a5d} },}, +/**/ {{{0x23b55bac, 0x3f42fe97} }, +/**/ {{0x3e538464, 0x3bd6cfb7} },}, +/**/ {{{0xe69a16ed, 0x3f437e83} }, +/**/ {{0x7cef2478, 0x3bee96f7} },}, +/**/ {{{0x29a5c947, 0x3f43fe70} }, +/**/ {{0xbf46e36a, 0xbbd4d578} },}, +/**/ {{{0xecd97242, 0x3f447e5b} }, +/**/ {{0x3ff7dd44, 0xbbc9eb66} },}, +/**/ {{{0x30361165, 0x3f44fe47} }, +/**/ {{0x7e93f2fd, 0x3be400d7} },}, +/**/ {{{0xf3bca635, 0x3f457e31} }, +/**/ {{0xd375017f, 0xbbe0e2a2} },}, +/**/ {{{0x376e3031, 0x3f45fe1c} }, +/**/ {{0x8a5ae7f6, 0xbbd524eb} },}, +/**/ {{{0xfb4baed7, 0x3f467e05} }, +/**/ {{0x4e85c4e9, 0x3be204fb} },}, +/**/ {{{0x3f5621a3, 0x3f46fdef} }, +/**/ {{0x34886d52, 0xbbdf09d7} },}, +/**/ {{{0x038e880b, 0x3f477dd8} }, +/**/ {{0x14e596a3, 0xbbb8900e} },}, +/**/ {{{0x47f5e185, 0x3f47fdc0} }, +/**/ {{0x57d202d3, 0xbbebfa5c} },}, +/**/ {{{0x0c8d2d81, 0x3f487da8} }, +/**/ {{0xd68c0614, 0x3be2f6ae} },}, +/**/ {{{0x51556b70, 0x3f48fd8f} }, +/**/ {{0xe08fd201, 0xbbd0f4f2} },}, +/**/ {{{0x164f9abc, 0x3f497d76} }, +/**/ {{0xa871af60, 0x3b5296b7} },}, +/**/ {{{0x5b7cbace, 0x3f49fd5c} }, +/**/ {{0x9f17d42d, 0x3beb6ed4} },}, +/**/ {{{0x20ddcb0d, 0x3f4a7d42} }, +/**/ {{0x67c30397, 0xbbcb1149} },}, +/**/ {{{0x6673cada, 0x3f4afd27} }, +/**/ {{0x45da594f, 0x3bd32225} },}, +/**/ {{{0x2c3fb996, 0x3f4b7d0c} }, +/**/ {{0x208d4630, 0xbbb68893} },}, +/**/ {{{0x7242969d, 0x3f4bfcf0} }, +/**/ {{0x2b3efe1c, 0x3bc5db4d} },}, +/**/ {{{0x387d6149, 0x3f4c7cd4} }, +/**/ {{0xed57d98a, 0x3be46eff} },}, +/**/ {{{0x7ef118f1, 0x3f4cfcb7} }, +/**/ {{0x06f300fb, 0x3becc554} },}, +/**/ {{{0x459ebce9, 0x3f4d7c9a} }, +/**/ {{0x13638eb6, 0x3be1d251} },}, +/**/ {{{0x8c874c82, 0x3f4dfc7c} }, +/**/ {{0xd57a176f, 0xbbe863e9} },}, +/**/ {{{0x53abc708, 0x3f4e7c5e} }, +/**/ {{0x9528e50d, 0x3be2d95c} },}, +/**/ {{{0x9b0d2bc8, 0x3f4efc3f} }, +/**/ {{0xa5f5b8b7, 0x3bd1e8e8} },}, +/**/ {{{0x62ac7a09, 0x3f4f7c20} }, +/**/ {{0x17802a46, 0x3b5c8123} },}, +/**/ {{{0xaa8ab110, 0x3f4ffc00} }, +/**/ {{0xeb9b6cdb, 0xbbe0fecb} },}, +/**/ {{{0x3954680f, 0x3f503df0} }, +/**/ {{0x1c693678, 0x3bdac89b} },}, +/**/ {{{0xdd83eb3a, 0x3f507ddf} }, +/**/ {{0x0a75ad5f, 0xbbf638f6} },}, +/**/ {{{0x41d461a5, 0x3f50bdcf} }, +/**/ {{0x45f05b10, 0x3bfd4bc9} },}, +/**/ {{{0x66464aef, 0x3f50fdbe} }, +/**/ {{0x6abbf59c, 0xbbbd0554} },}, +/**/ {{{0x4ada26b1, 0x3f513dad} }, +/**/ {{0x6036fe6f, 0x3be38c65} },}, +/**/ {{{0xef907485, 0x3f517d9b} }, +/**/ {{0xf158bbc3, 0x3bfdc8a1} },}, +/**/ {{{0x5469b404, 0x3f51bd8a} }, +/**/ {{0x55632e3f, 0xbbdea231} },}, +/**/ {{{0x796664c3, 0x3f51fd78} }, +/**/ {{0x2edb73c2, 0xbbe00849} },}, +/**/ {{{0x5e870657, 0x3f523d66} }, +/**/ {{0x0789343e, 0x3bfba943} },}, +/**/ {{{0x03cc1855, 0x3f527d54} }, +/**/ {{0xeafafc52, 0x3bc5f644} },}, +/**/ {{{0x69361a4e, 0x3f52bd41} }, +/**/ {{0xa4a6e79f, 0xbbf2f743} },}, +/**/ {{{0x8ec58bd2, 0x3f52fd2e} }, +/**/ {{0x5ceb1abf, 0xbbd4f786} },}, +/**/ {{{0x747aec71, 0x3f533d1b} }, +/**/ {{0x49dc497d, 0xbbf369e3} },}, +/**/ {{{0x1a56bbb8, 0x3f537d08} }, +/**/ {{0x3726b14a, 0xbbfc5e6f} },}, +/**/ {{{0x80597933, 0x3f53bcf4} }, +/**/ {{0x808f75a7, 0xbbfe8b82} },}, +/**/ {{{0xa683a46c, 0x3f53fce0} }, +/**/ {{0x9cd06ae6, 0x3be02719} },}, +/**/ {{{0x8cd5bced, 0x3f543ccc} }, +/**/ {{0x758f80f8, 0x3bf9f98d} },}, +/**/ {{{0x3350423e, 0x3f547cb8} }, +/**/ {{0x48401f45, 0xbbd79c3d} },}, +/**/ {{{0x99f3b3e4, 0x3f54bca3} }, +/**/ {{0x2fba8948, 0xbbf422b8} },}, +/**/ {{{0xc0c09163, 0x3f54fc8e} }, +/**/ {{0xf4044be8, 0x3bf32cc1} },}, +/**/ {{{0xa7b75a40, 0x3f553c79} }, +/**/ {{0xf2249008, 0xbbe72cac} },}, +/**/ {{{0x4ed88dfb, 0x3f557c64} }, +/**/ {{0x459a204f, 0xbbe7183c} },}, +/**/ {{{0xb624ac14, 0x3f55bc4e} }, +/**/ {{0xba26d3d7, 0x3bf8aa64} },}, +/**/ {{{0xdd9c340b, 0x3f55fc38} }, +/**/ {{0x45fa193c, 0x3bdbb2ff} },}, +/**/ {{{0xc53fa55c, 0x3f563c22} }, +/**/ {{0x0484397b, 0x3bd67249} },}, +/**/ {{{0x6d0f7f83, 0x3f567c0c} }, +/**/ {{0xf1e73188, 0xbbd183d7} },}, +/**/ {{{0xd50c41fa, 0x3f56bbf5} }, +/**/ {{0x4ab68187, 0xbbef433d} },}, +/**/ {{{0xfd366c39, 0x3f56fbde} }, +/**/ {{0x66e09e58, 0x3be796b8} },}, +/**/ {{{0xe58e7db8, 0x3f573bc7} }, +/**/ {{0x81e6e7e6, 0x3bf65ec5} },}, +/**/ {{{0x8e14f5ed, 0x3f577bb0} }, +/**/ {{0xa9463a9c, 0xbbdb944d} },}, +/**/ {{{0xf6ca544b, 0x3f57bb98} }, +/**/ {{0xc5eda344, 0xbbc396ec} },}, +/**/ {{{0x1faf1845, 0x3f57fb81} }, +/**/ {{0xbb624f97, 0x3beb9e6d} },}, +/**/ {{{0x08c3c14d, 0x3f583b69} }, +/**/ {{0xe6295bf2, 0xbbe6ee13} },}, +/**/ {{{0xb208ced1, 0x3f587b50} }, +/**/ {{0x6ca19875, 0x3bfcf1a5} },}, +/**/ {{{0x1b7ec041, 0x3f58bb38} }, +/**/ {{0x07b4fc7e, 0x3bf2d181} },}, +/**/ {{{0x45261509, 0x3f58fb1f} }, +/**/ {{0x21bad336, 0x3bc419c5} },}, +/**/ {{{0x2eff4c94, 0x3f593b06} }, +/**/ {{0x700b305b, 0xbbdc2a4c} },}, +/**/ {{{0xd90ae64c, 0x3f597aec} }, +/**/ {{0xa23f359c, 0xbbfc53d3} },}, +/**/ {{{0x43496198, 0x3f59bad3} }, +/**/ {{0xaed6b50f, 0x3bf0c270} },}, +/**/ {{{0x6dbb3de1, 0x3f59fab9} }, +/**/ {{0x7a8be031, 0xbbf11464} },}, +/**/ {{{0x5860fa8a, 0x3f5a3a9f} }, +/**/ {{0x470dbe32, 0x3beae9e7} },}, +/**/ {{{0x033b16f8, 0x3f5a7a85} }, +/**/ {{0xda1f8579, 0x3bfc4721} },}, +/**/ {{{0x6e4a128e, 0x3f5aba6a} }, +/**/ {{0x029258ce, 0xbbf41852} },}, +/**/ {{{0x998e6cab, 0x3f5afa4f} }, +/**/ {{0x2eb18782, 0xbbf28584} },}, +/**/ {{{0x8508a4af, 0x3f5b3a34} }, +/**/ {{0x23241a2c, 0xbbea7970} },}, +/**/ {{{0x30b939f8, 0x3f5b7a19} }, +/**/ {{0x600551b6, 0xbbf1d8db} },}, +/**/ {{{0x9ca0abe2, 0x3f5bb9fd} }, +/**/ {{0x8c26cc71, 0xbbeaa412} },}, +/**/ {{{0xc8bf79c8, 0x3f5bf9e1} }, +/**/ {{0x30427cfc, 0xbbe7f81b} },}, +/**/ {{{0xb5162303, 0x3f5c39c5} }, +/**/ {{0xd1f134e1, 0x3bd9ec5f} },}, +/**/ {{{0x61a526eb, 0x3f5c79a9} }, +/**/ {{0x8980e47d, 0x3bff0cb0} },}, +/**/ {{{0xce6d04d7, 0x3f5cb98c} }, +/**/ {{0xe84ca4e2, 0x3bf35aca} },}, +/**/ {{{0xfb6e3c1b, 0x3f5cf96f} }, +/**/ {{0x1b0bd69f, 0x3bf9b1b8} },}, +/**/ {{{0xe8a94c0b, 0x3f5d3952} }, +/**/ {{0x3ce51832, 0x3be21310} },}, +/**/ {{{0x961eb3f8, 0x3f5d7935} }, +/**/ {{0x840c58ce, 0x3bf90786} },}, +/**/ {{{0x03cef334, 0x3f5db918} }, +/**/ {{0xf2dfb3f4, 0xbbfe0048} },}, +/**/ {{{0x31ba890b, 0x3f5df8fa} }, +/**/ {{0x3e295bec, 0x3bfcf652} },}, +/**/ {{{0x1fe1f4ce, 0x3f5e38dc} }, +/**/ {{0x151c9300, 0xbbfc5ebe} },}, +/**/ {{{0xce45b5c6, 0x3f5e78bd} }, +/**/ {{0x8a25b9c7, 0xbbef2cc4} },}, +/**/ {{{0x3ce64b3e, 0x3f5eb89f} }, +/**/ {{0xa6fea7bd, 0x3bfe6d27} },}, +/**/ {{{0x6bc43481, 0x3f5ef880} }, +/**/ {{0x914a6dab, 0xbbf68037} },}, +/**/ {{{0x5adff0d4, 0x3f5f3861} }, +/**/ {{0xf909e0e6, 0xbbf1d2f3} },}, +/**/ {{{0x0a39ff7e, 0x3f5f7842} }, +/**/ {{0xff1e1f71, 0xbbf64661} },}, +/**/ {{{0x79d2dfc3, 0x3f5fb822} }, +/**/ {{0x5a6f9e9a, 0xbbd76ce8} },}, +/**/ {{{0xa9ab10e6, 0x3f5ff802} }, +/**/ {{0xa153e3b2, 0x3bfe29e3} },}, +/**/ {{{0x4ce18915, 0x3f601bf1} }, +/**/ {{0xa3a73044, 0xbbe57c28} },}, +/**/ {{{0x250db166, 0x3f603be1} }, +/**/ {{0xc1ad9590, 0x3c0fd271} },}, +/**/ {{{0xdd5a4107, 0x3f605bd0} }, +/**/ {{0xc424c676, 0x3bfe4b5d} },}, +/**/ {{{0x75c77796, 0x3f607bc0} }, +/**/ {{0xc0eff1ba, 0xbc068804} },}, +/**/ {{{0xee5594b0, 0x3f609baf} }, +/**/ {{0x51dbded5, 0xbc0ff798} },}, +/**/ {{{0x4704d7f2, 0x3f60bb9f} }, +/**/ {{0x2d5aba70, 0xbbf70ef4} },}, +/**/ {{{0x7fd580f9, 0x3f60db8e} }, +/**/ {{0x7ae804b5, 0xbbeccb65} },}, +/**/ {{{0x98c7cf60, 0x3f60fb7d} }, +/**/ {{0x1775134d, 0x3bfede2f} },}, +/**/ {{{0x91dc02c3, 0x3f611b6c} }, +/**/ {{0x91ca4a67, 0xbc04d41e} },}, +/**/ {{{0x6b125aba, 0x3f613b5b} }, +/**/ {{0x4a12201d, 0x3bfe6d0c} },}, +/**/ {{{0x246b16e0, 0x3f615b4a} }, +/**/ {{0x4d4238d3, 0x3bfe507d} },}, +/**/ {{{0xbde676cd, 0x3f617b38} }, +/**/ {{0x0640462a, 0x3bfe0272} },}, +/**/ {{{0x3784ba19, 0x3f619b27} }, +/**/ {{0x02285659, 0x3bd94ab3} },}, +/**/ {{{0x9146205b, 0x3f61bb15} }, +/**/ {{0x1cc35b7b, 0xbbff1e2e} },}, +/**/ {{{0xcb2ae929, 0x3f61db03} }, +/**/ {{0x12f6bf8d, 0xbc03ee8e} },}, +/**/ {{{0xe5335418, 0x3f61faf1} }, +/**/ {{0x7b7d619b, 0x3c0bae5f} },}, +/**/ {{{0xdf5fa0bf, 0x3f621adf} }, +/**/ {{0xb3b731b0, 0xbbf5546a} },}, +/**/ {{{0xb9b00eb0, 0x3f623acd} }, +/**/ {{0x105fd253, 0xbbafb2b0} },}, +/**/ {{{0x7424dd7f, 0x3f625abb} }, +/**/ {{0xca53444b, 0x3c011647} },}, +/**/ {{{0x0ebe4cbf, 0x3f627aa9} }, +/**/ {{0x592f3be8, 0x3c01678f} },}, +/**/ {{{0x897c9c02, 0x3f629a96} }, +/**/ {{0x4347451d, 0xbbef2b12} },}, +/**/ {{{0xe4600ad8, 0x3f62ba83} }, +/**/ {{0xb2a477bc, 0x3bfb5bb7} },}, +/**/ {{{0x1f68d8d3, 0x3f62da71} }, +/**/ {{0x7a5822e4, 0xbc0590e1} },}, +/**/ {{{0x3a974581, 0x3f62fa5e} }, +/**/ {{0x53123101, 0xbbf0f2e5} },}, +/**/ {{{0x35eb9072, 0x3f631a4b} }, +/**/ {{0x0e3f5fde, 0xbc018db4} },}, +/**/ {{{0x1165f933, 0x3f633a38} }, +/**/ {{0x8d0afb38, 0x3c0921d5} },}, +/**/ {{{0xcd06bf53, 0x3f635a24} }, +/**/ {{0xb5791b80, 0x3c01f6ba} },}, +/**/ {{{0x68ce225e, 0x3f637a11} }, +/**/ {{0xa1894236, 0x3bde2af8} },}, +/**/ {{{0xe4bc61e0, 0x3f6399fd} }, +/**/ {{0xd0f06ff3, 0xbc062a48} },}, +/**/ {{{0x40d1bd63, 0x3f63b9ea} }, +/**/ {{0x4b4f9c11, 0x3bffc80c} },}, +/**/ {{{0x7d0e7473, 0x3f63d9d6} }, +/**/ {{0x6a92c891, 0x3c02219b} },}, +/**/ {{{0x9972c699, 0x3f63f9c2} }, +/**/ {{0x790ade9e, 0x3c0d3590} },}, +/**/ {{{0x95fef35f, 0x3f6419ae} }, +/**/ {{0x792a458c, 0xbc01c279} },}, +/**/ {{{0x72b33a4b, 0x3f64399a} }, +/**/ {{0x327bffae, 0x3c02ce64} },}, +/**/ {{{0x2f8fdae7, 0x3f645986} }, +/**/ {{0xd231155c, 0xbc070aec} },}, +/**/ {{{0xcc9514b7, 0x3f647971} }, +/**/ {{0xe4bbf776, 0x3c0f373d} },}, +/**/ {{{0x49c32744, 0x3f64995d} }, +/**/ {{0xbf22b2a7, 0xbbf6d7e5} },}, +/**/ {{{0xa71a5211, 0x3f64b948} }, +/**/ {{0x64fe2936, 0xbbedec69} },}, +/**/ {{{0xe49ad4a3, 0x3f64d933} }, +/**/ {{0xabee4257, 0x3bf5fc4b} },}, +/**/ {{{0x0244ee7e, 0x3f64f91f} }, +/**/ {{0x3cd1474f, 0x3c0c6fe3} },}, +/**/ {{{0x0018df26, 0x3f65190a} }, +/**/ {{0xd11e7fa5, 0xbc023957} },}, +/**/ {{{0xde16e61b, 0x3f6538f4} }, +/**/ {{0x55380346, 0x3c006c31} },}, +/**/ {{{0x9c3f42e1, 0x3f6558df} }, +/**/ {{0xc4a5134c, 0xbc09b7d4} },}, +/**/ {{{0x3a9234f7, 0x3f6578ca} }, +/**/ {{0x2772c19c, 0xbc0e3f10} },}, +/**/ {{{0xb90ffbdd, 0x3f6598b4} }, +/**/ {{0x5592b468, 0x3be6f110} },}, +/**/ {{{0x17b8d714, 0x3f65b89f} }, +/**/ {{0xb251ace2, 0xbc0a5fea} },}, +/**/ {{{0x568d0619, 0x3f65d889} }, +/**/ {{0x315da285, 0xbc0aacc9} },}, +/**/ {{{0x758cc86a, 0x3f65f873} }, +/**/ {{0xba64d81a, 0xbbeb0782} },}, +/**/ {{{0x74b85d85, 0x3f66185d} }, +/**/ {{0x8e1eb3fa, 0xbc09b459} },}, +/**/ {{{0x541004e5, 0x3f663847} }, +/**/ {{0x1d86e863, 0x3bce9c22} },}, +/**/ {{{0x1393fe07, 0x3f665831} }, +/**/ {{0xcf37ee90, 0xbbfbeb77} },}, +/**/ {{{0xb3448865, 0x3f66781a} }, +/**/ {{0xc252e3c9, 0xbc02dc68} },}, +/**/ {{{0x3321e379, 0x3f669804} }, +/**/ {{0xb40b3741, 0xbbe73a0b} },}, + }; + +#endif +#endif diff --git a/libgcc-math/dbl-64/upow.h b/libgcc-math/dbl-64/upow.h new file mode 100644 index 00000000000..1db748319dc --- /dev/null +++ b/libgcc-math/dbl-64/upow.h @@ -0,0 +1,81 @@ +/* + * IBM Accurate Mathematical Library + * Written by International Business Machines Corp. + * Copyright (C) 2001, 2002 Free Software Foundation, Inc. + * + * This program is free software; you can redistribute it and/or modify + * it under the terms of the GNU Lesser General Public License as published by + * the Free Software Foundation; either version 2.1 of the License, or + * (at your option) any later version. + * + * This program is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU Lesser General Public License for more details. + * + * You should have received a copy of the GNU Lesser General Public License + * along with this program; if not, write to the Free Software + * Foundation, Inc., 59 Temple Place - Suite 330, Boston, MA 02111-1307, USA. + */ + +/******************************************************************/ +/* */ +/* MODULE_NAME:upow.h */ +/* */ +/* common data and variables prototype and definition */ +/******************************************************************/ + +#ifndef UPOW_H +#define UPOW_H + +#include "mydefs.h" + +#ifdef BIG_ENDI + const static mynumber +/**/ nZERO = {{0x80000000, 0}}, /* -0.0 */ +/**/ INF = {{0x7ff00000, 0x00000000}}, /* INF */ +/**/ nINF = {{0xfff00000, 0x00000000}}, /* -INF */ +/**/ NaNQ = {{0x7ff80000, 0x00000000}}, /* NaNQ */ +/**/ sqrt_2 = {{0x3ff6a09e, 0x667f3bcc}}, /* sqrt(2) */ +/**/ ln2a = {{0x3fe62e42, 0xfefa3800}}, /* ln(2) 43 bits */ +/**/ ln2b = {{0x3d2ef357, 0x93c76730}}, /* ln(2)-ln2a */ +/**/ bigu = {{0x4297ffff, 0xfffffd2c}}, /* 1.5*2**42 -724*2**-10 */ +/**/ bigv = {{0x4207ffff, 0xfff8016a}}, /* 1.5*2**33-1+362*2**-19 */ +/**/ t52 = {{0x43300000, 0x00000000}}, /* 2**52 */ +/**/ two52e = {{0x43300000, 0x000003ff}}; /* 2**52' */ + +#else +#ifdef LITTLE_ENDI + const static mynumber +/**/ nZERO = {{0, 0x80000000}}, /* -0.0 */ +/**/ INF = {{0x00000000, 0x7ff00000}}, /* INF */ +/**/ nINF = {{0x00000000, 0xfff00000}}, /* -INF */ +/**/ NaNQ = {{0x00000000, 0x7ff80000}}, /* NaNQ */ +/**/ sqrt_2 = {{0x667f3bcc, 0x3ff6a09e}}, /* sqrt(2) */ +/**/ ln2a = {{0xfefa3800, 0x3fe62e42}}, /* ln(2) 43 bits */ +/**/ ln2b = {{0x93c76730, 0x3d2ef357}}, /* ln(2)-ln2a */ +/**/ bigu = {{0xfffffd2c, 0x4297ffff}}, /* 1.5*2**42 -724*2**-10 */ +/**/ bigv = {{0xfff8016a, 0x4207ffff}}, /* 1.5*2**33-1+362*2**-19 */ +/**/ t52 = {{0x00000000, 0x43300000}}, /* 2**52 */ +/**/ two52e = {{0x000003ff, 0x43300000}}; /* 2**52' */ + +#endif +#endif + +const static double p2=-0.5, p3 = 3.3333333333333333333e-1, p4 = -0.25, + q2 = -0.5, q3 = 3.3333333333331404e-01, q4 = -2.4999999999996436e-01, + q5 = 2.0000010500004459e-01, q6 = -1.6666678916688004e-01, + r3 = 3.33333333333333333372884096563030E-01, + r4 = -2.50000000000000000213574153875908E-01, + r5 = 1.99999999999683593814072199830603E-01, + r6 = -1.66666666666065494878165510225378E-01, + r7 = 1.42857517857114380606360005067609E-01, + r8 = -1.25000449999974370683775964001702E-01, + s3 = 0.333251953125000000e0, + ss3 = 8.138020833333333333e-05, + s4 = -2.500000000000000000e-01, + s5 = 1.999999999999960937e-01, + s6 = -1.666666666666592447e-01, + s7 = 1.428571845238194705e-01, + s8 = -1.250000500000149097e-01; +#endif diff --git a/libgcc-math/dbl-64/upow.tbl b/libgcc-math/dbl-64/upow.tbl new file mode 100644 index 00000000000..acad6bcc894 --- /dev/null +++ b/libgcc-math/dbl-64/upow.tbl @@ -0,0 +1,10189 @@ +/* + * IBM Accurate Mathematical Library + * Written by International Business Machines Corp. + * Copyright (C) 2001 Free Software Foundation, Inc. + * + * This program is free software; you can redistribute it and/or modify + * it under the terms of the GNU Lesser General Public License as published by + * the Free Software Foundation; either version 2.1 of the License, or + * (at your option) any later version. + * + * This program is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU Lesser General Public License for more details. + * + * You should have received a copy of the GNU Lesser General Public License + * along with this program; if not, write to the Free Software + * Foundation, Inc., 59 Temple Place - Suite 330, Boston, MA 02111-1307, USA. + */ + +/****************************************************************/ +/* TABLES FOR THE upow() FUNCTION */ +/****************************************************************/ + + + +#ifdef BIG_ENDI +static const union {int4 i[5800]; double x[2900];} ui = { .i = { +/**/ 0x3FF6A000, 0x00000000, +/**/ 0x3F33CD15, 0x3729043E, +/**/ 0xBFD63003, 0x0B3AB000, +/**/ 0x3D2DB623, 0xE731AE00, +/**/ 0x3FF69800, 0x00000000, +/**/ 0x3F33F349, 0xCC7267D0, +/**/ 0xBFD61965, 0xCDB03000, +/**/ 0x3D2F08AD, 0x603C488E, +/**/ 0x3FF69000, 0x00000000, +/**/ 0x3F3473A8, 0x8D0BFD2E, +/**/ 0xBFD602D0, 0x8AF09000, +/**/ 0xBD1EBE91, 0x76DF3F65, +/**/ 0x3FF68800, 0x00000000, +/**/ 0x3F354DD2, 0x390B9ED0, +/**/ 0xBFD5EC43, 0x3D5C3000, +/**/ 0xBD36B71A, 0x1229D17F, +/**/ 0x3FF68000, 0x00000000, +/**/ 0x3F368168, 0x16816817, +/**/ 0xBFD5D5BD, 0xDF596000, +/**/ 0x3D0A0B2A, 0x08A465DC, +/**/ 0x3FF67800, 0x00000000, +/**/ 0x3F380E0B, 0xF08C7765, +/**/ 0xBFD5BF40, 0x6B544000, +/**/ 0x3D227023, 0xEB68981C, +/**/ 0x3FF67000, 0x00000000, +/**/ 0x3F39F360, 0x16719F36, +/**/ 0xBFD5A8CA, 0xDBBEE000, +/**/ 0x3CF7C79B, 0x0AF7ECF8, +/**/ 0x3FF66800, 0x00000000, +/**/ 0x3F3C3107, 0x5AB40167, +/**/ 0xBFD5925D, 0x2B113000, +/**/ 0x3D369BF5, 0xA7A56F34, +/**/ 0x3FF66000, 0x00000000, +/**/ 0x3F3EC6A5, 0x122F9016, +/**/ 0xBFD57BF7, 0x53C8D000, +/**/ 0xBD1FADED, 0xEE5D40EF, +/**/ 0x3FF65C00, 0x00000000, +/**/ 0xBF3E4C22, 0xECCA9097, +/**/ 0xBFD56599, 0x50695000, +/**/ 0xBD14C5FD, 0x2BADC774, +/**/ 0x3FF65400, 0x00000000, +/**/ 0xBF3B07AC, 0x4B55CC62, +/**/ 0xBFD54F43, 0x1B7BE000, +/**/ 0xBD1A8954, 0xC0910952, +/**/ 0x3FF64C00, 0x00000000, +/**/ 0xBF376C52, 0x32DA090E, +/**/ 0xBFD538F4, 0xAF8F7000, +/**/ 0xBD27EC02, 0xE45547CE, +/**/ 0x3FF64400, 0x00000000, +/**/ 0xBF337A6F, 0x4DE9BD38, +/**/ 0xBFD522AE, 0x0738A000, +/**/ 0xBD2EBE70, 0x8164C759, +/**/ 0x3FF63C00, 0x00000000, +/**/ 0xBF2E64BB, 0x923C708B, +/**/ 0xBFD50C6F, 0x1D11C000, +/**/ 0x3D3A0E6B, 0x7E827C2C, +/**/ 0x3FF63400, 0x00000000, +/**/ 0xBF2528EE, 0xA7E43FD4, +/**/ 0xBFD4F637, 0xEBBAA000, +/**/ 0x3D3FC158, 0xCB3124B9, +/**/ 0x3FF62C00, 0x00000000, +/**/ 0xBF168454, 0x86689DF7, +/**/ 0xBFD4E008, 0x6DD8C000, +/**/ 0x3D34D692, 0xA1E44788, +/**/ 0x3FF62400, 0x00000000, +/**/ 0xBED623FA, 0x77016240, +/**/ 0xBFD4C9E0, 0x9E173000, +/**/ 0x3D2E2089, 0x1B0AD8A4, +/**/ 0x3FF61C00, 0x00000000, +/**/ 0x3F151300, 0x58715130, +/**/ 0xBFD4B3C0, 0x77268000, +/**/ 0x3D165B46, 0x81052B9F, +/**/ 0x3FF61400, 0x00000000, +/**/ 0x3F266D06, 0x35D2754E, +/**/ 0xBFD49DA7, 0xF3BCC000, +/**/ 0xBD307B33, 0x4DAF4B9A, +/**/ 0x3FF60C00, 0x00000000, +/**/ 0x3F317C61, 0xDA197F23, +/**/ 0xBFD48797, 0x0E958000, +/**/ 0xBD3DC1B8, 0x465CF25F, +/**/ 0x3FF60400, 0x00000000, +/**/ 0x3F381605, 0x81605816, +/**/ 0xBFD4718D, 0xC271C000, +/**/ 0xBD306C18, 0xFB4C14C5, +/**/ 0x3FF5FC00, 0x00000000, +/**/ 0x3F3F0317, 0xB5C6F559, +/**/ 0xBFD45B8C, 0x0A17E000, +/**/ 0x3D0D9120, 0xE7D0A853, +/**/ 0x3FF5F800, 0x00000000, +/**/ 0xBF39BCBD, 0x6D2041E3, +/**/ 0xBFD44591, 0xE053A000, +/**/ 0x3D06E958, 0x92923D88, +/**/ 0x3FF5F000, 0x00000000, +/**/ 0xBF3229CF, 0x5604CC40, +/**/ 0xBFD42F9F, 0x3FF62000, +/**/ 0xBD390644, 0x0F7D3354, +/**/ 0x3FF5E800, 0x00000000, +/**/ 0xBF2488E5, 0xFD431489, +/**/ 0xBFD419B4, 0x23D5F000, +/**/ 0x3D3CE379, 0x226DE3EC, +/**/ 0x3FF5E000, 0x00000000, +/**/ 0xBF0067E7, 0x6424E9C9, +/**/ 0xBFD403D0, 0x86CEA000, +/**/ 0xBD3E6EF5, 0x74487308, +/**/ 0x3FF5D800, 0x00000000, +/**/ 0x3F19F0FB, 0x38A94D24, +/**/ 0xBFD3EDF4, 0x63C17000, +/**/ 0x3D3F067C, 0x297F2C3F, +/**/ 0x3FF5D000, 0x00000000, +/**/ 0x3F2EADD9, 0x23CAD2AA, +/**/ 0xBFD3D81F, 0xB5947000, +/**/ 0x3D222C7C, 0x2A9D37A4, +/**/ 0x3FF5C800, 0x00000000, +/**/ 0x3F3882B9, 0x31057262, +/**/ 0xBFD3C252, 0x77333000, +/**/ 0xBD183B54, 0xB606BD5C, +/**/ 0x3FF5C400, 0x00000000, +/**/ 0xBF3E00AE, 0x10FFA8F8, +/**/ 0xBFD3AC8C, 0xA38E6000, +/**/ 0x3D2D0BEF, 0xBC02BE4A, +/**/ 0x3FF5BC00, 0x00000000, +/**/ 0xBF34339B, 0x8056EAF3, +/**/ 0xBFD396CE, 0x359BC000, +/**/ 0x3D05839C, 0x5663663D, +/**/ 0x3FF5B400, 0x00000000, +/**/ 0xBF242CC1, 0xF31D7FD5, +/**/ 0xBFD38117, 0x28565000, +/**/ 0x3D2A71E4, 0x93A0702B, +/**/ 0x3FF5AC00, 0x00000000, +/**/ 0x3ED5AC05, 0x6B015AC0, +/**/ 0xBFD36B67, 0x76BE1000, +/**/ 0xBD116ECD, 0xB0F177C8, +/**/ 0x3FF5A400, 0x00000000, +/**/ 0x3F26268D, 0x5BA55E5A, +/**/ 0xBFD355BF, 0x1BD83000, +/**/ 0x3D2BA99B, 0x8964F0E8, +/**/ 0x3FF59C00, 0x00000000, +/**/ 0x3F361F12, 0x3CCAA376, +/**/ 0xBFD3401E, 0x12AED000, +/**/ 0x3D317C73, 0x556E291D, +/**/ 0x3FF59800, 0x00000000, +/**/ 0xBF3E863D, 0x62D32417, +/**/ 0xBFD32A84, 0x56512000, +/**/ 0xBD04F928, 0x139AF5D6, +/**/ 0x3FF59000, 0x00000000, +/**/ 0xBF32DCF7, 0xEA712DCF, +/**/ 0xBFD314F1, 0xE1D36000, +/**/ 0x3D28E27A, 0xD3213CB8, +/**/ 0x3FF58800, 0x00000000, +/**/ 0xBF1B95B2, 0xA0CC87E8, +/**/ 0xBFD2FF66, 0xB04EB000, +/**/ 0x3D38AED2, 0x541E6E2E, +/**/ 0x3FF58000, 0x00000000, +/**/ 0x3F158056, 0x01580560, +/**/ 0xBFD2E9E2, 0xBCE12000, +/**/ 0xBD24300C, 0x128D1DC2, +/**/ 0x3FF57800, 0x00000000, +/**/ 0x3F31F340, 0x15791F34, +/**/ 0xBFD2D466, 0x02ADD000, +/**/ 0x3D288D0D, 0xDCD54196, +/**/ 0x3FF57000, 0x00000000, +/**/ 0x3F3ED3C5, 0x06B39A23, +/**/ 0xBFD2BEF0, 0x7CDC9000, +/**/ 0xBD2A9CFA, 0x4A5004F4, +/**/ 0x3FF56C00, 0x00000000, +/**/ 0xBF33FEA9, 0x53FEA954, +/**/ 0xBFD2A982, 0x269A4000, +/**/ 0x3D22058E, 0x557285CF, +/**/ 0x3FF56400, 0x00000000, +/**/ 0xBF1A1160, 0xEB478503, +/**/ 0xBFD2941A, 0xFB187000, +/**/ 0x3D3210C2, 0xB730E28B, +/**/ 0x3FF55C00, 0x00000000, +/**/ 0x3F1D09AD, 0xE4A18B2E, +/**/ 0xBFD27EBA, 0xF58D9000, +/**/ 0x3D2B1988, 0x00B4BDA7, +/**/ 0x3FF55400, 0x00000000, +/**/ 0x3F355555, 0x55555555, +/**/ 0xBFD26962, 0x1134E000, +/**/ 0x3D31B61F, 0x10522625, +/**/ 0x3FF55000, 0x00000000, +/**/ 0xBF3C4BE6, 0xB319A21F, +/**/ 0xBFD25410, 0x494E5000, +/**/ 0xBD3B1D7A, 0xC0EF77F2, +/**/ 0x3FF54800, 0x00000000, +/**/ 0xBF2B4328, 0x8FA03FD5, +/**/ 0xBFD23EC5, 0x991EC000, +/**/ 0x3D36DBE4, 0x48A2E522, +/**/ 0x3FF54000, 0x00000000, +/**/ 0x3EF54015, 0x40154015, +/**/ 0xBFD22981, 0xFBEF8000, +/**/ 0x3D3A1421, 0x609580DA, +/**/ 0x3FF53800, 0x00000000, +/**/ 0x3F30948F, 0x40FEAC6F, +/**/ 0xBFD21445, 0x6D0EC000, +/**/ 0x3D3CAF04, 0x28B728A3, +/**/ 0x3FF53400, 0x00000000, +/**/ 0xBF3FE034, 0xFD04F7B8, +/**/ 0xBFD1FF0F, 0xE7CF4000, +/**/ 0xBD3E9D5B, 0x513FF0C1, +/**/ 0x3FF52C00, 0x00000000, +/**/ 0xBF300A95, 0x7FAB5403, +/**/ 0xBFD1E9E1, 0x6788A000, +/**/ 0x3D382EAE, 0xD3C8B65E, +/**/ 0x3FF52400, 0x00000000, +/**/ 0x3EB52401, 0x52401524, +/**/ 0xBFD1D4B9, 0xE796C000, +/**/ 0xBD222A66, 0x7C42E56D, +/**/ 0x3FF51C00, 0x00000000, +/**/ 0x3F307EAE, 0x2F8151D0, +/**/ 0xBFD1BF99, 0x635A7000, +/**/ 0x3D31AC89, 0x575C2125, +/**/ 0x3FF51800, 0x00000000, +/**/ 0xBF3ECE3F, 0xEAE9ECE4, +/**/ 0xBFD1AA7F, 0xD638D000, +/**/ 0xBD29F60A, 0x9616F7A0, +/**/ 0x3FF51000, 0x00000000, +/**/ 0xBF2BA3DD, 0xC7675243, +/**/ 0xBFD1956D, 0x3B9BC000, +/**/ 0xBD27D2F7, 0x3AD1AA14, +/**/ 0x3FF50800, 0x00000000, +/**/ 0x3F0B9AC8, 0x764E368D, +/**/ 0xBFD18061, 0x8EF19000, +/**/ 0x3D3482FF, 0xC86D38E5, +/**/ 0x3FF50000, 0x00000000, +/**/ 0x3F350150, 0x15015015, +/**/ 0xBFD16B5C, 0xCBAD0000, +/**/ 0x3D323299, 0x042D74BF, +/**/ 0x3FF4FC00, 0x00000000, +/**/ 0xBF392851, 0x4A683C50, +/**/ 0xBFD1565E, 0xED456000, +/**/ 0x3CEE75AD, 0xFB6ABA25, +/**/ 0x3FF4F400, 0x00000000, +/**/ 0xBF1C2748, 0xACD95EF0, +/**/ 0xBFD14167, 0xEF367000, +/**/ 0xBD3E0C07, 0x824DAAF5, +/**/ 0x3FF4EC00, 0x00000000, +/**/ 0x3F26B90D, 0x67A47465, +/**/ 0xBFD12C77, 0xCD007000, +/**/ 0xBD13B294, 0x8A11F797, +/**/ 0x3FF4E400, 0x00000000, +/**/ 0x3F3E0A72, 0xF0539783, +/**/ 0xBFD1178E, 0x8227E000, +/**/ 0xBD31EF78, 0xCE2D07F2, +/**/ 0x3FF4E000, 0x00000000, +/**/ 0xBF2E00A6, 0xF87FD642, +/**/ 0xBFD102AC, 0x0A35D000, +/**/ 0x3D2F1FBD, 0xDFDFD686, +/**/ 0x3FF4D800, 0x00000000, +/**/ 0x3F10EFB7, 0x0B12E3FD, +/**/ 0xBFD0EDD0, 0x60B78000, +/**/ 0xBD0019B5, 0x2D8435F5, +/**/ 0x3FF4D000, 0x00000000, +/**/ 0x3F37BEF1, 0x5CB4DBE5, +/**/ 0xBFD0D8FB, 0x813EB000, +/**/ 0xBD1EE8C8, 0x8753FA35, +/**/ 0x3FF4CC00, 0x00000000, +/**/ 0xBF34778D, 0xA50918B1, +/**/ 0xBFD0C42D, 0x67616000, +/**/ 0xBD27188B, 0x163CEAE9, +/**/ 0x3FF4C400, 0x00000000, +/**/ 0xBED9F4F7, 0xE37288EC, +/**/ 0xBFD0AF66, 0x0EB9E000, +/**/ 0xBD23C7C3, 0xF528D80A, +/**/ 0x3FF4BC00, 0x00000000, +/**/ 0x3F33EDDA, 0x68FE0E42, +/**/ 0xBFD09AA5, 0x72E6C000, +/**/ 0xBD3B50A1, 0xE1734342, +/**/ 0x3FF4B800, 0x00000000, +/**/ 0xBF3776C6, 0xB72E47D9, +/**/ 0xBFD085EB, 0x8F8AE000, +/**/ 0xBD3E5D51, 0x3F45FE7B, +/**/ 0x3FF4B000, 0x00000000, +/**/ 0xBF04AFD6, 0xA052BF5B, +/**/ 0xBFD07138, 0x604D6000, +/**/ 0x3D3E7632, 0x4E912B17, +/**/ 0x3FF4A800, 0x00000000, +/**/ 0x3F328FFA, 0xD5B5C015, +/**/ 0xBFD05C8B, 0xE0D96000, +/**/ 0xBD2AD0F1, 0xC77CCB58, +/**/ 0x3FF4A400, 0x00000000, +/**/ 0xBF380528, 0x9FEB5D80, +/**/ 0xBFD047E6, 0x0CDE8000, +/**/ 0xBD2DBDF1, 0x0D397F3C, +/**/ 0x3FF49C00, 0x00000000, +/**/ 0xBF02AD3E, 0x25FF5B21, +/**/ 0xBFD03346, 0xE0106000, +/**/ 0xBCF89FF8, 0xA966395C, +/**/ 0x3FF49400, 0x00000000, +/**/ 0x3F339E3B, 0x2D066EA2, +/**/ 0xBFD01EAE, 0x5626C000, +/**/ 0xBD3A43DC, 0xFADE85AE, +/**/ 0x3FF49000, 0x00000000, +/**/ 0xBF3629C1, 0xAFB2E932, +/**/ 0xBFD00A1C, 0x6ADDA000, +/**/ 0xBD31CD8D, 0x688B9E18, +/**/ 0x3FF48800, 0x00000000, +/**/ 0x3ED48805, 0x22014880, +/**/ 0xBFCFEB22, 0x33EA0000, +/**/ 0xBD2F3418, 0xDE00938B, +/**/ 0x3FF48000, 0x00000000, +/**/ 0x3F37119F, 0x3D324D89, +/**/ 0xBFCFC218, 0xBE620000, +/**/ 0xBD34BBA4, 0x6F1CF6A0, +/**/ 0x3FF47C00, 0x00000000, +/**/ 0xBF31EB85, 0x1EB851EC, +/**/ 0xBFCF991C, 0x6CB3C000, +/**/ 0x3D390D04, 0xCD7CC834, +/**/ 0x3FF47400, 0x00000000, +/**/ 0x3F1569C9, 0xAAFC7C01, +/**/ 0xBFCF702D, 0x36778000, +/**/ 0x3D108195, 0x16673E23, +/**/ 0x3FF46C00, 0x00000000, +/**/ 0x3F3CE345, 0x96066250, +/**/ 0xBFCF474B, 0x134E0000, +/**/ 0x3D3BAE49, 0xF1DF7B5E, +/**/ 0x3FF46800, 0x00000000, +/**/ 0xBF26A297, 0x1D02DE87, +/**/ 0xBFCF1E75, 0xFADFA000, +/**/ 0x3D20862B, 0x25D83F6D, +/**/ 0x3FF46000, 0x00000000, +/**/ 0x3F2978FE, 0xB9F34381, +/**/ 0xBFCEF5AD, 0xE4DD0000, +/**/ 0x3CCA2115, 0x65BB8E11, +/**/ 0x3FF45C00, 0x00000000, +/**/ 0xBF3AF398, 0xF6C71366, +/**/ 0xBFCECCF2, 0xC8FEA000, +/**/ 0x3D3BEC63, 0xA3E75640, +/**/ 0x3FF45400, 0x00000000, +/**/ 0xBF030E9C, 0x449AFF5D, +/**/ 0xBFCEA444, 0x9F04A000, +/**/ 0xBD35E916, 0x63732A36, +/**/ 0x3FF44C00, 0x00000000, +/**/ 0x3F367190, 0xF8B42EF3, +/**/ 0xBFCE7BA3, 0x5EB78000, +/**/ 0x3D0D5EEE, 0x23793649, +/**/ 0x3FF44800, 0x00000000, +/**/ 0xBF3079A9, 0xD260511C, +/**/ 0xBFCE530E, 0xFFE72000, +/**/ 0x3D3FDBDB, 0xB13F7C18, +/**/ 0x3FF44000, 0x00000000, +/**/ 0x3F21B87C, 0x0B644FBE, +/**/ 0xBFCE2A87, 0x7A6B2000, +/**/ 0xBD382381, 0x7787081A, +/**/ 0x3FF43C00, 0x00000000, +/**/ 0xBF3D8CF5, 0x411B2E25, +/**/ 0xBFCE020C, 0xC6236000, +/**/ 0x3D252B00, 0xADB91424, +/**/ 0x3FF43400, 0x00000000, +/**/ 0xBF0DAC08, 0xD6A60978, +/**/ 0xBFCDD99E, 0xDAF6E000, +/**/ 0x3D302EC6, 0x69C756EB, +/**/ 0x3FF42C00, 0x00000000, +/**/ 0x3F36625D, 0x51F86EFA, +/**/ 0xBFCDB13D, 0xB0D48000, +/**/ 0xBD32806A, 0x847527E6, +/**/ 0x3FF42800, 0x00000000, +/**/ 0xBF2E8B2D, 0xA8766564, +/**/ 0xBFCD88E9, 0x3FB30000, +/**/ 0x3D375F28, 0x0234BF51, +/**/ 0x3FF42000, 0x00000000, +/**/ 0x3F26A4CB, 0xCB2A247B, +/**/ 0xBFCD60A1, 0x7F904000, +/**/ 0x3D35D6E0, 0x6FC20D39, +/**/ 0x3FF41C00, 0x00000000, +/**/ 0xBF39D5E8, 0xC17DF552, +/**/ 0xBFCD3866, 0x68720000, +/**/ 0x3D373650, 0xB38932BC, +/**/ 0x3FF41400, 0x00000000, +/**/ 0x3EF41414, 0x14141414, +/**/ 0xBFCD1037, 0xF2656000, +/**/ 0x3D084A7E, 0x75B6F6E4, +/**/ 0x3FF40C00, 0x00000000, +/**/ 0x3F3C97A8, 0x43AE87FD, +/**/ 0xBFCCE816, 0x157F2000, +/**/ 0x3D29E0AB, 0xA2099515, +/**/ 0x3FF40800, 0x00000000, +/**/ 0xBF1F4BBC, 0x66A67E6F, +/**/ 0xBFCCC000, 0xC9DB4000, +/**/ 0x3D1D6D58, 0x5D57AFF9, +/**/ 0x3FF40000, 0x00000000, +/**/ 0x3F340140, 0x14014014, +/**/ 0xBFCC97F8, 0x079D4000, +/**/ 0xBD23B161, 0xA8C6E6C5, +/**/ 0x3FF3FC00, 0x00000000, +/**/ 0xBF2FD809, 0xFD809FD8, +/**/ 0xBFCC6FFB, 0xC6F00000, +/**/ 0xBD3EE138, 0xD3A69D43, +/**/ 0x3FF3F400, 0x00000000, +/**/ 0x3F28CA0E, 0x57EE89D2, +/**/ 0xBFCC480C, 0x0005C000, +/**/ 0xBD39A294, 0xD5E44E76, +/**/ 0x3FF3F000, 0x00000000, +/**/ 0xBF370BD5, 0xA50F9260, +/**/ 0xBFCC2028, 0xAB180000, +/**/ 0x3D292E0E, 0xE55C7AC6, +/**/ 0x3FF3E800, 0x00000000, +/**/ 0x3F1704AA, 0x75945FCE, +/**/ 0xBFCBF851, 0xC0676000, +/**/ 0x3D35420E, 0x4C0854AD, +/**/ 0x3FF3E400, 0x00000000, +/**/ 0xBF3D3431, 0xB56FD83C, +/**/ 0xBFCBD087, 0x383BE000, +/**/ 0x3D2D4BC4, 0x595412B6, +/**/ 0x3FF3DC00, 0x00000000, +/**/ 0x3EB3DC01, 0x3DC013DC, +/**/ 0xBFCBA8C9, 0x0AE4A000, +/**/ 0xBD3A32E7, 0xF44432DA, +/**/ 0x3FF3D400, 0x00000000, +/**/ 0x3F3D991A, 0xA75C5BBD, +/**/ 0xBFCB8117, 0x30B82000, +/**/ 0xBD1E9068, 0x3B9CD768, +/**/ 0x3FF3D000, 0x00000000, +/**/ 0xBF1292BA, 0x59C52F5D, +/**/ 0xBFCB5971, 0xA213A000, +/**/ 0xBD39B50E, 0x83AA91DF, +/**/ 0x3FF3C800, 0x00000000, +/**/ 0x3F395A47, 0xBABE7440, +/**/ 0xBFCB31D8, 0x575BC000, +/**/ 0xBD3C794E, 0x562A63CB, +/**/ 0x3FF3C400, 0x00000000, +/**/ 0xBF20D475, 0x58A0943A, +/**/ 0xBFCB0A4B, 0x48FC2000, +/**/ 0x3D22E72D, 0x5C3998ED, +/**/ 0x3FF3BC00, 0x00000000, +/**/ 0x3F360D92, 0x3295482C, +/**/ 0xBFCAE2CA, 0x6F672000, +/**/ 0xBD37A8D5, 0xAE54F550, +/**/ 0x3FF3B800, 0x00000000, +/**/ 0xBF267D12, 0xCAB48651, +/**/ 0xBFCABB55, 0xC316A000, +/**/ 0x3D38A65A, 0xCAF14CD8, +/**/ 0x3FF3B000, 0x00000000, +/**/ 0x3F33B13B, 0x13B13B14, +/**/ 0xBFCA93ED, 0x3C8AE000, +/**/ 0x3D287243, 0x50562169, +/**/ 0x3FF3AC00, 0x00000000, +/**/ 0xBF2A46AF, 0x2C8FD3BF, +/**/ 0xBFCA6C90, 0xD44B8000, +/**/ 0x3D3F63B7, 0xF037B0C6, +/**/ 0x3FF3A400, 0x00000000, +/**/ 0x3F324387, 0xAC822610, +/**/ 0xBFCA4540, 0x82E6A000, +/**/ 0xBD360A77, 0xC81F7171, +/**/ 0x3FF3A000, 0x00000000, +/**/ 0xBF2C34BB, 0xA1923DEE, +/**/ 0xBFCA1DFC, 0x40F1C000, +/**/ 0x3D301E0F, 0x004F3781, +/**/ 0x3FF39800, 0x00000000, +/**/ 0x3F31C2C1, 0x87F63372, +/**/ 0xBFC9F6C4, 0x0708A000, +/**/ 0x3D3337D9, 0x4BCD3F43, +/**/ 0x3FF39400, 0x00000000, +/**/ 0xBF2C4AA0, 0xE11BD52E, +/**/ 0xBFC9CF97, 0xCDCE0000, +/**/ 0xBD3D862F, 0x10C414E3, +/**/ 0x3FF38C00, 0x00000000, +/**/ 0x3F322D36, 0x6088DBF4, +/**/ 0xBFC9A877, 0x8DEBA000, +/**/ 0xBD3470FA, 0x3EFEC390, +/**/ 0x3FF38800, 0x00000000, +/**/ 0xBF2A8BBF, 0x503F774E, +/**/ 0xBFC98163, 0x4011A000, +/**/ 0xBD34EADD, 0x9E9045E2, +/**/ 0x3FF38000, 0x00000000, +/**/ 0x3F338138, 0x13813814, +/**/ 0xBFC95A5A, 0xDCF70000, +/**/ 0xBD07F228, 0x58A0FF6F, +/**/ 0x3FF37C00, 0x00000000, +/**/ 0xBF26FB6F, 0x1B177053, +/**/ 0xBFC9335E, 0x5D594000, +/**/ 0xBD33115C, 0x3ABD47DA, +/**/ 0x3FF37400, 0x00000000, +/**/ 0x3F35BD1C, 0x945EDC20, +/**/ 0xBFC90C6D, 0xB9FCC000, +/**/ 0x3D1935F5, 0x7718D7CA, +/**/ 0x3FF37000, 0x00000000, +/**/ 0xBF219D00, 0x4DBDCC60, +/**/ 0xBFC8E588, 0xEBAC2000, +/**/ 0xBD3B7D5C, 0xAB2D1140, +/**/ 0x3FF36800, 0x00000000, +/**/ 0x3F38DF3D, 0xE0747954, +/**/ 0xBFC8BEAF, 0xEB390000, +/**/ 0x3D073D54, 0xAAE92CD1, +/**/ 0x3FF36400, 0x00000000, +/**/ 0xBF14E775, 0xD9D3C49F, +/**/ 0xBFC897E2, 0xB17B2000, +/**/ 0x3D296B37, 0x380CBE9E, +/**/ 0x3FF35C00, 0x00000000, +/**/ 0x3F3CE5F9, 0xF2AF821E, +/**/ 0xBFC87121, 0x3750E000, +/**/ 0xBD3328EB, 0x42F9AF75, +/**/ 0x3FF35800, 0x00000000, +/**/ 0xBEE82DF0, 0xE34971F2, +/**/ 0xBFC84A6B, 0x759F6000, +/**/ 0x3D3DA280, 0x2ADF8609, +/**/ 0x3FF35400, 0x00000000, +/**/ 0xBF3E304D, 0x4873ECAE, +/**/ 0xBFC823C1, 0x6551A000, +/**/ 0xBD1E0DDB, 0x9A631E83, +/**/ 0x3FF34C00, 0x00000000, +/**/ 0x3F1264B6, 0x1FF659DB, +/**/ 0xBFC7FD22, 0xFF59A000, +/**/ 0x3D158BEB, 0xF457B7D2, +/**/ 0x3FF34800, 0x00000000, +/**/ 0xBF386531, 0xFECB9865, +/**/ 0xBFC7D690, 0x3CAF6000, +/**/ 0x3D24C06B, 0x17C301D7, +/**/ 0x3FF34000, 0x00000000, +/**/ 0x3F25A8C2, 0xEEDA65AE, +/**/ 0xBFC7B009, 0x16516000, +/**/ 0x3D3AE75F, 0xCB067E57, +/**/ 0x3FF33C00, 0x00000000, +/**/ 0xBF31BA4A, 0x8434E1F4, +/**/ 0xBFC7898D, 0x85444000, +/**/ 0xBD38E67B, 0xE3DBAF3F, +/**/ 0x3FF33400, 0x00000000, +/**/ 0x3F31EE97, 0xDBFC660A, +/**/ 0xBFC7631D, 0x82936000, +/**/ 0x3D25E77D, 0xC7C5F3E1, +/**/ 0x3FF33000, 0x00000000, +/**/ 0xBF246252, 0xBC40BFDA, +/**/ 0xBFC73CB9, 0x074FE000, +/**/ 0x3D3D66A9, 0x0D0005A6, +/**/ 0x3FF32800, 0x00000000, +/**/ 0x3F39E640, 0x13299E64, +/**/ 0xBFC71660, 0x0C914000, +/**/ 0xBCE51B15, 0x7CEC3838, +/**/ 0x3FF32400, 0x00000000, +/**/ 0xBEFCB5D4, 0xEF40991F, +/**/ 0xBFC6F012, 0x8B756000, +/**/ 0xBD357739, 0x0D31EF0F, +/**/ 0x3FF32000, 0x00000000, +/**/ 0xBF3D4632, 0xC823D892, +/**/ 0xBFC6C9D0, 0x7D204000, +/**/ 0x3CDC73FA, 0xFD9B2DCA, +/**/ 0x3FF31800, 0x00000000, +/**/ 0x3F1DD63A, 0x7AED804C, +/**/ 0xBFC6A399, 0xDABBE000, +/**/ 0x3D38F934, 0xE66A15A6, +/**/ 0x3FF31400, 0x00000000, +/**/ 0xBF339849, 0xE8C11E1A, +/**/ 0xBFC67D6E, 0x9D786000, +/**/ 0x3D311E88, 0x30A706D3, +/**/ 0x3FF30C00, 0x00000000, +/**/ 0x3F319013, 0x0D190131, +/**/ 0xBFC6574E, 0xBE8C2000, +/**/ 0x3D398C1D, 0x34F0F462, +/**/ 0x3FF30800, 0x00000000, +/**/ 0xBF222315, 0xB47A7FDA, +/**/ 0xBFC6313A, 0x37336000, +/**/ 0x3D144DF5, 0x4F21EA6D, +/**/ 0x3FF30000, 0x00000000, +/**/ 0x3F3C82AC, 0x40260390, +/**/ 0xBFC60B31, 0x00B0A000, +/**/ 0x3D371456, 0xC988F814, +/**/ 0x3FF2FC00, 0x00000000, +/**/ 0x3F026443, 0xA2430A62, +/**/ 0xBFC5E533, 0x144C2000, +/**/ 0x3D31CE0B, 0xF3B290EA, +/**/ 0x3FF2F800, 0x00000000, +/**/ 0xBF37B425, 0xED097B42, +/**/ 0xBFC5BF40, 0x6B544000, +/**/ 0x3D127023, 0xEB68981C, +/**/ 0x3FF2F000, 0x00000000, +/**/ 0x3F2D00E3, 0x4AE0553C, +/**/ 0xBFC59958, 0xFF1D6000, +/**/ 0x3D3A1D05, 0x9769CA05, +/**/ 0x3FF2EC00, 0x00000000, +/**/ 0xBF262BC0, 0x25D69D44, +/**/ 0xBFC5737C, 0xC9018000, +/**/ 0xBD39BAA7, 0xA6B887F6, +/**/ 0x3FF2E400, 0x00000000, +/**/ 0x3F3B88B5, 0xE3103D6B, +/**/ 0xBFC54DAB, 0xC2610000, +/**/ 0xBD2746FE, 0xE5C8D0D8, +/**/ 0x3FF2E000, 0x00000000, +/**/ 0x3F02E025, 0xC04B8097, +/**/ 0xBFC527E5, 0xE4A1C000, +/**/ 0x3D34E60B, 0x8D4B411D, +/**/ 0x3FF2DC00, 0x00000000, +/**/ 0xBF369C22, 0x2C305021, +/**/ 0xBFC5022B, 0x292F6000, +/**/ 0xBD348A05, 0xFF36A25B, +/**/ 0x3FF2D400, 0x00000000, +/**/ 0x3F30A012, 0xD50A012D, +/**/ 0xBFC4DC7B, 0x897BC000, +/**/ 0xBD0C79B6, 0x0AE1FF0F, +/**/ 0x3FF2D000, 0x00000000, +/**/ 0xBF1FBE29, 0xBC66484E, +/**/ 0xBFC4B6D6, 0xFEFE2000, +/**/ 0xBD1522EC, 0xF56E7952, +/**/ 0x3FF2C800, 0x00000000, +/**/ 0x3F3FB4D8, 0x12C9FB4E, +/**/ 0xBFC4913D, 0x8333C000, +/**/ 0x3D353E43, 0x558124C4, +/**/ 0x3FF2C400, 0x00000000, +/**/ 0x3F1E3432, 0x7004B11E, +/**/ 0xBFC46BAF, 0x0F9F6000, +/**/ 0x3D1249CD, 0x0790841A, +/**/ 0x3FF2C000, 0x00000000, +/**/ 0xBF30671A, 0x5C8EF02F, +/**/ 0xBFC4462B, 0x9DC9C000, +/**/ 0x3D384858, 0xA711B062, +/**/ 0x3FF2B800, 0x00000000, +/**/ 0x3F37D835, 0xD548D9AC, +/**/ 0xBFC420B3, 0x27410000, +/**/ 0x3D116282, 0xC85A0884, +/**/ 0x3FF2B400, 0x00000000, +/**/ 0x3ED2B404, 0xAD012B40, +/**/ 0xBFC3FB45, 0xA5992000, +/**/ 0xBD319713, 0xC0CAE559, +/**/ 0x3FF2B000, 0x00000000, +/**/ 0xBF370F78, 0x8E7302A1, +/**/ 0xBFC3D5E3, 0x126BC000, +/**/ 0xBD13FB2F, 0x85096C4B, +/**/ 0x3FF2A800, 0x00000000, +/**/ 0x3F31C92F, 0x3C1053F9, +/**/ 0xBFC3B08B, 0x67580000, +/**/ 0x3D3AADE8, 0xF29320FB, +/**/ 0x3FF2A400, 0x00000000, +/**/ 0xBF14AD94, 0x3DBE2E04, +/**/ 0xBFC38B3E, 0x9E028000, +/**/ 0x3D370EF0, 0x545C17F9, +/**/ 0x3FF2A000, 0x00000000, +/**/ 0xBF3BED61, 0xBED61BED, +/**/ 0xBFC365FC, 0xB015A000, +/**/ 0x3D3FD3A0, 0xAFB9691B, +/**/ 0x3FF29800, 0x00000000, +/**/ 0x3F2B061A, 0x26F004A6, +/**/ 0xBFC340C5, 0x97412000, +/**/ 0x3D37A3DC, 0xF7D9D386, +/**/ 0x3FF29400, 0x00000000, +/**/ 0xBF21B488, 0xFF6B646D, +/**/ 0xBFC31B99, 0x4D3A4000, +/**/ 0xBD3F098E, 0xE3A50810, +/**/ 0x3FF29000, 0x00000000, +/**/ 0xBF3F0582, 0x2CA5D5AC, +/**/ 0xBFC2F677, 0xCBBC0000, +/**/ 0xBD352B30, 0x2160F40D, +/**/ 0x3FF28800, 0x00000000, +/**/ 0x3F260251, 0x16025116, +/**/ 0xBFC2D161, 0x0C868000, +/**/ 0xBD039D6C, 0xCB81B4A1, +/**/ 0x3FF28400, 0x00000000, +/**/ 0xBF258CDF, 0x502065D2, +/**/ 0xBFC2AC55, 0x095F6000, +/**/ 0x3D1D3466, 0xD0C6C8A8, +/**/ 0x3FF27C00, 0x00000000, +/**/ 0x3F3FA38A, 0x1CE4D6F8, +/**/ 0xBFC28753, 0xBC11A000, +/**/ 0xBD37494E, 0x359302E6, +/**/ 0x3FF27800, 0x00000000, +/**/ 0x3F247DD5, 0xDCCA0781, +/**/ 0xBFC2625D, 0x1E6DE000, +/**/ 0x3CF52962, 0xF09E3D82, +/**/ 0x3FF27400, 0x00000000, +/**/ 0xBF25E8EF, 0xDB195E8F, +/**/ 0xBFC23D71, 0x2A49C000, +/**/ 0xBD100D23, 0x8FD3DF5C, +/**/ 0x3FF27000, 0x00000000, +/**/ 0xBF3FF6C8, 0xFFB647FE, +/**/ 0xBFC2188F, 0xD9808000, +/**/ 0x3D3B3A1E, 0x7F50C701, +/**/ 0x3FF26800, 0x00000000, +/**/ 0x3F266F9A, 0xC024D167, +/**/ 0xBFC1F3B9, 0x25F26000, +/**/ 0x3D15F74E, 0x9B083633, +/**/ 0x3FF26400, 0x00000000, +/**/ 0xBF22D1BD, 0xEABD0E14, +/**/ 0xBFC1CEED, 0x09854000, +/**/ 0x3D315C1C, 0x39192AF9, +/**/ 0x3FF26000, 0x00000000, +/**/ 0xBF3DD8F7, 0xF6D0EEC8, +/**/ 0xBFC1AA2B, 0x7E240000, +/**/ 0x3D31AC38, 0xDDE3B366, +/**/ 0x3FF25800, 0x00000000, +/**/ 0x3F2BCEB1, 0x2A241EF6, +/**/ 0xBFC18574, 0x7DBEC000, +/**/ 0xBD3E6744, 0x45BD9B49, +/**/ 0x3FF25400, 0x00000000, +/**/ 0xBF18A05B, 0xA21378D7, +/**/ 0xBFC160C8, 0x024B2000, +/**/ 0xBD2EC2D2, 0xA9009E3D, +/**/ 0x3FF25000, 0x00000000, +/**/ 0xBF3A076F, 0xD6CFA90C, +/**/ 0xBFC13C26, 0x05C3A000, +/**/ 0x3D2CF5FD, 0xD94F6509, +/**/ 0x3FF24800, 0x00000000, +/**/ 0x3F324924, 0x92492492, +/**/ 0xBFC1178E, 0x8227E000, +/**/ 0xBD21EF78, 0xCE2D07F2, +/**/ 0x3FF24400, 0x00000000, +/**/ 0xBEF3682B, 0x6151E899, +/**/ 0xBFC0F301, 0x717D0000, +/**/ 0x3D3E09B4, 0x41AE86C5, +/**/ 0x3FF24000, 0x00000000, +/**/ 0xBF34868E, 0x89FA4C67, +/**/ 0xBFC0CE7E, 0xCDCCC000, +/**/ 0xBD14652D, 0xABFF5447, +/**/ 0x3FF23800, 0x00000000, +/**/ 0x3F3858D8, 0x6B11F09F, +/**/ 0xBFC0AA06, 0x91268000, +/**/ 0x3D345519, 0xD7032129, +/**/ 0x3FF23400, 0x00000000, +/**/ 0x3F159E26, 0xAF37C049, +/**/ 0xBFC08598, 0xB59E4000, +/**/ 0x3D27E5DD, 0x7009902C, +/**/ 0x3FF23000, 0x00000000, +/**/ 0xBF2AB546, 0x2E076329, +/**/ 0xBFC06135, 0x354D4000, +/**/ 0xBD363046, 0x28340EE9, +/**/ 0x3FF22C00, 0x00000000, +/**/ 0xBF3FEDD5, 0xFEDD5FEE, +/**/ 0xBFC03CDC, 0x0A51E000, +/**/ 0xBD381A9C, 0xF169FC5C, +/**/ 0x3FF22400, 0x00000000, +/**/ 0x3F2B5B92, 0x009126D7, +/**/ 0xBFC0188D, 0x2ECF6000, +/**/ 0xBD03F965, 0x1CFF9DFE, +/**/ 0x3FF22000, 0x00000000, +/**/ 0xBF121FB7, 0x8121FB78, +/**/ 0xBFBFE891, 0x39DBC000, +/**/ 0xBD356594, 0xD82F7A82, +/**/ 0x3FF21C00, 0x00000000, +/**/ 0xBF368F22, 0x3A459635, +/**/ 0xBFBFA01C, 0x9DB58000, +/**/ 0x3D08F351, 0xFA48A730, +/**/ 0x3FF21400, 0x00000000, +/**/ 0x3F379804, 0x855E6012, +/**/ 0xBFBF57BC, 0x7D900000, +/**/ 0xBD176A6C, 0x9EA8B04E, +/**/ 0x3FF21000, 0x00000000, +/**/ 0x3F17B57C, 0x78CD7A37, +/**/ 0xBFBF0F70, 0xCDD98000, +/**/ 0xBD32E31F, 0x6C272C1E, +/**/ 0x3FF20C00, 0x00000000, +/**/ 0xBF271E73, 0x07E4EF15, +/**/ 0xBFBEC739, 0x830A0000, +/**/ 0xBD311FCB, 0xA80CDD10, +/**/ 0x3FF20800, 0x00000000, +/**/ 0xBF3CDDEC, 0x49392BA7, +/**/ 0xBFBE7F16, 0x91A34000, +/**/ 0x3D32C1C5, 0x9BC77BFA, +/**/ 0x3FF20000, 0x00000000, +/**/ 0x3F320120, 0x12012012, +/**/ 0xBFBE3707, 0xEE304000, +/**/ 0xBD20F684, 0xE6766ABD, +/**/ 0x3FF1FC00, 0x00000000, +/**/ 0x3EF0DC4F, 0xCE8AD1A2, +/**/ 0xBFBDEF0D, 0x8D468000, +/**/ 0x3D324750, 0x412E9A74, +/**/ 0x3FF1F800, 0x00000000, +/**/ 0xBF2F7047, 0xDC11F704, +/**/ 0xBFBDA727, 0x63844000, +/**/ 0xBD1A8940, 0x1FA71733, +/**/ 0x3FF1F000, 0x00000000, +/**/ 0x3F3FAF3F, 0x16B6419D, +/**/ 0xBFBD5F55, 0x65920000, +/**/ 0xBD30E239, 0xCC185469, +/**/ 0x3FF1EC00, 0x00000000, +/**/ 0x3F2E878F, 0xF70985E2, +/**/ 0xBFBD1797, 0x88218000, +/**/ 0xBD336433, 0xB5EFBEED, +/**/ 0x3FF1E800, 0x00000000, +/**/ 0xBEEF55E4, 0x94D7FDC3, +/**/ 0xBFBCCFED, 0xBFEE0000, +/**/ 0xBD33A823, 0x2FE71256, +/**/ 0x3FF1E400, 0x00000000, +/**/ 0xBF310C4C, 0x0478BBCF, +/**/ 0xBFBC8858, 0x01BC4000, +/**/ 0xBD2646D1, 0xC65AACD3, +/**/ 0x3FF1DC00, 0x00000000, +/**/ 0x3F3F0ECB, 0xCB840C49, +/**/ 0xBFBC40D6, 0x425A4000, +/**/ 0xBD3CB112, 0x1D1930DD, +/**/ 0x3FF1D800, 0x00000000, +/**/ 0x3F2EACE5, 0xC9579074, +/**/ 0xBFBBF968, 0x769FC000, +/**/ 0xBD24218C, 0x8D824283, +/**/ 0x3FF1D400, 0x00000000, +/**/ 0xBECABDFA, 0xFC60F0AE, +/**/ 0xBFBBB20E, 0x936D8000, +/**/ 0x3D368BA8, 0x35459B8E, +/**/ 0x3FF1D000, 0x00000000, +/**/ 0xBF2F2A4B, 0xAFDC61F3, +/**/ 0xBFBB6AC8, 0x8DAD4000, +/**/ 0xBD3B1BDF, 0xF50225C7, +/**/ 0x3FF1CC00, 0x00000000, +/**/ 0xBF3EC8AF, 0xAB802394, +/**/ 0xBFBB2396, 0x5A530000, +/**/ 0x3CEFF64E, 0xEA137079, +/**/ 0x3FF1C400, 0x00000000, +/**/ 0x3F322FC1, 0xCE058D9B, +/**/ 0xBFBADC77, 0xEE5B0000, +/**/ 0x3D3573B2, 0x09C31904, +/**/ 0x3FF1C000, 0x00000000, +/**/ 0x3F0AA04F, 0xE0EFA2CF, +/**/ 0xBFBA956D, 0x3ECAC000, +/**/ 0xBD3E6379, 0x4C02C4AF, +/**/ 0x3FF1BC00, 0x00000000, +/**/ 0xBF26B7F7, 0x225ADFDD, +/**/ 0xBFBA4E76, 0x40B1C000, +/**/ 0x3D0E42B6, 0xB94407C8, +/**/ 0x3FF1B800, 0x00000000, +/**/ 0xBF39E073, 0x217CD13A, +/**/ 0xBFBA0792, 0xE9278000, +/**/ 0x3D0A9CE6, 0xC9AD51BF, +/**/ 0x3FF1B000, 0x00000000, +/**/ 0x3F37C67F, 0x2BAE2B21, +/**/ 0xBFB9C0C3, 0x2D4D4000, +/**/ 0x3D3AB7C0, 0x9E838668, +/**/ 0x3FF1AC00, 0x00000000, +/**/ 0x3F23316E, 0xBD720DCF, +/**/ 0xBFB97A07, 0x024CC000, +/**/ 0x3CF8BCC1, 0x732093CE, +/**/ 0x3FF1A800, 0x00000000, +/**/ 0xBF11A7B9, 0x611A7B96, +/**/ 0xBFB9335E, 0x5D594000, +/**/ 0xBD23115C, 0x3ABD47DA, +/**/ 0x3FF1A400, 0x00000000, +/**/ 0xBF324195, 0xA1C1B8E7, +/**/ 0xBFB8ECC9, 0x33AEC000, +/**/ 0x3D222F39, 0xBE67F7AA, +/**/ 0x3FF1A000, 0x00000000, +/**/ 0xBF3FEE61, 0xFEE61FEE, +/**/ 0xBFB8A647, 0x7A91C000, +/**/ 0xBD3C28C0, 0xAF9BD6DF, +/**/ 0x3FF19800, 0x00000000, +/**/ 0x3F328F89, 0x362B721D, +/**/ 0xBFB85FD9, 0x27508000, +/**/ 0x3D35B818, 0x19970C1C, +/**/ 0x3FF19400, 0x00000000, +/**/ 0x3F14E023, 0x28A70119, +/**/ 0xBFB8197E, 0x2F410000, +/**/ 0x3D3C0FE4, 0x60D20041, +/**/ 0x3FF19000, 0x00000000, +/**/ 0xBF1FD419, 0x3E48FC6F, +/**/ 0xBFB7D336, 0x87C28000, +/**/ 0xBD33C88C, 0x3E706706, +/**/ 0x3FF18C00, 0x00000000, +/**/ 0xBF34F7C6, 0xFD42546B, +/**/ 0xBFB78D02, 0x263D8000, +/**/ 0xBD069B57, 0x94B69FB7, +/**/ 0x3FF18400, 0x00000000, +/**/ 0x3F3E2FA4, 0x01185E30, +/**/ 0xBFB746E1, 0x00228000, +/**/ 0x3D3126D1, 0x6E1E21D2, +/**/ 0x3FF18000, 0x00000000, +/**/ 0x3F318118, 0x11811812, +/**/ 0xBFB700D3, 0x0AEAC000, +/**/ 0xBCEC1E8D, 0xA99DED32, +/**/ 0x3FF17C00, 0x00000000, +/**/ 0x3F13F1CA, 0xFF2E2C43, +/**/ 0xBFB6BAD8, 0x3C188000, +/**/ 0xBD0DAF3C, 0xC08926AE, +/**/ 0x3FF17800, 0x00000000, +/**/ 0xBF1D79B9, 0x0A5EF9FF, +/**/ 0xBFB674F0, 0x89364000, +/**/ 0xBD3A7999, 0x4C9D3302, +/**/ 0x3FF17400, 0x00000000, +/**/ 0xBF338FAD, 0x1ECEA765, +/**/ 0xBFB62F1B, 0xE7D78000, +/**/ 0x3D217995, 0x7ED63C4E, +/**/ 0x3FF17000, 0x00000000, +/**/ 0xBF3F976B, 0xD8C8714B, +/**/ 0xBFB5E95A, 0x4D978000, +/**/ 0xBD31CB7C, 0xE1D17171, +/**/ 0x3FF16800, 0x00000000, +/**/ 0x3F348A33, 0xB08FA497, +/**/ 0xBFB5A3AB, 0xB01AC000, +/**/ 0xBD3E2574, 0x9E6AFA18, +/**/ 0x3FF16400, 0x00000000, +/**/ 0x3F21AA1F, 0x864022C9, +/**/ 0xBFB55E10, 0x050E0000, +/**/ 0xBD0C1D74, 0x0C53C72E, +/**/ 0x3FF16000, 0x00000000, +/**/ 0xBF05B7C9, 0xB487BCAD, +/**/ 0xBFB51887, 0x42260000, +/**/ 0xBD330A1D, 0x96258B3E, +/**/ 0x3FF15C00, 0x00000000, +/**/ 0xBF2C3411, 0x5B1E5F75, +/**/ 0xBFB4D311, 0x5D208000, +/**/ 0x3CF53A25, 0x82F4E1EF, +/**/ 0x3FF15800, 0x00000000, +/**/ 0xBF39543F, 0xEEA99544, +/**/ 0xBFB48DAE, 0x4BC30000, +/**/ 0xBD30185B, 0x208C200C, +/**/ 0x3FF15000, 0x00000000, +/**/ 0x3F3B9A3F, 0xDD5C8CB8, +/**/ 0xBFB4485E, 0x03DBC000, +/**/ 0xBD3FAD46, 0xE8D26AB7, +/**/ 0x3FF14C00, 0x00000000, +/**/ 0x3F30B155, 0xB19AE5C7, +/**/ 0xBFB40320, 0x7B414000, +/**/ 0xBD26FD84, 0xAA8157C0, +/**/ 0x3FF14800, 0x00000000, +/**/ 0x3F17C382, 0xB34EDA32, +/**/ 0xBFB3BDF5, 0xA7D20000, +/**/ 0x3D319BD0, 0xAD125895, +/**/ 0x3FF14400, 0x00000000, +/**/ 0xBF129CFF, 0xBAF129D0, +/**/ 0xBFB378DD, 0x7F748000, +/**/ 0xBD371411, 0x28F1FACA, +/**/ 0x3FF14000, 0x00000000, +/**/ 0xBF2E2E59, 0x771B7C7F, +/**/ 0xBFB333D7, 0xF8184000, +/**/ 0x3CE692B6, 0xA81B8848, +/**/ 0x3FF13C00, 0x00000000, +/**/ 0xBF395F06, 0x30FE1D9C, +/**/ 0xBFB2EEE5, 0x07B40000, +/**/ 0xBD08081E, 0xDD77C860, +/**/ 0x3FF13400, 0x00000000, +/**/ 0x3F3C8113, 0x5C81135D, +/**/ 0xBFB2AA04, 0xA4470000, +/**/ 0xBD37A48B, 0xA8B1CB41, +/**/ 0x3FF13000, 0x00000000, +/**/ 0x3F3288FF, 0xBB3B5DC0, +/**/ 0xBFB26536, 0xC3D8C000, +/**/ 0xBD0B4BAC, 0x097C5BA3, +/**/ 0x3FF12C00, 0x00000000, +/**/ 0x3F21713D, 0xB81577AE, +/**/ 0xBFB2207B, 0x5C784000, +/**/ 0xBD349D8C, 0xFC10C7BF, +/**/ 0x3FF12800, 0x00000000, +/**/ 0xBEEE05E5, 0xBAD6FC84, +/**/ 0xBFB1DBD2, 0x643D0000, +/**/ 0xBD390B24, 0xD977C494, +/**/ 0x3FF12400, 0x00000000, +/**/ 0xBF24E314, 0x59F992BF, +/**/ 0xBFB1973B, 0xD1464000, +/**/ 0xBD3566D1, 0x54F930B3, +/**/ 0x3FF12000, 0x00000000, +/**/ 0xBF33CB91, 0xC9F6E7A8, +/**/ 0xBFB152B7, 0x99BB4000, +/**/ 0x3D09BB29, 0x07030829, +/**/ 0x3FF11C00, 0x00000000, +/**/ 0xBF3CFE65, 0x8B7D9851, +/**/ 0xBFB10E45, 0xB3CB0000, +/**/ 0x3D37CF69, 0x284A3465, +/**/ 0x3FF11400, 0x00000000, +/**/ 0x3F39F5DB, 0x29605DF7, +/**/ 0xBFB0C9E6, 0x15AC4000, +/**/ 0xBD2C2DA8, 0x0974D976, +/**/ 0x3FF11000, 0x00000000, +/**/ 0x3F311111, 0x11111111, +/**/ 0xBFB08598, 0xB59E4000, +/**/ 0x3D17E5DD, 0x7009902C, +/**/ 0x3FF10C00, 0x00000000, +/**/ 0x3F20A63A, 0x12A5B1AE, +/**/ 0xBFB0415D, 0x89E74000, +/**/ 0xBD1111C0, 0x5CF1D753, +/**/ 0x3FF10800, 0x00000000, +/**/ 0xBED107FB, 0xBE011080, +/**/ 0xBFAFFA69, 0x11AB8000, +/**/ 0xBD23008C, 0x98381A8F, +/**/ 0x3FF10400, 0x00000000, +/**/ 0xBF216989, 0x6FEABBAE, +/**/ 0xBFAF723B, 0x51800000, +/**/ 0x3D3D6EB0, 0xDD5610D3, +/**/ 0x3FF10000, 0x00000000, +/**/ 0xBF30FEF0, 0x10FEF011, +/**/ 0xBFAEEA31, 0xC0068000, +/**/ 0xBD3C3DD8, 0x3606D891, +/**/ 0x3FF0FC00, 0x00000000, +/**/ 0xBF3922C0, 0x98CDDC74, +/**/ 0xBFAE624C, 0x4A0B8000, +/**/ 0x3D30F25C, 0x74676689, +/**/ 0x3FF0F400, 0x00000000, +/**/ 0x3F3EDFAB, 0x325A1A80, +/**/ 0xBFADDA8A, 0xDC680000, +/**/ 0x3D21B1AC, 0x64D9E42F, +/**/ 0x3FF0F000, 0x00000000, +/**/ 0x3F370834, 0xF27F9A57, +/**/ 0xBFAD52ED, 0x64060000, +/**/ 0x3D33C85D, 0x2A29BBD6, +/**/ 0x3FF0EC00, 0x00000000, +/**/ 0x3F2EAD7C, 0xD391FBC5, +/**/ 0xBFACCB73, 0xCDDD8000, +/**/ 0xBD3965C3, 0x6E09F5FE, +/**/ 0x3FF0E800, 0x00000000, +/**/ 0x3F1F2CA5, 0xE9479870, +/**/ 0xBFAC441E, 0x06F70000, +/**/ 0xBD354F1F, 0x49850D15, +/**/ 0x3FF0E400, 0x00000000, +/**/ 0x3ED95609, 0x80439019, +/**/ 0xBFABBCEB, 0xFC690000, +/**/ 0x3D17BF86, 0x8C317C2A, +/**/ 0x3FF0E000, 0x00000000, +/**/ 0xBF1B6B4D, 0xC6867596, +/**/ 0xBFAB35DD, 0x9B588000, +/**/ 0xBD3D5674, 0xD6CF558E, +/**/ 0x3FF0DC00, 0x00000000, +/**/ 0xBF2BEAEE, 0x172D4CE8, +/**/ 0xBFAAAEF2, 0xD0FB0000, +/**/ 0xBD20FC1A, 0x353BB42E, +/**/ 0x3FF0D800, 0x00000000, +/**/ 0xBF34EAB0, 0x479071A9, +/**/ 0xBFAA282B, 0x8A938000, +/**/ 0x3D2E8F59, 0x80EFC8E3, +/**/ 0x3FF0D400, 0x00000000, +/**/ 0xBF3BBA9C, 0xA61C62D3, +/**/ 0xBFA9A187, 0xB5740000, +/**/ 0x3D30C22E, 0x4EC4D90D, +/**/ 0x3FF0CC00, 0x00000000, +/**/ 0x3F3D9AA6, 0x77344011, +/**/ 0xBFA91B07, 0x3EFD8000, +/**/ 0x3D19D7C5, 0x3F76CA96, +/**/ 0x3FF0C800, 0x00000000, +/**/ 0x3F3714FB, 0xCDA3AC11, +/**/ 0xBFA894AA, 0x149F8000, +/**/ 0xBD39A19A, 0x8BE97661, +/**/ 0x3FF0C400, 0x00000000, +/**/ 0x3F30B446, 0x391F2E61, +/**/ 0xBFA80E70, 0x23D90000, +/**/ 0x3D399DC1, 0x6F28BF45, +/**/ 0x3FF0C000, 0x00000000, +/**/ 0x3F24F0D1, 0x682E11CD, +/**/ 0xBFA78859, 0x5A358000, +/**/ 0x3D108B0D, 0x083B3A4C, +/**/ 0x3FF0BC00, 0x00000000, +/**/ 0x3F118519, 0x5D5A36EA, +/**/ 0xBFA70265, 0xA5510000, +/**/ 0x3D2888DF, 0x11FD5CE7, +/**/ 0x3FF0B800, 0x00000000, +/**/ 0xBEF913DA, 0x62386CAB, +/**/ 0xBFA67C94, 0xF2D48000, +/**/ 0xBD3DAC20, 0x827CCA0C, +/**/ 0x3FF0B400, 0x00000000, +/**/ 0xBF1D7CFF, 0xBD31D7D0, +/**/ 0xBFA5F6E7, 0x30790000, +/**/ 0x3D20485A, 0x8012494C, +/**/ 0x3FF0B000, 0x00000000, +/**/ 0xBF2A11BA, 0x226951DC, +/**/ 0xBFA5715C, 0x4C040000, +/**/ 0x3D38888D, 0xDFC47628, +/**/ 0x3FF0AC00, 0x00000000, +/**/ 0xBF328E31, 0x7B2E9DD2, +/**/ 0xBFA4EBF4, 0x334A0000, +/**/ 0x3D2D9150, 0xF73BE773, +/**/ 0x3FF0A800, 0x00000000, +/**/ 0xBF37EF59, 0x7EF597EF, +/**/ 0xBFA466AE, 0xD42E0000, +/**/ 0x3D2C1673, 0x75BDFD28, +/**/ 0x3FF0A400, 0x00000000, +/**/ 0xBF3D2C71, 0x50D413C1, +/**/ 0xBFA3E18C, 0x1CA08000, +/**/ 0xBD3748ED, 0x3F6E378E, +/**/ 0x3FF09C00, 0x00000000, +/**/ 0x3F3DBA6A, 0xF836010A, +/**/ 0xBFA35C8B, 0xFAA10000, +/**/ 0xBD38357D, 0x5EF9EB35, +/**/ 0x3FF09800, 0x00000000, +/**/ 0x3F38C51F, 0x624D4AF5, +/**/ 0xBFA2D7AE, 0x5C3C8000, +/**/ 0x3D322939, 0x459DA66D, +/**/ 0x3FF09400, 0x00000000, +/**/ 0x3F33F390, 0x10953F39, +/**/ 0xBFA252F3, 0x2F8D0000, +/**/ 0xBD283E9A, 0xE021B67B, +/**/ 0x3FF09000, 0x00000000, +/**/ 0x3F2E8B42, 0x861539B9, +/**/ 0xBFA1CE5A, 0x62BC0000, +/**/ 0xBD3A9CC7, 0x8D8DF999, +/**/ 0x3FF08C00, 0x00000000, +/**/ 0x3F25766E, 0xACBC4021, +/**/ 0xBFA149E3, 0xE4008000, +/**/ 0x3D32B98A, 0x9A4168FD, +/**/ 0x3FF08800, 0x00000000, +/**/ 0x3F1950DB, 0x0F3DBD5A, +/**/ 0xBFA0C58F, 0xA19E0000, +/**/ 0x3D0559D1, 0x58B17913, +/**/ 0x3FF08400, 0x00000000, +/**/ 0x3F008421, 0x08421084, +/**/ 0xBFA0415D, 0x89E78000, +/**/ 0x3D3DDDC7, 0xF461C516, +/**/ 0x3FF08000, 0x00000000, +/**/ 0xBF007FDF, 0x0041FF7C, +/**/ 0xBF9F7A9B, 0x16780000, +/**/ 0xBD242AD9, 0x271BE7D7, +/**/ 0x3FF07C00, 0x00000000, +/**/ 0xBF183591, 0xC54798FB, +/**/ 0xBF9E72BF, 0x28140000, +/**/ 0x3D28D751, 0x49774D47, +/**/ 0x3FF07800, 0x00000000, +/**/ 0xBF23CFA1, 0x518F4EFD, +/**/ 0xBF9D6B27, 0x25980000, +/**/ 0x3D39FF7B, 0x50D1B838, +/**/ 0x3FF07400, 0x00000000, +/**/ 0xBF2B3EB7, 0x01073261, +/**/ 0xBF9C63D2, 0xEC150000, +/**/ 0x3D35439C, 0xE030A687, +/**/ 0x3FF07000, 0x00000000, +/**/ 0xBF31341F, 0xD6EAB025, +/**/ 0xBF9B5CC2, 0x58B70000, +/**/ 0xBD18E611, 0xB8AFBFE8, +/**/ 0x3FF06C00, 0x00000000, +/**/ 0xBF34A638, 0x6ED049E0, +/**/ 0xBF9A55F5, 0x48C60000, +/**/ 0x3D2DE070, 0x9F2D03C9, +/**/ 0x3FF06800, 0x00000000, +/**/ 0xBF37F5BF, 0xEF997F5C, +/**/ 0xBF994F6B, 0x99A20000, +/**/ 0xBD311D5E, 0xF96CF7F5, +/**/ 0x3FF06400, 0x00000000, +/**/ 0xBF3B22D0, 0xE5604189, +/**/ 0xBF984925, 0x28C90000, +/**/ 0x3D2AA0BA, 0x325A0C34, +/**/ 0x3FF06000, 0x00000000, +/**/ 0xBF3E2D85, 0xC1163FF0, +/**/ 0xBF974321, 0xD3D00000, +/**/ 0xBCFB4A69, 0x0FE94778, +/**/ 0x3FF05800, 0x00000000, +/**/ 0x3F3EEA07, 0x27586632, +/**/ 0xBF963D61, 0x78690000, +/**/ 0xBD07ABF3, 0x89596542, +/**/ 0x3FF05400, 0x00000000, +/**/ 0x3F3C23BB, 0x98E2A5E7, +/**/ 0xBF9537E3, 0xF45F0000, +/**/ 0xBD2AB259, 0xD2D7F253, +/**/ 0x3FF05000, 0x00000000, +/**/ 0x3F397F7D, 0x73404146, +/**/ 0xBF9432A9, 0x25980000, +/**/ 0xBD098139, 0x928637FE, +/**/ 0x3FF04C00, 0x00000000, +/**/ 0x3F36FD32, 0xB0C7B49A, +/**/ 0xBF932DB0, 0xEA130000, +/**/ 0xBD2710CB, 0x130895FC, +/**/ 0x3FF04800, 0x00000000, +/**/ 0x3F349CC1, 0x664C578A, +/**/ 0xBF9228FB, 0x1FEA0000, +/**/ 0xBD2713E3, 0x284991FE, +/**/ 0x3FF04400, 0x00000000, +/**/ 0x3F325E0F, 0xC2FCB1F4, +/**/ 0xBF912487, 0xA5500000, +/**/ 0xBD3FDBE5, 0xFED4B393, +/**/ 0x3FF04000, 0x00000000, +/**/ 0x3F304104, 0x10410410, +/**/ 0xBF902056, 0x58930000, +/**/ 0xBD3611D2, 0x7C8E8417, +/**/ 0x3FF03C00, 0x00000000, +/**/ 0x3F2C8B09, 0x6334030B, +/**/ 0xBF8E38CE, 0x30340000, +/**/ 0x3D39DE88, 0xA3DA281A, +/**/ 0x3FF03800, 0x00000000, +/**/ 0x3F28D6F0, 0x48FF7E3A, +/**/ 0xBF8C3173, 0x84C80000, +/**/ 0x3D341F33, 0xFCEFB9FE, +/**/ 0x3FF03400, 0x00000000, +/**/ 0x3F25658A, 0x0081A559, +/**/ 0xBF8A2A9C, 0x6C180000, +/**/ 0x3D3F73BC, 0x4D6D3472, +/**/ 0x3FF03000, 0x00000000, +/**/ 0x3F2236A3, 0xEBC349DE, +/**/ 0xBF882448, 0xA3880000, +/**/ 0xBD345544, 0x12C584E0, +/**/ 0x3FF02C00, 0x00000000, +/**/ 0x3F1E9417, 0x3FEFD386, +/**/ 0xBF861E77, 0xE8B60000, +/**/ 0x3D38073E, 0xEAF8EAF3, +/**/ 0x3FF02800, 0x00000000, +/**/ 0x3F193F1D, 0xCA7A317C, +/**/ 0xBF841929, 0xF9680000, +/**/ 0xBD1977C7, 0x55D01368, +/**/ 0x3FF02400, 0x00000000, +/**/ 0x3F146DF7, 0x6CB49652, +/**/ 0xBF82145E, 0x939E0000, +/**/ 0xBD3E3D12, 0x38C4EA00, +/**/ 0x3FF02000, 0x00000000, +/**/ 0x3F102040, 0x81020408, +/**/ 0xBF801015, 0x75880000, +/**/ 0xBD3BCE25, 0x1998B506, +/**/ 0x3FF01C00, 0x00000000, +/**/ 0x3F08AB2B, 0x8C355D63, +/**/ 0xBF7C189C, 0xBB100000, +/**/ 0x3D3D8055, 0x12588560, +/**/ 0x3FF01800, 0x00000000, +/**/ 0x3F021B28, 0xBD1BA97E, +/**/ 0xBF781212, 0x14580000, +/**/ 0xBD1AD503, 0x82973F27, +/**/ 0x3FF01400, 0x00000000, +/**/ 0x3EF91F67, 0x411155AB, +/**/ 0xBF740C8A, 0x74780000, +/**/ 0xBD1E3871, 0xDF070002, +/**/ 0x3FF01000, 0x00000000, +/**/ 0x3EF01010, 0x10101010, +/**/ 0xBF700805, 0x59580000, +/**/ 0xBD2166AF, 0xCB31C67B, +/**/ 0x3FF00C00, 0x00000000, +/**/ 0x3EE20D8A, 0x279DB649, +/**/ 0xBF680904, 0x82880000, +/**/ 0xBD285C06, 0x96A70C0C, +/**/ 0x3FF00800, 0x00000000, +/**/ 0x3ED00804, 0x02010080, +/**/ 0xBF600401, 0x55D80000, +/**/ 0x3D33BB10, 0xC7CC7089, +/**/ 0x3FF00400, 0x00000000, +/**/ 0x3EB00401, 0x00401004, +/**/ 0xBF500200, 0x55600000, +/**/ 0xBD356224, 0xCD5F35F8, +/**/ 0x3FF00000, 0x00000000, +/**/ 0x00000000, 0x00000000, +/**/ 0x00000000, 0x00000000, +/**/ 0x00000000, 0x00000000, +/**/ 0x3FEFF800, 0x00000000, +/**/ 0x3EAFF801, 0xFF801FF8, +/**/ 0x3F4FFC00, 0xAA800000, +/**/ 0x3D35621F, 0x7809A0A3, +/**/ 0x3FEFF000, 0x00000000, +/**/ 0x3ECFF007, 0xFC01FF00, +/**/ 0x3F5FF802, 0xA9B00000, +/**/ 0xBD33BC66, 0x1D61C5EB, +/**/ 0x3FEFE800, 0x00000000, +/**/ 0x3EE1F28A, 0x186DADBE, +/**/ 0x3F67F704, 0x7D780000, +/**/ 0x3D283DA6, 0x89D68648, +/**/ 0x3FEFE000, 0x00000000, +/**/ 0x3EEFE01F, 0xE01FE020, +/**/ 0x3F6FF00A, 0xA2B00000, +/**/ 0x3D20BC04, 0xA086B56A, +/**/ 0x3FEFD800, 0x00000000, +/**/ 0x3EF8E0E6, 0xDF68BD14, +/**/ 0x3F73F38A, 0x60F00000, +/**/ 0x3D192256, 0x93C93749, +/**/ 0x3FEFD000, 0x00000000, +/**/ 0x3F01E528, 0x439A981C, +/**/ 0x3F77EE11, 0xEBD80000, +/**/ 0x3D0749D3, 0xC2D23A07, +/**/ 0x3FEFC800, 0x00000000, +/**/ 0x3F08556A, 0x8596391C, +/**/ 0x3F7BE79C, 0x70040000, +/**/ 0x3D38EC8F, 0x9A6C0404, +/**/ 0x3FEFC000, 0x00000000, +/**/ 0x3F0FC07F, 0x01FC07F0, +/**/ 0x3F7FE02A, 0x6B100000, +/**/ 0x3D19E23F, 0x0DDA40E4, +/**/ 0x3FEFB800, 0x00000000, +/**/ 0x3F1412D5, 0x9F5976B5, +/**/ 0x3F81EBDE, 0x2D1A0000, +/**/ 0xBD2A0683, 0xFF48DC36, +/**/ 0x3FEFB000, 0x00000000, +/**/ 0x3F18C21A, 0xBD271E34, +/**/ 0x3F83E729, 0x5D260000, +/**/ 0xBD2609C1, 0xFF29A114, +/**/ 0x3FEFA800, 0x00000000, +/**/ 0x3F1DEDB2, 0x5594A734, +/**/ 0x3F85E1F7, 0x03EC0000, +/**/ 0x3D37CA09, 0xF585DA1B, +/**/ 0x3FEFA000, 0x00000000, +/**/ 0x3F21CAA0, 0x1FA11CAA, +/**/ 0x3F87DC47, 0x5F820000, +/**/ 0xBD3EB124, 0x5B5DA1F5, +/**/ 0x3FEF9800, 0x00000000, +/**/ 0x3F24DC34, 0x55E8CB6B, +/**/ 0x3F89D61A, 0xADC60000, +/**/ 0x3D37B196, 0x327B4257, +/**/ 0x3FEF9000, 0x00000000, +/**/ 0x3F282B68, 0x13BAF1B2, +/**/ 0x3F8BCF71, 0x2C740000, +/**/ 0x3D1C25E0, 0x97BD9771, +/**/ 0x3FEF8800, 0x00000000, +/**/ 0x3F2BB80D, 0xCC420861, +/**/ 0x3F8DC84B, 0x19120000, +/**/ 0x3D1C0A54, 0x1E3A5B30, +/**/ 0x3FEF8000, 0x00000000, +/**/ 0x3F2F81F8, 0x1F81F820, +/**/ 0x3F8FC0A8, 0xB0FC0000, +/**/ 0x3CDF1E7C, 0xF6D3A69C, +/**/ 0x3FEF7800, 0x00000000, +/**/ 0x3F31C47C, 0xED1079FA, +/**/ 0x3F90DC45, 0x18B00000, +/**/ 0xBD29BC2F, 0x380313FC, +/**/ 0x3FEF7000, 0x00000000, +/**/ 0x3F33E672, 0xFA98528D, +/**/ 0x3F91D7F7, 0xEB9F0000, +/**/ 0xBD14193A, 0x83FCC7A6, +/**/ 0x3FEF6800, 0x00000000, +/**/ 0x3F3626C7, 0xCAFBD3D2, +/**/ 0x3F92D36C, 0xEFB50000, +/**/ 0x3D35F0BB, 0x341706C3, +/**/ 0x3FEF6000, 0x00000000, +/**/ 0x3F388565, 0x06DDABA6, +/**/ 0x3F93CEA4, 0x43470000, +/**/ 0xBD36A2C4, 0x32D6A40B, +/**/ 0x3FEF5800, 0x00000000, +/**/ 0x3F3B0234, 0x6CC4F5F5, +/**/ 0x3F94C99E, 0x04900000, +/**/ 0x3D1DECC6, 0x5DF5F4A5, +/**/ 0x3FEF5000, 0x00000000, +/**/ 0x3F3D9D1F, 0xD102728A, +/**/ 0x3F95C45A, 0x51B90000, +/**/ 0xBD263BB6, 0x216D87D8, +/**/ 0x3FEF5000, 0x00000000, +/**/ 0xBF3FA9EE, 0xE26A1DD4, +/**/ 0x3F96BED9, 0x48D20000, +/**/ 0xBD320BC4, 0x160A43F8, +/**/ 0x3FEF4800, 0x00000000, +/**/ 0xBF3CD30D, 0xADEC7540, +/**/ 0x3F97B91B, 0x07D60000, +/**/ 0xBD33B955, 0xB602ACE4, +/**/ 0x3FEF4000, 0x00000000, +/**/ 0xBF39DE52, 0x7C761DC6, +/**/ 0x3F98B31F, 0xACAA0000, +/**/ 0xBD33FC78, 0xA96E4964, +/**/ 0x3FEF3800, 0x00000000, +/**/ 0xBF36CBD3, 0x23989FF0, +/**/ 0x3F99ACE7, 0x551D0000, +/**/ 0xBD2D75D9, 0x7EC7C410, +/**/ 0x3FEF3000, 0x00000000, +/**/ 0xBF339BA5, 0x639F8B15, +/**/ 0x3F9AA672, 0x1EE80000, +/**/ 0x3D2AD4EB, 0x5C5AF494, +/**/ 0x3FEF2800, 0x00000000, +/**/ 0xBF304DDE, 0xE7AA579B, +/**/ 0x3F9B9FC0, 0x27B00000, +/**/ 0xBD3B9A01, 0x0AE6922A, +/**/ 0x3FEF2000, 0x00000000, +/**/ 0xBF29C52A, 0x8B8C46FD, +/**/ 0x3F9C98D1, 0x8D010000, +/**/ 0xBD2BF615, 0x0589DF0F, +/**/ 0x3FEF1800, 0x00000000, +/**/ 0xBF22B3BB, 0xFE0E92B4, +/**/ 0x3F9D91A6, 0x6C540000, +/**/ 0x3D2E61F1, 0x658CFB9A, +/**/ 0x3FEF1000, 0x00000000, +/**/ 0xBF16CF39, 0xFE8B488E, +/**/ 0x3F9E8A3E, 0xE30D0000, +/**/ 0xBD21A9FA, 0x3DE53900, +/**/ 0x3FEF0800, 0x00000000, +/**/ 0xBEFF07C1, 0xF07C1F08, +/**/ 0x3F9F829B, 0x0E780000, +/**/ 0x3D298026, 0x7C7E09E4, +/**/ 0x3FEF0000, 0x00000000, +/**/ 0x3EFF003E, 0x007C00F8, +/**/ 0x3FA03D5D, 0x85E70000, +/**/ 0x3D3F7789, 0x60ED29CF, +/**/ 0x3FEEF800, 0x00000000, +/**/ 0x3F17B671, 0x3D759870, +/**/ 0x3FA0B94F, 0x7C198000, +/**/ 0xBD2E8989, 0x6F022783, +/**/ 0x3FEEF000, 0x00000000, +/**/ 0x3F241070, 0x2A8BB96A, +/**/ 0x3FA13523, 0x78598000, +/**/ 0xBD1C1AC3, 0xB71FA59B, +/**/ 0x3FEEE800, 0x00000000, +/**/ 0x3F2C7F84, 0x58E01EEA, +/**/ 0x3FA1B0D9, 0x89240000, +/**/ 0xBD33401E, 0x9AE889BB, +/**/ 0x3FEEE000, 0x00000000, +/**/ 0x3F329425, 0xA3D491BC, +/**/ 0x3FA22C71, 0xBCEA8000, +/**/ 0x3CFD2818, 0xF87F888F, +/**/ 0x3FEED800, 0x00000000, +/**/ 0x3F37054D, 0x9E9D2AE8, +/**/ 0x3FA2A7EC, 0x22150000, +/**/ 0xBD278CE7, 0x7A9163FE, +/**/ 0x3FEED000, 0x00000000, +/**/ 0x3F3B9325, 0x540C85E6, +/**/ 0x3FA32348, 0xC7000000, +/**/ 0x3D2696DB, 0x90B1E49F, +/**/ 0x3FEED000, 0x00000000, +/**/ 0xBF3FC267, 0xF099FC26, +/**/ 0x3FA39E87, 0xB9FE8000, +/**/ 0x3D3EAFD4, 0x80AD9015, +/**/ 0x3FEEC800, 0x00000000, +/**/ 0xBF3AFB6E, 0xD02A4E5D, +/**/ 0x3FA419A9, 0x09590000, +/**/ 0x3D3B5CDC, 0x67D48EA7, +/**/ 0x3FEEC000, 0x00000000, +/**/ 0xBF361803, 0xD7A79FF1, +/**/ 0x3FA494AC, 0xC34D8000, +/**/ 0x3D211C78, 0xA56FD247, +/**/ 0x3FEEB800, 0x00000000, +/**/ 0xBF31183B, 0x805C2197, +/**/ 0x3FA50F92, 0xF60F8000, +/**/ 0x3D296CFB, 0x0A91FFE3, +/**/ 0x3FEEB000, 0x00000000, +/**/ 0xBF27F854, 0x5FE15180, +/**/ 0x3FA58A5B, 0xAFC90000, +/**/ 0xBD2B2B73, 0x9570AD39, +/**/ 0x3FEEA800, 0x00000000, +/**/ 0xBF1B0F90, 0xE210C36A, +/**/ 0x3FA60506, 0xFE990000, +/**/ 0xBD32BA40, 0x8194E036, +/**/ 0x3FEEA000, 0x00000000, +/**/ 0xBEF6F7DD, 0x8C33ADB2, +/**/ 0x3FA67F94, 0xF0948000, +/**/ 0x3D3ECC1F, 0x3E7E4ED7, +/**/ 0x3FEE9800, 0x00000000, +/**/ 0x3F1003D3, 0x1003D310, +/**/ 0x3FA6FA05, 0x93C78000, +/**/ 0x3D3B415E, 0x41D634A1, +/**/ 0x3FEE9000, 0x00000000, +/**/ 0x3F231ABF, 0x0B7672A0, +/**/ 0x3FA77458, 0xF6330000, +/**/ 0xBD3181DC, 0xE586AF09, +/**/ 0x3FEE8800, 0x00000000, +/**/ 0x3F2E6B5C, 0xCF172481, +/**/ 0x3FA7EE8F, 0x25CD8000, +/**/ 0xBD3F4216, 0x11A5C1E9, +/**/ 0x3FEE8000, 0x00000000, +/**/ 0x3F34F9CD, 0x77A84876, +/**/ 0x3FA868A8, 0x30840000, +/**/ 0xBD12623A, 0x134AC693, +/**/ 0x3FEE7800, 0x00000000, +/**/ 0x3F3AD9A8, 0xD7473427, +/**/ 0x3FA8E2A4, 0x243A0000, +/**/ 0x3D2B9EEB, 0x01426490, +/**/ 0x3FEE7800, 0x00000000, +/**/ 0xBF3F2AD3, 0x4578DCCA, +/**/ 0x3FA95C83, 0x0EC90000, +/**/ 0xBD2C1482, 0x97C5FEB8, +/**/ 0x3FEE7000, 0x00000000, +/**/ 0xBF3913BA, 0x97A6A035, +/**/ 0x3FA9D644, 0xFDFF8000, +/**/ 0x3D313C90, 0x539A473B, +/**/ 0x3FEE6800, 0x00000000, +/**/ 0xBF32E120, 0xC594A915, +/**/ 0x3FAA4FE9, 0xFFA40000, +/**/ 0xBD36E584, 0xA0402925, +/**/ 0x3FEE6000, 0x00000000, +/**/ 0xBF292632, 0xC5DF4232, +/**/ 0x3FAAC972, 0x21710000, +/**/ 0x3D2F8D3E, 0xF013222C, +/**/ 0x3FEE5800, 0x00000000, +/**/ 0xBF18A6DF, 0xC3518A6E, +/**/ 0x3FAB42DD, 0x71198000, +/**/ 0xBD1C827A, 0xE5D6704C, +/**/ 0x3FEE5000, 0x00000000, +/**/ 0x3ED6BC08, 0x86833271, +/**/ 0x3FABBC2B, 0xFC450000, +/**/ 0xBD17D186, 0x91417DAF, +/**/ 0x3FEE4800, 0x00000000, +/**/ 0x3F1BEB2D, 0xE672838D, +/**/ 0x3FAC355D, 0xD0920000, +/**/ 0x3D2F2CCC, 0x9ABF8388, +/**/ 0x3FEE4000, 0x00000000, +/**/ 0x3F2B6B8D, 0x9785150A, +/**/ 0x3FACAE72, 0xFB960000, +/**/ 0xBD3EFABF, 0x2025B1BE, +/**/ 0x3FEE3800, 0x00000000, +/**/ 0x3F348BCE, 0xE0D399FA, +/**/ 0x3FAD276B, 0x8ADB0000, +/**/ 0x3D16A423, 0xC78A64B0, +/**/ 0x3FEE3000, 0x00000000, +/**/ 0x3F3B7CD0, 0x933AC00F, +/**/ 0x3FADA047, 0x8BE38000, +/**/ 0x3D2252C7, 0xB1F6FE05, +/**/ 0x3FEE3000, 0x00000000, +/**/ 0xBF3D7747, 0x308F5281, +/**/ 0x3FAE1907, 0x0C278000, +/**/ 0xBD2FEA46, 0x64629E86, +/**/ 0x3FEE2800, 0x00000000, +/**/ 0xBF36508B, 0x6C196F66, +/**/ 0x3FAE91AA, 0x19150000, +/**/ 0xBD0E82A0, 0x1DCC6A76, +/**/ 0x3FEE2000, 0x00000000, +/**/ 0xBF2E1E1E, 0x1E1E1E1E, +/**/ 0x3FAF0A30, 0xC0118000, +/**/ 0xBD2D599E, 0x83368E91, +/**/ 0x3FEE1800, 0x00000000, +/**/ 0xBF1ECB93, 0xDD355CDB, +/**/ 0x3FAF829B, 0x0E780000, +/**/ 0x3D398026, 0x7C7E09E4, +/**/ 0x3FEE1000, 0x00000000, +/**/ 0xBECE0FF8, 0x7C01E100, +/**/ 0x3FAFFAE9, 0x119B8000, +/**/ 0x3D230337, 0x4262C554, +/**/ 0x3FEE0800, 0x00000000, +/**/ 0x3F1D54B5, 0x25C73724, +/**/ 0x3FB0398D, 0x6B624000, +/**/ 0xBD3AB14D, 0xFCBFCD00, +/**/ 0x3FEE0000, 0x00000000, +/**/ 0x3F2E01E0, 0x1E01E01E, +/**/ 0x3FB07598, 0x35990000, +/**/ 0xBD3B8ECF, 0xE4B59987, +/**/ 0x3FEDF800, 0x00000000, +/**/ 0x3F36C715, 0xC84194BA, +/**/ 0x3FB0B194, 0xEE0D0000, +/**/ 0x3D3666EA, 0x4F69EDCC, +/**/ 0x3FEDF000, 0x00000000, +/**/ 0x3F3EA78B, 0xEF26D838, +/**/ 0x3FB0ED83, 0x9B554000, +/**/ 0xBD3901F4, 0x6D48ABB4, +/**/ 0x3FEDF000, 0x00000000, +/**/ 0xBF395DBF, 0xF10995DC, +/**/ 0x3FB12964, 0x44030000, +/**/ 0xBD3D53BB, 0x751AA773, +/**/ 0x3FEDE800, 0x00000000, +/**/ 0xBF3148E0, 0x3BCBADC8, +/**/ 0x3FB16536, 0xEEA38000, +/**/ 0xBD147C5E, 0x768FA309, +/**/ 0x3FEDE000, 0x00000000, +/**/ 0xBF2233CE, 0x86E25CE1, +/**/ 0x3FB1A0FB, 0xA1BF8000, +/**/ 0x3D24A3FC, 0xC319D6DC, +/**/ 0x3FEDD800, 0x00000000, +/**/ 0xBEEA1CE9, 0x26B3FE23, +/**/ 0x3FB1DCB2, 0x63DB0000, +/**/ 0x3D39444F, 0x5E9E8981, +/**/ 0x3FEDD000, 0x00000000, +/**/ 0x3F1E4836, 0x0AB71710, +/**/ 0x3FB2185B, 0x3B75C000, +/**/ 0xBD3E3189, 0xF8F32304, +/**/ 0x3FEDC800, 0x00000000, +/**/ 0x3F300EE5, 0x00EE500F, +/**/ 0x3FB253F6, 0x2F0A0000, +/**/ 0x3D3416F8, 0xFB69A701, +/**/ 0x3FEDC000, 0x00000000, +/**/ 0x3F38A58D, 0x231C226A, +/**/ 0x3FB28F83, 0x450EC000, +/**/ 0x3D3A8D75, 0xAA119769, +/**/ 0x3FEDC000, 0x00000000, +/**/ 0xBF3EAA0C, 0x14715D63, +/**/ 0x3FB2CB02, 0x83F5C000, +/**/ 0x3D3E1EE2, 0xCA657021, +/**/ 0x3FEDB800, 0x00000000, +/**/ 0xBF35DFF8, 0x92AEFFC5, +/**/ 0x3FB30673, 0xF22C8000, +/**/ 0x3D24C9E2, 0x9DCF0BA5, +/**/ 0x3FEDB000, 0x00000000, +/**/ 0xBF29F894, 0x67E251A0, +/**/ 0x3FB341D7, 0x961BC000, +/**/ 0x3D31D092, 0x99837610, +/**/ 0x3FEDA800, 0x00000000, +/**/ 0xBF0FF896, 0x1FF89620, +/**/ 0x3FB37D2D, 0x76284000, +/**/ 0xBD2C60AA, 0x9B7FF15C, +/**/ 0x3FEDA000, 0x00000000, +/**/ 0x3F145E70, 0x076828BD, +/**/ 0x3FB3B875, 0x98B1C000, +/**/ 0xBD222415, 0x94ACA313, +/**/ 0x3FED9800, 0x00000000, +/**/ 0x3F2C8F60, 0xE567D573, +/**/ 0x3FB3F3B0, 0x04140000, +/**/ 0x3CEE2474, 0xACDFCEC5, +/**/ 0x3FED9000, 0x00000000, +/**/ 0x3F379118, 0xF3FC4DA2, +/**/ 0x3FB42EDC, 0xBEA64000, +/**/ 0x3D1BC0EE, 0xEA7C9ACD, +/**/ 0x3FED9000, 0x00000000, +/**/ 0xBF3F0C3C, 0x049DE4C3, +/**/ 0x3FB469FB, 0xCEBB4000, +/**/ 0x3D3B663C, 0x4F257194, +/**/ 0x3FED8800, 0x00000000, +/**/ 0xBF35905F, 0xF13D5906, +/**/ 0x3FB4A50D, 0x3AA1C000, +/**/ 0xBD2F7FE1, 0x308973E2, +/**/ 0x3FED8000, 0x00000000, +/**/ 0xBF27F6C8, 0x77D1EA57, +/**/ 0x3FB4E011, 0x08A34000, +/**/ 0x3D3AE5CF, 0xDF2C5AE5, +/**/ 0x3FED7800, 0x00000000, +/**/ 0xBF026AD1, 0xF4F31BA0, +/**/ 0x3FB51B07, 0x3F060000, +/**/ 0x3D383F69, 0x278E686A, +/**/ 0x3FED7000, 0x00000000, +/**/ 0x3F1DE6B2, 0xF26DF1BD, +/**/ 0x3FB555EF, 0xE40B4000, +/**/ 0x3D30B497, 0x8C868E23, +/**/ 0x3FED6800, 0x00000000, +/**/ 0x3F31599F, 0x7BA23D96, +/**/ 0x3FB590CA, 0xFDF00000, +/**/ 0x3D3C284F, 0x5722ABAA, +/**/ 0x3FED6000, 0x00000000, +/**/ 0x3F3B526C, 0xD425A760, +/**/ 0x3FB5CB98, 0x92ED4000, +/**/ 0x3D17BE44, 0xA64FC52F, +/**/ 0x3FED6000, 0x00000000, +/**/ 0xBF3A9BFC, 0x546A6FF1, +/**/ 0x3FB60658, 0xA9374000, +/**/ 0x3D30C3B1, 0xDEE9C4F8, +/**/ 0x3FED5800, 0x00000000, +/**/ 0xBF3071AD, 0x08F02FAC, +/**/ 0x3FB6410B, 0x46FE8000, +/**/ 0xBD153F8F, 0x3CBD8D14, +/**/ 0x3FED5000, 0x00000000, +/**/ 0xBF18BAD9, 0x12C6C142, +/**/ 0x3FB67BB0, 0x726EC000, +/**/ 0x3CEF724B, 0x69EF5912, +/**/ 0x3FED4800, 0x00000000, +/**/ 0x3F10B35C, 0x3254A5A2, +/**/ 0x3FB6B648, 0x31B00000, +/**/ 0xBD3BF30A, 0x1377DE92, +/**/ 0x3FED4000, 0x00000000, +/**/ 0x3F2D41D4, 0x1D41D41D, +/**/ 0x3FB6F0D2, 0x8AE58000, +/**/ 0xBD34B464, 0x1B664613, +/**/ 0x3FED3800, 0x00000000, +/**/ 0x3F392D71, 0xF494E548, +/**/ 0x3FB72B4F, 0x842EC000, +/**/ 0xBD3704CC, 0xC00C9DD3, +/**/ 0x3FED3800, 0x00000000, +/**/ 0xBF3C2DA1, 0xFF165C2E, +/**/ 0x3FB765BF, 0x23A6C000, +/**/ 0xBCFECBC0, 0x35C4256A, +/**/ 0x3FED3000, 0x00000000, +/**/ 0xBF317062, 0x7AA49674, +/**/ 0x3FB7A021, 0x6F648000, +/**/ 0x3D3E124C, 0xA18418FF, +/**/ 0x3FED2800, 0x00000000, +/**/ 0xBF1A6B80, 0x749CB290, +/**/ 0x3FB7DA76, 0x6D7B0000, +/**/ 0x3D32CC84, 0x4480C89B, +/**/ 0x3FED2000, 0x00000000, +/**/ 0x3F114B52, 0x25C6336D, +/**/ 0x3FB814BE, 0x23F8C000, +/**/ 0x3CCB2381, 0xDA82FDFD, +/**/ 0x3FED1800, 0x00000000, +/**/ 0x3F2EB155, 0xF08A3B1D, +/**/ 0x3FB84EF8, 0x98E84000, +/**/ 0xBD37D5CD, 0x246977C9, +/**/ 0x3FED1000, 0x00000000, +/**/ 0x3F3A7692, 0xBD71CD93, +/**/ 0x3FB88925, 0xD24FC000, +/**/ 0xBD31D505, 0x44FBB806, +/**/ 0x3FED1000, 0x00000000, +/**/ 0xBF3A5384, 0x89FC5E69, +/**/ 0x3FB8C345, 0xD6318000, +/**/ 0x3D3B20F5, 0xACB42A66, +/**/ 0x3FED0800, 0x00000000, +/**/ 0xBF2E0B56, 0x6439240E, +/**/ 0x3FB8FD58, 0xAA8C4000, +/**/ 0xBD3EEC90, 0x1BCB725B, +/**/ 0x3FED0000, 0x00000000, +/**/ 0xBF0CFF8C, 0x01CFF8C0, +/**/ 0x3FB9375E, 0x55594000, +/**/ 0x3D3EDDC3, 0x7380C364, +/**/ 0x3FECF800, 0x00000000, +/**/ 0x3F1F7661, 0x546D8D78, +/**/ 0x3FB97156, 0xDC8F8000, +/**/ 0xBD3C1FC1, 0x9AFDB97B, +/**/ 0x3FECF000, 0x00000000, +/**/ 0x3F3372E2, 0x25FE30D9, +/**/ 0x3FB9AB42, 0x46204000, +/**/ 0xBD28A648, 0x26787061, +/**/ 0x3FECE800, 0x00000000, +/**/ 0x3F3F1FDB, 0xD92305A6, +/**/ 0x3FB9E520, 0x97F9C000, +/**/ 0x3D235FAC, 0xB52DD050, +/**/ 0x3FECE800, 0x00000000, +/**/ 0xBF351B8A, 0x9C37FC63, +/**/ 0x3FBA1EF1, 0xD8060000, +/**/ 0x3D3CD417, 0x6DF97BCB, +/**/ 0x3FECE000, 0x00000000, +/**/ 0xBF227EC2, 0x6CB725AB, +/**/ 0x3FBA58B6, 0x0C2B4000, +/**/ 0xBD3CDC73, 0x5C5C9F2A, +/**/ 0x3FECD800, 0x00000000, +/**/ 0x3F05A240, 0xE6C2B448, +/**/ 0x3FBA926D, 0x3A4AC000, +/**/ 0x3D356365, 0x0BD22A9C, +/**/ 0x3FECD000, 0x00000000, +/**/ 0x3F2D7EC2, 0xFBB8D9F3, +/**/ 0x3FBACC17, 0x68434000, +/**/ 0xBD2AA783, 0xA0B7FA4C, +/**/ 0x3FECC800, 0x00000000, +/**/ 0x3F3AE1DB, 0x1B71D3E9, +/**/ 0x3FBB05B4, 0x9BEE4000, +/**/ 0x3D0FF22C, 0x18F84A5E, +/**/ 0x3FECC800, 0x00000000, +/**/ 0xBF38E45A, 0xCD6DE82D, +/**/ 0x3FBB3F44, 0xDB220000, +/**/ 0x3D3FD153, 0xD8DE09AF, +/**/ 0x3FECC000, 0x00000000, +/**/ 0xBF29269F, 0xE341926A, +/**/ 0x3FBB78C8, 0x2BB10000, +/**/ 0xBD325EF7, 0xBC3987E7, +/**/ 0x3FECB800, 0x00000000, +/**/ 0xBEC589FB, 0xF620C1DA, +/**/ 0x3FBBB23E, 0x93690000, +/**/ 0xBD368B18, 0x3559DB8B, +/**/ 0x3FECB000, 0x00000000, +/**/ 0x3F28A893, 0x0DE5FF1A, +/**/ 0x3FBBEBA8, 0x18148000, +/**/ 0xBD389B78, 0xB6DF1F57, +/**/ 0x3FECA800, 0x00000000, +/**/ 0x3F38EAB9, 0x0039563B, +/**/ 0x3FBC2504, 0xBF79C000, +/**/ 0x3D3717C4, 0xD0EF4ADC, +/**/ 0x3FECA800, 0x00000000, +/**/ 0xBF3A67D5, 0x08F377F2, +/**/ 0x3FBC5E54, 0x8F5BC000, +/**/ 0x3D1D0C57, 0x585FBE06, +/**/ 0x3FECA000, 0x00000000, +/**/ 0xBF2B46E0, 0x072792E4, +/**/ 0x3FBC9797, 0x8D790000, +/**/ 0xBD36E010, 0x977D1884, +/**/ 0x3FEC9800, 0x00000000, +/**/ 0xBEE904EA, 0x1BB327C3, +/**/ 0x3FBCD0CD, 0xBF8C0000, +/**/ 0x3D33E14D, 0xB50DD743, +/**/ 0x3FEC9000, 0x00000000, +/**/ 0x3F2853EB, 0x77683AEC, +/**/ 0x3FBD09F7, 0x2B4C4000, +/**/ 0x3D2048C0, 0x00354E33, +/**/ 0x3FEC8800, 0x00000000, +/**/ 0x3F3932D7, 0xDC52100E, +/**/ 0x3FBD4313, 0xD66CC000, +/**/ 0xBD294543, 0x79135713, +/**/ 0x3FEC8800, 0x00000000, +/**/ 0xBF39AD90, 0x2736962B, +/**/ 0x3FBD7C23, 0xC69CC000, +/**/ 0xBD297EE4, 0xDD328771, +/**/ 0x3FEC8000, 0x00000000, +/**/ 0xBF28EEA2, 0xF316B4C2, +/**/ 0x3FBDB527, 0x0187C000, +/**/ 0x3D392778, 0x56AE181F, +/**/ 0x3FEC7800, 0x00000000, +/**/ 0x3EEAB099, 0x058F7536, +/**/ 0x3FBDEE1D, 0x8CD60000, +/**/ 0xBD328DA0, 0x729EFF89, +/**/ 0x3FEC7000, 0x00000000, +/**/ 0x3F2C71C7, 0x1C71C71C, +/**/ 0x3FBE2707, 0x6E2B0000, +/**/ 0xBD2A342C, 0x2AF0003C, +/**/ 0x3FEC6800, 0x00000000, +/**/ 0x3F3BB2BB, 0xD6422A30, +/**/ 0x3FBE5FE4, 0xAB274000, +/**/ 0xBD35FAE9, 0xF74FFE4D, +/**/ 0x3FEC6800, 0x00000000, +/**/ 0xBF36BD01, 0x54BDE47E, +/**/ 0x3FBE98B5, 0x49670000, +/**/ 0x3D346774, 0x89C50E97, +/**/ 0x3FEC6000, 0x00000000, +/**/ 0xBF222CC5, 0xB5157FE4, +/**/ 0x3FBED179, 0x4E838000, +/**/ 0xBD1FD143, 0x749D0484, +/**/ 0x3FEC5800, 0x00000000, +/**/ 0x3F129A21, 0xA930B840, +/**/ 0x3FBF0A30, 0xC0118000, +/**/ 0xBD3D599E, 0x83368E91, +/**/ 0x3FEC5000, 0x00000000, +/**/ 0x3F3279B1, 0xAC5CEE14, +/**/ 0x3FBF42DB, 0xA3A24000, +/**/ 0xBD3312B7, 0x32DF6C0D, +/**/ 0x3FEC5000, 0x00000000, +/**/ 0xBF3F9CF5, 0xD4AB8D0B, +/**/ 0x3FBF7B79, 0xFEC38000, +/**/ 0xBD010987, 0xE897ED01, +/**/ 0x3FEC4800, 0x00000000, +/**/ 0xBF319D7C, 0xCC17DAE4, +/**/ 0x3FBFB40B, 0xD6FF4000, +/**/ 0x3D2C0BEC, 0xB7B53B5B, +/**/ 0x3FEC4000, 0x00000000, +/**/ 0xBF0C3F8F, 0x01C3F8F0, +/**/ 0x3FBFEC91, 0x31DC0000, +/**/ 0xBD354555, 0xD1AE6607, +/**/ 0x3FEC3800, 0x00000000, +/**/ 0x3F254738, 0xAB1B8FFC, +/**/ 0x3FC01285, 0x0A6E0000, +/**/ 0xBD1A8619, 0x4805BF94, +/**/ 0x3FEC3000, 0x00000000, +/**/ 0x3F38E51F, 0x48B3C5D7, +/**/ 0x3FC02EBB, 0x42BF4000, +/**/ 0xBD15A8FA, 0x5CE00E5D, +/**/ 0x3FEC3000, 0x00000000, +/**/ 0xBF38C377, 0x867E595E, +/**/ 0x3FC04AEB, 0x449F6000, +/**/ 0x3D2AFA90, 0x65CCD35C, +/**/ 0x3FEC2800, 0x00000000, +/**/ 0xBF24AC6D, 0x15FE3D95, +/**/ 0x3FC06715, 0x12CA6000, +/**/ 0xBD2A4757, 0x9CDC0A3D, +/**/ 0x3FEC2000, 0x00000000, +/**/ 0x3F10B34F, 0x53B8CDAE, +/**/ 0x3FC08338, 0xAFFA2000, +/**/ 0x3D30533C, 0xAC823E27, +/**/ 0x3FEC1800, 0x00000000, +/**/ 0x3F32C599, 0x3FABB0F6, +/**/ 0x3FC09F56, 0x1EE72000, +/**/ 0xBD28F305, 0x7157D1A8, +/**/ 0x3FEC1800, 0x00000000, +/**/ 0xBF3E8BF4, 0x97CD1B6C, +/**/ 0x3FC0BB6D, 0x6247A000, +/**/ 0x3D35464F, 0x3CCD04B3, +/**/ 0x3FEC1000, 0x00000000, +/**/ 0xBF2F8FC7, 0xE3F1F8FC, +/**/ 0x3FC0D77E, 0x7CD08000, +/**/ 0x3D3CB2CD, 0x2EE2F482, +/**/ 0x3FEC0800, 0x00000000, +/**/ 0xBEEDC860, 0x5B199F35, +/**/ 0x3FC0F389, 0x7134C000, +/**/ 0xBD3DA359, 0xE893D6C6, +/**/ 0x3FEC0000, 0x00000000, +/**/ 0x3F2C01C0, 0x1C01C01C, +/**/ 0x3FC10F8E, 0x42254000, +/**/ 0xBD293B38, 0x43396307, +/**/ 0x3FEBF800, 0x00000000, +/**/ 0x3F3D0577, 0x256228AA, +/**/ 0x3FC12B8C, 0xF2518000, +/**/ 0x3D348A4A, 0x13C0A0FC, +/**/ 0x3FEBF800, 0x00000000, +/**/ 0xBF33E08B, 0xCB93A8A1, +/**/ 0x3FC14785, 0x84674000, +/**/ 0x3D156345, 0x1027C750, +/**/ 0x3FEBF000, 0x00000000, +/**/ 0xBF12C4DB, 0x1DE63F4A, +/**/ 0x3FC16377, 0xFB124000, +/**/ 0x3D091E1A, 0xBF41763E, +/**/ 0x3FEBE800, 0x00000000, +/**/ 0x3F2526D0, 0x769F9E4F, +/**/ 0x3FC17F64, 0x58FCA000, +/**/ 0x3D2843FA, 0xD093C8DC, +/**/ 0x3FEBE000, 0x00000000, +/**/ 0x3F39ED43, 0x5292D891, +/**/ 0x3FC19B4A, 0xA0CEE000, +/**/ 0xBD3D8824, 0x9621338B, +/**/ 0x3FEBE000, 0x00000000, +/**/ 0xBF36A3B3, 0x5FC845A9, +/**/ 0x3FC1B72A, 0xD52F6000, +/**/ 0x3D2E80A4, 0x1811A396, +/**/ 0x3FEBD800, 0x00000000, +/**/ 0xBF1C7E26, 0xB7230491, +/**/ 0x3FC1D304, 0xF8C36000, +/**/ 0xBD3A6D44, 0xDF451042, +/**/ 0x3FEBD000, 0x00000000, +/**/ 0x3F20F365, 0x451B61CB, +/**/ 0x3FC1EED9, 0x0E2DC000, +/**/ 0x3D161563, 0x7097648F, +/**/ 0x3FEBC800, 0x00000000, +/**/ 0x3F3827F3, 0xD72DD0AA, +/**/ 0x3FC20AA7, 0x18102000, +/**/ 0x3D3F2C94, 0x348552FE, +/**/ 0x3FEBC800, 0x00000000, +/**/ 0xBF3814D3, 0xBE0C262F, +/**/ 0x3FC2266F, 0x190A6000, +/**/ 0xBD24D20A, 0xB840E7F6, +/**/ 0x3FEBC000, 0x00000000, +/**/ 0xBF207963, 0x7ECECB53, +/**/ 0x3FC24231, 0x13BA6000, +/**/ 0xBD3E3A00, 0x78EE9D9C, +/**/ 0x3FEBB800, 0x00000000, +/**/ 0x3F1EC130, 0xF29268D3, +/**/ 0x3FC25DED, 0x0ABC6000, +/**/ 0x3D35A385, 0x4F176449, +/**/ 0x3FEBB000, 0x00000000, +/**/ 0x3F37B218, 0xAB6353BF, +/**/ 0x3FC279A3, 0x00AB4000, +/**/ 0x3D3EF432, 0xB3235108, +/**/ 0x3FEBB000, 0x00000000, +/**/ 0xBF383759, 0xF2298376, +/**/ 0x3FC29552, 0xF8200000, +/**/ 0xBD35B967, 0xF4471DFC, +/**/ 0x3FEBA800, 0x00000000, +/**/ 0xBF201832, 0x1EAD4253, +/**/ 0x3FC2B0FC, 0xF3B1A000, +/**/ 0x3D177CA3, 0xE30A59EA, +/**/ 0x3FEBA000, 0x00000000, +/**/ 0x3F20679B, 0xD84886B1, +/**/ 0x3FC2CCA0, 0xF5F60000, +/**/ 0xBD3B5EF1, 0x91AFF120, +/**/ 0x3FEB9800, 0x00000000, +/**/ 0x3F38884D, 0xA41FEB4C, +/**/ 0x3FC2E83F, 0x0180E000, +/**/ 0xBD3F0C2A, 0xC284E1CE, +/**/ 0x3FEB9800, 0x00000000, +/**/ 0xBF370EA7, 0x3806E548, +/**/ 0x3FC303D7, 0x18E48000, +/**/ 0xBCD680B5, 0xCE3ECB05, +/**/ 0x3FEB9000, 0x00000000, +/**/ 0xBF1A4477, 0xB5EF34C0, +/**/ 0x3FC31F69, 0x3EB1A000, +/**/ 0xBD2A6726, 0xE5A396FB, +/**/ 0x3FEB8800, 0x00000000, +/**/ 0x3F2401B8, 0x9401B894, +/**/ 0x3FC33AF5, 0x75770000, +/**/ 0x3D3C9ECC, 0xA2FE72A5, +/**/ 0x3FEB8000, 0x00000000, +/**/ 0x3F3AA73A, 0x400DC1AA, +/**/ 0x3FC3567B, 0xBFC22000, +/**/ 0x3D3250D2, 0x53991A1F, +/**/ 0x3FEB8000, 0x00000000, +/**/ 0xBF349E11, 0x2E63A6A8, +/**/ 0x3FC371FC, 0x201E8000, +/**/ 0x3D3EE877, 0x9B2D8ABC, +/**/ 0x3FEB7800, 0x00000000, +/**/ 0xBF0E7898, 0xC8DA04B9, +/**/ 0x3FC38D76, 0x99164000, +/**/ 0x3D1844A5, 0x9E39BB70, +/**/ 0x3FEB7000, 0x00000000, +/**/ 0x3F2A284E, 0xE6B33E2D, +/**/ 0x3FC3A8EB, 0x2D31A000, +/**/ 0x3D1BAFB7, 0x7D5D503E, +/**/ 0x3FEB6800, 0x00000000, +/**/ 0x3F3E0B91, 0x759C2BB4, +/**/ 0x3FC3C459, 0xDEF76000, +/**/ 0x3D3EDC86, 0xF6B70D33, +/**/ 0x3FEB6800, 0x00000000, +/**/ 0xBF30E8E2, 0x088FD6E7, +/**/ 0x3FC3DFC2, 0xB0ECC000, +/**/ 0x3D28A72A, 0x62B8C13F, +/**/ 0x3FEB6000, 0x00000000, +/**/ 0x3ECB6006, 0xD801B600, +/**/ 0x3FC3FB25, 0xA5952000, +/**/ 0x3D3195BE, 0x6B358FF7, +/**/ 0x3FEB5800, 0x00000000, +/**/ 0x3F316A6A, 0xD840F62C, +/**/ 0x3FC41682, 0xBF728000, +/**/ 0xBD210047, 0x081F849D, +/**/ 0x3FEB5800, 0x00000000, +/**/ 0xBF3D4DEE, 0x7DF8BD99, +/**/ 0x3FC431DA, 0x01050000, +/**/ 0x3D304837, 0x836E0391, +/**/ 0x3FEB5000, 0x00000000, +/**/ 0xBF27E4B1, 0x7E4B17E5, +/**/ 0x3FC44D2B, 0x6CCB8000, +/**/ 0xBD170CC1, 0x6135783C, +/**/ 0x3FEB4800, 0x00000000, +/**/ 0x3F15F47D, 0x55E6D8FE, +/**/ 0x3FC46877, 0x05430000, +/**/ 0xBD3D8145, 0xF8D5087E, +/**/ 0x3FEB4000, 0x00000000, +/**/ 0x3F37006D, 0x0B803686, +/**/ 0x3FC483BC, 0xCCE6E000, +/**/ 0x3D1EEA52, 0x723F6369, +/**/ 0x3FEB4000, 0x00000000, +/**/ 0xBF37687C, 0x46A66920, +/**/ 0x3FC49EFC, 0xC6314000, +/**/ 0xBD090F59, 0x9F55572B, +/**/ 0x3FEB3800, 0x00000000, +/**/ 0xBF16F6A4, 0xFF2645BE, +/**/ 0x3FC4BA36, 0xF39A6000, +/**/ 0xBD34354B, 0xB3F219E5, +/**/ 0x3FEB3000, 0x00000000, +/**/ 0x3F2801B3, 0x1801B318, +/**/ 0x3FC4D56B, 0x5798E000, +/**/ 0x3D380580, 0x15A96555, +/**/ 0x3FEB2800, 0x00000000, +/**/ 0x3F3DD2FF, 0x93511680, +/**/ 0x3FC4F099, 0xF4A24000, +/**/ 0xBD3E9BF2, 0xFAFEAF27, +/**/ 0x3FEB2800, 0x00000000, +/**/ 0xBF304743, 0xA89DCCAC, +/**/ 0x3FC50BC2, 0xCD29C000, +/**/ 0x3D1ADA57, 0x28DB8D4F, +/**/ 0x3FEB2000, 0x00000000, +/**/ 0x3EFB2036, 0x406C80D9, +/**/ 0x3FC526E5, 0xE3A1C000, +/**/ 0xBD3790BA, 0x37FC5238, +/**/ 0x3FEB1800, 0x00000000, +/**/ 0x3F33BEC8, 0x4F9DC00E, +/**/ 0x3FC54203, 0x3A7A8000, +/**/ 0x3D268D68, 0xED855F0E, +/**/ 0x3FEB1800, 0x00000000, +/**/ 0xBF3A2101, 0x44F8CE7E, +/**/ 0x3FC55D1A, 0xD4232000, +/**/ 0x3D3ADD94, 0xDDA647E8, +/**/ 0x3FEB1000, 0x00000000, +/**/ 0xBF1FB596, 0xB99AF3F3, +/**/ 0x3FC5782C, 0xB3092000, +/**/ 0xBD33A463, 0x51794442, +/**/ 0x3FEB0800, 0x00000000, +/**/ 0x3F24B31D, 0x922A3E85, +/**/ 0x3FC59338, 0xD9982000, +/**/ 0x3CF0BA68, 0xB7555D4A, +/**/ 0x3FEB0000, 0x00000000, +/**/ 0x3F3CB3CF, 0xE19BF6B7, +/**/ 0x3FC5AE3F, 0x4A3AA000, +/**/ 0x3D21EA25, 0xF012A8B9, +/**/ 0x3FEB0000, 0x00000000, +/**/ 0xBF30DEAE, 0x9A5BF0D1, +/**/ 0x3FC5C940, 0x07598000, +/**/ 0xBD3A8D94, 0x8CD23322, +/**/ 0x3FEAF800, 0x00000000, +/**/ 0x3EFA2072, 0x9EDE13CE, +/**/ 0x3FC5E43B, 0x135BE000, +/**/ 0xBD343AB4, 0xCEED9C31, +/**/ 0x3FEAF000, 0x00000000, +/**/ 0x3F3435E5, 0x0D79435E, +/**/ 0x3FC5FF30, 0x70A7A000, +/**/ 0xBD38586F, 0x183BEBF2, +/**/ 0x3FEAF000, 0x00000000, +/**/ 0xBF392321, 0x06855D30, +/**/ 0x3FC61A20, 0x21A0E000, +/**/ 0x3D3DD9DD, 0x1BDF3CDD, +/**/ 0x3FEAE800, 0x00000000, +/**/ 0xBF19A45C, 0x7ABED811, +/**/ 0x3FC6350A, 0x28AAA000, +/**/ 0x3D2D5EC0, 0xAB8163AF, +/**/ 0x3FEAE000, 0x00000000, +/**/ 0x3F28C7ED, 0x84EF68CB, +/**/ 0x3FC64FEE, 0x88260000, +/**/ 0xBD1DA40D, 0x759DDED6, +/**/ 0x3FEAD800, 0x00000000, +/**/ 0x3F3F43FC, 0xA482F00D, +/**/ 0x3FC66ACD, 0x4272A000, +/**/ 0x3D3AA1BD, 0xBFC6C785, +/**/ 0x3FEAD800, 0x00000000, +/**/ 0xBF2B9222, 0xCDE3E7AE, +/**/ 0x3FC685A6, 0x59EF0000, +/**/ 0xBD21F2A9, 0x6C103214, +/**/ 0x3FEAD000, 0x00000000, +/**/ 0x3F14F302, 0xEED254A3, +/**/ 0x3FC6A079, 0xD0F7A000, +/**/ 0x3D35A3F8, 0x448D14F5, +/**/ 0x3FEAC800, 0x00000000, +/**/ 0x3F385567, 0x32071DEF, +/**/ 0x3FC6BB47, 0xA9E80000, +/**/ 0x3D19F64D, 0x23EA3296, +/**/ 0x3FEAC800, 0x00000000, +/**/ 0xBF347F29, 0xD47F29D4, +/**/ 0x3FC6D60F, 0xE719E000, +/**/ 0xBD3BC6E5, 0x57134767, +/**/ 0x3FEAC000, 0x00000000, +/**/ 0xBEF40FE1, 0xE82D23BC, +/**/ 0x3FC6F0D2, 0x8AE56000, +/**/ 0x3D369737, 0xC93373DA, +/**/ 0x3FEAB800, 0x00000000, +/**/ 0x3F320FDE, 0x972D8538, +/**/ 0x3FC70B8F, 0x97A1A000, +/**/ 0x3D34EA64, 0xF6A95BEF, +/**/ 0x3FEAB800, 0x00000000, +/**/ 0xBF3A8C9F, 0x66711513, +/**/ 0x3FC72647, 0x0FA40000, +/**/ 0xBD3774DF, 0x0E743A45, +/**/ 0x3FEAB000, 0x00000000, +/**/ 0xBF1C5A0F, 0x02806ABC, +/**/ 0x3FC740F8, 0xF5404000, +/**/ 0xBD30B66C, 0x99018AA1, +/**/ 0x3FEAA800, 0x00000000, +/**/ 0x3F28E44B, 0xD22C937A, +/**/ 0x3FC75BA5, 0x4AC8E000, +/**/ 0x3D3DDCA5, 0x8BC4A7C0, +/**/ 0x3FEAA800, 0x00000000, +/**/ 0xBF3FF2AD, 0xFF2ADFF3, +/**/ 0x3FC7764C, 0x128F2000, +/**/ 0x3D027490, 0x3479E3D1, +/**/ 0x3FEAA000, 0x00000000, +/**/ 0xBF288A16, 0x0B3ADA5C, +/**/ 0x3FC790ED, 0x4EE26000, +/**/ 0x3D199BBD, 0x4E7746F6, +/**/ 0x3FEA9800, 0x00000000, +/**/ 0x3F1DEC0D, 0x4C77B035, +/**/ 0x3FC7AB89, 0x0210E000, +/**/ 0xBD2BDB90, 0x72534A58, +/**/ 0x3FEA9000, 0x00000000, +/**/ 0x3F3B4D71, 0x91F59E6B, +/**/ 0x3FC7C61F, 0x2E674000, +/**/ 0xBD32392D, 0xB31BE8E0, +/**/ 0x3FEA9000, 0x00000000, +/**/ 0xBF30CDCB, 0xB8A2A522, +/**/ 0x3FC7E0AF, 0xD630C000, +/**/ 0x3D139E7C, 0x1D8F1034, +/**/ 0x3FEA8800, 0x00000000, +/**/ 0x3F094A00, 0x6A2194A0, +/**/ 0x3FC7FB3A, 0xFBB76000, +/**/ 0xBD37DBF5, 0x24609D57, +/**/ 0x3FEA8000, 0x00000000, +/**/ 0x3F373289, 0x870AC52E, +/**/ 0x3FC815C0, 0xA1436000, +/**/ 0xBD302A52, 0xF9201CE8, +/**/ 0x3FEA8000, 0x00000000, +/**/ 0xBF34B1FA, 0x9E8684DD, +/**/ 0x3FC83040, 0xC91BC000, +/**/ 0x3D3E5B71, 0xC6E66F32, +/**/ 0x3FEA7800, 0x00000000, +/**/ 0xBEE08AF5, 0xA9267648, +/**/ 0x3FC84ABB, 0x75866000, +/**/ 0xBD3D8DAA, 0xDF4E2BD2, +/**/ 0x3FEA7000, 0x00000000, +/**/ 0x3F33BB67, 0x1A3D927E, +/**/ 0x3FC86530, 0xA8C70000, +/**/ 0x3D398BB0, 0xCB4EA3E3, +/**/ 0x3FEA7000, 0x00000000, +/**/ 0xBF37F2C9, 0x7F2C97F3, +/**/ 0x3FC87FA0, 0x6520C000, +/**/ 0x3D322120, 0x401202FC, +/**/ 0x3FEA6800, 0x00000000, +/**/ 0xBF0C77A5, 0x3C076D20, +/**/ 0x3FC89A0A, 0xACD4E000, +/**/ 0x3D2C0BFB, 0xDA8F5A72, +/**/ 0x3FEA6000, 0x00000000, +/**/ 0x3F30E6DA, 0x7C7EF82B, +/**/ 0x3FC8B46F, 0x82236000, +/**/ 0x3D12D9F2, 0x102DD7C9, +/**/ 0x3FEA6000, 0x00000000, +/**/ 0xBF3A9167, 0x2EC05C44, +/**/ 0x3FC8CECE, 0xE74AE000, +/**/ 0xBD3A5BA0, 0xAA429BB5, +/**/ 0x3FEA5800, 0x00000000, +/**/ 0xBF17DF12, 0xEEB6BD53, +/**/ 0x3FC8E928, 0xDE886000, +/**/ 0x3D3A8154, 0xB13D72D5, +/**/ 0x3FEA5000, 0x00000000, +/**/ 0x3F2D676D, 0x98C70AE6, +/**/ 0x3FC9037D, 0x6A180000, +/**/ 0x3D230DEA, 0x57C1C8D9, +/**/ 0x3FEA5000, 0x00000000, +/**/ 0xBF3C8EFF, 0x96CE4780, +/**/ 0x3FC91DCC, 0x8C340000, +/**/ 0x3D37BC6A, 0xBDDEFF46, +/**/ 0x3FEA4800, 0x00000000, +/**/ 0xBF1EFFCB, 0x71EFFCB7, +/**/ 0x3FC93816, 0x4715A000, +/**/ 0xBD34C63D, 0x6A3A39D9, +/**/ 0x3FEA4000, 0x00000000, +/**/ 0x3F2A41A4, 0x1A41A41A, +/**/ 0x3FC9525A, 0x9CF46000, +/**/ 0xBD329713, 0x7D9F158F, +/**/ 0x3FEA4000, 0x00000000, +/**/ 0xBF3DECBB, 0xBF3B3C0E, +/**/ 0x3FC96C99, 0x9006A000, +/**/ 0x3D2A88D5, 0x9CBB452C, +/**/ 0x3FEA3800, 0x00000000, +/**/ 0xBF21D14E, 0x3BCD35A8, +/**/ 0x3FC986D3, 0x22818000, +/**/ 0x3CF93B56, 0x4DD44000, +/**/ 0x3FEA3000, 0x00000000, +/**/ 0x3F285A0A, 0x3B5832C0, +/**/ 0x3FC9A107, 0x56988000, +/**/ 0x3D264AA6, 0x242CD098, +/**/ 0x3FEA3000, 0x00000000, +/**/ 0xBF3EABC1, 0xD71AFD8C, +/**/ 0x3FC9BB36, 0x2E7E0000, +/**/ 0xBD21F2A8, 0xA1CE0FFC, +/**/ 0x3FEA2800, 0x00000000, +/**/ 0xBF22E60D, 0x7C041611, +/**/ 0x3FC9D55F, 0xAC62E000, +/**/ 0xBD3F4669, 0xFC3B5BC3, +/**/ 0x3FEA2000, 0x00000000, +/**/ 0x3F27AE57, 0x5FF2EF43, +/**/ 0x3FC9EF83, 0xD276A000, +/**/ 0xBD2730B7, 0xB3F9CE00, +/**/ 0x3FEA2000, 0x00000000, +/**/ 0xBF3ECD35, 0x3D66322E, +/**/ 0x3FCA09A2, 0xA2E7A000, +/**/ 0xBD2DD99D, 0xCD411233, +/**/ 0x3FEA1800, 0x00000000, +/**/ 0xBF22C068, 0x5B4FE5E9, +/**/ 0x3FCA23BC, 0x1FE2C000, +/**/ 0xBD3539CD, 0x91DC9F0B, +/**/ 0x3FEA1000, 0x00000000, +/**/ 0x3F283C48, 0x80B67A9A, +/**/ 0x3FCA3DD0, 0x4B938000, +/**/ 0x3D297DA1, 0x366E2C5A, +/**/ 0x3FEA1000, 0x00000000, +/**/ 0xBF3E5236, 0x89907BBA, +/**/ 0x3FCA57DF, 0x28244000, +/**/ 0x3D3B99C8, 0xCA1D9ABB, +/**/ 0x3FEA0800, 0x00000000, +/**/ 0xBF21629E, 0x32054967, +/**/ 0x3FCA71E8, 0xB7BE0000, +/**/ 0xBD210ACA, 0x6EF05323, +/**/ 0x3FEA0000, 0x00000000, +/**/ 0x3F2A01A0, 0x1A01A01A, +/**/ 0x3FCA8BEC, 0xFC882000, +/**/ 0x3D3E3185, 0xCF21B9CF, +/**/ 0x3FEA0000, 0x00000000, +/**/ 0xBF3D3BE3, 0x93FF301D, +/**/ 0x3FCAA5EB, 0xF8A94000, +/**/ 0xBD32A0A9, 0x36951A8F, +/**/ 0x3FE9F800, 0x00000000, +/**/ 0xBF1D9DD1, 0xBFE608ED, +/**/ 0x3FCABFE5, 0xAE462000, +/**/ 0xBD3B68F5, 0x395F139D, +/**/ 0x3FE9F000, 0x00000000, +/**/ 0x3F2CFC26, 0x1B29257F, +/**/ 0x3FCAD9DA, 0x1F828000, +/**/ 0xBD3882B7, 0xC803F050, +/**/ 0x3FE9F000, 0x00000000, +/**/ 0xBF3B8B57, 0x7E613717, +/**/ 0x3FCAF3C9, 0x4E80C000, +/**/ 0xBCBA4E63, 0x3FCD9066, +/**/ 0x3FE9E800, 0x00000000, +/**/ 0xBF160EF9, 0xB9FABD04, +/**/ 0x3FCB0DB3, 0x3D620000, +/**/ 0x3D3FEE14, 0x38EAB906, +/**/ 0x3FE9E000, 0x00000000, +/**/ 0x3F3094D3, 0xEAF850E2, +/**/ 0x3FCB2797, 0xEE464000, +/**/ 0xBD3BE88A, 0x906D00A9, +/**/ 0x3FE9E000, 0x00000000, +/**/ 0xBF3941AA, 0xBBE88FDC, +/**/ 0x3FCB4177, 0x634BA000, +/**/ 0x3D355D01, 0x5666069F, +/**/ 0x3FE9D800, 0x00000000, +/**/ 0xBF083A25, 0x25F4B1AA, +/**/ 0x3FCB5B51, 0x9E8FC000, +/**/ 0xBD34B722, 0xEC011F31, +/**/ 0x3FE9D000, 0x00000000, +/**/ 0x3F3343FB, 0xF71FAC14, +/**/ 0x3FCB7526, 0xA22E4000, +/**/ 0x3D2C0DBF, 0x2E785490, +/**/ 0x3FE9D000, 0x00000000, +/**/ 0xBF365FF3, 0x1965FF32, +/**/ 0x3FCB8EF6, 0x70420000, +/**/ 0x3D387533, 0x321788E0, +/**/ 0x3FE9C800, 0x00000000, +/**/ 0x3EA9C801, 0x9C8019C8, +/**/ 0x3FCBA8C1, 0x0AE46000, +/**/ 0x3D3A32E2, 0x9EEE9D85, +/**/ 0x3FE9C000, 0x00000000, +/**/ 0x3F368A77, 0x25080CE1, +/**/ 0x3FCBC286, 0x742D8000, +/**/ 0x3D39AC53, 0xF39D121C, +/**/ 0x3FE9C000, 0x00000000, +/**/ 0xBF32E743, 0xC54763F2, +/**/ 0x3FCBDC46, 0xAE344000, +/**/ 0x3D3625B4, 0x023D6505, +/**/ 0x3FE9B800, 0x00000000, +/**/ 0x3F0DBD49, 0x8B7424F9, +/**/ 0x3FCBF601, 0xBB0E4000, +/**/ 0x3D2386A9, 0x47C378B5, +/**/ 0x3FE9B000, 0x00000000, +/**/ 0x3F3A6734, 0x00CD9A67, +/**/ 0x3FCC0FB7, 0x9CCFE000, +/**/ 0xBD346FFF, 0x99E8A558, +/**/ 0x3FE9B000, 0x00000000, +/**/ 0xBF2DB15A, 0xAEF25B7C, +/**/ 0x3FCC2968, 0x558C2000, +/**/ 0xBD2CFD73, 0xDEE38A40, +/**/ 0x3FE9A800, 0x00000000, +/**/ 0x3F1FDFEC, 0xC140C073, +/**/ 0x3FCC4313, 0xE754E000, +/**/ 0x3D3279BE, 0x74CAD7D6, +/**/ 0x3FE9A000, 0x00000000, +/**/ 0x3F3ED923, 0xA7DCBEB3, +/**/ 0x3FCC5CBA, 0x543AE000, +/**/ 0x3D20929D, 0xECB454FC, +/**/ 0x3FE9A000, 0x00000000, +/**/ 0xBF246A7B, 0xB256DE2C, +/**/ 0x3FCC765B, 0x9E4D6000, +/**/ 0x3D31AB6B, 0x36976F6C, +/**/ 0x3FE99800, 0x00000000, +/**/ 0x3F299999, 0x9999999A, +/**/ 0x3FCC8FF7, 0xC79AA000, +/**/ 0xBD27794F, 0x689F8434, +/**/ 0x3FE99800, 0x00000000, +/**/ 0xBF3C20C6, 0x3EC03FF3, +/**/ 0x3FCCA98E, 0xD22F6000, +/**/ 0xBCF698C1, 0x8CA209C8, +/**/ 0x3FE99000, 0x00000000, +/**/ 0xBF13F803, 0x31EC07FD, +/**/ 0x3FCCC320, 0xC0176000, +/**/ 0x3D240903, 0x9A653794, +/**/ 0x3FE98800, 0x00000000, +/**/ 0x3F323513, 0x5AC98715, +/**/ 0x3FCCDCAD, 0x935D2000, +/**/ 0xBD0A0FF0, 0x34C9A447, +/**/ 0x3FE98800, 0x00000000, +/**/ 0xBF368793, 0x89F80661, +/**/ 0x3FCCF635, 0x4E09C000, +/**/ 0x3D277123, 0x9A07D55B, +/**/ 0x3FE98000, 0x00000000, +/**/ 0x3EE98019, 0x8019801A, +/**/ 0x3FCD0FB7, 0xF2256000, +/**/ 0xBD0AF52B, 0x20633B29, +/**/ 0x3FE97800, 0x00000000, +/**/ 0x3F382FC6, 0xAB329020, +/**/ 0x3FCD2935, 0x81B6C000, +/**/ 0xBD383270, 0x128AAA5F, +/**/ 0x3FE97800, 0x00000000, +/**/ 0xBF305C4B, 0x962DBFF3, +/**/ 0x3FCD42AD, 0xFEC36000, +/**/ 0xBD175C00, 0xFD804272, +/**/ 0x3FE97000, 0x00000000, +/**/ 0x3F1C9F01, 0x970E4F81, +/**/ 0x3FCD5C21, 0x6B4FC000, +/**/ 0xBD21BA91, 0xBBCA681B, +/**/ 0x3FE96800, 0x00000000, +/**/ 0x3F3EBBE1, 0x049160B8, +/**/ 0x3FCD758F, 0xC95F0000, +/**/ 0xBD15A10A, 0x8B4162AA, +/**/ 0x3FE96800, 0x00000000, +/**/ 0xBF233FE6, 0x9933FE6A, +/**/ 0x3FCD8EF9, 0x1AF32000, +/**/ 0xBD15105F, 0xC364C784, +/**/ 0x3FE96000, 0x00000000, +/**/ 0x3F2C2873, 0xCE078906, +/**/ 0x3FCDA85D, 0x620CE000, +/**/ 0x3D240194, 0xC16CC7EC, +/**/ 0x3FE96000, 0x00000000, +/**/ 0xBF3A27A0, 0xE442936B, +/**/ 0x3FCDC1BC, 0xA0ABE000, +/**/ 0x3D38FAC1, 0xA628CCC6, +/**/ 0x3FE95800, 0x00000000, +/**/ 0xBF029C69, 0x548A97A9, +/**/ 0x3FCDDB16, 0xD8CEA000, +/**/ 0xBD1EEF79, 0x7104B8BC, +/**/ 0x3FE95000, 0x00000000, +/**/ 0x3F35906B, 0x9F74B92D, +/**/ 0x3FCDF46C, 0x0C722000, +/**/ 0x3D3A5E82, 0xB0B79039, +/**/ 0x3FE95000, 0x00000000, +/**/ 0xBF327BBF, 0xF35927BC, +/**/ 0x3FCE0DBC, 0x3D92A000, +/**/ 0x3D359233, 0xF0529BF1, +/**/ 0x3FE94800, 0x00000000, +/**/ 0x3F161F9A, 0xDD3C0CA4, +/**/ 0x3FCE2707, 0x6E2B0000, +/**/ 0xBD3A342C, 0x2AF0003C, +/**/ 0x3FE94000, 0x00000000, +/**/ 0x3F3D9B56, 0x41228A8F, +/**/ 0x3FCE404D, 0xA034C000, +/**/ 0xBD3187EE, 0xE09A2799, +/**/ 0x3FE94000, 0x00000000, +/**/ 0xBF2482F5, 0x598A73F8, +/**/ 0x3FCE598E, 0xD5A88000, +/**/ 0xBD0D134B, 0xCF1E98A1, +/**/ 0x3FE93800, 0x00000000, +/**/ 0x3F2BE2D5, 0x3C1B9728, +/**/ 0x3FCE72CB, 0x107DA000, +/**/ 0x3D1DD48C, 0xCDF5471C, +/**/ 0x3FE93800, 0x00000000, +/**/ 0xBF39CC03, 0x2698CFF3, +/**/ 0x3FCE8C02, 0x52AA6000, +/**/ 0xBD26805B, 0x80E8E6FF, +/**/ 0x3FE93000, 0x00000000, +/**/ 0xBEF79CD3, 0xB9F30358, +/**/ 0x3FCEA534, 0x9E23A000, +/**/ 0x3D381B93, 0x4C73CCB5, +/**/ 0x3FE92800, 0x00000000, +/**/ 0x3F36E803, 0x255BA00D, +/**/ 0x3FCEBE61, 0xF4DD8000, +/**/ 0xBD23D453, 0x30FDCA4D, +/**/ 0x3FE92800, 0x00000000, +/**/ 0xBF30A69B, 0x36077742, +/**/ 0x3FCED78A, 0x58CA8000, +/**/ 0x3D16F1B5, 0x3793387E, +/**/ 0x3FE92000, 0x00000000, +/**/ 0x3F1F693A, 0x1C451AB3, +/**/ 0x3FCEF0AD, 0xCBDC6000, +/**/ 0xBD2B26B7, 0x9C86AF24, +/**/ 0x3FE92000, 0x00000000, +/**/ 0xBF3F9548, 0xC74EA9E2, +/**/ 0x3FCF09CC, 0x50036000, +/**/ 0x3D3DA094, 0x18D999DB, +/**/ 0x3FE91800, 0x00000000, +/**/ 0xBF1BD5A8, 0xF7C46911, +/**/ 0x3FCF22E5, 0xE72F2000, +/**/ 0xBD3F454F, 0x1417E41F, +/**/ 0x3FE91000, 0x00000000, +/**/ 0x3F31B9E1, 0x0D83D1C6, +/**/ 0x3FCF3BFA, 0x934D6000, +/**/ 0x3D2D9F2A, 0x937B903B, +/**/ 0x3FE91000, 0x00000000, +/**/ 0xBF35876F, 0xF3795877, +/**/ 0x3FCF550A, 0x564B8000, +/**/ 0xBD2323E3, 0xA09202FE, +/**/ 0x3FE90800, 0x00000000, +/**/ 0x3F0A34CD, 0xBD1D87EC, +/**/ 0x3FCF6E15, 0x32154000, +/**/ 0xBD3C9A97, 0x7AC4EC74, +/**/ 0x3FE90000, 0x00000000, +/**/ 0x3F3C23F5, 0x0E760899, +/**/ 0x3FCF871B, 0x28956000, +/**/ 0xBD3F75FD, 0x6A526EFE, +/**/ 0x3FE90000, 0x00000000, +/**/ 0xBF25DECD, 0xD0BE9594, +/**/ 0x3FCFA01C, 0x3BB58000, +/**/ 0xBD1A1F71, 0xFAE1D786, +/**/ 0x3FE8F800, 0x00000000, +/**/ 0x3F2C18F9, 0xC18F9C19, +/**/ 0x3FCFB918, 0x6D5E4000, +/**/ 0xBD0D572A, 0xAB993C87, +/**/ 0x3FE8F800, 0x00000000, +/**/ 0xBF38E868, 0x8176594C, +/**/ 0x3FCFD20F, 0xBF770000, +/**/ 0xBD11C55B, 0x72C6FE70, +/**/ 0x3FE8F000, 0x00000000, +/**/ 0x3EC8F006, 0x3C018F00, +/**/ 0x3FCFEB02, 0x33E60000, +/**/ 0x3D2F316E, 0x32D5E8C7, +/**/ 0x3FE8E800, 0x00000000, +/**/ 0x3F395B4D, 0xAD115384, +/**/ 0x3FD001F7, 0xE6484000, +/**/ 0x3D38A957, 0x40C9ABBC, +/**/ 0x3FE8E800, 0x00000000, +/**/ 0xBF2AD850, 0xEC8C0F90, +/**/ 0x3FD00E6C, 0x45AD5000, +/**/ 0x3CDCC68D, 0x52E01203, +/**/ 0x3FE8E000, 0x00000000, +/**/ 0x3F27B6E9, 0xA56B1AA1, +/**/ 0x3FD01ADE, 0x3913A000, +/**/ 0xBD108930, 0xCCDC1521, +/**/ 0x3FE8E000, 0x00000000, +/**/ 0xBF3ACDE3, 0x40DFC1D8, +/**/ 0x3FD0274D, 0xC16C2000, +/**/ 0x3D2979E8, 0x9CF835C2, +/**/ 0x3FE8D800, 0x00000000, +/**/ 0xBEF68397, 0x317DF64C, +/**/ 0x3FD033BA, 0xDFA74000, +/**/ 0x3D0C30BC, 0x1485BDFF, +/**/ 0x3FE8D000, 0x00000000, +/**/ 0x3F380C69, 0x80C6980C, +/**/ 0x3FD04025, 0x94B4D000, +/**/ 0x3CF036B8, 0x9EF42D7F, +/**/ 0x3FE8D000, 0x00000000, +/**/ 0xBF2CE006, 0x338C7FE7, +/**/ 0x3FD04C8D, 0xE1842000, +/**/ 0xBD1FE6BA, 0x512CEB86, +/**/ 0x3FE8C800, 0x00000000, +/**/ 0x3F2644F0, 0x1EFBBD63, +/**/ 0x3FD058F3, 0xC703F000, +/**/ 0xBD30E866, 0xBCD236AD, +/**/ 0x3FE8C800, 0x00000000, +/**/ 0xBF3B3C2D, 0xAA79217A, +/**/ 0x3FD06557, 0x46227000, +/**/ 0x3D0131DF, 0xB4868D6A, +/**/ 0x3FE8C000, 0x00000000, +/**/ 0xBEF8BFCE, 0x8062FF3A, +/**/ 0x3FD071B8, 0x5FCD6000, +/**/ 0xBD3BCB8B, 0xA3E01A11, +/**/ 0x3FE8B800, 0x00000000, +/**/ 0x3F383301, 0xBD2672C4, +/**/ 0x3FD07E17, 0x14F1D000, +/**/ 0xBD3EFCC6, 0x4F384BD5, +/**/ 0x3FE8B800, 0x00000000, +/**/ 0xBF2BFE74, 0x9BFE749C, +/**/ 0x3FD08A73, 0x667C5000, +/**/ 0x3D3EBC1D, 0x40C5A329, +/**/ 0x3FE8B000, 0x00000000, +/**/ 0x3F27BA8C, 0xD4353EB3, +/**/ 0x3FD096CD, 0x55591000, +/**/ 0x3D3F998D, 0x20550A31, +/**/ 0x3FE8B000, 0x00000000, +/**/ 0xBF3A3784, 0xA062B2E4, +/**/ 0x3FD0A324, 0xE2739000, +/**/ 0x3D0C6BEE, 0x7EF4030E, +/**/ 0x3FE8A800, 0x00000000, +/**/ 0xBECED1F6, 0x5E630281, +/**/ 0x3FD0AF7A, 0x0EB6C000, +/**/ 0x3D23CCF9, 0x4945ADAD, +/**/ 0x3FE8A000, 0x00000000, +/**/ 0x3F39CAE0, 0x0C519CAE, +/**/ 0x3FD0BBCC, 0xDB0D2000, +/**/ 0x3D32F32C, 0xCC5DCDFB, +/**/ 0x3FE8A000, 0x00000000, +/**/ 0xBF283C02, 0x4EDBA5FD, +/**/ 0x3FD0C81D, 0x4860B000, +/**/ 0xBD3E5BCF, 0x401D1731, +/**/ 0x3FE89800, 0x00000000, +/**/ 0x3F2C0F60, 0x1899C0F6, +/**/ 0x3FD0D46B, 0x579AB000, +/**/ 0x3D3D2C81, 0xF640E1E6, +/**/ 0x3FE89800, 0x00000000, +/**/ 0xBF37C414, 0xBDBE51D0, +/**/ 0x3FD0E0B7, 0x09A43000, +/**/ 0x3D32A038, 0xA7862F2A, +/**/ 0x3FE89000, 0x00000000, +/**/ 0x3F03F540, 0xDD12CE7D, +/**/ 0x3FD0ED00, 0x5F658000, +/**/ 0xBD22DC75, 0x285AA803, +/**/ 0x3FE88800, 0x00000000, +/**/ 0x3F3CCFDE, 0x400C45CD, +/**/ 0x3FD0F947, 0x59C67000, +/**/ 0xBD395261, 0x7F0818B6, +/**/ 0x3FE88800, 0x00000000, +/**/ 0xBF21A0F5, 0x44FB66B5, +/**/ 0x3FD1058B, 0xF9AE5000, +/**/ 0xBD34AB9D, 0x817D52CD, +/**/ 0x3FE88000, 0x00000000, +/**/ 0x3F319D95, 0x2866A138, +/**/ 0x3FD111CE, 0x4003F000, +/**/ 0xBD1B3237, 0x096B4B6B, +/**/ 0x3FE88000, 0x00000000, +/**/ 0xBF33E5FA, 0xA48B49DA, +/**/ 0x3FD11E0E, 0x2DADA000, +/**/ 0xBD2A47F8, 0x8FCCE5BA, +/**/ 0x3FE87800, 0x00000000, +/**/ 0x3F1A9336, 0xDEECB0A8, +/**/ 0x3FD12A4B, 0xC3912000, +/**/ 0xBD35A750, 0x61473259, +/**/ 0x3FE87800, 0x00000000, +/**/ 0xBF3EC219, 0xFB6A388D, +/**/ 0x3FD13687, 0x0293B000, +/**/ 0xBD3D3E84, 0x99D67123, +/**/ 0x3FE87000, 0x00000000, +/**/ 0xBF106AE7, 0xC1625090, +/**/ 0x3FD142BF, 0xEB9A0000, +/**/ 0x3D31CE61, 0x85B58A9E, +/**/ 0x3FE86800, 0x00000000, +/**/ 0x3F369AE5, 0xACD4200C, +/**/ 0x3FD14EF6, 0x7F887000, +/**/ 0xBD3E97A6, 0x5DFC9794, +/**/ 0x3FE86800, 0x00000000, +/**/ 0xBF2D4286, 0x9389D11C, +/**/ 0x3FD15B2A, 0xBF429000, +/**/ 0xBD2D8E3B, 0x49B629B2, +/**/ 0x3FE86000, 0x00000000, +/**/ 0x3F286186, 0x18618618, +/**/ 0x3FD1675C, 0xABABA000, +/**/ 0x3D38380E, 0x731F55C4, +/**/ 0x3FE86000, 0x00000000, +/**/ 0xBF38EF0F, 0x6AC71708, +/**/ 0x3FD1738C, 0x45A67000, +/**/ 0xBD39C6E9, 0x0032C176, +/**/ 0x3FE85800, 0x00000000, +/**/ 0x3EFFF3D3, 0xE00C2C20, +/**/ 0x3FD17FB9, 0x8E151000, +/**/ 0xBD3A8A8B, 0xA74A2684, +/**/ 0x3FE85000, 0x00000000, +/**/ 0x3F3CFBA0, 0xF9592266, +/**/ 0x3FD18BE4, 0x85D93000, +/**/ 0x3D3C167F, 0x6F3604AB, +/**/ 0x3FE85000, 0x00000000, +/**/ 0xBF1FE7B0, 0xFF3D87FA, +/**/ 0x3FD1980D, 0x2DD42000, +/**/ 0x3D2B7B3A, 0x7A361C9A, +/**/ 0x3FE84800, 0x00000000, +/**/ 0x3F331E8D, 0x918DC223, +/**/ 0x3FD1A433, 0x86E68000, +/**/ 0xBD07A850, 0x634E0AAC, +/**/ 0x3FE84800, 0x00000000, +/**/ 0xBF31BAF9, 0x8D76B549, +/**/ 0x3FD1B057, 0x91F08000, +/**/ 0xBD32DD46, 0x6DC55E2D, +/**/ 0x3FE84000, 0x00000000, +/**/ 0x3F22F2EC, 0xDC90C512, +/**/ 0x3FD1BC79, 0x4FD1D000, +/**/ 0xBD3CCF0C, 0x747BA7BE, +/**/ 0x3FE84000, 0x00000000, +/**/ 0xBF3B442A, 0x6A0916B9, +/**/ 0x3FD1C898, 0xC169A000, +/**/ 0xBD381410, 0xE5C62AFF, +/**/ 0x3FE83800, 0x00000000, +/**/ 0x3EA83801, 0x83801838, +/**/ 0x3FD1D4B5, 0xE796A000, +/**/ 0x3D222A5B, 0xD197BAC2, +/**/ 0x3FE83000, 0x00000000, +/**/ 0x3F3B6A41, 0xCBD11C5C, +/**/ 0x3FD1E0D0, 0xC3371000, +/**/ 0x3D3AF8F2, 0xA9B0D4A0, +/**/ 0x3FE83000, 0x00000000, +/**/ 0xBF225381, 0xCB7A3CD6, +/**/ 0x3FD1ECE9, 0x5528B000, +/**/ 0xBD184E7B, 0x09B4A3B8, +/**/ 0x3FE82800, 0x00000000, +/**/ 0x3F32500C, 0x152500C1, +/**/ 0x3FD1F8FF, 0x9E48A000, +/**/ 0x3D27946C, 0x040CBE77, +/**/ 0x3FE82800, 0x00000000, +/**/ 0xBF32285F, 0x14902134, +/**/ 0x3FD20513, 0x9F73B000, +/**/ 0x3CF6E15E, 0x1609E0A4, +/**/ 0x3FE82000, 0x00000000, +/**/ 0x3F22D9EB, 0xA4018213, +/**/ 0x3FD21125, 0x59861000, +/**/ 0x3D382E78, 0xBA2950C4, +/**/ 0x3FE82000, 0x00000000, +/**/ 0xBF3AEFFC, 0xFC6BBFF4, +/**/ 0x3FD21D34, 0xCD5B9000, +/**/ 0x3D3B552F, 0xB28BADAA, +/**/ 0x3FE81800, 0x00000000, +/**/ 0x3EE81818, 0x18181818, +/**/ 0x3FD22941, 0xFBCF8000, +/**/ 0xBD3A6976, 0xF5EB0963, +/**/ 0x3FE81000, 0x00000000, +/**/ 0x3F3C7F27, 0x4FF0F3C6, +/**/ 0x3FD2354C, 0xE5BC9000, +/**/ 0xBD3D78ED, 0x0602A663, +/**/ 0x3FE81000, 0x00000000, +/**/ 0xBF1ED344, 0x0A86941D, +/**/ 0x3FD24155, 0x8BFD1000, +/**/ 0x3D300FFF, 0x3228FCAD, +/**/ 0x3FE80800, 0x00000000, +/**/ 0x3F3424D0, 0x1B0BD52D, +/**/ 0x3FD24D5B, 0xEF6AF000, +/**/ 0xBCBDD780, 0xFC9FABDD, +/**/ 0x3FE80800, 0x00000000, +/**/ 0xBF2FE7F9, 0xFE7F9FE8, +/**/ 0x3FD25960, 0x10DF7000, +/**/ 0x3D38E7BC, 0x224EA3E3, +/**/ 0x3FE80000, 0x00000000, +/**/ 0x3F280180, 0x18018018, +/**/ 0x3FD26561, 0xF1338000, +/**/ 0x3D38B488, 0x66FAA45F, +/**/ 0x3FE80000, 0x00000000, +/**/ 0xBF37FD00, 0x5FF40180, +/**/ 0x3FD27161, 0x913F8000, +/**/ 0x3D34F4F1, 0xF61564B4, +/**/ 0x3FE7F800, 0x00000000, +/**/ 0x3F104AE8, 0x9750B6C7, +/**/ 0x3FD27D5E, 0xF1DB6000, +/**/ 0xBD092374, 0x78CAC9F4, +/**/ 0x3FE7F800, 0x00000000, +/**/ 0xBF3FD017, 0xF405FD01, +/**/ 0x3FD2895A, 0x13DE8000, +/**/ 0x3D3A8D7A, 0xD24C13F0, +/**/ 0x3FE7F000, 0x00000000, +/**/ 0xBF0D2BF1, 0xC9C5485E, +/**/ 0x3FD29552, 0xF81FF000, +/**/ 0x3D348D30, 0x1771C408, +/**/ 0x3FE7E800, 0x00000000, +/**/ 0x3F38927F, 0xD029DB60, +/**/ 0x3FD2A149, 0x9F763000, +/**/ 0xBD30DBBF, 0x51F3AADC, +/**/ 0x3FE7E800, 0x00000000, +/**/ 0xBF26504A, 0xB0A45169, +/**/ 0x3FD2AD3E, 0x0AB73000, +/**/ 0x3D2B972E, 0x488C359F, +/**/ 0x3FE7E000, 0x00000000, +/**/ 0x3F312A8A, 0xD278E8DD, +/**/ 0x3FD2B930, 0x3AB8A000, +/**/ 0xBD26DB12, 0xD6BFB0A5, +/**/ 0x3FE7E000, 0x00000000, +/**/ 0xBF327577, 0x24BB32E7, +/**/ 0x3FD2C520, 0x304F8000, +/**/ 0x3D230852, 0x8C342F39, +/**/ 0x3FE7D800, 0x00000000, +/**/ 0x3F23EF9A, 0xA4B45AEC, +/**/ 0x3FD2D10D, 0xEC508000, +/**/ 0x3D360C61, 0xF7088353, +/**/ 0x3FE7D800, 0x00000000, +/**/ 0xBF398DAF, 0x32748CC1, +/**/ 0x3FD2DCF9, 0x6F8FD000, +/**/ 0x3D20B4A2, 0x8E33C9CE, +/**/ 0x3FE7D000, 0x00000000, +/**/ 0x3F07D05F, 0x417D05F4, +/**/ 0x3FD2E8E2, 0xBAE12000, +/**/ 0xBD267B1E, 0x99B72BD8, +/**/ 0x3FE7C800, 0x00000000, +/**/ 0x3F3F8EF7, 0x431D3027, +/**/ 0x3FD2F4C9, 0xCF17A000, +/**/ 0x3D371F04, 0x9374B87B, +/**/ 0x3FE7C800, 0x00000000, +/**/ 0xBF0E77A3, 0xDAD83E6C, +/**/ 0x3FD300AE, 0xAD063000, +/**/ 0x3D342F56, 0x8B75FCAC, +/**/ 0x3FE7C000, 0x00000000, +/**/ 0x3F38E041, 0x588D1676, +/**/ 0x3FD30C91, 0x557F2000, +/**/ 0xBD142958, 0xA1451755, +/**/ 0x3FE7C000, 0x00000000, +/**/ 0xBF24C6DD, 0x1FE8414C, +/**/ 0x3FD31871, 0xC9544000, +/**/ 0x3D184FAB, 0x94CECFD9, +/**/ 0x3FE7B800, 0x00000000, +/**/ 0x3F3265F4, 0x81C2D3B2, +/**/ 0x3FD32450, 0x09570000, +/**/ 0x3D3D271B, 0x9BDAE59D, +/**/ 0x3FE7B800, 0x00000000, +/**/ 0xBF30C39C, 0xB6466407, +/**/ 0x3FD3302C, 0x16586000, +/**/ 0x3D36217D, 0xC2A3E08B, +/**/ 0x3FE7B000, 0x00000000, +/**/ 0x3F283FAD, 0x12B21224, +/**/ 0x3FD33C05, 0xF128E000, +/**/ 0xBD22B906, 0x380E1A7D, +/**/ 0x3FE7B000, 0x00000000, +/**/ 0xBF36EFB8, 0xF899E55D, +/**/ 0x3FD347DD, 0x9A988000, +/**/ 0xBD25594D, 0xD4C58092, +/**/ 0x3FE7A800, 0x00000000, +/**/ 0x3F1836B6, 0x3FF42B9F, +/**/ 0x3FD353B3, 0x1376E000, +/**/ 0xBD1331AF, 0xE6C26D9B, +/**/ 0x3FE7A800, 0x00000000, +/**/ 0xBF3CE7FD, 0x0B739FF4, +/**/ 0x3FD35F86, 0x5C933000, +/**/ 0xBD3B07DE, 0x4EA1A54A, +/**/ 0x3FE7A000, 0x00000000, +/**/ 0x3EC7A005, 0xE8017A00, +/**/ 0x3FD36B57, 0x76BC1000, +/**/ 0x3D116978, 0x5A9C223F, +/**/ 0x3FE79800, 0x00000000, +/**/ 0x3F3D535D, 0xB1CC5B7B, +/**/ 0x3FD37726, 0x62BFE000, +/**/ 0xBD3E9436, 0xAC53B023, +/**/ 0x3FE79800, 0x00000000, +/**/ 0xBF15EEAC, 0xE0DA37A9, +/**/ 0x3FD382F3, 0x216C5000, +/**/ 0xBD1061D2, 0x1D1A7F6D, +/**/ 0x3FE79000, 0x00000000, +/**/ 0x3F37C21E, 0x344E16D6, +/**/ 0x3FD38EBD, 0xB38ED000, +/**/ 0x3D290582, 0xE67D4CA0, +/**/ 0x3FE79000, 0x00000000, +/**/ 0xBF25E69A, 0x39C9E465, +/**/ 0x3FD39A86, 0x19F45000, +/**/ 0x3D18EE51, 0x937354F5, +/**/ 0x3FE78800, 0x00000000, +/**/ 0x3F32640B, 0xC52640BC, +/**/ 0x3FD3A64C, 0x55694000, +/**/ 0x3D37A71C, 0xBCD735D0, +/**/ 0x3FE78800, 0x00000000, +/**/ 0xBF3037DE, 0x2F6A09ED, +/**/ 0x3FD3B210, 0x66B9C000, +/**/ 0xBD33C1ED, 0x9811560E, +/**/ 0x3FE78000, 0x00000000, +/**/ 0x3F2A71DC, 0x01781A72, +/**/ 0x3FD3BDD2, 0x4EB15000, +/**/ 0xBD3257B4, 0x970E6ED9, +/**/ 0x3FE78000, 0x00000000, +/**/ 0xBF354996, 0xA9EEBFF4, +/**/ 0x3FD3C992, 0x0E1B2000, +/**/ 0x3D141C28, 0xAA680B76, +/**/ 0x3FE77800, 0x00000000, +/**/ 0x3F208119, 0xAC60D341, +/**/ 0x3FD3D54F, 0xA5C1F000, +/**/ 0x3D3C3E1C, 0xD9A395E3, +/**/ 0x3FE77800, 0x00000000, +/**/ 0xBF3A28AE, 0x742E2DD0, +/**/ 0x3FD3E10B, 0x16701000, +/**/ 0x3D3F3BCF, 0x145429C7, +/**/ 0x3FE77000, 0x00000000, +/**/ 0x3F0BD584, 0x36340177, +/**/ 0x3FD3ECC4, 0x60EF6000, +/**/ 0xBD060286, 0x27C1300F, +/**/ 0x3FE77000, 0x00000000, +/**/ 0xBF3ED55D, 0x240C7174, +/**/ 0x3FD3F87B, 0x86094000, +/**/ 0xBD35DFD7, 0x54589889, +/**/ 0x3FE76800, 0x00000000, +/**/ 0xBEF18DE5, 0xAB277F45, +/**/ 0x3FD40430, 0x8686A000, +/**/ 0x3D3F8EF4, 0x3049F7D3, +/**/ 0x3FE76000, 0x00000000, +/**/ 0x3F3CB026, 0x01D3C7B8, +/**/ 0x3FD40FE3, 0x63303000, +/**/ 0x3D3E5C5F, 0xE79F05C6, +/**/ 0x3FE76000, 0x00000000, +/**/ 0xBF15E95B, 0xA9D08664, +/**/ 0x3FD41B94, 0x1CCE1000, +/**/ 0xBD304690, 0x13E43FC9, +/**/ 0x3FE75800, 0x00000000, +/**/ 0x3F3867A4, 0x097CFD43, +/**/ 0x3FD42742, 0xB427E000, +/**/ 0xBD398727, 0x02B82675, +/**/ 0x3FE75800, 0x00000000, +/**/ 0xBF2353DF, 0xE8A9353E, +/**/ 0x3FD432EF, 0x2A04F000, +/**/ 0xBD3FB129, 0x931715AD, +/**/ 0x3FE75000, 0x00000000, +/**/ 0x3F3450E6, 0x4F13DC4A, +/**/ 0x3FD43E99, 0x7F2C1000, +/**/ 0x3D1C3F72, 0x40C41A04, +/**/ 0x3FE75000, 0x00000000, +/**/ 0xBF2B4FBF, 0xE8B1B4FC, +/**/ 0x3FD44A41, 0xB463C000, +/**/ 0x3D31EE28, 0xF37CF612, +/**/ 0x3FE74800, 0x00000000, +/**/ 0x3F306BB6, 0x7E458100, +/**/ 0x3FD455E7, 0xCA720000, +/**/ 0x3D1AD8C6, 0x36629AED, +/**/ 0x3FE74800, 0x00000000, +/**/ 0xBF31745D, 0x1745D174, +/**/ 0x3FD4618B, 0xC21C6000, +/**/ 0xBD13D82F, 0x484C84CC, +/**/ 0x3FE74000, 0x00000000, +/**/ 0x3F296FBD, 0x236DEC04, +/**/ 0x3FD46D2D, 0x9C280000, +/**/ 0x3D359B27, 0x5F67F75A, +/**/ 0x3FE74000, 0x00000000, +/**/ 0xBF350F9D, 0x3B304B87, +/**/ 0x3FD478CD, 0x5959B000, +/**/ 0x3D2EC89B, 0xF0C8D098, +/**/ 0x3FE73800, 0x00000000, +/**/ 0x3F226A51, 0xA4EBDC70, +/**/ 0x3FD4846A, 0xFA75C000, +/**/ 0xBD263EA2, 0xE3798DCE, +/**/ 0x3FE73800, 0x00000000, +/**/ 0xBF3879D5, 0xF00B9A78, +/**/ 0x3FD49006, 0x80401000, +/**/ 0xBD38BCCF, 0xFE1A0F8C, +/**/ 0x3FE73000, 0x00000000, +/**/ 0x3F178D7F, 0x5DAAD90C, +/**/ 0x3FD49B9F, 0xEB7C1000, +/**/ 0x3D3DAC1C, 0x58AB60D7, +/**/ 0x3FE73000, 0x00000000, +/**/ 0xBF3BB33C, 0x783709C7, +/**/ 0x3FD4A737, 0x3CED0000, +/**/ 0xBD39A234, 0xEBF35449, +/**/ 0x3FE72800, 0x00000000, +/**/ 0x3F061274, 0x265AD23A, +/**/ 0x3FD4B2CC, 0x75556000, +/**/ 0xBD380FCB, 0xC78BFA4B, +/**/ 0x3FE72800, 0x00000000, +/**/ 0xBF3EBC05, 0xC90A1FD2, +/**/ 0x3FD4BE5F, 0x95778000, +/**/ 0xBD3D7C92, 0xCD9AD824, +/**/ 0x3FE72000, 0x00000000, +/**/ 0xBEC71FFA, 0x38017200, +/**/ 0x3FD4C9F0, 0x9E153000, +/**/ 0xBD2E1DDE, 0x70E02DE0, +/**/ 0x3FE71800, 0x00000000, +/**/ 0x3F3E6B99, 0x74A050E1, +/**/ 0x3FD4D57F, 0x8FEFE000, +/**/ 0x3D23F926, 0x7FD06868, +/**/ 0x3FE71800, 0x00000000, +/**/ 0xBF077400, 0xB8BD1180, +/**/ 0x3FD4E10C, 0x6BC8A000, +/**/ 0x3CF8283F, 0x1636F061, +/**/ 0x3FE71000, 0x00000000, +/**/ 0x3F3BC36C, 0xE3E0453A, +/**/ 0x3FD4EC97, 0x32600000, +/**/ 0x3D234D7A, 0xAF04D104, +/**/ 0x3FE71000, 0x00000000, +/**/ 0xBF15FA98, 0x6935DDC5, +/**/ 0x3FD4F81F, 0xE4764000, +/**/ 0xBD27FCF6, 0x434FF08D, +/**/ 0x3FE70800, 0x00000000, +/**/ 0x3F394B40, 0x7337CF08, +/**/ 0x3FD503A6, 0x82CB2000, +/**/ 0xBD2A68C8, 0xF16F9B5D, +/**/ 0x3FE70800, 0x00000000, +/**/ 0xBF1F7B97, 0xA835403A, +/**/ 0x3FD50F2B, 0x0E1E0000, +/**/ 0x3D3A0940, 0x8C47B8D8, +/**/ 0x3FE70000, 0x00000000, +/**/ 0x3F3702E0, 0x5C0B8170, +/**/ 0x3FD51AAD, 0x872E0000, +/**/ 0xBD3F4BD8, 0xDB0A7CC1, +/**/ 0x3FE70000, 0x00000000, +/**/ 0xBF241EE6, 0x4F67A855, +/**/ 0x3FD5262D, 0xEEB99000, +/**/ 0xBD3E1B9F, 0x70894A01, +/**/ 0x3FE6F800, 0x00000000, +/**/ 0x3F34EA19, 0x221C0170, +/**/ 0x3FD531AC, 0x457EE000, +/**/ 0x3D3DF83B, 0x7D931501, +/**/ 0x3FE6F800, 0x00000000, +/**/ 0xBF282102, 0x5508CA5C, +/**/ 0x3FD53D28, 0x8C3BE000, +/**/ 0xBD111397, 0xEB6DFAC5, +/**/ 0x3FE6F000, 0x00000000, +/**/ 0x3F3300B7, 0x9300B793, +/**/ 0x3FD548A2, 0xC3ADD000, +/**/ 0x3D23167E, 0x63081CF7, +/**/ 0x3FE6F000, 0x00000000, +/**/ 0xBF2BC486, 0x005BB90F, +/**/ 0x3FD5541A, 0xEC91C000, +/**/ 0xBCF816AA, 0xDC72EEBA, +/**/ 0x3FE6E800, 0x00000000, +/**/ 0x3F314688, 0xC5A3A00B, +/**/ 0x3FD55F91, 0x07A44000, +/**/ 0xBD11E647, 0x78DF4A62, +/**/ 0x3FE6E800, 0x00000000, +/**/ 0xBF2F09D6, 0xDA9C5AE1, +/**/ 0x3FD56B05, 0x15A18000, +/**/ 0x3D29247B, 0xBC4A23FC, +/**/ 0x3FE6E000, 0x00000000, +/**/ 0x3F2F76B4, 0x337C6CB1, +/**/ 0x3FD57677, 0x17456000, +/**/ 0xBD364EAD, 0x9524D7CA, +/**/ 0x3FE6E000, 0x00000000, +/**/ 0xBF30F8AC, 0xEDF4EC87, +/**/ 0x3FD581E7, 0x0D4B3000, +/**/ 0xBD1F31E1, 0xB12D8F1D, +/**/ 0x3FE6D800, 0x00000000, +/**/ 0x3F2CBDF2, 0x6EAEF381, +/**/ 0x3FD58D54, 0xF86E0000, +/**/ 0x3D2791F3, 0x0A795215, +/**/ 0x3FE6D800, 0x00000000, +/**/ 0xBF323DB9, 0xB624BFF5, +/**/ 0x3FD598C0, 0xD9688000, +/**/ 0xBD385F49, 0x70D96DA4, +/**/ 0x3FE6D000, 0x00000000, +/**/ 0x3F2A6268, 0x1C860FB0, +/**/ 0x3FD5A42A, 0xB0F4D000, +/**/ 0xBCDE63AF, 0x2DF7BA69, +/**/ 0x3FE6D000, 0x00000000, +/**/ 0xBF335443, 0xB253BAE1, +/**/ 0x3FD5AF92, 0x7FCCE000, +/**/ 0xBD1C032F, 0xF5FFC77A, +/**/ 0x3FE6C800, 0x00000000, +/**/ 0x3F2863B1, 0xAB4294D4, +/**/ 0x3FD5BAF8, 0x46AA2000, +/**/ 0xBD339AE8, 0xF873FA41, +/**/ 0x3FE6C800, 0x00000000, +/**/ 0xBF343C7C, 0x87EAA6DF, +/**/ 0x3FD5C65C, 0x0645A000, +/**/ 0xBD39FE06, 0x0180EE65, +/**/ 0x3FE6C000, 0x00000000, +/**/ 0x3F26C16C, 0x16C16C17, +/**/ 0x3FD5D1BD, 0xBF581000, +/**/ 0xBD38D6BD, 0xC9C7C238, +/**/ 0x3FE6C000, 0x00000000, +/**/ 0xBF34F695, 0x95C33E00, +/**/ 0x3FD5DD1D, 0x7299C000, +/**/ 0xBD38AF61, 0x8815CE17, +/**/ 0x3FE6B800, 0x00000000, +/**/ 0x3F257B34, 0xE7802D73, +/**/ 0x3FD5E87B, 0x20C29000, +/**/ 0x3D3527D1, 0x8F7738FA, +/**/ 0x3FE6B800, 0x00000000, +/**/ 0xBF3582BF, 0xF4A5582C, +/**/ 0x3FD5F3D6, 0xCA8A2000, +/**/ 0x3D37AF84, 0x8E19CC75, +/**/ 0x3FE6B000, 0x00000000, +/**/ 0x3F2490AA, 0x31A3CFC7, +/**/ 0x3FD5FF30, 0x70A79000, +/**/ 0x3D2E9E43, 0x9F105039, +/**/ 0x3FE6B000, 0x00000000, +/**/ 0xBF35E12C, 0x77C30E5A, +/**/ 0x3FD60A88, 0x13D1A000, +/**/ 0x3D36E9B9, 0xC879AF55, +/**/ 0x3FE6A800, 0x00000000, +/**/ 0x3F24016A, 0x94016A94, +/**/ 0x3FD615DD, 0xB4BEC000, +/**/ 0x3D13C7CA, 0x90BC04B2, +/**/ 0x3FE6A800, 0x00000000, +/**/ 0xBF36120B, 0xAD33D63F, +/**/ 0x3FD62131, 0x5424F000, +/**/ 0xBD3382FC, 0x4AA68669, +/**/ 0x3FE6A000, 0x00000000, +/**/ 0x3F23CD15, 0x3729043E, +/**/ 0x3FD62C82, 0xF2B9C000, +/**/ 0x3D3E54BD, 0xBD7C8A98 } }; + +static const union {int4 i[4350]; double x[2175]; } vj = { .i = { +/**/ 0x3F46A400, 0x7D161C28, +/**/ 0xBF46A200, 0x20600000, +/**/ 0x3D27DC4E, 0xAA7623D9, +/**/ 0x3F4693FA, 0xD596E639, +/**/ 0xBF4691FD, 0x4CE00000, +/**/ 0x3D26B0CF, 0x29C3F0AD, +/**/ 0x3F4683F5, 0x3219CE89, +/**/ 0xBF4681FA, 0x7B600000, +/**/ 0x3D22B290, 0x95B9FDCC, +/**/ 0x3F4673EF, 0x929ED397, +/**/ 0xBF4671F7, 0xABE00000, +/**/ 0x3D17C727, 0xFA2F2D87, +/**/ 0x3F4663E9, 0xF725F3E2, +/**/ 0xBF4661F4, 0xDE600000, +/**/ 0x3CF22ED3, 0x6EDBFF1C, +/**/ 0x3F4653E4, 0x5FAF2DE9, +/**/ 0xBF4651F2, 0x12E00000, +/**/ 0xBD144936, 0x157812BB, +/**/ 0x3F4643DE, 0xCC3A802B, +/**/ 0xBF4641EF, 0x49600000, +/**/ 0xBD2959CB, 0x60314E05, +/**/ 0x3F4633D9, 0x3CC7E927, +/**/ 0xBF4631EC, 0x81E00000, +/**/ 0xBD35ABDA, 0xC3638E99, +/**/ 0x3F4623D3, 0xB157675C, +/**/ 0xBF4621E9, 0xBC800000, +/**/ 0x3D3FF1D3, 0xC63F9A21, +/**/ 0x3F4613CE, 0x29E8F948, +/**/ 0xBF4611E6, 0xF9000000, +/**/ 0x3D342D26, 0x71EEE611, +/**/ 0x3F4603C8, 0xA67C9D6B, +/**/ 0xBF4601E4, 0x37800000, +/**/ 0x3D1C1C77, 0x11A09689, +/**/ 0x3F45F3C3, 0x27125244, +/**/ 0xBF45F1E1, 0x78000000, +/**/ 0xBD1DFD16, 0xF7DC643C, +/**/ 0x3F45E3BD, 0xABAA1651, +/**/ 0xBF45E1DE, 0xBA800000, +/**/ 0xBD376503, 0x91318A02, +/**/ 0x3F45D3B8, 0x3443E812, +/**/ 0xBF45D1DB, 0xFF200000, +/**/ 0x3D3756E4, 0xCE55DCDD, +/**/ 0x3F45C3B2, 0xC0DFC606, +/**/ 0xBF45C1D9, 0x45A00000, +/**/ 0x3D12D5CF, 0x8F6F8FA0, +/**/ 0x3F45B3AD, 0x517DAEAB, +/**/ 0xBF45B1D6, 0x8E200000, +/**/ 0xBD2E90AB, 0x9B85DC2C, +/**/ 0x3F45A3A7, 0xE61DA081, +/**/ 0xBF45A1D3, 0xD8C00000, +/**/ 0x3D3B5E88, 0x3BF5AC54, +/**/ 0x3F4593A2, 0x7EBF9A07, +/**/ 0xBF4591D1, 0x25400000, +/**/ 0x3D12AC3A, 0x0C86DDB1, +/**/ 0x3F45839D, 0x1B6399BB, +/**/ 0xBF4581CE, 0x73C00000, +/**/ 0xBD3361C2, 0x76830985, +/**/ 0x3F457397, 0xBC099E1C, +/**/ 0xBF4571CB, 0xC4600000, +/**/ 0x3D333915, 0xD062EBFF, +/**/ 0x3F456392, 0x60B1A5AA, +/**/ 0xBF4561C9, 0x16E00000, +/**/ 0xBD1E0DA0, 0x9CC4988F, +/**/ 0x3F45538D, 0x095BAEE4, +/**/ 0xBF4551C6, 0x6B800000, +/**/ 0x3D3C69C4, 0x235BC18A, +/**/ 0x3F454387, 0xB607B848, +/**/ 0xBF4541C3, 0xC2000000, +/**/ 0xBCEFCC99, 0xF7737723, +/**/ 0x3F453382, 0x66B5C056, +/**/ 0xBF4531C1, 0x1A800000, +/**/ 0xBD3FBAE2, 0x809CBCBB, +/**/ 0x3F45237D, 0x1B65C58C, +/**/ 0xBF4521BE, 0x75200000, +/**/ 0x3CCAA5C8, 0x194FEE63, +/**/ 0x3F451377, 0xD417C66A, +/**/ 0xBF4511BB, 0xD1C00000, +/**/ 0x3D3ED325, 0xE1CC7BBC, +/**/ 0x3F450372, 0x90CBC16E, +/**/ 0xBF4501B9, 0x30400000, +/**/ 0xBD0F0298, 0x68AB3742, +/**/ 0x3F44F36D, 0x5181B517, +/**/ 0xBF44F1B6, 0x90E00000, +/**/ 0x3D381BE1, 0x41E67AD9, +/**/ 0x3F44E368, 0x16399FE6, +/**/ 0xBF44E1B3, 0xF3600000, +/**/ 0xBD2A6E79, 0x668D3662, +/**/ 0x3F44D362, 0xDEF38058, +/**/ 0xBF44D1B1, 0x58000000, +/**/ 0x3D284EA7, 0x21F8B7C2, +/**/ 0x3F44C35D, 0xABAF54EC, +/**/ 0xBF44C1AE, 0xBE800000, +/**/ 0xBD3BC76D, 0x7417D9C5, +/**/ 0x3F44B358, 0x7C6D1C22, +/**/ 0xBF44B1AC, 0x27200000, +/**/ 0xBD1409FD, 0x16AAD1FC, +/**/ 0x3F44A353, 0x512CD479, +/**/ 0xBF44A1A9, 0x91C00000, +/**/ 0x3D30771E, 0x98BC14FD, +/**/ 0x3F44934E, 0x29EE7C70, +/**/ 0xBF4491A6, 0xFE400000, +/**/ 0xBD3B5993, 0x5CCB7232, +/**/ 0x3F448349, 0x06B21285, +/**/ 0xBF4481A4, 0x6CE00000, +/**/ 0xBD20E729, 0x5512F9C2, +/**/ 0x3F447343, 0xE7779538, +/**/ 0xBF4471A1, 0xDD800000, +/**/ 0x3D225436, 0x55B30899, +/**/ 0x3F44633E, 0xCC3F0308, +/**/ 0xBF44619F, 0x50200000, +/**/ 0x3D39807C, 0x9E54E31F, +/**/ 0x3F445339, 0xB5085A73, +/**/ 0xBF44519C, 0xC4A00000, +/**/ 0xBD376F6F, 0xD5804C0E, +/**/ 0x3F444334, 0xA1D399FA, +/**/ 0xBF44419A, 0x3B400000, +/**/ 0xBD234953, 0x6CDE6425, +/**/ 0x3F44332F, 0x92A0C01A, +/**/ 0xBF443197, 0xB3E00000, +/**/ 0x3D070E7B, 0xAAF6596F, +/**/ 0x3F44232A, 0x876FCB54, +/**/ 0xBF442195, 0x2E800000, +/**/ 0x3D2C49F8, 0x4EC011F1, +/**/ 0x3F441325, 0x8040BA25, +/**/ 0xBF441192, 0xAB200000, +/**/ 0x3D3825DC, 0xD8AAA7EB, +/**/ 0x3F440320, 0x7D138B0E, +/**/ 0xBF440190, 0x29A00000, +/**/ 0xBD3F1A8D, 0xFE0B73D6, +/**/ 0x3F43F31B, 0x7DE83C8C, +/**/ 0xBF43F18D, 0xAA400000, +/**/ 0xBD379B43, 0xE46CA26B, +/**/ 0x3F43E316, 0x82BECD20, +/**/ 0xBF43E18B, 0x2CE00000, +/**/ 0xBD315B44, 0x6283780D, +/**/ 0x3F43D311, 0x8B973B49, +/**/ 0xBF43D188, 0xB1800000, +/**/ 0xBD28B31E, 0x017589BE, +/**/ 0x3F43C30C, 0x98718584, +/**/ 0xBF43C186, 0x38200000, +/**/ 0xBD212A46, 0x8FBB296E, +/**/ 0x3F43B307, 0xA94DAA52, +/**/ 0xBF43B183, 0xC0C00000, +/**/ 0xBD183403, 0x045CBBD2, +/**/ 0x3F43A302, 0xBE2BA832, +/**/ 0xBF43A181, 0x4B600000, +/**/ 0xBD13009B, 0xD7CC5936, +/**/ 0x3F4392FD, 0xD70B7DA2, +/**/ 0xBF43917E, 0xD8000000, +/**/ 0xBD12B655, 0xC1742279, +/**/ 0x3F4382F8, 0xF3ED2921, +/**/ 0xBF43817C, 0x66A00000, +/**/ 0xBD17512E, 0xEA83FAE8, +/**/ 0x3F4372F4, 0x14D0A930, +/**/ 0xBF437179, 0xF7400000, +/**/ 0xBD206692, 0xBED65875, +/**/ 0x3F4362EF, 0x39B5FC4C, +/**/ 0xBF436177, 0x89E00000, +/**/ 0xBD27931B, 0xD38FFE9E, +/**/ 0x3F4352EA, 0x629D20F5, +/**/ 0xBF435175, 0x1E800000, +/**/ 0xBD309618, 0xE524208F, +/**/ 0x3F4342E5, 0x8F8615AA, +/**/ 0xBF434172, 0xB5200000, +/**/ 0xBD3697E9, 0xDD4C72C5, +/**/ 0x3F4332E0, 0xC070D8EB, +/**/ 0xBF433170, 0x4DC00000, +/**/ 0xBD3DCE00, 0x5E6E12C3, +/**/ 0x3F4322DB, 0xF55D6935, +/**/ 0xBF43216D, 0xE8800000, +/**/ 0x3D39C8A4, 0x0AE9A8CE, +/**/ 0x3F4312D7, 0x2E4BC509, +/**/ 0xBF43116B, 0x85200000, +/**/ 0x3D302D03, 0xD1CD2FA1, +/**/ 0x3F4302D2, 0x6B3BEAE5, +/**/ 0xBF430169, 0x23C00000, +/**/ 0x3D15807D, 0xA3BADFD1, +/**/ 0x3F42F2CD, 0xAC2DD949, +/**/ 0xBF42F166, 0xC4600000, +/**/ 0xBD1A7422, 0xF57F0504, +/**/ 0x3F42E2C8, 0xF1218EB3, +/**/ 0xBF42E164, 0x67000000, +/**/ 0xBD33C974, 0x2F2C781C, +/**/ 0x3F42D2C4, 0x3A1709A3, +/**/ 0xBF42D162, 0x0BC00000, +/**/ 0x3D3DDBDD, 0x851A1E61, +/**/ 0x3F42C2BF, 0x870E4898, +/**/ 0xBF42C15F, 0xB2600000, +/**/ 0x3D2CA7D9, 0xA14AA8FD, +/**/ 0x3F42B2BA, 0xD8074A10, +/**/ 0xBF42B15D, 0x5B000000, +/**/ 0xBD03022E, 0xDDCDDFF5, +/**/ 0x3F42A2B6, 0x2D020C8C, +/**/ 0xBF42A15B, 0x05A00000, +/**/ 0xBD343FBA, 0x0F9231A8, +/**/ 0x3F4292B1, 0x85FE8E8A, +/**/ 0xBF429158, 0xB2600000, +/**/ 0x3D38B690, 0xA52C9CCF, +/**/ 0x3F4282AC, 0xE2FCCE8A, +/**/ 0xBF428156, 0x61000000, +/**/ 0x3D120E6A, 0xC8CC82EB, +/**/ 0x3F4272A8, 0x43FCCB0A, +/**/ 0xBF427154, 0x11A00000, +/**/ 0xBD30D79B, 0x792E6C51, +/**/ 0x3F4262A3, 0xA8FE8289, +/**/ 0xBF426151, 0xC4600000, +/**/ 0x3D38A5EE, 0x91F7F7AA, +/**/ 0x3F42529F, 0x1201F387, +/**/ 0xBF42514F, 0x79000000, +/**/ 0x3CEFA728, 0x46C2E8BA, +/**/ 0x3F42429A, 0x7F071C84, +/**/ 0xBF42414D, 0x2FA00000, +/**/ 0xBD37D0BA, 0xFA447A17, +/**/ 0x3F423295, 0xF00DFBFD, +/**/ 0xBF42314A, 0xE8600000, +/**/ 0x3D2C7A24, 0x94AF3FED, +/**/ 0x3F422291, 0x65169072, +/**/ 0xBF422148, 0xA3000000, +/**/ 0xBD29B0BD, 0x050CEA04, +/**/ 0x3F42128C, 0xDE20D863, +/**/ 0xBF421146, 0x5FC00000, +/**/ 0x3D36EFF3, 0x0C3035EB, +/**/ 0x3F420288, 0x5B2CD24E, +/**/ 0xBF420144, 0x1E600000, +/**/ 0xBD19A3E2, 0x73569B27, +/**/ 0x3F41F283, 0xDC3A7CB2, +/**/ 0xBF41F141, 0xDF200000, +/**/ 0x3D3B1DDE, 0xEEB67715, +/**/ 0x3F41E27F, 0x6149D610, +/**/ 0xBF41E13F, 0xA1C00000, +/**/ 0xBD11EA17, 0x94F49154, +/**/ 0x3F41D27A, 0xEA5ADCE5, +/**/ 0xBF41D13D, 0x66800000, +/**/ 0x3D3ACED9, 0x52DD9D37, +/**/ 0x3F41C276, 0x776D8FB1, +/**/ 0xBF41C13B, 0x2D200000, +/**/ 0xBD1C140B, 0xF72D8EEB, +/**/ 0x3F41B272, 0x0881ECF4, +/**/ 0xBF41B138, 0xF5E00000, +/**/ 0x3D360AE5, 0x939583E1, +/**/ 0x3F41A26D, 0x9D97F32C, +/**/ 0xBF41A136, 0xC0800000, +/**/ 0xBD2C00D9, 0x1D246C7C, +/**/ 0x3F419269, 0x36AFA0D9, +/**/ 0xBF419134, 0x8D400000, +/**/ 0x3D29B40E, 0x0B955CFB, +/**/ 0x3F418264, 0xD3C8F479, +/**/ 0xBF418132, 0x5BE00000, +/**/ 0xBD3964BF, 0x45A6C249, +/**/ 0x3F417260, 0x74E3EC8D, +/**/ 0xBF417130, 0x2CA00000, +/**/ 0xBCE777E0, 0xF3363612, +/**/ 0x3F41625C, 0x1A008792, +/**/ 0xBF41612D, 0xFF600000, +/**/ 0x3D36D608, 0x28DE8296, +/**/ 0x3F415257, 0xC31EC409, +/**/ 0xBF41512B, 0xD4000000, +/**/ 0xBD32AE69, 0x4BB1B788, +/**/ 0x3F414253, 0x703EA071, +/**/ 0xBF414129, 0xAAC00000, +/**/ 0x3D05BF68, 0x170ECD8C, +/**/ 0x3F41324F, 0x21601B48, +/**/ 0xBF413127, 0x83800000, +/**/ 0x3D370A0B, 0x7C653BFC, +/**/ 0x3F41224A, 0xD683330E, +/**/ 0xBF412125, 0x5E200000, +/**/ 0xBD35B70D, 0x77BBBEBF, +/**/ 0x3F411246, 0x8FA7E642, +/**/ 0xBF411123, 0x3AE00000, +/**/ 0xBD0C52EB, 0x93ABC1CD, +/**/ 0x3F410242, 0x4CCE3363, +/**/ 0xBF410121, 0x19A00000, +/**/ 0x3D2B2237, 0xE5C6F4C7, +/**/ 0x3F40F23E, 0x0DF618F1, +/**/ 0xBF40F11E, 0xFA600000, +/**/ 0x3D3D9C5F, 0x1E9A50AD, +/**/ 0x3F40E239, 0xD31F956A, +/**/ 0xBF40E11C, 0xDD000000, +/**/ 0xBD336793, 0x8965F0DA, +/**/ 0x3F40D235, 0x9C4AA74E, +/**/ 0xBF40D11A, 0xC1C00000, +/**/ 0xBD15E6EE, 0x7E49E231, +/**/ 0x3F40C231, 0x69774D1D, +/**/ 0xBF40C118, 0xA8800000, +/**/ 0x3D1D9B9D, 0x04FD621C, +/**/ 0x3F40B22D, 0x3AA58554, +/**/ 0xBF40B116, 0x91400000, +/**/ 0x3D333B55, 0x7DD9EED3, +/**/ 0x3F40A229, 0x0FD54E74, +/**/ 0xBF40A114, 0x7C000000, +/**/ 0x3D3E048F, 0x7AA78478, +/**/ 0x3F409224, 0xE906A6FC, +/**/ 0xBF409112, 0x68A00000, +/**/ 0xBD383C6A, 0x644DDE88, +/**/ 0x3F408220, 0xC6398D6B, +/**/ 0xBF408110, 0x57600000, +/**/ 0xBD2F0D2F, 0x76B8C83A, +/**/ 0x3F40721C, 0xA76E0040, +/**/ 0xBF40710E, 0x48200000, +/**/ 0xBD1F63E0, 0x9CE99FD3, +/**/ 0x3F406218, 0x8CA3FDFB, +/**/ 0xBF40610C, 0x3AE00000, +/**/ 0xBCF328B4, 0x4FE774F2, +/**/ 0x3F405214, 0x75DB851A, +/**/ 0xBF40510A, 0x2FA00000, +/**/ 0x3D11B6BD, 0x3782BCD4, +/**/ 0x3F404210, 0x6314941D, +/**/ 0xBF404108, 0x26600000, +/**/ 0x3D22116F, 0xE7183792, +/**/ 0x3F40320C, 0x544F2983, +/**/ 0xBF403106, 0x1F200000, +/**/ 0x3D293F1E, 0x1B995B3D, +/**/ 0x3F402208, 0x498B43CB, +/**/ 0xBF402104, 0x19E00000, +/**/ 0x3D2E6669, 0xFC162630, +/**/ 0x3F401204, 0x42C8E175, +/**/ 0xBF401102, 0x16A00000, +/**/ 0x3D30C4AA, 0x254FC9F8, +/**/ 0x3F400200, 0x40080100, +/**/ 0xBF400100, 0x15600000, +/**/ 0x3D3154EE, 0xE4431F92, +/**/ 0x3F3FE3F8, 0x829141D6, +/**/ 0xBF3FE1FC, 0x2C400000, +/**/ 0x3D30E503, 0x9B2D30FB, +/**/ 0x3F3FC3F0, 0x8D157F6B, +/**/ 0xBF3FC1F8, 0x31C00000, +/**/ 0x3D2EEBD1, 0x53EBD670, +/**/ 0x3F3FA3E8, 0x9F9CB7BC, +/**/ 0xBF3FA1F4, 0x3B400000, +/**/ 0x3D2A113C, 0xE04A16E0, +/**/ 0x3F3F83E0, 0xBA26E7CA, +/**/ 0xBF3F81F0, 0x48C00000, +/**/ 0x3D233C4A, 0x99C43E34, +/**/ 0x3F3F63D8, 0xDCB40C91, +/**/ 0xBF3F61EC, 0x5A400000, +/**/ 0x3D14DDF6, 0x7BD210C1, +/**/ 0x3F3F43D1, 0x07442311, +/**/ 0xBF3F41E8, 0x6FC00000, +/**/ 0xBCC52C1D, 0x9E4B51C8, +/**/ 0x3F3F23C9, 0x39D72849, +/**/ 0xBF3F21E4, 0x89400000, +/**/ 0xBD1A196F, 0x8EA8C754, +/**/ 0x3F3F03C1, 0x746D1936, +/**/ 0xBF3F01E0, 0xA6C00000, +/**/ 0xBD2BB719, 0xF95AF98D, +/**/ 0x3F3EE3B9, 0xB705F2D8, +/**/ 0xBF3EE1DC, 0xC8400000, +/**/ 0xBD3628EB, 0x28FFD598, +/**/ 0x3F3EC3B2, 0x01A1B22C, +/**/ 0xBF3EC1D8, 0xEDC00000, +/**/ 0xBD3F6D76, 0x0BBAC8F8, +/**/ 0x3F3EA3AA, 0x54405432, +/**/ 0xBF3EA1D5, 0x17800000, +/**/ 0x3D3657D2, 0xB7A7EE0D, +/**/ 0x3F3E83A2, 0xAEE1D5E8, +/**/ 0xBF3E81D1, 0x45000000, +/**/ 0x3D264FDE, 0xFA9CCC78, +/**/ 0x3F3E639B, 0x1186344C, +/**/ 0xBF3E61CD, 0x76800000, +/**/ 0xBCEF83EB, 0xE02EF455, +/**/ 0x3F3E4393, 0x7C2D6C5E, +/**/ 0xBF3E41C9, 0xAC000000, +/**/ 0xBD2C26B3, 0x03C3E129, +/**/ 0x3F3E238B, 0xEED77B1B, +/**/ 0xBF3E21C5, 0xE5800000, +/**/ 0xBD3C1CBE, 0x904D773D, +/**/ 0x3F3E0384, 0x69845D83, +/**/ 0xBF3E01C2, 0x23400000, +/**/ 0x3D34E8B1, 0xD0615454, +/**/ 0x3F3DE37C, 0xEC341093, +/**/ 0xBF3DE1BE, 0x64C00000, +/**/ 0x3D13F7DF, 0xE9BE933E, +/**/ 0x3F3DC375, 0x76E6914B, +/**/ 0xBF3DC1BA, 0xAA400000, +/**/ 0xBD27B7D7, 0x707B004A, +/**/ 0x3F3DA36E, 0x099BDCA9, +/**/ 0xBF3DA1B6, 0xF3C00000, +/**/ 0xBD3DA3F8, 0xEE2141C3, +/**/ 0x3F3D8366, 0xA453EFAC, +/**/ 0xBF3D81B3, 0x41800000, +/**/ 0x3D2F4DA1, 0x63D21825, +/**/ 0x3F3D635F, 0x470EC752, +/**/ 0xBF3D61AF, 0x93000000, +/**/ 0xBD0FD473, 0xFAD0B844, +/**/ 0x3F3D4357, 0xF1CC609A, +/**/ 0xBF3D41AB, 0xE8800000, +/**/ 0xBD388716, 0x298657C2, +/**/ 0x3F3D2350, 0xA48CB882, +/**/ 0xBF3D21A8, 0x42400000, +/**/ 0x3D32023A, 0x0B68711A, +/**/ 0x3F3D0349, 0x5F4FCC0A, +/**/ 0xBF3D01A4, 0x9FC00000, +/**/ 0xBD117676, 0x23A704B0, +/**/ 0x3F3CE342, 0x22159830, +/**/ 0xBF3CE1A1, 0x01400000, +/**/ 0xBD3BA59C, 0x8F391F09, +/**/ 0x3F3CC33A, 0xECDE19F1, +/**/ 0xBF3CC19D, 0x67000000, +/**/ 0x3D28567A, 0x9EBBF706, +/**/ 0x3F3CA333, 0xBFA94E4E, +/**/ 0xBF3CA199, 0xD0800000, +/**/ 0xBD29D41F, 0x2D41F1CC, +/**/ 0x3F3C832C, 0x9A773245, +/**/ 0xBF3C8196, 0x3E400000, +/**/ 0x3D391B7D, 0x14ED5134, +/**/ 0x3F3C6325, 0x7D47C2D4, +/**/ 0xBF3C6192, 0xAFC00000, +/**/ 0xBCFC31C5, 0x83403B5B, +/**/ 0x3F3C431E, 0x681AFCFA, +/**/ 0xBF3C418F, 0x25400000, +/**/ 0xBD3D84DB, 0x88A1FFF3, +/**/ 0x3F3C2317, 0x5AF0DDB6, +/**/ 0xBF3C218B, 0x9F000000, +/**/ 0x3D175CFF, 0x6298A63B, +/**/ 0x3F3C0310, 0x55C96207, +/**/ 0xBF3C0188, 0x1C800000, +/**/ 0xBD37ADC9, 0xDFB8E489, +/**/ 0x3F3BE309, 0x58A486EA, +/**/ 0xBF3BE184, 0x9E400000, +/**/ 0x3D23DA0F, 0x45069C64, +/**/ 0x3F3BC302, 0x6382495F, +/**/ 0xBF3BC181, 0x23C00000, +/**/ 0xBD35574B, 0x4CC2EFE0, +/**/ 0x3F3BA2FB, 0x7662A665, +/**/ 0xBF3BA17D, 0xAD800000, +/**/ 0x3D250C7B, 0x4BED0B89, +/**/ 0x3F3B82F4, 0x91459AFA, +/**/ 0xBF3B817A, 0x3B000000, +/**/ 0xBD36795D, 0x322E5605, +/**/ 0x3F3B62ED, 0xB42B241D, +/**/ 0xBF3B6176, 0xCCC00000, +/**/ 0x3D1EAB91, 0xF6413886, +/**/ 0x3F3B42E6, 0xDF133ECC, +/**/ 0xBF3B4173, 0x62400000, +/**/ 0xBD3B0BFC, 0xF86BE5B5, +/**/ 0x3F3B22E0, 0x11FDE807, +/**/ 0xBF3B216F, 0xFC000000, +/**/ 0x3CF62FEB, 0xDDE8D701, +/**/ 0x3F3B02D9, 0x4CEB1CCC, +/**/ 0xBF3B016C, 0x99C00000, +/**/ 0x3D3CF8D7, 0xF210FD9E, +/**/ 0x3F3AE2D2, 0x8FDADA1A, +/**/ 0xBF3AE169, 0x3B400000, +/**/ 0xBD2092E2, 0x1526CFB0, +/**/ 0x3F3AC2CB, 0xDACD1CEF, +/**/ 0xBF3AC165, 0xE1000000, +/**/ 0x3D319D24, 0x18D261D5, +/**/ 0x3F3AA2C5, 0x2DC1E24A, +/**/ 0xBF3AA162, 0x8A800000, +/**/ 0xBD355268, 0x533CC8EC, +/**/ 0x3F3A82BE, 0x88B9272B, +/**/ 0xBF3A815F, 0x38400000, +/**/ 0x3D074750, 0x0AFE6139, +/**/ 0x3F3A62B7, 0xEBB2E88F, +/**/ 0xBF3A615B, 0xEA000000, +/**/ 0x3D3A501B, 0x6668AD57, +/**/ 0x3F3A42B1, 0x56AF2375, +/**/ 0xBF3A4158, 0x9F800000, +/**/ 0xBD2E37A7, 0xA98381BD, +/**/ 0x3F3A22AA, 0xC9ADD4DD, +/**/ 0xBF3A2155, 0x59400000, +/**/ 0x3D1A9872, 0x7B82F9AC, +/**/ 0x3F3A02A4, 0x44AEF9C5, +/**/ 0xBF3A0152, 0x17000000, +/**/ 0x3D3B96ED, 0x0FF040AD, +/**/ 0x3F39E29D, 0xC7B28F2C, +/**/ 0xBF39E14E, 0xD8800000, +/**/ 0xBD304862, 0x33534BD7, +/**/ 0x3F39C297, 0x52B89211, +/**/ 0xBF39C14B, 0x9E400000, +/**/ 0x3D084979, 0x17AF009B, +/**/ 0x3F39A290, 0xE5C0FF72, +/**/ 0xBF39A148, 0x68000000, +/**/ 0x3D358CA1, 0x604B64C9, +/**/ 0x3F39828A, 0x80CBD44E, +/**/ 0xBF398145, 0x35800000, +/**/ 0xBD38BD0B, 0x2E334404, +/**/ 0x3F396284, 0x23D90DA4, +/**/ 0xBF396142, 0x07400000, +/**/ 0xBD1F4B58, 0xEF1B1C68, +/**/ 0x3F39427D, 0xCEE8A873, +/**/ 0xBF39413E, 0xDD000000, +/**/ 0x3D209881, 0x07E010EC, +/**/ 0x3F392277, 0x81FAA1B9, +/**/ 0xBF39213B, 0xB6C00000, +/**/ 0x3D37A139, 0x5CF03181, +/**/ 0x3F390271, 0x3D0EF676, +/**/ 0xBF390138, 0x94400000, +/**/ 0xBD39D2EB, 0x65276B0B, +/**/ 0x3F38E26B, 0x0025A3A8, +/**/ 0xBF38E135, 0x76000000, +/**/ 0xBD281E5A, 0xEE3023F6, +/**/ 0x3F38C264, 0xCB3EA64F, +/**/ 0xBF38C132, 0x5BC00000, +/**/ 0x3CEDAE6E, 0x3F9A4B53, +/**/ 0x3F38A25E, 0x9E59FB68, +/**/ 0xBF38A12F, 0x45800000, +/**/ 0x3D2A47EF, 0x412B648E, +/**/ 0x3F388258, 0x79779FF3, +/**/ 0xBF38812C, 0x33400000, +/**/ 0x3D38955F, 0x5ED0D8F2, +/**/ 0x3F386252, 0x5C9790EE, +/**/ 0xBF386129, 0x24C00000, +/**/ 0xBD3CBD55, 0x09939374, +/**/ 0x3F38424C, 0x47B9CB5A, +/**/ 0xBF384126, 0x1A800000, +/**/ 0xBD32D325, 0x4F399186, +/**/ 0x3F382246, 0x3ADE4C33, +/**/ 0xBF382123, 0x14400000, +/**/ 0xBD235622, 0x524688EB, +/**/ 0x3F380240, 0x3605107A, +/**/ 0xBF380120, 0x12000000, +/**/ 0xBCF44184, 0xEB2F3DDC, +/**/ 0x3F37E23A, 0x392E152C, +/**/ 0xBF37E11D, 0x13C00000, +/**/ 0x3D198B16, 0x2153D1B8, +/**/ 0x3F37C234, 0x4459574A, +/**/ 0xBF37C11A, 0x19800000, +/**/ 0x3D2A9511, 0x47A3C923, +/**/ 0x3F37A22E, 0x5786D3D1, +/**/ 0xBF37A117, 0x23400000, +/**/ 0x3D337431, 0x4B4128D9, +/**/ 0x3F378228, 0x72B687C1, +/**/ 0xBF378114, 0x31000000, +/**/ 0x3D38E0BF, 0xC5BFE9E8, +/**/ 0x3F376222, 0x95E87019, +/**/ 0xBF376111, 0x42C00000, +/**/ 0x3D3D9134, 0x5A0B2CE9, +/**/ 0x3F37421C, 0xC11C89D8, +/**/ 0xBF37410E, 0x58400000, +/**/ 0xBD3E7970, 0xB1802C40, +/**/ 0x3F372216, 0xF452D1FB, +/**/ 0xBF37210B, 0x72000000, +/**/ 0xBD3B3E2F, 0x16E562C9, +/**/ 0x3F370211, 0x2F8B4583, +/**/ 0xBF370108, 0x8FC00000, +/**/ 0xBD38BC06, 0x9087DACD, +/**/ 0x3F36E20B, 0x72C5E16F, +/**/ 0xBF36E105, 0xB1800000, +/**/ 0xBD36F1F6, 0xD92B1B21, +/**/ 0x3F36C205, 0xBE02A2BC, +/**/ 0xBF36C102, 0xD7400000, +/**/ 0xBD35DEFF, 0xABF2CD23, +/**/ 0x3F36A200, 0x1141866B, +/**/ 0xBF36A100, 0x01000000, +/**/ 0xBD358220, 0xC462BC85, +/**/ 0x3F3681FA, 0x6C828979, +/**/ 0xBF3680FD, 0x2EC00000, +/**/ 0xBD35DA59, 0xDE5ED723, +/**/ 0x3F3661F4, 0xCFC5A8E7, +/**/ 0xBF3660FA, 0x60800000, +/**/ 0xBD36E6AA, 0xB62B2CD1, +/**/ 0x3F3641EF, 0x3B0AE1B2, +/**/ 0xBF3640F7, 0x96400000, +/**/ 0xBD38A613, 0x086BEF29, +/**/ 0x3F3621E9, 0xAE5230DA, +/**/ 0xBF3620F4, 0xD0000000, +/**/ 0xBD3B1792, 0x9225715D, +/**/ 0x3F3601E4, 0x299B935F, +/**/ 0xBF3600F2, 0x0DC00000, +/**/ 0xBD3E3A29, 0x10BC2805, +/**/ 0x3F35E1DE, 0xACE7063E, +/**/ 0xBF35E0EF, 0x4FC00000, +/**/ 0x3D3DF329, 0xBE0B570D, +/**/ 0x3F35C1D9, 0x38348676, +/**/ 0xBF35C0EC, 0x95800000, +/**/ 0x3D397166, 0x1C0C5502, +/**/ 0x3F35A1D3, 0xCB841108, +/**/ 0xBF35A0E9, 0xDF400000, +/**/ 0x3D34418C, 0x4AC1FA2D, +/**/ 0x3F3581CE, 0x66D5A2F1, +/**/ 0xBF3580E7, 0x2D000000, +/**/ 0x3D2CC939, 0x168E9C6E, +/**/ 0x3F3561C9, 0x0A293931, +/**/ 0xBF3560E4, 0x7EC00000, +/**/ 0x3D1F6E5C, 0x795CE154, +/**/ 0x3F3541C3, 0xB57ED0C7, +/**/ 0xBF3540E1, 0xD4800000, +/**/ 0x3CE4EF88, 0x898FEE67, +/**/ 0x3F3521BE, 0x68D666B1, +/**/ 0xBF3520DF, 0x2E400000, +/**/ 0xBD1CDACF, 0x0B78D65E, +/**/ 0x3F3501B9, 0x242FF7EF, +/**/ 0xBF3500DC, 0x8C000000, +/**/ 0xBD2F7BF1, 0x6F1CBFB8, +/**/ 0x3F34E1B3, 0xE78B8180, +/**/ 0xBF34E0D9, 0xEDC00000, +/**/ 0xBD38ED52, 0x5A899820, +/**/ 0x3F34C1AE, 0xB2E90063, +/**/ 0xBF34C0D7, 0x53C00000, +/**/ 0x3D3D3C3F, 0x930A694E, +/**/ 0x3F34A1A9, 0x86487196, +/**/ 0xBF34A0D4, 0xBD800000, +/**/ 0x3D32BFBD, 0x4FA7CCCB, +/**/ 0x3F3481A4, 0x61A9D219, +/**/ 0xBF3480D2, 0x2B400000, +/**/ 0x3D1E789C, 0x65A26E32, +/**/ 0x3F34619F, 0x450D1EEB, +/**/ 0xBF3460CF, 0x9D000000, +/**/ 0xBD109E0B, 0x47E500B5, +/**/ 0x3F34419A, 0x3072550B, +/**/ 0xBF3440CD, 0x12C00000, +/**/ 0xBD309040, 0x3523FAE9, +/**/ 0x3F342195, 0x23D97178, +/**/ 0xBF3420CA, 0x8C800000, +/**/ 0xBD3D9B10, 0xD31DE7C2, +/**/ 0x3F340190, 0x1F427131, +/**/ 0xBF3400C8, 0x0A800000, +/**/ 0x3D34B90B, 0x90B287C4, +/**/ 0x3F33E18B, 0x22AD5135, +/**/ 0xBF33E0C5, 0x8C400000, +/**/ 0x3D19B454, 0xCA1B0FC2, +/**/ 0x3F33C186, 0x2E1A0E83, +/**/ 0xBF33C0C3, 0x12000000, +/**/ 0xBD20FBE7, 0x638FC1F4, +/**/ 0x3F33A181, 0x4188A61A, +/**/ 0xBF33A0C0, 0x9BC00000, +/**/ 0xBD38070E, 0xE0C03290, +/**/ 0x3F33817C, 0x5CF914F9, +/**/ 0xBF3380BE, 0x29C00000, +/**/ 0x3D37D2C3, 0xE0B6E5F5, +/**/ 0x3F336177, 0x806B5820, +/**/ 0xBF3360BB, 0xBB800000, +/**/ 0x3D1C4213, 0x35598794, +/**/ 0x3F334172, 0xABDF6C8D, +/**/ 0xBF3340B9, 0x51400000, +/**/ 0xBD249997, 0xC111C569, +/**/ 0x3F33216D, 0xDF554F40, +/**/ 0xBF3320B6, 0xEB000000, +/**/ 0xBD3C442D, 0xEEEE28E2, +/**/ 0x3F330169, 0x1ACCFD37, +/**/ 0xBF3300B4, 0x89000000, +/**/ 0x3D312B5E, 0xDBBF316D, +/**/ 0x3F32E164, 0x5E467372, +/**/ 0xBF32E0B2, 0x2AC00000, +/**/ 0xBCFFD254, 0x7484E6E1, +/**/ 0x3F32C15F, 0xA9C1AEF0, +/**/ 0xBF32C0AF, 0xD0800000, +/**/ 0xBD35BCBA, 0x1F2C3F9D, +/**/ 0x3F32A15A, 0xFD3EACAF, +/**/ 0xBF32A0AD, 0x7A800000, +/**/ 0x3D35EDA0, 0x8C8BAA61, +/**/ 0x3F328156, 0x58BD69B0, +/**/ 0xBF3280AB, 0x28400000, +/**/ 0x3CF02EAF, 0x3F79FE5E, +/**/ 0x3F326151, 0xBC3DE2F1, +/**/ 0xBF3260A8, 0xDA000000, +/**/ 0xBD347BDA, 0xB1304AA8, +/**/ 0x3F32414D, 0x27C01572, +/**/ 0xBF3240A6, 0x90000000, +/**/ 0x3D35724F, 0xD46BE359, +/**/ 0x3F322148, 0x9B43FE30, +/**/ 0xBF3220A4, 0x49C00000, +/**/ 0xBCF31954, 0x43BF90C9, +/**/ 0x3F320144, 0x16C99A2D, +/**/ 0xBF3200A2, 0x07800000, +/**/ 0xBD386689, 0xC4901E30, +/**/ 0x3F31E13F, 0x9A50E666, +/**/ 0xBF31E09F, 0xC9800000, +/**/ 0x3D2FA8E5, 0x134E34BF, +/**/ 0x3F31C13B, 0x25D9DFDB, +/**/ 0xBF31C09D, 0x8F400000, +/**/ 0xBD20FF40, 0x477D87DF, +/**/ 0x3F31A136, 0xB964838C, +/**/ 0xBF31A09B, 0x59400000, +/**/ 0x3D3E9E3E, 0x68B5B77B, +/**/ 0x3F318132, 0x54F0CE76, +/**/ 0xBF318099, 0x27000000, +/**/ 0x3D14BC39, 0x906F8A53, +/**/ 0x3F31612D, 0xF87EBD9A, +/**/ 0xBF316096, 0xF8C00000, +/**/ 0xBD34CC2F, 0xFCD50724, +/**/ 0x3F314129, 0xA40E4DF7, +/**/ 0xBF314094, 0xCEC00000, +/**/ 0x3D30AD83, 0x7A3A1B8D, +/**/ 0x3F312125, 0x579F7C8B, +/**/ 0xBF312092, 0xA8800000, +/**/ 0xBD24C5AE, 0x057F5C66, +/**/ 0x3F310121, 0x13324657, +/**/ 0xBF310090, 0x86800000, +/**/ 0x3D3A03C0, 0xBFD488E0, +/**/ 0x3F30E11C, 0xD6C6A858, +/**/ 0xBF30E08E, 0x68400000, +/**/ 0xBD00EDA8, 0x56935D63, +/**/ 0x3F30C118, 0xA25C9F8F, +/**/ 0xBF30C08C, 0x4E000000, +/**/ 0xBD3EC638, 0x2FDDD1CE, +/**/ 0x3F30A114, 0x75F428FB, +/**/ 0xBF30A08A, 0x38000000, +/**/ 0x3D102CDE, 0x0CA3DCBE, +/**/ 0x3F308110, 0x518D419B, +/**/ 0xBF308088, 0x25C00000, +/**/ 0xBD39A865, 0xBFA78921, +/**/ 0x3F30610C, 0x3527E66D, +/**/ 0xBF306086, 0x17C00000, +/**/ 0x3D203FE0, 0x72CE37BD, +/**/ 0x3F304108, 0x20C41472, +/**/ 0xBF304084, 0x0D800000, +/**/ 0xBD369AC6, 0x6054C3FA, +/**/ 0x3F302104, 0x1461C8A9, +/**/ 0xBF302082, 0x07800000, +/**/ 0x3D2450ED, 0x4836293A, +/**/ 0x3F300100, 0x10010010, +/**/ 0xBF300080, 0x05400000, +/**/ 0xBD359558, 0x88B3357C, +/**/ 0x3F2FC1F8, 0x27436F4F, +/**/ 0xBF2FC0FC, 0x0E800000, +/**/ 0x3D245998, 0x92ECD4D1, +/**/ 0x3F2F81F0, 0x3E87D8DC, +/**/ 0xBF2F80F8, 0x1A000000, +/**/ 0xBD36901A, 0xB592170A, +/**/ 0x3F2F41E8, 0x65CF36C6, +/**/ 0xBF2F40F4, 0x2E000000, +/**/ 0x3D2069E5, 0x53524603, +/**/ 0x3F2F01E0, 0x9D19830B, +/**/ 0xBF2F00F0, 0x49800000, +/**/ 0xBD39830B, 0x69C22240, +/**/ 0x3F2EC1D8, 0xE466B7AB, +/**/ 0xBF2EC0EC, 0x6D800000, +/**/ 0x3D1123AC, 0xFB871BBA, +/**/ 0x3F2E81D1, 0x3BB6CEA4, +/**/ 0xBF2E80E8, 0x99000000, +/**/ 0xBD3E6629, 0x2E158AF6, +/**/ 0x3F2E41C9, 0xA309C1F4, +/**/ 0xBF2E40E4, 0xCD000000, +/**/ 0xBCF8F488, 0x2B29884E, +/**/ 0x3F2E01C2, 0x1A5F8B99, +/**/ 0xBF2E00E1, 0x09000000, +/**/ 0x3D3ACE8D, 0x6EA006C6, +/**/ 0x3F2DC1BA, 0xA1B82593, +/**/ 0xBF2DC0DD, 0x4C800000, +/**/ 0xBD22974E, 0x59D0B687, +/**/ 0x3F2D81B3, 0x391389E0, +/**/ 0xBF2D80D9, 0x98800000, +/**/ 0x3D322319, 0xD7897CAD, +/**/ 0x3F2D41AB, 0xE071B27F, +/**/ 0xBF2D40D5, 0xEC000000, +/**/ 0xBD32E42F, 0x57954C6E, +/**/ 0x3F2D01A4, 0x97D2996E, +/**/ 0xBF2D00D2, 0x48000000, +/**/ 0x3D1E7DF5, 0xC741610E, +/**/ 0x3F2CC19D, 0x5F3638AB, +/**/ 0xBF2CC0CE, 0xAB800000, +/**/ 0xBD3E50DF, 0xA0909C5A, +/**/ 0x3F2C8196, 0x369C8A37, +/**/ 0xBF2C80CB, 0x17800000, +/**/ 0xBD12D119, 0x8D8D1C8F, +/**/ 0x3F2C418F, 0x1E05880E, +/**/ 0xBF2C40C7, 0x8B800000, +/**/ 0x3D347649, 0x544D2574, +/**/ 0x3F2C0188, 0x15712C30, +/**/ 0xBF2C00C4, 0x07000000, +/**/ 0xBD32D030, 0x4EEA9E68, +/**/ 0x3F2BC181, 0x1CDF709C, +/**/ 0xBF2BC0C0, 0x8B000000, +/**/ 0x3D15E533, 0x74A84109, +/**/ 0x3F2B817A, 0x34504F50, +/**/ 0xBF2B80BD, 0x17000000, +/**/ 0x3D3D53C1, 0x025FBF68, +/**/ 0x3F2B4173, 0x5BC3C24B, +/**/ 0xBF2B40B9, 0xAA800000, +/**/ 0xBD267FA7, 0x6BAA2FA8, +/**/ 0x3F2B016C, 0x9339C38C, +/**/ 0xBF2B00B6, 0x46800000, +/**/ 0x3D277F1D, 0xBB3FDE1E, +/**/ 0x3F2AC165, 0xDAB24D11, +/**/ 0xBF2AC0B2, 0xEA000000, +/**/ 0xBD3DAD17, 0x1A8CDBE2, +/**/ 0x3F2A815F, 0x322D58D9, +/**/ 0xBF2A80AF, 0x96000000, +/**/ 0xBD1E1315, 0xD81CF36E, +/**/ 0x3F2A4158, 0x99AAE0E3, +/**/ 0xBF2A40AC, 0x4A000000, +/**/ 0x3D2C7307, 0xE649E7B4, +/**/ 0x3F2A0152, 0x112ADF2D, +/**/ 0xBF2A00A9, 0x05800000, +/**/ 0xBD3C713A, 0xB77435EC, +/**/ 0x3F29C14B, 0x98AD4DB7, +/**/ 0xBF29C0A5, 0xC9800000, +/**/ 0xBD1E1005, 0x3A7AE827, +/**/ 0x3F298145, 0x3032267F, +/**/ 0xBF2980A2, 0x95800000, +/**/ 0x3D2A0460, 0xA8F2A842, +/**/ 0x3F29413E, 0xD7B96385, +/**/ 0xBF29409F, 0x69000000, +/**/ 0xBD3EDDA5, 0xA7B8321E, +/**/ 0x3F290138, 0x8F42FEC5, +/**/ 0xBF29009C, 0x45000000, +/**/ 0xBD264506, 0x3A3F0D33, +/**/ 0x3F28C132, 0x56CEF241, +/**/ 0xBF28C099, 0x29000000, +/**/ 0x3D206930, 0x33EE13CD, +/**/ 0x3F28812C, 0x2E5D37F6, +/**/ 0xBF288096, 0x15000000, +/**/ 0x3D3B28AC, 0x22DF1FDA, +/**/ 0x3F284126, 0x15EDC9E3, +/**/ 0xBF284093, 0x08800000, +/**/ 0xBD324546, 0xDD73B6DB, +/**/ 0x3F280120, 0x0D80A208, +/**/ 0xBF280090, 0x04800000, +/**/ 0xBCB440C2, 0x6DFEB485, +/**/ 0x3F27C11A, 0x1515BA62, +/**/ 0xBF27C08D, 0x08800000, +/**/ 0x3D31BCBE, 0x9823B19D, +/**/ 0x3F278114, 0x2CAD0CF1, +/**/ 0xBF27808A, 0x14000000, +/**/ 0xBD3CD148, 0xA9EB4E97, +/**/ 0x3F27410E, 0x544693B4, +/**/ 0xBF274087, 0x28000000, +/**/ 0xBD277AAC, 0xCA4F73AA, +/**/ 0x3F270108, 0x8BE248AA, +/**/ 0xBF270084, 0x44000000, +/**/ 0x3D13E656, 0x26068EF7, +/**/ 0x3F26C102, 0xD38025D2, +/**/ 0xBF26C081, 0x68000000, +/**/ 0x3D35547B, 0x44C3EC8A, +/**/ 0x3F2680FD, 0x2B20252A, +/**/ 0xBF26807E, 0x93800000, +/**/ 0xBD3AABA5, 0x110DCE4B, +/**/ 0x3F2640F7, 0x92C240B1, +/**/ 0xBF26407B, 0xC7800000, +/**/ 0xBD260B96, 0xAC011956, +/**/ 0x3F2600F2, 0x0A667267, +/**/ 0xBF260079, 0x03800000, +/**/ 0x3D111C22, 0x5DFA826E, +/**/ 0x3F25C0EC, 0x920CB44A, +/**/ 0xBF25C076, 0x47800000, +/**/ 0x3D333BD6, 0xD8A2980A, +/**/ 0x3F2580E7, 0x29B5005A, +/**/ 0xBF258073, 0x93000000, +/**/ 0xBD3E2660, 0x71C1D861, +/**/ 0x3F2540E1, 0xD15F5095, +/**/ 0xBF254070, 0xE7000000, +/**/ 0xBD2FBD3A, 0x4E77E5EE, +/**/ 0x3F2500DC, 0x890B9EFA, +/**/ 0xBF25006E, 0x43000000, +/**/ 0xBCFEBDF2, 0x7B90A2D9, +/**/ 0x3F24C0D7, 0x50B9E589, +/**/ 0xBF24C06B, 0xA7000000, +/**/ 0x3D2765B3, 0x58F2FF2C, +/**/ 0x3F2480D2, 0x286A1E40, +/**/ 0xBF248069, 0x13000000, +/**/ 0x3D38FE8D, 0x74AE382C, +/**/ 0x3F2440CD, 0x101C431E, +/**/ 0xBF244066, 0x86800000, +/**/ 0xBD3A07C3, 0xB0286224, +/**/ 0x3F2400C8, 0x07D04E23, +/**/ 0xBF240064, 0x02800000, +/**/ 0xBD2ABE33, 0x46EFC0EC, +/**/ 0x3F23C0C3, 0x0F86394D, +/**/ 0xBF23C061, 0x86800000, +/**/ 0xBCF06744, 0x70DE3151, +/**/ 0x3F2380BE, 0x273DFE9C, +/**/ 0xBF23805F, 0x12800000, +/**/ 0x3D260659, 0x05CFCD61, +/**/ 0x3F2340B9, 0x4EF7980F, +/**/ 0xBF23405C, 0xA6800000, +/**/ 0x3D36BEC8, 0xD7DBBEBC, +/**/ 0x3F2300B4, 0x86B2FFA4, +/**/ 0xBF23005A, 0x42000000, +/**/ 0xBD3DD29F, 0x2B2027B4, +/**/ 0x3F22C0AF, 0xCE702F5C, +/**/ 0xBF22C057, 0xE6000000, +/**/ 0xBD32B00B, 0x6959A7D0, +/**/ 0x3F2280AB, 0x262F2134, +/**/ 0xBF228055, 0x92000000, +/**/ 0xBD1F61EF, 0x19FAAC2D, +/**/ 0x3F2240A6, 0x8DEFCF2C, +/**/ 0xBF224053, 0x46000000, +/**/ 0x3D05A87E, 0xCB16B8A8, +/**/ 0x3F2200A2, 0x05B23344, +/**/ 0xBF220051, 0x02000000, +/**/ 0x3D29F32F, 0x23B9B257, +/**/ 0x3F21C09D, 0x8D76477A, +/**/ 0xBF21C04E, 0xC6000000, +/**/ 0x3D36F61B, 0x7E214821, +/**/ 0x3F218099, 0x253C05CD, +/**/ 0xBF21804C, 0x91800000, +/**/ 0xBD3F5464, 0x46FDFCA2, +/**/ 0x3F214094, 0xCD03683D, +/**/ 0xBF21404A, 0x65800000, +/**/ 0xBD35E4E7, 0xA30F2308, +/**/ 0x3F210090, 0x84CC68C9, +/**/ 0xBF210048, 0x41800000, +/**/ 0xBD2974DC, 0xF800CC34, +/**/ 0x3F20C08C, 0x4C970171, +/**/ 0xBF20C046, 0x25800000, +/**/ 0xBD0E9FC5, 0xC1006E9D, +/**/ 0x3F208088, 0x24632C32, +/**/ 0xBF208044, 0x11800000, +/**/ 0x3D133DE7, 0x078E4438, +/**/ 0x3F204084, 0x0C30E30D, +/**/ 0xBF204042, 0x05800000, +/**/ 0x3D2A61D2, 0x15F82A7B, +/**/ 0x3F200080, 0x04002001, +/**/ 0xBF200040, 0x01800000, +/**/ 0x3D355155, 0x3BBB110C, +/**/ 0x3F1F80F8, 0x17A1BA1A, +/**/ 0xBF1F807C, 0x0B000000, +/**/ 0x3D3D31BE, 0x6C520A9B, +/**/ 0x3F1F00F0, 0x47462860, +/**/ 0xBF1F0078, 0x22000000, +/**/ 0xBD3B2CDB, 0x4B6D83F6, +/**/ 0x3F1E80E8, 0x96ED7ED3, +/**/ 0xBF1E8074, 0x4A000000, +/**/ 0xBD33C977, 0xD4122C5A, +/**/ 0x3F1E00E1, 0x0697B172, +/**/ 0xBF1E0070, 0x82000000, +/**/ 0xBD29462E, 0x2D1517C4, +/**/ 0x3F1D80D9, 0x9644B43B, +/**/ 0xBF1D806C, 0xCA000000, +/**/ 0xBD16E2E3, 0xF0952D45, +/**/ 0x3F1D00D2, 0x45F47B2C, +/**/ 0xBF1D0069, 0x22000000, +/**/ 0x3CEED452, 0x2DDC2A8D, +/**/ 0x3F1C80CB, 0x15A6FA46, +/**/ 0xBF1C8065, 0x8A000000, +/**/ 0x3D1DAFEE, 0xA08CEBE8, +/**/ 0x3F1C00C4, 0x055C2585, +/**/ 0xBF1C0062, 0x02000000, +/**/ 0x3D2B50A4, 0xBB11EF55, +/**/ 0x3F1B80BD, 0x1513F0E9, +/**/ 0xBF1B805E, 0x8A000000, +/**/ 0x3D33ACA6, 0xC6D142BF, +/**/ 0x3F1B00B6, 0x44CE5071, +/**/ 0xBF1B005B, 0x22000000, +/**/ 0x3D3979F8, 0xF8CD3D11, +/**/ 0x3F1A80AF, 0x948B381A, +/**/ 0xBF1A8057, 0xCA000000, +/**/ 0x3D3F1149, 0x07EDFD29, +/**/ 0x3F1A00A9, 0x044A9BE5, +/**/ 0xBF1A0054, 0x81000000, +/**/ 0xBD3B8C68, 0xF7BB7092, +/**/ 0x3F1980A2, 0x940C6FCF, +/**/ 0xBF198051, 0x49000000, +/**/ 0xBD365E1C, 0xF27E09A9, +/**/ 0x3F19009C, 0x43D0A7D8, +/**/ 0xBF19004E, 0x21000000, +/**/ 0xBD3162D2, 0xD508D564, +/**/ 0x3F188096, 0x139737FE, +/**/ 0xBF18804B, 0x09000000, +/**/ 0xBD293315, 0x18D5C93E, +/**/ 0x3F180090, 0x03601440, +/**/ 0xBF180048, 0x01000000, +/**/ 0xBD200288, 0x0C26A328, +/**/ 0x3F17808A, 0x132B309E, +/**/ 0xBF178045, 0x09000000, +/**/ 0xBD0CC7F9, 0x7E89FD6F, +/**/ 0x3F170084, 0x42F88115, +/**/ 0xBF170042, 0x21000000, +/**/ 0x3CE40881, 0x058494DC, +/**/ 0x3F16807E, 0x92C7F9A5, +/**/ 0xBF16803F, 0x49000000, +/**/ 0x3D12AE16, 0xCD5698B9, +/**/ 0x3F160079, 0x02998E4D, +/**/ 0xBF16003C, 0x81000000, +/**/ 0x3D21138B, 0xC5780E17, +/**/ 0x3F158073, 0x926D330B, +/**/ 0xBF158039, 0xC9000000, +/**/ 0x3D287809, 0x4E2001E2, +/**/ 0x3F15006E, 0x4242DBDF, +/**/ 0xBF150037, 0x21000000, +/**/ 0x3D2F8684, 0x21448AA2, +/**/ 0x3F148069, 0x121A7CC8, +/**/ 0xBF148034, 0x89000000, +/**/ 0x3D33207E, 0x2F637D8E, +/**/ 0x3F140064, 0x01F409C4, +/**/ 0xBF140032, 0x01000000, +/**/ 0x3D3654B9, 0x12E44B29, +/**/ 0x3F13805F, 0x11CF76D3, +/**/ 0xBF13802F, 0x89000000, +/**/ 0x3D3960F2, 0xCA5547F3, +/**/ 0x3F13005A, 0x41ACB7F4, +/**/ 0xBF13002D, 0x21000000, +/**/ 0x3D3C462B, 0x6487063D, +/**/ 0x3F128055, 0x918BC126, +/**/ 0xBF12802A, 0xC9000000, +/**/ 0x3D3F0562, 0xEFEA1107, +/**/ 0x3F120051, 0x016C8668, +/**/ 0xBF120028, 0x80000000, +/**/ 0xBD3E6066, 0x857113CE, +/**/ 0x3F11804C, 0x914EFBBA, +/**/ 0xBF118026, 0x48000000, +/**/ 0xBD3BEA30, 0xEDD9EB54, +/**/ 0x3F110048, 0x41331519, +/**/ 0xBF110024, 0x20000000, +/**/ 0xBD3996FC, 0x3BFFFF5A, +/**/ 0x3F108044, 0x1118C686, +/**/ 0xBF108022, 0x08000000, +/**/ 0xBD3765C8, 0x62F2E042, +/**/ 0x3F100040, 0x01000400, +/**/ 0xBF100020, 0x00000000, +/**/ 0xBD355595, 0x562224CD, +/**/ 0x3F0F0078, 0x21D1830C, +/**/ 0xBF0F003C, 0x10000000, +/**/ 0xBD336563, 0x095D69EB, +/**/ 0x3F0E0070, 0x81A5E62E, +/**/ 0xBF0E0038, 0x40000000, +/**/ 0xBD319431, 0x70D45290, +/**/ 0x3F0D0069, 0x217D1965, +/**/ 0xBF0D0034, 0x90000000, +/**/ 0xBD2FC201, 0x022D0EF6, +/**/ 0x3F0C0062, 0x015704B1, +/**/ 0xBF0C0031, 0x00000000, +/**/ 0xBD2C95A0, 0x5E276E21, +/**/ 0x3F0B005B, 0x2133900E, +/**/ 0xBF0B002D, 0x90000000, +/**/ 0xBD29A140, 0xE0372A42, +/**/ 0x3F0A0054, 0x8112A37D, +/**/ 0xBF0A002A, 0x40000000, +/**/ 0xBD26E2E2, 0x73BBB580, +/**/ 0x3F09004E, 0x20F426FB, +/**/ 0xBF090027, 0x10000000, +/**/ 0xBD245885, 0x04D48C20, +/**/ 0x3F080048, 0x00D80288, +/**/ 0xBF080024, 0x00000000, +/**/ 0xBD220028, 0x80613426, +/**/ 0x3F070042, 0x20BE1E23, +/**/ 0xBF070021, 0x10000000, +/**/ 0xBD1FAF99, 0xA80279F3, +/**/ 0x3F06003C, 0x80A661CA, +/**/ 0xBF06001E, 0x40000000, +/**/ 0xBD1BBAE3, 0xDC287DFE, +/**/ 0x3F050037, 0x2090B57C, +/**/ 0xBF05001B, 0x90000000, +/**/ 0xBD181E2F, 0x7B73B67C, +/**/ 0x3F040032, 0x007D0139, +/**/ 0xBF040019, 0x00000000, +/**/ 0xBD14D57C, 0x65A375F8, +/**/ 0x3F03002D, 0x206B2CFF, +/**/ 0xBF030016, 0x90000000, +/**/ 0xBD11DCCA, 0x7BF71EC1, +/**/ 0x3F020028, 0x805B20CD, +/**/ 0xBF020014, 0x40000000, +/**/ 0xBD0E6033, 0x425C4447, +/**/ 0x3F010024, 0x204CC4A3, +/**/ 0xBF010012, 0x10000000, +/**/ 0xBD0996D3, 0x730FFF5C, +/**/ 0x3F000020, 0x00400080, +/**/ 0xBF000010, 0x00000000, +/**/ 0xBD055575, 0x558888DE, +/**/ 0x3EFE0038, 0x406978C6, +/**/ 0xBEFE001C, 0x20000000, +/**/ 0xBD019418, 0xB845146A, +/**/ 0x3EFC0031, 0x0055C096, +/**/ 0xBEFC0018, 0x80000000, +/**/ 0xBCFC957A, 0xD989DB3C, +/**/ 0x3EFA002A, 0x4044A870, +/**/ 0xBEFA0015, 0x20000000, +/**/ 0xBCF6E2C6, 0x8F0EED2F, +/**/ 0x3EF80024, 0x00360051, +/**/ 0xBEF80012, 0x00000000, +/**/ 0xBCF20014, 0x40184CEB, +/**/ 0x3EF6001E, 0x40299839, +/**/ 0xBEF6000F, 0x20000000, +/**/ 0xBCEBBAC7, 0x434A1F5C, +/**/ 0x3EF40019, 0x001F4027, +/**/ 0xBEF4000C, 0x80000000, +/**/ 0xBCE4D568, 0xDD68DD6A, +/**/ 0x3EF20014, 0x4016C81A, +/**/ 0xBEF2000A, 0x20000000, +/**/ 0xBCDE6019, 0xA11710FC, +/**/ 0x3EF00010, 0x00100010, +/**/ 0xBEF00008, 0x00000000, +/**/ 0xBCD55565, 0x5562222D, +/**/ 0x3EEC0018, 0x80157013, +/**/ 0xBEEC000C, 0x40000000, +/**/ 0xBCCC9568, 0x176276C5, +/**/ 0x3EE80012, 0x000D800A, +/**/ 0xBEE80009, 0x00000000, +/**/ 0xBCC2000A, 0x20061337, +/**/ 0x3EE4000C, 0x8007D005, +/**/ 0xBEE40006, 0x40000000, +/**/ 0xBCB4D55F, 0x195A3758, +/**/ 0x3EE00008, 0x00040002, +/**/ 0xBEE00004, 0x00000000, +/**/ 0xBCA5555D, 0x5558888A, +/**/ 0x3ED80009, 0x00036001, +/**/ 0xBED80004, 0x80000000, +/**/ 0xBC920005, 0x100184CD, +/**/ 0x3ED00004, 0x00010000, +/**/ 0xBED00002, 0x00000000, +/**/ 0xBC755559, 0x55562222, +/**/ 0x3EC00002, 0x00004000, +/**/ 0xBEC00001, 0x00000000, +/**/ 0xBC455557, 0x55558889, +/**/ 0x00000000, 0x00000000, +/**/ 0x00000000, 0x00000000, +/**/ 0x00000000, 0x00000000, +/**/ 0xBEBFFFFC, 0x00008000, +/**/ 0x3EBFFFFE, 0x00000000, +/**/ 0x3C455553, 0x55558889, +/**/ 0xBECFFFF8, 0x00020000, +/**/ 0x3ECFFFFC, 0x00000000, +/**/ 0x3C755551, 0x55562222, +/**/ 0xBED7FFF7, 0x00035FFF, +/**/ 0x3ED7FFFB, 0x80000000, +/**/ 0x3C91FFFA, 0xF00184CC, +/**/ 0xBEDFFFF0, 0x0007FFFC, +/**/ 0x3EDFFFF8, 0x00000000, +/**/ 0x3CA5554D, 0x55588887, +/**/ 0xBEE3FFF3, 0x8007CFFB, +/**/ 0x3EE3FFF9, 0xC0000000, +/**/ 0x3CB4D54B, 0x915A3753, +/**/ 0xBEE7FFEE, 0x000D7FF6, +/**/ 0x3EE7FFF7, 0x00000000, +/**/ 0x3CC1FFF5, 0xE006132F, +/**/ 0xBEEBFFE7, 0x80156FED, +/**/ 0x3EEBFFF3, 0xC0000000, +/**/ 0x3CCC9542, 0x936276B2, +/**/ 0xBEEFFFE0, 0x001FFFE0, +/**/ 0x3EEFFFF0, 0x00000000, +/**/ 0x3CD55545, 0x55622217, +/**/ 0xBEF1FFEB, 0xC016C7E6, +/**/ 0x3EF1FFF5, 0xE0000000, +/**/ 0x3CDE5FE6, 0x5F1710D1, +/**/ 0xBEF3FFE7, 0x001F3FD9, +/**/ 0x3EF3FFF3, 0x80000000, +/**/ 0x3CE4D541, 0xCD68DD41, +/**/ 0xBEF5FFE1, 0xC02997C7, +/**/ 0x3EF5FFF0, 0xE0000000, +/**/ 0x3CEBBA8E, 0x124A1F13, +/**/ 0xBEF7FFDC, 0x0035FFAF, +/**/ 0x3EF7FFEE, 0x00000000, +/**/ 0x3CF1FFEB, 0xC0184CAE, +/**/ 0xBEF9FFD5, 0xC044A790, +/**/ 0x3EF9FFEA, 0xE0000000, +/**/ 0x3CF6E28E, 0xC68EECCD, +/**/ 0xBEFBFFCF, 0x0055BF6A, +/**/ 0x3EFBFFE7, 0x80000000, +/**/ 0x3CFC952F, 0xD189DAA2, +/**/ 0xBEFDFFC7, 0xC069773A, +/**/ 0x3EFDFFE3, 0xE0000000, +/**/ 0x3D0193E7, 0x480513F6, +/**/ 0xBEFFFFC0, 0x007FFF00, +/**/ 0x3EFFFFE0, 0x00000000, +/**/ 0x3D055535, 0x55888833, +/**/ 0xBF00FFDB, 0xE04CC35D, +/**/ 0x3F00FFED, 0xF0000000, +/**/ 0x3D099681, 0xE2CFFE66, +/**/ 0xBF01FFD7, 0x805B1F33, +/**/ 0x3F01FFEB, 0xC0000000, +/**/ 0x3D0E5FCC, 0xBE5C42ED, +/**/ 0xBF02FFD2, 0xE06B2B01, +/**/ 0x3F02FFE9, 0x70000000, +/**/ 0x3D11DC8A, 0xD9D71DD1, +/**/ 0xBF03FFCE, 0x007CFEC8, +/**/ 0x3F03FFE7, 0x00000000, +/**/ 0x3D14D52E, 0x45A374B3, +/**/ 0xBF04FFC8, 0xE090B284, +/**/ 0x3F04FFE4, 0x70000000, +/**/ 0x3D181DD0, 0x8553B4C7, +/**/ 0xBF05FFC3, 0x80A65E36, +/**/ 0x3F05FFE1, 0xC0000000, +/**/ 0x3D1BBA71, 0x7A287BBE, +/**/ 0xBF06FFBD, 0xE0BE19DD, +/**/ 0x3F06FFDE, 0xF0000000, +/**/ 0x3D1FAF11, 0x03E27702, +/**/ 0xBF07FFB8, 0x00D7FD78, +/**/ 0x3F07FFDC, 0x00000000, +/**/ 0x3D21FFD7, 0x80613240, +/**/ 0xBF08FFB1, 0xE0F42105, +/**/ 0x3F08FFD8, 0xF0000000, +/**/ 0x3D245825, 0xA6C489B3, +/**/ 0xBF09FFAB, 0x81129C84, +/**/ 0x3F09FFD5, 0xC0000000, +/**/ 0x3D26E272, 0xE2BBB26F, +/**/ 0xBF0AFFA4, 0xE13387F2, +/**/ 0x3F0AFFD2, 0x70000000, +/**/ 0x3D29A0BF, 0x21272669, +/**/ 0xBF0BFF9E, 0x0156FB50, +/**/ 0x3F0BFFCF, 0x00000000, +/**/ 0x3D2C950A, 0x4E276957, +/**/ 0xBF0CFF96, 0xE17D0E9B, +/**/ 0x3F0CFFCB, 0x70000000, +/**/ 0x3D2FC154, 0x551D090E, +/**/ 0xBF0DFF8F, 0x81A5D9D2, +/**/ 0x3F0DFFC7, 0xC0000000, +/**/ 0x3D3193CE, 0x90544EF1, +/**/ 0xBF0EFF87, 0xE1D174F4, +/**/ 0x3F0EFFC3, 0xF0000000, +/**/ 0x3D3364F2, 0x4D556583, +/**/ 0xBF0FFF80, 0x01FFF800, +/**/ 0x3F0FFFC0, 0x00000000, +/**/ 0x3D355515, 0x56221F78, +/**/ 0xBF107FBB, 0xF118BD7A, +/**/ 0x3F107FDD, 0xF8000000, +/**/ 0x3D376537, 0x9EEAD9D8, +/**/ 0xBF10FFB7, 0xC1330AE7, +/**/ 0x3F10FFDB, 0xE0000000, +/**/ 0x3D399659, 0x1B7FF7AE, +/**/ 0xBF117FB3, 0x714EF047, +/**/ 0x3F117FD9, 0xB8000000, +/**/ 0x3D3BE979, 0xBF51E233, +/**/ 0xBF11FFAF, 0x016C7998, +/**/ 0x3F11FFD7, 0x80000000, +/**/ 0x3D3E5F99, 0x7D7108FF, +/**/ 0xBF127FAA, 0x718BB2DA, +/**/ 0x3F127FD5, 0x39000000, +/**/ 0xBD3F0647, 0xB7721DC6, +/**/ 0xBF12FFA5, 0xC1ACA80C, +/**/ 0x3F12FFD2, 0xE1000000, +/**/ 0xBD3C4729, 0xED071532, +/**/ 0xBF137FA0, 0xF1CF652D, +/**/ 0x3F137FD0, 0x79000000, +/**/ 0xBD39620D, 0x315D596D, +/**/ 0xBF13FF9C, 0x01F3F63C, +/**/ 0x3F13FFCE, 0x01000000, +/**/ 0xBD3655F1, 0x92E45F81, +/**/ 0xBF147F96, 0xF21A6739, +/**/ 0x3F147FCB, 0x79000000, +/**/ 0xBD3321D7, 0x206B9526, +/**/ 0xBF14FF91, 0xC242C421, +/**/ 0x3F14FFC8, 0xE1000000, +/**/ 0xBD2F897B, 0xD244C12A, +/**/ 0xBF157F8C, 0x726D18F6, +/**/ 0x3F157FC6, 0x39000000, +/**/ 0xBD287B4B, 0xF93040AE, +/**/ 0xBF15FF87, 0x029971B4, +/**/ 0x3F15FFC3, 0x81000000, +/**/ 0xBD21171E, 0xD578562C, +/**/ 0xBF167F81, 0x72C7DA5C, +/**/ 0x3F167FC0, 0xB9000000, +/**/ 0xBD12B5E9, 0x0F773DB4, +/**/ 0xBF16FF7B, 0xC2F85EEC, +/**/ 0x3F16FFBD, 0xE1000000, +/**/ 0xBCE44CD3, 0x158A76C2, +/**/ 0xBF177F75, 0xF32B0B63, +/**/ 0x3F177FBA, 0xF9000000, +/**/ 0x3D0CB55C, 0x2E48511B, +/**/ 0xBF17FF70, 0x035FEBC0, +/**/ 0x3F17FFB8, 0x01000000, +/**/ 0x3D1FFAF0, 0x184C534F, +/**/ 0xBF187F69, 0xF3970C03, +/**/ 0x3F187FB4, 0xF9000000, +/**/ 0x3D292D95, 0xACC53FBE, +/**/ 0xBF18FF63, 0xC3D07829, +/**/ 0x3F18FFB1, 0xE1000000, +/**/ 0x3D315FD7, 0xE48887C8, +/**/ 0xBF197F5D, 0x740C3C32, +/**/ 0x3F197FAE, 0xB9000000, +/**/ 0x3D365AE3, 0x1DF5B242, +/**/ 0xBF19FF57, 0x044A641C, +/**/ 0x3F19FFAB, 0x81000000, +/**/ 0x3D3B88EC, 0x6FBB0E5F, +/**/ 0xBF1A7F50, 0x748AFBE7, +/**/ 0x3F1A7FA8, 0x3A000000, +/**/ 0xBD3F150C, 0x39766B40, +/**/ 0xBF1AFF49, 0xC4CE0F91, +/**/ 0x3F1AFFA4, 0xE2000000, +/**/ 0xBD397E06, 0xF14DB839, +/**/ 0xBF1B7F42, 0xF513AB19, +/**/ 0x3F1B7FA1, 0x7A000000, +/**/ 0xBD33B103, 0xCBD9CC3D, +/**/ 0xBF1BFF3C, 0x055BDA7D, +/**/ 0x3F1BFF9E, 0x02000000, +/**/ 0xBD2B5A05, 0xBB1321B5, +/**/ 0xBF1C7F34, 0xF5A6A9BD, +/**/ 0x3F1C7F9A, 0x7A000000, +/**/ 0xBD1DC410, 0xECAF9551, +/**/ 0xBF1CFF2D, 0xC5F424D6, +/**/ 0x3F1CFF96, 0xE2000000, +/**/ 0xBCEF80FF, 0x3DF3CD68, +/**/ 0xBF1D7F26, 0x764457C8, +/**/ 0x3F1D7F93, 0x3A000000, +/**/ 0x3D16CBC7, 0x4271E737, +/**/ 0xBF1DFF1F, 0x06974E91, +/**/ 0x3F1DFF8F, 0x82000000, +/**/ 0x3D2939D2, 0x1D134848, +/**/ 0xBF1E7F17, 0x76ED1530, +/**/ 0x3F1E7F8B, 0xBA000000, +/**/ 0x3D33C2DD, 0xA9892C73, +/**/ 0xBF1EFF0F, 0xC745B7A4, +/**/ 0x3F1EFF87, 0xE2000000, +/**/ 0x3D3B25CF, 0x8AEC69D5, +/**/ 0xBF1F7F07, 0xF7A141EA, +/**/ 0x3F1F7F83, 0xFB000000, +/**/ 0xBD3D3941, 0x645B412A, +/**/ 0xBF1FFF00, 0x07FFC002, +/**/ 0x3F1FFF80, 0x03000000, +/**/ 0xBD355955, 0x3BBC6662, +/**/ 0xBF203F7B, 0xFC309EF5, +/**/ 0x3F203FBD, 0xFD800000, +/**/ 0xBD2A72D8, 0x260B17B3, +/**/ 0xBF207F77, 0xE462E3D0, +/**/ 0x3F207FBB, 0xF1800000, +/**/ 0xBD136218, 0x0994AE68, +/**/ 0xBF20BF73, 0xBC96B492, +/**/ 0x3F20BFB9, 0xDD800000, +/**/ 0x3D0E52E6, 0xECB2641F, +/**/ 0xBF20FF6F, 0x84CC1739, +/**/ 0x3F20FFB7, 0xC1800000, +/**/ 0x3D296078, 0xE7FCF60B, +/**/ 0xBF213F6B, 0x3D0311C6, +/**/ 0x3F213FB5, 0x9D800000, +/**/ 0x3D35DA18, 0xA7850AFF, +/**/ 0xBF217F66, 0xE53BAA36, +/**/ 0x3F217FB3, 0x71800000, +/**/ 0x3D3F48F1, 0x5E7BB444, +/**/ 0xBF21BF62, 0x7D75E68A, +/**/ 0x3F21BFB1, 0x3E000000, +/**/ 0xBD370239, 0x812BC469, +/**/ 0xBF21FF5E, 0x05B1CCC0, +/**/ 0x3F21FFAF, 0x02000000, +/**/ 0xBD2A0CD0, 0x23BF1A4D, +/**/ 0xBF223F59, 0x7DEF62D8, +/**/ 0x3F223FAC, 0xBE000000, +/**/ 0xBD0614D3, 0x736E3623, +/**/ 0xBF227F54, 0xE62EAED0, +/**/ 0x3F227FAA, 0x72000000, +/**/ 0x3D1F28BD, 0x37EDEDB0, +/**/ 0xBF22BF50, 0x3E6FB6A9, +/**/ 0x3F22BFA8, 0x1E000000, +/**/ 0x3D32A0F5, 0x07CE33C8, +/**/ 0xBF22FF4B, 0x86B28060, +/**/ 0x3F22FFA5, 0xC2000000, +/**/ 0x3D3DC2B6, 0xA31C6A8D, +/**/ 0xBF233F46, 0xBEF711F6, +/**/ 0x3F233FA3, 0x5E800000, +/**/ 0xBD36CF8B, 0xFC67C9FB, +/**/ 0xBF237F41, 0xE73D7169, +/**/ 0x3F237FA0, 0xF2800000, +/**/ 0xBD2629A5, 0xE6D88A89, +/**/ 0xBF23BF3C, 0xFF85A4B8, +/**/ 0x3F23BF9E, 0x7E800000, +/**/ 0x3CEE7C34, 0x202574EC, +/**/ 0xBF23FF38, 0x07CFB1E3, +/**/ 0x3F23FF9C, 0x02800000, +/**/ 0x3D2A9723, 0x46E594C1, +/**/ 0xBF243F33, 0x001B9EE8, +/**/ 0x3F243F99, 0x7E800000, +/**/ 0x3D39F33C, 0xF61AE74C, +/**/ 0xBF247F2D, 0xE86971C7, +/**/ 0x3F247F96, 0xF3000000, +/**/ 0xBD39141C, 0x85341E31, +/**/ 0xBF24BF28, 0xC0B9307F, +/**/ 0x3F24BF94, 0x5F000000, +/**/ 0xBD2792F5, 0xDA0FAF09, +/**/ 0xBF24FF23, 0x890AE10E, +/**/ 0x3F24FF91, 0xC3000000, +/**/ 0x3CFD4219, 0xFB239430, +/**/ 0xBF253F1E, 0x415E8974, +/**/ 0x3F253F8F, 0x1F000000, +/**/ 0x3D2F8B72, 0x0359434A, +/**/ 0xBF257F18, 0xE9B42FAF, +/**/ 0x3F257F8C, 0x73000000, +/**/ 0x3D3E0C4B, 0x1939FEDF, +/**/ 0xBF25BF13, 0x820BD9BF, +/**/ 0x3F25BF89, 0xBF800000, +/**/ 0xBD335728, 0x39B301E2, +/**/ 0xBF25FF0E, 0x0A658DA3, +/**/ 0x3F25FF87, 0x03800000, +/**/ 0xBD118E84, 0x5E1E8D4F, +/**/ 0xBF263F08, 0x82C15159, +/**/ 0x3F263F84, 0x3F800000, +/**/ 0x3D25CFC0, 0xBDDDD045, +/**/ 0xBF267F02, 0xEB1F2AE1, +/**/ 0x3F267F81, 0x73800000, +/**/ 0x3D3A8C5C, 0x08837E99, +/**/ 0xBF26BEFD, 0x437F203A, +/**/ 0x3F26BF7E, 0xA0000000, +/**/ 0xBD35752E, 0x3C56F12D, +/**/ 0xBF26FEF7, 0x8BE13762, +/**/ 0x3F26FF7B, 0xC4000000, +/**/ 0xBD146EFA, 0x46359E28, +/**/ 0xBF273EF1, 0xC4457659, +/**/ 0x3F273F78, 0xE0000000, +/**/ 0x3D273355, 0xCD265865, +/**/ 0xBF277EEB, 0xECABE31C, +/**/ 0x3F277F75, 0xF4000000, +/**/ 0x3D3CAC0E, 0x095DEBF8, +/**/ 0xBF27BEE6, 0x051483AC, +/**/ 0x3F27BF73, 0x00800000, +/**/ 0xBD31E395, 0x4C39F4DB, +/**/ 0xBF27FEE0, 0x0D7F5E08, +/**/ 0x3F27FF70, 0x04800000, +/**/ 0xBCB43F3D, 0xA1314B81, +/**/ 0xBF283EDA, 0x05EC782D, +/**/ 0x3F283F6D, 0x00800000, +/**/ 0x3D321B10, 0x115B8D70, +/**/ 0xBF287ED3, 0xEE5BD81B, +/**/ 0x3F287F69, 0xF5000000, +/**/ 0xBD3B54A7, 0x83704FE1, +/**/ 0xBF28BECD, 0xC6CD83D1, +/**/ 0x3F28BF66, 0xE1000000, +/**/ 0xBD20C4CC, 0x41229C91, +/**/ 0xBF28FEC7, 0x8F41814D, +/**/ 0x3F28FF63, 0xC5000000, +/**/ 0x3D25E5A8, 0x2A183F17, +/**/ 0xBF293EC1, 0x47B7D68F, +/**/ 0x3F293F60, 0xA1000000, +/**/ 0x3D3EAC06, 0xF81B997D, +/**/ 0xBF297EBA, 0xF0308995, +/**/ 0x3F297F5D, 0x75800000, +/**/ 0xBD2A6B9B, 0x3A1E5BAD, +/**/ 0xBF29BEB4, 0x88ABA05E, +/**/ 0x3F29BF5A, 0x41800000, +/**/ 0x3D1D3958, 0xBDFE3C77, +/**/ 0xBF29FEAE, 0x112920E9, +/**/ 0x3F29FF57, 0x05800000, +/**/ 0x3D3C3972, 0x375BA904, +/**/ 0xBF2A3EA7, 0x89A91135, +/**/ 0x3F2A3F53, 0xC2000000, +/**/ 0xBD2CE6F3, 0x588DE85B, +/**/ 0xBF2A7EA0, 0xF22B7740, +/**/ 0x3F2A7F50, 0x76000000, +/**/ 0x3D1D2249, 0x75AEDBFD, +/**/ 0xBF2ABE9A, 0x4AB05909, +/**/ 0x3F2ABF4D, 0x22000000, +/**/ 0x3D3D6E96, 0x2CE7BDAC, +/**/ 0xBF2AFE93, 0x9337BC90, +/**/ 0x3F2AFF49, 0xC6800000, +/**/ 0xBD2800DC, 0xCB7D724C, +/**/ 0xBF2B3E8C, 0xCBC1A7D1, +/**/ 0x3F2B3F46, 0x62800000, +/**/ 0x3D25F908, 0xFA591B29, +/**/ 0xBF2B7E85, 0xF44E20CE, +/**/ 0x3F2B7F42, 0xF7000000, +/**/ 0xBD3D9991, 0x53021ED8, +/**/ 0xBF2BBE7F, 0x0CDD2D83, +/**/ 0x3F2BBF3F, 0x83000000, +/**/ 0xBD1706BF, 0xFD596AD6, +/**/ 0xBF2BFE78, 0x156ED3F0, +/**/ 0x3F2BFF3C, 0x07000000, +/**/ 0x3D328528, 0x4EC45253, +/**/ 0xBF2C3E71, 0x0E031A14, +/**/ 0x3F2C3F38, 0x83800000, +/**/ 0xBD34C408, 0x927D8A9E, +/**/ 0xBF2C7E69, 0xF69A05ED, +/**/ 0x3F2C7F34, 0xF7800000, +/**/ 0x3D118EF4, 0xCAE2C25F, +/**/ 0xBF2CBE62, 0xCF339D7A, +/**/ 0x3F2CBF31, 0x63800000, +/**/ 0x3D3DFD79, 0x73DBBB41, +/**/ 0xBF2CFE5B, 0x97CFE6B9, +/**/ 0x3F2CFF2D, 0xC8000000, +/**/ 0xBD1FD74F, 0xE7FE77E6, +/**/ 0xBF2D3E54, 0x506EE7AA, +/**/ 0x3F2D3F2A, 0x24000000, +/**/ 0x3D328AD4, 0xBDDB871F, +/**/ 0xBF2D7E4C, 0xF910A64A, +/**/ 0x3F2D7F26, 0x78800000, +/**/ 0xBD327F8C, 0x903DDD81, +/**/ 0xBF2DBE45, 0x91B52899, +/**/ 0x3F2DBF22, 0xC4800000, +/**/ 0x3D21D80F, 0xDF52840A, +/**/ 0xBF2DFE3E, 0x1A5C7495, +/**/ 0x3F2DFF1F, 0x09000000, +/**/ 0xBD3B316D, 0xEED9F651, +/**/ 0xBF2E3E36, 0x9306903D, +/**/ 0x3F2E3F1B, 0x45000000, +/**/ 0x3CF2911A, 0x76DB3C6B, +/**/ 0xBF2E7E2E, 0xFBB3818F, +/**/ 0x3F2E7F17, 0x79000000, +/**/ 0x3D3DFC86, 0x85559113, +/**/ 0xBF2EBE27, 0x54634E89, +/**/ 0x3F2EBF13, 0xA5800000, +/**/ 0xBD12D83E, 0x0AB3DBE7, +/**/ 0xBF2EFE1F, 0x9D15FD2B, +/**/ 0x3F2EFF0F, 0xC9800000, +/**/ 0x3D39124F, 0x617B99F1, +/**/ 0xBF2F3E17, 0xD5CB9373, +/**/ 0x3F2F3F0B, 0xE6000000, +/**/ 0xBD2152B9, 0xF8F64DA1, +/**/ 0xBF2F7E0F, 0xFE841760, +/**/ 0x3F2F7F07, 0xFA000000, +/**/ 0x3D3617EB, 0x34C4735B, +/**/ 0xBF2FBE08, 0x173F8EEF, +/**/ 0x3F2FBF04, 0x06800000, +/**/ 0xBD2551B0, 0x739FA712, +/**/ 0xBF2FFE00, 0x1FFE0020, +/**/ 0x3F2FFF00, 0x0A800000, +/**/ 0x3D351558, 0x885DE027, +/**/ 0xBF301EFC, 0x0C5FB879, +/**/ 0x3F301F7E, 0x03800000, +/**/ 0xBD255905, 0x68F8FC50, +/**/ 0xBF303EF8, 0x00C1F3B0, +/**/ 0x3F303F7B, 0xFD800000, +/**/ 0x3D361295, 0xDF771CF4, +/**/ 0xBF305EF3, 0xED25B4B7, +/**/ 0x3F305F79, 0xF3C00000, +/**/ 0xBD2158BB, 0xD8A255DB, +/**/ 0xBF307EEF, 0xD18AFE8B, +/**/ 0x3F307F77, 0xE5C00000, +/**/ 0x3D3917A1, 0xB740E625, +/**/ 0xBF309EEB, 0xADF1D42C, +/**/ 0x3F309F75, 0xD4000000, +/**/ 0xBD1281AD, 0x9C716D59, +/**/ 0xBF30BEE7, 0x825A3899, +/**/ 0x3F30BF73, 0xBE000000, +/**/ 0x3D3E2C7A, 0x86ED7DDC, +/**/ 0xBF30DEE3, 0x4EC42ED1, +/**/ 0x3F30DF71, 0xA4400000, +/**/ 0x3CF7F534, 0xF54F7E28, +/**/ 0xBF30FEDF, 0x132FB9D5, +/**/ 0x3F30FF6F, 0x86800000, +/**/ 0xBD3AA6E1, 0x404F4E01, +/**/ 0xBF311EDA, 0xCF9CDCA2, +/**/ 0x3F311F6D, 0x64800000, +/**/ 0x3D2375B9, 0x4A6EC981, +/**/ 0xBF313ED6, 0x840B9A38, +/**/ 0x3F313F6B, 0x3EC00000, +/**/ 0xBD315A73, 0x33401DD0, +/**/ 0xBF315ED2, 0x307BF596, +/**/ 0x3F315F69, 0x14C00000, +/**/ 0x3D341A2F, 0x02C11605, +/**/ 0xBF317ECD, 0xD4EDF1BC, +/**/ 0x3F317F66, 0xE7000000, +/**/ 0xBD1798F3, 0xB2B7E8C5, +/**/ 0xBF319EC9, 0x716191A8, +/**/ 0x3F319F64, 0xB5400000, +/**/ 0xBD3F5AB7, 0x35D62ED5, +/**/ 0xBF31BEC5, 0x05D6D85A, +/**/ 0x3F31BF62, 0x7F400000, +/**/ 0x3D1EF6FF, 0xCA7EC7CD, +/**/ 0xBF31DEC0, 0x924DC8D2, +/**/ 0x3F31DF60, 0x45800000, +/**/ 0xBD309BD7, 0xA8550396, +/**/ 0xBF31FEBC, 0x16C6660D, +/**/ 0x3F31FF5E, 0x07800000, +/**/ 0x3D379981, 0xC3E31F70, +/**/ 0xBF321EB7, 0x9340B30B, +/**/ 0x3F321F5B, 0xC5C00000, +/**/ 0x3CD7B300, 0x5FE92B94, +/**/ 0xBF323EB3, 0x07BCB2CC, +/**/ 0x3F323F59, 0x80000000, +/**/ 0xBD364AF9, 0x25A7CF34, +/**/ 0xBF325EAE, 0x743A684F, +/**/ 0x3F325F57, 0x36000000, +/**/ 0x3D339D32, 0x17E48399, +/**/ 0xBF327EA9, 0xD8B9D692, +/**/ 0x3F327F54, 0xE8400000, +/**/ 0xBCFE7B27, 0xCC387BD1, +/**/ 0xBF329EA5, 0x353B0095, +/**/ 0x3F329F52, 0x96800000, +/**/ 0xBD36D8A7, 0x1AE7FA80, +/**/ 0xBF32BEA0, 0x89BDE957, +/**/ 0x3F32BF50, 0x40800000, +/**/ 0x3D34CB54, 0x05CF3DC3, +/**/ 0xBF32DE9B, 0xD64293D7, +/**/ 0x3F32DF4D, 0xE6C00000, +/**/ 0x3CF053EA, 0xD5A4F691, +/**/ 0xBF32FE97, 0x1AC90315, +/**/ 0x3F32FF4B, 0x89000000, +/**/ 0xBD3229E7, 0x5CAE7B16, +/**/ 0xBF331E92, 0x57513A0F, +/**/ 0x3F331F49, 0x27000000, +/**/ 0x3D3B3EE1, 0xAEED4509, +/**/ 0xBF333E8D, 0x8BDB3BC4, +/**/ 0x3F333F46, 0xC1400000, +/**/ 0x3D228133, 0x2E0C2605, +/**/ 0xBF335E88, 0xB8670B34, +/**/ 0x3F335F44, 0x57800000, +/**/ 0xBD20477F, 0xBBD6E280, +/**/ 0xBF337E83, 0xDCF4AB5D, +/**/ 0x3F337F41, 0xE9C00000, +/**/ 0xBD38ED2A, 0xE9CE8AFC, +/**/ 0xBF339E7E, 0xF9841F3F, +/**/ 0x3F339F3F, 0x77C00000, +/**/ 0x3D36E558, 0x39159F9B, +/**/ 0xBF33BE7A, 0x0E1569D9, +/**/ 0x3F33BF3D, 0x02000000, +/**/ 0x3D1D5325, 0x40681634, +/**/ 0xBF33DE75, 0x1AA88E2A, +/**/ 0x3F33DF3A, 0x88400000, +/**/ 0xBD1E775F, 0x7F2112CE, +/**/ 0xBF33FE70, 0x1F3D8F31, +/**/ 0x3F33FF38, 0x0A800000, +/**/ 0xBD35F18B, 0x91F80D1B, +/**/ 0xBF341E6B, 0x1BD46FED, +/**/ 0x3F341F35, 0x88800000, +/**/ 0x3D3C5AAD, 0xFDC3FC2F, +/**/ 0xBF343E66, 0x106D335D, +/**/ 0x3F343F33, 0x02C00000, +/**/ 0x3D2E8FA9, 0x268A89F1, +/**/ 0xBF345E60, 0xFD07DC80, +/**/ 0x3F345F30, 0x79000000, +/**/ 0x3D06B73F, 0x902AC9EE, +/**/ 0xBF347E5B, 0xE1A46E55, +/**/ 0x3F347F2D, 0xEB400000, +/**/ 0xBD21EE30, 0x45C43959, +/**/ 0xBF349E56, 0xBE42EBDC, +/**/ 0x3F349F2B, 0x59800000, +/**/ 0xBD34212B, 0xE8B753E8, +/**/ 0xBF34BE51, 0x92E35813, +/**/ 0x3F34BF28, 0xC3C00000, +/**/ 0xBD3EA653, 0x9D2064DB, +/**/ 0xBF34DE4C, 0x5F85B5F9, +/**/ 0x3F34DF26, 0x29C00000, +/**/ 0x3D377A70, 0x81DCB6FB, +/**/ 0xBF34FE47, 0x242A088D, +/**/ 0x3F34FF23, 0x8C000000, +/**/ 0x3D2C8440, 0x6BB44A6D, +/**/ 0xBF351E41, 0xE0D052CF, +/**/ 0x3F351F20, 0xEA400000, +/**/ 0x3D16C6ED, 0x0048AAF8, +/**/ 0xBF353E3C, 0x957897BD, +/**/ 0x3F353F1E, 0x44800000, +/**/ 0xBD01ADF4, 0xF506A07E, +/**/ 0xBF355E37, 0x4222DA57, +/**/ 0x3F355F1B, 0x9AC00000, +/**/ 0xBD22E69B, 0x4B88A655, +/**/ 0xBF357E31, 0xE6CF1D9B, +/**/ 0x3F357F18, 0xED000000, +/**/ 0xBD3005F2, 0x153DAEB0, +/**/ 0xBF359E2C, 0x837D6488, +/**/ 0x3F359F16, 0x3B400000, +/**/ 0xBD35ECAC, 0x2D5222B4, +/**/ 0xBF35BE27, 0x182DB21E, +/**/ 0x3F35BF13, 0x85800000, +/**/ 0xBD3B267C, 0x2EA6CB14, +/**/ 0xBF35DE21, 0xA4E0095B, +/**/ 0x3F35DF10, 0xCBC00000, +/**/ 0xBD3FB262, 0x5A40A340, +/**/ 0xBF35FE1C, 0x29946D3F, +/**/ 0x3F35FF0E, 0x0DC00000, +/**/ 0x3D3C70A1, 0x0E7B79ED, +/**/ 0xBF361E16, 0xA64AE0C7, +/**/ 0x3F361F0B, 0x4C000000, +/**/ 0x3D39438D, 0xC9C8D263, +/**/ 0xBF363E11, 0x1B0366F4, +/**/ 0x3F363F08, 0x86400000, +/**/ 0x3D36C763, 0x9582CD0C, +/**/ 0xBF365E0B, 0x87BE02C5, +/**/ 0x3F365F05, 0xBC800000, +/**/ 0x3D34FD22, 0x2F24F1F9, +/**/ 0xBF367E05, 0xEC7AB737, +/**/ 0x3F367F02, 0xEEC00000, +/**/ 0x3D33E5C9, 0x53CAEA94, +/**/ 0xBF369E00, 0x4939874A, +/**/ 0x3F369F00, 0x1D000000, +/**/ 0x3D338258, 0xC03081D0, +/**/ 0xBF36BDFA, 0x9DFA75FE, +/**/ 0x3F36BEFD, 0x47400000, +/**/ 0x3D33D3D0, 0x30B1A458, +/**/ 0xBF36DDF4, 0xEABD8651, +/**/ 0x3F36DEFA, 0x6D800000, +/**/ 0x3D34DB2F, 0x614A60C1, +/**/ 0xBF36FDEF, 0x2F82BB41, +/**/ 0x3F36FEF7, 0x8FC00000, +/**/ 0x3D369976, 0x0D96E7B8, +/**/ 0xBF371DE9, 0x6C4A17CF, +/**/ 0x3F371EF4, 0xAE000000, +/**/ 0x3D390FA3, 0xF0D38C30, +/**/ 0xBF373DE3, 0xA1139EF8, +/**/ 0x3F373EF1, 0xC8400000, +/**/ 0x3D3C3EB8, 0xC5DCC397, +/**/ 0xBF375DDD, 0xCDDF53BC, +/**/ 0x3F375EEE, 0xDEC00000, +/**/ 0xBD3FD84B, 0xB8D0D9FD, +/**/ 0xBF377DD7, 0xF2AD3919, +/**/ 0x3F377EEB, 0xF1000000, +/**/ 0xBD3B3469, 0xD11891A0, +/**/ 0xBF379DD2, 0x0F7D520F, +/**/ 0x3F379EE8, 0xFF400000, +/**/ 0xBD35D4A1, 0xC93D855B, +/**/ 0xBF37BDCC, 0x244FA19D, +/**/ 0x3F37BEE6, 0x09800000, +/**/ 0xBD2F6FE7, 0xCFC56806, +/**/ 0xBF37DDC6, 0x31242AC1, +/**/ 0x3F37DEE3, 0x0FC00000, +/**/ 0xBD21BAC0, 0xE815F202, +/**/ 0xBF37FDC0, 0x35FAF079, +/**/ 0x3F37FEE0, 0x12000000, +/**/ 0xBCF43E7B, 0x5190C28B, +/**/ 0xBF381DBA, 0x32D3F5C6, +/**/ 0x3F381EDD, 0x10400000, +/**/ 0x3D1C55D8, 0x34C1F9E9, +/**/ 0xBF383DB4, 0x27AF3DA6, +/**/ 0x3F383EDA, 0x0A800000, +/**/ 0x3D302FB8, 0x8AAF36D4, +/**/ 0xBF385DAE, 0x148CCB18, +/**/ 0x3F385ED7, 0x00C00000, +/**/ 0x3D3A0BDF, 0x7AE0D0F8, +/**/ 0xBF387DA7, 0xF96CA11B, +/**/ 0x3F387ED3, 0xF3400000, +/**/ 0xBD3B5515, 0x6B1CDAAF, +/**/ 0xBF389DA1, 0xD64EC2AD, +/**/ 0x3F389ED0, 0xE1800000, +/**/ 0xBD2FE44C, 0xE1179E5E, +/**/ 0xBF38BD9B, 0xAB3332CD, +/**/ 0x3F38BECD, 0xCBC00000, +/**/ 0xBD0E529E, 0xF86F56EC, +/**/ 0xBF38DD95, 0x7819F47A, +/**/ 0x3F38DECA, 0xB2000000, +/**/ 0x3D2246C3, 0xFEB631AB, +/**/ 0xBF38FD8F, 0x3D030AB4, +/**/ 0x3F38FEC7, 0x94400000, +/**/ 0x3D36D7FA, 0xE04DA791, +/**/ 0xBF391D88, 0xF9EE7878, +/**/ 0x3F391EC4, 0x72C00000, +/**/ 0xBD3AAB89, 0x86F7ADBB, +/**/ 0xBF393D82, 0xAEDC40C7, +/**/ 0x3F393EC1, 0x4D000000, +/**/ 0xBD26CC57, 0x032C6155, +/**/ 0xBF395D7C, 0x5BCC669D, +/**/ 0x3F395EBE, 0x23400000, +/**/ 0x3D12A452, 0x93C3EB3D, +/**/ 0xBF397D76, 0x00BEECFB, +/**/ 0x3F397EBA, 0xF5800000, +/**/ 0x3D358336, 0xA0BCD695, +/**/ 0xBF399D6F, 0x9DB3D6E0, +/**/ 0x3F399EB7, 0xC4000000, +/**/ 0xBD38D6C5, 0xDA737570, +/**/ 0xBF39BD69, 0x32AB2749, +/**/ 0x3F39BEB4, 0x8E400000, +/**/ 0xBD198F84, 0x65026C7D, +/**/ 0xBF39DD62, 0xBFA4E136, +/**/ 0x3F39DEB1, 0x54800000, +/**/ 0x3D29B9C9, 0x2EA9B41A, +/**/ 0xBF39FD5C, 0x44A107A5, +/**/ 0x3F39FEAE, 0x17000000, +/**/ 0xBD3F1375, 0x16137ACF, +/**/ 0xBF3A1D55, 0xC19F9D96, +/**/ 0x3F3A1EAA, 0xD5400000, +/**/ 0xBD2467DC, 0xDE73AFA0, +/**/ 0xBF3A3D4F, 0x36A0A607, +/**/ 0x3F3A3EA7, 0x8F800000, +/**/ 0x3D26F8F0, 0x7B8357C6, +/**/ 0xBF3A5D48, 0xA3A423F7, +/**/ 0x3F3A5EA4, 0x46000000, +/**/ 0xBD3E0141, 0x5DA0DFB7, +/**/ 0xBF3A7D42, 0x08AA1A64, +/**/ 0x3F3A7EA0, 0xF8400000, +/**/ 0xBD1AB06E, 0x41050D29, +/**/ 0xBF3A9D3B, 0x65B28C4E, +/**/ 0x3F3A9E9D, 0xA6800000, +/**/ 0x3D317CE9, 0x56A0E005, +/**/ 0xBF3ABD34, 0xBABD7CB3, +/**/ 0x3F3ABE9A, 0x51000000, +/**/ 0xBD358532, 0xF899EF39, +/**/ 0xBF3ADD2E, 0x07CAEE92, +/**/ 0x3F3ADE96, 0xF7400000, +/**/ 0x3D113A3C, 0xC83BF5C2, +/**/ 0xBF3AFD27, 0x4CDAE4EA, +/**/ 0x3F3AFE93, 0x99800000, +/**/ 0x3D3EF92F, 0x863C7C8E, +/**/ 0xBF3B1D20, 0x89ED62B9, +/**/ 0x3F3B1E90, 0x38000000, +/**/ 0xBD161149, 0x3341CC3C, +/**/ 0xBF3B3D19, 0xBF026AFE, +/**/ 0x3F3B3E8C, 0xD2400000, +/**/ 0x3D36D709, 0x67C955DF, +/**/ 0xBF3B5D12, 0xEC1A00B8, +/**/ 0x3F3B5E89, 0x68C00000, +/**/ 0xBD27E77B, 0x5AE9B17A, +/**/ 0xBF3B7D0C, 0x113426E6, +/**/ 0x3F3B7E85, 0xFB000000, +/**/ 0x3D321C58, 0x219679DE, +/**/ 0xBF3B9D05, 0x2E50E086, +/**/ 0x3F3B9E82, 0x89800000, +/**/ 0xBD2DEF6A, 0xFAA62113, +/**/ 0xBF3BBCFE, 0x43703097, +/**/ 0x3F3BBE7F, 0x13C00000, +/**/ 0x3D30D119, 0x23305306, +/**/ 0xBF3BDCF7, 0x50921A17, +/**/ 0x3F3BDE7B, 0x9A400000, +/**/ 0xBD2D1078, 0x9FBACE27, +/**/ 0xBF3BFCF0, 0x55B6A006, +/**/ 0x3F3BFE78, 0x1C800000, +/**/ 0x3D32FD49, 0xD625DF1E, +/**/ 0xBF3C1CE9, 0x52DDC563, +/**/ 0x3F3C1E74, 0x9B000000, +/**/ 0xBD253AA9, 0x7D07255B, +/**/ 0xBF3C3CE2, 0x48078D2B, +/**/ 0x3F3C3E71, 0x15400000, +/**/ 0x3D38A8E7, 0x9E08B538, +/**/ 0xBF3C5CDB, 0x3533FA5D, +/**/ 0x3F3C5E6D, 0x8BC00000, +/**/ 0xBD09780B, 0x45956AFC, +/**/ 0xBF3C7CD4, 0x1A630FF9, +/**/ 0x3F3C7E69, 0xFE400000, +/**/ 0xBD3E2410, 0x2792F44E, +/**/ 0xBF3C9CCC, 0xF794D0FC, +/**/ 0x3F3C9E66, 0x6C800000, +/**/ 0x3D1F2AEC, 0x30AB4456, +/**/ 0xBF3CBCC5, 0xCCC94066, +/**/ 0x3F3CBE62, 0xD7000000, +/**/ 0xBD3161A0, 0x231641D5, +/**/ 0xBF3CDCBE, 0x9A006135, +/**/ 0x3F3CDE5F, 0x3D400000, +/**/ 0x3D3657DD, 0xF4AD1934, +/**/ 0xBF3CFCB7, 0x5F3A3668, +/**/ 0x3F3CFE5B, 0x9FC00000, +/**/ 0xBCF07CB0, 0x2E7AC798, +/**/ 0xBF3D1CB0, 0x1C76C2FD, +/**/ 0x3F3D1E57, 0xFE400000, +/**/ 0xBD377F9B, 0x6090F643, +/**/ 0xBF3D3CA8, 0xD1B609F3, +/**/ 0x3F3D3E54, 0x58800000, +/**/ 0x3D32F16C, 0x849503E6, +/**/ 0xBF3D5CA1, 0x7EF80E49, +/**/ 0x3F3D5E50, 0xAF000000, +/**/ 0xBCFB3B3A, 0xAF1CA4EA, +/**/ 0xBF3D7C9A, 0x243CD2FE, +/**/ 0x3F3D7E4D, 0x01800000, +/**/ 0xBD356DFC, 0x4701415B, +/**/ 0xBF3D9C92, 0xC1845B0F, +/**/ 0x3F3D9E49, 0x4FC00000, +/**/ 0x3D37C392, 0x582AEA48, +/**/ 0xBF3DBC8B, 0x56CEA97C, +/**/ 0x3F3DBE45, 0x9A400000, +/**/ 0x3D1787DF, 0x67DCC15E, +/**/ 0xBF3DDC83, 0xE41BC143, +/**/ 0x3F3DDE41, 0xE0C00000, +/**/ 0xBD262398, 0x352F961F, +/**/ 0xBF3DFC7C, 0x696BA563, +/**/ 0x3F3DFE3E, 0x23400000, +/**/ 0xBD3B16B9, 0xDEDD373A, +/**/ 0xBF3E1C74, 0xE6BE58DA, +/**/ 0x3F3E1E3A, 0x61800000, +/**/ 0x3D35D42E, 0x336BE94B, +/**/ 0xBF3E3C6D, 0x5C13DEA7, +/**/ 0x3F3E3E36, 0x9C000000, +/**/ 0x3D1EBFAF, 0x08A303A2, +/**/ 0xBF3E5C65, 0xC96C39C9, +/**/ 0x3F3E5E32, 0xD2800000, +/**/ 0xBD160A06, 0x34856362, +/**/ 0xBF3E7C5E, 0x2EC76D3D, +/**/ 0x3F3E7E2F, 0x05000000, +/**/ 0xBD31C21A, 0x154CDF1A, +/**/ 0xBF3E9C56, 0x8C257C04, +/**/ 0x3F3E9E2B, 0x33800000, +/**/ 0xBD3D0DDE, 0x31941F7F, +/**/ 0xBF3EBC4E, 0xE186691B, +/**/ 0x3F3EBE27, 0x5DC00000, +/**/ 0x3D389B31, 0xC26EC60D, +/**/ 0xBF3EDC47, 0x2EEA3781, +/**/ 0x3F3EDE23, 0x84400000, +/**/ 0x3D2E742A, 0xD583BEF8, +/**/ 0xBF3EFC3F, 0x7450EA34, +/**/ 0x3F3EFE1F, 0xA6C00000, +/**/ 0x3D1B3F31, 0xAC2DA351, +/**/ 0xBF3F1C37, 0xB1BA8433, +/**/ 0x3F3F1E1B, 0xC5400000, +/**/ 0xBCE45533, 0x2DC67430, +/**/ 0xBF3F3C2F, 0xE727087C, +/**/ 0x3F3F3E17, 0xDFC00000, +/**/ 0xBD1C7133, 0xFF1174AE, +/**/ 0xBF3F5C28, 0x14967A0F, +/**/ 0x3F3F5E13, 0xF6400000, +/**/ 0xBD29383C, 0x4AE098DC, +/**/ 0xBF3F7C20, 0x3A08DBE9, +/**/ 0x3F3F7E10, 0x08C00000, +/**/ 0xBD31211D, 0x684B0B3B, +/**/ 0xBF3F9C18, 0x577E3109, +/**/ 0x3F3F9E0C, 0x17400000, +/**/ 0xBD34AA4B, 0x268D7464, +/**/ 0xBF3FBC10, 0x6CF67C6E, +/**/ 0x3F3FBE08, 0x21C00000, +/**/ 0xBD3736A7, 0xBED03388, +/**/ 0xBF3FDC08, 0x7A71C116, +/**/ 0x3F3FDE04, 0x28400000, +/**/ 0xBD38C533, 0x900BC4E5, +/**/ 0xBF3FFC00, 0x7FF00200, +/**/ 0x3F3FFE00, 0x2AC00000, +/**/ 0xBD3954EE, 0xF9987527, +/**/ 0xBF400DFC, 0x3EB8A115, +/**/ 0x3F400EFE, 0x14A00000, +/**/ 0xBD38E4DA, 0x5B2E613B, +/**/ 0xBF401DF8, 0x397AC249, +/**/ 0x3F401EFC, 0x11E00000, +/**/ 0xBD3773F6, 0x14E5761B, +/**/ 0xBF402DF4, 0x303E661C, +/**/ 0x3F402EFA, 0x0D200000, +/**/ 0xBD350142, 0x873570A0, +/**/ 0xBF403DF0, 0x23038E0C, +/**/ 0x3F403EF8, 0x06600000, +/**/ 0xBD318BC0, 0x12F5DD53, +/**/ 0xBF404DEC, 0x11CA3B9A, +/**/ 0x3F404EF5, 0xFDA00000, +/**/ 0xBD2A24DE, 0x32BC307C, +/**/ 0xBF405DE7, 0xFC927044, +/**/ 0x3F405EF3, 0xF2E00000, +/**/ 0xBD1E513F, 0xF01532DA, +/**/ 0xBF406DE3, 0xE35C2D8A, +/**/ 0x3F406EF1, 0xE6200000, +/**/ 0xBCF10631, 0xCE27534E, +/**/ 0xBF407DDF, 0xC62774EA, +/**/ 0x3F407EEF, 0xD7600000, +/**/ 0x3D19E95C, 0x86CE9380, +/**/ 0xBF408DDB, 0xA4F447E4, +/**/ 0x3F408EED, 0xC6A00000, +/**/ 0x3D2E19BC, 0xBA0CD2C3, +/**/ 0xBF409DD7, 0x7FC2A7F8, +/**/ 0x3F409EEB, 0xB3E00000, +/**/ 0x3D38A832, 0x31FF7199, +/**/ 0xBF40ADD3, 0x569296A4, +/**/ 0x3F40AEE9, 0x9F400000, +/**/ 0xBD3CB2AD, 0xC2D77791, +/**/ 0xBF40BDCF, 0x29641567, +/**/ 0x3F40BEE7, 0x88800000, +/**/ 0xBD3102C1, 0xE5545563, +/**/ 0xBF40CDCA, 0xF83725C2, +/**/ 0x3F40CEE5, 0x6FC00000, +/**/ 0xBD111C2A, 0x66B3E48D, +/**/ 0xBF40DDC6, 0xC30BC932, +/**/ 0x3F40DEE3, 0x55000000, +/**/ 0x3D2302EF, 0x7711FC2A, +/**/ 0xBF40EDC2, 0x89E20138, +/**/ 0x3F40EEE1, 0x38400000, +/**/ 0x3D3857C4, 0xB558238E, +/**/ 0xBF40FDBE, 0x4CB9CF52, +/**/ 0x3F40FEDF, 0x19A00000, +/**/ 0xBD37C324, 0x1194C2E1, +/**/ 0xBF410DBA, 0x0B933501, +/**/ 0x3F410EDC, 0xF8E00000, +/**/ 0xBD1B390B, 0xFBCAF285, +/**/ 0xBF411DB5, 0xC66E33C2, +/**/ 0x3F411EDA, 0xD6200000, +/**/ 0x3D266ECF, 0x0E52C3A4, +/**/ 0xBF412DB1, 0x7D4ACD15, +/**/ 0x3F412ED8, 0xB1600000, +/**/ 0x3D3E4EDB, 0x1A4AF71D, +/**/ 0xBF413DAD, 0x30290279, +/**/ 0x3F413ED6, 0x8AC00000, +/**/ 0xBD2B0DD1, 0x58C4D599, +/**/ 0xBF414DA8, 0xDF08D56E, +/**/ 0x3F414ED4, 0x62000000, +/**/ 0x3D1EDC6F, 0x2FB4061D, +/**/ 0xBF415DA4, 0x89EA4773, +/**/ 0x3F415ED2, 0x37400000, +/**/ 0x3D3E09E8, 0x1BA53538, +/**/ 0xBF416DA0, 0x30CD5A06, +/**/ 0x3F416ED0, 0x0AA00000, +/**/ 0xBD251B08, 0x4A5B4574, +/**/ 0xBF417D9B, 0xD3B20EA8, +/**/ 0x3F417ECD, 0xDBE00000, +/**/ 0x3D2BE3AD, 0x4241B57B, +/**/ 0xBF418D97, 0x729866D7, +/**/ 0x3F418ECB, 0xAB400000, +/**/ 0xBD387707, 0xFA22BD16, +/**/ 0xBF419D93, 0x0D806412, +/**/ 0x3F419EC9, 0x78800000, +/**/ 0x3D01C6FC, 0xFFA2FC2F, +/**/ 0xBF41AD8E, 0xA46A07D9, +/**/ 0x3F41AEC7, 0x43C00000, +/**/ 0x3D3E028D, 0x05F32EE8, +/**/ 0xBF41BD8A, 0x375553AB, +/**/ 0x3F41BEC5, 0x0D200000, +/**/ 0xBD146400, 0xC7E46F2B, +/**/ 0xBF41CD85, 0xC6424907, +/**/ 0x3F41CEC2, 0xD4600000, +/**/ 0x3D38E737, 0x8DFCE791, +/**/ 0xBF41DD81, 0x5130E96B, +/**/ 0x3F41DEC0, 0x99C00000, +/**/ 0xBD1FEF30, 0x92F4A6CE, +/**/ 0xBF41ED7C, 0xD8213659, +/**/ 0x3F41EEBE, 0x5D000000, +/**/ 0x3D383EF4, 0x4AE68315, +/**/ 0xBF41FD78, 0x5B13314D, +/**/ 0x3F41FEBC, 0x1E600000, +/**/ 0xBD199E1E, 0x39A8276A, +/**/ 0xBF420D73, 0xDA06DBC8, +/**/ 0x3F420EB9, 0xDDA00000, +/**/ 0x3D3C11BF, 0xE39F6D77, +/**/ 0xBF421D6F, 0x54FC3749, +/**/ 0x3F421EB7, 0x9B000000, +/**/ 0xBCD50D72, 0xC3A8C440, +/**/ 0xBF422D6A, 0xCBF3454F, +/**/ 0x3F422EB5, 0x56600000, +/**/ 0xBD3B9869, 0x06E59170, +/**/ 0xBF423D66, 0x3EEC0759, +/**/ 0x3F423EB3, 0x0FA00000, +/**/ 0x3D248C4B, 0x86930551, +/**/ 0xBF424D61, 0xADE67EE6, +/**/ 0x3F424EB0, 0xC7000000, +/**/ 0xBD2D6F13, 0xB3649FF7, +/**/ 0xBF425D5D, 0x18E2AD76, +/**/ 0x3F425EAE, 0x7C400000, +/**/ 0x3D396F87, 0xB496441D, +/**/ 0xBF426D58, 0x7FE09487, +/**/ 0x3F426EAC, 0x2FA00000, +/**/ 0x3D05E2D0, 0x01961A2F, +/**/ 0xBF427D53, 0xE2E03598, +/**/ 0x3F427EA9, 0xE1000000, +/**/ 0xBD32D013, 0x652D1720, +/**/ 0xBF428D4F, 0x41E1922A, +/**/ 0x3F428EA7, 0x90400000, +/**/ 0x3D38CB3F, 0x15C6A78A, +/**/ 0xBF429D4A, 0x9CE4ABBA, +/**/ 0x3F429EA5, 0x3DA00000, +/**/ 0x3D163D44, 0x07F8A52A, +/**/ 0xBF42AD45, 0xF3E983C8, +/**/ 0x3F42AEA2, 0xE9000000, +/**/ 0xBD2905BC, 0x1FEC6070, +/**/ 0xBF42BD41, 0x46F01BD4, +/**/ 0x3F42BEA0, 0x92600000, +/**/ 0xBD3D6A4E, 0x8FE5CB8E, +/**/ 0xBF42CD3C, 0x95F8755C, +/**/ 0x3F42CE9E, 0x39A00000, +/**/ 0x3D32D9FF, 0x120028B6, +/**/ 0xBF42DD37, 0xE10291DF, +/**/ 0x3F42DE9B, 0xDF000000, +/**/ 0x3D112C29, 0x94B2D8A6, +/**/ 0xBF42ED33, 0x280E72DD, +/**/ 0x3F42EE99, 0x82600000, +/**/ 0xBD222C5A, 0x0E9DC27F, +/**/ 0xBF42FD2E, 0x6B1C19D4, +/**/ 0x3F42FE97, 0x23C00000, +/**/ 0xBD3548A7, 0xA4C12307, +/**/ 0xBF430D29, 0xAA2B8844, +/**/ 0x3F430E94, 0xC3000000, +/**/ 0x3D3FB49A, 0x1B27A40C, +/**/ 0xBF431D24, 0xE53CBFAC, +/**/ 0x3F431E92, 0x60600000, +/**/ 0x3D35E297, 0xC65D601D, +/**/ 0xBF432D20, 0x1C4FC18B, +/**/ 0x3F432E8F, 0xFBC00000, +/**/ 0x3D2A84A1, 0xD4E46CD5, +/**/ 0xBF433D1B, 0x4F648F60, +/**/ 0x3F433E8D, 0x95200000, +/**/ 0x3D175314, 0x526215F8, +/**/ 0xBF434D16, 0x7E7B2AAB, +/**/ 0x3F434E8B, 0x2C800000, +/**/ 0xBCD9430B, 0x9746A94C, +/**/ 0xBF435D11, 0xA99394E9, +/**/ 0x3F435E88, 0xC1E00000, +/**/ 0xBD15A88D, 0x47EF6144, +/**/ 0xBF436D0C, 0xD0ADCF9B, +/**/ 0x3F436E86, 0x55400000, +/**/ 0xBD227301, 0x94614FFB, +/**/ 0xBF437D07, 0xF3C9DC3F, +/**/ 0x3F437E83, 0xE6A00000, +/**/ 0xBD27A44A, 0x16908831, +/**/ 0xBF438D03, 0x12E7BC55, +/**/ 0x3F438E81, 0x76000000, +/**/ 0xBD2A6621, 0x13DE59AC, +/**/ 0xBF439CFE, 0x2E07715C, +/**/ 0x3F439E7F, 0x03600000, +/**/ 0xBD2AB687, 0x76635000, +/**/ 0xBF43ACF9, 0x4528FCD2, +/**/ 0x3F43AE7C, 0x8EC00000, +/**/ 0xBD28937E, 0x28F7818F, +/**/ 0xBF43BCF4, 0x584C6037, +/**/ 0x3F43BE7A, 0x18200000, +/**/ 0xBD23FB06, 0x17328F27, +/**/ 0xBF43CCEF, 0x67719D0A, +/**/ 0x3F43CE77, 0x9F800000, +/**/ 0xBD19D640, 0x5AD74747, +/**/ 0xBF43DCEA, 0x7298B4CA, +/**/ 0x3F43DE75, 0x24E00000, +/**/ 0xBCFB0E6A, 0xC5CB9C74, +/**/ 0xBF43ECE5, 0x79C1A8F6, +/**/ 0x3F43EE72, 0xA8400000, +/**/ 0x3D1145E2, 0xF21B8682, +/**/ 0xBF43FCE0, 0x7CEC7B0D, +/**/ 0x3F43FE70, 0x29A00000, +/**/ 0x3D27251B, 0x59543A06, +/**/ 0xBF440CDB, 0x7C192C8E, +/**/ 0x3F440E6D, 0xA9000000, +/**/ 0x3D341357, 0xAC6250B6, +/**/ 0xBF441CD6, 0x7747BEF8, +/**/ 0x3F441E6B, 0x26600000, +/**/ 0x3D3DD4D6, 0x43A510F7, +/**/ 0xBF442CD1, 0x6E7833CB, +/**/ 0x3F442E68, 0xA1E00000, +/**/ 0xBD3727F7, 0x05F7D1E1, +/**/ 0xBF443CCC, 0x61AA8C85, +/**/ 0x3F443E66, 0x1B400000, +/**/ 0xBD25C421, 0x527C9668, +/**/ 0xBF444CC7, 0x50DECAA5, +/**/ 0x3F444E63, 0x92A00000, +/**/ 0x3D053C47, 0x053F70AC, +/**/ 0xBF445CC2, 0x3C14EFAB, +/**/ 0x3F445E61, 0x08000000, +/**/ 0x3D3175D5, 0x1E315FBB, +/**/ 0xBF446CBD, 0x234CFD15, +/**/ 0x3F446E5E, 0x7B800000, +/**/ 0xBD3E762C, 0x6A8B33AC, +/**/ 0xBF447CB8, 0x0686F463, +/**/ 0x3F447E5B, 0xECE00000, +/**/ 0xBD2A36F8, 0x67AD9900, +/**/ 0xBF448CB2, 0xE5C2D713, +/**/ 0x3F448E59, 0x5C400000, +/**/ 0x3D161B95, 0x1E974853, +/**/ 0xBF449CAD, 0xC100A6A5, +/**/ 0x3F449E56, 0xC9A00000, +/**/ 0x3D3971F7, 0x8CE22250, +/**/ 0xBF44ACA8, 0x98406498, +/**/ 0x3F44AE54, 0x35200000, +/**/ 0xBD315945, 0xDF8A23F8, +/**/ 0xBF44BCA3, 0x6B82126A, +/**/ 0x3F44BE51, 0x9E800000, +/**/ 0x3D1498B2, 0x1A63D360, +/**/ 0xBF44CC9E, 0x3AC5B19B, +/**/ 0x3F44CE4F, 0x05E00000, +/**/ 0x3D3CF14E, 0x4323A054, +/**/ 0xBF44DC99, 0x060B43AA, +/**/ 0x3F44DE4C, 0x6B600000, +/**/ 0xBD23EDC2, 0x4CE35F94, +/**/ 0xBF44EC93, 0xCD52CA15, +/**/ 0x3F44EE49, 0xCEC00000, +/**/ 0x3D306E9D, 0xCCF1B48E, +/**/ 0xBF44FC8E, 0x909C465C, +/**/ 0x3F44FE47, 0x30400000, +/**/ 0xBD33DD35, 0x5FF9440B, +/**/ 0xBF450C89, 0x4FE7B9FF, +/**/ 0x3F450E44, 0x8FA00000, +/**/ 0x3D224D49, 0xAA4D276D, +/**/ 0xBF451C84, 0x0B35267A, +/**/ 0x3F451E41, 0xED200000, +/**/ 0xBD3884D4, 0x11B557F9, +/**/ 0xBF452C7E, 0xC2848D4F, +/**/ 0x3F452E3F, 0x48800000, +/**/ 0x3D1C857D, 0xB43290C4, +/**/ 0xBF453C79, 0x75D5EFFC, +/**/ 0x3F453E3C, 0xA2000000, +/**/ 0xBD37E5C1, 0x2D598D3C, +/**/ 0xBF454C74, 0x25294FFF, +/**/ 0x3F454E39, 0xF9600000, +/**/ 0x3D24CD93, 0x3FE47B89, +/**/ 0xBF455C6E, 0xD07EAED8, +/**/ 0x3F455E37, 0x4EE00000, +/**/ 0xBD31F800, 0xAA959122, +/**/ 0xBF456C69, 0x77D60E06, +/**/ 0x3F456E34, 0xA2400000, +/**/ 0x3D32FEDF, 0x7329AF92, +/**/ 0xBF457C64, 0x1B2F6F08, +/**/ 0x3F457E31, 0xF3C00000, +/**/ 0xBD1ACE5A, 0x1C545A6F, +/**/ 0xBF458C5E, 0xBA8AD35D, +/**/ 0x3F458E2F, 0x43400000, +/**/ 0xBD3F0E63, 0x19F6B9EF, +/**/ 0xBF459C59, 0x55E83C84, +/**/ 0x3F459E2C, 0x90A00000, +/**/ 0x3D23DEF2, 0x73005F6F, +/**/ 0xBF45AC53, 0xED47ABFB, +/**/ 0x3F45AE29, 0xDC200000, +/**/ 0xBD277204, 0x1C295DE7, +/**/ 0xBF45BC4E, 0x80A92343, +/**/ 0x3F45BE27, 0x25800000, +/**/ 0x3D3FF92A, 0x8D869589, +/**/ 0xBF45CC49, 0x100CA3D9, +/**/ 0x3F45CE24, 0x6D000000, +/**/ 0x3D2A0DFD, 0x145C5335, +/**/ 0xBF45DC43, 0x9B722F3C, +/**/ 0x3F45DE21, 0xB2800000, +/**/ 0xBD123A1A, 0x6A8614B3, +/**/ 0xBF45EC3E, 0x22D9C6ED, +/**/ 0x3F45EE1E, 0xF6000000, +/**/ 0xBD34C665, 0x63CBC7E7, +/**/ 0xBF45FC38, 0xA6436C69, +/**/ 0x3F45FE1C, 0x37600000, +/**/ 0x3D3C6061, 0xAB6C51D7, +/**/ 0xBF460C33, 0x25AF2130, +/**/ 0x3F460E19, 0x76E00000, +/**/ 0x3D2DCD9C, 0x1EC7F453, +/**/ 0xBF461C2D, 0xA11CE6C1, +/**/ 0x3F461E16, 0xB4600000, +/**/ 0x3D066EFA, 0x20C52899, +/**/ 0xBF462C28, 0x188CBE9A, +/**/ 0x3F462E13, 0xEFE00000, +/**/ 0xBD1FA5AC, 0xEB5FDD5C, +/**/ 0xBF463C22, 0x8BFEAA3B, +/**/ 0x3F463E11, 0x29600000, +/**/ 0xBD313E11, 0xF22FE2BC, +/**/ 0xBF464C1C, 0xFB72AB23, +/**/ 0x3F464E0E, 0x60E00000, +/**/ 0xBD392F15, 0x6710E251, +/**/ 0xBF465C17, 0x66E8C2D0, +/**/ 0x3F465E0B, 0x96600000, +/**/ 0xBD3FBB76, 0x1EFC78A7, +/**/ 0xBF466C11, 0xCE60F2C1, +/**/ 0x3F466E08, 0xC9C00000, +/**/ 0x3D3B1DCB, 0x602C1A84, +/**/ 0xBF467C0C, 0x31DB3C76, +/**/ 0x3F467E05, 0xFB400000, +/**/ 0x3D375DAE, 0x9027DA74, +/**/ 0xBF468C06, 0x9157A16E, +/**/ 0x3F468E03, 0x2AC00000, +/**/ 0x3D350532, 0xEA560DA0, +/**/ 0xBF469C00, 0xECD62326, +/**/ 0x3F469E00, 0x58400000, +/**/ 0x3D341557, 0xE7B63DE2 } }; + +#else +#ifdef LITTLE_ENDI +static const union {int4 i[5800]; double x[2900];} ui = { .i = { +/**/ 0x00000000, 0x3FF6A000, +/**/ 0x3729043E, 0x3F33CD15, +/**/ 0x0B3AB000, 0xBFD63003, +/**/ 0xE731AE00, 0x3D2DB623, +/**/ 0x00000000, 0x3FF69800, +/**/ 0xCC7267D0, 0x3F33F349, +/**/ 0xCDB03000, 0xBFD61965, +/**/ 0x603C488E, 0x3D2F08AD, +/**/ 0x00000000, 0x3FF69000, +/**/ 0x8D0BFD2E, 0x3F3473A8, +/**/ 0x8AF09000, 0xBFD602D0, +/**/ 0x76DF3F65, 0xBD1EBE91, +/**/ 0x00000000, 0x3FF68800, +/**/ 0x390B9ED0, 0x3F354DD2, +/**/ 0x3D5C3000, 0xBFD5EC43, +/**/ 0x1229D17F, 0xBD36B71A, +/**/ 0x00000000, 0x3FF68000, +/**/ 0x16816817, 0x3F368168, +/**/ 0xDF596000, 0xBFD5D5BD, +/**/ 0x08A465DC, 0x3D0A0B2A, +/**/ 0x00000000, 0x3FF67800, +/**/ 0xF08C7765, 0x3F380E0B, +/**/ 0x6B544000, 0xBFD5BF40, +/**/ 0xEB68981C, 0x3D227023, +/**/ 0x00000000, 0x3FF67000, +/**/ 0x16719F36, 0x3F39F360, +/**/ 0xDBBEE000, 0xBFD5A8CA, +/**/ 0x0AF7ECF8, 0x3CF7C79B, +/**/ 0x00000000, 0x3FF66800, +/**/ 0x5AB40167, 0x3F3C3107, +/**/ 0x2B113000, 0xBFD5925D, +/**/ 0xA7A56F34, 0x3D369BF5, +/**/ 0x00000000, 0x3FF66000, +/**/ 0x122F9016, 0x3F3EC6A5, +/**/ 0x53C8D000, 0xBFD57BF7, +/**/ 0xEE5D40EF, 0xBD1FADED, +/**/ 0x00000000, 0x3FF65C00, +/**/ 0xECCA9097, 0xBF3E4C22, +/**/ 0x50695000, 0xBFD56599, +/**/ 0x2BADC774, 0xBD14C5FD, +/**/ 0x00000000, 0x3FF65400, +/**/ 0x4B55CC62, 0xBF3B07AC, +/**/ 0x1B7BE000, 0xBFD54F43, +/**/ 0xC0910952, 0xBD1A8954, +/**/ 0x00000000, 0x3FF64C00, +/**/ 0x32DA090E, 0xBF376C52, +/**/ 0xAF8F7000, 0xBFD538F4, +/**/ 0xE45547CE, 0xBD27EC02, +/**/ 0x00000000, 0x3FF64400, +/**/ 0x4DE9BD38, 0xBF337A6F, +/**/ 0x0738A000, 0xBFD522AE, +/**/ 0x8164C759, 0xBD2EBE70, +/**/ 0x00000000, 0x3FF63C00, +/**/ 0x923C708B, 0xBF2E64BB, +/**/ 0x1D11C000, 0xBFD50C6F, +/**/ 0x7E827C2C, 0x3D3A0E6B, +/**/ 0x00000000, 0x3FF63400, +/**/ 0xA7E43FD4, 0xBF2528EE, +/**/ 0xEBBAA000, 0xBFD4F637, +/**/ 0xCB3124B9, 0x3D3FC158, +/**/ 0x00000000, 0x3FF62C00, +/**/ 0x86689DF7, 0xBF168454, +/**/ 0x6DD8C000, 0xBFD4E008, +/**/ 0xA1E44788, 0x3D34D692, +/**/ 0x00000000, 0x3FF62400, +/**/ 0x77016240, 0xBED623FA, +/**/ 0x9E173000, 0xBFD4C9E0, +/**/ 0x1B0AD8A4, 0x3D2E2089, +/**/ 0x00000000, 0x3FF61C00, +/**/ 0x58715130, 0x3F151300, +/**/ 0x77268000, 0xBFD4B3C0, +/**/ 0x81052B9F, 0x3D165B46, +/**/ 0x00000000, 0x3FF61400, +/**/ 0x35D2754E, 0x3F266D06, +/**/ 0xF3BCC000, 0xBFD49DA7, +/**/ 0x4DAF4B9A, 0xBD307B33, +/**/ 0x00000000, 0x3FF60C00, +/**/ 0xDA197F23, 0x3F317C61, +/**/ 0x0E958000, 0xBFD48797, +/**/ 0x465CF25F, 0xBD3DC1B8, +/**/ 0x00000000, 0x3FF60400, +/**/ 0x81605816, 0x3F381605, +/**/ 0xC271C000, 0xBFD4718D, +/**/ 0xFB4C14C5, 0xBD306C18, +/**/ 0x00000000, 0x3FF5FC00, +/**/ 0xB5C6F559, 0x3F3F0317, +/**/ 0x0A17E000, 0xBFD45B8C, +/**/ 0xE7D0A853, 0x3D0D9120, +/**/ 0x00000000, 0x3FF5F800, +/**/ 0x6D2041E3, 0xBF39BCBD, +/**/ 0xE053A000, 0xBFD44591, +/**/ 0x92923D88, 0x3D06E958, +/**/ 0x00000000, 0x3FF5F000, +/**/ 0x5604CC40, 0xBF3229CF, +/**/ 0x3FF62000, 0xBFD42F9F, +/**/ 0x0F7D3354, 0xBD390644, +/**/ 0x00000000, 0x3FF5E800, +/**/ 0xFD431489, 0xBF2488E5, +/**/ 0x23D5F000, 0xBFD419B4, +/**/ 0x226DE3EC, 0x3D3CE379, +/**/ 0x00000000, 0x3FF5E000, +/**/ 0x6424E9C9, 0xBF0067E7, +/**/ 0x86CEA000, 0xBFD403D0, +/**/ 0x74487308, 0xBD3E6EF5, +/**/ 0x00000000, 0x3FF5D800, +/**/ 0x38A94D24, 0x3F19F0FB, +/**/ 0x63C17000, 0xBFD3EDF4, +/**/ 0x297F2C3F, 0x3D3F067C, +/**/ 0x00000000, 0x3FF5D000, +/**/ 0x23CAD2AA, 0x3F2EADD9, +/**/ 0xB5947000, 0xBFD3D81F, +/**/ 0x2A9D37A4, 0x3D222C7C, +/**/ 0x00000000, 0x3FF5C800, +/**/ 0x31057262, 0x3F3882B9, +/**/ 0x77333000, 0xBFD3C252, +/**/ 0xB606BD5C, 0xBD183B54, +/**/ 0x00000000, 0x3FF5C400, +/**/ 0x10FFA8F8, 0xBF3E00AE, +/**/ 0xA38E6000, 0xBFD3AC8C, +/**/ 0xBC02BE4A, 0x3D2D0BEF, +/**/ 0x00000000, 0x3FF5BC00, +/**/ 0x8056EAF3, 0xBF34339B, +/**/ 0x359BC000, 0xBFD396CE, +/**/ 0x5663663D, 0x3D05839C, +/**/ 0x00000000, 0x3FF5B400, +/**/ 0xF31D7FD5, 0xBF242CC1, +/**/ 0x28565000, 0xBFD38117, +/**/ 0x93A0702B, 0x3D2A71E4, +/**/ 0x00000000, 0x3FF5AC00, +/**/ 0x6B015AC0, 0x3ED5AC05, +/**/ 0x76BE1000, 0xBFD36B67, +/**/ 0xB0F177C8, 0xBD116ECD, +/**/ 0x00000000, 0x3FF5A400, +/**/ 0x5BA55E5A, 0x3F26268D, +/**/ 0x1BD83000, 0xBFD355BF, +/**/ 0x8964F0E8, 0x3D2BA99B, +/**/ 0x00000000, 0x3FF59C00, +/**/ 0x3CCAA376, 0x3F361F12, +/**/ 0x12AED000, 0xBFD3401E, +/**/ 0x556E291D, 0x3D317C73, +/**/ 0x00000000, 0x3FF59800, +/**/ 0x62D32417, 0xBF3E863D, +/**/ 0x56512000, 0xBFD32A84, +/**/ 0x139AF5D6, 0xBD04F928, +/**/ 0x00000000, 0x3FF59000, +/**/ 0xEA712DCF, 0xBF32DCF7, +/**/ 0xE1D36000, 0xBFD314F1, +/**/ 0xD3213CB8, 0x3D28E27A, +/**/ 0x00000000, 0x3FF58800, +/**/ 0xA0CC87E8, 0xBF1B95B2, +/**/ 0xB04EB000, 0xBFD2FF66, +/**/ 0x541E6E2E, 0x3D38AED2, +/**/ 0x00000000, 0x3FF58000, +/**/ 0x01580560, 0x3F158056, +/**/ 0xBCE12000, 0xBFD2E9E2, +/**/ 0x128D1DC2, 0xBD24300C, +/**/ 0x00000000, 0x3FF57800, +/**/ 0x15791F34, 0x3F31F340, +/**/ 0x02ADD000, 0xBFD2D466, +/**/ 0xDCD54196, 0x3D288D0D, +/**/ 0x00000000, 0x3FF57000, +/**/ 0x06B39A23, 0x3F3ED3C5, +/**/ 0x7CDC9000, 0xBFD2BEF0, +/**/ 0x4A5004F4, 0xBD2A9CFA, +/**/ 0x00000000, 0x3FF56C00, +/**/ 0x53FEA954, 0xBF33FEA9, +/**/ 0x269A4000, 0xBFD2A982, +/**/ 0x557285CF, 0x3D22058E, +/**/ 0x00000000, 0x3FF56400, +/**/ 0xEB478503, 0xBF1A1160, +/**/ 0xFB187000, 0xBFD2941A, +/**/ 0xB730E28B, 0x3D3210C2, +/**/ 0x00000000, 0x3FF55C00, +/**/ 0xE4A18B2E, 0x3F1D09AD, +/**/ 0xF58D9000, 0xBFD27EBA, +/**/ 0x00B4BDA7, 0x3D2B1988, +/**/ 0x00000000, 0x3FF55400, +/**/ 0x55555555, 0x3F355555, +/**/ 0x1134E000, 0xBFD26962, +/**/ 0x10522625, 0x3D31B61F, +/**/ 0x00000000, 0x3FF55000, +/**/ 0xB319A21F, 0xBF3C4BE6, +/**/ 0x494E5000, 0xBFD25410, +/**/ 0xC0EF77F2, 0xBD3B1D7A, +/**/ 0x00000000, 0x3FF54800, +/**/ 0x8FA03FD5, 0xBF2B4328, +/**/ 0x991EC000, 0xBFD23EC5, +/**/ 0x48A2E522, 0x3D36DBE4, +/**/ 0x00000000, 0x3FF54000, +/**/ 0x40154015, 0x3EF54015, +/**/ 0xFBEF8000, 0xBFD22981, +/**/ 0x609580DA, 0x3D3A1421, +/**/ 0x00000000, 0x3FF53800, +/**/ 0x40FEAC6F, 0x3F30948F, +/**/ 0x6D0EC000, 0xBFD21445, +/**/ 0x28B728A3, 0x3D3CAF04, +/**/ 0x00000000, 0x3FF53400, +/**/ 0xFD04F7B8, 0xBF3FE034, +/**/ 0xE7CF4000, 0xBFD1FF0F, +/**/ 0x513FF0C1, 0xBD3E9D5B, +/**/ 0x00000000, 0x3FF52C00, +/**/ 0x7FAB5403, 0xBF300A95, +/**/ 0x6788A000, 0xBFD1E9E1, +/**/ 0xD3C8B65E, 0x3D382EAE, +/**/ 0x00000000, 0x3FF52400, +/**/ 0x52401524, 0x3EB52401, +/**/ 0xE796C000, 0xBFD1D4B9, +/**/ 0x7C42E56D, 0xBD222A66, +/**/ 0x00000000, 0x3FF51C00, +/**/ 0x2F8151D0, 0x3F307EAE, +/**/ 0x635A7000, 0xBFD1BF99, +/**/ 0x575C2125, 0x3D31AC89, +/**/ 0x00000000, 0x3FF51800, +/**/ 0xEAE9ECE4, 0xBF3ECE3F, +/**/ 0xD638D000, 0xBFD1AA7F, +/**/ 0x9616F7A0, 0xBD29F60A, +/**/ 0x00000000, 0x3FF51000, +/**/ 0xC7675243, 0xBF2BA3DD, +/**/ 0x3B9BC000, 0xBFD1956D, +/**/ 0x3AD1AA14, 0xBD27D2F7, +/**/ 0x00000000, 0x3FF50800, +/**/ 0x764E368D, 0x3F0B9AC8, +/**/ 0x8EF19000, 0xBFD18061, +/**/ 0xC86D38E5, 0x3D3482FF, +/**/ 0x00000000, 0x3FF50000, +/**/ 0x15015015, 0x3F350150, +/**/ 0xCBAD0000, 0xBFD16B5C, +/**/ 0x042D74BF, 0x3D323299, +/**/ 0x00000000, 0x3FF4FC00, +/**/ 0x4A683C50, 0xBF392851, +/**/ 0xED456000, 0xBFD1565E, +/**/ 0xFB6ABA25, 0x3CEE75AD, +/**/ 0x00000000, 0x3FF4F400, +/**/ 0xACD95EF0, 0xBF1C2748, +/**/ 0xEF367000, 0xBFD14167, +/**/ 0x824DAAF5, 0xBD3E0C07, +/**/ 0x00000000, 0x3FF4EC00, +/**/ 0x67A47465, 0x3F26B90D, +/**/ 0xCD007000, 0xBFD12C77, +/**/ 0x8A11F797, 0xBD13B294, +/**/ 0x00000000, 0x3FF4E400, +/**/ 0xF0539783, 0x3F3E0A72, +/**/ 0x8227E000, 0xBFD1178E, +/**/ 0xCE2D07F2, 0xBD31EF78, +/**/ 0x00000000, 0x3FF4E000, +/**/ 0xF87FD642, 0xBF2E00A6, +/**/ 0x0A35D000, 0xBFD102AC, +/**/ 0xDFDFD686, 0x3D2F1FBD, +/**/ 0x00000000, 0x3FF4D800, +/**/ 0x0B12E3FD, 0x3F10EFB7, +/**/ 0x60B78000, 0xBFD0EDD0, +/**/ 0x2D8435F5, 0xBD0019B5, +/**/ 0x00000000, 0x3FF4D000, +/**/ 0x5CB4DBE5, 0x3F37BEF1, +/**/ 0x813EB000, 0xBFD0D8FB, +/**/ 0x8753FA35, 0xBD1EE8C8, +/**/ 0x00000000, 0x3FF4CC00, +/**/ 0xA50918B1, 0xBF34778D, +/**/ 0x67616000, 0xBFD0C42D, +/**/ 0x163CEAE9, 0xBD27188B, +/**/ 0x00000000, 0x3FF4C400, +/**/ 0xE37288EC, 0xBED9F4F7, +/**/ 0x0EB9E000, 0xBFD0AF66, +/**/ 0xF528D80A, 0xBD23C7C3, +/**/ 0x00000000, 0x3FF4BC00, +/**/ 0x68FE0E42, 0x3F33EDDA, +/**/ 0x72E6C000, 0xBFD09AA5, +/**/ 0xE1734342, 0xBD3B50A1, +/**/ 0x00000000, 0x3FF4B800, +/**/ 0xB72E47D9, 0xBF3776C6, +/**/ 0x8F8AE000, 0xBFD085EB, +/**/ 0x3F45FE7B, 0xBD3E5D51, +/**/ 0x00000000, 0x3FF4B000, +/**/ 0xA052BF5B, 0xBF04AFD6, +/**/ 0x604D6000, 0xBFD07138, +/**/ 0x4E912B17, 0x3D3E7632, +/**/ 0x00000000, 0x3FF4A800, +/**/ 0xD5B5C015, 0x3F328FFA, +/**/ 0xE0D96000, 0xBFD05C8B, +/**/ 0xC77CCB58, 0xBD2AD0F1, +/**/ 0x00000000, 0x3FF4A400, +/**/ 0x9FEB5D80, 0xBF380528, +/**/ 0x0CDE8000, 0xBFD047E6, +/**/ 0x0D397F3C, 0xBD2DBDF1, +/**/ 0x00000000, 0x3FF49C00, +/**/ 0x25FF5B21, 0xBF02AD3E, +/**/ 0xE0106000, 0xBFD03346, +/**/ 0xA966395C, 0xBCF89FF8, +/**/ 0x00000000, 0x3FF49400, +/**/ 0x2D066EA2, 0x3F339E3B, +/**/ 0x5626C000, 0xBFD01EAE, +/**/ 0xFADE85AE, 0xBD3A43DC, +/**/ 0x00000000, 0x3FF49000, +/**/ 0xAFB2E932, 0xBF3629C1, +/**/ 0x6ADDA000, 0xBFD00A1C, +/**/ 0x688B9E18, 0xBD31CD8D, +/**/ 0x00000000, 0x3FF48800, +/**/ 0x22014880, 0x3ED48805, +/**/ 0x33EA0000, 0xBFCFEB22, +/**/ 0xDE00938B, 0xBD2F3418, +/**/ 0x00000000, 0x3FF48000, +/**/ 0x3D324D89, 0x3F37119F, +/**/ 0xBE620000, 0xBFCFC218, +/**/ 0x6F1CF6A0, 0xBD34BBA4, +/**/ 0x00000000, 0x3FF47C00, +/**/ 0x1EB851EC, 0xBF31EB85, +/**/ 0x6CB3C000, 0xBFCF991C, +/**/ 0xCD7CC834, 0x3D390D04, +/**/ 0x00000000, 0x3FF47400, +/**/ 0xAAFC7C01, 0x3F1569C9, +/**/ 0x36778000, 0xBFCF702D, +/**/ 0x16673E23, 0x3D108195, +/**/ 0x00000000, 0x3FF46C00, +/**/ 0x96066250, 0x3F3CE345, +/**/ 0x134E0000, 0xBFCF474B, +/**/ 0xF1DF7B5E, 0x3D3BAE49, +/**/ 0x00000000, 0x3FF46800, +/**/ 0x1D02DE87, 0xBF26A297, +/**/ 0xFADFA000, 0xBFCF1E75, +/**/ 0x25D83F6D, 0x3D20862B, +/**/ 0x00000000, 0x3FF46000, +/**/ 0xB9F34381, 0x3F2978FE, +/**/ 0xE4DD0000, 0xBFCEF5AD, +/**/ 0x65BB8E11, 0x3CCA2115, +/**/ 0x00000000, 0x3FF45C00, +/**/ 0xF6C71366, 0xBF3AF398, +/**/ 0xC8FEA000, 0xBFCECCF2, +/**/ 0xA3E75640, 0x3D3BEC63, +/**/ 0x00000000, 0x3FF45400, +/**/ 0x449AFF5D, 0xBF030E9C, +/**/ 0x9F04A000, 0xBFCEA444, +/**/ 0x63732A36, 0xBD35E916, +/**/ 0x00000000, 0x3FF44C00, +/**/ 0xF8B42EF3, 0x3F367190, +/**/ 0x5EB78000, 0xBFCE7BA3, +/**/ 0x23793649, 0x3D0D5EEE, +/**/ 0x00000000, 0x3FF44800, +/**/ 0xD260511C, 0xBF3079A9, +/**/ 0xFFE72000, 0xBFCE530E, +/**/ 0xB13F7C18, 0x3D3FDBDB, +/**/ 0x00000000, 0x3FF44000, +/**/ 0x0B644FBE, 0x3F21B87C, +/**/ 0x7A6B2000, 0xBFCE2A87, +/**/ 0x7787081A, 0xBD382381, +/**/ 0x00000000, 0x3FF43C00, +/**/ 0x411B2E25, 0xBF3D8CF5, +/**/ 0xC6236000, 0xBFCE020C, +/**/ 0xADB91424, 0x3D252B00, +/**/ 0x00000000, 0x3FF43400, +/**/ 0xD6A60978, 0xBF0DAC08, +/**/ 0xDAF6E000, 0xBFCDD99E, +/**/ 0x69C756EB, 0x3D302EC6, +/**/ 0x00000000, 0x3FF42C00, +/**/ 0x51F86EFA, 0x3F36625D, +/**/ 0xB0D48000, 0xBFCDB13D, +/**/ 0x847527E6, 0xBD32806A, +/**/ 0x00000000, 0x3FF42800, +/**/ 0xA8766564, 0xBF2E8B2D, +/**/ 0x3FB30000, 0xBFCD88E9, +/**/ 0x0234BF51, 0x3D375F28, +/**/ 0x00000000, 0x3FF42000, +/**/ 0xCB2A247B, 0x3F26A4CB, +/**/ 0x7F904000, 0xBFCD60A1, +/**/ 0x6FC20D39, 0x3D35D6E0, +/**/ 0x00000000, 0x3FF41C00, +/**/ 0xC17DF552, 0xBF39D5E8, +/**/ 0x68720000, 0xBFCD3866, +/**/ 0xB38932BC, 0x3D373650, +/**/ 0x00000000, 0x3FF41400, +/**/ 0x14141414, 0x3EF41414, +/**/ 0xF2656000, 0xBFCD1037, +/**/ 0x75B6F6E4, 0x3D084A7E, +/**/ 0x00000000, 0x3FF40C00, +/**/ 0x43AE87FD, 0x3F3C97A8, +/**/ 0x157F2000, 0xBFCCE816, +/**/ 0xA2099515, 0x3D29E0AB, +/**/ 0x00000000, 0x3FF40800, +/**/ 0x66A67E6F, 0xBF1F4BBC, +/**/ 0xC9DB4000, 0xBFCCC000, +/**/ 0x5D57AFF9, 0x3D1D6D58, +/**/ 0x00000000, 0x3FF40000, +/**/ 0x14014014, 0x3F340140, +/**/ 0x079D4000, 0xBFCC97F8, +/**/ 0xA8C6E6C5, 0xBD23B161, +/**/ 0x00000000, 0x3FF3FC00, +/**/ 0xFD809FD8, 0xBF2FD809, +/**/ 0xC6F00000, 0xBFCC6FFB, +/**/ 0xD3A69D43, 0xBD3EE138, +/**/ 0x00000000, 0x3FF3F400, +/**/ 0x57EE89D2, 0x3F28CA0E, +/**/ 0x0005C000, 0xBFCC480C, +/**/ 0xD5E44E76, 0xBD39A294, +/**/ 0x00000000, 0x3FF3F000, +/**/ 0xA50F9260, 0xBF370BD5, +/**/ 0xAB180000, 0xBFCC2028, +/**/ 0xE55C7AC6, 0x3D292E0E, +/**/ 0x00000000, 0x3FF3E800, +/**/ 0x75945FCE, 0x3F1704AA, +/**/ 0xC0676000, 0xBFCBF851, +/**/ 0x4C0854AD, 0x3D35420E, +/**/ 0x00000000, 0x3FF3E400, +/**/ 0xB56FD83C, 0xBF3D3431, +/**/ 0x383BE000, 0xBFCBD087, +/**/ 0x595412B6, 0x3D2D4BC4, +/**/ 0x00000000, 0x3FF3DC00, +/**/ 0x3DC013DC, 0x3EB3DC01, +/**/ 0x0AE4A000, 0xBFCBA8C9, +/**/ 0xF44432DA, 0xBD3A32E7, +/**/ 0x00000000, 0x3FF3D400, +/**/ 0xA75C5BBD, 0x3F3D991A, +/**/ 0x30B82000, 0xBFCB8117, +/**/ 0x3B9CD768, 0xBD1E9068, +/**/ 0x00000000, 0x3FF3D000, +/**/ 0x59C52F5D, 0xBF1292BA, +/**/ 0xA213A000, 0xBFCB5971, +/**/ 0x83AA91DF, 0xBD39B50E, +/**/ 0x00000000, 0x3FF3C800, +/**/ 0xBABE7440, 0x3F395A47, +/**/ 0x575BC000, 0xBFCB31D8, +/**/ 0x562A63CB, 0xBD3C794E, +/**/ 0x00000000, 0x3FF3C400, +/**/ 0x58A0943A, 0xBF20D475, +/**/ 0x48FC2000, 0xBFCB0A4B, +/**/ 0x5C3998ED, 0x3D22E72D, +/**/ 0x00000000, 0x3FF3BC00, +/**/ 0x3295482C, 0x3F360D92, +/**/ 0x6F672000, 0xBFCAE2CA, +/**/ 0xAE54F550, 0xBD37A8D5, +/**/ 0x00000000, 0x3FF3B800, +/**/ 0xCAB48651, 0xBF267D12, +/**/ 0xC316A000, 0xBFCABB55, +/**/ 0xCAF14CD8, 0x3D38A65A, +/**/ 0x00000000, 0x3FF3B000, +/**/ 0x13B13B14, 0x3F33B13B, +/**/ 0x3C8AE000, 0xBFCA93ED, +/**/ 0x50562169, 0x3D287243, +/**/ 0x00000000, 0x3FF3AC00, +/**/ 0x2C8FD3BF, 0xBF2A46AF, +/**/ 0xD44B8000, 0xBFCA6C90, +/**/ 0xF037B0C6, 0x3D3F63B7, +/**/ 0x00000000, 0x3FF3A400, +/**/ 0xAC822610, 0x3F324387, +/**/ 0x82E6A000, 0xBFCA4540, +/**/ 0xC81F7171, 0xBD360A77, +/**/ 0x00000000, 0x3FF3A000, +/**/ 0xA1923DEE, 0xBF2C34BB, +/**/ 0x40F1C000, 0xBFCA1DFC, +/**/ 0x004F3781, 0x3D301E0F, +/**/ 0x00000000, 0x3FF39800, +/**/ 0x87F63372, 0x3F31C2C1, +/**/ 0x0708A000, 0xBFC9F6C4, +/**/ 0x4BCD3F43, 0x3D3337D9, +/**/ 0x00000000, 0x3FF39400, +/**/ 0xE11BD52E, 0xBF2C4AA0, +/**/ 0xCDCE0000, 0xBFC9CF97, +/**/ 0x10C414E3, 0xBD3D862F, +/**/ 0x00000000, 0x3FF38C00, +/**/ 0x6088DBF4, 0x3F322D36, +/**/ 0x8DEBA000, 0xBFC9A877, +/**/ 0x3EFEC390, 0xBD3470FA, +/**/ 0x00000000, 0x3FF38800, +/**/ 0x503F774E, 0xBF2A8BBF, +/**/ 0x4011A000, 0xBFC98163, +/**/ 0x9E9045E2, 0xBD34EADD, +/**/ 0x00000000, 0x3FF38000, +/**/ 0x13813814, 0x3F338138, +/**/ 0xDCF70000, 0xBFC95A5A, +/**/ 0x58A0FF6F, 0xBD07F228, +/**/ 0x00000000, 0x3FF37C00, +/**/ 0x1B177053, 0xBF26FB6F, +/**/ 0x5D594000, 0xBFC9335E, +/**/ 0x3ABD47DA, 0xBD33115C, +/**/ 0x00000000, 0x3FF37400, +/**/ 0x945EDC20, 0x3F35BD1C, +/**/ 0xB9FCC000, 0xBFC90C6D, +/**/ 0x7718D7CA, 0x3D1935F5, +/**/ 0x00000000, 0x3FF37000, +/**/ 0x4DBDCC60, 0xBF219D00, +/**/ 0xEBAC2000, 0xBFC8E588, +/**/ 0xAB2D1140, 0xBD3B7D5C, +/**/ 0x00000000, 0x3FF36800, +/**/ 0xE0747954, 0x3F38DF3D, +/**/ 0xEB390000, 0xBFC8BEAF, +/**/ 0xAAE92CD1, 0x3D073D54, +/**/ 0x00000000, 0x3FF36400, +/**/ 0xD9D3C49F, 0xBF14E775, +/**/ 0xB17B2000, 0xBFC897E2, +/**/ 0x380CBE9E, 0x3D296B37, +/**/ 0x00000000, 0x3FF35C00, +/**/ 0xF2AF821E, 0x3F3CE5F9, +/**/ 0x3750E000, 0xBFC87121, +/**/ 0x42F9AF75, 0xBD3328EB, +/**/ 0x00000000, 0x3FF35800, +/**/ 0xE34971F2, 0xBEE82DF0, +/**/ 0x759F6000, 0xBFC84A6B, +/**/ 0x2ADF8609, 0x3D3DA280, +/**/ 0x00000000, 0x3FF35400, +/**/ 0x4873ECAE, 0xBF3E304D, +/**/ 0x6551A000, 0xBFC823C1, +/**/ 0x9A631E83, 0xBD1E0DDB, +/**/ 0x00000000, 0x3FF34C00, +/**/ 0x1FF659DB, 0x3F1264B6, +/**/ 0xFF59A000, 0xBFC7FD22, +/**/ 0xF457B7D2, 0x3D158BEB, +/**/ 0x00000000, 0x3FF34800, +/**/ 0xFECB9865, 0xBF386531, +/**/ 0x3CAF6000, 0xBFC7D690, +/**/ 0x17C301D7, 0x3D24C06B, +/**/ 0x00000000, 0x3FF34000, +/**/ 0xEEDA65AE, 0x3F25A8C2, +/**/ 0x16516000, 0xBFC7B009, +/**/ 0xCB067E57, 0x3D3AE75F, +/**/ 0x00000000, 0x3FF33C00, +/**/ 0x8434E1F4, 0xBF31BA4A, +/**/ 0x85444000, 0xBFC7898D, +/**/ 0xE3DBAF3F, 0xBD38E67B, +/**/ 0x00000000, 0x3FF33400, +/**/ 0xDBFC660A, 0x3F31EE97, +/**/ 0x82936000, 0xBFC7631D, +/**/ 0xC7C5F3E1, 0x3D25E77D, +/**/ 0x00000000, 0x3FF33000, +/**/ 0xBC40BFDA, 0xBF246252, +/**/ 0x074FE000, 0xBFC73CB9, +/**/ 0x0D0005A6, 0x3D3D66A9, +/**/ 0x00000000, 0x3FF32800, +/**/ 0x13299E64, 0x3F39E640, +/**/ 0x0C914000, 0xBFC71660, +/**/ 0x7CEC3838, 0xBCE51B15, +/**/ 0x00000000, 0x3FF32400, +/**/ 0xEF40991F, 0xBEFCB5D4, +/**/ 0x8B756000, 0xBFC6F012, +/**/ 0x0D31EF0F, 0xBD357739, +/**/ 0x00000000, 0x3FF32000, +/**/ 0xC823D892, 0xBF3D4632, +/**/ 0x7D204000, 0xBFC6C9D0, +/**/ 0xFD9B2DCA, 0x3CDC73FA, +/**/ 0x00000000, 0x3FF31800, +/**/ 0x7AED804C, 0x3F1DD63A, +/**/ 0xDABBE000, 0xBFC6A399, +/**/ 0xE66A15A6, 0x3D38F934, +/**/ 0x00000000, 0x3FF31400, +/**/ 0xE8C11E1A, 0xBF339849, +/**/ 0x9D786000, 0xBFC67D6E, +/**/ 0x30A706D3, 0x3D311E88, +/**/ 0x00000000, 0x3FF30C00, +/**/ 0x0D190131, 0x3F319013, +/**/ 0xBE8C2000, 0xBFC6574E, +/**/ 0x34F0F462, 0x3D398C1D, +/**/ 0x00000000, 0x3FF30800, +/**/ 0xB47A7FDA, 0xBF222315, +/**/ 0x37336000, 0xBFC6313A, +/**/ 0x4F21EA6D, 0x3D144DF5, +/**/ 0x00000000, 0x3FF30000, +/**/ 0x40260390, 0x3F3C82AC, +/**/ 0x00B0A000, 0xBFC60B31, +/**/ 0xC988F814, 0x3D371456, +/**/ 0x00000000, 0x3FF2FC00, +/**/ 0xA2430A62, 0x3F026443, +/**/ 0x144C2000, 0xBFC5E533, +/**/ 0xF3B290EA, 0x3D31CE0B, +/**/ 0x00000000, 0x3FF2F800, +/**/ 0xED097B42, 0xBF37B425, +/**/ 0x6B544000, 0xBFC5BF40, +/**/ 0xEB68981C, 0x3D127023, +/**/ 0x00000000, 0x3FF2F000, +/**/ 0x4AE0553C, 0x3F2D00E3, +/**/ 0xFF1D6000, 0xBFC59958, +/**/ 0x9769CA05, 0x3D3A1D05, +/**/ 0x00000000, 0x3FF2EC00, +/**/ 0x25D69D44, 0xBF262BC0, +/**/ 0xC9018000, 0xBFC5737C, +/**/ 0xA6B887F6, 0xBD39BAA7, +/**/ 0x00000000, 0x3FF2E400, +/**/ 0xE3103D6B, 0x3F3B88B5, +/**/ 0xC2610000, 0xBFC54DAB, +/**/ 0xE5C8D0D8, 0xBD2746FE, +/**/ 0x00000000, 0x3FF2E000, +/**/ 0xC04B8097, 0x3F02E025, +/**/ 0xE4A1C000, 0xBFC527E5, +/**/ 0x8D4B411D, 0x3D34E60B, +/**/ 0x00000000, 0x3FF2DC00, +/**/ 0x2C305021, 0xBF369C22, +/**/ 0x292F6000, 0xBFC5022B, +/**/ 0xFF36A25B, 0xBD348A05, +/**/ 0x00000000, 0x3FF2D400, +/**/ 0xD50A012D, 0x3F30A012, +/**/ 0x897BC000, 0xBFC4DC7B, +/**/ 0x0AE1FF0F, 0xBD0C79B6, +/**/ 0x00000000, 0x3FF2D000, +/**/ 0xBC66484E, 0xBF1FBE29, +/**/ 0xFEFE2000, 0xBFC4B6D6, +/**/ 0xF56E7952, 0xBD1522EC, +/**/ 0x00000000, 0x3FF2C800, +/**/ 0x12C9FB4E, 0x3F3FB4D8, +/**/ 0x8333C000, 0xBFC4913D, +/**/ 0x558124C4, 0x3D353E43, +/**/ 0x00000000, 0x3FF2C400, +/**/ 0x7004B11E, 0x3F1E3432, +/**/ 0x0F9F6000, 0xBFC46BAF, +/**/ 0x0790841A, 0x3D1249CD, +/**/ 0x00000000, 0x3FF2C000, +/**/ 0x5C8EF02F, 0xBF30671A, +/**/ 0x9DC9C000, 0xBFC4462B, +/**/ 0xA711B062, 0x3D384858, +/**/ 0x00000000, 0x3FF2B800, +/**/ 0xD548D9AC, 0x3F37D835, +/**/ 0x27410000, 0xBFC420B3, +/**/ 0xC85A0884, 0x3D116282, +/**/ 0x00000000, 0x3FF2B400, +/**/ 0xAD012B40, 0x3ED2B404, +/**/ 0xA5992000, 0xBFC3FB45, +/**/ 0xC0CAE559, 0xBD319713, +/**/ 0x00000000, 0x3FF2B000, +/**/ 0x8E7302A1, 0xBF370F78, +/**/ 0x126BC000, 0xBFC3D5E3, +/**/ 0x85096C4B, 0xBD13FB2F, +/**/ 0x00000000, 0x3FF2A800, +/**/ 0x3C1053F9, 0x3F31C92F, +/**/ 0x67580000, 0xBFC3B08B, +/**/ 0xF29320FB, 0x3D3AADE8, +/**/ 0x00000000, 0x3FF2A400, +/**/ 0x3DBE2E04, 0xBF14AD94, +/**/ 0x9E028000, 0xBFC38B3E, +/**/ 0x545C17F9, 0x3D370EF0, +/**/ 0x00000000, 0x3FF2A000, +/**/ 0xBED61BED, 0xBF3BED61, +/**/ 0xB015A000, 0xBFC365FC, +/**/ 0xAFB9691B, 0x3D3FD3A0, +/**/ 0x00000000, 0x3FF29800, +/**/ 0x26F004A6, 0x3F2B061A, +/**/ 0x97412000, 0xBFC340C5, +/**/ 0xF7D9D386, 0x3D37A3DC, +/**/ 0x00000000, 0x3FF29400, +/**/ 0xFF6B646D, 0xBF21B488, +/**/ 0x4D3A4000, 0xBFC31B99, +/**/ 0xE3A50810, 0xBD3F098E, +/**/ 0x00000000, 0x3FF29000, +/**/ 0x2CA5D5AC, 0xBF3F0582, +/**/ 0xCBBC0000, 0xBFC2F677, +/**/ 0x2160F40D, 0xBD352B30, +/**/ 0x00000000, 0x3FF28800, +/**/ 0x16025116, 0x3F260251, +/**/ 0x0C868000, 0xBFC2D161, +/**/ 0xCB81B4A1, 0xBD039D6C, +/**/ 0x00000000, 0x3FF28400, +/**/ 0x502065D2, 0xBF258CDF, +/**/ 0x095F6000, 0xBFC2AC55, +/**/ 0xD0C6C8A8, 0x3D1D3466, +/**/ 0x00000000, 0x3FF27C00, +/**/ 0x1CE4D6F8, 0x3F3FA38A, +/**/ 0xBC11A000, 0xBFC28753, +/**/ 0x359302E6, 0xBD37494E, +/**/ 0x00000000, 0x3FF27800, +/**/ 0xDCCA0781, 0x3F247DD5, +/**/ 0x1E6DE000, 0xBFC2625D, +/**/ 0xF09E3D82, 0x3CF52962, +/**/ 0x00000000, 0x3FF27400, +/**/ 0xDB195E8F, 0xBF25E8EF, +/**/ 0x2A49C000, 0xBFC23D71, +/**/ 0x8FD3DF5C, 0xBD100D23, +/**/ 0x00000000, 0x3FF27000, +/**/ 0xFFB647FE, 0xBF3FF6C8, +/**/ 0xD9808000, 0xBFC2188F, +/**/ 0x7F50C701, 0x3D3B3A1E, +/**/ 0x00000000, 0x3FF26800, +/**/ 0xC024D167, 0x3F266F9A, +/**/ 0x25F26000, 0xBFC1F3B9, +/**/ 0x9B083633, 0x3D15F74E, +/**/ 0x00000000, 0x3FF26400, +/**/ 0xEABD0E14, 0xBF22D1BD, +/**/ 0x09854000, 0xBFC1CEED, +/**/ 0x39192AF9, 0x3D315C1C, +/**/ 0x00000000, 0x3FF26000, +/**/ 0xF6D0EEC8, 0xBF3DD8F7, +/**/ 0x7E240000, 0xBFC1AA2B, +/**/ 0xDDE3B366, 0x3D31AC38, +/**/ 0x00000000, 0x3FF25800, +/**/ 0x2A241EF6, 0x3F2BCEB1, +/**/ 0x7DBEC000, 0xBFC18574, +/**/ 0x45BD9B49, 0xBD3E6744, +/**/ 0x00000000, 0x3FF25400, +/**/ 0xA21378D7, 0xBF18A05B, +/**/ 0x024B2000, 0xBFC160C8, +/**/ 0xA9009E3D, 0xBD2EC2D2, +/**/ 0x00000000, 0x3FF25000, +/**/ 0xD6CFA90C, 0xBF3A076F, +/**/ 0x05C3A000, 0xBFC13C26, +/**/ 0xD94F6509, 0x3D2CF5FD, +/**/ 0x00000000, 0x3FF24800, +/**/ 0x92492492, 0x3F324924, +/**/ 0x8227E000, 0xBFC1178E, +/**/ 0xCE2D07F2, 0xBD21EF78, +/**/ 0x00000000, 0x3FF24400, +/**/ 0x6151E899, 0xBEF3682B, +/**/ 0x717D0000, 0xBFC0F301, +/**/ 0x41AE86C5, 0x3D3E09B4, +/**/ 0x00000000, 0x3FF24000, +/**/ 0x89FA4C67, 0xBF34868E, +/**/ 0xCDCCC000, 0xBFC0CE7E, +/**/ 0xABFF5447, 0xBD14652D, +/**/ 0x00000000, 0x3FF23800, +/**/ 0x6B11F09F, 0x3F3858D8, +/**/ 0x91268000, 0xBFC0AA06, +/**/ 0xD7032129, 0x3D345519, +/**/ 0x00000000, 0x3FF23400, +/**/ 0xAF37C049, 0x3F159E26, +/**/ 0xB59E4000, 0xBFC08598, +/**/ 0x7009902C, 0x3D27E5DD, +/**/ 0x00000000, 0x3FF23000, +/**/ 0x2E076329, 0xBF2AB546, +/**/ 0x354D4000, 0xBFC06135, +/**/ 0x28340EE9, 0xBD363046, +/**/ 0x00000000, 0x3FF22C00, +/**/ 0xFEDD5FEE, 0xBF3FEDD5, +/**/ 0x0A51E000, 0xBFC03CDC, +/**/ 0xF169FC5C, 0xBD381A9C, +/**/ 0x00000000, 0x3FF22400, +/**/ 0x009126D7, 0x3F2B5B92, +/**/ 0x2ECF6000, 0xBFC0188D, +/**/ 0x1CFF9DFE, 0xBD03F965, +/**/ 0x00000000, 0x3FF22000, +/**/ 0x8121FB78, 0xBF121FB7, +/**/ 0x39DBC000, 0xBFBFE891, +/**/ 0xD82F7A82, 0xBD356594, +/**/ 0x00000000, 0x3FF21C00, +/**/ 0x3A459635, 0xBF368F22, +/**/ 0x9DB58000, 0xBFBFA01C, +/**/ 0xFA48A730, 0x3D08F351, +/**/ 0x00000000, 0x3FF21400, +/**/ 0x855E6012, 0x3F379804, +/**/ 0x7D900000, 0xBFBF57BC, +/**/ 0x9EA8B04E, 0xBD176A6C, +/**/ 0x00000000, 0x3FF21000, +/**/ 0x78CD7A37, 0x3F17B57C, +/**/ 0xCDD98000, 0xBFBF0F70, +/**/ 0x6C272C1E, 0xBD32E31F, +/**/ 0x00000000, 0x3FF20C00, +/**/ 0x07E4EF15, 0xBF271E73, +/**/ 0x830A0000, 0xBFBEC739, +/**/ 0xA80CDD10, 0xBD311FCB, +/**/ 0x00000000, 0x3FF20800, +/**/ 0x49392BA7, 0xBF3CDDEC, +/**/ 0x91A34000, 0xBFBE7F16, +/**/ 0x9BC77BFA, 0x3D32C1C5, +/**/ 0x00000000, 0x3FF20000, +/**/ 0x12012012, 0x3F320120, +/**/ 0xEE304000, 0xBFBE3707, +/**/ 0xE6766ABD, 0xBD20F684, +/**/ 0x00000000, 0x3FF1FC00, +/**/ 0xCE8AD1A2, 0x3EF0DC4F, +/**/ 0x8D468000, 0xBFBDEF0D, +/**/ 0x412E9A74, 0x3D324750, +/**/ 0x00000000, 0x3FF1F800, +/**/ 0xDC11F704, 0xBF2F7047, +/**/ 0x63844000, 0xBFBDA727, +/**/ 0x1FA71733, 0xBD1A8940, +/**/ 0x00000000, 0x3FF1F000, +/**/ 0x16B6419D, 0x3F3FAF3F, +/**/ 0x65920000, 0xBFBD5F55, +/**/ 0xCC185469, 0xBD30E239, +/**/ 0x00000000, 0x3FF1EC00, +/**/ 0xF70985E2, 0x3F2E878F, +/**/ 0x88218000, 0xBFBD1797, +/**/ 0xB5EFBEED, 0xBD336433, +/**/ 0x00000000, 0x3FF1E800, +/**/ 0x94D7FDC3, 0xBEEF55E4, +/**/ 0xBFEE0000, 0xBFBCCFED, +/**/ 0x2FE71256, 0xBD33A823, +/**/ 0x00000000, 0x3FF1E400, +/**/ 0x0478BBCF, 0xBF310C4C, +/**/ 0x01BC4000, 0xBFBC8858, +/**/ 0xC65AACD3, 0xBD2646D1, +/**/ 0x00000000, 0x3FF1DC00, +/**/ 0xCB840C49, 0x3F3F0ECB, +/**/ 0x425A4000, 0xBFBC40D6, +/**/ 0x1D1930DD, 0xBD3CB112, +/**/ 0x00000000, 0x3FF1D800, +/**/ 0xC9579074, 0x3F2EACE5, +/**/ 0x769FC000, 0xBFBBF968, +/**/ 0x8D824283, 0xBD24218C, +/**/ 0x00000000, 0x3FF1D400, +/**/ 0xFC60F0AE, 0xBECABDFA, +/**/ 0x936D8000, 0xBFBBB20E, +/**/ 0x35459B8E, 0x3D368BA8, +/**/ 0x00000000, 0x3FF1D000, +/**/ 0xAFDC61F3, 0xBF2F2A4B, +/**/ 0x8DAD4000, 0xBFBB6AC8, +/**/ 0xF50225C7, 0xBD3B1BDF, +/**/ 0x00000000, 0x3FF1CC00, +/**/ 0xAB802394, 0xBF3EC8AF, +/**/ 0x5A530000, 0xBFBB2396, +/**/ 0xEA137079, 0x3CEFF64E, +/**/ 0x00000000, 0x3FF1C400, +/**/ 0xCE058D9B, 0x3F322FC1, +/**/ 0xEE5B0000, 0xBFBADC77, +/**/ 0x09C31904, 0x3D3573B2, +/**/ 0x00000000, 0x3FF1C000, +/**/ 0xE0EFA2CF, 0x3F0AA04F, +/**/ 0x3ECAC000, 0xBFBA956D, +/**/ 0x4C02C4AF, 0xBD3E6379, +/**/ 0x00000000, 0x3FF1BC00, +/**/ 0x225ADFDD, 0xBF26B7F7, +/**/ 0x40B1C000, 0xBFBA4E76, +/**/ 0xB94407C8, 0x3D0E42B6, +/**/ 0x00000000, 0x3FF1B800, +/**/ 0x217CD13A, 0xBF39E073, +/**/ 0xE9278000, 0xBFBA0792, +/**/ 0xC9AD51BF, 0x3D0A9CE6, +/**/ 0x00000000, 0x3FF1B000, +/**/ 0x2BAE2B21, 0x3F37C67F, +/**/ 0x2D4D4000, 0xBFB9C0C3, +/**/ 0x9E838668, 0x3D3AB7C0, +/**/ 0x00000000, 0x3FF1AC00, +/**/ 0xBD720DCF, 0x3F23316E, +/**/ 0x024CC000, 0xBFB97A07, +/**/ 0x732093CE, 0x3CF8BCC1, +/**/ 0x00000000, 0x3FF1A800, +/**/ 0x611A7B96, 0xBF11A7B9, +/**/ 0x5D594000, 0xBFB9335E, +/**/ 0x3ABD47DA, 0xBD23115C, +/**/ 0x00000000, 0x3FF1A400, +/**/ 0xA1C1B8E7, 0xBF324195, +/**/ 0x33AEC000, 0xBFB8ECC9, +/**/ 0xBE67F7AA, 0x3D222F39, +/**/ 0x00000000, 0x3FF1A000, +/**/ 0xFEE61FEE, 0xBF3FEE61, +/**/ 0x7A91C000, 0xBFB8A647, +/**/ 0xAF9BD6DF, 0xBD3C28C0, +/**/ 0x00000000, 0x3FF19800, +/**/ 0x362B721D, 0x3F328F89, +/**/ 0x27508000, 0xBFB85FD9, +/**/ 0x19970C1C, 0x3D35B818, +/**/ 0x00000000, 0x3FF19400, +/**/ 0x28A70119, 0x3F14E023, +/**/ 0x2F410000, 0xBFB8197E, +/**/ 0x60D20041, 0x3D3C0FE4, +/**/ 0x00000000, 0x3FF19000, +/**/ 0x3E48FC6F, 0xBF1FD419, +/**/ 0x87C28000, 0xBFB7D336, +/**/ 0x3E706706, 0xBD33C88C, +/**/ 0x00000000, 0x3FF18C00, +/**/ 0xFD42546B, 0xBF34F7C6, +/**/ 0x263D8000, 0xBFB78D02, +/**/ 0x94B69FB7, 0xBD069B57, +/**/ 0x00000000, 0x3FF18400, +/**/ 0x01185E30, 0x3F3E2FA4, +/**/ 0x00228000, 0xBFB746E1, +/**/ 0x6E1E21D2, 0x3D3126D1, +/**/ 0x00000000, 0x3FF18000, +/**/ 0x11811812, 0x3F318118, +/**/ 0x0AEAC000, 0xBFB700D3, +/**/ 0xA99DED32, 0xBCEC1E8D, +/**/ 0x00000000, 0x3FF17C00, +/**/ 0xFF2E2C43, 0x3F13F1CA, +/**/ 0x3C188000, 0xBFB6BAD8, +/**/ 0xC08926AE, 0xBD0DAF3C, +/**/ 0x00000000, 0x3FF17800, +/**/ 0x0A5EF9FF, 0xBF1D79B9, +/**/ 0x89364000, 0xBFB674F0, +/**/ 0x4C9D3302, 0xBD3A7999, +/**/ 0x00000000, 0x3FF17400, +/**/ 0x1ECEA765, 0xBF338FAD, +/**/ 0xE7D78000, 0xBFB62F1B, +/**/ 0x7ED63C4E, 0x3D217995, +/**/ 0x00000000, 0x3FF17000, +/**/ 0xD8C8714B, 0xBF3F976B, +/**/ 0x4D978000, 0xBFB5E95A, +/**/ 0xE1D17171, 0xBD31CB7C, +/**/ 0x00000000, 0x3FF16800, +/**/ 0xB08FA497, 0x3F348A33, +/**/ 0xB01AC000, 0xBFB5A3AB, +/**/ 0x9E6AFA18, 0xBD3E2574, +/**/ 0x00000000, 0x3FF16400, +/**/ 0x864022C9, 0x3F21AA1F, +/**/ 0x050E0000, 0xBFB55E10, +/**/ 0x0C53C72E, 0xBD0C1D74, +/**/ 0x00000000, 0x3FF16000, +/**/ 0xB487BCAD, 0xBF05B7C9, +/**/ 0x42260000, 0xBFB51887, +/**/ 0x96258B3E, 0xBD330A1D, +/**/ 0x00000000, 0x3FF15C00, +/**/ 0x5B1E5F75, 0xBF2C3411, +/**/ 0x5D208000, 0xBFB4D311, +/**/ 0x82F4E1EF, 0x3CF53A25, +/**/ 0x00000000, 0x3FF15800, +/**/ 0xEEA99544, 0xBF39543F, +/**/ 0x4BC30000, 0xBFB48DAE, +/**/ 0x208C200C, 0xBD30185B, +/**/ 0x00000000, 0x3FF15000, +/**/ 0xDD5C8CB8, 0x3F3B9A3F, +/**/ 0x03DBC000, 0xBFB4485E, +/**/ 0xE8D26AB7, 0xBD3FAD46, +/**/ 0x00000000, 0x3FF14C00, +/**/ 0xB19AE5C7, 0x3F30B155, +/**/ 0x7B414000, 0xBFB40320, +/**/ 0xAA8157C0, 0xBD26FD84, +/**/ 0x00000000, 0x3FF14800, +/**/ 0xB34EDA32, 0x3F17C382, +/**/ 0xA7D20000, 0xBFB3BDF5, +/**/ 0xAD125895, 0x3D319BD0, +/**/ 0x00000000, 0x3FF14400, +/**/ 0xBAF129D0, 0xBF129CFF, +/**/ 0x7F748000, 0xBFB378DD, +/**/ 0x28F1FACA, 0xBD371411, +/**/ 0x00000000, 0x3FF14000, +/**/ 0x771B7C7F, 0xBF2E2E59, +/**/ 0xF8184000, 0xBFB333D7, +/**/ 0xA81B8848, 0x3CE692B6, +/**/ 0x00000000, 0x3FF13C00, +/**/ 0x30FE1D9C, 0xBF395F06, +/**/ 0x07B40000, 0xBFB2EEE5, +/**/ 0xDD77C860, 0xBD08081E, +/**/ 0x00000000, 0x3FF13400, +/**/ 0x5C81135D, 0x3F3C8113, +/**/ 0xA4470000, 0xBFB2AA04, +/**/ 0xA8B1CB41, 0xBD37A48B, +/**/ 0x00000000, 0x3FF13000, +/**/ 0xBB3B5DC0, 0x3F3288FF, +/**/ 0xC3D8C000, 0xBFB26536, +/**/ 0x097C5BA3, 0xBD0B4BAC, +/**/ 0x00000000, 0x3FF12C00, +/**/ 0xB81577AE, 0x3F21713D, +/**/ 0x5C784000, 0xBFB2207B, +/**/ 0xFC10C7BF, 0xBD349D8C, +/**/ 0x00000000, 0x3FF12800, +/**/ 0xBAD6FC84, 0xBEEE05E5, +/**/ 0x643D0000, 0xBFB1DBD2, +/**/ 0xD977C494, 0xBD390B24, +/**/ 0x00000000, 0x3FF12400, +/**/ 0x59F992BF, 0xBF24E314, +/**/ 0xD1464000, 0xBFB1973B, +/**/ 0x54F930B3, 0xBD3566D1, +/**/ 0x00000000, 0x3FF12000, +/**/ 0xC9F6E7A8, 0xBF33CB91, +/**/ 0x99BB4000, 0xBFB152B7, +/**/ 0x07030829, 0x3D09BB29, +/**/ 0x00000000, 0x3FF11C00, +/**/ 0x8B7D9851, 0xBF3CFE65, +/**/ 0xB3CB0000, 0xBFB10E45, +/**/ 0x284A3465, 0x3D37CF69, +/**/ 0x00000000, 0x3FF11400, +/**/ 0x29605DF7, 0x3F39F5DB, +/**/ 0x15AC4000, 0xBFB0C9E6, +/**/ 0x0974D976, 0xBD2C2DA8, +/**/ 0x00000000, 0x3FF11000, +/**/ 0x11111111, 0x3F311111, +/**/ 0xB59E4000, 0xBFB08598, +/**/ 0x7009902C, 0x3D17E5DD, +/**/ 0x00000000, 0x3FF10C00, +/**/ 0x12A5B1AE, 0x3F20A63A, +/**/ 0x89E74000, 0xBFB0415D, +/**/ 0x5CF1D753, 0xBD1111C0, +/**/ 0x00000000, 0x3FF10800, +/**/ 0xBE011080, 0xBED107FB, +/**/ 0x11AB8000, 0xBFAFFA69, +/**/ 0x98381A8F, 0xBD23008C, +/**/ 0x00000000, 0x3FF10400, +/**/ 0x6FEABBAE, 0xBF216989, +/**/ 0x51800000, 0xBFAF723B, +/**/ 0xDD5610D3, 0x3D3D6EB0, +/**/ 0x00000000, 0x3FF10000, +/**/ 0x10FEF011, 0xBF30FEF0, +/**/ 0xC0068000, 0xBFAEEA31, +/**/ 0x3606D891, 0xBD3C3DD8, +/**/ 0x00000000, 0x3FF0FC00, +/**/ 0x98CDDC74, 0xBF3922C0, +/**/ 0x4A0B8000, 0xBFAE624C, +/**/ 0x74676689, 0x3D30F25C, +/**/ 0x00000000, 0x3FF0F400, +/**/ 0x325A1A80, 0x3F3EDFAB, +/**/ 0xDC680000, 0xBFADDA8A, +/**/ 0x64D9E42F, 0x3D21B1AC, +/**/ 0x00000000, 0x3FF0F000, +/**/ 0xF27F9A57, 0x3F370834, +/**/ 0x64060000, 0xBFAD52ED, +/**/ 0x2A29BBD6, 0x3D33C85D, +/**/ 0x00000000, 0x3FF0EC00, +/**/ 0xD391FBC5, 0x3F2EAD7C, +/**/ 0xCDDD8000, 0xBFACCB73, +/**/ 0x6E09F5FE, 0xBD3965C3, +/**/ 0x00000000, 0x3FF0E800, +/**/ 0xE9479870, 0x3F1F2CA5, +/**/ 0x06F70000, 0xBFAC441E, +/**/ 0x49850D15, 0xBD354F1F, +/**/ 0x00000000, 0x3FF0E400, +/**/ 0x80439019, 0x3ED95609, +/**/ 0xFC690000, 0xBFABBCEB, +/**/ 0x8C317C2A, 0x3D17BF86, +/**/ 0x00000000, 0x3FF0E000, +/**/ 0xC6867596, 0xBF1B6B4D, +/**/ 0x9B588000, 0xBFAB35DD, +/**/ 0xD6CF558E, 0xBD3D5674, +/**/ 0x00000000, 0x3FF0DC00, +/**/ 0x172D4CE8, 0xBF2BEAEE, +/**/ 0xD0FB0000, 0xBFAAAEF2, +/**/ 0x353BB42E, 0xBD20FC1A, +/**/ 0x00000000, 0x3FF0D800, +/**/ 0x479071A9, 0xBF34EAB0, +/**/ 0x8A938000, 0xBFAA282B, +/**/ 0x80EFC8E3, 0x3D2E8F59, +/**/ 0x00000000, 0x3FF0D400, +/**/ 0xA61C62D3, 0xBF3BBA9C, +/**/ 0xB5740000, 0xBFA9A187, +/**/ 0x4EC4D90D, 0x3D30C22E, +/**/ 0x00000000, 0x3FF0CC00, +/**/ 0x77344011, 0x3F3D9AA6, +/**/ 0x3EFD8000, 0xBFA91B07, +/**/ 0x3F76CA96, 0x3D19D7C5, +/**/ 0x00000000, 0x3FF0C800, +/**/ 0xCDA3AC11, 0x3F3714FB, +/**/ 0x149F8000, 0xBFA894AA, +/**/ 0x8BE97661, 0xBD39A19A, +/**/ 0x00000000, 0x3FF0C400, +/**/ 0x391F2E61, 0x3F30B446, +/**/ 0x23D90000, 0xBFA80E70, +/**/ 0x6F28BF45, 0x3D399DC1, +/**/ 0x00000000, 0x3FF0C000, +/**/ 0x682E11CD, 0x3F24F0D1, +/**/ 0x5A358000, 0xBFA78859, +/**/ 0x083B3A4C, 0x3D108B0D, +/**/ 0x00000000, 0x3FF0BC00, +/**/ 0x5D5A36EA, 0x3F118519, +/**/ 0xA5510000, 0xBFA70265, +/**/ 0x11FD5CE7, 0x3D2888DF, +/**/ 0x00000000, 0x3FF0B800, +/**/ 0x62386CAB, 0xBEF913DA, +/**/ 0xF2D48000, 0xBFA67C94, +/**/ 0x827CCA0C, 0xBD3DAC20, +/**/ 0x00000000, 0x3FF0B400, +/**/ 0xBD31D7D0, 0xBF1D7CFF, +/**/ 0x30790000, 0xBFA5F6E7, +/**/ 0x8012494C, 0x3D20485A, +/**/ 0x00000000, 0x3FF0B000, +/**/ 0x226951DC, 0xBF2A11BA, +/**/ 0x4C040000, 0xBFA5715C, +/**/ 0xDFC47628, 0x3D38888D, +/**/ 0x00000000, 0x3FF0AC00, +/**/ 0x7B2E9DD2, 0xBF328E31, +/**/ 0x334A0000, 0xBFA4EBF4, +/**/ 0xF73BE773, 0x3D2D9150, +/**/ 0x00000000, 0x3FF0A800, +/**/ 0x7EF597EF, 0xBF37EF59, +/**/ 0xD42E0000, 0xBFA466AE, +/**/ 0x75BDFD28, 0x3D2C1673, +/**/ 0x00000000, 0x3FF0A400, +/**/ 0x50D413C1, 0xBF3D2C71, +/**/ 0x1CA08000, 0xBFA3E18C, +/**/ 0x3F6E378E, 0xBD3748ED, +/**/ 0x00000000, 0x3FF09C00, +/**/ 0xF836010A, 0x3F3DBA6A, +/**/ 0xFAA10000, 0xBFA35C8B, +/**/ 0x5EF9EB35, 0xBD38357D, +/**/ 0x00000000, 0x3FF09800, +/**/ 0x624D4AF5, 0x3F38C51F, +/**/ 0x5C3C8000, 0xBFA2D7AE, +/**/ 0x459DA66D, 0x3D322939, +/**/ 0x00000000, 0x3FF09400, +/**/ 0x10953F39, 0x3F33F390, +/**/ 0x2F8D0000, 0xBFA252F3, +/**/ 0xE021B67B, 0xBD283E9A, +/**/ 0x00000000, 0x3FF09000, +/**/ 0x861539B9, 0x3F2E8B42, +/**/ 0x62BC0000, 0xBFA1CE5A, +/**/ 0x8D8DF999, 0xBD3A9CC7, +/**/ 0x00000000, 0x3FF08C00, +/**/ 0xACBC4021, 0x3F25766E, +/**/ 0xE4008000, 0xBFA149E3, +/**/ 0x9A4168FD, 0x3D32B98A, +/**/ 0x00000000, 0x3FF08800, +/**/ 0x0F3DBD5A, 0x3F1950DB, +/**/ 0xA19E0000, 0xBFA0C58F, +/**/ 0x58B17913, 0x3D0559D1, +/**/ 0x00000000, 0x3FF08400, +/**/ 0x08421084, 0x3F008421, +/**/ 0x89E78000, 0xBFA0415D, +/**/ 0xF461C516, 0x3D3DDDC7, +/**/ 0x00000000, 0x3FF08000, +/**/ 0x0041FF7C, 0xBF007FDF, +/**/ 0x16780000, 0xBF9F7A9B, +/**/ 0x271BE7D7, 0xBD242AD9, +/**/ 0x00000000, 0x3FF07C00, +/**/ 0xC54798FB, 0xBF183591, +/**/ 0x28140000, 0xBF9E72BF, +/**/ 0x49774D47, 0x3D28D751, +/**/ 0x00000000, 0x3FF07800, +/**/ 0x518F4EFD, 0xBF23CFA1, +/**/ 0x25980000, 0xBF9D6B27, +/**/ 0x50D1B838, 0x3D39FF7B, +/**/ 0x00000000, 0x3FF07400, +/**/ 0x01073261, 0xBF2B3EB7, +/**/ 0xEC150000, 0xBF9C63D2, +/**/ 0xE030A687, 0x3D35439C, +/**/ 0x00000000, 0x3FF07000, +/**/ 0xD6EAB025, 0xBF31341F, +/**/ 0x58B70000, 0xBF9B5CC2, +/**/ 0xB8AFBFE8, 0xBD18E611, +/**/ 0x00000000, 0x3FF06C00, +/**/ 0x6ED049E0, 0xBF34A638, +/**/ 0x48C60000, 0xBF9A55F5, +/**/ 0x9F2D03C9, 0x3D2DE070, +/**/ 0x00000000, 0x3FF06800, +/**/ 0xEF997F5C, 0xBF37F5BF, +/**/ 0x99A20000, 0xBF994F6B, +/**/ 0xF96CF7F5, 0xBD311D5E, +/**/ 0x00000000, 0x3FF06400, +/**/ 0xE5604189, 0xBF3B22D0, +/**/ 0x28C90000, 0xBF984925, +/**/ 0x325A0C34, 0x3D2AA0BA, +/**/ 0x00000000, 0x3FF06000, +/**/ 0xC1163FF0, 0xBF3E2D85, +/**/ 0xD3D00000, 0xBF974321, +/**/ 0x0FE94778, 0xBCFB4A69, +/**/ 0x00000000, 0x3FF05800, +/**/ 0x27586632, 0x3F3EEA07, +/**/ 0x78690000, 0xBF963D61, +/**/ 0x89596542, 0xBD07ABF3, +/**/ 0x00000000, 0x3FF05400, +/**/ 0x98E2A5E7, 0x3F3C23BB, +/**/ 0xF45F0000, 0xBF9537E3, +/**/ 0xD2D7F253, 0xBD2AB259, +/**/ 0x00000000, 0x3FF05000, +/**/ 0x73404146, 0x3F397F7D, +/**/ 0x25980000, 0xBF9432A9, +/**/ 0x928637FE, 0xBD098139, +/**/ 0x00000000, 0x3FF04C00, +/**/ 0xB0C7B49A, 0x3F36FD32, +/**/ 0xEA130000, 0xBF932DB0, +/**/ 0x130895FC, 0xBD2710CB, +/**/ 0x00000000, 0x3FF04800, +/**/ 0x664C578A, 0x3F349CC1, +/**/ 0x1FEA0000, 0xBF9228FB, +/**/ 0x284991FE, 0xBD2713E3, +/**/ 0x00000000, 0x3FF04400, +/**/ 0xC2FCB1F4, 0x3F325E0F, +/**/ 0xA5500000, 0xBF912487, +/**/ 0xFED4B393, 0xBD3FDBE5, +/**/ 0x00000000, 0x3FF04000, +/**/ 0x10410410, 0x3F304104, +/**/ 0x58930000, 0xBF902056, +/**/ 0x7C8E8417, 0xBD3611D2, +/**/ 0x00000000, 0x3FF03C00, +/**/ 0x6334030B, 0x3F2C8B09, +/**/ 0x30340000, 0xBF8E38CE, +/**/ 0xA3DA281A, 0x3D39DE88, +/**/ 0x00000000, 0x3FF03800, +/**/ 0x48FF7E3A, 0x3F28D6F0, +/**/ 0x84C80000, 0xBF8C3173, +/**/ 0xFCEFB9FE, 0x3D341F33, +/**/ 0x00000000, 0x3FF03400, +/**/ 0x0081A559, 0x3F25658A, +/**/ 0x6C180000, 0xBF8A2A9C, +/**/ 0x4D6D3472, 0x3D3F73BC, +/**/ 0x00000000, 0x3FF03000, +/**/ 0xEBC349DE, 0x3F2236A3, +/**/ 0xA3880000, 0xBF882448, +/**/ 0x12C584E0, 0xBD345544, +/**/ 0x00000000, 0x3FF02C00, +/**/ 0x3FEFD386, 0x3F1E9417, +/**/ 0xE8B60000, 0xBF861E77, +/**/ 0xEAF8EAF3, 0x3D38073E, +/**/ 0x00000000, 0x3FF02800, +/**/ 0xCA7A317C, 0x3F193F1D, +/**/ 0xF9680000, 0xBF841929, +/**/ 0x55D01368, 0xBD1977C7, +/**/ 0x00000000, 0x3FF02400, +/**/ 0x6CB49652, 0x3F146DF7, +/**/ 0x939E0000, 0xBF82145E, +/**/ 0x38C4EA00, 0xBD3E3D12, +/**/ 0x00000000, 0x3FF02000, +/**/ 0x81020408, 0x3F102040, +/**/ 0x75880000, 0xBF801015, +/**/ 0x1998B506, 0xBD3BCE25, +/**/ 0x00000000, 0x3FF01C00, +/**/ 0x8C355D63, 0x3F08AB2B, +/**/ 0xBB100000, 0xBF7C189C, +/**/ 0x12588560, 0x3D3D8055, +/**/ 0x00000000, 0x3FF01800, +/**/ 0xBD1BA97E, 0x3F021B28, +/**/ 0x14580000, 0xBF781212, +/**/ 0x82973F27, 0xBD1AD503, +/**/ 0x00000000, 0x3FF01400, +/**/ 0x411155AB, 0x3EF91F67, +/**/ 0x74780000, 0xBF740C8A, +/**/ 0xDF070002, 0xBD1E3871, +/**/ 0x00000000, 0x3FF01000, +/**/ 0x10101010, 0x3EF01010, +/**/ 0x59580000, 0xBF700805, +/**/ 0xCB31C67B, 0xBD2166AF, +/**/ 0x00000000, 0x3FF00C00, +/**/ 0x279DB649, 0x3EE20D8A, +/**/ 0x82880000, 0xBF680904, +/**/ 0x96A70C0C, 0xBD285C06, +/**/ 0x00000000, 0x3FF00800, +/**/ 0x02010080, 0x3ED00804, +/**/ 0x55D80000, 0xBF600401, +/**/ 0xC7CC7089, 0x3D33BB10, +/**/ 0x00000000, 0x3FF00400, +/**/ 0x00401004, 0x3EB00401, +/**/ 0x55600000, 0xBF500200, +/**/ 0xCD5F35F8, 0xBD356224, +/**/ 0x00000000, 0x3FF00000, +/**/ 0x00000000, 0x00000000, +/**/ 0x00000000, 0x00000000, +/**/ 0x00000000, 0x00000000, +/**/ 0x00000000, 0x3FEFF800, +/**/ 0xFF801FF8, 0x3EAFF801, +/**/ 0xAA800000, 0x3F4FFC00, +/**/ 0x7809A0A3, 0x3D35621F, +/**/ 0x00000000, 0x3FEFF000, +/**/ 0xFC01FF00, 0x3ECFF007, +/**/ 0xA9B00000, 0x3F5FF802, +/**/ 0x1D61C5EB, 0xBD33BC66, +/**/ 0x00000000, 0x3FEFE800, +/**/ 0x186DADBE, 0x3EE1F28A, +/**/ 0x7D780000, 0x3F67F704, +/**/ 0x89D68648, 0x3D283DA6, +/**/ 0x00000000, 0x3FEFE000, +/**/ 0xE01FE020, 0x3EEFE01F, +/**/ 0xA2B00000, 0x3F6FF00A, +/**/ 0xA086B56A, 0x3D20BC04, +/**/ 0x00000000, 0x3FEFD800, +/**/ 0xDF68BD14, 0x3EF8E0E6, +/**/ 0x60F00000, 0x3F73F38A, +/**/ 0x93C93749, 0x3D192256, +/**/ 0x00000000, 0x3FEFD000, +/**/ 0x439A981C, 0x3F01E528, +/**/ 0xEBD80000, 0x3F77EE11, +/**/ 0xC2D23A07, 0x3D0749D3, +/**/ 0x00000000, 0x3FEFC800, +/**/ 0x8596391C, 0x3F08556A, +/**/ 0x70040000, 0x3F7BE79C, +/**/ 0x9A6C0404, 0x3D38EC8F, +/**/ 0x00000000, 0x3FEFC000, +/**/ 0x01FC07F0, 0x3F0FC07F, +/**/ 0x6B100000, 0x3F7FE02A, +/**/ 0x0DDA40E4, 0x3D19E23F, +/**/ 0x00000000, 0x3FEFB800, +/**/ 0x9F5976B5, 0x3F1412D5, +/**/ 0x2D1A0000, 0x3F81EBDE, +/**/ 0xFF48DC36, 0xBD2A0683, +/**/ 0x00000000, 0x3FEFB000, +/**/ 0xBD271E34, 0x3F18C21A, +/**/ 0x5D260000, 0x3F83E729, +/**/ 0xFF29A114, 0xBD2609C1, +/**/ 0x00000000, 0x3FEFA800, +/**/ 0x5594A734, 0x3F1DEDB2, +/**/ 0x03EC0000, 0x3F85E1F7, +/**/ 0xF585DA1B, 0x3D37CA09, +/**/ 0x00000000, 0x3FEFA000, +/**/ 0x1FA11CAA, 0x3F21CAA0, +/**/ 0x5F820000, 0x3F87DC47, +/**/ 0x5B5DA1F5, 0xBD3EB124, +/**/ 0x00000000, 0x3FEF9800, +/**/ 0x55E8CB6B, 0x3F24DC34, +/**/ 0xADC60000, 0x3F89D61A, +/**/ 0x327B4257, 0x3D37B196, +/**/ 0x00000000, 0x3FEF9000, +/**/ 0x13BAF1B2, 0x3F282B68, +/**/ 0x2C740000, 0x3F8BCF71, +/**/ 0x97BD9771, 0x3D1C25E0, +/**/ 0x00000000, 0x3FEF8800, +/**/ 0xCC420861, 0x3F2BB80D, +/**/ 0x19120000, 0x3F8DC84B, +/**/ 0x1E3A5B30, 0x3D1C0A54, +/**/ 0x00000000, 0x3FEF8000, +/**/ 0x1F81F820, 0x3F2F81F8, +/**/ 0xB0FC0000, 0x3F8FC0A8, +/**/ 0xF6D3A69C, 0x3CDF1E7C, +/**/ 0x00000000, 0x3FEF7800, +/**/ 0xED1079FA, 0x3F31C47C, +/**/ 0x18B00000, 0x3F90DC45, +/**/ 0x380313FC, 0xBD29BC2F, +/**/ 0x00000000, 0x3FEF7000, +/**/ 0xFA98528D, 0x3F33E672, +/**/ 0xEB9F0000, 0x3F91D7F7, +/**/ 0x83FCC7A6, 0xBD14193A, +/**/ 0x00000000, 0x3FEF6800, +/**/ 0xCAFBD3D2, 0x3F3626C7, +/**/ 0xEFB50000, 0x3F92D36C, +/**/ 0x341706C3, 0x3D35F0BB, +/**/ 0x00000000, 0x3FEF6000, +/**/ 0x06DDABA6, 0x3F388565, +/**/ 0x43470000, 0x3F93CEA4, +/**/ 0x32D6A40B, 0xBD36A2C4, +/**/ 0x00000000, 0x3FEF5800, +/**/ 0x6CC4F5F5, 0x3F3B0234, +/**/ 0x04900000, 0x3F94C99E, +/**/ 0x5DF5F4A5, 0x3D1DECC6, +/**/ 0x00000000, 0x3FEF5000, +/**/ 0xD102728A, 0x3F3D9D1F, +/**/ 0x51B90000, 0x3F95C45A, +/**/ 0x216D87D8, 0xBD263BB6, +/**/ 0x00000000, 0x3FEF5000, +/**/ 0xE26A1DD4, 0xBF3FA9EE, +/**/ 0x48D20000, 0x3F96BED9, +/**/ 0x160A43F8, 0xBD320BC4, +/**/ 0x00000000, 0x3FEF4800, +/**/ 0xADEC7540, 0xBF3CD30D, +/**/ 0x07D60000, 0x3F97B91B, +/**/ 0xB602ACE4, 0xBD33B955, +/**/ 0x00000000, 0x3FEF4000, +/**/ 0x7C761DC6, 0xBF39DE52, +/**/ 0xACAA0000, 0x3F98B31F, +/**/ 0xA96E4964, 0xBD33FC78, +/**/ 0x00000000, 0x3FEF3800, +/**/ 0x23989FF0, 0xBF36CBD3, +/**/ 0x551D0000, 0x3F99ACE7, +/**/ 0x7EC7C410, 0xBD2D75D9, +/**/ 0x00000000, 0x3FEF3000, +/**/ 0x639F8B15, 0xBF339BA5, +/**/ 0x1EE80000, 0x3F9AA672, +/**/ 0x5C5AF494, 0x3D2AD4EB, +/**/ 0x00000000, 0x3FEF2800, +/**/ 0xE7AA579B, 0xBF304DDE, +/**/ 0x27B00000, 0x3F9B9FC0, +/**/ 0x0AE6922A, 0xBD3B9A01, +/**/ 0x00000000, 0x3FEF2000, +/**/ 0x8B8C46FD, 0xBF29C52A, +/**/ 0x8D010000, 0x3F9C98D1, +/**/ 0x0589DF0F, 0xBD2BF615, +/**/ 0x00000000, 0x3FEF1800, +/**/ 0xFE0E92B4, 0xBF22B3BB, +/**/ 0x6C540000, 0x3F9D91A6, +/**/ 0x658CFB9A, 0x3D2E61F1, +/**/ 0x00000000, 0x3FEF1000, +/**/ 0xFE8B488E, 0xBF16CF39, +/**/ 0xE30D0000, 0x3F9E8A3E, +/**/ 0x3DE53900, 0xBD21A9FA, +/**/ 0x00000000, 0x3FEF0800, +/**/ 0xF07C1F08, 0xBEFF07C1, +/**/ 0x0E780000, 0x3F9F829B, +/**/ 0x7C7E09E4, 0x3D298026, +/**/ 0x00000000, 0x3FEF0000, +/**/ 0x007C00F8, 0x3EFF003E, +/**/ 0x85E70000, 0x3FA03D5D, +/**/ 0x60ED29CF, 0x3D3F7789, +/**/ 0x00000000, 0x3FEEF800, +/**/ 0x3D759870, 0x3F17B671, +/**/ 0x7C198000, 0x3FA0B94F, +/**/ 0x6F022783, 0xBD2E8989, +/**/ 0x00000000, 0x3FEEF000, +/**/ 0x2A8BB96A, 0x3F241070, +/**/ 0x78598000, 0x3FA13523, +/**/ 0xB71FA59B, 0xBD1C1AC3, +/**/ 0x00000000, 0x3FEEE800, +/**/ 0x58E01EEA, 0x3F2C7F84, +/**/ 0x89240000, 0x3FA1B0D9, +/**/ 0x9AE889BB, 0xBD33401E, +/**/ 0x00000000, 0x3FEEE000, +/**/ 0xA3D491BC, 0x3F329425, +/**/ 0xBCEA8000, 0x3FA22C71, +/**/ 0xF87F888F, 0x3CFD2818, +/**/ 0x00000000, 0x3FEED800, +/**/ 0x9E9D2AE8, 0x3F37054D, +/**/ 0x22150000, 0x3FA2A7EC, +/**/ 0x7A9163FE, 0xBD278CE7, +/**/ 0x00000000, 0x3FEED000, +/**/ 0x540C85E6, 0x3F3B9325, +/**/ 0xC7000000, 0x3FA32348, +/**/ 0x90B1E49F, 0x3D2696DB, +/**/ 0x00000000, 0x3FEED000, +/**/ 0xF099FC26, 0xBF3FC267, +/**/ 0xB9FE8000, 0x3FA39E87, +/**/ 0x80AD9015, 0x3D3EAFD4, +/**/ 0x00000000, 0x3FEEC800, +/**/ 0xD02A4E5D, 0xBF3AFB6E, +/**/ 0x09590000, 0x3FA419A9, +/**/ 0x67D48EA7, 0x3D3B5CDC, +/**/ 0x00000000, 0x3FEEC000, +/**/ 0xD7A79FF1, 0xBF361803, +/**/ 0xC34D8000, 0x3FA494AC, +/**/ 0xA56FD247, 0x3D211C78, +/**/ 0x00000000, 0x3FEEB800, +/**/ 0x805C2197, 0xBF31183B, +/**/ 0xF60F8000, 0x3FA50F92, +/**/ 0x0A91FFE3, 0x3D296CFB, +/**/ 0x00000000, 0x3FEEB000, +/**/ 0x5FE15180, 0xBF27F854, +/**/ 0xAFC90000, 0x3FA58A5B, +/**/ 0x9570AD39, 0xBD2B2B73, +/**/ 0x00000000, 0x3FEEA800, +/**/ 0xE210C36A, 0xBF1B0F90, +/**/ 0xFE990000, 0x3FA60506, +/**/ 0x8194E036, 0xBD32BA40, +/**/ 0x00000000, 0x3FEEA000, +/**/ 0x8C33ADB2, 0xBEF6F7DD, +/**/ 0xF0948000, 0x3FA67F94, +/**/ 0x3E7E4ED7, 0x3D3ECC1F, +/**/ 0x00000000, 0x3FEE9800, +/**/ 0x1003D310, 0x3F1003D3, +/**/ 0x93C78000, 0x3FA6FA05, +/**/ 0x41D634A1, 0x3D3B415E, +/**/ 0x00000000, 0x3FEE9000, +/**/ 0x0B7672A0, 0x3F231ABF, +/**/ 0xF6330000, 0x3FA77458, +/**/ 0xE586AF09, 0xBD3181DC, +/**/ 0x00000000, 0x3FEE8800, +/**/ 0xCF172481, 0x3F2E6B5C, +/**/ 0x25CD8000, 0x3FA7EE8F, +/**/ 0x11A5C1E9, 0xBD3F4216, +/**/ 0x00000000, 0x3FEE8000, +/**/ 0x77A84876, 0x3F34F9CD, +/**/ 0x30840000, 0x3FA868A8, +/**/ 0x134AC693, 0xBD12623A, +/**/ 0x00000000, 0x3FEE7800, +/**/ 0xD7473427, 0x3F3AD9A8, +/**/ 0x243A0000, 0x3FA8E2A4, +/**/ 0x01426490, 0x3D2B9EEB, +/**/ 0x00000000, 0x3FEE7800, +/**/ 0x4578DCCA, 0xBF3F2AD3, +/**/ 0x0EC90000, 0x3FA95C83, +/**/ 0x97C5FEB8, 0xBD2C1482, +/**/ 0x00000000, 0x3FEE7000, +/**/ 0x97A6A035, 0xBF3913BA, +/**/ 0xFDFF8000, 0x3FA9D644, +/**/ 0x539A473B, 0x3D313C90, +/**/ 0x00000000, 0x3FEE6800, +/**/ 0xC594A915, 0xBF32E120, +/**/ 0xFFA40000, 0x3FAA4FE9, +/**/ 0xA0402925, 0xBD36E584, +/**/ 0x00000000, 0x3FEE6000, +/**/ 0xC5DF4232, 0xBF292632, +/**/ 0x21710000, 0x3FAAC972, +/**/ 0xF013222C, 0x3D2F8D3E, +/**/ 0x00000000, 0x3FEE5800, +/**/ 0xC3518A6E, 0xBF18A6DF, +/**/ 0x71198000, 0x3FAB42DD, +/**/ 0xE5D6704C, 0xBD1C827A, +/**/ 0x00000000, 0x3FEE5000, +/**/ 0x86833271, 0x3ED6BC08, +/**/ 0xFC450000, 0x3FABBC2B, +/**/ 0x91417DAF, 0xBD17D186, +/**/ 0x00000000, 0x3FEE4800, +/**/ 0xE672838D, 0x3F1BEB2D, +/**/ 0xD0920000, 0x3FAC355D, +/**/ 0x9ABF8388, 0x3D2F2CCC, +/**/ 0x00000000, 0x3FEE4000, +/**/ 0x9785150A, 0x3F2B6B8D, +/**/ 0xFB960000, 0x3FACAE72, +/**/ 0x2025B1BE, 0xBD3EFABF, +/**/ 0x00000000, 0x3FEE3800, +/**/ 0xE0D399FA, 0x3F348BCE, +/**/ 0x8ADB0000, 0x3FAD276B, +/**/ 0xC78A64B0, 0x3D16A423, +/**/ 0x00000000, 0x3FEE3000, +/**/ 0x933AC00F, 0x3F3B7CD0, +/**/ 0x8BE38000, 0x3FADA047, +/**/ 0xB1F6FE05, 0x3D2252C7, +/**/ 0x00000000, 0x3FEE3000, +/**/ 0x308F5281, 0xBF3D7747, +/**/ 0x0C278000, 0x3FAE1907, +/**/ 0x64629E86, 0xBD2FEA46, +/**/ 0x00000000, 0x3FEE2800, +/**/ 0x6C196F66, 0xBF36508B, +/**/ 0x19150000, 0x3FAE91AA, +/**/ 0x1DCC6A76, 0xBD0E82A0, +/**/ 0x00000000, 0x3FEE2000, +/**/ 0x1E1E1E1E, 0xBF2E1E1E, +/**/ 0xC0118000, 0x3FAF0A30, +/**/ 0x83368E91, 0xBD2D599E, +/**/ 0x00000000, 0x3FEE1800, +/**/ 0xDD355CDB, 0xBF1ECB93, +/**/ 0x0E780000, 0x3FAF829B, +/**/ 0x7C7E09E4, 0x3D398026, +/**/ 0x00000000, 0x3FEE1000, +/**/ 0x7C01E100, 0xBECE0FF8, +/**/ 0x119B8000, 0x3FAFFAE9, +/**/ 0x4262C554, 0x3D230337, +/**/ 0x00000000, 0x3FEE0800, +/**/ 0x25C73724, 0x3F1D54B5, +/**/ 0x6B624000, 0x3FB0398D, +/**/ 0xFCBFCD00, 0xBD3AB14D, +/**/ 0x00000000, 0x3FEE0000, +/**/ 0x1E01E01E, 0x3F2E01E0, +/**/ 0x35990000, 0x3FB07598, +/**/ 0xE4B59987, 0xBD3B8ECF, +/**/ 0x00000000, 0x3FEDF800, +/**/ 0xC84194BA, 0x3F36C715, +/**/ 0xEE0D0000, 0x3FB0B194, +/**/ 0x4F69EDCC, 0x3D3666EA, +/**/ 0x00000000, 0x3FEDF000, +/**/ 0xEF26D838, 0x3F3EA78B, +/**/ 0x9B554000, 0x3FB0ED83, +/**/ 0x6D48ABB4, 0xBD3901F4, +/**/ 0x00000000, 0x3FEDF000, +/**/ 0xF10995DC, 0xBF395DBF, +/**/ 0x44030000, 0x3FB12964, +/**/ 0x751AA773, 0xBD3D53BB, +/**/ 0x00000000, 0x3FEDE800, +/**/ 0x3BCBADC8, 0xBF3148E0, +/**/ 0xEEA38000, 0x3FB16536, +/**/ 0x768FA309, 0xBD147C5E, +/**/ 0x00000000, 0x3FEDE000, +/**/ 0x86E25CE1, 0xBF2233CE, +/**/ 0xA1BF8000, 0x3FB1A0FB, +/**/ 0xC319D6DC, 0x3D24A3FC, +/**/ 0x00000000, 0x3FEDD800, +/**/ 0x26B3FE23, 0xBEEA1CE9, +/**/ 0x63DB0000, 0x3FB1DCB2, +/**/ 0x5E9E8981, 0x3D39444F, +/**/ 0x00000000, 0x3FEDD000, +/**/ 0x0AB71710, 0x3F1E4836, +/**/ 0x3B75C000, 0x3FB2185B, +/**/ 0xF8F32304, 0xBD3E3189, +/**/ 0x00000000, 0x3FEDC800, +/**/ 0x00EE500F, 0x3F300EE5, +/**/ 0x2F0A0000, 0x3FB253F6, +/**/ 0xFB69A701, 0x3D3416F8, +/**/ 0x00000000, 0x3FEDC000, +/**/ 0x231C226A, 0x3F38A58D, +/**/ 0x450EC000, 0x3FB28F83, +/**/ 0xAA119769, 0x3D3A8D75, +/**/ 0x00000000, 0x3FEDC000, +/**/ 0x14715D63, 0xBF3EAA0C, +/**/ 0x83F5C000, 0x3FB2CB02, +/**/ 0xCA657021, 0x3D3E1EE2, +/**/ 0x00000000, 0x3FEDB800, +/**/ 0x92AEFFC5, 0xBF35DFF8, +/**/ 0xF22C8000, 0x3FB30673, +/**/ 0x9DCF0BA5, 0x3D24C9E2, +/**/ 0x00000000, 0x3FEDB000, +/**/ 0x67E251A0, 0xBF29F894, +/**/ 0x961BC000, 0x3FB341D7, +/**/ 0x99837610, 0x3D31D092, +/**/ 0x00000000, 0x3FEDA800, +/**/ 0x1FF89620, 0xBF0FF896, +/**/ 0x76284000, 0x3FB37D2D, +/**/ 0x9B7FF15C, 0xBD2C60AA, +/**/ 0x00000000, 0x3FEDA000, +/**/ 0x076828BD, 0x3F145E70, +/**/ 0x98B1C000, 0x3FB3B875, +/**/ 0x94ACA313, 0xBD222415, +/**/ 0x00000000, 0x3FED9800, +/**/ 0xE567D573, 0x3F2C8F60, +/**/ 0x04140000, 0x3FB3F3B0, +/**/ 0xACDFCEC5, 0x3CEE2474, +/**/ 0x00000000, 0x3FED9000, +/**/ 0xF3FC4DA2, 0x3F379118, +/**/ 0xBEA64000, 0x3FB42EDC, +/**/ 0xEA7C9ACD, 0x3D1BC0EE, +/**/ 0x00000000, 0x3FED9000, +/**/ 0x049DE4C3, 0xBF3F0C3C, +/**/ 0xCEBB4000, 0x3FB469FB, +/**/ 0x4F257194, 0x3D3B663C, +/**/ 0x00000000, 0x3FED8800, +/**/ 0xF13D5906, 0xBF35905F, +/**/ 0x3AA1C000, 0x3FB4A50D, +/**/ 0x308973E2, 0xBD2F7FE1, +/**/ 0x00000000, 0x3FED8000, +/**/ 0x77D1EA57, 0xBF27F6C8, +/**/ 0x08A34000, 0x3FB4E011, +/**/ 0xDF2C5AE5, 0x3D3AE5CF, +/**/ 0x00000000, 0x3FED7800, +/**/ 0xF4F31BA0, 0xBF026AD1, +/**/ 0x3F060000, 0x3FB51B07, +/**/ 0x278E686A, 0x3D383F69, +/**/ 0x00000000, 0x3FED7000, +/**/ 0xF26DF1BD, 0x3F1DE6B2, +/**/ 0xE40B4000, 0x3FB555EF, +/**/ 0x8C868E23, 0x3D30B497, +/**/ 0x00000000, 0x3FED6800, +/**/ 0x7BA23D96, 0x3F31599F, +/**/ 0xFDF00000, 0x3FB590CA, +/**/ 0x5722ABAA, 0x3D3C284F, +/**/ 0x00000000, 0x3FED6000, +/**/ 0xD425A760, 0x3F3B526C, +/**/ 0x92ED4000, 0x3FB5CB98, +/**/ 0xA64FC52F, 0x3D17BE44, +/**/ 0x00000000, 0x3FED6000, +/**/ 0x546A6FF1, 0xBF3A9BFC, +/**/ 0xA9374000, 0x3FB60658, +/**/ 0xDEE9C4F8, 0x3D30C3B1, +/**/ 0x00000000, 0x3FED5800, +/**/ 0x08F02FAC, 0xBF3071AD, +/**/ 0x46FE8000, 0x3FB6410B, +/**/ 0x3CBD8D14, 0xBD153F8F, +/**/ 0x00000000, 0x3FED5000, +/**/ 0x12C6C142, 0xBF18BAD9, +/**/ 0x726EC000, 0x3FB67BB0, +/**/ 0x69EF5912, 0x3CEF724B, +/**/ 0x00000000, 0x3FED4800, +/**/ 0x3254A5A2, 0x3F10B35C, +/**/ 0x31B00000, 0x3FB6B648, +/**/ 0x1377DE92, 0xBD3BF30A, +/**/ 0x00000000, 0x3FED4000, +/**/ 0x1D41D41D, 0x3F2D41D4, +/**/ 0x8AE58000, 0x3FB6F0D2, +/**/ 0x1B664613, 0xBD34B464, +/**/ 0x00000000, 0x3FED3800, +/**/ 0xF494E548, 0x3F392D71, +/**/ 0x842EC000, 0x3FB72B4F, +/**/ 0xC00C9DD3, 0xBD3704CC, +/**/ 0x00000000, 0x3FED3800, +/**/ 0xFF165C2E, 0xBF3C2DA1, +/**/ 0x23A6C000, 0x3FB765BF, +/**/ 0x35C4256A, 0xBCFECBC0, +/**/ 0x00000000, 0x3FED3000, +/**/ 0x7AA49674, 0xBF317062, +/**/ 0x6F648000, 0x3FB7A021, +/**/ 0xA18418FF, 0x3D3E124C, +/**/ 0x00000000, 0x3FED2800, +/**/ 0x749CB290, 0xBF1A6B80, +/**/ 0x6D7B0000, 0x3FB7DA76, +/**/ 0x4480C89B, 0x3D32CC84, +/**/ 0x00000000, 0x3FED2000, +/**/ 0x25C6336D, 0x3F114B52, +/**/ 0x23F8C000, 0x3FB814BE, +/**/ 0xDA82FDFD, 0x3CCB2381, +/**/ 0x00000000, 0x3FED1800, +/**/ 0xF08A3B1D, 0x3F2EB155, +/**/ 0x98E84000, 0x3FB84EF8, +/**/ 0x246977C9, 0xBD37D5CD, +/**/ 0x00000000, 0x3FED1000, +/**/ 0xBD71CD93, 0x3F3A7692, +/**/ 0xD24FC000, 0x3FB88925, +/**/ 0x44FBB806, 0xBD31D505, +/**/ 0x00000000, 0x3FED1000, +/**/ 0x89FC5E69, 0xBF3A5384, +/**/ 0xD6318000, 0x3FB8C345, +/**/ 0xACB42A66, 0x3D3B20F5, +/**/ 0x00000000, 0x3FED0800, +/**/ 0x6439240E, 0xBF2E0B56, +/**/ 0xAA8C4000, 0x3FB8FD58, +/**/ 0x1BCB725B, 0xBD3EEC90, +/**/ 0x00000000, 0x3FED0000, +/**/ 0x01CFF8C0, 0xBF0CFF8C, +/**/ 0x55594000, 0x3FB9375E, +/**/ 0x7380C364, 0x3D3EDDC3, +/**/ 0x00000000, 0x3FECF800, +/**/ 0x546D8D78, 0x3F1F7661, +/**/ 0xDC8F8000, 0x3FB97156, +/**/ 0x9AFDB97B, 0xBD3C1FC1, +/**/ 0x00000000, 0x3FECF000, +/**/ 0x25FE30D9, 0x3F3372E2, +/**/ 0x46204000, 0x3FB9AB42, +/**/ 0x26787061, 0xBD28A648, +/**/ 0x00000000, 0x3FECE800, +/**/ 0xD92305A6, 0x3F3F1FDB, +/**/ 0x97F9C000, 0x3FB9E520, +/**/ 0xB52DD050, 0x3D235FAC, +/**/ 0x00000000, 0x3FECE800, +/**/ 0x9C37FC63, 0xBF351B8A, +/**/ 0xD8060000, 0x3FBA1EF1, +/**/ 0x6DF97BCB, 0x3D3CD417, +/**/ 0x00000000, 0x3FECE000, +/**/ 0x6CB725AB, 0xBF227EC2, +/**/ 0x0C2B4000, 0x3FBA58B6, +/**/ 0x5C5C9F2A, 0xBD3CDC73, +/**/ 0x00000000, 0x3FECD800, +/**/ 0xE6C2B448, 0x3F05A240, +/**/ 0x3A4AC000, 0x3FBA926D, +/**/ 0x0BD22A9C, 0x3D356365, +/**/ 0x00000000, 0x3FECD000, +/**/ 0xFBB8D9F3, 0x3F2D7EC2, +/**/ 0x68434000, 0x3FBACC17, +/**/ 0xA0B7FA4C, 0xBD2AA783, +/**/ 0x00000000, 0x3FECC800, +/**/ 0x1B71D3E9, 0x3F3AE1DB, +/**/ 0x9BEE4000, 0x3FBB05B4, +/**/ 0x18F84A5E, 0x3D0FF22C, +/**/ 0x00000000, 0x3FECC800, +/**/ 0xCD6DE82D, 0xBF38E45A, +/**/ 0xDB220000, 0x3FBB3F44, +/**/ 0xD8DE09AF, 0x3D3FD153, +/**/ 0x00000000, 0x3FECC000, +/**/ 0xE341926A, 0xBF29269F, +/**/ 0x2BB10000, 0x3FBB78C8, +/**/ 0xBC3987E7, 0xBD325EF7, +/**/ 0x00000000, 0x3FECB800, +/**/ 0xF620C1DA, 0xBEC589FB, +/**/ 0x93690000, 0x3FBBB23E, +/**/ 0x3559DB8B, 0xBD368B18, +/**/ 0x00000000, 0x3FECB000, +/**/ 0x0DE5FF1A, 0x3F28A893, +/**/ 0x18148000, 0x3FBBEBA8, +/**/ 0xB6DF1F57, 0xBD389B78, +/**/ 0x00000000, 0x3FECA800, +/**/ 0x0039563B, 0x3F38EAB9, +/**/ 0xBF79C000, 0x3FBC2504, +/**/ 0xD0EF4ADC, 0x3D3717C4, +/**/ 0x00000000, 0x3FECA800, +/**/ 0x08F377F2, 0xBF3A67D5, +/**/ 0x8F5BC000, 0x3FBC5E54, +/**/ 0x585FBE06, 0x3D1D0C57, +/**/ 0x00000000, 0x3FECA000, +/**/ 0x072792E4, 0xBF2B46E0, +/**/ 0x8D790000, 0x3FBC9797, +/**/ 0x977D1884, 0xBD36E010, +/**/ 0x00000000, 0x3FEC9800, +/**/ 0x1BB327C3, 0xBEE904EA, +/**/ 0xBF8C0000, 0x3FBCD0CD, +/**/ 0xB50DD743, 0x3D33E14D, +/**/ 0x00000000, 0x3FEC9000, +/**/ 0x77683AEC, 0x3F2853EB, +/**/ 0x2B4C4000, 0x3FBD09F7, +/**/ 0x00354E33, 0x3D2048C0, +/**/ 0x00000000, 0x3FEC8800, +/**/ 0xDC52100E, 0x3F3932D7, +/**/ 0xD66CC000, 0x3FBD4313, +/**/ 0x79135713, 0xBD294543, +/**/ 0x00000000, 0x3FEC8800, +/**/ 0x2736962B, 0xBF39AD90, +/**/ 0xC69CC000, 0x3FBD7C23, +/**/ 0xDD328771, 0xBD297EE4, +/**/ 0x00000000, 0x3FEC8000, +/**/ 0xF316B4C2, 0xBF28EEA2, +/**/ 0x0187C000, 0x3FBDB527, +/**/ 0x56AE181F, 0x3D392778, +/**/ 0x00000000, 0x3FEC7800, +/**/ 0x058F7536, 0x3EEAB099, +/**/ 0x8CD60000, 0x3FBDEE1D, +/**/ 0x729EFF89, 0xBD328DA0, +/**/ 0x00000000, 0x3FEC7000, +/**/ 0x1C71C71C, 0x3F2C71C7, +/**/ 0x6E2B0000, 0x3FBE2707, +/**/ 0x2AF0003C, 0xBD2A342C, +/**/ 0x00000000, 0x3FEC6800, +/**/ 0xD6422A30, 0x3F3BB2BB, +/**/ 0xAB274000, 0x3FBE5FE4, +/**/ 0xF74FFE4D, 0xBD35FAE9, +/**/ 0x00000000, 0x3FEC6800, +/**/ 0x54BDE47E, 0xBF36BD01, +/**/ 0x49670000, 0x3FBE98B5, +/**/ 0x89C50E97, 0x3D346774, +/**/ 0x00000000, 0x3FEC6000, +/**/ 0xB5157FE4, 0xBF222CC5, +/**/ 0x4E838000, 0x3FBED179, +/**/ 0x749D0484, 0xBD1FD143, +/**/ 0x00000000, 0x3FEC5800, +/**/ 0xA930B840, 0x3F129A21, +/**/ 0xC0118000, 0x3FBF0A30, +/**/ 0x83368E91, 0xBD3D599E, +/**/ 0x00000000, 0x3FEC5000, +/**/ 0xAC5CEE14, 0x3F3279B1, +/**/ 0xA3A24000, 0x3FBF42DB, +/**/ 0x32DF6C0D, 0xBD3312B7, +/**/ 0x00000000, 0x3FEC5000, +/**/ 0xD4AB8D0B, 0xBF3F9CF5, +/**/ 0xFEC38000, 0x3FBF7B79, +/**/ 0xE897ED01, 0xBD010987, +/**/ 0x00000000, 0x3FEC4800, +/**/ 0xCC17DAE4, 0xBF319D7C, +/**/ 0xD6FF4000, 0x3FBFB40B, +/**/ 0xB7B53B5B, 0x3D2C0BEC, +/**/ 0x00000000, 0x3FEC4000, +/**/ 0x01C3F8F0, 0xBF0C3F8F, +/**/ 0x31DC0000, 0x3FBFEC91, +/**/ 0xD1AE6607, 0xBD354555, +/**/ 0x00000000, 0x3FEC3800, +/**/ 0xAB1B8FFC, 0x3F254738, +/**/ 0x0A6E0000, 0x3FC01285, +/**/ 0x4805BF94, 0xBD1A8619, +/**/ 0x00000000, 0x3FEC3000, +/**/ 0x48B3C5D7, 0x3F38E51F, +/**/ 0x42BF4000, 0x3FC02EBB, +/**/ 0x5CE00E5D, 0xBD15A8FA, +/**/ 0x00000000, 0x3FEC3000, +/**/ 0x867E595E, 0xBF38C377, +/**/ 0x449F6000, 0x3FC04AEB, +/**/ 0x65CCD35C, 0x3D2AFA90, +/**/ 0x00000000, 0x3FEC2800, +/**/ 0x15FE3D95, 0xBF24AC6D, +/**/ 0x12CA6000, 0x3FC06715, +/**/ 0x9CDC0A3D, 0xBD2A4757, +/**/ 0x00000000, 0x3FEC2000, +/**/ 0x53B8CDAE, 0x3F10B34F, +/**/ 0xAFFA2000, 0x3FC08338, +/**/ 0xAC823E27, 0x3D30533C, +/**/ 0x00000000, 0x3FEC1800, +/**/ 0x3FABB0F6, 0x3F32C599, +/**/ 0x1EE72000, 0x3FC09F56, +/**/ 0x7157D1A8, 0xBD28F305, +/**/ 0x00000000, 0x3FEC1800, +/**/ 0x97CD1B6C, 0xBF3E8BF4, +/**/ 0x6247A000, 0x3FC0BB6D, +/**/ 0x3CCD04B3, 0x3D35464F, +/**/ 0x00000000, 0x3FEC1000, +/**/ 0xE3F1F8FC, 0xBF2F8FC7, +/**/ 0x7CD08000, 0x3FC0D77E, +/**/ 0x2EE2F482, 0x3D3CB2CD, +/**/ 0x00000000, 0x3FEC0800, +/**/ 0x5B199F35, 0xBEEDC860, +/**/ 0x7134C000, 0x3FC0F389, +/**/ 0xE893D6C6, 0xBD3DA359, +/**/ 0x00000000, 0x3FEC0000, +/**/ 0x1C01C01C, 0x3F2C01C0, +/**/ 0x42254000, 0x3FC10F8E, +/**/ 0x43396307, 0xBD293B38, +/**/ 0x00000000, 0x3FEBF800, +/**/ 0x256228AA, 0x3F3D0577, +/**/ 0xF2518000, 0x3FC12B8C, +/**/ 0x13C0A0FC, 0x3D348A4A, +/**/ 0x00000000, 0x3FEBF800, +/**/ 0xCB93A8A1, 0xBF33E08B, +/**/ 0x84674000, 0x3FC14785, +/**/ 0x1027C750, 0x3D156345, +/**/ 0x00000000, 0x3FEBF000, +/**/ 0x1DE63F4A, 0xBF12C4DB, +/**/ 0xFB124000, 0x3FC16377, +/**/ 0xBF41763E, 0x3D091E1A, +/**/ 0x00000000, 0x3FEBE800, +/**/ 0x769F9E4F, 0x3F2526D0, +/**/ 0x58FCA000, 0x3FC17F64, +/**/ 0xD093C8DC, 0x3D2843FA, +/**/ 0x00000000, 0x3FEBE000, +/**/ 0x5292D891, 0x3F39ED43, +/**/ 0xA0CEE000, 0x3FC19B4A, +/**/ 0x9621338B, 0xBD3D8824, +/**/ 0x00000000, 0x3FEBE000, +/**/ 0x5FC845A9, 0xBF36A3B3, +/**/ 0xD52F6000, 0x3FC1B72A, +/**/ 0x1811A396, 0x3D2E80A4, +/**/ 0x00000000, 0x3FEBD800, +/**/ 0xB7230491, 0xBF1C7E26, +/**/ 0xF8C36000, 0x3FC1D304, +/**/ 0xDF451042, 0xBD3A6D44, +/**/ 0x00000000, 0x3FEBD000, +/**/ 0x451B61CB, 0x3F20F365, +/**/ 0x0E2DC000, 0x3FC1EED9, +/**/ 0x7097648F, 0x3D161563, +/**/ 0x00000000, 0x3FEBC800, +/**/ 0xD72DD0AA, 0x3F3827F3, +/**/ 0x18102000, 0x3FC20AA7, +/**/ 0x348552FE, 0x3D3F2C94, +/**/ 0x00000000, 0x3FEBC800, +/**/ 0xBE0C262F, 0xBF3814D3, +/**/ 0x190A6000, 0x3FC2266F, +/**/ 0xB840E7F6, 0xBD24D20A, +/**/ 0x00000000, 0x3FEBC000, +/**/ 0x7ECECB53, 0xBF207963, +/**/ 0x13BA6000, 0x3FC24231, +/**/ 0x78EE9D9C, 0xBD3E3A00, +/**/ 0x00000000, 0x3FEBB800, +/**/ 0xF29268D3, 0x3F1EC130, +/**/ 0x0ABC6000, 0x3FC25DED, +/**/ 0x4F176449, 0x3D35A385, +/**/ 0x00000000, 0x3FEBB000, +/**/ 0xAB6353BF, 0x3F37B218, +/**/ 0x00AB4000, 0x3FC279A3, +/**/ 0xB3235108, 0x3D3EF432, +/**/ 0x00000000, 0x3FEBB000, +/**/ 0xF2298376, 0xBF383759, +/**/ 0xF8200000, 0x3FC29552, +/**/ 0xF4471DFC, 0xBD35B967, +/**/ 0x00000000, 0x3FEBA800, +/**/ 0x1EAD4253, 0xBF201832, +/**/ 0xF3B1A000, 0x3FC2B0FC, +/**/ 0xE30A59EA, 0x3D177CA3, +/**/ 0x00000000, 0x3FEBA000, +/**/ 0xD84886B1, 0x3F20679B, +/**/ 0xF5F60000, 0x3FC2CCA0, +/**/ 0x91AFF120, 0xBD3B5EF1, +/**/ 0x00000000, 0x3FEB9800, +/**/ 0xA41FEB4C, 0x3F38884D, +/**/ 0x0180E000, 0x3FC2E83F, +/**/ 0xC284E1CE, 0xBD3F0C2A, +/**/ 0x00000000, 0x3FEB9800, +/**/ 0x3806E548, 0xBF370EA7, +/**/ 0x18E48000, 0x3FC303D7, +/**/ 0xCE3ECB05, 0xBCD680B5, +/**/ 0x00000000, 0x3FEB9000, +/**/ 0xB5EF34C0, 0xBF1A4477, +/**/ 0x3EB1A000, 0x3FC31F69, +/**/ 0xE5A396FB, 0xBD2A6726, +/**/ 0x00000000, 0x3FEB8800, +/**/ 0x9401B894, 0x3F2401B8, +/**/ 0x75770000, 0x3FC33AF5, +/**/ 0xA2FE72A5, 0x3D3C9ECC, +/**/ 0x00000000, 0x3FEB8000, +/**/ 0x400DC1AA, 0x3F3AA73A, +/**/ 0xBFC22000, 0x3FC3567B, +/**/ 0x53991A1F, 0x3D3250D2, +/**/ 0x00000000, 0x3FEB8000, +/**/ 0x2E63A6A8, 0xBF349E11, +/**/ 0x201E8000, 0x3FC371FC, +/**/ 0x9B2D8ABC, 0x3D3EE877, +/**/ 0x00000000, 0x3FEB7800, +/**/ 0xC8DA04B9, 0xBF0E7898, +/**/ 0x99164000, 0x3FC38D76, +/**/ 0x9E39BB70, 0x3D1844A5, +/**/ 0x00000000, 0x3FEB7000, +/**/ 0xE6B33E2D, 0x3F2A284E, +/**/ 0x2D31A000, 0x3FC3A8EB, +/**/ 0x7D5D503E, 0x3D1BAFB7, +/**/ 0x00000000, 0x3FEB6800, +/**/ 0x759C2BB4, 0x3F3E0B91, +/**/ 0xDEF76000, 0x3FC3C459, +/**/ 0xF6B70D33, 0x3D3EDC86, +/**/ 0x00000000, 0x3FEB6800, +/**/ 0x088FD6E7, 0xBF30E8E2, +/**/ 0xB0ECC000, 0x3FC3DFC2, +/**/ 0x62B8C13F, 0x3D28A72A, +/**/ 0x00000000, 0x3FEB6000, +/**/ 0xD801B600, 0x3ECB6006, +/**/ 0xA5952000, 0x3FC3FB25, +/**/ 0x6B358FF7, 0x3D3195BE, +/**/ 0x00000000, 0x3FEB5800, +/**/ 0xD840F62C, 0x3F316A6A, +/**/ 0xBF728000, 0x3FC41682, +/**/ 0x081F849D, 0xBD210047, +/**/ 0x00000000, 0x3FEB5800, +/**/ 0x7DF8BD99, 0xBF3D4DEE, +/**/ 0x01050000, 0x3FC431DA, +/**/ 0x836E0391, 0x3D304837, +/**/ 0x00000000, 0x3FEB5000, +/**/ 0x7E4B17E5, 0xBF27E4B1, +/**/ 0x6CCB8000, 0x3FC44D2B, +/**/ 0x6135783C, 0xBD170CC1, +/**/ 0x00000000, 0x3FEB4800, +/**/ 0x55E6D8FE, 0x3F15F47D, +/**/ 0x05430000, 0x3FC46877, +/**/ 0xF8D5087E, 0xBD3D8145, +/**/ 0x00000000, 0x3FEB4000, +/**/ 0x0B803686, 0x3F37006D, +/**/ 0xCCE6E000, 0x3FC483BC, +/**/ 0x723F6369, 0x3D1EEA52, +/**/ 0x00000000, 0x3FEB4000, +/**/ 0x46A66920, 0xBF37687C, +/**/ 0xC6314000, 0x3FC49EFC, +/**/ 0x9F55572B, 0xBD090F59, +/**/ 0x00000000, 0x3FEB3800, +/**/ 0xFF2645BE, 0xBF16F6A4, +/**/ 0xF39A6000, 0x3FC4BA36, +/**/ 0xB3F219E5, 0xBD34354B, +/**/ 0x00000000, 0x3FEB3000, +/**/ 0x1801B318, 0x3F2801B3, +/**/ 0x5798E000, 0x3FC4D56B, +/**/ 0x15A96555, 0x3D380580, +/**/ 0x00000000, 0x3FEB2800, +/**/ 0x93511680, 0x3F3DD2FF, +/**/ 0xF4A24000, 0x3FC4F099, +/**/ 0xFAFEAF27, 0xBD3E9BF2, +/**/ 0x00000000, 0x3FEB2800, +/**/ 0xA89DCCAC, 0xBF304743, +/**/ 0xCD29C000, 0x3FC50BC2, +/**/ 0x28DB8D4F, 0x3D1ADA57, +/**/ 0x00000000, 0x3FEB2000, +/**/ 0x406C80D9, 0x3EFB2036, +/**/ 0xE3A1C000, 0x3FC526E5, +/**/ 0x37FC5238, 0xBD3790BA, +/**/ 0x00000000, 0x3FEB1800, +/**/ 0x4F9DC00E, 0x3F33BEC8, +/**/ 0x3A7A8000, 0x3FC54203, +/**/ 0xED855F0E, 0x3D268D68, +/**/ 0x00000000, 0x3FEB1800, +/**/ 0x44F8CE7E, 0xBF3A2101, +/**/ 0xD4232000, 0x3FC55D1A, +/**/ 0xDDA647E8, 0x3D3ADD94, +/**/ 0x00000000, 0x3FEB1000, +/**/ 0xB99AF3F3, 0xBF1FB596, +/**/ 0xB3092000, 0x3FC5782C, +/**/ 0x51794442, 0xBD33A463, +/**/ 0x00000000, 0x3FEB0800, +/**/ 0x922A3E85, 0x3F24B31D, +/**/ 0xD9982000, 0x3FC59338, +/**/ 0xB7555D4A, 0x3CF0BA68, +/**/ 0x00000000, 0x3FEB0000, +/**/ 0xE19BF6B7, 0x3F3CB3CF, +/**/ 0x4A3AA000, 0x3FC5AE3F, +/**/ 0xF012A8B9, 0x3D21EA25, +/**/ 0x00000000, 0x3FEB0000, +/**/ 0x9A5BF0D1, 0xBF30DEAE, +/**/ 0x07598000, 0x3FC5C940, +/**/ 0x8CD23322, 0xBD3A8D94, +/**/ 0x00000000, 0x3FEAF800, +/**/ 0x9EDE13CE, 0x3EFA2072, +/**/ 0x135BE000, 0x3FC5E43B, +/**/ 0xCEED9C31, 0xBD343AB4, +/**/ 0x00000000, 0x3FEAF000, +/**/ 0x0D79435E, 0x3F3435E5, +/**/ 0x70A7A000, 0x3FC5FF30, +/**/ 0x183BEBF2, 0xBD38586F, +/**/ 0x00000000, 0x3FEAF000, +/**/ 0x06855D30, 0xBF392321, +/**/ 0x21A0E000, 0x3FC61A20, +/**/ 0x1BDF3CDD, 0x3D3DD9DD, +/**/ 0x00000000, 0x3FEAE800, +/**/ 0x7ABED811, 0xBF19A45C, +/**/ 0x28AAA000, 0x3FC6350A, +/**/ 0xAB8163AF, 0x3D2D5EC0, +/**/ 0x00000000, 0x3FEAE000, +/**/ 0x84EF68CB, 0x3F28C7ED, +/**/ 0x88260000, 0x3FC64FEE, +/**/ 0x759DDED6, 0xBD1DA40D, +/**/ 0x00000000, 0x3FEAD800, +/**/ 0xA482F00D, 0x3F3F43FC, +/**/ 0x4272A000, 0x3FC66ACD, +/**/ 0xBFC6C785, 0x3D3AA1BD, +/**/ 0x00000000, 0x3FEAD800, +/**/ 0xCDE3E7AE, 0xBF2B9222, +/**/ 0x59EF0000, 0x3FC685A6, +/**/ 0x6C103214, 0xBD21F2A9, +/**/ 0x00000000, 0x3FEAD000, +/**/ 0xEED254A3, 0x3F14F302, +/**/ 0xD0F7A000, 0x3FC6A079, +/**/ 0x448D14F5, 0x3D35A3F8, +/**/ 0x00000000, 0x3FEAC800, +/**/ 0x32071DEF, 0x3F385567, +/**/ 0xA9E80000, 0x3FC6BB47, +/**/ 0x23EA3296, 0x3D19F64D, +/**/ 0x00000000, 0x3FEAC800, +/**/ 0xD47F29D4, 0xBF347F29, +/**/ 0xE719E000, 0x3FC6D60F, +/**/ 0x57134767, 0xBD3BC6E5, +/**/ 0x00000000, 0x3FEAC000, +/**/ 0xE82D23BC, 0xBEF40FE1, +/**/ 0x8AE56000, 0x3FC6F0D2, +/**/ 0xC93373DA, 0x3D369737, +/**/ 0x00000000, 0x3FEAB800, +/**/ 0x972D8538, 0x3F320FDE, +/**/ 0x97A1A000, 0x3FC70B8F, +/**/ 0xF6A95BEF, 0x3D34EA64, +/**/ 0x00000000, 0x3FEAB800, +/**/ 0x66711513, 0xBF3A8C9F, +/**/ 0x0FA40000, 0x3FC72647, +/**/ 0x0E743A45, 0xBD3774DF, +/**/ 0x00000000, 0x3FEAB000, +/**/ 0x02806ABC, 0xBF1C5A0F, +/**/ 0xF5404000, 0x3FC740F8, +/**/ 0x99018AA1, 0xBD30B66C, +/**/ 0x00000000, 0x3FEAA800, +/**/ 0xD22C937A, 0x3F28E44B, +/**/ 0x4AC8E000, 0x3FC75BA5, +/**/ 0x8BC4A7C0, 0x3D3DDCA5, +/**/ 0x00000000, 0x3FEAA800, +/**/ 0xFF2ADFF3, 0xBF3FF2AD, +/**/ 0x128F2000, 0x3FC7764C, +/**/ 0x3479E3D1, 0x3D027490, +/**/ 0x00000000, 0x3FEAA000, +/**/ 0x0B3ADA5C, 0xBF288A16, +/**/ 0x4EE26000, 0x3FC790ED, +/**/ 0x4E7746F6, 0x3D199BBD, +/**/ 0x00000000, 0x3FEA9800, +/**/ 0x4C77B035, 0x3F1DEC0D, +/**/ 0x0210E000, 0x3FC7AB89, +/**/ 0x72534A58, 0xBD2BDB90, +/**/ 0x00000000, 0x3FEA9000, +/**/ 0x91F59E6B, 0x3F3B4D71, +/**/ 0x2E674000, 0x3FC7C61F, +/**/ 0xB31BE8E0, 0xBD32392D, +/**/ 0x00000000, 0x3FEA9000, +/**/ 0xB8A2A522, 0xBF30CDCB, +/**/ 0xD630C000, 0x3FC7E0AF, +/**/ 0x1D8F1034, 0x3D139E7C, +/**/ 0x00000000, 0x3FEA8800, +/**/ 0x6A2194A0, 0x3F094A00, +/**/ 0xFBB76000, 0x3FC7FB3A, +/**/ 0x24609D57, 0xBD37DBF5, +/**/ 0x00000000, 0x3FEA8000, +/**/ 0x870AC52E, 0x3F373289, +/**/ 0xA1436000, 0x3FC815C0, +/**/ 0xF9201CE8, 0xBD302A52, +/**/ 0x00000000, 0x3FEA8000, +/**/ 0x9E8684DD, 0xBF34B1FA, +/**/ 0xC91BC000, 0x3FC83040, +/**/ 0xC6E66F32, 0x3D3E5B71, +/**/ 0x00000000, 0x3FEA7800, +/**/ 0xA9267648, 0xBEE08AF5, +/**/ 0x75866000, 0x3FC84ABB, +/**/ 0xDF4E2BD2, 0xBD3D8DAA, +/**/ 0x00000000, 0x3FEA7000, +/**/ 0x1A3D927E, 0x3F33BB67, +/**/ 0xA8C70000, 0x3FC86530, +/**/ 0xCB4EA3E3, 0x3D398BB0, +/**/ 0x00000000, 0x3FEA7000, +/**/ 0x7F2C97F3, 0xBF37F2C9, +/**/ 0x6520C000, 0x3FC87FA0, +/**/ 0x401202FC, 0x3D322120, +/**/ 0x00000000, 0x3FEA6800, +/**/ 0x3C076D20, 0xBF0C77A5, +/**/ 0xACD4E000, 0x3FC89A0A, +/**/ 0xDA8F5A72, 0x3D2C0BFB, +/**/ 0x00000000, 0x3FEA6000, +/**/ 0x7C7EF82B, 0x3F30E6DA, +/**/ 0x82236000, 0x3FC8B46F, +/**/ 0x102DD7C9, 0x3D12D9F2, +/**/ 0x00000000, 0x3FEA6000, +/**/ 0x2EC05C44, 0xBF3A9167, +/**/ 0xE74AE000, 0x3FC8CECE, +/**/ 0xAA429BB5, 0xBD3A5BA0, +/**/ 0x00000000, 0x3FEA5800, +/**/ 0xEEB6BD53, 0xBF17DF12, +/**/ 0xDE886000, 0x3FC8E928, +/**/ 0xB13D72D5, 0x3D3A8154, +/**/ 0x00000000, 0x3FEA5000, +/**/ 0x98C70AE6, 0x3F2D676D, +/**/ 0x6A180000, 0x3FC9037D, +/**/ 0x57C1C8D9, 0x3D230DEA, +/**/ 0x00000000, 0x3FEA5000, +/**/ 0x96CE4780, 0xBF3C8EFF, +/**/ 0x8C340000, 0x3FC91DCC, +/**/ 0xBDDEFF46, 0x3D37BC6A, +/**/ 0x00000000, 0x3FEA4800, +/**/ 0x71EFFCB7, 0xBF1EFFCB, +/**/ 0x4715A000, 0x3FC93816, +/**/ 0x6A3A39D9, 0xBD34C63D, +/**/ 0x00000000, 0x3FEA4000, +/**/ 0x1A41A41A, 0x3F2A41A4, +/**/ 0x9CF46000, 0x3FC9525A, +/**/ 0x7D9F158F, 0xBD329713, +/**/ 0x00000000, 0x3FEA4000, +/**/ 0xBF3B3C0E, 0xBF3DECBB, +/**/ 0x9006A000, 0x3FC96C99, +/**/ 0x9CBB452C, 0x3D2A88D5, +/**/ 0x00000000, 0x3FEA3800, +/**/ 0x3BCD35A8, 0xBF21D14E, +/**/ 0x22818000, 0x3FC986D3, +/**/ 0x4DD44000, 0x3CF93B56, +/**/ 0x00000000, 0x3FEA3000, +/**/ 0x3B5832C0, 0x3F285A0A, +/**/ 0x56988000, 0x3FC9A107, +/**/ 0x242CD098, 0x3D264AA6, +/**/ 0x00000000, 0x3FEA3000, +/**/ 0xD71AFD8C, 0xBF3EABC1, +/**/ 0x2E7E0000, 0x3FC9BB36, +/**/ 0xA1CE0FFC, 0xBD21F2A8, +/**/ 0x00000000, 0x3FEA2800, +/**/ 0x7C041611, 0xBF22E60D, +/**/ 0xAC62E000, 0x3FC9D55F, +/**/ 0xFC3B5BC3, 0xBD3F4669, +/**/ 0x00000000, 0x3FEA2000, +/**/ 0x5FF2EF43, 0x3F27AE57, +/**/ 0xD276A000, 0x3FC9EF83, +/**/ 0xB3F9CE00, 0xBD2730B7, +/**/ 0x00000000, 0x3FEA2000, +/**/ 0x3D66322E, 0xBF3ECD35, +/**/ 0xA2E7A000, 0x3FCA09A2, +/**/ 0xCD411233, 0xBD2DD99D, +/**/ 0x00000000, 0x3FEA1800, +/**/ 0x5B4FE5E9, 0xBF22C068, +/**/ 0x1FE2C000, 0x3FCA23BC, +/**/ 0x91DC9F0B, 0xBD3539CD, +/**/ 0x00000000, 0x3FEA1000, +/**/ 0x80B67A9A, 0x3F283C48, +/**/ 0x4B938000, 0x3FCA3DD0, +/**/ 0x366E2C5A, 0x3D297DA1, +/**/ 0x00000000, 0x3FEA1000, +/**/ 0x89907BBA, 0xBF3E5236, +/**/ 0x28244000, 0x3FCA57DF, +/**/ 0xCA1D9ABB, 0x3D3B99C8, +/**/ 0x00000000, 0x3FEA0800, +/**/ 0x32054967, 0xBF21629E, +/**/ 0xB7BE0000, 0x3FCA71E8, +/**/ 0x6EF05323, 0xBD210ACA, +/**/ 0x00000000, 0x3FEA0000, +/**/ 0x1A01A01A, 0x3F2A01A0, +/**/ 0xFC882000, 0x3FCA8BEC, +/**/ 0xCF21B9CF, 0x3D3E3185, +/**/ 0x00000000, 0x3FEA0000, +/**/ 0x93FF301D, 0xBF3D3BE3, +/**/ 0xF8A94000, 0x3FCAA5EB, +/**/ 0x36951A8F, 0xBD32A0A9, +/**/ 0x00000000, 0x3FE9F800, +/**/ 0xBFE608ED, 0xBF1D9DD1, +/**/ 0xAE462000, 0x3FCABFE5, +/**/ 0x395F139D, 0xBD3B68F5, +/**/ 0x00000000, 0x3FE9F000, +/**/ 0x1B29257F, 0x3F2CFC26, +/**/ 0x1F828000, 0x3FCAD9DA, +/**/ 0xC803F050, 0xBD3882B7, +/**/ 0x00000000, 0x3FE9F000, +/**/ 0x7E613717, 0xBF3B8B57, +/**/ 0x4E80C000, 0x3FCAF3C9, +/**/ 0x3FCD9066, 0xBCBA4E63, +/**/ 0x00000000, 0x3FE9E800, +/**/ 0xB9FABD04, 0xBF160EF9, +/**/ 0x3D620000, 0x3FCB0DB3, +/**/ 0x38EAB906, 0x3D3FEE14, +/**/ 0x00000000, 0x3FE9E000, +/**/ 0xEAF850E2, 0x3F3094D3, +/**/ 0xEE464000, 0x3FCB2797, +/**/ 0x906D00A9, 0xBD3BE88A, +/**/ 0x00000000, 0x3FE9E000, +/**/ 0xBBE88FDC, 0xBF3941AA, +/**/ 0x634BA000, 0x3FCB4177, +/**/ 0x5666069F, 0x3D355D01, +/**/ 0x00000000, 0x3FE9D800, +/**/ 0x25F4B1AA, 0xBF083A25, +/**/ 0x9E8FC000, 0x3FCB5B51, +/**/ 0xEC011F31, 0xBD34B722, +/**/ 0x00000000, 0x3FE9D000, +/**/ 0xF71FAC14, 0x3F3343FB, +/**/ 0xA22E4000, 0x3FCB7526, +/**/ 0x2E785490, 0x3D2C0DBF, +/**/ 0x00000000, 0x3FE9D000, +/**/ 0x1965FF32, 0xBF365FF3, +/**/ 0x70420000, 0x3FCB8EF6, +/**/ 0x321788E0, 0x3D387533, +/**/ 0x00000000, 0x3FE9C800, +/**/ 0x9C8019C8, 0x3EA9C801, +/**/ 0x0AE46000, 0x3FCBA8C1, +/**/ 0x9EEE9D85, 0x3D3A32E2, +/**/ 0x00000000, 0x3FE9C000, +/**/ 0x25080CE1, 0x3F368A77, +/**/ 0x742D8000, 0x3FCBC286, +/**/ 0xF39D121C, 0x3D39AC53, +/**/ 0x00000000, 0x3FE9C000, +/**/ 0xC54763F2, 0xBF32E743, +/**/ 0xAE344000, 0x3FCBDC46, +/**/ 0x023D6505, 0x3D3625B4, +/**/ 0x00000000, 0x3FE9B800, +/**/ 0x8B7424F9, 0x3F0DBD49, +/**/ 0xBB0E4000, 0x3FCBF601, +/**/ 0x47C378B5, 0x3D2386A9, +/**/ 0x00000000, 0x3FE9B000, +/**/ 0x00CD9A67, 0x3F3A6734, +/**/ 0x9CCFE000, 0x3FCC0FB7, +/**/ 0x99E8A558, 0xBD346FFF, +/**/ 0x00000000, 0x3FE9B000, +/**/ 0xAEF25B7C, 0xBF2DB15A, +/**/ 0x558C2000, 0x3FCC2968, +/**/ 0xDEE38A40, 0xBD2CFD73, +/**/ 0x00000000, 0x3FE9A800, +/**/ 0xC140C073, 0x3F1FDFEC, +/**/ 0xE754E000, 0x3FCC4313, +/**/ 0x74CAD7D6, 0x3D3279BE, +/**/ 0x00000000, 0x3FE9A000, +/**/ 0xA7DCBEB3, 0x3F3ED923, +/**/ 0x543AE000, 0x3FCC5CBA, +/**/ 0xECB454FC, 0x3D20929D, +/**/ 0x00000000, 0x3FE9A000, +/**/ 0xB256DE2C, 0xBF246A7B, +/**/ 0x9E4D6000, 0x3FCC765B, +/**/ 0x36976F6C, 0x3D31AB6B, +/**/ 0x00000000, 0x3FE99800, +/**/ 0x9999999A, 0x3F299999, +/**/ 0xC79AA000, 0x3FCC8FF7, +/**/ 0x689F8434, 0xBD27794F, +/**/ 0x00000000, 0x3FE99800, +/**/ 0x3EC03FF3, 0xBF3C20C6, +/**/ 0xD22F6000, 0x3FCCA98E, +/**/ 0x8CA209C8, 0xBCF698C1, +/**/ 0x00000000, 0x3FE99000, +/**/ 0x31EC07FD, 0xBF13F803, +/**/ 0xC0176000, 0x3FCCC320, +/**/ 0x9A653794, 0x3D240903, +/**/ 0x00000000, 0x3FE98800, +/**/ 0x5AC98715, 0x3F323513, +/**/ 0x935D2000, 0x3FCCDCAD, +/**/ 0x34C9A447, 0xBD0A0FF0, +/**/ 0x00000000, 0x3FE98800, +/**/ 0x89F80661, 0xBF368793, +/**/ 0x4E09C000, 0x3FCCF635, +/**/ 0x9A07D55B, 0x3D277123, +/**/ 0x00000000, 0x3FE98000, +/**/ 0x8019801A, 0x3EE98019, +/**/ 0xF2256000, 0x3FCD0FB7, +/**/ 0x20633B29, 0xBD0AF52B, +/**/ 0x00000000, 0x3FE97800, +/**/ 0xAB329020, 0x3F382FC6, +/**/ 0x81B6C000, 0x3FCD2935, +/**/ 0x128AAA5F, 0xBD383270, +/**/ 0x00000000, 0x3FE97800, +/**/ 0x962DBFF3, 0xBF305C4B, +/**/ 0xFEC36000, 0x3FCD42AD, +/**/ 0xFD804272, 0xBD175C00, +/**/ 0x00000000, 0x3FE97000, +/**/ 0x970E4F81, 0x3F1C9F01, +/**/ 0x6B4FC000, 0x3FCD5C21, +/**/ 0xBBCA681B, 0xBD21BA91, +/**/ 0x00000000, 0x3FE96800, +/**/ 0x049160B8, 0x3F3EBBE1, +/**/ 0xC95F0000, 0x3FCD758F, +/**/ 0x8B4162AA, 0xBD15A10A, +/**/ 0x00000000, 0x3FE96800, +/**/ 0x9933FE6A, 0xBF233FE6, +/**/ 0x1AF32000, 0x3FCD8EF9, +/**/ 0xC364C784, 0xBD15105F, +/**/ 0x00000000, 0x3FE96000, +/**/ 0xCE078906, 0x3F2C2873, +/**/ 0x620CE000, 0x3FCDA85D, +/**/ 0xC16CC7EC, 0x3D240194, +/**/ 0x00000000, 0x3FE96000, +/**/ 0xE442936B, 0xBF3A27A0, +/**/ 0xA0ABE000, 0x3FCDC1BC, +/**/ 0xA628CCC6, 0x3D38FAC1, +/**/ 0x00000000, 0x3FE95800, +/**/ 0x548A97A9, 0xBF029C69, +/**/ 0xD8CEA000, 0x3FCDDB16, +/**/ 0x7104B8BC, 0xBD1EEF79, +/**/ 0x00000000, 0x3FE95000, +/**/ 0x9F74B92D, 0x3F35906B, +/**/ 0x0C722000, 0x3FCDF46C, +/**/ 0xB0B79039, 0x3D3A5E82, +/**/ 0x00000000, 0x3FE95000, +/**/ 0xF35927BC, 0xBF327BBF, +/**/ 0x3D92A000, 0x3FCE0DBC, +/**/ 0xF0529BF1, 0x3D359233, +/**/ 0x00000000, 0x3FE94800, +/**/ 0xDD3C0CA4, 0x3F161F9A, +/**/ 0x6E2B0000, 0x3FCE2707, +/**/ 0x2AF0003C, 0xBD3A342C, +/**/ 0x00000000, 0x3FE94000, +/**/ 0x41228A8F, 0x3F3D9B56, +/**/ 0xA034C000, 0x3FCE404D, +/**/ 0xE09A2799, 0xBD3187EE, +/**/ 0x00000000, 0x3FE94000, +/**/ 0x598A73F8, 0xBF2482F5, +/**/ 0xD5A88000, 0x3FCE598E, +/**/ 0xCF1E98A1, 0xBD0D134B, +/**/ 0x00000000, 0x3FE93800, +/**/ 0x3C1B9728, 0x3F2BE2D5, +/**/ 0x107DA000, 0x3FCE72CB, +/**/ 0xCDF5471C, 0x3D1DD48C, +/**/ 0x00000000, 0x3FE93800, +/**/ 0x2698CFF3, 0xBF39CC03, +/**/ 0x52AA6000, 0x3FCE8C02, +/**/ 0x80E8E6FF, 0xBD26805B, +/**/ 0x00000000, 0x3FE93000, +/**/ 0xB9F30358, 0xBEF79CD3, +/**/ 0x9E23A000, 0x3FCEA534, +/**/ 0x4C73CCB5, 0x3D381B93, +/**/ 0x00000000, 0x3FE92800, +/**/ 0x255BA00D, 0x3F36E803, +/**/ 0xF4DD8000, 0x3FCEBE61, +/**/ 0x30FDCA4D, 0xBD23D453, +/**/ 0x00000000, 0x3FE92800, +/**/ 0x36077742, 0xBF30A69B, +/**/ 0x58CA8000, 0x3FCED78A, +/**/ 0x3793387E, 0x3D16F1B5, +/**/ 0x00000000, 0x3FE92000, +/**/ 0x1C451AB3, 0x3F1F693A, +/**/ 0xCBDC6000, 0x3FCEF0AD, +/**/ 0x9C86AF24, 0xBD2B26B7, +/**/ 0x00000000, 0x3FE92000, +/**/ 0xC74EA9E2, 0xBF3F9548, +/**/ 0x50036000, 0x3FCF09CC, +/**/ 0x18D999DB, 0x3D3DA094, +/**/ 0x00000000, 0x3FE91800, +/**/ 0xF7C46911, 0xBF1BD5A8, +/**/ 0xE72F2000, 0x3FCF22E5, +/**/ 0x1417E41F, 0xBD3F454F, +/**/ 0x00000000, 0x3FE91000, +/**/ 0x0D83D1C6, 0x3F31B9E1, +/**/ 0x934D6000, 0x3FCF3BFA, +/**/ 0x937B903B, 0x3D2D9F2A, +/**/ 0x00000000, 0x3FE91000, +/**/ 0xF3795877, 0xBF35876F, +/**/ 0x564B8000, 0x3FCF550A, +/**/ 0xA09202FE, 0xBD2323E3, +/**/ 0x00000000, 0x3FE90800, +/**/ 0xBD1D87EC, 0x3F0A34CD, +/**/ 0x32154000, 0x3FCF6E15, +/**/ 0x7AC4EC74, 0xBD3C9A97, +/**/ 0x00000000, 0x3FE90000, +/**/ 0x0E760899, 0x3F3C23F5, +/**/ 0x28956000, 0x3FCF871B, +/**/ 0x6A526EFE, 0xBD3F75FD, +/**/ 0x00000000, 0x3FE90000, +/**/ 0xD0BE9594, 0xBF25DECD, +/**/ 0x3BB58000, 0x3FCFA01C, +/**/ 0xFAE1D786, 0xBD1A1F71, +/**/ 0x00000000, 0x3FE8F800, +/**/ 0xC18F9C19, 0x3F2C18F9, +/**/ 0x6D5E4000, 0x3FCFB918, +/**/ 0xAB993C87, 0xBD0D572A, +/**/ 0x00000000, 0x3FE8F800, +/**/ 0x8176594C, 0xBF38E868, +/**/ 0xBF770000, 0x3FCFD20F, +/**/ 0x72C6FE70, 0xBD11C55B, +/**/ 0x00000000, 0x3FE8F000, +/**/ 0x3C018F00, 0x3EC8F006, +/**/ 0x33E60000, 0x3FCFEB02, +/**/ 0x32D5E8C7, 0x3D2F316E, +/**/ 0x00000000, 0x3FE8E800, +/**/ 0xAD115384, 0x3F395B4D, +/**/ 0xE6484000, 0x3FD001F7, +/**/ 0x40C9ABBC, 0x3D38A957, +/**/ 0x00000000, 0x3FE8E800, +/**/ 0xEC8C0F90, 0xBF2AD850, +/**/ 0x45AD5000, 0x3FD00E6C, +/**/ 0x52E01203, 0x3CDCC68D, +/**/ 0x00000000, 0x3FE8E000, +/**/ 0xA56B1AA1, 0x3F27B6E9, +/**/ 0x3913A000, 0x3FD01ADE, +/**/ 0xCCDC1521, 0xBD108930, +/**/ 0x00000000, 0x3FE8E000, +/**/ 0x40DFC1D8, 0xBF3ACDE3, +/**/ 0xC16C2000, 0x3FD0274D, +/**/ 0x9CF835C2, 0x3D2979E8, +/**/ 0x00000000, 0x3FE8D800, +/**/ 0x317DF64C, 0xBEF68397, +/**/ 0xDFA74000, 0x3FD033BA, +/**/ 0x1485BDFF, 0x3D0C30BC, +/**/ 0x00000000, 0x3FE8D000, +/**/ 0x80C6980C, 0x3F380C69, +/**/ 0x94B4D000, 0x3FD04025, +/**/ 0x9EF42D7F, 0x3CF036B8, +/**/ 0x00000000, 0x3FE8D000, +/**/ 0x338C7FE7, 0xBF2CE006, +/**/ 0xE1842000, 0x3FD04C8D, +/**/ 0x512CEB86, 0xBD1FE6BA, +/**/ 0x00000000, 0x3FE8C800, +/**/ 0x1EFBBD63, 0x3F2644F0, +/**/ 0xC703F000, 0x3FD058F3, +/**/ 0xBCD236AD, 0xBD30E866, +/**/ 0x00000000, 0x3FE8C800, +/**/ 0xAA79217A, 0xBF3B3C2D, +/**/ 0x46227000, 0x3FD06557, +/**/ 0xB4868D6A, 0x3D0131DF, +/**/ 0x00000000, 0x3FE8C000, +/**/ 0x8062FF3A, 0xBEF8BFCE, +/**/ 0x5FCD6000, 0x3FD071B8, +/**/ 0xA3E01A11, 0xBD3BCB8B, +/**/ 0x00000000, 0x3FE8B800, +/**/ 0xBD2672C4, 0x3F383301, +/**/ 0x14F1D000, 0x3FD07E17, +/**/ 0x4F384BD5, 0xBD3EFCC6, +/**/ 0x00000000, 0x3FE8B800, +/**/ 0x9BFE749C, 0xBF2BFE74, +/**/ 0x667C5000, 0x3FD08A73, +/**/ 0x40C5A329, 0x3D3EBC1D, +/**/ 0x00000000, 0x3FE8B000, +/**/ 0xD4353EB3, 0x3F27BA8C, +/**/ 0x55591000, 0x3FD096CD, +/**/ 0x20550A31, 0x3D3F998D, +/**/ 0x00000000, 0x3FE8B000, +/**/ 0xA062B2E4, 0xBF3A3784, +/**/ 0xE2739000, 0x3FD0A324, +/**/ 0x7EF4030E, 0x3D0C6BEE, +/**/ 0x00000000, 0x3FE8A800, +/**/ 0x5E630281, 0xBECED1F6, +/**/ 0x0EB6C000, 0x3FD0AF7A, +/**/ 0x4945ADAD, 0x3D23CCF9, +/**/ 0x00000000, 0x3FE8A000, +/**/ 0x0C519CAE, 0x3F39CAE0, +/**/ 0xDB0D2000, 0x3FD0BBCC, +/**/ 0xCC5DCDFB, 0x3D32F32C, +/**/ 0x00000000, 0x3FE8A000, +/**/ 0x4EDBA5FD, 0xBF283C02, +/**/ 0x4860B000, 0x3FD0C81D, +/**/ 0x401D1731, 0xBD3E5BCF, +/**/ 0x00000000, 0x3FE89800, +/**/ 0x1899C0F6, 0x3F2C0F60, +/**/ 0x579AB000, 0x3FD0D46B, +/**/ 0xF640E1E6, 0x3D3D2C81, +/**/ 0x00000000, 0x3FE89800, +/**/ 0xBDBE51D0, 0xBF37C414, +/**/ 0x09A43000, 0x3FD0E0B7, +/**/ 0xA7862F2A, 0x3D32A038, +/**/ 0x00000000, 0x3FE89000, +/**/ 0xDD12CE7D, 0x3F03F540, +/**/ 0x5F658000, 0x3FD0ED00, +/**/ 0x285AA803, 0xBD22DC75, +/**/ 0x00000000, 0x3FE88800, +/**/ 0x400C45CD, 0x3F3CCFDE, +/**/ 0x59C67000, 0x3FD0F947, +/**/ 0x7F0818B6, 0xBD395261, +/**/ 0x00000000, 0x3FE88800, +/**/ 0x44FB66B5, 0xBF21A0F5, +/**/ 0xF9AE5000, 0x3FD1058B, +/**/ 0x817D52CD, 0xBD34AB9D, +/**/ 0x00000000, 0x3FE88000, +/**/ 0x2866A138, 0x3F319D95, +/**/ 0x4003F000, 0x3FD111CE, +/**/ 0x096B4B6B, 0xBD1B3237, +/**/ 0x00000000, 0x3FE88000, +/**/ 0xA48B49DA, 0xBF33E5FA, +/**/ 0x2DADA000, 0x3FD11E0E, +/**/ 0x8FCCE5BA, 0xBD2A47F8, +/**/ 0x00000000, 0x3FE87800, +/**/ 0xDEECB0A8, 0x3F1A9336, +/**/ 0xC3912000, 0x3FD12A4B, +/**/ 0x61473259, 0xBD35A750, +/**/ 0x00000000, 0x3FE87800, +/**/ 0xFB6A388D, 0xBF3EC219, +/**/ 0x0293B000, 0x3FD13687, +/**/ 0x99D67123, 0xBD3D3E84, +/**/ 0x00000000, 0x3FE87000, +/**/ 0xC1625090, 0xBF106AE7, +/**/ 0xEB9A0000, 0x3FD142BF, +/**/ 0x85B58A9E, 0x3D31CE61, +/**/ 0x00000000, 0x3FE86800, +/**/ 0xACD4200C, 0x3F369AE5, +/**/ 0x7F887000, 0x3FD14EF6, +/**/ 0x5DFC9794, 0xBD3E97A6, +/**/ 0x00000000, 0x3FE86800, +/**/ 0x9389D11C, 0xBF2D4286, +/**/ 0xBF429000, 0x3FD15B2A, +/**/ 0x49B629B2, 0xBD2D8E3B, +/**/ 0x00000000, 0x3FE86000, +/**/ 0x18618618, 0x3F286186, +/**/ 0xABABA000, 0x3FD1675C, +/**/ 0x731F55C4, 0x3D38380E, +/**/ 0x00000000, 0x3FE86000, +/**/ 0x6AC71708, 0xBF38EF0F, +/**/ 0x45A67000, 0x3FD1738C, +/**/ 0x0032C176, 0xBD39C6E9, +/**/ 0x00000000, 0x3FE85800, +/**/ 0xE00C2C20, 0x3EFFF3D3, +/**/ 0x8E151000, 0x3FD17FB9, +/**/ 0xA74A2684, 0xBD3A8A8B, +/**/ 0x00000000, 0x3FE85000, +/**/ 0xF9592266, 0x3F3CFBA0, +/**/ 0x85D93000, 0x3FD18BE4, +/**/ 0x6F3604AB, 0x3D3C167F, +/**/ 0x00000000, 0x3FE85000, +/**/ 0xFF3D87FA, 0xBF1FE7B0, +/**/ 0x2DD42000, 0x3FD1980D, +/**/ 0x7A361C9A, 0x3D2B7B3A, +/**/ 0x00000000, 0x3FE84800, +/**/ 0x918DC223, 0x3F331E8D, +/**/ 0x86E68000, 0x3FD1A433, +/**/ 0x634E0AAC, 0xBD07A850, +/**/ 0x00000000, 0x3FE84800, +/**/ 0x8D76B549, 0xBF31BAF9, +/**/ 0x91F08000, 0x3FD1B057, +/**/ 0x6DC55E2D, 0xBD32DD46, +/**/ 0x00000000, 0x3FE84000, +/**/ 0xDC90C512, 0x3F22F2EC, +/**/ 0x4FD1D000, 0x3FD1BC79, +/**/ 0x747BA7BE, 0xBD3CCF0C, +/**/ 0x00000000, 0x3FE84000, +/**/ 0x6A0916B9, 0xBF3B442A, +/**/ 0xC169A000, 0x3FD1C898, +/**/ 0xE5C62AFF, 0xBD381410, +/**/ 0x00000000, 0x3FE83800, +/**/ 0x83801838, 0x3EA83801, +/**/ 0xE796A000, 0x3FD1D4B5, +/**/ 0xD197BAC2, 0x3D222A5B, +/**/ 0x00000000, 0x3FE83000, +/**/ 0xCBD11C5C, 0x3F3B6A41, +/**/ 0xC3371000, 0x3FD1E0D0, +/**/ 0xA9B0D4A0, 0x3D3AF8F2, +/**/ 0x00000000, 0x3FE83000, +/**/ 0xCB7A3CD6, 0xBF225381, +/**/ 0x5528B000, 0x3FD1ECE9, +/**/ 0x09B4A3B8, 0xBD184E7B, +/**/ 0x00000000, 0x3FE82800, +/**/ 0x152500C1, 0x3F32500C, +/**/ 0x9E48A000, 0x3FD1F8FF, +/**/ 0x040CBE77, 0x3D27946C, +/**/ 0x00000000, 0x3FE82800, +/**/ 0x14902134, 0xBF32285F, +/**/ 0x9F73B000, 0x3FD20513, +/**/ 0x1609E0A4, 0x3CF6E15E, +/**/ 0x00000000, 0x3FE82000, +/**/ 0xA4018213, 0x3F22D9EB, +/**/ 0x59861000, 0x3FD21125, +/**/ 0xBA2950C4, 0x3D382E78, +/**/ 0x00000000, 0x3FE82000, +/**/ 0xFC6BBFF4, 0xBF3AEFFC, +/**/ 0xCD5B9000, 0x3FD21D34, +/**/ 0xB28BADAA, 0x3D3B552F, +/**/ 0x00000000, 0x3FE81800, +/**/ 0x18181818, 0x3EE81818, +/**/ 0xFBCF8000, 0x3FD22941, +/**/ 0xF5EB0963, 0xBD3A6976, +/**/ 0x00000000, 0x3FE81000, +/**/ 0x4FF0F3C6, 0x3F3C7F27, +/**/ 0xE5BC9000, 0x3FD2354C, +/**/ 0x0602A663, 0xBD3D78ED, +/**/ 0x00000000, 0x3FE81000, +/**/ 0x0A86941D, 0xBF1ED344, +/**/ 0x8BFD1000, 0x3FD24155, +/**/ 0x3228FCAD, 0x3D300FFF, +/**/ 0x00000000, 0x3FE80800, +/**/ 0x1B0BD52D, 0x3F3424D0, +/**/ 0xEF6AF000, 0x3FD24D5B, +/**/ 0xFC9FABDD, 0xBCBDD780, +/**/ 0x00000000, 0x3FE80800, +/**/ 0xFE7F9FE8, 0xBF2FE7F9, +/**/ 0x10DF7000, 0x3FD25960, +/**/ 0x224EA3E3, 0x3D38E7BC, +/**/ 0x00000000, 0x3FE80000, +/**/ 0x18018018, 0x3F280180, +/**/ 0xF1338000, 0x3FD26561, +/**/ 0x66FAA45F, 0x3D38B488, +/**/ 0x00000000, 0x3FE80000, +/**/ 0x5FF40180, 0xBF37FD00, +/**/ 0x913F8000, 0x3FD27161, +/**/ 0xF61564B4, 0x3D34F4F1, +/**/ 0x00000000, 0x3FE7F800, +/**/ 0x9750B6C7, 0x3F104AE8, +/**/ 0xF1DB6000, 0x3FD27D5E, +/**/ 0x78CAC9F4, 0xBD092374, +/**/ 0x00000000, 0x3FE7F800, +/**/ 0xF405FD01, 0xBF3FD017, +/**/ 0x13DE8000, 0x3FD2895A, +/**/ 0xD24C13F0, 0x3D3A8D7A, +/**/ 0x00000000, 0x3FE7F000, +/**/ 0xC9C5485E, 0xBF0D2BF1, +/**/ 0xF81FF000, 0x3FD29552, +/**/ 0x1771C408, 0x3D348D30, +/**/ 0x00000000, 0x3FE7E800, +/**/ 0xD029DB60, 0x3F38927F, +/**/ 0x9F763000, 0x3FD2A149, +/**/ 0x51F3AADC, 0xBD30DBBF, +/**/ 0x00000000, 0x3FE7E800, +/**/ 0xB0A45169, 0xBF26504A, +/**/ 0x0AB73000, 0x3FD2AD3E, +/**/ 0x488C359F, 0x3D2B972E, +/**/ 0x00000000, 0x3FE7E000, +/**/ 0xD278E8DD, 0x3F312A8A, +/**/ 0x3AB8A000, 0x3FD2B930, +/**/ 0xD6BFB0A5, 0xBD26DB12, +/**/ 0x00000000, 0x3FE7E000, +/**/ 0x24BB32E7, 0xBF327577, +/**/ 0x304F8000, 0x3FD2C520, +/**/ 0x8C342F39, 0x3D230852, +/**/ 0x00000000, 0x3FE7D800, +/**/ 0xA4B45AEC, 0x3F23EF9A, +/**/ 0xEC508000, 0x3FD2D10D, +/**/ 0xF7088353, 0x3D360C61, +/**/ 0x00000000, 0x3FE7D800, +/**/ 0x32748CC1, 0xBF398DAF, +/**/ 0x6F8FD000, 0x3FD2DCF9, +/**/ 0x8E33C9CE, 0x3D20B4A2, +/**/ 0x00000000, 0x3FE7D000, +/**/ 0x417D05F4, 0x3F07D05F, +/**/ 0xBAE12000, 0x3FD2E8E2, +/**/ 0x99B72BD8, 0xBD267B1E, +/**/ 0x00000000, 0x3FE7C800, +/**/ 0x431D3027, 0x3F3F8EF7, +/**/ 0xCF17A000, 0x3FD2F4C9, +/**/ 0x9374B87B, 0x3D371F04, +/**/ 0x00000000, 0x3FE7C800, +/**/ 0xDAD83E6C, 0xBF0E77A3, +/**/ 0xAD063000, 0x3FD300AE, +/**/ 0x8B75FCAC, 0x3D342F56, +/**/ 0x00000000, 0x3FE7C000, +/**/ 0x588D1676, 0x3F38E041, +/**/ 0x557F2000, 0x3FD30C91, +/**/ 0xA1451755, 0xBD142958, +/**/ 0x00000000, 0x3FE7C000, +/**/ 0x1FE8414C, 0xBF24C6DD, +/**/ 0xC9544000, 0x3FD31871, +/**/ 0x94CECFD9, 0x3D184FAB, +/**/ 0x00000000, 0x3FE7B800, +/**/ 0x81C2D3B2, 0x3F3265F4, +/**/ 0x09570000, 0x3FD32450, +/**/ 0x9BDAE59D, 0x3D3D271B, +/**/ 0x00000000, 0x3FE7B800, +/**/ 0xB6466407, 0xBF30C39C, +/**/ 0x16586000, 0x3FD3302C, +/**/ 0xC2A3E08B, 0x3D36217D, +/**/ 0x00000000, 0x3FE7B000, +/**/ 0x12B21224, 0x3F283FAD, +/**/ 0xF128E000, 0x3FD33C05, +/**/ 0x380E1A7D, 0xBD22B906, +/**/ 0x00000000, 0x3FE7B000, +/**/ 0xF899E55D, 0xBF36EFB8, +/**/ 0x9A988000, 0x3FD347DD, +/**/ 0xD4C58092, 0xBD25594D, +/**/ 0x00000000, 0x3FE7A800, +/**/ 0x3FF42B9F, 0x3F1836B6, +/**/ 0x1376E000, 0x3FD353B3, +/**/ 0xE6C26D9B, 0xBD1331AF, +/**/ 0x00000000, 0x3FE7A800, +/**/ 0x0B739FF4, 0xBF3CE7FD, +/**/ 0x5C933000, 0x3FD35F86, +/**/ 0x4EA1A54A, 0xBD3B07DE, +/**/ 0x00000000, 0x3FE7A000, +/**/ 0xE8017A00, 0x3EC7A005, +/**/ 0x76BC1000, 0x3FD36B57, +/**/ 0x5A9C223F, 0x3D116978, +/**/ 0x00000000, 0x3FE79800, +/**/ 0xB1CC5B7B, 0x3F3D535D, +/**/ 0x62BFE000, 0x3FD37726, +/**/ 0xAC53B023, 0xBD3E9436, +/**/ 0x00000000, 0x3FE79800, +/**/ 0xE0DA37A9, 0xBF15EEAC, +/**/ 0x216C5000, 0x3FD382F3, +/**/ 0x1D1A7F6D, 0xBD1061D2, +/**/ 0x00000000, 0x3FE79000, +/**/ 0x344E16D6, 0x3F37C21E, +/**/ 0xB38ED000, 0x3FD38EBD, +/**/ 0xE67D4CA0, 0x3D290582, +/**/ 0x00000000, 0x3FE79000, +/**/ 0x39C9E465, 0xBF25E69A, +/**/ 0x19F45000, 0x3FD39A86, +/**/ 0x937354F5, 0x3D18EE51, +/**/ 0x00000000, 0x3FE78800, +/**/ 0xC52640BC, 0x3F32640B, +/**/ 0x55694000, 0x3FD3A64C, +/**/ 0xBCD735D0, 0x3D37A71C, +/**/ 0x00000000, 0x3FE78800, +/**/ 0x2F6A09ED, 0xBF3037DE, +/**/ 0x66B9C000, 0x3FD3B210, +/**/ 0x9811560E, 0xBD33C1ED, +/**/ 0x00000000, 0x3FE78000, +/**/ 0x01781A72, 0x3F2A71DC, +/**/ 0x4EB15000, 0x3FD3BDD2, +/**/ 0x970E6ED9, 0xBD3257B4, +/**/ 0x00000000, 0x3FE78000, +/**/ 0xA9EEBFF4, 0xBF354996, +/**/ 0x0E1B2000, 0x3FD3C992, +/**/ 0xAA680B76, 0x3D141C28, +/**/ 0x00000000, 0x3FE77800, +/**/ 0xAC60D341, 0x3F208119, +/**/ 0xA5C1F000, 0x3FD3D54F, +/**/ 0xD9A395E3, 0x3D3C3E1C, +/**/ 0x00000000, 0x3FE77800, +/**/ 0x742E2DD0, 0xBF3A28AE, +/**/ 0x16701000, 0x3FD3E10B, +/**/ 0x145429C7, 0x3D3F3BCF, +/**/ 0x00000000, 0x3FE77000, +/**/ 0x36340177, 0x3F0BD584, +/**/ 0x60EF6000, 0x3FD3ECC4, +/**/ 0x27C1300F, 0xBD060286, +/**/ 0x00000000, 0x3FE77000, +/**/ 0x240C7174, 0xBF3ED55D, +/**/ 0x86094000, 0x3FD3F87B, +/**/ 0x54589889, 0xBD35DFD7, +/**/ 0x00000000, 0x3FE76800, +/**/ 0xAB277F45, 0xBEF18DE5, +/**/ 0x8686A000, 0x3FD40430, +/**/ 0x3049F7D3, 0x3D3F8EF4, +/**/ 0x00000000, 0x3FE76000, +/**/ 0x01D3C7B8, 0x3F3CB026, +/**/ 0x63303000, 0x3FD40FE3, +/**/ 0xE79F05C6, 0x3D3E5C5F, +/**/ 0x00000000, 0x3FE76000, +/**/ 0xA9D08664, 0xBF15E95B, +/**/ 0x1CCE1000, 0x3FD41B94, +/**/ 0x13E43FC9, 0xBD304690, +/**/ 0x00000000, 0x3FE75800, +/**/ 0x097CFD43, 0x3F3867A4, +/**/ 0xB427E000, 0x3FD42742, +/**/ 0x02B82675, 0xBD398727, +/**/ 0x00000000, 0x3FE75800, +/**/ 0xE8A9353E, 0xBF2353DF, +/**/ 0x2A04F000, 0x3FD432EF, +/**/ 0x931715AD, 0xBD3FB129, +/**/ 0x00000000, 0x3FE75000, +/**/ 0x4F13DC4A, 0x3F3450E6, +/**/ 0x7F2C1000, 0x3FD43E99, +/**/ 0x40C41A04, 0x3D1C3F72, +/**/ 0x00000000, 0x3FE75000, +/**/ 0xE8B1B4FC, 0xBF2B4FBF, +/**/ 0xB463C000, 0x3FD44A41, +/**/ 0xF37CF612, 0x3D31EE28, +/**/ 0x00000000, 0x3FE74800, +/**/ 0x7E458100, 0x3F306BB6, +/**/ 0xCA720000, 0x3FD455E7, +/**/ 0x36629AED, 0x3D1AD8C6, +/**/ 0x00000000, 0x3FE74800, +/**/ 0x1745D174, 0xBF31745D, +/**/ 0xC21C6000, 0x3FD4618B, +/**/ 0x484C84CC, 0xBD13D82F, +/**/ 0x00000000, 0x3FE74000, +/**/ 0x236DEC04, 0x3F296FBD, +/**/ 0x9C280000, 0x3FD46D2D, +/**/ 0x5F67F75A, 0x3D359B27, +/**/ 0x00000000, 0x3FE74000, +/**/ 0x3B304B87, 0xBF350F9D, +/**/ 0x5959B000, 0x3FD478CD, +/**/ 0xF0C8D098, 0x3D2EC89B, +/**/ 0x00000000, 0x3FE73800, +/**/ 0xA4EBDC70, 0x3F226A51, +/**/ 0xFA75C000, 0x3FD4846A, +/**/ 0xE3798DCE, 0xBD263EA2, +/**/ 0x00000000, 0x3FE73800, +/**/ 0xF00B9A78, 0xBF3879D5, +/**/ 0x80401000, 0x3FD49006, +/**/ 0xFE1A0F8C, 0xBD38BCCF, +/**/ 0x00000000, 0x3FE73000, +/**/ 0x5DAAD90C, 0x3F178D7F, +/**/ 0xEB7C1000, 0x3FD49B9F, +/**/ 0x58AB60D7, 0x3D3DAC1C, +/**/ 0x00000000, 0x3FE73000, +/**/ 0x783709C7, 0xBF3BB33C, +/**/ 0x3CED0000, 0x3FD4A737, +/**/ 0xEBF35449, 0xBD39A234, +/**/ 0x00000000, 0x3FE72800, +/**/ 0x265AD23A, 0x3F061274, +/**/ 0x75556000, 0x3FD4B2CC, +/**/ 0xC78BFA4B, 0xBD380FCB, +/**/ 0x00000000, 0x3FE72800, +/**/ 0xC90A1FD2, 0xBF3EBC05, +/**/ 0x95778000, 0x3FD4BE5F, +/**/ 0xCD9AD824, 0xBD3D7C92, +/**/ 0x00000000, 0x3FE72000, +/**/ 0x38017200, 0xBEC71FFA, +/**/ 0x9E153000, 0x3FD4C9F0, +/**/ 0x70E02DE0, 0xBD2E1DDE, +/**/ 0x00000000, 0x3FE71800, +/**/ 0x74A050E1, 0x3F3E6B99, +/**/ 0x8FEFE000, 0x3FD4D57F, +/**/ 0x7FD06868, 0x3D23F926, +/**/ 0x00000000, 0x3FE71800, +/**/ 0xB8BD1180, 0xBF077400, +/**/ 0x6BC8A000, 0x3FD4E10C, +/**/ 0x1636F061, 0x3CF8283F, +/**/ 0x00000000, 0x3FE71000, +/**/ 0xE3E0453A, 0x3F3BC36C, +/**/ 0x32600000, 0x3FD4EC97, +/**/ 0xAF04D104, 0x3D234D7A, +/**/ 0x00000000, 0x3FE71000, +/**/ 0x6935DDC5, 0xBF15FA98, +/**/ 0xE4764000, 0x3FD4F81F, +/**/ 0x434FF08D, 0xBD27FCF6, +/**/ 0x00000000, 0x3FE70800, +/**/ 0x7337CF08, 0x3F394B40, +/**/ 0x82CB2000, 0x3FD503A6, +/**/ 0xF16F9B5D, 0xBD2A68C8, +/**/ 0x00000000, 0x3FE70800, +/**/ 0xA835403A, 0xBF1F7B97, +/**/ 0x0E1E0000, 0x3FD50F2B, +/**/ 0x8C47B8D8, 0x3D3A0940, +/**/ 0x00000000, 0x3FE70000, +/**/ 0x5C0B8170, 0x3F3702E0, +/**/ 0x872E0000, 0x3FD51AAD, +/**/ 0xDB0A7CC1, 0xBD3F4BD8, +/**/ 0x00000000, 0x3FE70000, +/**/ 0x4F67A855, 0xBF241EE6, +/**/ 0xEEB99000, 0x3FD5262D, +/**/ 0x70894A01, 0xBD3E1B9F, +/**/ 0x00000000, 0x3FE6F800, +/**/ 0x221C0170, 0x3F34EA19, +/**/ 0x457EE000, 0x3FD531AC, +/**/ 0x7D931501, 0x3D3DF83B, +/**/ 0x00000000, 0x3FE6F800, +/**/ 0x5508CA5C, 0xBF282102, +/**/ 0x8C3BE000, 0x3FD53D28, +/**/ 0xEB6DFAC5, 0xBD111397, +/**/ 0x00000000, 0x3FE6F000, +/**/ 0x9300B793, 0x3F3300B7, +/**/ 0xC3ADD000, 0x3FD548A2, +/**/ 0x63081CF7, 0x3D23167E, +/**/ 0x00000000, 0x3FE6F000, +/**/ 0x005BB90F, 0xBF2BC486, +/**/ 0xEC91C000, 0x3FD5541A, +/**/ 0xDC72EEBA, 0xBCF816AA, +/**/ 0x00000000, 0x3FE6E800, +/**/ 0xC5A3A00B, 0x3F314688, +/**/ 0x07A44000, 0x3FD55F91, +/**/ 0x78DF4A62, 0xBD11E647, +/**/ 0x00000000, 0x3FE6E800, +/**/ 0xDA9C5AE1, 0xBF2F09D6, +/**/ 0x15A18000, 0x3FD56B05, +/**/ 0xBC4A23FC, 0x3D29247B, +/**/ 0x00000000, 0x3FE6E000, +/**/ 0x337C6CB1, 0x3F2F76B4, +/**/ 0x17456000, 0x3FD57677, +/**/ 0x9524D7CA, 0xBD364EAD, +/**/ 0x00000000, 0x3FE6E000, +/**/ 0xEDF4EC87, 0xBF30F8AC, +/**/ 0x0D4B3000, 0x3FD581E7, +/**/ 0xB12D8F1D, 0xBD1F31E1, +/**/ 0x00000000, 0x3FE6D800, +/**/ 0x6EAEF381, 0x3F2CBDF2, +/**/ 0xF86E0000, 0x3FD58D54, +/**/ 0x0A795215, 0x3D2791F3, +/**/ 0x00000000, 0x3FE6D800, +/**/ 0xB624BFF5, 0xBF323DB9, +/**/ 0xD9688000, 0x3FD598C0, +/**/ 0x70D96DA4, 0xBD385F49, +/**/ 0x00000000, 0x3FE6D000, +/**/ 0x1C860FB0, 0x3F2A6268, +/**/ 0xB0F4D000, 0x3FD5A42A, +/**/ 0x2DF7BA69, 0xBCDE63AF, +/**/ 0x00000000, 0x3FE6D000, +/**/ 0xB253BAE1, 0xBF335443, +/**/ 0x7FCCE000, 0x3FD5AF92, +/**/ 0xF5FFC77A, 0xBD1C032F, +/**/ 0x00000000, 0x3FE6C800, +/**/ 0xAB4294D4, 0x3F2863B1, +/**/ 0x46AA2000, 0x3FD5BAF8, +/**/ 0xF873FA41, 0xBD339AE8, +/**/ 0x00000000, 0x3FE6C800, +/**/ 0x87EAA6DF, 0xBF343C7C, +/**/ 0x0645A000, 0x3FD5C65C, +/**/ 0x0180EE65, 0xBD39FE06, +/**/ 0x00000000, 0x3FE6C000, +/**/ 0x16C16C17, 0x3F26C16C, +/**/ 0xBF581000, 0x3FD5D1BD, +/**/ 0xC9C7C238, 0xBD38D6BD, +/**/ 0x00000000, 0x3FE6C000, +/**/ 0x95C33E00, 0xBF34F695, +/**/ 0x7299C000, 0x3FD5DD1D, +/**/ 0x8815CE17, 0xBD38AF61, +/**/ 0x00000000, 0x3FE6B800, +/**/ 0xE7802D73, 0x3F257B34, +/**/ 0x20C29000, 0x3FD5E87B, +/**/ 0x8F7738FA, 0x3D3527D1, +/**/ 0x00000000, 0x3FE6B800, +/**/ 0xF4A5582C, 0xBF3582BF, +/**/ 0xCA8A2000, 0x3FD5F3D6, +/**/ 0x8E19CC75, 0x3D37AF84, +/**/ 0x00000000, 0x3FE6B000, +/**/ 0x31A3CFC7, 0x3F2490AA, +/**/ 0x70A79000, 0x3FD5FF30, +/**/ 0x9F105039, 0x3D2E9E43, +/**/ 0x00000000, 0x3FE6B000, +/**/ 0x77C30E5A, 0xBF35E12C, +/**/ 0x13D1A000, 0x3FD60A88, +/**/ 0xC879AF55, 0x3D36E9B9, +/**/ 0x00000000, 0x3FE6A800, +/**/ 0x94016A94, 0x3F24016A, +/**/ 0xB4BEC000, 0x3FD615DD, +/**/ 0x90BC04B2, 0x3D13C7CA, +/**/ 0x00000000, 0x3FE6A800, +/**/ 0xAD33D63F, 0xBF36120B, +/**/ 0x5424F000, 0x3FD62131, +/**/ 0x4AA68669, 0xBD3382FC, +/**/ 0x00000000, 0x3FE6A000, +/**/ 0x3729043E, 0x3F23CD15, +/**/ 0xF2B9C000, 0x3FD62C82, +/**/ 0xBD7C8A98, 0x3D3E54BD } }; + +static const union {int4 i[4350]; double x[2175]; } vj = { .i = { +/**/ 0x7D161C28, 0x3F46A400, +/**/ 0x20600000, 0xBF46A200, +/**/ 0xAA7623D9, 0x3D27DC4E, +/**/ 0xD596E639, 0x3F4693FA, +/**/ 0x4CE00000, 0xBF4691FD, +/**/ 0x29C3F0AD, 0x3D26B0CF, +/**/ 0x3219CE89, 0x3F4683F5, +/**/ 0x7B600000, 0xBF4681FA, +/**/ 0x95B9FDCC, 0x3D22B290, +/**/ 0x929ED397, 0x3F4673EF, +/**/ 0xABE00000, 0xBF4671F7, +/**/ 0xFA2F2D87, 0x3D17C727, +/**/ 0xF725F3E2, 0x3F4663E9, +/**/ 0xDE600000, 0xBF4661F4, +/**/ 0x6EDBFF1C, 0x3CF22ED3, +/**/ 0x5FAF2DE9, 0x3F4653E4, +/**/ 0x12E00000, 0xBF4651F2, +/**/ 0x157812BB, 0xBD144936, +/**/ 0xCC3A802B, 0x3F4643DE, +/**/ 0x49600000, 0xBF4641EF, +/**/ 0x60314E05, 0xBD2959CB, +/**/ 0x3CC7E927, 0x3F4633D9, +/**/ 0x81E00000, 0xBF4631EC, +/**/ 0xC3638E99, 0xBD35ABDA, +/**/ 0xB157675C, 0x3F4623D3, +/**/ 0xBC800000, 0xBF4621E9, +/**/ 0xC63F9A21, 0x3D3FF1D3, +/**/ 0x29E8F948, 0x3F4613CE, +/**/ 0xF9000000, 0xBF4611E6, +/**/ 0x71EEE611, 0x3D342D26, +/**/ 0xA67C9D6B, 0x3F4603C8, +/**/ 0x37800000, 0xBF4601E4, +/**/ 0x11A09689, 0x3D1C1C77, +/**/ 0x27125244, 0x3F45F3C3, +/**/ 0x78000000, 0xBF45F1E1, +/**/ 0xF7DC643C, 0xBD1DFD16, +/**/ 0xABAA1651, 0x3F45E3BD, +/**/ 0xBA800000, 0xBF45E1DE, +/**/ 0x91318A02, 0xBD376503, +/**/ 0x3443E812, 0x3F45D3B8, +/**/ 0xFF200000, 0xBF45D1DB, +/**/ 0xCE55DCDD, 0x3D3756E4, +/**/ 0xC0DFC606, 0x3F45C3B2, +/**/ 0x45A00000, 0xBF45C1D9, +/**/ 0x8F6F8FA0, 0x3D12D5CF, +/**/ 0x517DAEAB, 0x3F45B3AD, +/**/ 0x8E200000, 0xBF45B1D6, +/**/ 0x9B85DC2C, 0xBD2E90AB, +/**/ 0xE61DA081, 0x3F45A3A7, +/**/ 0xD8C00000, 0xBF45A1D3, +/**/ 0x3BF5AC54, 0x3D3B5E88, +/**/ 0x7EBF9A07, 0x3F4593A2, +/**/ 0x25400000, 0xBF4591D1, +/**/ 0x0C86DDB1, 0x3D12AC3A, +/**/ 0x1B6399BB, 0x3F45839D, +/**/ 0x73C00000, 0xBF4581CE, +/**/ 0x76830985, 0xBD3361C2, +/**/ 0xBC099E1C, 0x3F457397, +/**/ 0xC4600000, 0xBF4571CB, +/**/ 0xD062EBFF, 0x3D333915, +/**/ 0x60B1A5AA, 0x3F456392, +/**/ 0x16E00000, 0xBF4561C9, +/**/ 0x9CC4988F, 0xBD1E0DA0, +/**/ 0x095BAEE4, 0x3F45538D, +/**/ 0x6B800000, 0xBF4551C6, +/**/ 0x235BC18A, 0x3D3C69C4, +/**/ 0xB607B848, 0x3F454387, +/**/ 0xC2000000, 0xBF4541C3, +/**/ 0xF7737723, 0xBCEFCC99, +/**/ 0x66B5C056, 0x3F453382, +/**/ 0x1A800000, 0xBF4531C1, +/**/ 0x809CBCBB, 0xBD3FBAE2, +/**/ 0x1B65C58C, 0x3F45237D, +/**/ 0x75200000, 0xBF4521BE, +/**/ 0x194FEE63, 0x3CCAA5C8, +/**/ 0xD417C66A, 0x3F451377, +/**/ 0xD1C00000, 0xBF4511BB, +/**/ 0xE1CC7BBC, 0x3D3ED325, +/**/ 0x90CBC16E, 0x3F450372, +/**/ 0x30400000, 0xBF4501B9, +/**/ 0x68AB3742, 0xBD0F0298, +/**/ 0x5181B517, 0x3F44F36D, +/**/ 0x90E00000, 0xBF44F1B6, +/**/ 0x41E67AD9, 0x3D381BE1, +/**/ 0x16399FE6, 0x3F44E368, +/**/ 0xF3600000, 0xBF44E1B3, +/**/ 0x668D3662, 0xBD2A6E79, +/**/ 0xDEF38058, 0x3F44D362, +/**/ 0x58000000, 0xBF44D1B1, +/**/ 0x21F8B7C2, 0x3D284EA7, +/**/ 0xABAF54EC, 0x3F44C35D, +/**/ 0xBE800000, 0xBF44C1AE, +/**/ 0x7417D9C5, 0xBD3BC76D, +/**/ 0x7C6D1C22, 0x3F44B358, +/**/ 0x27200000, 0xBF44B1AC, +/**/ 0x16AAD1FC, 0xBD1409FD, +/**/ 0x512CD479, 0x3F44A353, +/**/ 0x91C00000, 0xBF44A1A9, +/**/ 0x98BC14FD, 0x3D30771E, +/**/ 0x29EE7C70, 0x3F44934E, +/**/ 0xFE400000, 0xBF4491A6, +/**/ 0x5CCB7232, 0xBD3B5993, +/**/ 0x06B21285, 0x3F448349, +/**/ 0x6CE00000, 0xBF4481A4, +/**/ 0x5512F9C2, 0xBD20E729, +/**/ 0xE7779538, 0x3F447343, +/**/ 0xDD800000, 0xBF4471A1, +/**/ 0x55B30899, 0x3D225436, +/**/ 0xCC3F0308, 0x3F44633E, +/**/ 0x50200000, 0xBF44619F, +/**/ 0x9E54E31F, 0x3D39807C, +/**/ 0xB5085A73, 0x3F445339, +/**/ 0xC4A00000, 0xBF44519C, +/**/ 0xD5804C0E, 0xBD376F6F, +/**/ 0xA1D399FA, 0x3F444334, +/**/ 0x3B400000, 0xBF44419A, +/**/ 0x6CDE6425, 0xBD234953, +/**/ 0x92A0C01A, 0x3F44332F, +/**/ 0xB3E00000, 0xBF443197, +/**/ 0xAAF6596F, 0x3D070E7B, +/**/ 0x876FCB54, 0x3F44232A, +/**/ 0x2E800000, 0xBF442195, +/**/ 0x4EC011F1, 0x3D2C49F8, +/**/ 0x8040BA25, 0x3F441325, +/**/ 0xAB200000, 0xBF441192, +/**/ 0xD8AAA7EB, 0x3D3825DC, +/**/ 0x7D138B0E, 0x3F440320, +/**/ 0x29A00000, 0xBF440190, +/**/ 0xFE0B73D6, 0xBD3F1A8D, +/**/ 0x7DE83C8C, 0x3F43F31B, +/**/ 0xAA400000, 0xBF43F18D, +/**/ 0xE46CA26B, 0xBD379B43, +/**/ 0x82BECD20, 0x3F43E316, +/**/ 0x2CE00000, 0xBF43E18B, +/**/ 0x6283780D, 0xBD315B44, +/**/ 0x8B973B49, 0x3F43D311, +/**/ 0xB1800000, 0xBF43D188, +/**/ 0x017589BE, 0xBD28B31E, +/**/ 0x98718584, 0x3F43C30C, +/**/ 0x38200000, 0xBF43C186, +/**/ 0x8FBB296E, 0xBD212A46, +/**/ 0xA94DAA52, 0x3F43B307, +/**/ 0xC0C00000, 0xBF43B183, +/**/ 0x045CBBD2, 0xBD183403, +/**/ 0xBE2BA832, 0x3F43A302, +/**/ 0x4B600000, 0xBF43A181, +/**/ 0xD7CC5936, 0xBD13009B, +/**/ 0xD70B7DA2, 0x3F4392FD, +/**/ 0xD8000000, 0xBF43917E, +/**/ 0xC1742279, 0xBD12B655, +/**/ 0xF3ED2921, 0x3F4382F8, +/**/ 0x66A00000, 0xBF43817C, +/**/ 0xEA83FAE8, 0xBD17512E, +/**/ 0x14D0A930, 0x3F4372F4, +/**/ 0xF7400000, 0xBF437179, +/**/ 0xBED65875, 0xBD206692, +/**/ 0x39B5FC4C, 0x3F4362EF, +/**/ 0x89E00000, 0xBF436177, +/**/ 0xD38FFE9E, 0xBD27931B, +/**/ 0x629D20F5, 0x3F4352EA, +/**/ 0x1E800000, 0xBF435175, +/**/ 0xE524208F, 0xBD309618, +/**/ 0x8F8615AA, 0x3F4342E5, +/**/ 0xB5200000, 0xBF434172, +/**/ 0xDD4C72C5, 0xBD3697E9, +/**/ 0xC070D8EB, 0x3F4332E0, +/**/ 0x4DC00000, 0xBF433170, +/**/ 0x5E6E12C3, 0xBD3DCE00, +/**/ 0xF55D6935, 0x3F4322DB, +/**/ 0xE8800000, 0xBF43216D, +/**/ 0x0AE9A8CE, 0x3D39C8A4, +/**/ 0x2E4BC509, 0x3F4312D7, +/**/ 0x85200000, 0xBF43116B, +/**/ 0xD1CD2FA1, 0x3D302D03, +/**/ 0x6B3BEAE5, 0x3F4302D2, +/**/ 0x23C00000, 0xBF430169, +/**/ 0xA3BADFD1, 0x3D15807D, +/**/ 0xAC2DD949, 0x3F42F2CD, +/**/ 0xC4600000, 0xBF42F166, +/**/ 0xF57F0504, 0xBD1A7422, +/**/ 0xF1218EB3, 0x3F42E2C8, +/**/ 0x67000000, 0xBF42E164, +/**/ 0x2F2C781C, 0xBD33C974, +/**/ 0x3A1709A3, 0x3F42D2C4, +/**/ 0x0BC00000, 0xBF42D162, +/**/ 0x851A1E61, 0x3D3DDBDD, +/**/ 0x870E4898, 0x3F42C2BF, +/**/ 0xB2600000, 0xBF42C15F, +/**/ 0xA14AA8FD, 0x3D2CA7D9, +/**/ 0xD8074A10, 0x3F42B2BA, +/**/ 0x5B000000, 0xBF42B15D, +/**/ 0xDDCDDFF5, 0xBD03022E, +/**/ 0x2D020C8C, 0x3F42A2B6, +/**/ 0x05A00000, 0xBF42A15B, +/**/ 0x0F9231A8, 0xBD343FBA, +/**/ 0x85FE8E8A, 0x3F4292B1, +/**/ 0xB2600000, 0xBF429158, +/**/ 0xA52C9CCF, 0x3D38B690, +/**/ 0xE2FCCE8A, 0x3F4282AC, +/**/ 0x61000000, 0xBF428156, +/**/ 0xC8CC82EB, 0x3D120E6A, +/**/ 0x43FCCB0A, 0x3F4272A8, +/**/ 0x11A00000, 0xBF427154, +/**/ 0x792E6C51, 0xBD30D79B, +/**/ 0xA8FE8289, 0x3F4262A3, +/**/ 0xC4600000, 0xBF426151, +/**/ 0x91F7F7AA, 0x3D38A5EE, +/**/ 0x1201F387, 0x3F42529F, +/**/ 0x79000000, 0xBF42514F, +/**/ 0x46C2E8BA, 0x3CEFA728, +/**/ 0x7F071C84, 0x3F42429A, +/**/ 0x2FA00000, 0xBF42414D, +/**/ 0xFA447A17, 0xBD37D0BA, +/**/ 0xF00DFBFD, 0x3F423295, +/**/ 0xE8600000, 0xBF42314A, +/**/ 0x94AF3FED, 0x3D2C7A24, +/**/ 0x65169072, 0x3F422291, +/**/ 0xA3000000, 0xBF422148, +/**/ 0x050CEA04, 0xBD29B0BD, +/**/ 0xDE20D863, 0x3F42128C, +/**/ 0x5FC00000, 0xBF421146, +/**/ 0x0C3035EB, 0x3D36EFF3, +/**/ 0x5B2CD24E, 0x3F420288, +/**/ 0x1E600000, 0xBF420144, +/**/ 0x73569B27, 0xBD19A3E2, +/**/ 0xDC3A7CB2, 0x3F41F283, +/**/ 0xDF200000, 0xBF41F141, +/**/ 0xEEB67715, 0x3D3B1DDE, +/**/ 0x6149D610, 0x3F41E27F, +/**/ 0xA1C00000, 0xBF41E13F, +/**/ 0x94F49154, 0xBD11EA17, +/**/ 0xEA5ADCE5, 0x3F41D27A, +/**/ 0x66800000, 0xBF41D13D, +/**/ 0x52DD9D37, 0x3D3ACED9, +/**/ 0x776D8FB1, 0x3F41C276, +/**/ 0x2D200000, 0xBF41C13B, +/**/ 0xF72D8EEB, 0xBD1C140B, +/**/ 0x0881ECF4, 0x3F41B272, +/**/ 0xF5E00000, 0xBF41B138, +/**/ 0x939583E1, 0x3D360AE5, +/**/ 0x9D97F32C, 0x3F41A26D, +/**/ 0xC0800000, 0xBF41A136, +/**/ 0x1D246C7C, 0xBD2C00D9, +/**/ 0x36AFA0D9, 0x3F419269, +/**/ 0x8D400000, 0xBF419134, +/**/ 0x0B955CFB, 0x3D29B40E, +/**/ 0xD3C8F479, 0x3F418264, +/**/ 0x5BE00000, 0xBF418132, +/**/ 0x45A6C249, 0xBD3964BF, +/**/ 0x74E3EC8D, 0x3F417260, +/**/ 0x2CA00000, 0xBF417130, +/**/ 0xF3363612, 0xBCE777E0, +/**/ 0x1A008792, 0x3F41625C, +/**/ 0xFF600000, 0xBF41612D, +/**/ 0x28DE8296, 0x3D36D608, +/**/ 0xC31EC409, 0x3F415257, +/**/ 0xD4000000, 0xBF41512B, +/**/ 0x4BB1B788, 0xBD32AE69, +/**/ 0x703EA071, 0x3F414253, +/**/ 0xAAC00000, 0xBF414129, +/**/ 0x170ECD8C, 0x3D05BF68, +/**/ 0x21601B48, 0x3F41324F, +/**/ 0x83800000, 0xBF413127, +/**/ 0x7C653BFC, 0x3D370A0B, +/**/ 0xD683330E, 0x3F41224A, +/**/ 0x5E200000, 0xBF412125, +/**/ 0x77BBBEBF, 0xBD35B70D, +/**/ 0x8FA7E642, 0x3F411246, +/**/ 0x3AE00000, 0xBF411123, +/**/ 0x93ABC1CD, 0xBD0C52EB, +/**/ 0x4CCE3363, 0x3F410242, +/**/ 0x19A00000, 0xBF410121, +/**/ 0xE5C6F4C7, 0x3D2B2237, +/**/ 0x0DF618F1, 0x3F40F23E, +/**/ 0xFA600000, 0xBF40F11E, +/**/ 0x1E9A50AD, 0x3D3D9C5F, +/**/ 0xD31F956A, 0x3F40E239, +/**/ 0xDD000000, 0xBF40E11C, +/**/ 0x8965F0DA, 0xBD336793, +/**/ 0x9C4AA74E, 0x3F40D235, +/**/ 0xC1C00000, 0xBF40D11A, +/**/ 0x7E49E231, 0xBD15E6EE, +/**/ 0x69774D1D, 0x3F40C231, +/**/ 0xA8800000, 0xBF40C118, +/**/ 0x04FD621C, 0x3D1D9B9D, +/**/ 0x3AA58554, 0x3F40B22D, +/**/ 0x91400000, 0xBF40B116, +/**/ 0x7DD9EED3, 0x3D333B55, +/**/ 0x0FD54E74, 0x3F40A229, +/**/ 0x7C000000, 0xBF40A114, +/**/ 0x7AA78478, 0x3D3E048F, +/**/ 0xE906A6FC, 0x3F409224, +/**/ 0x68A00000, 0xBF409112, +/**/ 0x644DDE88, 0xBD383C6A, +/**/ 0xC6398D6B, 0x3F408220, +/**/ 0x57600000, 0xBF408110, +/**/ 0x76B8C83A, 0xBD2F0D2F, +/**/ 0xA76E0040, 0x3F40721C, +/**/ 0x48200000, 0xBF40710E, +/**/ 0x9CE99FD3, 0xBD1F63E0, +/**/ 0x8CA3FDFB, 0x3F406218, +/**/ 0x3AE00000, 0xBF40610C, +/**/ 0x4FE774F2, 0xBCF328B4, +/**/ 0x75DB851A, 0x3F405214, +/**/ 0x2FA00000, 0xBF40510A, +/**/ 0x3782BCD4, 0x3D11B6BD, +/**/ 0x6314941D, 0x3F404210, +/**/ 0x26600000, 0xBF404108, +/**/ 0xE7183792, 0x3D22116F, +/**/ 0x544F2983, 0x3F40320C, +/**/ 0x1F200000, 0xBF403106, +/**/ 0x1B995B3D, 0x3D293F1E, +/**/ 0x498B43CB, 0x3F402208, +/**/ 0x19E00000, 0xBF402104, +/**/ 0xFC162630, 0x3D2E6669, +/**/ 0x42C8E175, 0x3F401204, +/**/ 0x16A00000, 0xBF401102, +/**/ 0x254FC9F8, 0x3D30C4AA, +/**/ 0x40080100, 0x3F400200, +/**/ 0x15600000, 0xBF400100, +/**/ 0xE4431F92, 0x3D3154EE, +/**/ 0x829141D6, 0x3F3FE3F8, +/**/ 0x2C400000, 0xBF3FE1FC, +/**/ 0x9B2D30FB, 0x3D30E503, +/**/ 0x8D157F6B, 0x3F3FC3F0, +/**/ 0x31C00000, 0xBF3FC1F8, +/**/ 0x53EBD670, 0x3D2EEBD1, +/**/ 0x9F9CB7BC, 0x3F3FA3E8, +/**/ 0x3B400000, 0xBF3FA1F4, +/**/ 0xE04A16E0, 0x3D2A113C, +/**/ 0xBA26E7CA, 0x3F3F83E0, +/**/ 0x48C00000, 0xBF3F81F0, +/**/ 0x99C43E34, 0x3D233C4A, +/**/ 0xDCB40C91, 0x3F3F63D8, +/**/ 0x5A400000, 0xBF3F61EC, +/**/ 0x7BD210C1, 0x3D14DDF6, +/**/ 0x07442311, 0x3F3F43D1, +/**/ 0x6FC00000, 0xBF3F41E8, +/**/ 0x9E4B51C8, 0xBCC52C1D, +/**/ 0x39D72849, 0x3F3F23C9, +/**/ 0x89400000, 0xBF3F21E4, +/**/ 0x8EA8C754, 0xBD1A196F, +/**/ 0x746D1936, 0x3F3F03C1, +/**/ 0xA6C00000, 0xBF3F01E0, +/**/ 0xF95AF98D, 0xBD2BB719, +/**/ 0xB705F2D8, 0x3F3EE3B9, +/**/ 0xC8400000, 0xBF3EE1DC, +/**/ 0x28FFD598, 0xBD3628EB, +/**/ 0x01A1B22C, 0x3F3EC3B2, +/**/ 0xEDC00000, 0xBF3EC1D8, +/**/ 0x0BBAC8F8, 0xBD3F6D76, +/**/ 0x54405432, 0x3F3EA3AA, +/**/ 0x17800000, 0xBF3EA1D5, +/**/ 0xB7A7EE0D, 0x3D3657D2, +/**/ 0xAEE1D5E8, 0x3F3E83A2, +/**/ 0x45000000, 0xBF3E81D1, +/**/ 0xFA9CCC78, 0x3D264FDE, +/**/ 0x1186344C, 0x3F3E639B, +/**/ 0x76800000, 0xBF3E61CD, +/**/ 0xE02EF455, 0xBCEF83EB, +/**/ 0x7C2D6C5E, 0x3F3E4393, +/**/ 0xAC000000, 0xBF3E41C9, +/**/ 0x03C3E129, 0xBD2C26B3, +/**/ 0xEED77B1B, 0x3F3E238B, +/**/ 0xE5800000, 0xBF3E21C5, +/**/ 0x904D773D, 0xBD3C1CBE, +/**/ 0x69845D83, 0x3F3E0384, +/**/ 0x23400000, 0xBF3E01C2, +/**/ 0xD0615454, 0x3D34E8B1, +/**/ 0xEC341093, 0x3F3DE37C, +/**/ 0x64C00000, 0xBF3DE1BE, +/**/ 0xE9BE933E, 0x3D13F7DF, +/**/ 0x76E6914B, 0x3F3DC375, +/**/ 0xAA400000, 0xBF3DC1BA, +/**/ 0x707B004A, 0xBD27B7D7, +/**/ 0x099BDCA9, 0x3F3DA36E, +/**/ 0xF3C00000, 0xBF3DA1B6, +/**/ 0xEE2141C3, 0xBD3DA3F8, +/**/ 0xA453EFAC, 0x3F3D8366, +/**/ 0x41800000, 0xBF3D81B3, +/**/ 0x63D21825, 0x3D2F4DA1, +/**/ 0x470EC752, 0x3F3D635F, +/**/ 0x93000000, 0xBF3D61AF, +/**/ 0xFAD0B844, 0xBD0FD473, +/**/ 0xF1CC609A, 0x3F3D4357, +/**/ 0xE8800000, 0xBF3D41AB, +/**/ 0x298657C2, 0xBD388716, +/**/ 0xA48CB882, 0x3F3D2350, +/**/ 0x42400000, 0xBF3D21A8, +/**/ 0x0B68711A, 0x3D32023A, +/**/ 0x5F4FCC0A, 0x3F3D0349, +/**/ 0x9FC00000, 0xBF3D01A4, +/**/ 0x23A704B0, 0xBD117676, +/**/ 0x22159830, 0x3F3CE342, +/**/ 0x01400000, 0xBF3CE1A1, +/**/ 0x8F391F09, 0xBD3BA59C, +/**/ 0xECDE19F1, 0x3F3CC33A, +/**/ 0x67000000, 0xBF3CC19D, +/**/ 0x9EBBF706, 0x3D28567A, +/**/ 0xBFA94E4E, 0x3F3CA333, +/**/ 0xD0800000, 0xBF3CA199, +/**/ 0x2D41F1CC, 0xBD29D41F, +/**/ 0x9A773245, 0x3F3C832C, +/**/ 0x3E400000, 0xBF3C8196, +/**/ 0x14ED5134, 0x3D391B7D, +/**/ 0x7D47C2D4, 0x3F3C6325, +/**/ 0xAFC00000, 0xBF3C6192, +/**/ 0x83403B5B, 0xBCFC31C5, +/**/ 0x681AFCFA, 0x3F3C431E, +/**/ 0x25400000, 0xBF3C418F, +/**/ 0x88A1FFF3, 0xBD3D84DB, +/**/ 0x5AF0DDB6, 0x3F3C2317, +/**/ 0x9F000000, 0xBF3C218B, +/**/ 0x6298A63B, 0x3D175CFF, +/**/ 0x55C96207, 0x3F3C0310, +/**/ 0x1C800000, 0xBF3C0188, +/**/ 0xDFB8E489, 0xBD37ADC9, +/**/ 0x58A486EA, 0x3F3BE309, +/**/ 0x9E400000, 0xBF3BE184, +/**/ 0x45069C64, 0x3D23DA0F, +/**/ 0x6382495F, 0x3F3BC302, +/**/ 0x23C00000, 0xBF3BC181, +/**/ 0x4CC2EFE0, 0xBD35574B, +/**/ 0x7662A665, 0x3F3BA2FB, +/**/ 0xAD800000, 0xBF3BA17D, +/**/ 0x4BED0B89, 0x3D250C7B, +/**/ 0x91459AFA, 0x3F3B82F4, +/**/ 0x3B000000, 0xBF3B817A, +/**/ 0x322E5605, 0xBD36795D, +/**/ 0xB42B241D, 0x3F3B62ED, +/**/ 0xCCC00000, 0xBF3B6176, +/**/ 0xF6413886, 0x3D1EAB91, +/**/ 0xDF133ECC, 0x3F3B42E6, +/**/ 0x62400000, 0xBF3B4173, +/**/ 0xF86BE5B5, 0xBD3B0BFC, +/**/ 0x11FDE807, 0x3F3B22E0, +/**/ 0xFC000000, 0xBF3B216F, +/**/ 0xDDE8D701, 0x3CF62FEB, +/**/ 0x4CEB1CCC, 0x3F3B02D9, +/**/ 0x99C00000, 0xBF3B016C, +/**/ 0xF210FD9E, 0x3D3CF8D7, +/**/ 0x8FDADA1A, 0x3F3AE2D2, +/**/ 0x3B400000, 0xBF3AE169, +/**/ 0x1526CFB0, 0xBD2092E2, +/**/ 0xDACD1CEF, 0x3F3AC2CB, +/**/ 0xE1000000, 0xBF3AC165, +/**/ 0x18D261D5, 0x3D319D24, +/**/ 0x2DC1E24A, 0x3F3AA2C5, +/**/ 0x8A800000, 0xBF3AA162, +/**/ 0x533CC8EC, 0xBD355268, +/**/ 0x88B9272B, 0x3F3A82BE, +/**/ 0x38400000, 0xBF3A815F, +/**/ 0x0AFE6139, 0x3D074750, +/**/ 0xEBB2E88F, 0x3F3A62B7, +/**/ 0xEA000000, 0xBF3A615B, +/**/ 0x6668AD57, 0x3D3A501B, +/**/ 0x56AF2375, 0x3F3A42B1, +/**/ 0x9F800000, 0xBF3A4158, +/**/ 0xA98381BD, 0xBD2E37A7, +/**/ 0xC9ADD4DD, 0x3F3A22AA, +/**/ 0x59400000, 0xBF3A2155, +/**/ 0x7B82F9AC, 0x3D1A9872, +/**/ 0x44AEF9C5, 0x3F3A02A4, +/**/ 0x17000000, 0xBF3A0152, +/**/ 0x0FF040AD, 0x3D3B96ED, +/**/ 0xC7B28F2C, 0x3F39E29D, +/**/ 0xD8800000, 0xBF39E14E, +/**/ 0x33534BD7, 0xBD304862, +/**/ 0x52B89211, 0x3F39C297, +/**/ 0x9E400000, 0xBF39C14B, +/**/ 0x17AF009B, 0x3D084979, +/**/ 0xE5C0FF72, 0x3F39A290, +/**/ 0x68000000, 0xBF39A148, +/**/ 0x604B64C9, 0x3D358CA1, +/**/ 0x80CBD44E, 0x3F39828A, +/**/ 0x35800000, 0xBF398145, +/**/ 0x2E334404, 0xBD38BD0B, +/**/ 0x23D90DA4, 0x3F396284, +/**/ 0x07400000, 0xBF396142, +/**/ 0xEF1B1C68, 0xBD1F4B58, +/**/ 0xCEE8A873, 0x3F39427D, +/**/ 0xDD000000, 0xBF39413E, +/**/ 0x07E010EC, 0x3D209881, +/**/ 0x81FAA1B9, 0x3F392277, +/**/ 0xB6C00000, 0xBF39213B, +/**/ 0x5CF03181, 0x3D37A139, +/**/ 0x3D0EF676, 0x3F390271, +/**/ 0x94400000, 0xBF390138, +/**/ 0x65276B0B, 0xBD39D2EB, +/**/ 0x0025A3A8, 0x3F38E26B, +/**/ 0x76000000, 0xBF38E135, +/**/ 0xEE3023F6, 0xBD281E5A, +/**/ 0xCB3EA64F, 0x3F38C264, +/**/ 0x5BC00000, 0xBF38C132, +/**/ 0x3F9A4B53, 0x3CEDAE6E, +/**/ 0x9E59FB68, 0x3F38A25E, +/**/ 0x45800000, 0xBF38A12F, +/**/ 0x412B648E, 0x3D2A47EF, +/**/ 0x79779FF3, 0x3F388258, +/**/ 0x33400000, 0xBF38812C, +/**/ 0x5ED0D8F2, 0x3D38955F, +/**/ 0x5C9790EE, 0x3F386252, +/**/ 0x24C00000, 0xBF386129, +/**/ 0x09939374, 0xBD3CBD55, +/**/ 0x47B9CB5A, 0x3F38424C, +/**/ 0x1A800000, 0xBF384126, +/**/ 0x4F399186, 0xBD32D325, +/**/ 0x3ADE4C33, 0x3F382246, +/**/ 0x14400000, 0xBF382123, +/**/ 0x524688EB, 0xBD235622, +/**/ 0x3605107A, 0x3F380240, +/**/ 0x12000000, 0xBF380120, +/**/ 0xEB2F3DDC, 0xBCF44184, +/**/ 0x392E152C, 0x3F37E23A, +/**/ 0x13C00000, 0xBF37E11D, +/**/ 0x2153D1B8, 0x3D198B16, +/**/ 0x4459574A, 0x3F37C234, +/**/ 0x19800000, 0xBF37C11A, +/**/ 0x47A3C923, 0x3D2A9511, +/**/ 0x5786D3D1, 0x3F37A22E, +/**/ 0x23400000, 0xBF37A117, +/**/ 0x4B4128D9, 0x3D337431, +/**/ 0x72B687C1, 0x3F378228, +/**/ 0x31000000, 0xBF378114, +/**/ 0xC5BFE9E8, 0x3D38E0BF, +/**/ 0x95E87019, 0x3F376222, +/**/ 0x42C00000, 0xBF376111, +/**/ 0x5A0B2CE9, 0x3D3D9134, +/**/ 0xC11C89D8, 0x3F37421C, +/**/ 0x58400000, 0xBF37410E, +/**/ 0xB1802C40, 0xBD3E7970, +/**/ 0xF452D1FB, 0x3F372216, +/**/ 0x72000000, 0xBF37210B, +/**/ 0x16E562C9, 0xBD3B3E2F, +/**/ 0x2F8B4583, 0x3F370211, +/**/ 0x8FC00000, 0xBF370108, +/**/ 0x9087DACD, 0xBD38BC06, +/**/ 0x72C5E16F, 0x3F36E20B, +/**/ 0xB1800000, 0xBF36E105, +/**/ 0xD92B1B21, 0xBD36F1F6, +/**/ 0xBE02A2BC, 0x3F36C205, +/**/ 0xD7400000, 0xBF36C102, +/**/ 0xABF2CD23, 0xBD35DEFF, +/**/ 0x1141866B, 0x3F36A200, +/**/ 0x01000000, 0xBF36A100, +/**/ 0xC462BC85, 0xBD358220, +/**/ 0x6C828979, 0x3F3681FA, +/**/ 0x2EC00000, 0xBF3680FD, +/**/ 0xDE5ED723, 0xBD35DA59, +/**/ 0xCFC5A8E7, 0x3F3661F4, +/**/ 0x60800000, 0xBF3660FA, +/**/ 0xB62B2CD1, 0xBD36E6AA, +/**/ 0x3B0AE1B2, 0x3F3641EF, +/**/ 0x96400000, 0xBF3640F7, +/**/ 0x086BEF29, 0xBD38A613, +/**/ 0xAE5230DA, 0x3F3621E9, +/**/ 0xD0000000, 0xBF3620F4, +/**/ 0x9225715D, 0xBD3B1792, +/**/ 0x299B935F, 0x3F3601E4, +/**/ 0x0DC00000, 0xBF3600F2, +/**/ 0x10BC2805, 0xBD3E3A29, +/**/ 0xACE7063E, 0x3F35E1DE, +/**/ 0x4FC00000, 0xBF35E0EF, +/**/ 0xBE0B570D, 0x3D3DF329, +/**/ 0x38348676, 0x3F35C1D9, +/**/ 0x95800000, 0xBF35C0EC, +/**/ 0x1C0C5502, 0x3D397166, +/**/ 0xCB841108, 0x3F35A1D3, +/**/ 0xDF400000, 0xBF35A0E9, +/**/ 0x4AC1FA2D, 0x3D34418C, +/**/ 0x66D5A2F1, 0x3F3581CE, +/**/ 0x2D000000, 0xBF3580E7, +/**/ 0x168E9C6E, 0x3D2CC939, +/**/ 0x0A293931, 0x3F3561C9, +/**/ 0x7EC00000, 0xBF3560E4, +/**/ 0x795CE154, 0x3D1F6E5C, +/**/ 0xB57ED0C7, 0x3F3541C3, +/**/ 0xD4800000, 0xBF3540E1, +/**/ 0x898FEE67, 0x3CE4EF88, +/**/ 0x68D666B1, 0x3F3521BE, +/**/ 0x2E400000, 0xBF3520DF, +/**/ 0x0B78D65E, 0xBD1CDACF, +/**/ 0x242FF7EF, 0x3F3501B9, +/**/ 0x8C000000, 0xBF3500DC, +/**/ 0x6F1CBFB8, 0xBD2F7BF1, +/**/ 0xE78B8180, 0x3F34E1B3, +/**/ 0xEDC00000, 0xBF34E0D9, +/**/ 0x5A899820, 0xBD38ED52, +/**/ 0xB2E90063, 0x3F34C1AE, +/**/ 0x53C00000, 0xBF34C0D7, +/**/ 0x930A694E, 0x3D3D3C3F, +/**/ 0x86487196, 0x3F34A1A9, +/**/ 0xBD800000, 0xBF34A0D4, +/**/ 0x4FA7CCCB, 0x3D32BFBD, +/**/ 0x61A9D219, 0x3F3481A4, +/**/ 0x2B400000, 0xBF3480D2, +/**/ 0x65A26E32, 0x3D1E789C, +/**/ 0x450D1EEB, 0x3F34619F, +/**/ 0x9D000000, 0xBF3460CF, +/**/ 0x47E500B5, 0xBD109E0B, +/**/ 0x3072550B, 0x3F34419A, +/**/ 0x12C00000, 0xBF3440CD, +/**/ 0x3523FAE9, 0xBD309040, +/**/ 0x23D97178, 0x3F342195, +/**/ 0x8C800000, 0xBF3420CA, +/**/ 0xD31DE7C2, 0xBD3D9B10, +/**/ 0x1F427131, 0x3F340190, +/**/ 0x0A800000, 0xBF3400C8, +/**/ 0x90B287C4, 0x3D34B90B, +/**/ 0x22AD5135, 0x3F33E18B, +/**/ 0x8C400000, 0xBF33E0C5, +/**/ 0xCA1B0FC2, 0x3D19B454, +/**/ 0x2E1A0E83, 0x3F33C186, +/**/ 0x12000000, 0xBF33C0C3, +/**/ 0x638FC1F4, 0xBD20FBE7, +/**/ 0x4188A61A, 0x3F33A181, +/**/ 0x9BC00000, 0xBF33A0C0, +/**/ 0xE0C03290, 0xBD38070E, +/**/ 0x5CF914F9, 0x3F33817C, +/**/ 0x29C00000, 0xBF3380BE, +/**/ 0xE0B6E5F5, 0x3D37D2C3, +/**/ 0x806B5820, 0x3F336177, +/**/ 0xBB800000, 0xBF3360BB, +/**/ 0x35598794, 0x3D1C4213, +/**/ 0xABDF6C8D, 0x3F334172, +/**/ 0x51400000, 0xBF3340B9, +/**/ 0xC111C569, 0xBD249997, +/**/ 0xDF554F40, 0x3F33216D, +/**/ 0xEB000000, 0xBF3320B6, +/**/ 0xEEEE28E2, 0xBD3C442D, +/**/ 0x1ACCFD37, 0x3F330169, +/**/ 0x89000000, 0xBF3300B4, +/**/ 0xDBBF316D, 0x3D312B5E, +/**/ 0x5E467372, 0x3F32E164, +/**/ 0x2AC00000, 0xBF32E0B2, +/**/ 0x7484E6E1, 0xBCFFD254, +/**/ 0xA9C1AEF0, 0x3F32C15F, +/**/ 0xD0800000, 0xBF32C0AF, +/**/ 0x1F2C3F9D, 0xBD35BCBA, +/**/ 0xFD3EACAF, 0x3F32A15A, +/**/ 0x7A800000, 0xBF32A0AD, +/**/ 0x8C8BAA61, 0x3D35EDA0, +/**/ 0x58BD69B0, 0x3F328156, +/**/ 0x28400000, 0xBF3280AB, +/**/ 0x3F79FE5E, 0x3CF02EAF, +/**/ 0xBC3DE2F1, 0x3F326151, +/**/ 0xDA000000, 0xBF3260A8, +/**/ 0xB1304AA8, 0xBD347BDA, +/**/ 0x27C01572, 0x3F32414D, +/**/ 0x90000000, 0xBF3240A6, +/**/ 0xD46BE359, 0x3D35724F, +/**/ 0x9B43FE30, 0x3F322148, +/**/ 0x49C00000, 0xBF3220A4, +/**/ 0x43BF90C9, 0xBCF31954, +/**/ 0x16C99A2D, 0x3F320144, +/**/ 0x07800000, 0xBF3200A2, +/**/ 0xC4901E30, 0xBD386689, +/**/ 0x9A50E666, 0x3F31E13F, +/**/ 0xC9800000, 0xBF31E09F, +/**/ 0x134E34BF, 0x3D2FA8E5, +/**/ 0x25D9DFDB, 0x3F31C13B, +/**/ 0x8F400000, 0xBF31C09D, +/**/ 0x477D87DF, 0xBD20FF40, +/**/ 0xB964838C, 0x3F31A136, +/**/ 0x59400000, 0xBF31A09B, +/**/ 0x68B5B77B, 0x3D3E9E3E, +/**/ 0x54F0CE76, 0x3F318132, +/**/ 0x27000000, 0xBF318099, +/**/ 0x906F8A53, 0x3D14BC39, +/**/ 0xF87EBD9A, 0x3F31612D, +/**/ 0xF8C00000, 0xBF316096, +/**/ 0xFCD50724, 0xBD34CC2F, +/**/ 0xA40E4DF7, 0x3F314129, +/**/ 0xCEC00000, 0xBF314094, +/**/ 0x7A3A1B8D, 0x3D30AD83, +/**/ 0x579F7C8B, 0x3F312125, +/**/ 0xA8800000, 0xBF312092, +/**/ 0x057F5C66, 0xBD24C5AE, +/**/ 0x13324657, 0x3F310121, +/**/ 0x86800000, 0xBF310090, +/**/ 0xBFD488E0, 0x3D3A03C0, +/**/ 0xD6C6A858, 0x3F30E11C, +/**/ 0x68400000, 0xBF30E08E, +/**/ 0x56935D63, 0xBD00EDA8, +/**/ 0xA25C9F8F, 0x3F30C118, +/**/ 0x4E000000, 0xBF30C08C, +/**/ 0x2FDDD1CE, 0xBD3EC638, +/**/ 0x75F428FB, 0x3F30A114, +/**/ 0x38000000, 0xBF30A08A, +/**/ 0x0CA3DCBE, 0x3D102CDE, +/**/ 0x518D419B, 0x3F308110, +/**/ 0x25C00000, 0xBF308088, +/**/ 0xBFA78921, 0xBD39A865, +/**/ 0x3527E66D, 0x3F30610C, +/**/ 0x17C00000, 0xBF306086, +/**/ 0x72CE37BD, 0x3D203FE0, +/**/ 0x20C41472, 0x3F304108, +/**/ 0x0D800000, 0xBF304084, +/**/ 0x6054C3FA, 0xBD369AC6, +/**/ 0x1461C8A9, 0x3F302104, +/**/ 0x07800000, 0xBF302082, +/**/ 0x4836293A, 0x3D2450ED, +/**/ 0x10010010, 0x3F300100, +/**/ 0x05400000, 0xBF300080, +/**/ 0x88B3357C, 0xBD359558, +/**/ 0x27436F4F, 0x3F2FC1F8, +/**/ 0x0E800000, 0xBF2FC0FC, +/**/ 0x92ECD4D1, 0x3D245998, +/**/ 0x3E87D8DC, 0x3F2F81F0, +/**/ 0x1A000000, 0xBF2F80F8, +/**/ 0xB592170A, 0xBD36901A, +/**/ 0x65CF36C6, 0x3F2F41E8, +/**/ 0x2E000000, 0xBF2F40F4, +/**/ 0x53524603, 0x3D2069E5, +/**/ 0x9D19830B, 0x3F2F01E0, +/**/ 0x49800000, 0xBF2F00F0, +/**/ 0x69C22240, 0xBD39830B, +/**/ 0xE466B7AB, 0x3F2EC1D8, +/**/ 0x6D800000, 0xBF2EC0EC, +/**/ 0xFB871BBA, 0x3D1123AC, +/**/ 0x3BB6CEA4, 0x3F2E81D1, +/**/ 0x99000000, 0xBF2E80E8, +/**/ 0x2E158AF6, 0xBD3E6629, +/**/ 0xA309C1F4, 0x3F2E41C9, +/**/ 0xCD000000, 0xBF2E40E4, +/**/ 0x2B29884E, 0xBCF8F488, +/**/ 0x1A5F8B99, 0x3F2E01C2, +/**/ 0x09000000, 0xBF2E00E1, +/**/ 0x6EA006C6, 0x3D3ACE8D, +/**/ 0xA1B82593, 0x3F2DC1BA, +/**/ 0x4C800000, 0xBF2DC0DD, +/**/ 0x59D0B687, 0xBD22974E, +/**/ 0x391389E0, 0x3F2D81B3, +/**/ 0x98800000, 0xBF2D80D9, +/**/ 0xD7897CAD, 0x3D322319, +/**/ 0xE071B27F, 0x3F2D41AB, +/**/ 0xEC000000, 0xBF2D40D5, +/**/ 0x57954C6E, 0xBD32E42F, +/**/ 0x97D2996E, 0x3F2D01A4, +/**/ 0x48000000, 0xBF2D00D2, +/**/ 0xC741610E, 0x3D1E7DF5, +/**/ 0x5F3638AB, 0x3F2CC19D, +/**/ 0xAB800000, 0xBF2CC0CE, +/**/ 0xA0909C5A, 0xBD3E50DF, +/**/ 0x369C8A37, 0x3F2C8196, +/**/ 0x17800000, 0xBF2C80CB, +/**/ 0x8D8D1C8F, 0xBD12D119, +/**/ 0x1E05880E, 0x3F2C418F, +/**/ 0x8B800000, 0xBF2C40C7, +/**/ 0x544D2574, 0x3D347649, +/**/ 0x15712C30, 0x3F2C0188, +/**/ 0x07000000, 0xBF2C00C4, +/**/ 0x4EEA9E68, 0xBD32D030, +/**/ 0x1CDF709C, 0x3F2BC181, +/**/ 0x8B000000, 0xBF2BC0C0, +/**/ 0x74A84109, 0x3D15E533, +/**/ 0x34504F50, 0x3F2B817A, +/**/ 0x17000000, 0xBF2B80BD, +/**/ 0x025FBF68, 0x3D3D53C1, +/**/ 0x5BC3C24B, 0x3F2B4173, +/**/ 0xAA800000, 0xBF2B40B9, +/**/ 0x6BAA2FA8, 0xBD267FA7, +/**/ 0x9339C38C, 0x3F2B016C, +/**/ 0x46800000, 0xBF2B00B6, +/**/ 0xBB3FDE1E, 0x3D277F1D, +/**/ 0xDAB24D11, 0x3F2AC165, +/**/ 0xEA000000, 0xBF2AC0B2, +/**/ 0x1A8CDBE2, 0xBD3DAD17, +/**/ 0x322D58D9, 0x3F2A815F, +/**/ 0x96000000, 0xBF2A80AF, +/**/ 0xD81CF36E, 0xBD1E1315, +/**/ 0x99AAE0E3, 0x3F2A4158, +/**/ 0x4A000000, 0xBF2A40AC, +/**/ 0xE649E7B4, 0x3D2C7307, +/**/ 0x112ADF2D, 0x3F2A0152, +/**/ 0x05800000, 0xBF2A00A9, +/**/ 0xB77435EC, 0xBD3C713A, +/**/ 0x98AD4DB7, 0x3F29C14B, +/**/ 0xC9800000, 0xBF29C0A5, +/**/ 0x3A7AE827, 0xBD1E1005, +/**/ 0x3032267F, 0x3F298145, +/**/ 0x95800000, 0xBF2980A2, +/**/ 0xA8F2A842, 0x3D2A0460, +/**/ 0xD7B96385, 0x3F29413E, +/**/ 0x69000000, 0xBF29409F, +/**/ 0xA7B8321E, 0xBD3EDDA5, +/**/ 0x8F42FEC5, 0x3F290138, +/**/ 0x45000000, 0xBF29009C, +/**/ 0x3A3F0D33, 0xBD264506, +/**/ 0x56CEF241, 0x3F28C132, +/**/ 0x29000000, 0xBF28C099, +/**/ 0x33EE13CD, 0x3D206930, +/**/ 0x2E5D37F6, 0x3F28812C, +/**/ 0x15000000, 0xBF288096, +/**/ 0x22DF1FDA, 0x3D3B28AC, +/**/ 0x15EDC9E3, 0x3F284126, +/**/ 0x08800000, 0xBF284093, +/**/ 0xDD73B6DB, 0xBD324546, +/**/ 0x0D80A208, 0x3F280120, +/**/ 0x04800000, 0xBF280090, +/**/ 0x6DFEB485, 0xBCB440C2, +/**/ 0x1515BA62, 0x3F27C11A, +/**/ 0x08800000, 0xBF27C08D, +/**/ 0x9823B19D, 0x3D31BCBE, +/**/ 0x2CAD0CF1, 0x3F278114, +/**/ 0x14000000, 0xBF27808A, +/**/ 0xA9EB4E97, 0xBD3CD148, +/**/ 0x544693B4, 0x3F27410E, +/**/ 0x28000000, 0xBF274087, +/**/ 0xCA4F73AA, 0xBD277AAC, +/**/ 0x8BE248AA, 0x3F270108, +/**/ 0x44000000, 0xBF270084, +/**/ 0x26068EF7, 0x3D13E656, +/**/ 0xD38025D2, 0x3F26C102, +/**/ 0x68000000, 0xBF26C081, +/**/ 0x44C3EC8A, 0x3D35547B, +/**/ 0x2B20252A, 0x3F2680FD, +/**/ 0x93800000, 0xBF26807E, +/**/ 0x110DCE4B, 0xBD3AABA5, +/**/ 0x92C240B1, 0x3F2640F7, +/**/ 0xC7800000, 0xBF26407B, +/**/ 0xAC011956, 0xBD260B96, +/**/ 0x0A667267, 0x3F2600F2, +/**/ 0x03800000, 0xBF260079, +/**/ 0x5DFA826E, 0x3D111C22, +/**/ 0x920CB44A, 0x3F25C0EC, +/**/ 0x47800000, 0xBF25C076, +/**/ 0xD8A2980A, 0x3D333BD6, +/**/ 0x29B5005A, 0x3F2580E7, +/**/ 0x93000000, 0xBF258073, +/**/ 0x71C1D861, 0xBD3E2660, +/**/ 0xD15F5095, 0x3F2540E1, +/**/ 0xE7000000, 0xBF254070, +/**/ 0x4E77E5EE, 0xBD2FBD3A, +/**/ 0x890B9EFA, 0x3F2500DC, +/**/ 0x43000000, 0xBF25006E, +/**/ 0x7B90A2D9, 0xBCFEBDF2, +/**/ 0x50B9E589, 0x3F24C0D7, +/**/ 0xA7000000, 0xBF24C06B, +/**/ 0x58F2FF2C, 0x3D2765B3, +/**/ 0x286A1E40, 0x3F2480D2, +/**/ 0x13000000, 0xBF248069, +/**/ 0x74AE382C, 0x3D38FE8D, +/**/ 0x101C431E, 0x3F2440CD, +/**/ 0x86800000, 0xBF244066, +/**/ 0xB0286224, 0xBD3A07C3, +/**/ 0x07D04E23, 0x3F2400C8, +/**/ 0x02800000, 0xBF240064, +/**/ 0x46EFC0EC, 0xBD2ABE33, +/**/ 0x0F86394D, 0x3F23C0C3, +/**/ 0x86800000, 0xBF23C061, +/**/ 0x70DE3151, 0xBCF06744, +/**/ 0x273DFE9C, 0x3F2380BE, +/**/ 0x12800000, 0xBF23805F, +/**/ 0x05CFCD61, 0x3D260659, +/**/ 0x4EF7980F, 0x3F2340B9, +/**/ 0xA6800000, 0xBF23405C, +/**/ 0xD7DBBEBC, 0x3D36BEC8, +/**/ 0x86B2FFA4, 0x3F2300B4, +/**/ 0x42000000, 0xBF23005A, +/**/ 0x2B2027B4, 0xBD3DD29F, +/**/ 0xCE702F5C, 0x3F22C0AF, +/**/ 0xE6000000, 0xBF22C057, +/**/ 0x6959A7D0, 0xBD32B00B, +/**/ 0x262F2134, 0x3F2280AB, +/**/ 0x92000000, 0xBF228055, +/**/ 0x19FAAC2D, 0xBD1F61EF, +/**/ 0x8DEFCF2C, 0x3F2240A6, +/**/ 0x46000000, 0xBF224053, +/**/ 0xCB16B8A8, 0x3D05A87E, +/**/ 0x05B23344, 0x3F2200A2, +/**/ 0x02000000, 0xBF220051, +/**/ 0x23B9B257, 0x3D29F32F, +/**/ 0x8D76477A, 0x3F21C09D, +/**/ 0xC6000000, 0xBF21C04E, +/**/ 0x7E214821, 0x3D36F61B, +/**/ 0x253C05CD, 0x3F218099, +/**/ 0x91800000, 0xBF21804C, +/**/ 0x46FDFCA2, 0xBD3F5464, +/**/ 0xCD03683D, 0x3F214094, +/**/ 0x65800000, 0xBF21404A, +/**/ 0xA30F2308, 0xBD35E4E7, +/**/ 0x84CC68C9, 0x3F210090, +/**/ 0x41800000, 0xBF210048, +/**/ 0xF800CC34, 0xBD2974DC, +/**/ 0x4C970171, 0x3F20C08C, +/**/ 0x25800000, 0xBF20C046, +/**/ 0xC1006E9D, 0xBD0E9FC5, +/**/ 0x24632C32, 0x3F208088, +/**/ 0x11800000, 0xBF208044, +/**/ 0x078E4438, 0x3D133DE7, +/**/ 0x0C30E30D, 0x3F204084, +/**/ 0x05800000, 0xBF204042, +/**/ 0x15F82A7B, 0x3D2A61D2, +/**/ 0x04002001, 0x3F200080, +/**/ 0x01800000, 0xBF200040, +/**/ 0x3BBB110C, 0x3D355155, +/**/ 0x17A1BA1A, 0x3F1F80F8, +/**/ 0x0B000000, 0xBF1F807C, +/**/ 0x6C520A9B, 0x3D3D31BE, +/**/ 0x47462860, 0x3F1F00F0, +/**/ 0x22000000, 0xBF1F0078, +/**/ 0x4B6D83F6, 0xBD3B2CDB, +/**/ 0x96ED7ED3, 0x3F1E80E8, +/**/ 0x4A000000, 0xBF1E8074, +/**/ 0xD4122C5A, 0xBD33C977, +/**/ 0x0697B172, 0x3F1E00E1, +/**/ 0x82000000, 0xBF1E0070, +/**/ 0x2D1517C4, 0xBD29462E, +/**/ 0x9644B43B, 0x3F1D80D9, +/**/ 0xCA000000, 0xBF1D806C, +/**/ 0xF0952D45, 0xBD16E2E3, +/**/ 0x45F47B2C, 0x3F1D00D2, +/**/ 0x22000000, 0xBF1D0069, +/**/ 0x2DDC2A8D, 0x3CEED452, +/**/ 0x15A6FA46, 0x3F1C80CB, +/**/ 0x8A000000, 0xBF1C8065, +/**/ 0xA08CEBE8, 0x3D1DAFEE, +/**/ 0x055C2585, 0x3F1C00C4, +/**/ 0x02000000, 0xBF1C0062, +/**/ 0xBB11EF55, 0x3D2B50A4, +/**/ 0x1513F0E9, 0x3F1B80BD, +/**/ 0x8A000000, 0xBF1B805E, +/**/ 0xC6D142BF, 0x3D33ACA6, +/**/ 0x44CE5071, 0x3F1B00B6, +/**/ 0x22000000, 0xBF1B005B, +/**/ 0xF8CD3D11, 0x3D3979F8, +/**/ 0x948B381A, 0x3F1A80AF, +/**/ 0xCA000000, 0xBF1A8057, +/**/ 0x07EDFD29, 0x3D3F1149, +/**/ 0x044A9BE5, 0x3F1A00A9, +/**/ 0x81000000, 0xBF1A0054, +/**/ 0xF7BB7092, 0xBD3B8C68, +/**/ 0x940C6FCF, 0x3F1980A2, +/**/ 0x49000000, 0xBF198051, +/**/ 0xF27E09A9, 0xBD365E1C, +/**/ 0x43D0A7D8, 0x3F19009C, +/**/ 0x21000000, 0xBF19004E, +/**/ 0xD508D564, 0xBD3162D2, +/**/ 0x139737FE, 0x3F188096, +/**/ 0x09000000, 0xBF18804B, +/**/ 0x18D5C93E, 0xBD293315, +/**/ 0x03601440, 0x3F180090, +/**/ 0x01000000, 0xBF180048, +/**/ 0x0C26A328, 0xBD200288, +/**/ 0x132B309E, 0x3F17808A, +/**/ 0x09000000, 0xBF178045, +/**/ 0x7E89FD6F, 0xBD0CC7F9, +/**/ 0x42F88115, 0x3F170084, +/**/ 0x21000000, 0xBF170042, +/**/ 0x058494DC, 0x3CE40881, +/**/ 0x92C7F9A5, 0x3F16807E, +/**/ 0x49000000, 0xBF16803F, +/**/ 0xCD5698B9, 0x3D12AE16, +/**/ 0x02998E4D, 0x3F160079, +/**/ 0x81000000, 0xBF16003C, +/**/ 0xC5780E17, 0x3D21138B, +/**/ 0x926D330B, 0x3F158073, +/**/ 0xC9000000, 0xBF158039, +/**/ 0x4E2001E2, 0x3D287809, +/**/ 0x4242DBDF, 0x3F15006E, +/**/ 0x21000000, 0xBF150037, +/**/ 0x21448AA2, 0x3D2F8684, +/**/ 0x121A7CC8, 0x3F148069, +/**/ 0x89000000, 0xBF148034, +/**/ 0x2F637D8E, 0x3D33207E, +/**/ 0x01F409C4, 0x3F140064, +/**/ 0x01000000, 0xBF140032, +/**/ 0x12E44B29, 0x3D3654B9, +/**/ 0x11CF76D3, 0x3F13805F, +/**/ 0x89000000, 0xBF13802F, +/**/ 0xCA5547F3, 0x3D3960F2, +/**/ 0x41ACB7F4, 0x3F13005A, +/**/ 0x21000000, 0xBF13002D, +/**/ 0x6487063D, 0x3D3C462B, +/**/ 0x918BC126, 0x3F128055, +/**/ 0xC9000000, 0xBF12802A, +/**/ 0xEFEA1107, 0x3D3F0562, +/**/ 0x016C8668, 0x3F120051, +/**/ 0x80000000, 0xBF120028, +/**/ 0x857113CE, 0xBD3E6066, +/**/ 0x914EFBBA, 0x3F11804C, +/**/ 0x48000000, 0xBF118026, +/**/ 0xEDD9EB54, 0xBD3BEA30, +/**/ 0x41331519, 0x3F110048, +/**/ 0x20000000, 0xBF110024, +/**/ 0x3BFFFF5A, 0xBD3996FC, +/**/ 0x1118C686, 0x3F108044, +/**/ 0x08000000, 0xBF108022, +/**/ 0x62F2E042, 0xBD3765C8, +/**/ 0x01000400, 0x3F100040, +/**/ 0x00000000, 0xBF100020, +/**/ 0x562224CD, 0xBD355595, +/**/ 0x21D1830C, 0x3F0F0078, +/**/ 0x10000000, 0xBF0F003C, +/**/ 0x095D69EB, 0xBD336563, +/**/ 0x81A5E62E, 0x3F0E0070, +/**/ 0x40000000, 0xBF0E0038, +/**/ 0x70D45290, 0xBD319431, +/**/ 0x217D1965, 0x3F0D0069, +/**/ 0x90000000, 0xBF0D0034, +/**/ 0x022D0EF6, 0xBD2FC201, +/**/ 0x015704B1, 0x3F0C0062, +/**/ 0x00000000, 0xBF0C0031, +/**/ 0x5E276E21, 0xBD2C95A0, +/**/ 0x2133900E, 0x3F0B005B, +/**/ 0x90000000, 0xBF0B002D, +/**/ 0xE0372A42, 0xBD29A140, +/**/ 0x8112A37D, 0x3F0A0054, +/**/ 0x40000000, 0xBF0A002A, +/**/ 0x73BBB580, 0xBD26E2E2, +/**/ 0x20F426FB, 0x3F09004E, +/**/ 0x10000000, 0xBF090027, +/**/ 0x04D48C20, 0xBD245885, +/**/ 0x00D80288, 0x3F080048, +/**/ 0x00000000, 0xBF080024, +/**/ 0x80613426, 0xBD220028, +/**/ 0x20BE1E23, 0x3F070042, +/**/ 0x10000000, 0xBF070021, +/**/ 0xA80279F3, 0xBD1FAF99, +/**/ 0x80A661CA, 0x3F06003C, +/**/ 0x40000000, 0xBF06001E, +/**/ 0xDC287DFE, 0xBD1BBAE3, +/**/ 0x2090B57C, 0x3F050037, +/**/ 0x90000000, 0xBF05001B, +/**/ 0x7B73B67C, 0xBD181E2F, +/**/ 0x007D0139, 0x3F040032, +/**/ 0x00000000, 0xBF040019, +/**/ 0x65A375F8, 0xBD14D57C, +/**/ 0x206B2CFF, 0x3F03002D, +/**/ 0x90000000, 0xBF030016, +/**/ 0x7BF71EC1, 0xBD11DCCA, +/**/ 0x805B20CD, 0x3F020028, +/**/ 0x40000000, 0xBF020014, +/**/ 0x425C4447, 0xBD0E6033, +/**/ 0x204CC4A3, 0x3F010024, +/**/ 0x10000000, 0xBF010012, +/**/ 0x730FFF5C, 0xBD0996D3, +/**/ 0x00400080, 0x3F000020, +/**/ 0x00000000, 0xBF000010, +/**/ 0x558888DE, 0xBD055575, +/**/ 0x406978C6, 0x3EFE0038, +/**/ 0x20000000, 0xBEFE001C, +/**/ 0xB845146A, 0xBD019418, +/**/ 0x0055C096, 0x3EFC0031, +/**/ 0x80000000, 0xBEFC0018, +/**/ 0xD989DB3C, 0xBCFC957A, +/**/ 0x4044A870, 0x3EFA002A, +/**/ 0x20000000, 0xBEFA0015, +/**/ 0x8F0EED2F, 0xBCF6E2C6, +/**/ 0x00360051, 0x3EF80024, +/**/ 0x00000000, 0xBEF80012, +/**/ 0x40184CEB, 0xBCF20014, +/**/ 0x40299839, 0x3EF6001E, +/**/ 0x20000000, 0xBEF6000F, +/**/ 0x434A1F5C, 0xBCEBBAC7, +/**/ 0x001F4027, 0x3EF40019, +/**/ 0x80000000, 0xBEF4000C, +/**/ 0xDD68DD6A, 0xBCE4D568, +/**/ 0x4016C81A, 0x3EF20014, +/**/ 0x20000000, 0xBEF2000A, +/**/ 0xA11710FC, 0xBCDE6019, +/**/ 0x00100010, 0x3EF00010, +/**/ 0x00000000, 0xBEF00008, +/**/ 0x5562222D, 0xBCD55565, +/**/ 0x80157013, 0x3EEC0018, +/**/ 0x40000000, 0xBEEC000C, +/**/ 0x176276C5, 0xBCCC9568, +/**/ 0x000D800A, 0x3EE80012, +/**/ 0x00000000, 0xBEE80009, +/**/ 0x20061337, 0xBCC2000A, +/**/ 0x8007D005, 0x3EE4000C, +/**/ 0x40000000, 0xBEE40006, +/**/ 0x195A3758, 0xBCB4D55F, +/**/ 0x00040002, 0x3EE00008, +/**/ 0x00000000, 0xBEE00004, +/**/ 0x5558888A, 0xBCA5555D, +/**/ 0x00036001, 0x3ED80009, +/**/ 0x80000000, 0xBED80004, +/**/ 0x100184CD, 0xBC920005, +/**/ 0x00010000, 0x3ED00004, +/**/ 0x00000000, 0xBED00002, +/**/ 0x55562222, 0xBC755559, +/**/ 0x00004000, 0x3EC00002, +/**/ 0x00000000, 0xBEC00001, +/**/ 0x55558889, 0xBC455557, +/**/ 0x00000000, 0x00000000, +/**/ 0x00000000, 0x00000000, +/**/ 0x00000000, 0x00000000, +/**/ 0x00008000, 0xBEBFFFFC, +/**/ 0x00000000, 0x3EBFFFFE, +/**/ 0x55558889, 0x3C455553, +/**/ 0x00020000, 0xBECFFFF8, +/**/ 0x00000000, 0x3ECFFFFC, +/**/ 0x55562222, 0x3C755551, +/**/ 0x00035FFF, 0xBED7FFF7, +/**/ 0x80000000, 0x3ED7FFFB, +/**/ 0xF00184CC, 0x3C91FFFA, +/**/ 0x0007FFFC, 0xBEDFFFF0, +/**/ 0x00000000, 0x3EDFFFF8, +/**/ 0x55588887, 0x3CA5554D, +/**/ 0x8007CFFB, 0xBEE3FFF3, +/**/ 0xC0000000, 0x3EE3FFF9, +/**/ 0x915A3753, 0x3CB4D54B, +/**/ 0x000D7FF6, 0xBEE7FFEE, +/**/ 0x00000000, 0x3EE7FFF7, +/**/ 0xE006132F, 0x3CC1FFF5, +/**/ 0x80156FED, 0xBEEBFFE7, +/**/ 0xC0000000, 0x3EEBFFF3, +/**/ 0x936276B2, 0x3CCC9542, +/**/ 0x001FFFE0, 0xBEEFFFE0, +/**/ 0x00000000, 0x3EEFFFF0, +/**/ 0x55622217, 0x3CD55545, +/**/ 0xC016C7E6, 0xBEF1FFEB, +/**/ 0xE0000000, 0x3EF1FFF5, +/**/ 0x5F1710D1, 0x3CDE5FE6, +/**/ 0x001F3FD9, 0xBEF3FFE7, +/**/ 0x80000000, 0x3EF3FFF3, +/**/ 0xCD68DD41, 0x3CE4D541, +/**/ 0xC02997C7, 0xBEF5FFE1, +/**/ 0xE0000000, 0x3EF5FFF0, +/**/ 0x124A1F13, 0x3CEBBA8E, +/**/ 0x0035FFAF, 0xBEF7FFDC, +/**/ 0x00000000, 0x3EF7FFEE, +/**/ 0xC0184CAE, 0x3CF1FFEB, +/**/ 0xC044A790, 0xBEF9FFD5, +/**/ 0xE0000000, 0x3EF9FFEA, +/**/ 0xC68EECCD, 0x3CF6E28E, +/**/ 0x0055BF6A, 0xBEFBFFCF, +/**/ 0x80000000, 0x3EFBFFE7, +/**/ 0xD189DAA2, 0x3CFC952F, +/**/ 0xC069773A, 0xBEFDFFC7, +/**/ 0xE0000000, 0x3EFDFFE3, +/**/ 0x480513F6, 0x3D0193E7, +/**/ 0x007FFF00, 0xBEFFFFC0, +/**/ 0x00000000, 0x3EFFFFE0, +/**/ 0x55888833, 0x3D055535, +/**/ 0xE04CC35D, 0xBF00FFDB, +/**/ 0xF0000000, 0x3F00FFED, +/**/ 0xE2CFFE66, 0x3D099681, +/**/ 0x805B1F33, 0xBF01FFD7, +/**/ 0xC0000000, 0x3F01FFEB, +/**/ 0xBE5C42ED, 0x3D0E5FCC, +/**/ 0xE06B2B01, 0xBF02FFD2, +/**/ 0x70000000, 0x3F02FFE9, +/**/ 0xD9D71DD1, 0x3D11DC8A, +/**/ 0x007CFEC8, 0xBF03FFCE, +/**/ 0x00000000, 0x3F03FFE7, +/**/ 0x45A374B3, 0x3D14D52E, +/**/ 0xE090B284, 0xBF04FFC8, +/**/ 0x70000000, 0x3F04FFE4, +/**/ 0x8553B4C7, 0x3D181DD0, +/**/ 0x80A65E36, 0xBF05FFC3, +/**/ 0xC0000000, 0x3F05FFE1, +/**/ 0x7A287BBE, 0x3D1BBA71, +/**/ 0xE0BE19DD, 0xBF06FFBD, +/**/ 0xF0000000, 0x3F06FFDE, +/**/ 0x03E27702, 0x3D1FAF11, +/**/ 0x00D7FD78, 0xBF07FFB8, +/**/ 0x00000000, 0x3F07FFDC, +/**/ 0x80613240, 0x3D21FFD7, +/**/ 0xE0F42105, 0xBF08FFB1, +/**/ 0xF0000000, 0x3F08FFD8, +/**/ 0xA6C489B3, 0x3D245825, +/**/ 0x81129C84, 0xBF09FFAB, +/**/ 0xC0000000, 0x3F09FFD5, +/**/ 0xE2BBB26F, 0x3D26E272, +/**/ 0xE13387F2, 0xBF0AFFA4, +/**/ 0x70000000, 0x3F0AFFD2, +/**/ 0x21272669, 0x3D29A0BF, +/**/ 0x0156FB50, 0xBF0BFF9E, +/**/ 0x00000000, 0x3F0BFFCF, +/**/ 0x4E276957, 0x3D2C950A, +/**/ 0xE17D0E9B, 0xBF0CFF96, +/**/ 0x70000000, 0x3F0CFFCB, +/**/ 0x551D090E, 0x3D2FC154, +/**/ 0x81A5D9D2, 0xBF0DFF8F, +/**/ 0xC0000000, 0x3F0DFFC7, +/**/ 0x90544EF1, 0x3D3193CE, +/**/ 0xE1D174F4, 0xBF0EFF87, +/**/ 0xF0000000, 0x3F0EFFC3, +/**/ 0x4D556583, 0x3D3364F2, +/**/ 0x01FFF800, 0xBF0FFF80, +/**/ 0x00000000, 0x3F0FFFC0, +/**/ 0x56221F78, 0x3D355515, +/**/ 0xF118BD7A, 0xBF107FBB, +/**/ 0xF8000000, 0x3F107FDD, +/**/ 0x9EEAD9D8, 0x3D376537, +/**/ 0xC1330AE7, 0xBF10FFB7, +/**/ 0xE0000000, 0x3F10FFDB, +/**/ 0x1B7FF7AE, 0x3D399659, +/**/ 0x714EF047, 0xBF117FB3, +/**/ 0xB8000000, 0x3F117FD9, +/**/ 0xBF51E233, 0x3D3BE979, +/**/ 0x016C7998, 0xBF11FFAF, +/**/ 0x80000000, 0x3F11FFD7, +/**/ 0x7D7108FF, 0x3D3E5F99, +/**/ 0x718BB2DA, 0xBF127FAA, +/**/ 0x39000000, 0x3F127FD5, +/**/ 0xB7721DC6, 0xBD3F0647, +/**/ 0xC1ACA80C, 0xBF12FFA5, +/**/ 0xE1000000, 0x3F12FFD2, +/**/ 0xED071532, 0xBD3C4729, +/**/ 0xF1CF652D, 0xBF137FA0, +/**/ 0x79000000, 0x3F137FD0, +/**/ 0x315D596D, 0xBD39620D, +/**/ 0x01F3F63C, 0xBF13FF9C, +/**/ 0x01000000, 0x3F13FFCE, +/**/ 0x92E45F81, 0xBD3655F1, +/**/ 0xF21A6739, 0xBF147F96, +/**/ 0x79000000, 0x3F147FCB, +/**/ 0x206B9526, 0xBD3321D7, +/**/ 0xC242C421, 0xBF14FF91, +/**/ 0xE1000000, 0x3F14FFC8, +/**/ 0xD244C12A, 0xBD2F897B, +/**/ 0x726D18F6, 0xBF157F8C, +/**/ 0x39000000, 0x3F157FC6, +/**/ 0xF93040AE, 0xBD287B4B, +/**/ 0x029971B4, 0xBF15FF87, +/**/ 0x81000000, 0x3F15FFC3, +/**/ 0xD578562C, 0xBD21171E, +/**/ 0x72C7DA5C, 0xBF167F81, +/**/ 0xB9000000, 0x3F167FC0, +/**/ 0x0F773DB4, 0xBD12B5E9, +/**/ 0xC2F85EEC, 0xBF16FF7B, +/**/ 0xE1000000, 0x3F16FFBD, +/**/ 0x158A76C2, 0xBCE44CD3, +/**/ 0xF32B0B63, 0xBF177F75, +/**/ 0xF9000000, 0x3F177FBA, +/**/ 0x2E48511B, 0x3D0CB55C, +/**/ 0x035FEBC0, 0xBF17FF70, +/**/ 0x01000000, 0x3F17FFB8, +/**/ 0x184C534F, 0x3D1FFAF0, +/**/ 0xF3970C03, 0xBF187F69, +/**/ 0xF9000000, 0x3F187FB4, +/**/ 0xACC53FBE, 0x3D292D95, +/**/ 0xC3D07829, 0xBF18FF63, +/**/ 0xE1000000, 0x3F18FFB1, +/**/ 0xE48887C8, 0x3D315FD7, +/**/ 0x740C3C32, 0xBF197F5D, +/**/ 0xB9000000, 0x3F197FAE, +/**/ 0x1DF5B242, 0x3D365AE3, +/**/ 0x044A641C, 0xBF19FF57, +/**/ 0x81000000, 0x3F19FFAB, +/**/ 0x6FBB0E5F, 0x3D3B88EC, +/**/ 0x748AFBE7, 0xBF1A7F50, +/**/ 0x3A000000, 0x3F1A7FA8, +/**/ 0x39766B40, 0xBD3F150C, +/**/ 0xC4CE0F91, 0xBF1AFF49, +/**/ 0xE2000000, 0x3F1AFFA4, +/**/ 0xF14DB839, 0xBD397E06, +/**/ 0xF513AB19, 0xBF1B7F42, +/**/ 0x7A000000, 0x3F1B7FA1, +/**/ 0xCBD9CC3D, 0xBD33B103, +/**/ 0x055BDA7D, 0xBF1BFF3C, +/**/ 0x02000000, 0x3F1BFF9E, +/**/ 0xBB1321B5, 0xBD2B5A05, +/**/ 0xF5A6A9BD, 0xBF1C7F34, +/**/ 0x7A000000, 0x3F1C7F9A, +/**/ 0xECAF9551, 0xBD1DC410, +/**/ 0xC5F424D6, 0xBF1CFF2D, +/**/ 0xE2000000, 0x3F1CFF96, +/**/ 0x3DF3CD68, 0xBCEF80FF, +/**/ 0x764457C8, 0xBF1D7F26, +/**/ 0x3A000000, 0x3F1D7F93, +/**/ 0x4271E737, 0x3D16CBC7, +/**/ 0x06974E91, 0xBF1DFF1F, +/**/ 0x82000000, 0x3F1DFF8F, +/**/ 0x1D134848, 0x3D2939D2, +/**/ 0x76ED1530, 0xBF1E7F17, +/**/ 0xBA000000, 0x3F1E7F8B, +/**/ 0xA9892C73, 0x3D33C2DD, +/**/ 0xC745B7A4, 0xBF1EFF0F, +/**/ 0xE2000000, 0x3F1EFF87, +/**/ 0x8AEC69D5, 0x3D3B25CF, +/**/ 0xF7A141EA, 0xBF1F7F07, +/**/ 0xFB000000, 0x3F1F7F83, +/**/ 0x645B412A, 0xBD3D3941, +/**/ 0x07FFC002, 0xBF1FFF00, +/**/ 0x03000000, 0x3F1FFF80, +/**/ 0x3BBC6662, 0xBD355955, +/**/ 0xFC309EF5, 0xBF203F7B, +/**/ 0xFD800000, 0x3F203FBD, +/**/ 0x260B17B3, 0xBD2A72D8, +/**/ 0xE462E3D0, 0xBF207F77, +/**/ 0xF1800000, 0x3F207FBB, +/**/ 0x0994AE68, 0xBD136218, +/**/ 0xBC96B492, 0xBF20BF73, +/**/ 0xDD800000, 0x3F20BFB9, +/**/ 0xECB2641F, 0x3D0E52E6, +/**/ 0x84CC1739, 0xBF20FF6F, +/**/ 0xC1800000, 0x3F20FFB7, +/**/ 0xE7FCF60B, 0x3D296078, +/**/ 0x3D0311C6, 0xBF213F6B, +/**/ 0x9D800000, 0x3F213FB5, +/**/ 0xA7850AFF, 0x3D35DA18, +/**/ 0xE53BAA36, 0xBF217F66, +/**/ 0x71800000, 0x3F217FB3, +/**/ 0x5E7BB444, 0x3D3F48F1, +/**/ 0x7D75E68A, 0xBF21BF62, +/**/ 0x3E000000, 0x3F21BFB1, +/**/ 0x812BC469, 0xBD370239, +/**/ 0x05B1CCC0, 0xBF21FF5E, +/**/ 0x02000000, 0x3F21FFAF, +/**/ 0x23BF1A4D, 0xBD2A0CD0, +/**/ 0x7DEF62D8, 0xBF223F59, +/**/ 0xBE000000, 0x3F223FAC, +/**/ 0x736E3623, 0xBD0614D3, +/**/ 0xE62EAED0, 0xBF227F54, +/**/ 0x72000000, 0x3F227FAA, +/**/ 0x37EDEDB0, 0x3D1F28BD, +/**/ 0x3E6FB6A9, 0xBF22BF50, +/**/ 0x1E000000, 0x3F22BFA8, +/**/ 0x07CE33C8, 0x3D32A0F5, +/**/ 0x86B28060, 0xBF22FF4B, +/**/ 0xC2000000, 0x3F22FFA5, +/**/ 0xA31C6A8D, 0x3D3DC2B6, +/**/ 0xBEF711F6, 0xBF233F46, +/**/ 0x5E800000, 0x3F233FA3, +/**/ 0xFC67C9FB, 0xBD36CF8B, +/**/ 0xE73D7169, 0xBF237F41, +/**/ 0xF2800000, 0x3F237FA0, +/**/ 0xE6D88A89, 0xBD2629A5, +/**/ 0xFF85A4B8, 0xBF23BF3C, +/**/ 0x7E800000, 0x3F23BF9E, +/**/ 0x202574EC, 0x3CEE7C34, +/**/ 0x07CFB1E3, 0xBF23FF38, +/**/ 0x02800000, 0x3F23FF9C, +/**/ 0x46E594C1, 0x3D2A9723, +/**/ 0x001B9EE8, 0xBF243F33, +/**/ 0x7E800000, 0x3F243F99, +/**/ 0xF61AE74C, 0x3D39F33C, +/**/ 0xE86971C7, 0xBF247F2D, +/**/ 0xF3000000, 0x3F247F96, +/**/ 0x85341E31, 0xBD39141C, +/**/ 0xC0B9307F, 0xBF24BF28, +/**/ 0x5F000000, 0x3F24BF94, +/**/ 0xDA0FAF09, 0xBD2792F5, +/**/ 0x890AE10E, 0xBF24FF23, +/**/ 0xC3000000, 0x3F24FF91, +/**/ 0xFB239430, 0x3CFD4219, +/**/ 0x415E8974, 0xBF253F1E, +/**/ 0x1F000000, 0x3F253F8F, +/**/ 0x0359434A, 0x3D2F8B72, +/**/ 0xE9B42FAF, 0xBF257F18, +/**/ 0x73000000, 0x3F257F8C, +/**/ 0x1939FEDF, 0x3D3E0C4B, +/**/ 0x820BD9BF, 0xBF25BF13, +/**/ 0xBF800000, 0x3F25BF89, +/**/ 0x39B301E2, 0xBD335728, +/**/ 0x0A658DA3, 0xBF25FF0E, +/**/ 0x03800000, 0x3F25FF87, +/**/ 0x5E1E8D4F, 0xBD118E84, +/**/ 0x82C15159, 0xBF263F08, +/**/ 0x3F800000, 0x3F263F84, +/**/ 0xBDDDD045, 0x3D25CFC0, +/**/ 0xEB1F2AE1, 0xBF267F02, +/**/ 0x73800000, 0x3F267F81, +/**/ 0x08837E99, 0x3D3A8C5C, +/**/ 0x437F203A, 0xBF26BEFD, +/**/ 0xA0000000, 0x3F26BF7E, +/**/ 0x3C56F12D, 0xBD35752E, +/**/ 0x8BE13762, 0xBF26FEF7, +/**/ 0xC4000000, 0x3F26FF7B, +/**/ 0x46359E28, 0xBD146EFA, +/**/ 0xC4457659, 0xBF273EF1, +/**/ 0xE0000000, 0x3F273F78, +/**/ 0xCD265865, 0x3D273355, +/**/ 0xECABE31C, 0xBF277EEB, +/**/ 0xF4000000, 0x3F277F75, +/**/ 0x095DEBF8, 0x3D3CAC0E, +/**/ 0x051483AC, 0xBF27BEE6, +/**/ 0x00800000, 0x3F27BF73, +/**/ 0x4C39F4DB, 0xBD31E395, +/**/ 0x0D7F5E08, 0xBF27FEE0, +/**/ 0x04800000, 0x3F27FF70, +/**/ 0xA1314B81, 0xBCB43F3D, +/**/ 0x05EC782D, 0xBF283EDA, +/**/ 0x00800000, 0x3F283F6D, +/**/ 0x115B8D70, 0x3D321B10, +/**/ 0xEE5BD81B, 0xBF287ED3, +/**/ 0xF5000000, 0x3F287F69, +/**/ 0x83704FE1, 0xBD3B54A7, +/**/ 0xC6CD83D1, 0xBF28BECD, +/**/ 0xE1000000, 0x3F28BF66, +/**/ 0x41229C91, 0xBD20C4CC, +/**/ 0x8F41814D, 0xBF28FEC7, +/**/ 0xC5000000, 0x3F28FF63, +/**/ 0x2A183F17, 0x3D25E5A8, +/**/ 0x47B7D68F, 0xBF293EC1, +/**/ 0xA1000000, 0x3F293F60, +/**/ 0xF81B997D, 0x3D3EAC06, +/**/ 0xF0308995, 0xBF297EBA, +/**/ 0x75800000, 0x3F297F5D, +/**/ 0x3A1E5BAD, 0xBD2A6B9B, +/**/ 0x88ABA05E, 0xBF29BEB4, +/**/ 0x41800000, 0x3F29BF5A, +/**/ 0xBDFE3C77, 0x3D1D3958, +/**/ 0x112920E9, 0xBF29FEAE, +/**/ 0x05800000, 0x3F29FF57, +/**/ 0x375BA904, 0x3D3C3972, +/**/ 0x89A91135, 0xBF2A3EA7, +/**/ 0xC2000000, 0x3F2A3F53, +/**/ 0x588DE85B, 0xBD2CE6F3, +/**/ 0xF22B7740, 0xBF2A7EA0, +/**/ 0x76000000, 0x3F2A7F50, +/**/ 0x75AEDBFD, 0x3D1D2249, +/**/ 0x4AB05909, 0xBF2ABE9A, +/**/ 0x22000000, 0x3F2ABF4D, +/**/ 0x2CE7BDAC, 0x3D3D6E96, +/**/ 0x9337BC90, 0xBF2AFE93, +/**/ 0xC6800000, 0x3F2AFF49, +/**/ 0xCB7D724C, 0xBD2800DC, +/**/ 0xCBC1A7D1, 0xBF2B3E8C, +/**/ 0x62800000, 0x3F2B3F46, +/**/ 0xFA591B29, 0x3D25F908, +/**/ 0xF44E20CE, 0xBF2B7E85, +/**/ 0xF7000000, 0x3F2B7F42, +/**/ 0x53021ED8, 0xBD3D9991, +/**/ 0x0CDD2D83, 0xBF2BBE7F, +/**/ 0x83000000, 0x3F2BBF3F, +/**/ 0xFD596AD6, 0xBD1706BF, +/**/ 0x156ED3F0, 0xBF2BFE78, +/**/ 0x07000000, 0x3F2BFF3C, +/**/ 0x4EC45253, 0x3D328528, +/**/ 0x0E031A14, 0xBF2C3E71, +/**/ 0x83800000, 0x3F2C3F38, +/**/ 0x927D8A9E, 0xBD34C408, +/**/ 0xF69A05ED, 0xBF2C7E69, +/**/ 0xF7800000, 0x3F2C7F34, +/**/ 0xCAE2C25F, 0x3D118EF4, +/**/ 0xCF339D7A, 0xBF2CBE62, +/**/ 0x63800000, 0x3F2CBF31, +/**/ 0x73DBBB41, 0x3D3DFD79, +/**/ 0x97CFE6B9, 0xBF2CFE5B, +/**/ 0xC8000000, 0x3F2CFF2D, +/**/ 0xE7FE77E6, 0xBD1FD74F, +/**/ 0x506EE7AA, 0xBF2D3E54, +/**/ 0x24000000, 0x3F2D3F2A, +/**/ 0xBDDB871F, 0x3D328AD4, +/**/ 0xF910A64A, 0xBF2D7E4C, +/**/ 0x78800000, 0x3F2D7F26, +/**/ 0x903DDD81, 0xBD327F8C, +/**/ 0x91B52899, 0xBF2DBE45, +/**/ 0xC4800000, 0x3F2DBF22, +/**/ 0xDF52840A, 0x3D21D80F, +/**/ 0x1A5C7495, 0xBF2DFE3E, +/**/ 0x09000000, 0x3F2DFF1F, +/**/ 0xEED9F651, 0xBD3B316D, +/**/ 0x9306903D, 0xBF2E3E36, +/**/ 0x45000000, 0x3F2E3F1B, +/**/ 0x76DB3C6B, 0x3CF2911A, +/**/ 0xFBB3818F, 0xBF2E7E2E, +/**/ 0x79000000, 0x3F2E7F17, +/**/ 0x85559113, 0x3D3DFC86, +/**/ 0x54634E89, 0xBF2EBE27, +/**/ 0xA5800000, 0x3F2EBF13, +/**/ 0x0AB3DBE7, 0xBD12D83E, +/**/ 0x9D15FD2B, 0xBF2EFE1F, +/**/ 0xC9800000, 0x3F2EFF0F, +/**/ 0x617B99F1, 0x3D39124F, +/**/ 0xD5CB9373, 0xBF2F3E17, +/**/ 0xE6000000, 0x3F2F3F0B, +/**/ 0xF8F64DA1, 0xBD2152B9, +/**/ 0xFE841760, 0xBF2F7E0F, +/**/ 0xFA000000, 0x3F2F7F07, +/**/ 0x34C4735B, 0x3D3617EB, +/**/ 0x173F8EEF, 0xBF2FBE08, +/**/ 0x06800000, 0x3F2FBF04, +/**/ 0x739FA712, 0xBD2551B0, +/**/ 0x1FFE0020, 0xBF2FFE00, +/**/ 0x0A800000, 0x3F2FFF00, +/**/ 0x885DE027, 0x3D351558, +/**/ 0x0C5FB879, 0xBF301EFC, +/**/ 0x03800000, 0x3F301F7E, +/**/ 0x68F8FC50, 0xBD255905, +/**/ 0x00C1F3B0, 0xBF303EF8, +/**/ 0xFD800000, 0x3F303F7B, +/**/ 0xDF771CF4, 0x3D361295, +/**/ 0xED25B4B7, 0xBF305EF3, +/**/ 0xF3C00000, 0x3F305F79, +/**/ 0xD8A255DB, 0xBD2158BB, +/**/ 0xD18AFE8B, 0xBF307EEF, +/**/ 0xE5C00000, 0x3F307F77, +/**/ 0xB740E625, 0x3D3917A1, +/**/ 0xADF1D42C, 0xBF309EEB, +/**/ 0xD4000000, 0x3F309F75, +/**/ 0x9C716D59, 0xBD1281AD, +/**/ 0x825A3899, 0xBF30BEE7, +/**/ 0xBE000000, 0x3F30BF73, +/**/ 0x86ED7DDC, 0x3D3E2C7A, +/**/ 0x4EC42ED1, 0xBF30DEE3, +/**/ 0xA4400000, 0x3F30DF71, +/**/ 0xF54F7E28, 0x3CF7F534, +/**/ 0x132FB9D5, 0xBF30FEDF, +/**/ 0x86800000, 0x3F30FF6F, +/**/ 0x404F4E01, 0xBD3AA6E1, +/**/ 0xCF9CDCA2, 0xBF311EDA, +/**/ 0x64800000, 0x3F311F6D, +/**/ 0x4A6EC981, 0x3D2375B9, +/**/ 0x840B9A38, 0xBF313ED6, +/**/ 0x3EC00000, 0x3F313F6B, +/**/ 0x33401DD0, 0xBD315A73, +/**/ 0x307BF596, 0xBF315ED2, +/**/ 0x14C00000, 0x3F315F69, +/**/ 0x02C11605, 0x3D341A2F, +/**/ 0xD4EDF1BC, 0xBF317ECD, +/**/ 0xE7000000, 0x3F317F66, +/**/ 0xB2B7E8C5, 0xBD1798F3, +/**/ 0x716191A8, 0xBF319EC9, +/**/ 0xB5400000, 0x3F319F64, +/**/ 0x35D62ED5, 0xBD3F5AB7, +/**/ 0x05D6D85A, 0xBF31BEC5, +/**/ 0x7F400000, 0x3F31BF62, +/**/ 0xCA7EC7CD, 0x3D1EF6FF, +/**/ 0x924DC8D2, 0xBF31DEC0, +/**/ 0x45800000, 0x3F31DF60, +/**/ 0xA8550396, 0xBD309BD7, +/**/ 0x16C6660D, 0xBF31FEBC, +/**/ 0x07800000, 0x3F31FF5E, +/**/ 0xC3E31F70, 0x3D379981, +/**/ 0x9340B30B, 0xBF321EB7, +/**/ 0xC5C00000, 0x3F321F5B, +/**/ 0x5FE92B94, 0x3CD7B300, +/**/ 0x07BCB2CC, 0xBF323EB3, +/**/ 0x80000000, 0x3F323F59, +/**/ 0x25A7CF34, 0xBD364AF9, +/**/ 0x743A684F, 0xBF325EAE, +/**/ 0x36000000, 0x3F325F57, +/**/ 0x17E48399, 0x3D339D32, +/**/ 0xD8B9D692, 0xBF327EA9, +/**/ 0xE8400000, 0x3F327F54, +/**/ 0xCC387BD1, 0xBCFE7B27, +/**/ 0x353B0095, 0xBF329EA5, +/**/ 0x96800000, 0x3F329F52, +/**/ 0x1AE7FA80, 0xBD36D8A7, +/**/ 0x89BDE957, 0xBF32BEA0, +/**/ 0x40800000, 0x3F32BF50, +/**/ 0x05CF3DC3, 0x3D34CB54, +/**/ 0xD64293D7, 0xBF32DE9B, +/**/ 0xE6C00000, 0x3F32DF4D, +/**/ 0xD5A4F691, 0x3CF053EA, +/**/ 0x1AC90315, 0xBF32FE97, +/**/ 0x89000000, 0x3F32FF4B, +/**/ 0x5CAE7B16, 0xBD3229E7, +/**/ 0x57513A0F, 0xBF331E92, +/**/ 0x27000000, 0x3F331F49, +/**/ 0xAEED4509, 0x3D3B3EE1, +/**/ 0x8BDB3BC4, 0xBF333E8D, +/**/ 0xC1400000, 0x3F333F46, +/**/ 0x2E0C2605, 0x3D228133, +/**/ 0xB8670B34, 0xBF335E88, +/**/ 0x57800000, 0x3F335F44, +/**/ 0xBBD6E280, 0xBD20477F, +/**/ 0xDCF4AB5D, 0xBF337E83, +/**/ 0xE9C00000, 0x3F337F41, +/**/ 0xE9CE8AFC, 0xBD38ED2A, +/**/ 0xF9841F3F, 0xBF339E7E, +/**/ 0x77C00000, 0x3F339F3F, +/**/ 0x39159F9B, 0x3D36E558, +/**/ 0x0E1569D9, 0xBF33BE7A, +/**/ 0x02000000, 0x3F33BF3D, +/**/ 0x40681634, 0x3D1D5325, +/**/ 0x1AA88E2A, 0xBF33DE75, +/**/ 0x88400000, 0x3F33DF3A, +/**/ 0x7F2112CE, 0xBD1E775F, +/**/ 0x1F3D8F31, 0xBF33FE70, +/**/ 0x0A800000, 0x3F33FF38, +/**/ 0x91F80D1B, 0xBD35F18B, +/**/ 0x1BD46FED, 0xBF341E6B, +/**/ 0x88800000, 0x3F341F35, +/**/ 0xFDC3FC2F, 0x3D3C5AAD, +/**/ 0x106D335D, 0xBF343E66, +/**/ 0x02C00000, 0x3F343F33, +/**/ 0x268A89F1, 0x3D2E8FA9, +/**/ 0xFD07DC80, 0xBF345E60, +/**/ 0x79000000, 0x3F345F30, +/**/ 0x902AC9EE, 0x3D06B73F, +/**/ 0xE1A46E55, 0xBF347E5B, +/**/ 0xEB400000, 0x3F347F2D, +/**/ 0x45C43959, 0xBD21EE30, +/**/ 0xBE42EBDC, 0xBF349E56, +/**/ 0x59800000, 0x3F349F2B, +/**/ 0xE8B753E8, 0xBD34212B, +/**/ 0x92E35813, 0xBF34BE51, +/**/ 0xC3C00000, 0x3F34BF28, +/**/ 0x9D2064DB, 0xBD3EA653, +/**/ 0x5F85B5F9, 0xBF34DE4C, +/**/ 0x29C00000, 0x3F34DF26, +/**/ 0x81DCB6FB, 0x3D377A70, +/**/ 0x242A088D, 0xBF34FE47, +/**/ 0x8C000000, 0x3F34FF23, +/**/ 0x6BB44A6D, 0x3D2C8440, +/**/ 0xE0D052CF, 0xBF351E41, +/**/ 0xEA400000, 0x3F351F20, +/**/ 0x0048AAF8, 0x3D16C6ED, +/**/ 0x957897BD, 0xBF353E3C, +/**/ 0x44800000, 0x3F353F1E, +/**/ 0xF506A07E, 0xBD01ADF4, +/**/ 0x4222DA57, 0xBF355E37, +/**/ 0x9AC00000, 0x3F355F1B, +/**/ 0x4B88A655, 0xBD22E69B, +/**/ 0xE6CF1D9B, 0xBF357E31, +/**/ 0xED000000, 0x3F357F18, +/**/ 0x153DAEB0, 0xBD3005F2, +/**/ 0x837D6488, 0xBF359E2C, +/**/ 0x3B400000, 0x3F359F16, +/**/ 0x2D5222B4, 0xBD35ECAC, +/**/ 0x182DB21E, 0xBF35BE27, +/**/ 0x85800000, 0x3F35BF13, +/**/ 0x2EA6CB14, 0xBD3B267C, +/**/ 0xA4E0095B, 0xBF35DE21, +/**/ 0xCBC00000, 0x3F35DF10, +/**/ 0x5A40A340, 0xBD3FB262, +/**/ 0x29946D3F, 0xBF35FE1C, +/**/ 0x0DC00000, 0x3F35FF0E, +/**/ 0x0E7B79ED, 0x3D3C70A1, +/**/ 0xA64AE0C7, 0xBF361E16, +/**/ 0x4C000000, 0x3F361F0B, +/**/ 0xC9C8D263, 0x3D39438D, +/**/ 0x1B0366F4, 0xBF363E11, +/**/ 0x86400000, 0x3F363F08, +/**/ 0x9582CD0C, 0x3D36C763, +/**/ 0x87BE02C5, 0xBF365E0B, +/**/ 0xBC800000, 0x3F365F05, +/**/ 0x2F24F1F9, 0x3D34FD22, +/**/ 0xEC7AB737, 0xBF367E05, +/**/ 0xEEC00000, 0x3F367F02, +/**/ 0x53CAEA94, 0x3D33E5C9, +/**/ 0x4939874A, 0xBF369E00, +/**/ 0x1D000000, 0x3F369F00, +/**/ 0xC03081D0, 0x3D338258, +/**/ 0x9DFA75FE, 0xBF36BDFA, +/**/ 0x47400000, 0x3F36BEFD, +/**/ 0x30B1A458, 0x3D33D3D0, +/**/ 0xEABD8651, 0xBF36DDF4, +/**/ 0x6D800000, 0x3F36DEFA, +/**/ 0x614A60C1, 0x3D34DB2F, +/**/ 0x2F82BB41, 0xBF36FDEF, +/**/ 0x8FC00000, 0x3F36FEF7, +/**/ 0x0D96E7B8, 0x3D369976, +/**/ 0x6C4A17CF, 0xBF371DE9, +/**/ 0xAE000000, 0x3F371EF4, +/**/ 0xF0D38C30, 0x3D390FA3, +/**/ 0xA1139EF8, 0xBF373DE3, +/**/ 0xC8400000, 0x3F373EF1, +/**/ 0xC5DCC397, 0x3D3C3EB8, +/**/ 0xCDDF53BC, 0xBF375DDD, +/**/ 0xDEC00000, 0x3F375EEE, +/**/ 0xB8D0D9FD, 0xBD3FD84B, +/**/ 0xF2AD3919, 0xBF377DD7, +/**/ 0xF1000000, 0x3F377EEB, +/**/ 0xD11891A0, 0xBD3B3469, +/**/ 0x0F7D520F, 0xBF379DD2, +/**/ 0xFF400000, 0x3F379EE8, +/**/ 0xC93D855B, 0xBD35D4A1, +/**/ 0x244FA19D, 0xBF37BDCC, +/**/ 0x09800000, 0x3F37BEE6, +/**/ 0xCFC56806, 0xBD2F6FE7, +/**/ 0x31242AC1, 0xBF37DDC6, +/**/ 0x0FC00000, 0x3F37DEE3, +/**/ 0xE815F202, 0xBD21BAC0, +/**/ 0x35FAF079, 0xBF37FDC0, +/**/ 0x12000000, 0x3F37FEE0, +/**/ 0x5190C28B, 0xBCF43E7B, +/**/ 0x32D3F5C6, 0xBF381DBA, +/**/ 0x10400000, 0x3F381EDD, +/**/ 0x34C1F9E9, 0x3D1C55D8, +/**/ 0x27AF3DA6, 0xBF383DB4, +/**/ 0x0A800000, 0x3F383EDA, +/**/ 0x8AAF36D4, 0x3D302FB8, +/**/ 0x148CCB18, 0xBF385DAE, +/**/ 0x00C00000, 0x3F385ED7, +/**/ 0x7AE0D0F8, 0x3D3A0BDF, +/**/ 0xF96CA11B, 0xBF387DA7, +/**/ 0xF3400000, 0x3F387ED3, +/**/ 0x6B1CDAAF, 0xBD3B5515, +/**/ 0xD64EC2AD, 0xBF389DA1, +/**/ 0xE1800000, 0x3F389ED0, +/**/ 0xE1179E5E, 0xBD2FE44C, +/**/ 0xAB3332CD, 0xBF38BD9B, +/**/ 0xCBC00000, 0x3F38BECD, +/**/ 0xF86F56EC, 0xBD0E529E, +/**/ 0x7819F47A, 0xBF38DD95, +/**/ 0xB2000000, 0x3F38DECA, +/**/ 0xFEB631AB, 0x3D2246C3, +/**/ 0x3D030AB4, 0xBF38FD8F, +/**/ 0x94400000, 0x3F38FEC7, +/**/ 0xE04DA791, 0x3D36D7FA, +/**/ 0xF9EE7878, 0xBF391D88, +/**/ 0x72C00000, 0x3F391EC4, +/**/ 0x86F7ADBB, 0xBD3AAB89, +/**/ 0xAEDC40C7, 0xBF393D82, +/**/ 0x4D000000, 0x3F393EC1, +/**/ 0x032C6155, 0xBD26CC57, +/**/ 0x5BCC669D, 0xBF395D7C, +/**/ 0x23400000, 0x3F395EBE, +/**/ 0x93C3EB3D, 0x3D12A452, +/**/ 0x00BEECFB, 0xBF397D76, +/**/ 0xF5800000, 0x3F397EBA, +/**/ 0xA0BCD695, 0x3D358336, +/**/ 0x9DB3D6E0, 0xBF399D6F, +/**/ 0xC4000000, 0x3F399EB7, +/**/ 0xDA737570, 0xBD38D6C5, +/**/ 0x32AB2749, 0xBF39BD69, +/**/ 0x8E400000, 0x3F39BEB4, +/**/ 0x65026C7D, 0xBD198F84, +/**/ 0xBFA4E136, 0xBF39DD62, +/**/ 0x54800000, 0x3F39DEB1, +/**/ 0x2EA9B41A, 0x3D29B9C9, +/**/ 0x44A107A5, 0xBF39FD5C, +/**/ 0x17000000, 0x3F39FEAE, +/**/ 0x16137ACF, 0xBD3F1375, +/**/ 0xC19F9D96, 0xBF3A1D55, +/**/ 0xD5400000, 0x3F3A1EAA, +/**/ 0xDE73AFA0, 0xBD2467DC, +/**/ 0x36A0A607, 0xBF3A3D4F, +/**/ 0x8F800000, 0x3F3A3EA7, +/**/ 0x7B8357C6, 0x3D26F8F0, +/**/ 0xA3A423F7, 0xBF3A5D48, +/**/ 0x46000000, 0x3F3A5EA4, +/**/ 0x5DA0DFB7, 0xBD3E0141, +/**/ 0x08AA1A64, 0xBF3A7D42, +/**/ 0xF8400000, 0x3F3A7EA0, +/**/ 0x41050D29, 0xBD1AB06E, +/**/ 0x65B28C4E, 0xBF3A9D3B, +/**/ 0xA6800000, 0x3F3A9E9D, +/**/ 0x56A0E005, 0x3D317CE9, +/**/ 0xBABD7CB3, 0xBF3ABD34, +/**/ 0x51000000, 0x3F3ABE9A, +/**/ 0xF899EF39, 0xBD358532, +/**/ 0x07CAEE92, 0xBF3ADD2E, +/**/ 0xF7400000, 0x3F3ADE96, +/**/ 0xC83BF5C2, 0x3D113A3C, +/**/ 0x4CDAE4EA, 0xBF3AFD27, +/**/ 0x99800000, 0x3F3AFE93, +/**/ 0x863C7C8E, 0x3D3EF92F, +/**/ 0x89ED62B9, 0xBF3B1D20, +/**/ 0x38000000, 0x3F3B1E90, +/**/ 0x3341CC3C, 0xBD161149, +/**/ 0xBF026AFE, 0xBF3B3D19, +/**/ 0xD2400000, 0x3F3B3E8C, +/**/ 0x67C955DF, 0x3D36D709, +/**/ 0xEC1A00B8, 0xBF3B5D12, +/**/ 0x68C00000, 0x3F3B5E89, +/**/ 0x5AE9B17A, 0xBD27E77B, +/**/ 0x113426E6, 0xBF3B7D0C, +/**/ 0xFB000000, 0x3F3B7E85, +/**/ 0x219679DE, 0x3D321C58, +/**/ 0x2E50E086, 0xBF3B9D05, +/**/ 0x89800000, 0x3F3B9E82, +/**/ 0xFAA62113, 0xBD2DEF6A, +/**/ 0x43703097, 0xBF3BBCFE, +/**/ 0x13C00000, 0x3F3BBE7F, +/**/ 0x23305306, 0x3D30D119, +/**/ 0x50921A17, 0xBF3BDCF7, +/**/ 0x9A400000, 0x3F3BDE7B, +/**/ 0x9FBACE27, 0xBD2D1078, +/**/ 0x55B6A006, 0xBF3BFCF0, +/**/ 0x1C800000, 0x3F3BFE78, +/**/ 0xD625DF1E, 0x3D32FD49, +/**/ 0x52DDC563, 0xBF3C1CE9, +/**/ 0x9B000000, 0x3F3C1E74, +/**/ 0x7D07255B, 0xBD253AA9, +/**/ 0x48078D2B, 0xBF3C3CE2, +/**/ 0x15400000, 0x3F3C3E71, +/**/ 0x9E08B538, 0x3D38A8E7, +/**/ 0x3533FA5D, 0xBF3C5CDB, +/**/ 0x8BC00000, 0x3F3C5E6D, +/**/ 0x45956AFC, 0xBD09780B, +/**/ 0x1A630FF9, 0xBF3C7CD4, +/**/ 0xFE400000, 0x3F3C7E69, +/**/ 0x2792F44E, 0xBD3E2410, +/**/ 0xF794D0FC, 0xBF3C9CCC, +/**/ 0x6C800000, 0x3F3C9E66, +/**/ 0x30AB4456, 0x3D1F2AEC, +/**/ 0xCCC94066, 0xBF3CBCC5, +/**/ 0xD7000000, 0x3F3CBE62, +/**/ 0x231641D5, 0xBD3161A0, +/**/ 0x9A006135, 0xBF3CDCBE, +/**/ 0x3D400000, 0x3F3CDE5F, +/**/ 0xF4AD1934, 0x3D3657DD, +/**/ 0x5F3A3668, 0xBF3CFCB7, +/**/ 0x9FC00000, 0x3F3CFE5B, +/**/ 0x2E7AC798, 0xBCF07CB0, +/**/ 0x1C76C2FD, 0xBF3D1CB0, +/**/ 0xFE400000, 0x3F3D1E57, +/**/ 0x6090F643, 0xBD377F9B, +/**/ 0xD1B609F3, 0xBF3D3CA8, +/**/ 0x58800000, 0x3F3D3E54, +/**/ 0x849503E6, 0x3D32F16C, +/**/ 0x7EF80E49, 0xBF3D5CA1, +/**/ 0xAF000000, 0x3F3D5E50, +/**/ 0xAF1CA4EA, 0xBCFB3B3A, +/**/ 0x243CD2FE, 0xBF3D7C9A, +/**/ 0x01800000, 0x3F3D7E4D, +/**/ 0x4701415B, 0xBD356DFC, +/**/ 0xC1845B0F, 0xBF3D9C92, +/**/ 0x4FC00000, 0x3F3D9E49, +/**/ 0x582AEA48, 0x3D37C392, +/**/ 0x56CEA97C, 0xBF3DBC8B, +/**/ 0x9A400000, 0x3F3DBE45, +/**/ 0x67DCC15E, 0x3D1787DF, +/**/ 0xE41BC143, 0xBF3DDC83, +/**/ 0xE0C00000, 0x3F3DDE41, +/**/ 0x352F961F, 0xBD262398, +/**/ 0x696BA563, 0xBF3DFC7C, +/**/ 0x23400000, 0x3F3DFE3E, +/**/ 0xDEDD373A, 0xBD3B16B9, +/**/ 0xE6BE58DA, 0xBF3E1C74, +/**/ 0x61800000, 0x3F3E1E3A, +/**/ 0x336BE94B, 0x3D35D42E, +/**/ 0x5C13DEA7, 0xBF3E3C6D, +/**/ 0x9C000000, 0x3F3E3E36, +/**/ 0x08A303A2, 0x3D1EBFAF, +/**/ 0xC96C39C9, 0xBF3E5C65, +/**/ 0xD2800000, 0x3F3E5E32, +/**/ 0x34856362, 0xBD160A06, +/**/ 0x2EC76D3D, 0xBF3E7C5E, +/**/ 0x05000000, 0x3F3E7E2F, +/**/ 0x154CDF1A, 0xBD31C21A, +/**/ 0x8C257C04, 0xBF3E9C56, +/**/ 0x33800000, 0x3F3E9E2B, +/**/ 0x31941F7F, 0xBD3D0DDE, +/**/ 0xE186691B, 0xBF3EBC4E, +/**/ 0x5DC00000, 0x3F3EBE27, +/**/ 0xC26EC60D, 0x3D389B31, +/**/ 0x2EEA3781, 0xBF3EDC47, +/**/ 0x84400000, 0x3F3EDE23, +/**/ 0xD583BEF8, 0x3D2E742A, +/**/ 0x7450EA34, 0xBF3EFC3F, +/**/ 0xA6C00000, 0x3F3EFE1F, +/**/ 0xAC2DA351, 0x3D1B3F31, +/**/ 0xB1BA8433, 0xBF3F1C37, +/**/ 0xC5400000, 0x3F3F1E1B, +/**/ 0x2DC67430, 0xBCE45533, +/**/ 0xE727087C, 0xBF3F3C2F, +/**/ 0xDFC00000, 0x3F3F3E17, +/**/ 0xFF1174AE, 0xBD1C7133, +/**/ 0x14967A0F, 0xBF3F5C28, +/**/ 0xF6400000, 0x3F3F5E13, +/**/ 0x4AE098DC, 0xBD29383C, +/**/ 0x3A08DBE9, 0xBF3F7C20, +/**/ 0x08C00000, 0x3F3F7E10, +/**/ 0x684B0B3B, 0xBD31211D, +/**/ 0x577E3109, 0xBF3F9C18, +/**/ 0x17400000, 0x3F3F9E0C, +/**/ 0x268D7464, 0xBD34AA4B, +/**/ 0x6CF67C6E, 0xBF3FBC10, +/**/ 0x21C00000, 0x3F3FBE08, +/**/ 0xBED03388, 0xBD3736A7, +/**/ 0x7A71C116, 0xBF3FDC08, +/**/ 0x28400000, 0x3F3FDE04, +/**/ 0x900BC4E5, 0xBD38C533, +/**/ 0x7FF00200, 0xBF3FFC00, +/**/ 0x2AC00000, 0x3F3FFE00, +/**/ 0xF9987527, 0xBD3954EE, +/**/ 0x3EB8A115, 0xBF400DFC, +/**/ 0x14A00000, 0x3F400EFE, +/**/ 0x5B2E613B, 0xBD38E4DA, +/**/ 0x397AC249, 0xBF401DF8, +/**/ 0x11E00000, 0x3F401EFC, +/**/ 0x14E5761B, 0xBD3773F6, +/**/ 0x303E661C, 0xBF402DF4, +/**/ 0x0D200000, 0x3F402EFA, +/**/ 0x873570A0, 0xBD350142, +/**/ 0x23038E0C, 0xBF403DF0, +/**/ 0x06600000, 0x3F403EF8, +/**/ 0x12F5DD53, 0xBD318BC0, +/**/ 0x11CA3B9A, 0xBF404DEC, +/**/ 0xFDA00000, 0x3F404EF5, +/**/ 0x32BC307C, 0xBD2A24DE, +/**/ 0xFC927044, 0xBF405DE7, +/**/ 0xF2E00000, 0x3F405EF3, +/**/ 0xF01532DA, 0xBD1E513F, +/**/ 0xE35C2D8A, 0xBF406DE3, +/**/ 0xE6200000, 0x3F406EF1, +/**/ 0xCE27534E, 0xBCF10631, +/**/ 0xC62774EA, 0xBF407DDF, +/**/ 0xD7600000, 0x3F407EEF, +/**/ 0x86CE9380, 0x3D19E95C, +/**/ 0xA4F447E4, 0xBF408DDB, +/**/ 0xC6A00000, 0x3F408EED, +/**/ 0xBA0CD2C3, 0x3D2E19BC, +/**/ 0x7FC2A7F8, 0xBF409DD7, +/**/ 0xB3E00000, 0x3F409EEB, +/**/ 0x31FF7199, 0x3D38A832, +/**/ 0x569296A4, 0xBF40ADD3, +/**/ 0x9F400000, 0x3F40AEE9, +/**/ 0xC2D77791, 0xBD3CB2AD, +/**/ 0x29641567, 0xBF40BDCF, +/**/ 0x88800000, 0x3F40BEE7, +/**/ 0xE5545563, 0xBD3102C1, +/**/ 0xF83725C2, 0xBF40CDCA, +/**/ 0x6FC00000, 0x3F40CEE5, +/**/ 0x66B3E48D, 0xBD111C2A, +/**/ 0xC30BC932, 0xBF40DDC6, +/**/ 0x55000000, 0x3F40DEE3, +/**/ 0x7711FC2A, 0x3D2302EF, +/**/ 0x89E20138, 0xBF40EDC2, +/**/ 0x38400000, 0x3F40EEE1, +/**/ 0xB558238E, 0x3D3857C4, +/**/ 0x4CB9CF52, 0xBF40FDBE, +/**/ 0x19A00000, 0x3F40FEDF, +/**/ 0x1194C2E1, 0xBD37C324, +/**/ 0x0B933501, 0xBF410DBA, +/**/ 0xF8E00000, 0x3F410EDC, +/**/ 0xFBCAF285, 0xBD1B390B, +/**/ 0xC66E33C2, 0xBF411DB5, +/**/ 0xD6200000, 0x3F411EDA, +/**/ 0x0E52C3A4, 0x3D266ECF, +/**/ 0x7D4ACD15, 0xBF412DB1, +/**/ 0xB1600000, 0x3F412ED8, +/**/ 0x1A4AF71D, 0x3D3E4EDB, +/**/ 0x30290279, 0xBF413DAD, +/**/ 0x8AC00000, 0x3F413ED6, +/**/ 0x58C4D599, 0xBD2B0DD1, +/**/ 0xDF08D56E, 0xBF414DA8, +/**/ 0x62000000, 0x3F414ED4, +/**/ 0x2FB4061D, 0x3D1EDC6F, +/**/ 0x89EA4773, 0xBF415DA4, +/**/ 0x37400000, 0x3F415ED2, +/**/ 0x1BA53538, 0x3D3E09E8, +/**/ 0x30CD5A06, 0xBF416DA0, +/**/ 0x0AA00000, 0x3F416ED0, +/**/ 0x4A5B4574, 0xBD251B08, +/**/ 0xD3B20EA8, 0xBF417D9B, +/**/ 0xDBE00000, 0x3F417ECD, +/**/ 0x4241B57B, 0x3D2BE3AD, +/**/ 0x729866D7, 0xBF418D97, +/**/ 0xAB400000, 0x3F418ECB, +/**/ 0xFA22BD16, 0xBD387707, +/**/ 0x0D806412, 0xBF419D93, +/**/ 0x78800000, 0x3F419EC9, +/**/ 0xFFA2FC2F, 0x3D01C6FC, +/**/ 0xA46A07D9, 0xBF41AD8E, +/**/ 0x43C00000, 0x3F41AEC7, +/**/ 0x05F32EE8, 0x3D3E028D, +/**/ 0x375553AB, 0xBF41BD8A, +/**/ 0x0D200000, 0x3F41BEC5, +/**/ 0xC7E46F2B, 0xBD146400, +/**/ 0xC6424907, 0xBF41CD85, +/**/ 0xD4600000, 0x3F41CEC2, +/**/ 0x8DFCE791, 0x3D38E737, +/**/ 0x5130E96B, 0xBF41DD81, +/**/ 0x99C00000, 0x3F41DEC0, +/**/ 0x92F4A6CE, 0xBD1FEF30, +/**/ 0xD8213659, 0xBF41ED7C, +/**/ 0x5D000000, 0x3F41EEBE, +/**/ 0x4AE68315, 0x3D383EF4, +/**/ 0x5B13314D, 0xBF41FD78, +/**/ 0x1E600000, 0x3F41FEBC, +/**/ 0x39A8276A, 0xBD199E1E, +/**/ 0xDA06DBC8, 0xBF420D73, +/**/ 0xDDA00000, 0x3F420EB9, +/**/ 0xE39F6D77, 0x3D3C11BF, +/**/ 0x54FC3749, 0xBF421D6F, +/**/ 0x9B000000, 0x3F421EB7, +/**/ 0xC3A8C440, 0xBCD50D72, +/**/ 0xCBF3454F, 0xBF422D6A, +/**/ 0x56600000, 0x3F422EB5, +/**/ 0x06E59170, 0xBD3B9869, +/**/ 0x3EEC0759, 0xBF423D66, +/**/ 0x0FA00000, 0x3F423EB3, +/**/ 0x86930551, 0x3D248C4B, +/**/ 0xADE67EE6, 0xBF424D61, +/**/ 0xC7000000, 0x3F424EB0, +/**/ 0xB3649FF7, 0xBD2D6F13, +/**/ 0x18E2AD76, 0xBF425D5D, +/**/ 0x7C400000, 0x3F425EAE, +/**/ 0xB496441D, 0x3D396F87, +/**/ 0x7FE09487, 0xBF426D58, +/**/ 0x2FA00000, 0x3F426EAC, +/**/ 0x01961A2F, 0x3D05E2D0, +/**/ 0xE2E03598, 0xBF427D53, +/**/ 0xE1000000, 0x3F427EA9, +/**/ 0x652D1720, 0xBD32D013, +/**/ 0x41E1922A, 0xBF428D4F, +/**/ 0x90400000, 0x3F428EA7, +/**/ 0x15C6A78A, 0x3D38CB3F, +/**/ 0x9CE4ABBA, 0xBF429D4A, +/**/ 0x3DA00000, 0x3F429EA5, +/**/ 0x07F8A52A, 0x3D163D44, +/**/ 0xF3E983C8, 0xBF42AD45, +/**/ 0xE9000000, 0x3F42AEA2, +/**/ 0x1FEC6070, 0xBD2905BC, +/**/ 0x46F01BD4, 0xBF42BD41, +/**/ 0x92600000, 0x3F42BEA0, +/**/ 0x8FE5CB8E, 0xBD3D6A4E, +/**/ 0x95F8755C, 0xBF42CD3C, +/**/ 0x39A00000, 0x3F42CE9E, +/**/ 0x120028B6, 0x3D32D9FF, +/**/ 0xE10291DF, 0xBF42DD37, +/**/ 0xDF000000, 0x3F42DE9B, +/**/ 0x94B2D8A6, 0x3D112C29, +/**/ 0x280E72DD, 0xBF42ED33, +/**/ 0x82600000, 0x3F42EE99, +/**/ 0x0E9DC27F, 0xBD222C5A, +/**/ 0x6B1C19D4, 0xBF42FD2E, +/**/ 0x23C00000, 0x3F42FE97, +/**/ 0xA4C12307, 0xBD3548A7, +/**/ 0xAA2B8844, 0xBF430D29, +/**/ 0xC3000000, 0x3F430E94, +/**/ 0x1B27A40C, 0x3D3FB49A, +/**/ 0xE53CBFAC, 0xBF431D24, +/**/ 0x60600000, 0x3F431E92, +/**/ 0xC65D601D, 0x3D35E297, +/**/ 0x1C4FC18B, 0xBF432D20, +/**/ 0xFBC00000, 0x3F432E8F, +/**/ 0xD4E46CD5, 0x3D2A84A1, +/**/ 0x4F648F60, 0xBF433D1B, +/**/ 0x95200000, 0x3F433E8D, +/**/ 0x526215F8, 0x3D175314, +/**/ 0x7E7B2AAB, 0xBF434D16, +/**/ 0x2C800000, 0x3F434E8B, +/**/ 0x9746A94C, 0xBCD9430B, +/**/ 0xA99394E9, 0xBF435D11, +/**/ 0xC1E00000, 0x3F435E88, +/**/ 0x47EF6144, 0xBD15A88D, +/**/ 0xD0ADCF9B, 0xBF436D0C, +/**/ 0x55400000, 0x3F436E86, +/**/ 0x94614FFB, 0xBD227301, +/**/ 0xF3C9DC3F, 0xBF437D07, +/**/ 0xE6A00000, 0x3F437E83, +/**/ 0x16908831, 0xBD27A44A, +/**/ 0x12E7BC55, 0xBF438D03, +/**/ 0x76000000, 0x3F438E81, +/**/ 0x13DE59AC, 0xBD2A6621, +/**/ 0x2E07715C, 0xBF439CFE, +/**/ 0x03600000, 0x3F439E7F, +/**/ 0x76635000, 0xBD2AB687, +/**/ 0x4528FCD2, 0xBF43ACF9, +/**/ 0x8EC00000, 0x3F43AE7C, +/**/ 0x28F7818F, 0xBD28937E, +/**/ 0x584C6037, 0xBF43BCF4, +/**/ 0x18200000, 0x3F43BE7A, +/**/ 0x17328F27, 0xBD23FB06, +/**/ 0x67719D0A, 0xBF43CCEF, +/**/ 0x9F800000, 0x3F43CE77, +/**/ 0x5AD74747, 0xBD19D640, +/**/ 0x7298B4CA, 0xBF43DCEA, +/**/ 0x24E00000, 0x3F43DE75, +/**/ 0xC5CB9C74, 0xBCFB0E6A, +/**/ 0x79C1A8F6, 0xBF43ECE5, +/**/ 0xA8400000, 0x3F43EE72, +/**/ 0xF21B8682, 0x3D1145E2, +/**/ 0x7CEC7B0D, 0xBF43FCE0, +/**/ 0x29A00000, 0x3F43FE70, +/**/ 0x59543A06, 0x3D27251B, +/**/ 0x7C192C8E, 0xBF440CDB, +/**/ 0xA9000000, 0x3F440E6D, +/**/ 0xAC6250B6, 0x3D341357, +/**/ 0x7747BEF8, 0xBF441CD6, +/**/ 0x26600000, 0x3F441E6B, +/**/ 0x43A510F7, 0x3D3DD4D6, +/**/ 0x6E7833CB, 0xBF442CD1, +/**/ 0xA1E00000, 0x3F442E68, +/**/ 0x05F7D1E1, 0xBD3727F7, +/**/ 0x61AA8C85, 0xBF443CCC, +/**/ 0x1B400000, 0x3F443E66, +/**/ 0x527C9668, 0xBD25C421, +/**/ 0x50DECAA5, 0xBF444CC7, +/**/ 0x92A00000, 0x3F444E63, +/**/ 0x053F70AC, 0x3D053C47, +/**/ 0x3C14EFAB, 0xBF445CC2, +/**/ 0x08000000, 0x3F445E61, +/**/ 0x1E315FBB, 0x3D3175D5, +/**/ 0x234CFD15, 0xBF446CBD, +/**/ 0x7B800000, 0x3F446E5E, +/**/ 0x6A8B33AC, 0xBD3E762C, +/**/ 0x0686F463, 0xBF447CB8, +/**/ 0xECE00000, 0x3F447E5B, +/**/ 0x67AD9900, 0xBD2A36F8, +/**/ 0xE5C2D713, 0xBF448CB2, +/**/ 0x5C400000, 0x3F448E59, +/**/ 0x1E974853, 0x3D161B95, +/**/ 0xC100A6A5, 0xBF449CAD, +/**/ 0xC9A00000, 0x3F449E56, +/**/ 0x8CE22250, 0x3D3971F7, +/**/ 0x98406498, 0xBF44ACA8, +/**/ 0x35200000, 0x3F44AE54, +/**/ 0xDF8A23F8, 0xBD315945, +/**/ 0x6B82126A, 0xBF44BCA3, +/**/ 0x9E800000, 0x3F44BE51, +/**/ 0x1A63D360, 0x3D1498B2, +/**/ 0x3AC5B19B, 0xBF44CC9E, +/**/ 0x05E00000, 0x3F44CE4F, +/**/ 0x4323A054, 0x3D3CF14E, +/**/ 0x060B43AA, 0xBF44DC99, +/**/ 0x6B600000, 0x3F44DE4C, +/**/ 0x4CE35F94, 0xBD23EDC2, +/**/ 0xCD52CA15, 0xBF44EC93, +/**/ 0xCEC00000, 0x3F44EE49, +/**/ 0xCCF1B48E, 0x3D306E9D, +/**/ 0x909C465C, 0xBF44FC8E, +/**/ 0x30400000, 0x3F44FE47, +/**/ 0x5FF9440B, 0xBD33DD35, +/**/ 0x4FE7B9FF, 0xBF450C89, +/**/ 0x8FA00000, 0x3F450E44, +/**/ 0xAA4D276D, 0x3D224D49, +/**/ 0x0B35267A, 0xBF451C84, +/**/ 0xED200000, 0x3F451E41, +/**/ 0x11B557F9, 0xBD3884D4, +/**/ 0xC2848D4F, 0xBF452C7E, +/**/ 0x48800000, 0x3F452E3F, +/**/ 0xB43290C4, 0x3D1C857D, +/**/ 0x75D5EFFC, 0xBF453C79, +/**/ 0xA2000000, 0x3F453E3C, +/**/ 0x2D598D3C, 0xBD37E5C1, +/**/ 0x25294FFF, 0xBF454C74, +/**/ 0xF9600000, 0x3F454E39, +/**/ 0x3FE47B89, 0x3D24CD93, +/**/ 0xD07EAED8, 0xBF455C6E, +/**/ 0x4EE00000, 0x3F455E37, +/**/ 0xAA959122, 0xBD31F800, +/**/ 0x77D60E06, 0xBF456C69, +/**/ 0xA2400000, 0x3F456E34, +/**/ 0x7329AF92, 0x3D32FEDF, +/**/ 0x1B2F6F08, 0xBF457C64, +/**/ 0xF3C00000, 0x3F457E31, +/**/ 0x1C545A6F, 0xBD1ACE5A, +/**/ 0xBA8AD35D, 0xBF458C5E, +/**/ 0x43400000, 0x3F458E2F, +/**/ 0x19F6B9EF, 0xBD3F0E63, +/**/ 0x55E83C84, 0xBF459C59, +/**/ 0x90A00000, 0x3F459E2C, +/**/ 0x73005F6F, 0x3D23DEF2, +/**/ 0xED47ABFB, 0xBF45AC53, +/**/ 0xDC200000, 0x3F45AE29, +/**/ 0x1C295DE7, 0xBD277204, +/**/ 0x80A92343, 0xBF45BC4E, +/**/ 0x25800000, 0x3F45BE27, +/**/ 0x8D869589, 0x3D3FF92A, +/**/ 0x100CA3D9, 0xBF45CC49, +/**/ 0x6D000000, 0x3F45CE24, +/**/ 0x145C5335, 0x3D2A0DFD, +/**/ 0x9B722F3C, 0xBF45DC43, +/**/ 0xB2800000, 0x3F45DE21, +/**/ 0x6A8614B3, 0xBD123A1A, +/**/ 0x22D9C6ED, 0xBF45EC3E, +/**/ 0xF6000000, 0x3F45EE1E, +/**/ 0x63CBC7E7, 0xBD34C665, +/**/ 0xA6436C69, 0xBF45FC38, +/**/ 0x37600000, 0x3F45FE1C, +/**/ 0xAB6C51D7, 0x3D3C6061, +/**/ 0x25AF2130, 0xBF460C33, +/**/ 0x76E00000, 0x3F460E19, +/**/ 0x1EC7F453, 0x3D2DCD9C, +/**/ 0xA11CE6C1, 0xBF461C2D, +/**/ 0xB4600000, 0x3F461E16, +/**/ 0x20C52899, 0x3D066EFA, +/**/ 0x188CBE9A, 0xBF462C28, +/**/ 0xEFE00000, 0x3F462E13, +/**/ 0xEB5FDD5C, 0xBD1FA5AC, +/**/ 0x8BFEAA3B, 0xBF463C22, +/**/ 0x29600000, 0x3F463E11, +/**/ 0xF22FE2BC, 0xBD313E11, +/**/ 0xFB72AB23, 0xBF464C1C, +/**/ 0x60E00000, 0x3F464E0E, +/**/ 0x6710E251, 0xBD392F15, +/**/ 0x66E8C2D0, 0xBF465C17, +/**/ 0x96600000, 0x3F465E0B, +/**/ 0x1EFC78A7, 0xBD3FBB76, +/**/ 0xCE60F2C1, 0xBF466C11, +/**/ 0xC9C00000, 0x3F466E08, +/**/ 0x602C1A84, 0x3D3B1DCB, +/**/ 0x31DB3C76, 0xBF467C0C, +/**/ 0xFB400000, 0x3F467E05, +/**/ 0x9027DA74, 0x3D375DAE, +/**/ 0x9157A16E, 0xBF468C06, +/**/ 0x2AC00000, 0x3F468E03, +/**/ 0xEA560DA0, 0x3D350532, +/**/ 0xECD62326, 0xBF469C00, +/**/ 0x58400000, 0x3F469E00, +/**/ 0xE7B63DE2, 0x3D341557 } }; + +#endif +#endif diff --git a/libgcc-math/dbl-64/urem.h b/libgcc-math/dbl-64/urem.h new file mode 100644 index 00000000000..3713dd90d8a --- /dev/null +++ b/libgcc-math/dbl-64/urem.h @@ -0,0 +1,51 @@ +/* + * IBM Accurate Mathematical Library + * Written by International Business Machines Corp. + * Copyright (C) 2001 Free Software Foundation, Inc. + * + * This program is free software; you can redistribute it and/or modify + * it under the terms of the GNU Lesser General Public License as published by + * the Free Software Foundation; either version 2.1 of the License, or + * (at your option) any later version. + * + * This program is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU Lesser General Public License for more details. + * + * You should have received a copy of the GNU Lesser General Public License + * along with this program; if not, write to the Free Software + * Foundation, Inc., 59 Temple Place - Suite 330, Boston, MA 02111-1307, USA. + */ + +/************************************************************************/ +/* MODULE_NAME: urem.h */ +/* */ +/* */ +/* common data and variables definition for BIG or LITTLE ENDIAN */ +/************************************************************************/ + +#ifndef UREM_H +#define UREM_H + +#ifdef BIG_ENDI +static const mynumber big = {{0x43380000, 0}}, /* 6755399441055744 */ + t128 = {{0x47f00000, 0}}, /* 2^ 128 */ + tm128 = {{0x37f00000, 0}}, /* 2^-128 */ + ZERO = {{0, 0}}, /* 0.0 */ + nZERO = {{0x80000000, 0}}, /* -0.0 */ + NAN = {{0x7ff80000, 0}}, /* NaN */ + nNAN = {{0xfff80000, 0}}; /* -NaN */ +#else +#ifdef LITTLE_ENDI +static const mynumber big = {{0, 0x43380000}}, /* 6755399441055744 */ + t128 = {{0, 0x47f00000}}, /* 2^ 128 */ + tm128 = {{0, 0x37f00000}}, /* 2^-128 */ + ZERO = {{0, 0}}, /* 0.0 */ + nZERO = {{0, 0x80000000}}, /* -0.0 */ + NAN = {{0, 0x7ff80000}}, /* NaN */ + nNAN = {{0, 0xfff80000}}; /* -NaN */ +#endif +#endif + +#endif diff --git a/libgcc-math/dbl-64/uroot.h b/libgcc-math/dbl-64/uroot.h new file mode 100644 index 00000000000..02b74cb262e --- /dev/null +++ b/libgcc-math/dbl-64/uroot.h @@ -0,0 +1,44 @@ +/* + * IBM Accurate Mathematical Library + * Written by International Business Machines Corp. + * Copyright (C) 2001 Free Software Foundation, Inc. + * + * This program is free software; you can redistribute it and/or modify + * it under the terms of the GNU Lesser General Public License as published by + * the Free Software Foundation; either version 2.1 of the License, or + * (at your option) any later version. + * + * This program is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU Lesser General Public License for more details. + * + * You should have received a copy of the GNU Lesser General Public License + * along with this program; if not, write to the Free Software + * Foundation, Inc., 59 Temple Place - Suite 330, Boston, MA 02111-1307, USA. + */ + +/******************************************************************/ +/* */ +/* MODULE_NAME:uroot.h */ +/* */ +/* common data and variables prototype and definition */ +/******************************************************************/ + +#ifndef UROOT_H +#define UROOT_H + +#ifdef BIG_ENDI + static const mynumber +/**/ t512 = {{0x5ff00000, 0x00000000 }}, /* 2^512 */ +/**/ tm256 = {{0x2ff00000, 0x00000000 }}; /* 2^-256 */ + +#else +#ifdef LITTLE_ENDI + static const mynumber +/**/ t512 = {{0x00000000, 0x5ff00000 }}, /* 2^512 */ +/**/ tm256 = {{0x00000000, 0x2ff00000 }}; /* 2^-256 */ +#endif +#endif + +#endif diff --git a/libgcc-math/dbl-64/usncs.h b/libgcc-math/dbl-64/usncs.h new file mode 100644 index 00000000000..6c80f0cf958 --- /dev/null +++ b/libgcc-math/dbl-64/usncs.h @@ -0,0 +1,80 @@ +/* + * IBM Accurate Mathematical Library + * Written by International Business Machines Corp. + * Copyright (C) 2001 Free Software Foundation, Inc. + * + * This program is free software; you can redistribute it and/or modify + * it under the terms of the GNU Lesser General Public License as published by + * the Free Software Foundation; either version 2.1 of the License, or + * (at your option) any later version. + * + * This program is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU Lesser General Public License for more details. + * + * You should have received a copy of the GNU Lesser General Public License + * along with this program; if not, write to the Free Software + * Foundation, Inc., 59 Temple Place - Suite 330, Boston, MA 02111-1307, USA. + */ + +/************************************************************************/ +/* MODULE_NAME: dosincos.h */ +/* */ +/* */ +/* common data and variables definition for BIG or LITTLE ENDIAN */ +/************************************************************************/ + +#ifndef USNCS_H +#define USNCS_H + +#ifdef BIG_ENDI +static const mynumber + +/**/ NAN = {{0x7ff80000, 0x00000000 }}, /* NaN */ +/**/ s1 = {{0xBFC55555, 0x55555555 }}, /* -0.16666666666666666 */ +/**/ s2 = {{0x3F811111, 0x11110ECE }}, /* 0.0083333333333323288 */ +/**/ s3 = {{0xBF2A01A0, 0x19DB08B8 }}, /* -0.00019841269834414642 */ +/**/ s4 = {{0x3EC71DE2, 0x7B9A7ED9 }}, /* 2.755729806860771e-06 */ +/**/ s5 = {{0xBE5ADDFF, 0xC2FCDF59 }}, /* -2.5022014848318398e-08 */ +/**/ aa = {{0xBFC55580, 0x00000000 }}, /* -0.1666717529296875 */ +/**/ bb = {{0x3ED55555, 0x55556E24 }}, /* 5.0862630208387126e-06 */ +/**/ big = {{0x42c80000, 0x00000000 }}, /* 52776558133248 */ +/**/ hp0 = {{0x3FF921FB, 0x54442D18 }}, /* 1.5707963267948966 */ +/**/ hp1 = {{0x3C91A626, 0x33145C07 }}, /* 6.123233995736766e-17 */ +/**/ mp1 = {{0x3FF921FB, 0x58000000 }}, /* 1.5707963407039642 */ +/**/ mp2 = {{0xBE4DDE97, 0x3C000000 }}, /* -1.3909067564377153e-08 */ +/**/ mp3 = {{0xBC8CB3B3, 0x99D747F2 }}, /* -4.9789962505147994e-17 */ +/**/ pp3 = {{0xBC8CB3B3, 0x98000000 }}, /* -4.9789962314799099e-17 */ +/**/ pp4 = {{0xbacd747f, 0x23e32ed7 }}, /* -1.9034889620193266e-25 */ +/**/ hpinv = {{0x3FE45F30, 0x6DC9C883 }}, /* 0.63661977236758138 */ +/**/ toint = {{0x43380000, 0x00000000 }}; /* 6755399441055744 */ + +#else +#ifdef LITTLE_ENDI +static const mynumber + +/**/ NAN = {{0x00000000, 0x7ff80000 }},/* NaN */ +/**/ s1 = {{0x55555555, 0xBFC55555 }},/* -0.16666666666666666 */ +/**/ s2 = {{0x11110ECE, 0x3F811111 }},/* 0.0083333333333323288 */ +/**/ s3 = {{0x19DB08B8, 0xBF2A01A0 }},/* -0.00019841269834414642 */ +/**/ s4 = {{0x7B9A7ED9, 0x3EC71DE2 }},/* 2.755729806860771e-06 */ +/**/ s5 = {{0xC2FCDF59, 0xBE5ADDFF }},/* -2.5022014848318398e-08 */ +/**/ aa = {{0x00000000, 0xBFC55580 }},/* -0.1666717529296875 */ +/**/ bb = {{0x55556E24, 0x3ED55555 }},/* 5.0862630208387126e-06 */ +/**/ big = {{0x00000000, 0x42c80000 }},/* 52776558133248 */ +/**/ hp0 = {{0x54442D18, 0x3FF921FB }},/* 1.5707963267948966 */ +/**/ hp1 = {{0x33145C07, 0x3C91A626 }},/* 6.123233995736766e-17 */ +/**/ mp1 = {{0x58000000, 0x3FF921FB }},/* 1.5707963407039642 */ +/**/ mp2 = {{0x3C000000, 0xBE4DDE97 }},/* -1.3909067564377153e-08 */ +/**/ mp3 = {{0x99D747F2, 0xBC8CB3B3 }},/* -4.9789962505147994e-17 */ +/**/ pp3 = {{0x98000000, 0xBC8CB3B3 }},/* -4.9789962314799099e-17 */ +/**/ pp4 = {{0x23e32ed7, 0xbacd747f }},/* -1.9034889620193266e-25 */ +/**/ hpinv = {{0x6DC9C883, 0x3FE45F30 }},/* 0.63661977236758138 */ +/**/ toint = {{0x00000000, 0x43380000 }};/* 6755399441055744 */ + + +#endif +#endif + +#endif diff --git a/libgcc-math/dbl-64/utan.h b/libgcc-math/dbl-64/utan.h new file mode 100644 index 00000000000..c866e88edc8 --- /dev/null +++ b/libgcc-math/dbl-64/utan.h @@ -0,0 +1,280 @@ +/* + * IBM Accurate Mathematical Library + * Written by International Business Machines Corp. + * Copyright (C) 2001 Free Software Foundation, Inc. + * + * This program is free software; you can redistribute it and/or modify + * it under the terms of the GNU Lesser General Public License as published by + * the Free Software Foundation; either version 2.1 of the License, or + * (at your option) any later version. + * + * This program is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU Lesser General Public License for more details. + * + * You should have received a copy of the GNU Lesser General Public License + * along with this program; if not, write to the Free Software + * Foundation, Inc., 59 Temple Place - Suite 330, Boston, MA 02111-1307, USA. + */ + +/******************************************************************/ +/* */ +/* MODULE_NAME:utan.h */ +/* */ +/* common data and variables prototype and definition */ +/******************************************************************/ + +#ifndef UTAN_H +#define UTAN_H + +#ifdef BIG_ENDI + static const number + /* polynomial I */ +/**/ d3 = {{0x3FD55555, 0x55555555} }, /* 0.333... */ +/**/ d5 = {{0x3FC11111, 0x111107C6} }, /* 0.133... */ +/**/ d7 = {{0x3FABA1BA, 0x1CDB8745} }, /* . */ +/**/ d9 = {{0x3F9664ED, 0x49CFC666} }, /* . */ +/**/ d11 = {{0x3F82385A, 0x3CF2E4EA} }, /* . */ + /* polynomial II */ +/**/ a3 = {{0x3fd55555, 0x55555555} }, /* 1/3 */ +/**/ aa3 = {{0x3c755555, 0x55555555} }, /* 1/3-a3 */ +/**/ a5 = {{0x3fc11111, 0x11111111} }, /* 2/15 */ +/**/ aa5 = {{0x3c411111, 0x11111111} }, /* 2/15-a5 */ +/**/ a7 = {{0x3faba1ba, 0x1ba1ba1c} }, /* 17/315 */ +/**/ aa7 = {{0xbc479179, 0x17917918} }, /* ()-a7 */ +/**/ a9 = {{0x3f9664f4, 0x882c10fa} }, /* 62/2835 */ +/**/ aa9 = {{0xbc09a528, 0x8b6c44fd} }, /* ()-a9 */ +/**/ a11 = {{0x3f8226e3, 0x55e6c23d} }, /* . */ +/**/ aa11 = {{0xbc2c292b, 0x8f1a2c13} }, /* . */ +/**/ a13 = {{0x3f6d6d3d, 0x0e157de0} }, /* . */ +/**/ aa13 = {{0xbc0280cf, 0xc968d971} }, /* . */ +/**/ a15 = {{0x3f57da36, 0x452b75e3} }, /* . */ +#if 0 +/**/ aa15 = {{0xbbf25789, 0xb285d2ed} }, /* . */ +#endif +/**/ a17 = {{0x3f435582, 0x48036744} }, /* . */ +#if 0 +/**/ aa17 = {{0x3be488d9, 0x563f1f23} }, /* . */ +#endif +/**/ a19 = {{0x3f2f57d7, 0x734d1664} }, /* . */ +#if 0 +/**/ aa19 = {{0x3bb0d55a, 0x913ccb50} }, /* . */ +#endif +/**/ a21 = {{0x3f1967e1, 0x8afcafad} }, /* . */ +#if 0 +/**/ aa21 = {{0xbbbd7614, 0xa42d44e6} }, /* . */ +#endif +/**/ a23 = {{0x3f0497d8, 0xeea25259} }, /* . */ +#if 0 +/**/ aa23 = {{0x3b99f2d0, 0x2e4d2863} }, /* . */ +#endif +/**/ a25 = {{0x3ef0b132, 0xd39a6050} }, /* . */ +#if 0 +/**/ aa25 = {{0x3b93b274, 0xc2c19614} }, /* . */ +#endif +/**/ a27 = {{0x3edb0f72, 0xd3ee24e9} }, /* . */ +#if 0 +/**/ aa27 = {{0x3b61688d, 0xdd595609} }, /* . */ +#endif + /* polynomial III */ +/**/ e0 = {{0x3FD55555, 0x55554DBD} }, /* . */ +/**/ e1 = {{0x3FC11112, 0xE0A6B45F} }, /* . */ + + /* constants */ +/**/ zero = {{0x00000000, 0x00000000} }, /* 0 */ +/**/ one = {{0x3ff00000, 0x00000000} }, /* 1 */ +/**/ mone = {{0xbff00000, 0x00000000} }, /*-1 */ +/**/ mfftnhf = {{0xc02f0000, 0x00000000} }, /*-15.5 */ +/**/ two8 = {{0x40700000, 0x00000000} }, /* 256 */ + +/**/ g1 = {{0x3e4b096c, 0x00000000} }, /* 1.259e-8 */ +/**/ g2 = {{0x3faf212d, 0x00000000} }, /* 0.0608 */ +/**/ g3 = {{0x3fe92f1a, 0x00000000} }, /* 0.787 */ +/**/ g4 = {{0x40390000, 0x00000000} }, /* 25.0 */ +/**/ g5 = {{0x4197d784, 0x00000000} }, /* 1e8 */ +/**/ gy1 = {{0x3e7ad7f2, 0x9abcaf48} }, /* 1e-7 */ +/**/ gy2 = {{0x3faf212d, 0x00000000} }, /* 0.0608 */ + +/**/ u1 = {{0x3cc8c33a, 0x00000000} }, /* 6.873e-16 */ +/**/ u2 = {{0x3983dc4d, 0x00000000} }, /* 1.224e-31 */ +/**/ u3 = {{0x3c78e14b, 0x00000000} }, /* 2.158e-17 */ +/**/ ua3 = {{0x3bfd8b58, 0x00000000} }, /* 1.001e-19 */ +/**/ ub3 = {{0x3cc81898, 0x00000000} }, /* 6.688e-16 */ +/**/ u4 = {{0x399856c2, 0x00000000} }, /* 3e-31 */ +/**/ u5 = {{0x3c39d80a, 0x00000000} }, /* 1.401e-18 */ +/**/ u6 = {{0x3c374c5a, 0x00000000} }, /* 1.263e-18 */ +/**/ u7 = {{0x39903beb, 0x00000000} }, /* 2.001e-31 */ +/**/ u8 = {{0x399c56ae, 0x00000000} }, /* 3.493e-31 */ +/**/ u9 = {{0x3c7d0ac7, 0x00000000} }, /* 2.519e-17 */ +/**/ ua9 = {{0x3bfd8b58, 0x00000000} }, /* 1.001e-19 */ +/**/ ub9 = {{0x3ccc2375, 0x00000000} }, /* 7.810e-16 */ +/**/ u10 = {{0x3c7e40af, 0x00000000} }, /* 2.624e-17 */ +/**/ ua10 = {{0x3bfd8b58, 0x00000000} }, /* 1.001e-19 */ +/**/ ub10 = {{0x3ccc6405, 0x00000000} }, /* 7.880e-16 */ +/**/ u11 = {{0x39e509b6, 0x00000000} }, /* 8.298e-30 */ +/**/ u12 = {{0x39e509b6, 0x00000000} }, /* 8.298e-30 */ +/**/ u13 = {{0x3c39d80a, 0x00000000} }, /* 1.401e-18 */ +/**/ u14 = {{0x3c374c5a, 0x00000000} }, /* 1.263e-18 */ +/**/ u15 = {{0x3ab5767a, 0x00000000} }, /* 6.935e-26 */ +/**/ u16 = {{0x3ab57744, 0x00000000} }, /* 6.936e-26 */ +/**/ u17 = {{0x3c7d0ac7, 0x00000000} }, /* 2.519e-17 */ +/**/ ua17 = {{0x3bfdb11f, 0x00000000} }, /* 1.006e-19 */ +/**/ ub17 = {{0x3ccc2375, 0x00000000} }, /* 7.810e-16 */ +/**/ u18 = {{0x3c7e40af, 0x00000000} }, /* 2.624e-17 */ +/**/ ua18 = {{0x3bfdb11f, 0x00000000} }, /* 1.006e-19 */ +/**/ ub18 = {{0x3ccc6405, 0x00000000} }, /* 7.880e-16 */ +/**/ u19 = {{0x39a13b61, 0x00000000} }, /* 4.248e-31 */ +/**/ u20 = {{0x39a13b61, 0x00000000} }, /* 4.248e-31 */ +/**/ u21 = {{0x3c3bb9b8, 0x00000000} }, /* 1.503e-18 */ +/**/ u22 = {{0x3c392e08, 0x00000000} }, /* 1.365e-18 */ +/**/ u23 = {{0x3a0ce706, 0x00000000} }, /* 4.560e-29 */ +/**/ u24 = {{0x3a0cff5d, 0x00000000} }, /* 4.575e-29 */ +/**/ u25 = {{0x3c7d0ac7, 0x00000000} }, /* 2.519e-17 */ +/**/ ua25 = {{0x3bfd8b58, 0x00000000} }, /* 1.001e-19 */ +/**/ ub25 = {{0x3ccc2375, 0x00000000} }, /* 7.810e-16 */ +/**/ u26 = {{0x3c7e40af, 0x00000000} }, /* 2.624e-17 */ +/**/ ua26 = {{0x3bfd8b58, 0x00000000} }, /* 1.001e-19 */ +/**/ ub26 = {{0x3ccc6405, 0x00000000} }, /* 7.880e-16 */ +/**/ u27 = {{0x3ad421cb, 0x00000000} }, /* 2.602e-25 */ +/**/ u28 = {{0x3ad421cb, 0x00000000} }, /* 2.602e-25 */ + +/**/ mp1 = {{0x3FF921FB, 0x58000000} }, +/**/ mp2 = {{0xBE4DDE97, 0x3C000000} }, +/**/ mp3 = {{0xBC8CB3B3, 0x99D747F2} }, +/**/ pp3 = {{0xBC8CB3B3, 0x98000000} }, +/**/ pp4 = {{0xbacd747f, 0x23e32ed7} }, +/**/ hpinv = {{0x3FE45F30, 0x6DC9C883} }, +/**/ toint = {{0x43380000, 0x00000000} }; + +#else +#ifdef LITTLE_ENDI + + static const number + /* polynomial I */ +/**/ d3 = {{0x55555555, 0x3FD55555} }, /* 0.333... */ +/**/ d5 = {{0x111107C6, 0x3FC11111} }, /* 0.133... */ +/**/ d7 = {{0x1CDB8745, 0x3FABA1BA} }, /* . */ +/**/ d9 = {{0x49CFC666, 0x3F9664ED} }, /* . */ +/**/ d11 = {{0x3CF2E4EA, 0x3F82385A} }, /* . */ + /* polynomial II */ +/**/ a3 = {{0x55555555, 0x3fd55555} }, /* 1/3 */ +/**/ aa3 = {{0x55555555, 0x3c755555} }, /* 1/3-a3 */ +/**/ a5 = {{0x11111111, 0x3fc11111} }, /* 2/15 */ +/**/ aa5 = {{0x11111111, 0x3c411111} }, /* 2/15-a5 */ +/**/ a7 = {{0x1ba1ba1c, 0x3faba1ba} }, /* 17/315 */ +/**/ aa7 = {{0x17917918, 0xbc479179} }, /* ()-a7 */ +/**/ a9 = {{0x882c10fa, 0x3f9664f4} }, /* 62/2835 */ +/**/ aa9 = {{0x8b6c44fd, 0xbc09a528} }, /* ()-a9 */ +/**/ a11 = {{0x55e6c23d, 0x3f8226e3} }, /* . */ +/**/ aa11 = {{0x8f1a2c13, 0xbc2c292b} }, /* . */ +/**/ a13 = {{0x0e157de0, 0x3f6d6d3d} }, /* . */ +/**/ aa13 = {{0xc968d971, 0xbc0280cf} }, /* . */ +/**/ a15 = {{0x452b75e3, 0x3f57da36} }, /* . */ +#if 0 +/**/ aa15 = {{0xb285d2ed, 0xbbf25789} }, /* . */ +#endif +/**/ a17 = {{0x48036744, 0x3f435582} }, /* . */ +#if 0 +/**/ aa17 = {{0x563f1f23, 0x3be488d9} }, /* . */ +#endif +/**/ a19 = {{0x734d1664, 0x3f2f57d7} }, /* . */ +#if 0 +/**/ aa19 = {{0x913ccb50, 0x3bb0d55a} }, /* . */ +#endif +/**/ a21 = {{0x8afcafad, 0x3f1967e1} }, /* . */ +#if 0 +/**/ aa21 = {{0xa42d44e6, 0xbbbd7614} }, /* . */ +#endif +/**/ a23 = {{0xeea25259, 0x3f0497d8} }, /* . */ +#if 0 +/**/ aa23 = {{0x2e4d2863, 0x3b99f2d0} }, /* . */ +#endif +/**/ a25 = {{0xd39a6050, 0x3ef0b132} }, /* . */ +#if 0 +/**/ aa25 = {{0xc2c19614, 0x3b93b274} }, /* . */ +#endif +/**/ a27 = {{0xd3ee24e9, 0x3edb0f72} }, /* . */ +#if 0 +/**/ aa27 = {{0xdd595609, 0x3b61688d} }, /* . */ +#endif + /* polynomial III */ +/**/ e0 = {{0x55554DBD, 0x3FD55555} }, /* . */ +/**/ e1 = {{0xE0A6B45F, 0x3FC11112} }, /* . */ + + /* constants */ +/**/ zero = {{0x00000000, 0x00000000} }, /* 0 */ +/**/ one = {{0x00000000, 0x3ff00000} }, /* 1 */ +/**/ mone = {{0x00000000, 0xbff00000} }, /*-1 */ +/**/ mfftnhf = {{0x00000000, 0xc02f0000} }, /*-15.5 */ +/**/ two8 = {{0x00000000, 0x40700000} }, /* 256 */ + +/**/ g1 = {{0x00000000, 0x3e4b096c} }, /* 1.259e-8 */ +/**/ g2 = {{0x00000000, 0x3faf212d} }, /* 0.0608 */ +/**/ g3 = {{0x00000000, 0x3fe92f1a} }, /* 0.787 */ +/**/ g4 = {{0x00000000, 0x40390000} }, /* 25.0 */ +/**/ g5 = {{0x00000000, 0x4197d784} }, /* 1e8 */ +/**/ gy1 = {{0x9abcaf48, 0x3e7ad7f2} }, /* 1e-7 */ +/**/ gy2 = {{0x00000000, 0x3faf212d} }, /* 0.0608 */ + +/**/ u1 = {{0x00000000, 0x3cc8c33a} }, /* 6.873e-16 */ +/**/ u2 = {{0x00000000, 0x3983dc4d} }, /* 1.224e-31 */ +/**/ u3 = {{0x00000000, 0x3c78e14b} }, /* 2.158e-17 */ +/**/ ua3 = {{0x00000000, 0x3bfd8b58} }, /* 1.001e-19 */ +/**/ ub3 = {{0x00000000, 0x3cc81898} }, /* 6.688e-16 */ +/**/ u4 = {{0x00000000, 0x399856c2} }, /* 3e-31 */ +/**/ u5 = {{0x00000000, 0x3c39d80a} }, /* 1.401e-18 */ +/**/ u6 = {{0x00000000, 0x3c374c5a} }, /* 1.263e-18 */ +/**/ u7 = {{0x00000000, 0x39903beb} }, /* 2.001e-31 */ +/**/ u8 = {{0x00000000, 0x399c56ae} }, /* 3.493e-31 */ +/**/ u9 = {{0x00000000, 0x3c7d0ac7} }, /* 2.519e-17 */ +/**/ ua9 = {{0x00000000, 0x3bfd8b58} }, /* 1.001e-19 */ +/**/ ub9 = {{0x00000000, 0x3ccc2375} }, /* 7.810e-16 */ +/**/ u10 = {{0x00000000, 0x3c7e40af} }, /* 2.624e-17 */ +/**/ ua10 = {{0x00000000, 0x3bfd8b58} }, /* 1.001e-19 */ +/**/ ub10 = {{0x00000000, 0x3ccc6405} }, /* 7.880e-16 */ +/**/ u11 = {{0x00000000, 0x39e509b6} }, /* 8.298e-30 */ +/**/ u12 = {{0x00000000, 0x39e509b6} }, /* 8.298e-30 */ +/**/ u13 = {{0x00000000, 0x3c39d80a} }, /* 1.401e-18 */ +/**/ u14 = {{0x00000000, 0x3c374c5a} }, /* 1.263e-18 */ +/**/ u15 = {{0x00000000, 0x3ab5767a} }, /* 6.935e-26 */ +/**/ u16 = {{0x00000000, 0x3ab57744} }, /* 6.936e-26 */ +/**/ u17 = {{0x00000000, 0x3c7d0ac7} }, /* 2.519e-17 */ +/**/ ua17 = {{0x00000000, 0x3bfdb11f} }, /* 1.006e-19 */ +/**/ ub17 = {{0x00000000, 0x3ccc2375} }, /* 7.810e-16 */ +/**/ u18 = {{0x00000000, 0x3c7e40af} }, /* 2.624e-17 */ +/**/ ua18 = {{0x00000000, 0x3bfdb11f} }, /* 1.006e-19 */ +/**/ ub18 = {{0x00000000, 0x3ccc6405} }, /* 7.880e-16 */ +/**/ u19 = {{0x00000000, 0x39a13b61} }, /* 4.248e-31 */ +/**/ u20 = {{0x00000000, 0x39a13b61} }, /* 4.248e-31 */ +/**/ u21 = {{0x00000000, 0x3c3bb9b8} }, /* 1.503e-18 */ +/**/ u22 = {{0x00000000, 0x3c392e08} }, /* 1.365e-18 */ +/**/ u23 = {{0x00000000, 0x3a0ce706} }, /* 4.560e-29 */ +/**/ u24 = {{0x00000000, 0x3a0cff5d} }, /* 4.575e-29 */ +/**/ u25 = {{0x00000000, 0x3c7d0ac7} }, /* 2.519e-17 */ +/**/ ua25 = {{0x00000000, 0x3bfd8b58} }, /* 1.001e-19 */ +/**/ ub25 = {{0x00000000, 0x3ccc2375} }, /* 7.810e-16 */ +/**/ u26 = {{0x00000000, 0x3c7e40af} }, /* 2.624e-17 */ +/**/ ua26 = {{0x00000000, 0x3bfd8b58} }, /* 1.001e-19 */ +/**/ ub26 = {{0x00000000, 0x3ccc6405} }, /* 7.880e-16 */ +/**/ u27 = {{0x00000000, 0x3ad421cb} }, /* 2.602e-25 */ +/**/ u28 = {{0x00000000, 0x3ad421cb} }, /* 2.602e-25 */ + +/**/ mp1 = {{0x58000000, 0x3FF921FB} }, +/**/ mp2 = {{0x3C000000, 0xBE4DDE97} }, +/**/ mp3 = {{0x99D747F2, 0xBC8CB3B3} }, +/**/ pp3 = {{0x98000000, 0xBC8CB3B3} }, +/**/ pp4 = {{0x23e32ed7, 0xbacd747f} }, +/**/ hpinv = {{0x6DC9C883, 0x3FE45F30} }, +/**/ toint = {{0x00000000, 0x43380000} }; + +#endif +#endif + + +#define ZERO zero.d +#define ONE one.d +#define MONE mone.d +#define TWO8 two8.d + +#endif diff --git a/libgcc-math/dbl-64/utan.tbl b/libgcc-math/dbl-64/utan.tbl new file mode 100644 index 00000000000..eb248bada9b --- /dev/null +++ b/libgcc-math/dbl-64/utan.tbl @@ -0,0 +1,1526 @@ +/* + * IBM Accurate Mathematical Library + * Written by International Business Machines Corp. + * Copyright (C) 2001 Free Software Foundation, Inc. + * + * This program is free software; you can redistribute it and/or modify + * it under the terms of the GNU Lesser General Public License as published by + * the Free Software Foundation; either version 2.1 of the License, or + * (at your option) any later version. + * + * This program is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU Lesser General Public License for more details. + * + * You should have received a copy of the GNU Lesser General Public License + * along with this program; if not, write to the Free Software + * Foundation, Inc., 59 Temple Place - Suite 330, Boston, MA 02111-1307, USA. + */ + +/****************************************************************/ +/* TABLES FOR THE utan() FUNCTION */ +/****************************************************************/ + + +#ifdef BIG_ENDI +static const number + xfg[186][4] = { /* xi,Fi,Gi,FFi, i=16..201 */ +/**/ {{{0x3fb00000, 0x1e519d60} }, +/**/ {{0x3fb00557, 0x96c4e240} }, +/**/ {{0x402ff554, 0x628127b7} }, +/**/ {{0xbb9a1dee, 0x9e355b06} },}, +/**/ {{{0x3fb10000, 0x1b1a7010} }, +/**/ {{0x3fb10668, 0xaab892b7} }, +/**/ {{0x402e12c7, 0xbe3fdf74} }, +/**/ {{0x3ba89234, 0x037da741} },}, +/**/ {{{0x3fb20000, 0x2505e350} }, +/**/ {{0x3fb2079b, 0xff547824} }, +/**/ {{0x402c65c5, 0xde853633} }, +/**/ {{0x3bb7486e, 0xe9614250} },}, +/**/ {{{0x3fb2ffff, 0xfcdc4252} }, +/**/ {{0x3fb308f3, 0x5eb16c68} }, +/**/ {{0x402ae5da, 0xe56be74f} }, +/**/ {{0xbb82c726, 0x91a23034} },}, +/**/ {{{0x3fb3ffff, 0xe3ff849f} }, +/**/ {{0x3fb40a71, 0x154999cc} }, +/**/ {{0x40298c43, 0x046b7352} }, +/**/ {{0x3b9aceaf, 0x3843738f} },}, +/**/ {{{0x3fb4ffff, 0xedc9590f} }, +/**/ {{0x3fb50c17, 0x429bdd80} }, +/**/ {{0x40285384, 0x91b5d674} }, +/**/ {{0xbbc1d02d, 0xb4403d22} },}, +/**/ {{{0x3fb60000, 0x00ee83f7} }, +/**/ {{0x3fb60de7, 0xda80cc21} }, +/**/ {{0x40273724, 0xef21a2a7} }, +/**/ {{0xbb95e53c, 0x72523ffd} },}, +/**/ {{{0x3fb6ffff, 0xeb05ea41} }, +/**/ {{0x3fb70fe4, 0xb8c51bea} }, +/**/ {{0x40263370, 0xfae562ff} }, +/**/ {{0xbb99ad0e, 0x8ffe0626} },}, +/**/ {{{0x3fb7ffff, 0xdc0515f7} }, +/**/ {{0x3fb81210, 0x1db54498} }, +/**/ {{0x40254553, 0x0e7eab5c} }, +/**/ {{0xbb914c87, 0xd62ed686} },}, +/**/ {{{0x3fb8ffff, 0xe384d7ab} }, +/**/ {{0x3fb9146c, 0x2a8d3727} }, +/**/ {{0x40246a33, 0xfd57f3fd} }, +/**/ {{0xbbbbda8d, 0x5381e06d} },}, +/**/ {{{0x3fb9ffff, 0xe4832347} }, +/**/ {{0x3fba16fa, 0xd50e1050} }, +/**/ {{0x40239fe2, 0xc5537a96} }, +/**/ {{0x3bc7f695, 0xc111eabb} },}, +/**/ {{{0x3fbb0000, 0x274540e3} }, +/**/ {{0x3fbb19be, 0x7ae68517} }, +/**/ {{0x4022e481, 0x3637e946} }, +/**/ {{0x3bc307f8, 0x8dbd9d93} },}, +/**/ {{{0x3fbbffff, 0xfebf2e9b} }, +/**/ {{0x3fbc1cb8, 0x8369cd19} }, +/**/ {{0x40223676, 0x17aef223} }, +/**/ {{0x3bc50038, 0x424a9cf3} },}, +/**/ {{{0x3fbd0000, 0x23529045} }, +/**/ {{0x3fbd1feb, 0xc11d7ef7} }, +/**/ {{0x4021945f, 0xb8e43d4e} }, +/**/ {{0x3b812007, 0x52a6f224} },}, +/**/ {{{0x3fbdffff, 0xd872a829} }, +/**/ {{0x3fbe2359, 0x8ee4d6b7} }, +/**/ {{0x4020fd0c, 0x76195d5f} }, +/**/ {{0xbbb4d9ab, 0x85fdca85} },}, +/**/ {{{0x3fbeffff, 0xff323b84} }, +/**/ {{0x3fbf2704, 0xec9073e5} }, +/**/ {{0x40206f71, 0x3020200f} }, +/**/ {{0x3bb77aa2, 0x12836992} },}, +/**/ {{{0x3fc00000, 0x0ce79195} }, +/**/ {{0x3fc01577, 0xbc30cc61} }, +/**/ {{0x401fd549, 0xd6564a88} }, +/**/ {{0xbbc8926f, 0x965c0ad0} },}, +/**/ {{{0x3fc07fff, 0xee40e918} }, +/**/ {{0x3fc0978d, 0x8279ac01} }, +/**/ {{0x401edbb5, 0x9294bc03} }, +/**/ {{0xbb80a533, 0x4aae45d6} },}, +/**/ {{{0x3fc10000, 0x0cc091fd} }, +/**/ {{0x3fc119c5, 0x44dfb2f7} }, +/**/ {{0x401df0bb, 0x067d8e18} }, +/**/ {{0xbbcc2c18, 0x4ff642a4} },}, +/**/ {{{0x3fc18000, 0x0d9936a1} }, +/**/ {{0x3fc19c1f, 0xb9085a4b} }, +/**/ {{0x401d131a, 0x71ce3629} }, +/**/ {{0xbbc36553, 0x0669355b} },}, +/**/ {{{0x3fc1ffff, 0xed5f3188} }, +/**/ {{0x3fc21e9d, 0xee74bf2d} }, +/**/ {{0x401c41b6, 0xff0cd655} }, +/**/ {{0x3b8867f5, 0x478ecfc5} },}, +/**/ {{{0x3fc28000, 0x05f06a51} }, +/**/ {{0x3fc2a141, 0x550b313f} }, +/**/ {{0x401b7b92, 0x1702e6d2} }, +/**/ {{0xbbadab51, 0x380131fe} },}, +/**/ {{{0x3fc2ffff, 0xfe3d339e} }, +/**/ {{0x3fc3240a, 0xa75f76df} }, +/**/ {{0x401abfc8, 0xfcb6409d} }, +/**/ {{0x3bc60bcf, 0x0d291d83} },}, +/**/ {{{0x3fc37fff, 0xed888d6f} }, +/**/ {{0x3fc3a6fb, 0x13cc5db7} }, +/**/ {{0x401a0d8f, 0x8ed5320d} }, +/**/ {{0x3bb8a48e, 0x4eef03ab} },}, +/**/ {{{0x3fc40000, 0x02ca050d} }, +/**/ {{0x3fc42a13, 0xe25776bb} }, +/**/ {{0x4019642d, 0xfa84c2bc} }, +/**/ {{0xbbd0bd5d, 0xcc56516f} },}, +/**/ {{{0x3fc47fff, 0xf2531f5c} }, +/**/ {{0x3fc4ad55, 0xdeb73404} }, +/**/ {{0x4018c2fe, 0xf86e9035} }, +/**/ {{0x3b9cffe7, 0x5aa287c8} },}, +/**/ {{{0x3fc50000, 0x13774992} }, +/**/ {{0x3fc530c2, 0x7d0ee307} }, +/**/ {{0x4018296c, 0x370caf35} }, +/**/ {{0xbbcf75d1, 0xf91d6532} },}, +/**/ {{{0x3fc57fff, 0xedddcb2d} }, +/**/ {{0x3fc5b45a, 0x5db4347d} }, +/**/ {{0x401796ee, 0x52190c0e} }, +/**/ {{0x3b88a25f, 0x17d5d076} },}, +/**/ {{{0x3fc5ffff, 0xf41949a0} }, +/**/ {{0x3fc6381f, 0x13bf986a} }, +/**/ {{0x40170b09, 0x2d2255fd} }, +/**/ {{0xbb9bfb23, 0xb1bcd5e7} },}, +/**/ {{{0x3fc67fff, 0xf834d3a1} }, +/**/ {{0x3fc6bc11, 0x8ec85952} }, +/**/ {{0x4016854c, 0x62cf2268} }, +/**/ {{0x3b9ee53b, 0x82e39e04} },}, +/**/ {{{0x3fc6ffff, 0xfd9106ea} }, +/**/ {{0x3fc74032, 0xf298f6f7} }, +/**/ {{0x40160551, 0x1f4f84a9} }, +/**/ {{0xbbb59c4a, 0x112634b8} },}, +/**/ {{{0x3fc78000, 0x0f649a4f} }, +/**/ {{0x3fc7c484, 0x6ca53abc} }, +/**/ {{0x40158ab9, 0x4809d175} }, +/**/ {{0x3bc91c75, 0x73d3cd2e} },}, +/**/ {{{0x3fc7ffff, 0xef06bbd8} }, +/**/ {{0x3fc84906, 0xdf7d76ad} }, +/**/ {{0x4015152e, 0xdd2b30a6} }, +/**/ {{0xbbbfa2da, 0x084c3eef} },}, +/**/ {{{0x3fc88000, 0x021c6334} }, +/**/ {{0x3fc8cdbb, 0xd965f986} }, +/**/ {{0x4014a462, 0x51b74296} }, +/**/ {{0xbb9ec02e, 0x74dcfe0b} },}, +/**/ {{{0x3fc8ffff, 0xf38d0756} }, +/**/ {{0x3fc952a4, 0x28e173c7} }, +/**/ {{0x4014380b, 0x17b59ebd} }, +/**/ {{0xbbcd0f1c, 0xb77589f0} },}, +/**/ {{{0x3fc98000, 0x104efca1} }, +/**/ {{0x3fc9d7c1, 0x4644d23c} }, +/**/ {{0x4013cfe5, 0xcb1eabd5} }, +/**/ {{0xbbd5d6f7, 0xea188d9e} },}, +/**/ {{{0x3fca0000, 0x09417b30} }, +/**/ {{0x3fca5d14, 0x096d76aa} }, +/**/ {{0x40136bb4, 0xb3723db0} }, +/**/ {{0x3bbe3e0d, 0xfbf3979c} },}, +/**/ {{{0x3fca7fff, 0xeb1c23ec} }, +/**/ {{0x3fcae29d, 0xab60288d} }, +/**/ {{0x40130b3e, 0x783071d7} }, +/**/ {{0xbbc7dd82, 0x3d5384bf} },}, +/**/ {{{0x3fcaffff, 0xfb171c13} }, +/**/ {{0x3fcb685f, 0xa221a96b} }, +/**/ {{0x4012ae4d, 0xd8c0747d} }, +/**/ {{0x3bd4644b, 0xd5554972} },}, +/**/ {{{0x3fcb8000, 0x0aba44be} }, +/**/ {{0x3fcbee5a, 0xecdf241f} }, +/**/ {{0x401254b1, 0xc6fad63b} }, +/**/ {{0x3ba41916, 0xd092b85a} },}, +/**/ {{{0x3fcc0000, 0x113d2a3e} }, +/**/ {{0x3fcc7490, 0xb3e92543} }, +/**/ {{0x4011fe3c, 0x9a62c035} }, +/**/ {{0xbba3cc39, 0x41a03739} },}, +/**/ {{{0x3fcc7fff, 0xf49e00ce} }, +/**/ {{0x3fccfb02, 0x0f59eab0} }, +/**/ {{0x4011aac3, 0xe956a631} }, +/**/ {{0xbbb7a383, 0xbfa8cb5b} },}, +/**/ {{{0x3fcd0000, 0x05f611ab} }, +/**/ {{0x3fcd81b0, 0x89e6844e} }, +/**/ {{0x40115a1f, 0xf391268d} }, +/**/ {{0x3bd39b5c, 0xb2dc91f3} },}, +/**/ {{{0x3fcd8000, 0x14764ceb} }, +/**/ {{0x3fce089d, 0x27debf0d} }, +/**/ {{0x40110c2b, 0xfbc84740} }, +/**/ {{0x3bc14d4d, 0x84712510} },}, +/**/ {{{0x3fce0000, 0x14bcea76} }, +/**/ {{0x3fce8fc9, 0x16dbc820} }, +/**/ {{0x4010c0c5, 0xa00ca48e} }, +/**/ {{0xbbd33788, 0x640f1b9e} },}, +/**/ {{{0x3fce7fff, 0xfd7995bd} }, +/**/ {{0x3fcf1735, 0x88b50424} }, +/**/ {{0x401077cc, 0xbe02169a} }, +/**/ {{0xbbb61fee, 0x221fdf77} },}, +/**/ {{{0x3fcf0000, 0x0cc35436} }, +/**/ {{0x3fcf9ee3, 0xfd21a40b} }, +/**/ {{0x40103123, 0x1ee7ffe8} }, +/**/ {{0x3bd427e3, 0xc79ff5c1} },}, +/**/ {{{0x3fcf8000, 0x01d1da33} }, +/**/ {{0x3fd0136a, 0xb7dbe15c} }, +/**/ {{0x400fd959, 0x77d559e5} }, +/**/ {{0x3bb0c6a1, 0xd67948d7} },}, +/**/ {{{0x3fd00000, 0x060c13b2} }, +/**/ {{0x3fd05785, 0xaaad4f18} }, +/**/ {{0x400f549e, 0x2675d182} }, +/**/ {{0xbbc15208, 0x18f0dd10} },}, +/**/ {{{0x3fd04000, 0x03885492} }, +/**/ {{0x3fd09bc3, 0x660542d7} }, +/**/ {{0x400ed3e2, 0xdf3f5fec} }, +/**/ {{0xbbd95657, 0xb883ae62} },}, +/**/ {{{0x3fd08000, 0x052f5a13} }, +/**/ {{0x3fd0e024, 0x9a195045} }, +/**/ {{0x400e56f8, 0xfa68f2c8} }, +/**/ {{0x3bded7ba, 0x5a543e8e} },}, +/**/ {{{0x3fd0c000, 0x02ba1af5} }, +/**/ {{0x3fd124a9, 0xe2e7f24b} }, +/**/ {{0x400dddb4, 0xbffe633f} }, +/**/ {{0xbbdcba86, 0x0c60278f} },}, +/**/ {{{0x3fd0ffff, 0xf76642c1} }, +/**/ {{0x3fd16953, 0xe162ffe6} }, +/**/ {{0x400d67ed, 0x0311d5d5} }, +/**/ {{0x3b7b1f4a, 0xe40c5f9e} },}, +/**/ {{{0x3fd14000, 0x033602f0} }, +/**/ {{0x3fd1ae23, 0x5f49508e} }, +/**/ {{0x400cf57a, 0xb8708266} }, +/**/ {{0xbbd6a6c2, 0x8620f301} },}, +/**/ {{{0x3fd17fff, 0xfefd1a13} }, +/**/ {{0x3fd1f318, 0xdb2a9ba1} }, +/**/ {{0x400c8639, 0x8d11009e} }, +/**/ {{0x3bd3a9c6, 0x69b21d3b} },}, +/**/ {{{0x3fd1bfff, 0xf718365d} }, +/**/ {{0x3fd23835, 0x0c41e3ac} }, +/**/ {{0x400c1a06, 0xe02be47c} }, +/**/ {{0x3bdb961a, 0x129e8cd1} },}, +/**/ {{{0x3fd1ffff, 0xff001e00} }, +/**/ {{0x3fd27d78, 0xb2f6395e} }, +/**/ {{0x400bb0c1, 0xf2fe9a85} }, +/**/ {{0x3be074a9, 0xe68fd7d8} },}, +/**/ {{{0x3fd23fff, 0xfe425a6a} }, +/**/ {{0x3fd2c2e4, 0x618faabe} }, +/**/ {{0x400b4a4c, 0x190b18df} }, +/**/ {{0xbbdf0d1f, 0xf615aad1} },}, +/**/ {{{0x3fd28000, 0x059ec1db} }, +/**/ {{0x3fd30878, 0xd8583884} }, +/**/ {{0x400ae688, 0x0cd82bc2} }, +/**/ {{0xbbd563c3, 0x141c1f8d} },}, +/**/ {{{0x3fd2c000, 0x000dd081} }, +/**/ {{0x3fd34e36, 0xaffdb6d8} }, +/**/ {{0x400a855a, 0x5270fc15} }, +/**/ {{0xbbc6d88d, 0x9f2cdafd} },}, +/**/ {{{0x3fd2ffff, 0xfc1dcd2b} }, +/**/ {{0x3fd3941e, 0xa95875bc} }, +/**/ {{0x400a26a8, 0xaa9502b6} }, +/**/ {{0xbbe13cad, 0x8389b15c} },}, +/**/ {{{0x3fd33fff, 0xf6c0d4a0} }, +/**/ {{0x3fd3da31, 0x739845f5} }, +/**/ {{0x4009ca5a, 0x4d2573a0} }, +/**/ {{0xbbc71636, 0xacaee379} },}, +/**/ {{{0x3fd38000, 0x06b16793} }, +/**/ {{0x3fd4206f, 0xdbc088f0} }, +/**/ {{0x40097057, 0x9344e33a} }, +/**/ {{0xbbc2c052, 0x1d7a4f81} },}, +/**/ {{{0x3fd3c000, 0x07358fa3} }, +/**/ {{0x3fd466da, 0x6f23311d} }, +/**/ {{0x4009188a, 0x5aa612ea} }, +/**/ {{0x3b8653a5, 0x685e8edc} },}, +/**/ {{{0x3fd3ffff, 0xfc3b18cf} }, +/**/ {{0x3fd4ad71, 0xe9282e6b} }, +/**/ {{0x4008c2dd, 0x641e643d} }, +/**/ {{0x3b95f0ef, 0x3f567c64} },}, +/**/ {{{0x3fd44000, 0x000dd2a8} }, +/**/ {{0x3fd4f437, 0x1fa3f2d1} }, +/**/ {{0x40086f3c, 0x6072f821} }, +/**/ {{0x3bb68efa, 0x95ff68b5} },}, +/**/ {{{0x3fd47fff, 0xfbb43713} }, +/**/ {{0x3fd53b2a, 0xb3ac333c} }, +/**/ {{0x40081d94, 0x3da56692} }, +/**/ {{0xbbbf4d7f, 0x2985fd3f} },}, +/**/ {{{0x3fd4bfff, 0xfb113bf4} }, +/**/ {{0x3fd5824d, 0x6e8ed9c2} }, +/**/ {{0x4007cdd2, 0xa8add00f} }, +/**/ {{0x3bcf478a, 0x1c9b3657} },}, +/**/ {{{0x3fd4ffff, 0xf7f087c9} }, +/**/ {{0x3fd5c9a0, 0x07446496} }, +/**/ {{0x40077fe6, 0x444588eb} }, +/**/ {{0xbbc177dc, 0xa4eabb0c} },}, +/**/ {{{0x3fd54000, 0x088b3814} }, +/**/ {{0x3fd61123, 0x564125f9} }, +/**/ {{0x400733be, 0x6281a765} }, +/**/ {{0xbbc2c52c, 0xf57051c4} },}, +/**/ {{{0x3fd57fff, 0xf7d55966} }, +/**/ {{0x3fd658d7, 0xe194a5d5} }, +/**/ {{0x4006e94b, 0x73b47d1f} }, +/**/ {{0x3bda2fcf, 0xf9996dc6} },}, +/**/ {{{0x3fd5c000, 0x08bf2490} }, +/**/ {{0x3fd6a0be, 0xb775b28d} }, +/**/ {{0x4006a07e, 0x15b6ec28} }, +/**/ {{0xbbe0ca90, 0xaa5285b8} },}, +/**/ {{{0x3fd60000, 0x09fa853f} }, +/**/ {{0x3fd6e8d8, 0x65a66cfd} }, +/**/ {{0x40065948, 0x1c701269} }, +/**/ {{0x3bd9ea95, 0x8591e13a} },}, +/**/ {{{0x3fd64000, 0x07595fca} }, +/**/ {{0x3fd73125, 0xc0556a7c} }, +/**/ {{0x4006139b, 0xbaae9d02} }, +/**/ {{0x3bd88aff, 0x40152b83} },}, +/**/ {{{0x3fd68000, 0x031687da} }, +/**/ {{0x3fd779a7, 0x92e2cfd0} }, +/**/ {{0x4005cf6b, 0xcae0882b} }, +/**/ {{0xbbd8a4a2, 0x9f439451} },}, +/**/ {{{0x3fd6bfff, 0xf5c8cfe2} }, +/**/ {{0x3fd7c25e, 0x9fb452ed} }, +/**/ {{0x40058cab, 0xc561f1cd} }, +/**/ {{0xbbe371a6, 0xf6a37d74} },}, +/**/ {{{0x3fd6ffff, 0xf81df231} }, +/**/ {{0x3fd80b4b, 0xcfb4dab5} }, +/**/ {{0x40054b4f, 0x8d3ca5d3} }, +/**/ {{0x3bcb4686, 0x679dc99f} },}, +/**/ {{{0x3fd73fff, 0xfa71385e} }, +/**/ {{0x3fd8546f, 0xe007a9b6} }, +/**/ {{0x40050b4b, 0xb3b22176} }, +/**/ {{0xbbcd1540, 0xa5c73477} },}, +/**/ {{{0x3fd78000, 0x024a9c2b} }, +/**/ {{0x3fd89dcb, 0xa7fcf5cf} }, +/**/ {{0x4004cc95, 0x3159cbe1} }, +/**/ {{0xbbdc25ea, 0xd58a6ad0} },}, +/**/ {{{0x3fd7c000, 0x02eb62b8} }, +/**/ {{0x3fd8e75f, 0xec0ba5cf} }, +/**/ {{0x40048f21, 0x8731eeea} }, +/**/ {{0xbbc1cb73, 0xcc1adafb} },}, +/**/ {{{0x3fd80000, 0x054a52d1} }, +/**/ {{0x3fd9312d, 0x8bb822e9} }, +/**/ {{0x400452e6, 0x9170a729} }, +/**/ {{0xbbd8bb17, 0xeac002ee} },}, +/**/ {{{0x3fd83fff, 0xf93a00a3} }, +/**/ {{0x3fd97b35, 0x4bb9ad2a} }, +/**/ {{0x400417da, 0xae924e7f} }, +/**/ {{0x3bd4b800, 0x9a378cc7} },}, +/**/ {{{0x3fd87fff, 0xfbdc91c1} }, +/**/ {{0x3fd9c578, 0x2771b601} }, +/**/ {{0x4003ddf4, 0x78855799} }, +/**/ {{0x3bd9077d, 0xa00445d9} },}, +/**/ {{{0x3fd8bfff, 0xf6d215e6} }, +/**/ {{0x3fda0ff6, 0xe0ea4a0b} }, +/**/ {{0x4003a52b, 0x189a0989} }, +/**/ {{0xbbda6831, 0x89c0613d} },}, +/**/ {{{0x3fd90000, 0x02f734ef} }, +/**/ {{0x3fda5ab2, 0x736bf579} }, +/**/ {{0x40036d75, 0xe9244ca6} }, +/**/ {{0x3be3a6d8, 0x4b722377} },}, +/**/ {{{0x3fd94000, 0x04eef8b4} }, +/**/ {{0x3fdaa5ab, 0x9fb6e3d0} }, +/**/ {{0x400336cc, 0xc9089cb7} }, +/**/ {{0x3b9f6963, 0x22cc00bb} },}, +/**/ {{{0x3fd98000, 0x041ec76a} }, +/**/ {{0x3fdaf0e3, 0x5176c7e4} }, +/**/ {{0x40030127, 0xcb0b9506} }, +/**/ {{0x3bb1ffdb, 0x5385a849} },}, +/**/ {{{0x3fd9c000, 0x08044e47} }, +/**/ {{0x3fdb3c5a, 0x77071224} }, +/**/ {{0x4002cc7f, 0x50d75ec7} }, +/**/ {{0xbbb0fade, 0x78effc8a} },}, +/**/ {{{0x3fda0000, 0x01f8235b} }, +/**/ {{0x3fdb8811, 0xe725782e} }, +/**/ {{0x400298cc, 0x18fbfb37} }, +/**/ {{0xbbe55ed3, 0x3b50e71b} },}, +/**/ {{{0x3fda3fff, 0xfb8c6f08} }, +/**/ {{0x3fdbd40a, 0x97b086f3} }, +/**/ {{0x40026607, 0x154de04b} }, +/**/ {{0xbbdec65e, 0x455faae3} },}, +/**/ {{{0x3fda7fff, 0xfb3d63e1} }, +/**/ {{0x3fdc2045, 0x7d9a3b8a} }, +/**/ {{0x40023429, 0x7e60bfbb} }, +/**/ {{0x3be3001c, 0x154ebd33} },}, +/**/ {{{0x3fdabfff, 0xf5f45c48} }, +/**/ {{0x3fdc6cc3, 0x7b8d45e6} }, +/**/ {{0x4002032c, 0xdb1ace69} }, +/**/ {{0xbbe5ebf8, 0x3ed33616} },}, +/**/ {{{0x3fdb0000, 0x0508b34c} }, +/**/ {{0x3fdcb985, 0xa27e8d37} }, +/**/ {{0x4001d30a, 0xd4459a2b} }, +/**/ {{0xbbd01432, 0xae61e2d1} },}, +/**/ {{{0x3fdb4000, 0x0a84710c} }, +/**/ {{0x3fdd068c, 0xc3e50155} }, +/**/ {{0x4001a3bd, 0x775034dd} }, +/**/ {{0xbbe80b1e, 0x58e0e228} },}, +/**/ {{{0x3fdb7fff, 0xf692e9d8} }, +/**/ {{0x3fdd53d9, 0xc49d6627} }, +/**/ {{0x4001753e, 0xfe18066a} }, +/**/ {{0xbbb004c8, 0xf760d33e} },}, +/**/ {{{0x3fdbc000, 0x0280f14d} }, +/**/ {{0x3fdda16d, 0xe4e81013} }, +/**/ {{0x40014789, 0xa38ea052} }, +/**/ {{0x3be848bc, 0x27c9c4ea} },}, +/**/ {{{0x3fdc0000, 0x001121d1} }, +/**/ {{0x3fddef49, 0xeac018f0} }, +/**/ {{0x40011a98, 0x20b8be0c} }, +/**/ {{0xbbe1527e, 0xd0d6010e} },}, +/**/ {{{0x3fdc3fff, 0xfef662aa} }, +/**/ {{0x3fde3d6e, 0xea0c7070} }, +/**/ {{0x4000ee65, 0x32f46ccd} }, +/**/ {{0x3be8d241, 0x189a000d} },}, +/**/ {{{0x3fdc8000, 0x09845818} }, +/**/ {{0x3fde8bdd, 0xf36a8b1b} }, +/**/ {{0x4000c2eb, 0xcac73476} }, +/**/ {{0x3bd221f7, 0x12bed284} },}, +/**/ {{{0x3fdcbfff, 0xfb0493bf} }, +/**/ {{0x3fdeda97, 0xe0c60d10} }, +/**/ {{0x40009827, 0x251c7836} }, +/**/ {{0xbbe0bd54, 0x6eec41b7} },}, +/**/ {{{0x3fdcffff, 0xfd52961f} }, +/**/ {{0x3fdf299d, 0xefb3e44b} }, +/**/ {{0x40006e12, 0x74e459f5} }, +/**/ {{0xbbd93f77, 0xe969c82f} },}, +/**/ {{{0x3fdd3fff, 0xfe2319a4} }, +/**/ {{0x3fdf78f1, 0x17139490} }, +/**/ {{0x400044a9, 0x3e737e94} }, +/**/ {{0xbb91e7cc, 0x49594b7a} },}, +/**/ {{{0x3fdd7fff, 0xfa4de596} }, +/**/ {{0x3fdfc892, 0x638f49e8} }, +/**/ {{0x40001be7, 0x231057a5} }, +/**/ {{0x3bd482b0, 0xf5af9f5f} },}, +/**/ {{{0x3fddbfff, 0xfe729a69} }, +/**/ {{0x3fe00c41, 0x7c6ab019} }, +/**/ {{0x3fffe78f, 0xbf612660} }, +/**/ {{0x3bea5cda, 0x00da681e} },}, +/**/ {{{0x3fde0000, 0x09d66802} }, +/**/ {{0x3fe03461, 0xf6b883cf} }, +/**/ {{0x3fff988e, 0xbc05a87c} }, +/**/ {{0xbbe06c33, 0xf2372669} },}, +/**/ {{{0x3fde3fff, 0xfb211657} }, +/**/ {{0x3fe05cab, 0x191db8e8} }, +/**/ {{0x3fff4ac3, 0x7bcfe6be} }, +/**/ {{0xbbd5d51f, 0x5ed8d35b} },}, +/**/ {{{0x3fde8000, 0x0a3f068a} }, +/**/ {{0x3fe0851d, 0x95fb54f0} }, +/**/ {{0x3ffefe26, 0x144ca408} }, +/**/ {{0xbbc7c894, 0xa2c169c5} },}, +/**/ {{{0x3fdec000, 0x01adb060} }, +/**/ {{0x3fe0adb9, 0xdc7b54f9} }, +/**/ {{0x3ffeb2af, 0x5ebe52a7} }, +/**/ {{0x3bd4e740, 0x312c5ffd} },}, +/**/ {{{0x3fdeffff, 0xff5c0d01} }, +/**/ {{0x3fe0d680, 0x92550a8d} }, +/**/ {{0x3ffe6858, 0x0d71fdf0} }, +/**/ {{0x3bddd8a6, 0x96b35499} },}, +/**/ {{{0x3fdf3fff, 0xf93d5fcc} }, +/**/ {{0x3fe0ff72, 0x45cb4374} }, +/**/ {{0x3ffe1f19, 0x3cce5040} }, +/**/ {{0xbbc9f0ec, 0x7c1efab4} },}, +/**/ {{{0x3fdf7fff, 0xfa0dd18f} }, +/**/ {{0x3fe1288f, 0x944dd508} }, +/**/ {{0x3ffdd6ec, 0x298b874d} }, +/**/ {{0x3bea6ebd, 0x9642a0a6} },}, +/**/ {{{0x3fdfbfff, 0xfd3a9f1a} }, +/**/ {{0x3fe151d9, 0x13750f3e} }, +/**/ {{0x3ffd8fca, 0x5806a27e} }, +/**/ {{0x3bda2a03, 0xfc65ac7a} },}, +/**/ {{{0x3fdfffff, 0xfc481400} }, +/**/ {{0x3fe17b4f, 0x598944ca} }, +/**/ {{0x3ffd49ad, 0x82532170} }, +/**/ {{0x3bc4412e, 0x3d236dc3} },}, +/**/ {{{0x3fe01fff, 0xff53786c} }, +/**/ {{0x3fe1a4f3, 0x07d83d47} }, +/**/ {{0x3ffd048f, 0x851bffeb} }, +/**/ {{0x3bd1589d, 0x29f81b14} },}, +/**/ {{{0x3fe03fff, 0xfee301b7} }, +/**/ {{0x3fe1cec4, 0xb8a6a382} }, +/**/ {{0x3ffcc06a, 0x7c519db6} }, +/**/ {{0x3bd370e6, 0x5b24d6b2} },}, +/**/ {{{0x3fe06000, 0x006e36bf} }, +/**/ {{0x3fe1f8c5, 0x114eb8be} }, +/**/ {{0x3ffc7d38, 0xa34d6786} }, +/**/ {{0xbbea92de, 0x4b98c1d4} },}, +/**/ {{{0x3fe07fff, 0xfd60aa43} }, +/**/ {{0x3fe222f4, 0xabeccecb} }, +/**/ {{0x3ffc3af4, 0x77342ac4} }, +/**/ {{0xbbdd47f6, 0x03a5c2c2} },}, +/**/ {{{0x3fe0a000, 0x037762e8} }, +/**/ {{0x3fe24d54, 0x3f99efe8} }, +/**/ {{0x3ffbf998, 0x75f54fab} }, +/**/ {{0x3bedf7f4, 0x15771a46} },}, +/**/ {{{0x3fe0bfff, 0xff1c6921} }, +/**/ {{0x3fe277e4, 0x598e35d0} }, +/**/ {{0x3ffbb91f, 0x8addd186} }, +/**/ {{0x3be0f16c, 0x5e0e5a73} },}, +/**/ {{{0x3fe0dfff, 0xff07154b} }, +/**/ {{0x3fe2a2a5, 0xb6bc3986} }, +/**/ {{0x3ffb7984, 0x8301646d} }, +/**/ {{0xbbf02dd0, 0xbbaa5310} },}, +/**/ {{{0x3fe10000, 0x02fcdda4} }, +/**/ {{0x3fe2cd99, 0x02a59f1e} }, +/**/ {{0x3ffb3ac2, 0x705219bf} }, +/**/ {{0xbbe59357, 0x112fa616} },}, +/**/ {{{0x3fe12000, 0x01ce1140} }, +/**/ {{0x3fe2f8be, 0xdf0a67c2} }, +/**/ {{0x3ffafcd4, 0x9ab8ae2a} }, +/**/ {{0x3be2c542, 0x9303f346} },}, +/**/ {{{0x3fe14000, 0x04d0f355} }, +/**/ {{0x3fe32418, 0x08fcc7bf} }, +/**/ {{0x3ffabfb6, 0x497b9a36} }, +/**/ {{0x3bebc044, 0xb5a59234} },}, +/**/ {{{0x3fe16000, 0x00fb0c8a} }, +/**/ {{0x3fe34fa5, 0x2471618b} }, +/**/ {{0x3ffa8363, 0x0d26d117} }, +/**/ {{0xbbdbfbb2, 0x3f7bb7c9} },}, +/**/ {{{0x3fe18000, 0x026f10b3} }, +/**/ {{0x3fe37b66, 0xf7579056} }, +/**/ {{0x3ffa47d6, 0x6b4cf4b1} }, +/**/ {{0x3bf0f6b4, 0xaf0b5de9} },}, +/**/ {{{0x3fe19fff, 0xfd0978f8} }, +/**/ {{0x3fe3a75e, 0x290cc78c} }, +/**/ {{0x3ffa0d0c, 0x36c21315} }, +/**/ {{0x3beb2129, 0xa296b262} },}, +/**/ {{{0x3fe1bfff, 0xfd94840b} }, +/**/ {{0x3fe3d38b, 0x85b4e4a4} }, +/**/ {{0x3ff9d300, 0x32f2ecef} }, +/**/ {{0xbbdbab1a, 0xb9bb7d74} },}, +/**/ {{{0x3fe1dfff, 0xfbda1ea1} }, +/**/ {{0x3fe3ffef, 0xbf3cee2f} }, +/**/ {{0x3ff999ae, 0x6770fed8} }, +/**/ {{0x3bda0bdc, 0xb4ace9a4} },}, +/**/ {{{0x3fe1ffff, 0xfc989533} }, +/**/ {{0x3fe42c8b, 0x9c27900c} }, +/**/ {{0x3ff96112, 0xe0d9f1ac} }, +/**/ {{0xbbee19eb, 0x2fa2d81a} },}, +/**/ {{{0x3fe22000, 0x012b8d26} }, +/**/ {{0x3fe4595f, 0xe11975ca} }, +/**/ {{0x3ff92929, 0xcdaa4e80} }, +/**/ {{0x3bf23382, 0xacc82d4b} },}, +/**/ {{{0x3fe24000, 0x04f4d6af} }, +/**/ {{0x3fe4866d, 0x4d224131} }, +/**/ {{0x3ff8f1ef, 0x815c34e8} }, +/**/ {{0xbbd0c6ff, 0x3b740a99} },}, +/**/ {{{0x3fe25fff, 0xfcc07bda} }, +/**/ {{0x3fe4b3b4, 0x98b7d010} }, +/**/ {{0x3ff8bb60, 0x73e7ffa1} }, +/**/ {{0x3bebc31b, 0x1ad7a9c2} },}, +/**/ {{{0x3fe28000, 0x042d9639} }, +/**/ {{0x3fe4e136, 0xb64540d1} }, +/**/ {{0x3ff88578, 0xf4374938} }, +/**/ {{0x3be36de9, 0x1b85e901} },}, +/**/ {{{0x3fe2a000, 0x03be29a0} }, +/**/ {{0x3fe50ef4, 0x52bffd96} }, +/**/ {{0x3ff85035, 0xc0042c06} }, +/**/ {{0x3be15d01, 0x76f5efbd} },}, +/**/ {{{0x3fe2bfff, 0xfaa91f12} }, +/**/ {{0x3fe53cee, 0x3e2f4e0d} }, +/**/ {{0x3ff81b93, 0x8542df07} }, +/**/ {{0x3be555cd, 0x17662a2b} },}, +/**/ {{{0x3fe2dfff, 0xfe884891} }, +/**/ {{0x3fe56b25, 0x6c1a2470} }, +/**/ {{0x3ff7e78e, 0xe422ea70} }, +/**/ {{0x3bf03504, 0xbd030c11} },}, +/**/ {{{0x3fe2ffff, 0xfe87152b} }, +/**/ {{0x3fe5999a, 0x9beaaaa1} }, +/**/ {{0x3ff7b424, 0xd18fe9b3} }, +/**/ {{0xbb649a5f, 0x773e0e64} },}, +/**/ {{{0x3fe31fff, 0xffc1a721} }, +/**/ {{0x3fe5c84e, 0xafe0e564} }, +/**/ {{0x3ff78152, 0x338db8d4} }, +/**/ {{0x3beaf428, 0x5da8e935} },}, +/**/ {{{0x3fe33fff, 0xff70a372} }, +/**/ {{0x3fe5f742, 0x82191d64} }, +/**/ {{0x3ff74f14, 0x1122bcae} }, +/**/ {{0x3bdb1c4b, 0xdee4bfaf} },}, +/**/ {{{0x3fe36000, 0x0436e836} }, +/**/ {{0x3fe62676, 0xfde6ccff} }, +/**/ {{0x3ff71d67, 0x7644252c} }, +/**/ {{0xbbec3d10, 0xe08c3afb} },}, +/**/ {{{0x3fe37fff, 0xfcbe9641} }, +/**/ {{0x3fe655ec, 0xee9ffdaf} }, +/**/ {{0x3ff6ec49, 0xa6fc0515} }, +/**/ {{0x3bdda453, 0x2ed29567} },}, +/**/ {{{0x3fe39fff, 0xffb6d6ca} }, +/**/ {{0x3fe685a5, 0x5e67a1e1} }, +/**/ {{0x3ff6bbb7, 0xbc2ae969} }, +/**/ {{0x3becbf7b, 0x2ef43882} },}, +/**/ {{{0x3fe3c000, 0x04934fec} }, +/**/ {{0x3fe6b5a1, 0x2cc07d75} }, +/**/ {{0x3ff68baf, 0x10b02ef8} }, +/**/ {{0xbbe7c8fb, 0xfeb7cabd} },}, +/**/ {{{0x3fe3e000, 0x03f5cf7f} }, +/**/ {{0x3fe6e5e1, 0x3e59def6} }, +/**/ {{0x3ff65c2d, 0x0e61500f} }, +/**/ {{0xbbe30ba4, 0x035f7845} },}, +/**/ {{{0x3fe40000, 0x05280ad9} }, +/**/ {{0x3fe71666, 0x91ab4c3e} }, +/**/ {{0x3ff62d2f, 0x19f01c90} }, +/**/ {{0xbbf1e9f5, 0xffe95f6a} },}, +/**/ {{{0x3fe42000, 0x049efb65} }, +/**/ {{0x3fe74732, 0x18af3b9d} }, +/**/ {{0x3ff5feb2, 0xb86465e4} }, +/**/ {{0x3bc4cad7, 0x280d591e} },}, +/**/ {{{0x3fe44000, 0x0035ccb6} }, +/**/ {{0x3fe77844, 0xcb4ff1e5} }, +/**/ {{0x3ff5d0b5, 0x7c455428} }, +/**/ {{0x3bed8c18, 0x7ba5617c} },}, +/**/ {{{0x3fe46000, 0x03346717} }, +/**/ {{0x3fe7a99f, 0xba258778} }, +/**/ {{0x3ff5a334, 0xf4392254} }, +/**/ {{0xbbefd14a, 0xfc84a570} },}, +/**/ {{{0x3fe48000, 0x03002575} }, +/**/ {{0x3fe7db43, 0xd836768f} }, +/**/ {{0x3ff5762e, 0xdcf97e0c} }, +/**/ {{0xbbdd7eba, 0x5f5df49e} },}, +/**/ {{{0x3fe4a000, 0x055bf381} }, +/**/ {{0x3fe80d32, 0x35edeefa} }, +/**/ {{0x3ff549a0, 0xea46e31f} }, +/**/ {{0xbbdba522, 0x76823eac} },}, +/**/ {{{0x3fe4c000, 0x04ce10e3} }, +/**/ {{0x3fe83f6b, 0xd67dc1a8} }, +/**/ {{0x3ff51d88, 0xed82bcc4} }, +/**/ {{0xbbeae92d, 0x077d29ea} },}, +/**/ {{{0x3fe4e000, 0x016c60e1} }, +/**/ {{0x3fe871f1, 0xca0aaf31} }, +/**/ {{0x3ff4f1e4, 0xbdacbf16} }, +/**/ {{0x3be82958, 0x46ee425e} },}, +/**/ {{{0x3fe4ffff, 0xff966f0a} }, +/**/ {{0x3fe8a4c5, 0x2bff2dae} }, +/**/ {{0x3ff4c6b2, 0x3917657e} }, +/**/ {{0xbbf127c2, 0x5c86c705} },}, +/**/ {{{0x3fe52000, 0x0076e6eb} }, +/**/ {{0x3fe8d7e7, 0x175651e8} }, +/**/ {{0x3ff49bef, 0x4f459b05} }, +/**/ {{0xbbb1e9d1, 0x4181bbfc} },}, +/**/ {{{0x3fe54000, 0x03d12d3b} }, +/**/ {{0x3fe90b58, 0xa976ed56} }, +/**/ {{0x3ff47199, 0xfdf24af4} }, +/**/ {{0x3be38c17, 0xc30decaf} },}, +/**/ {{{0x3fe55fff, 0xfce7fa8d} }, +/**/ {{0x3fe93f1a, 0xf03a3a09} }, +/**/ {{0x3ff447b0, 0x5f13234b} }, +/**/ {{0x3bf1b8b2, 0x70df7e20} },}, +/**/ {{{0x3fe58000, 0x0331b46a} }, +/**/ {{0x3fe9732f, 0x38e83134} }, +/**/ {{0x3ff41e30, 0x68d8b41b} }, +/**/ {{0xbbee24d8, 0xb90bc28b} },}, +/**/ {{{0x3fe59fff, 0xfc14848e} }, +/**/ {{0x3fe9a796, 0x8471b489} }, +/**/ {{0x3ff3f518, 0x5de3aa73} }, +/**/ {{0xbbecacd9, 0xe0761536} },}, +/**/ {{{0x3fe5bfff, 0xfb7cd395} }, +/**/ {{0x3fe9dc52, 0x24a8b955} }, +/**/ {{0x3ff3cc66, 0x4f8fff15} }, +/**/ {{0xbbf67c97, 0x82045611} },}, +/**/ {{{0x3fe5e000, 0x000dcc40} }, +/**/ {{0x3fea1163, 0x4df5b93e} }, +/**/ {{0x3ff3a418, 0x75853228} }, +/**/ {{0xbbf585da, 0xd481f350} },}, +/**/ {{{0x3fe60000, 0x02efd2fc} }, +/**/ {{0x3fea46cb, 0x30d16323} }, +/**/ {{0x3ff37c2d, 0x187962ae} }, +/**/ {{0x3bf004c3, 0xa5f77bb0} },}, +/**/ {{{0x3fe61fff, 0xfeb8088a} }, +/**/ {{0x3fea7c8b, 0x053920c0} }, +/**/ {{0x3ff354a2, 0x891769a9} }, +/**/ {{0x3bbc6b30, 0x3fee3029} },}, +/**/ {{{0x3fe64000, 0x00f3ca06} }, +/**/ {{0x3feab2a4, 0x28a1911a} }, +/**/ {{0x3ff32d77, 0x0a6f0a4a} }, +/**/ {{0x3bf2a6f8, 0xfac5081a} },}, +/**/ {{{0x3fe65fff, 0xfe9ec2f4} }, +/**/ {{0x3feae917, 0xd4ce7239} }, +/**/ {{0x3ff306a9, 0x0751a948} }, +/**/ {{0xbbe950b5, 0x51ab9dbd} },}, +/**/ {{{0x3fe68000, 0x03d43966} }, +/**/ {{0x3feb1fe7, 0x708b998a} }, +/**/ {{0x3ff2e036, 0xd7a153c7} }, +/**/ {{0x3bdd36e2, 0xa1e4a14e} },}, +/**/ {{{0x3fe69fff, 0xfab67783} }, +/**/ {{0x3feb5714, 0x2e575464} }, +/**/ {{0x3ff2ba1f, 0x05006cb6} }, +/**/ {{0x3bea9a4a, 0x473c2e31} },}, +/**/ {{{0x3fe6bfff, 0xfcb65f89} }, +/**/ {{0x3feb8e9f, 0x981efd2f} }, +/**/ {{0x3ff2945f, 0xe948d9f7} }, +/**/ {{0xbbca5294, 0xe802df72} },}, +/**/ {{{0x3fe6dfff, 0xfc5609a9} }, +/**/ {{0x3febc68a, 0xfaed6ff1} }, +/**/ {{0x3ff26ef8, 0x1533411e} }, +/**/ {{0xbbf89153, 0xf51bc566} },}, +/**/ {{{0x3fe6ffff, 0xfc4eef86} }, +/**/ {{0x3febfed7, 0xc62205fe} }, +/**/ {{0x3ff249e6, 0x0e70978c} }, +/**/ {{0x3bc39021, 0xa2b9ff56} },}, +/**/ {{{0x3fe72000, 0x004d98b3} }, +/**/ {{0x3fec3787, 0x716968ad} }, +/**/ {{0x3ff22528, 0x61be7751} }, +/**/ {{0x3befc9c5, 0x74ee2211} },}, +/**/ {{{0x3fe73fff, 0xfc155075} }, +/**/ {{0x3fec709b, 0x5ec6fd4e} }, +/**/ {{0x3ff200bd, 0xb5d53311} }, +/**/ {{0x3be28a4d, 0xa269ae63} },}, +/**/ {{{0x3fe76000, 0x0498c203} }, +/**/ {{0x3fecaa15, 0x323d08c1} }, +/**/ {{0x3ff1dca4, 0x93433f65} }, +/**/ {{0x3bf8cae4, 0x14a28fb7} },}, +/**/ {{{0x3fe77fff, 0xff1e5636} }, +/**/ {{0x3fece3f6, 0x4147c12c} }, +/**/ {{0x3ff1b8db, 0xbfe294a8} }, +/**/ {{0xbbe7e19c, 0x4b56a744} },}, +/**/ {{{0x3fe7a000, 0x0226d45a} }, +/**/ {{0x3fed1e40, 0x4120eb7f} }, +/**/ {{0x3ff19561, 0xd15f8278} }, +/**/ {{0x3be64b28, 0x032c5d4c} },}, +/**/ {{{0x3fe7c000, 0x0250a5aa} }, +/**/ {{0x3fed58f4, 0xb112a1e1} }, +/**/ {{0x3ff17235, 0x8a59d565} }, +/**/ {{0xbbe716de, 0xb8dc7867} },}, +/**/ {{{0x3fe7e000, 0x0482f82e} }, +/**/ {{0x3fed9415, 0x3576bdf0} }, +/**/ {{0x3ff14f55, 0xa22a1c5b} }, +/**/ {{0x3bf207e1, 0xe1305604} },}, +/**/ {{{0x3fe80000, 0x0205003e} }, +/**/ {{0x3fedcfa3, 0x64d69ff7} }, +/**/ {{0x3ff12cc0, 0xe37eb26f} }, +/**/ {{0xbbd52ec6, 0xe32395f8} },}, +/**/ {{{0x3fe81fff, 0xfbf99411} }, +/**/ {{0x3fee0ba0, 0xebf98f51} }, +/**/ {{0x3ff10a76, 0x16ddd5d6} }, +/**/ {{0xbbece0d6, 0x59866045} },}, +/**/ {{{0x3fe84000, 0x0248e3a3} }, +/**/ {{0x3fee480f, 0x9bb7f565} }, +/**/ {{0x3ff0e873, 0xfb84e05c} }, +/**/ {{0x3bf4e5e8, 0x1595df92} },}, +/**/ {{{0x3fe86000, 0x0145c157} }, +/**/ {{0x3fee84f1, 0x0a10b3ab} }, +/**/ {{0x3ff0c6b9, 0x7cbd7b1e} }, +/**/ {{0xbbe19de6, 0xd5f121d0} },}, +/**/ {{{0x3fe88000, 0x022631b9} }, +/**/ {{0x3feec247, 0x0be1f047} }, +/**/ {{0x3ff0a545, 0x6d0b3ee6} }, +/**/ {{0xbbc272b1, 0xa3ba2c6f} },}, +/**/ {{{0x3fe8a000, 0x045f7828} }, +/**/ {{0x3fef0013, 0x6c45ba1c} }, +/**/ {{0x3ff08416, 0xaf2a0f09} }, +/**/ {{0x3be82b56, 0x5b63c799} },}, +/**/ {{{0x3fe8bfff, 0xffc686cf} }, +/**/ {{0x3fef3e57, 0xf03c824b} }, +/**/ {{0x3ff0632c, 0x33502220} }, +/**/ {{0xbbd039ad, 0x2dbeeb25} },}, +/**/ {{{0x3fe8dfff, 0xfd8644c6} }, +/**/ {{0x3fef7d16, 0x8774261d} }, +/**/ {{0x3ff04284, 0xdd5b3019} }, +/**/ {{0x3bd79f33, 0xe1eba933} },}, +/**/ {{{0x3fe8ffff, 0xfe4e7937} }, +/**/ {{0x3fefbc51, 0x1a99a641} }, +/**/ {{0x3ff0221f, 0x9f69840b} }, +/**/ {{0xbbea9e84, 0x7beee018} },}, +/**/ {{{0x3fe92000, 0x0435251f} }, +/**/ {{0x3feffc09, 0x9eb22390} }, +/**/ {{0x3ff001fb, 0x6f7c51e8} }, +/**/ {{0xbb5a12e7, 0x31032e0a} },}, + }; + +#else +#ifdef LITTLE_ENDI +static const number + xfg[186][4] = { /* xi,Fi,Gi,FFi, i=16..201 */ +/**/ {{{0x1e519d60, 0x3fb00000} }, +/**/ {{0x96c4e240, 0x3fb00557} }, +/**/ {{0x628127b7, 0x402ff554} }, +/**/ {{0x9e355b06, 0xbb9a1dee} },}, +/**/ {{{0x1b1a7010, 0x3fb10000} }, +/**/ {{0xaab892b7, 0x3fb10668} }, +/**/ {{0xbe3fdf74, 0x402e12c7} }, +/**/ {{0x037da741, 0x3ba89234} },}, +/**/ {{{0x2505e350, 0x3fb20000} }, +/**/ {{0xff547824, 0x3fb2079b} }, +/**/ {{0xde853633, 0x402c65c5} }, +/**/ {{0xe9614250, 0x3bb7486e} },}, +/**/ {{{0xfcdc4252, 0x3fb2ffff} }, +/**/ {{0x5eb16c68, 0x3fb308f3} }, +/**/ {{0xe56be74f, 0x402ae5da} }, +/**/ {{0x91a23034, 0xbb82c726} },}, +/**/ {{{0xe3ff849f, 0x3fb3ffff} }, +/**/ {{0x154999cc, 0x3fb40a71} }, +/**/ {{0x046b7352, 0x40298c43} }, +/**/ {{0x3843738f, 0x3b9aceaf} },}, +/**/ {{{0xedc9590f, 0x3fb4ffff} }, +/**/ {{0x429bdd80, 0x3fb50c17} }, +/**/ {{0x91b5d674, 0x40285384} }, +/**/ {{0xb4403d22, 0xbbc1d02d} },}, +/**/ {{{0x00ee83f7, 0x3fb60000} }, +/**/ {{0xda80cc21, 0x3fb60de7} }, +/**/ {{0xef21a2a7, 0x40273724} }, +/**/ {{0x72523ffd, 0xbb95e53c} },}, +/**/ {{{0xeb05ea41, 0x3fb6ffff} }, +/**/ {{0xb8c51bea, 0x3fb70fe4} }, +/**/ {{0xfae562ff, 0x40263370} }, +/**/ {{0x8ffe0626, 0xbb99ad0e} },}, +/**/ {{{0xdc0515f7, 0x3fb7ffff} }, +/**/ {{0x1db54498, 0x3fb81210} }, +/**/ {{0x0e7eab5c, 0x40254553} }, +/**/ {{0xd62ed686, 0xbb914c87} },}, +/**/ {{{0xe384d7ab, 0x3fb8ffff} }, +/**/ {{0x2a8d3727, 0x3fb9146c} }, +/**/ {{0xfd57f3fd, 0x40246a33} }, +/**/ {{0x5381e06d, 0xbbbbda8d} },}, +/**/ {{{0xe4832347, 0x3fb9ffff} }, +/**/ {{0xd50e1050, 0x3fba16fa} }, +/**/ {{0xc5537a96, 0x40239fe2} }, +/**/ {{0xc111eabb, 0x3bc7f695} },}, +/**/ {{{0x274540e3, 0x3fbb0000} }, +/**/ {{0x7ae68517, 0x3fbb19be} }, +/**/ {{0x3637e946, 0x4022e481} }, +/**/ {{0x8dbd9d93, 0x3bc307f8} },}, +/**/ {{{0xfebf2e9b, 0x3fbbffff} }, +/**/ {{0x8369cd19, 0x3fbc1cb8} }, +/**/ {{0x17aef223, 0x40223676} }, +/**/ {{0x424a9cf3, 0x3bc50038} },}, +/**/ {{{0x23529045, 0x3fbd0000} }, +/**/ {{0xc11d7ef7, 0x3fbd1feb} }, +/**/ {{0xb8e43d4e, 0x4021945f} }, +/**/ {{0x52a6f224, 0x3b812007} },}, +/**/ {{{0xd872a829, 0x3fbdffff} }, +/**/ {{0x8ee4d6b7, 0x3fbe2359} }, +/**/ {{0x76195d5f, 0x4020fd0c} }, +/**/ {{0x85fdca85, 0xbbb4d9ab} },}, +/**/ {{{0xff323b84, 0x3fbeffff} }, +/**/ {{0xec9073e5, 0x3fbf2704} }, +/**/ {{0x3020200f, 0x40206f71} }, +/**/ {{0x12836992, 0x3bb77aa2} },}, +/**/ {{{0x0ce79195, 0x3fc00000} }, +/**/ {{0xbc30cc61, 0x3fc01577} }, +/**/ {{0xd6564a88, 0x401fd549} }, +/**/ {{0x965c0ad0, 0xbbc8926f} },}, +/**/ {{{0xee40e918, 0x3fc07fff} }, +/**/ {{0x8279ac01, 0x3fc0978d} }, +/**/ {{0x9294bc03, 0x401edbb5} }, +/**/ {{0x4aae45d6, 0xbb80a533} },}, +/**/ {{{0x0cc091fd, 0x3fc10000} }, +/**/ {{0x44dfb2f7, 0x3fc119c5} }, +/**/ {{0x067d8e18, 0x401df0bb} }, +/**/ {{0x4ff642a4, 0xbbcc2c18} },}, +/**/ {{{0x0d9936a1, 0x3fc18000} }, +/**/ {{0xb9085a4b, 0x3fc19c1f} }, +/**/ {{0x71ce3629, 0x401d131a} }, +/**/ {{0x0669355b, 0xbbc36553} },}, +/**/ {{{0xed5f3188, 0x3fc1ffff} }, +/**/ {{0xee74bf2d, 0x3fc21e9d} }, +/**/ {{0xff0cd655, 0x401c41b6} }, +/**/ {{0x478ecfc5, 0x3b8867f5} },}, +/**/ {{{0x05f06a51, 0x3fc28000} }, +/**/ {{0x550b313f, 0x3fc2a141} }, +/**/ {{0x1702e6d2, 0x401b7b92} }, +/**/ {{0x380131fe, 0xbbadab51} },}, +/**/ {{{0xfe3d339e, 0x3fc2ffff} }, +/**/ {{0xa75f76df, 0x3fc3240a} }, +/**/ {{0xfcb6409d, 0x401abfc8} }, +/**/ {{0x0d291d83, 0x3bc60bcf} },}, +/**/ {{{0xed888d6f, 0x3fc37fff} }, +/**/ {{0x13cc5db7, 0x3fc3a6fb} }, +/**/ {{0x8ed5320d, 0x401a0d8f} }, +/**/ {{0x4eef03ab, 0x3bb8a48e} },}, +/**/ {{{0x02ca050d, 0x3fc40000} }, +/**/ {{0xe25776bb, 0x3fc42a13} }, +/**/ {{0xfa84c2bc, 0x4019642d} }, +/**/ {{0xcc56516f, 0xbbd0bd5d} },}, +/**/ {{{0xf2531f5c, 0x3fc47fff} }, +/**/ {{0xdeb73404, 0x3fc4ad55} }, +/**/ {{0xf86e9035, 0x4018c2fe} }, +/**/ {{0x5aa287c8, 0x3b9cffe7} },}, +/**/ {{{0x13774992, 0x3fc50000} }, +/**/ {{0x7d0ee307, 0x3fc530c2} }, +/**/ {{0x370caf35, 0x4018296c} }, +/**/ {{0xf91d6532, 0xbbcf75d1} },}, +/**/ {{{0xedddcb2d, 0x3fc57fff} }, +/**/ {{0x5db4347d, 0x3fc5b45a} }, +/**/ {{0x52190c0e, 0x401796ee} }, +/**/ {{0x17d5d076, 0x3b88a25f} },}, +/**/ {{{0xf41949a0, 0x3fc5ffff} }, +/**/ {{0x13bf986a, 0x3fc6381f} }, +/**/ {{0x2d2255fd, 0x40170b09} }, +/**/ {{0xb1bcd5e7, 0xbb9bfb23} },}, +/**/ {{{0xf834d3a1, 0x3fc67fff} }, +/**/ {{0x8ec85952, 0x3fc6bc11} }, +/**/ {{0x62cf2268, 0x4016854c} }, +/**/ {{0x82e39e04, 0x3b9ee53b} },}, +/**/ {{{0xfd9106ea, 0x3fc6ffff} }, +/**/ {{0xf298f6f7, 0x3fc74032} }, +/**/ {{0x1f4f84a9, 0x40160551} }, +/**/ {{0x112634b8, 0xbbb59c4a} },}, +/**/ {{{0x0f649a4f, 0x3fc78000} }, +/**/ {{0x6ca53abc, 0x3fc7c484} }, +/**/ {{0x4809d175, 0x40158ab9} }, +/**/ {{0x73d3cd2e, 0x3bc91c75} },}, +/**/ {{{0xef06bbd8, 0x3fc7ffff} }, +/**/ {{0xdf7d76ad, 0x3fc84906} }, +/**/ {{0xdd2b30a6, 0x4015152e} }, +/**/ {{0x084c3eef, 0xbbbfa2da} },}, +/**/ {{{0x021c6334, 0x3fc88000} }, +/**/ {{0xd965f986, 0x3fc8cdbb} }, +/**/ {{0x51b74296, 0x4014a462} }, +/**/ {{0x74dcfe0b, 0xbb9ec02e} },}, +/**/ {{{0xf38d0756, 0x3fc8ffff} }, +/**/ {{0x28e173c7, 0x3fc952a4} }, +/**/ {{0x17b59ebd, 0x4014380b} }, +/**/ {{0xb77589f0, 0xbbcd0f1c} },}, +/**/ {{{0x104efca1, 0x3fc98000} }, +/**/ {{0x4644d23c, 0x3fc9d7c1} }, +/**/ {{0xcb1eabd5, 0x4013cfe5} }, +/**/ {{0xea188d9e, 0xbbd5d6f7} },}, +/**/ {{{0x09417b30, 0x3fca0000} }, +/**/ {{0x096d76aa, 0x3fca5d14} }, +/**/ {{0xb3723db0, 0x40136bb4} }, +/**/ {{0xfbf3979c, 0x3bbe3e0d} },}, +/**/ {{{0xeb1c23ec, 0x3fca7fff} }, +/**/ {{0xab60288d, 0x3fcae29d} }, +/**/ {{0x783071d7, 0x40130b3e} }, +/**/ {{0x3d5384bf, 0xbbc7dd82} },}, +/**/ {{{0xfb171c13, 0x3fcaffff} }, +/**/ {{0xa221a96b, 0x3fcb685f} }, +/**/ {{0xd8c0747d, 0x4012ae4d} }, +/**/ {{0xd5554972, 0x3bd4644b} },}, +/**/ {{{0x0aba44be, 0x3fcb8000} }, +/**/ {{0xecdf241f, 0x3fcbee5a} }, +/**/ {{0xc6fad63b, 0x401254b1} }, +/**/ {{0xd092b85a, 0x3ba41916} },}, +/**/ {{{0x113d2a3e, 0x3fcc0000} }, +/**/ {{0xb3e92543, 0x3fcc7490} }, +/**/ {{0x9a62c035, 0x4011fe3c} }, +/**/ {{0x41a03739, 0xbba3cc39} },}, +/**/ {{{0xf49e00ce, 0x3fcc7fff} }, +/**/ {{0x0f59eab0, 0x3fccfb02} }, +/**/ {{0xe956a631, 0x4011aac3} }, +/**/ {{0xbfa8cb5b, 0xbbb7a383} },}, +/**/ {{{0x05f611ab, 0x3fcd0000} }, +/**/ {{0x89e6844e, 0x3fcd81b0} }, +/**/ {{0xf391268d, 0x40115a1f} }, +/**/ {{0xb2dc91f3, 0x3bd39b5c} },}, +/**/ {{{0x14764ceb, 0x3fcd8000} }, +/**/ {{0x27debf0d, 0x3fce089d} }, +/**/ {{0xfbc84740, 0x40110c2b} }, +/**/ {{0x84712510, 0x3bc14d4d} },}, +/**/ {{{0x14bcea76, 0x3fce0000} }, +/**/ {{0x16dbc820, 0x3fce8fc9} }, +/**/ {{0xa00ca48e, 0x4010c0c5} }, +/**/ {{0x640f1b9e, 0xbbd33788} },}, +/**/ {{{0xfd7995bd, 0x3fce7fff} }, +/**/ {{0x88b50424, 0x3fcf1735} }, +/**/ {{0xbe02169a, 0x401077cc} }, +/**/ {{0x221fdf77, 0xbbb61fee} },}, +/**/ {{{0x0cc35436, 0x3fcf0000} }, +/**/ {{0xfd21a40b, 0x3fcf9ee3} }, +/**/ {{0x1ee7ffe8, 0x40103123} }, +/**/ {{0xc79ff5c1, 0x3bd427e3} },}, +/**/ {{{0x01d1da33, 0x3fcf8000} }, +/**/ {{0xb7dbe15c, 0x3fd0136a} }, +/**/ {{0x77d559e5, 0x400fd959} }, +/**/ {{0xd67948d7, 0x3bb0c6a1} },}, +/**/ {{{0x060c13b2, 0x3fd00000} }, +/**/ {{0xaaad4f18, 0x3fd05785} }, +/**/ {{0x2675d182, 0x400f549e} }, +/**/ {{0x18f0dd10, 0xbbc15208} },}, +/**/ {{{0x03885492, 0x3fd04000} }, +/**/ {{0x660542d7, 0x3fd09bc3} }, +/**/ {{0xdf3f5fec, 0x400ed3e2} }, +/**/ {{0xb883ae62, 0xbbd95657} },}, +/**/ {{{0x052f5a13, 0x3fd08000} }, +/**/ {{0x9a195045, 0x3fd0e024} }, +/**/ {{0xfa68f2c8, 0x400e56f8} }, +/**/ {{0x5a543e8e, 0x3bded7ba} },}, +/**/ {{{0x02ba1af5, 0x3fd0c000} }, +/**/ {{0xe2e7f24b, 0x3fd124a9} }, +/**/ {{0xbffe633f, 0x400dddb4} }, +/**/ {{0x0c60278f, 0xbbdcba86} },}, +/**/ {{{0xf76642c1, 0x3fd0ffff} }, +/**/ {{0xe162ffe6, 0x3fd16953} }, +/**/ {{0x0311d5d5, 0x400d67ed} }, +/**/ {{0xe40c5f9e, 0x3b7b1f4a} },}, +/**/ {{{0x033602f0, 0x3fd14000} }, +/**/ {{0x5f49508e, 0x3fd1ae23} }, +/**/ {{0xb8708266, 0x400cf57a} }, +/**/ {{0x8620f301, 0xbbd6a6c2} },}, +/**/ {{{0xfefd1a13, 0x3fd17fff} }, +/**/ {{0xdb2a9ba1, 0x3fd1f318} }, +/**/ {{0x8d11009e, 0x400c8639} }, +/**/ {{0x69b21d3b, 0x3bd3a9c6} },}, +/**/ {{{0xf718365d, 0x3fd1bfff} }, +/**/ {{0x0c41e3ac, 0x3fd23835} }, +/**/ {{0xe02be47c, 0x400c1a06} }, +/**/ {{0x129e8cd1, 0x3bdb961a} },}, +/**/ {{{0xff001e00, 0x3fd1ffff} }, +/**/ {{0xb2f6395e, 0x3fd27d78} }, +/**/ {{0xf2fe9a85, 0x400bb0c1} }, +/**/ {{0xe68fd7d8, 0x3be074a9} },}, +/**/ {{{0xfe425a6a, 0x3fd23fff} }, +/**/ {{0x618faabe, 0x3fd2c2e4} }, +/**/ {{0x190b18df, 0x400b4a4c} }, +/**/ {{0xf615aad1, 0xbbdf0d1f} },}, +/**/ {{{0x059ec1db, 0x3fd28000} }, +/**/ {{0xd8583884, 0x3fd30878} }, +/**/ {{0x0cd82bc2, 0x400ae688} }, +/**/ {{0x141c1f8d, 0xbbd563c3} },}, +/**/ {{{0x000dd081, 0x3fd2c000} }, +/**/ {{0xaffdb6d8, 0x3fd34e36} }, +/**/ {{0x5270fc15, 0x400a855a} }, +/**/ {{0x9f2cdafd, 0xbbc6d88d} },}, +/**/ {{{0xfc1dcd2b, 0x3fd2ffff} }, +/**/ {{0xa95875bc, 0x3fd3941e} }, +/**/ {{0xaa9502b6, 0x400a26a8} }, +/**/ {{0x8389b15c, 0xbbe13cad} },}, +/**/ {{{0xf6c0d4a0, 0x3fd33fff} }, +/**/ {{0x739845f5, 0x3fd3da31} }, +/**/ {{0x4d2573a0, 0x4009ca5a} }, +/**/ {{0xacaee379, 0xbbc71636} },}, +/**/ {{{0x06b16793, 0x3fd38000} }, +/**/ {{0xdbc088f0, 0x3fd4206f} }, +/**/ {{0x9344e33a, 0x40097057} }, +/**/ {{0x1d7a4f81, 0xbbc2c052} },}, +/**/ {{{0x07358fa3, 0x3fd3c000} }, +/**/ {{0x6f23311d, 0x3fd466da} }, +/**/ {{0x5aa612ea, 0x4009188a} }, +/**/ {{0x685e8edc, 0x3b8653a5} },}, +/**/ {{{0xfc3b18cf, 0x3fd3ffff} }, +/**/ {{0xe9282e6b, 0x3fd4ad71} }, +/**/ {{0x641e643d, 0x4008c2dd} }, +/**/ {{0x3f567c64, 0x3b95f0ef} },}, +/**/ {{{0x000dd2a8, 0x3fd44000} }, +/**/ {{0x1fa3f2d1, 0x3fd4f437} }, +/**/ {{0x6072f821, 0x40086f3c} }, +/**/ {{0x95ff68b5, 0x3bb68efa} },}, +/**/ {{{0xfbb43713, 0x3fd47fff} }, +/**/ {{0xb3ac333c, 0x3fd53b2a} }, +/**/ {{0x3da56692, 0x40081d94} }, +/**/ {{0x2985fd3f, 0xbbbf4d7f} },}, +/**/ {{{0xfb113bf4, 0x3fd4bfff} }, +/**/ {{0x6e8ed9c2, 0x3fd5824d} }, +/**/ {{0xa8add00f, 0x4007cdd2} }, +/**/ {{0x1c9b3657, 0x3bcf478a} },}, +/**/ {{{0xf7f087c9, 0x3fd4ffff} }, +/**/ {{0x07446496, 0x3fd5c9a0} }, +/**/ {{0x444588eb, 0x40077fe6} }, +/**/ {{0xa4eabb0c, 0xbbc177dc} },}, +/**/ {{{0x088b3814, 0x3fd54000} }, +/**/ {{0x564125f9, 0x3fd61123} }, +/**/ {{0x6281a765, 0x400733be} }, +/**/ {{0xf57051c4, 0xbbc2c52c} },}, +/**/ {{{0xf7d55966, 0x3fd57fff} }, +/**/ {{0xe194a5d5, 0x3fd658d7} }, +/**/ {{0x73b47d1f, 0x4006e94b} }, +/**/ {{0xf9996dc6, 0x3bda2fcf} },}, +/**/ {{{0x08bf2490, 0x3fd5c000} }, +/**/ {{0xb775b28d, 0x3fd6a0be} }, +/**/ {{0x15b6ec28, 0x4006a07e} }, +/**/ {{0xaa5285b8, 0xbbe0ca90} },}, +/**/ {{{0x09fa853f, 0x3fd60000} }, +/**/ {{0x65a66cfd, 0x3fd6e8d8} }, +/**/ {{0x1c701269, 0x40065948} }, +/**/ {{0x8591e13a, 0x3bd9ea95} },}, +/**/ {{{0x07595fca, 0x3fd64000} }, +/**/ {{0xc0556a7c, 0x3fd73125} }, +/**/ {{0xbaae9d02, 0x4006139b} }, +/**/ {{0x40152b83, 0x3bd88aff} },}, +/**/ {{{0x031687da, 0x3fd68000} }, +/**/ {{0x92e2cfd0, 0x3fd779a7} }, +/**/ {{0xcae0882b, 0x4005cf6b} }, +/**/ {{0x9f439451, 0xbbd8a4a2} },}, +/**/ {{{0xf5c8cfe2, 0x3fd6bfff} }, +/**/ {{0x9fb452ed, 0x3fd7c25e} }, +/**/ {{0xc561f1cd, 0x40058cab} }, +/**/ {{0xf6a37d74, 0xbbe371a6} },}, +/**/ {{{0xf81df231, 0x3fd6ffff} }, +/**/ {{0xcfb4dab5, 0x3fd80b4b} }, +/**/ {{0x8d3ca5d3, 0x40054b4f} }, +/**/ {{0x679dc99f, 0x3bcb4686} },}, +/**/ {{{0xfa71385e, 0x3fd73fff} }, +/**/ {{0xe007a9b6, 0x3fd8546f} }, +/**/ {{0xb3b22176, 0x40050b4b} }, +/**/ {{0xa5c73477, 0xbbcd1540} },}, +/**/ {{{0x024a9c2b, 0x3fd78000} }, +/**/ {{0xa7fcf5cf, 0x3fd89dcb} }, +/**/ {{0x3159cbe1, 0x4004cc95} }, +/**/ {{0xd58a6ad0, 0xbbdc25ea} },}, +/**/ {{{0x02eb62b8, 0x3fd7c000} }, +/**/ {{0xec0ba5cf, 0x3fd8e75f} }, +/**/ {{0x8731eeea, 0x40048f21} }, +/**/ {{0xcc1adafb, 0xbbc1cb73} },}, +/**/ {{{0x054a52d1, 0x3fd80000} }, +/**/ {{0x8bb822e9, 0x3fd9312d} }, +/**/ {{0x9170a729, 0x400452e6} }, +/**/ {{0xeac002ee, 0xbbd8bb17} },}, +/**/ {{{0xf93a00a3, 0x3fd83fff} }, +/**/ {{0x4bb9ad2a, 0x3fd97b35} }, +/**/ {{0xae924e7f, 0x400417da} }, +/**/ {{0x9a378cc7, 0x3bd4b800} },}, +/**/ {{{0xfbdc91c1, 0x3fd87fff} }, +/**/ {{0x2771b601, 0x3fd9c578} }, +/**/ {{0x78855799, 0x4003ddf4} }, +/**/ {{0xa00445d9, 0x3bd9077d} },}, +/**/ {{{0xf6d215e6, 0x3fd8bfff} }, +/**/ {{0xe0ea4a0b, 0x3fda0ff6} }, +/**/ {{0x189a0989, 0x4003a52b} }, +/**/ {{0x89c0613d, 0xbbda6831} },}, +/**/ {{{0x02f734ef, 0x3fd90000} }, +/**/ {{0x736bf579, 0x3fda5ab2} }, +/**/ {{0xe9244ca6, 0x40036d75} }, +/**/ {{0x4b722377, 0x3be3a6d8} },}, +/**/ {{{0x04eef8b4, 0x3fd94000} }, +/**/ {{0x9fb6e3d0, 0x3fdaa5ab} }, +/**/ {{0xc9089cb7, 0x400336cc} }, +/**/ {{0x22cc00bb, 0x3b9f6963} },}, +/**/ {{{0x041ec76a, 0x3fd98000} }, +/**/ {{0x5176c7e4, 0x3fdaf0e3} }, +/**/ {{0xcb0b9506, 0x40030127} }, +/**/ {{0x5385a849, 0x3bb1ffdb} },}, +/**/ {{{0x08044e47, 0x3fd9c000} }, +/**/ {{0x77071224, 0x3fdb3c5a} }, +/**/ {{0x50d75ec7, 0x4002cc7f} }, +/**/ {{0x78effc8a, 0xbbb0fade} },}, +/**/ {{{0x01f8235b, 0x3fda0000} }, +/**/ {{0xe725782e, 0x3fdb8811} }, +/**/ {{0x18fbfb37, 0x400298cc} }, +/**/ {{0x3b50e71b, 0xbbe55ed3} },}, +/**/ {{{0xfb8c6f08, 0x3fda3fff} }, +/**/ {{0x97b086f3, 0x3fdbd40a} }, +/**/ {{0x154de04b, 0x40026607} }, +/**/ {{0x455faae3, 0xbbdec65e} },}, +/**/ {{{0xfb3d63e1, 0x3fda7fff} }, +/**/ {{0x7d9a3b8a, 0x3fdc2045} }, +/**/ {{0x7e60bfbb, 0x40023429} }, +/**/ {{0x154ebd33, 0x3be3001c} },}, +/**/ {{{0xf5f45c48, 0x3fdabfff} }, +/**/ {{0x7b8d45e6, 0x3fdc6cc3} }, +/**/ {{0xdb1ace69, 0x4002032c} }, +/**/ {{0x3ed33616, 0xbbe5ebf8} },}, +/**/ {{{0x0508b34c, 0x3fdb0000} }, +/**/ {{0xa27e8d37, 0x3fdcb985} }, +/**/ {{0xd4459a2b, 0x4001d30a} }, +/**/ {{0xae61e2d1, 0xbbd01432} },}, +/**/ {{{0x0a84710c, 0x3fdb4000} }, +/**/ {{0xc3e50155, 0x3fdd068c} }, +/**/ {{0x775034dd, 0x4001a3bd} }, +/**/ {{0x58e0e228, 0xbbe80b1e} },}, +/**/ {{{0xf692e9d8, 0x3fdb7fff} }, +/**/ {{0xc49d6627, 0x3fdd53d9} }, +/**/ {{0xfe18066a, 0x4001753e} }, +/**/ {{0xf760d33e, 0xbbb004c8} },}, +/**/ {{{0x0280f14d, 0x3fdbc000} }, +/**/ {{0xe4e81013, 0x3fdda16d} }, +/**/ {{0xa38ea052, 0x40014789} }, +/**/ {{0x27c9c4ea, 0x3be848bc} },}, +/**/ {{{0x001121d1, 0x3fdc0000} }, +/**/ {{0xeac018f0, 0x3fddef49} }, +/**/ {{0x20b8be0c, 0x40011a98} }, +/**/ {{0xd0d6010e, 0xbbe1527e} },}, +/**/ {{{0xfef662aa, 0x3fdc3fff} }, +/**/ {{0xea0c7070, 0x3fde3d6e} }, +/**/ {{0x32f46ccd, 0x4000ee65} }, +/**/ {{0x189a000d, 0x3be8d241} },}, +/**/ {{{0x09845818, 0x3fdc8000} }, +/**/ {{0xf36a8b1b, 0x3fde8bdd} }, +/**/ {{0xcac73476, 0x4000c2eb} }, +/**/ {{0x12bed284, 0x3bd221f7} },}, +/**/ {{{0xfb0493bf, 0x3fdcbfff} }, +/**/ {{0xe0c60d10, 0x3fdeda97} }, +/**/ {{0x251c7836, 0x40009827} }, +/**/ {{0x6eec41b7, 0xbbe0bd54} },}, +/**/ {{{0xfd52961f, 0x3fdcffff} }, +/**/ {{0xefb3e44b, 0x3fdf299d} }, +/**/ {{0x74e459f5, 0x40006e12} }, +/**/ {{0xe969c82f, 0xbbd93f77} },}, +/**/ {{{0xfe2319a4, 0x3fdd3fff} }, +/**/ {{0x17139490, 0x3fdf78f1} }, +/**/ {{0x3e737e94, 0x400044a9} }, +/**/ {{0x49594b7a, 0xbb91e7cc} },}, +/**/ {{{0xfa4de596, 0x3fdd7fff} }, +/**/ {{0x638f49e8, 0x3fdfc892} }, +/**/ {{0x231057a5, 0x40001be7} }, +/**/ {{0xf5af9f5f, 0x3bd482b0} },}, +/**/ {{{0xfe729a69, 0x3fddbfff} }, +/**/ {{0x7c6ab019, 0x3fe00c41} }, +/**/ {{0xbf612660, 0x3fffe78f} }, +/**/ {{0x00da681e, 0x3bea5cda} },}, +/**/ {{{0x09d66802, 0x3fde0000} }, +/**/ {{0xf6b883cf, 0x3fe03461} }, +/**/ {{0xbc05a87c, 0x3fff988e} }, +/**/ {{0xf2372669, 0xbbe06c33} },}, +/**/ {{{0xfb211657, 0x3fde3fff} }, +/**/ {{0x191db8e8, 0x3fe05cab} }, +/**/ {{0x7bcfe6be, 0x3fff4ac3} }, +/**/ {{0x5ed8d35b, 0xbbd5d51f} },}, +/**/ {{{0x0a3f068a, 0x3fde8000} }, +/**/ {{0x95fb54f0, 0x3fe0851d} }, +/**/ {{0x144ca408, 0x3ffefe26} }, +/**/ {{0xa2c169c5, 0xbbc7c894} },}, +/**/ {{{0x01adb060, 0x3fdec000} }, +/**/ {{0xdc7b54f9, 0x3fe0adb9} }, +/**/ {{0x5ebe52a7, 0x3ffeb2af} }, +/**/ {{0x312c5ffd, 0x3bd4e740} },}, +/**/ {{{0xff5c0d01, 0x3fdeffff} }, +/**/ {{0x92550a8d, 0x3fe0d680} }, +/**/ {{0x0d71fdf0, 0x3ffe6858} }, +/**/ {{0x96b35499, 0x3bddd8a6} },}, +/**/ {{{0xf93d5fcc, 0x3fdf3fff} }, +/**/ {{0x45cb4374, 0x3fe0ff72} }, +/**/ {{0x3cce5040, 0x3ffe1f19} }, +/**/ {{0x7c1efab4, 0xbbc9f0ec} },}, +/**/ {{{0xfa0dd18f, 0x3fdf7fff} }, +/**/ {{0x944dd508, 0x3fe1288f} }, +/**/ {{0x298b874d, 0x3ffdd6ec} }, +/**/ {{0x9642a0a6, 0x3bea6ebd} },}, +/**/ {{{0xfd3a9f1a, 0x3fdfbfff} }, +/**/ {{0x13750f3e, 0x3fe151d9} }, +/**/ {{0x5806a27e, 0x3ffd8fca} }, +/**/ {{0xfc65ac7a, 0x3bda2a03} },}, +/**/ {{{0xfc481400, 0x3fdfffff} }, +/**/ {{0x598944ca, 0x3fe17b4f} }, +/**/ {{0x82532170, 0x3ffd49ad} }, +/**/ {{0x3d236dc3, 0x3bc4412e} },}, +/**/ {{{0xff53786c, 0x3fe01fff} }, +/**/ {{0x07d83d47, 0x3fe1a4f3} }, +/**/ {{0x851bffeb, 0x3ffd048f} }, +/**/ {{0x29f81b14, 0x3bd1589d} },}, +/**/ {{{0xfee301b7, 0x3fe03fff} }, +/**/ {{0xb8a6a382, 0x3fe1cec4} }, +/**/ {{0x7c519db6, 0x3ffcc06a} }, +/**/ {{0x5b24d6b2, 0x3bd370e6} },}, +/**/ {{{0x006e36bf, 0x3fe06000} }, +/**/ {{0x114eb8be, 0x3fe1f8c5} }, +/**/ {{0xa34d6786, 0x3ffc7d38} }, +/**/ {{0x4b98c1d4, 0xbbea92de} },}, +/**/ {{{0xfd60aa43, 0x3fe07fff} }, +/**/ {{0xabeccecb, 0x3fe222f4} }, +/**/ {{0x77342ac4, 0x3ffc3af4} }, +/**/ {{0x03a5c2c2, 0xbbdd47f6} },}, +/**/ {{{0x037762e8, 0x3fe0a000} }, +/**/ {{0x3f99efe8, 0x3fe24d54} }, +/**/ {{0x75f54fab, 0x3ffbf998} }, +/**/ {{0x15771a46, 0x3bedf7f4} },}, +/**/ {{{0xff1c6921, 0x3fe0bfff} }, +/**/ {{0x598e35d0, 0x3fe277e4} }, +/**/ {{0x8addd186, 0x3ffbb91f} }, +/**/ {{0x5e0e5a73, 0x3be0f16c} },}, +/**/ {{{0xff07154b, 0x3fe0dfff} }, +/**/ {{0xb6bc3986, 0x3fe2a2a5} }, +/**/ {{0x8301646d, 0x3ffb7984} }, +/**/ {{0xbbaa5310, 0xbbf02dd0} },}, +/**/ {{{0x02fcdda4, 0x3fe10000} }, +/**/ {{0x02a59f1e, 0x3fe2cd99} }, +/**/ {{0x705219bf, 0x3ffb3ac2} }, +/**/ {{0x112fa616, 0xbbe59357} },}, +/**/ {{{0x01ce1140, 0x3fe12000} }, +/**/ {{0xdf0a67c2, 0x3fe2f8be} }, +/**/ {{0x9ab8ae2a, 0x3ffafcd4} }, +/**/ {{0x9303f346, 0x3be2c542} },}, +/**/ {{{0x04d0f355, 0x3fe14000} }, +/**/ {{0x08fcc7bf, 0x3fe32418} }, +/**/ {{0x497b9a36, 0x3ffabfb6} }, +/**/ {{0xb5a59234, 0x3bebc044} },}, +/**/ {{{0x00fb0c8a, 0x3fe16000} }, +/**/ {{0x2471618b, 0x3fe34fa5} }, +/**/ {{0x0d26d117, 0x3ffa8363} }, +/**/ {{0x3f7bb7c9, 0xbbdbfbb2} },}, +/**/ {{{0x026f10b3, 0x3fe18000} }, +/**/ {{0xf7579056, 0x3fe37b66} }, +/**/ {{0x6b4cf4b1, 0x3ffa47d6} }, +/**/ {{0xaf0b5de9, 0x3bf0f6b4} },}, +/**/ {{{0xfd0978f8, 0x3fe19fff} }, +/**/ {{0x290cc78c, 0x3fe3a75e} }, +/**/ {{0x36c21315, 0x3ffa0d0c} }, +/**/ {{0xa296b262, 0x3beb2129} },}, +/**/ {{{0xfd94840b, 0x3fe1bfff} }, +/**/ {{0x85b4e4a4, 0x3fe3d38b} }, +/**/ {{0x32f2ecef, 0x3ff9d300} }, +/**/ {{0xb9bb7d74, 0xbbdbab1a} },}, +/**/ {{{0xfbda1ea1, 0x3fe1dfff} }, +/**/ {{0xbf3cee2f, 0x3fe3ffef} }, +/**/ {{0x6770fed8, 0x3ff999ae} }, +/**/ {{0xb4ace9a4, 0x3bda0bdc} },}, +/**/ {{{0xfc989533, 0x3fe1ffff} }, +/**/ {{0x9c27900c, 0x3fe42c8b} }, +/**/ {{0xe0d9f1ac, 0x3ff96112} }, +/**/ {{0x2fa2d81a, 0xbbee19eb} },}, +/**/ {{{0x012b8d26, 0x3fe22000} }, +/**/ {{0xe11975ca, 0x3fe4595f} }, +/**/ {{0xcdaa4e80, 0x3ff92929} }, +/**/ {{0xacc82d4b, 0x3bf23382} },}, +/**/ {{{0x04f4d6af, 0x3fe24000} }, +/**/ {{0x4d224131, 0x3fe4866d} }, +/**/ {{0x815c34e8, 0x3ff8f1ef} }, +/**/ {{0x3b740a99, 0xbbd0c6ff} },}, +/**/ {{{0xfcc07bda, 0x3fe25fff} }, +/**/ {{0x98b7d010, 0x3fe4b3b4} }, +/**/ {{0x73e7ffa1, 0x3ff8bb60} }, +/**/ {{0x1ad7a9c2, 0x3bebc31b} },}, +/**/ {{{0x042d9639, 0x3fe28000} }, +/**/ {{0xb64540d1, 0x3fe4e136} }, +/**/ {{0xf4374938, 0x3ff88578} }, +/**/ {{0x1b85e901, 0x3be36de9} },}, +/**/ {{{0x03be29a0, 0x3fe2a000} }, +/**/ {{0x52bffd96, 0x3fe50ef4} }, +/**/ {{0xc0042c06, 0x3ff85035} }, +/**/ {{0x76f5efbd, 0x3be15d01} },}, +/**/ {{{0xfaa91f12, 0x3fe2bfff} }, +/**/ {{0x3e2f4e0d, 0x3fe53cee} }, +/**/ {{0x8542df07, 0x3ff81b93} }, +/**/ {{0x17662a2b, 0x3be555cd} },}, +/**/ {{{0xfe884891, 0x3fe2dfff} }, +/**/ {{0x6c1a2470, 0x3fe56b25} }, +/**/ {{0xe422ea70, 0x3ff7e78e} }, +/**/ {{0xbd030c11, 0x3bf03504} },}, +/**/ {{{0xfe87152b, 0x3fe2ffff} }, +/**/ {{0x9beaaaa1, 0x3fe5999a} }, +/**/ {{0xd18fe9b3, 0x3ff7b424} }, +/**/ {{0x773e0e64, 0xbb649a5f} },}, +/**/ {{{0xffc1a721, 0x3fe31fff} }, +/**/ {{0xafe0e564, 0x3fe5c84e} }, +/**/ {{0x338db8d4, 0x3ff78152} }, +/**/ {{0x5da8e935, 0x3beaf428} },}, +/**/ {{{0xff70a372, 0x3fe33fff} }, +/**/ {{0x82191d64, 0x3fe5f742} }, +/**/ {{0x1122bcae, 0x3ff74f14} }, +/**/ {{0xdee4bfaf, 0x3bdb1c4b} },}, +/**/ {{{0x0436e836, 0x3fe36000} }, +/**/ {{0xfde6ccff, 0x3fe62676} }, +/**/ {{0x7644252c, 0x3ff71d67} }, +/**/ {{0xe08c3afb, 0xbbec3d10} },}, +/**/ {{{0xfcbe9641, 0x3fe37fff} }, +/**/ {{0xee9ffdaf, 0x3fe655ec} }, +/**/ {{0xa6fc0515, 0x3ff6ec49} }, +/**/ {{0x2ed29567, 0x3bdda453} },}, +/**/ {{{0xffb6d6ca, 0x3fe39fff} }, +/**/ {{0x5e67a1e1, 0x3fe685a5} }, +/**/ {{0xbc2ae969, 0x3ff6bbb7} }, +/**/ {{0x2ef43882, 0x3becbf7b} },}, +/**/ {{{0x04934fec, 0x3fe3c000} }, +/**/ {{0x2cc07d75, 0x3fe6b5a1} }, +/**/ {{0x10b02ef8, 0x3ff68baf} }, +/**/ {{0xfeb7cabd, 0xbbe7c8fb} },}, +/**/ {{{0x03f5cf7f, 0x3fe3e000} }, +/**/ {{0x3e59def6, 0x3fe6e5e1} }, +/**/ {{0x0e61500f, 0x3ff65c2d} }, +/**/ {{0x035f7845, 0xbbe30ba4} },}, +/**/ {{{0x05280ad9, 0x3fe40000} }, +/**/ {{0x91ab4c3e, 0x3fe71666} }, +/**/ {{0x19f01c90, 0x3ff62d2f} }, +/**/ {{0xffe95f6a, 0xbbf1e9f5} },}, +/**/ {{{0x049efb65, 0x3fe42000} }, +/**/ {{0x18af3b9d, 0x3fe74732} }, +/**/ {{0xb86465e4, 0x3ff5feb2} }, +/**/ {{0x280d591e, 0x3bc4cad7} },}, +/**/ {{{0x0035ccb6, 0x3fe44000} }, +/**/ {{0xcb4ff1e5, 0x3fe77844} }, +/**/ {{0x7c455428, 0x3ff5d0b5} }, +/**/ {{0x7ba5617c, 0x3bed8c18} },}, +/**/ {{{0x03346717, 0x3fe46000} }, +/**/ {{0xba258778, 0x3fe7a99f} }, +/**/ {{0xf4392254, 0x3ff5a334} }, +/**/ {{0xfc84a570, 0xbbefd14a} },}, +/**/ {{{0x03002575, 0x3fe48000} }, +/**/ {{0xd836768f, 0x3fe7db43} }, +/**/ {{0xdcf97e0c, 0x3ff5762e} }, +/**/ {{0x5f5df49e, 0xbbdd7eba} },}, +/**/ {{{0x055bf381, 0x3fe4a000} }, +/**/ {{0x35edeefa, 0x3fe80d32} }, +/**/ {{0xea46e31f, 0x3ff549a0} }, +/**/ {{0x76823eac, 0xbbdba522} },}, +/**/ {{{0x04ce10e3, 0x3fe4c000} }, +/**/ {{0xd67dc1a8, 0x3fe83f6b} }, +/**/ {{0xed82bcc4, 0x3ff51d88} }, +/**/ {{0x077d29ea, 0xbbeae92d} },}, +/**/ {{{0x016c60e1, 0x3fe4e000} }, +/**/ {{0xca0aaf31, 0x3fe871f1} }, +/**/ {{0xbdacbf16, 0x3ff4f1e4} }, +/**/ {{0x46ee425e, 0x3be82958} },}, +/**/ {{{0xff966f0a, 0x3fe4ffff} }, +/**/ {{0x2bff2dae, 0x3fe8a4c5} }, +/**/ {{0x3917657e, 0x3ff4c6b2} }, +/**/ {{0x5c86c705, 0xbbf127c2} },}, +/**/ {{{0x0076e6eb, 0x3fe52000} }, +/**/ {{0x175651e8, 0x3fe8d7e7} }, +/**/ {{0x4f459b05, 0x3ff49bef} }, +/**/ {{0x4181bbfc, 0xbbb1e9d1} },}, +/**/ {{{0x03d12d3b, 0x3fe54000} }, +/**/ {{0xa976ed56, 0x3fe90b58} }, +/**/ {{0xfdf24af4, 0x3ff47199} }, +/**/ {{0xc30decaf, 0x3be38c17} },}, +/**/ {{{0xfce7fa8d, 0x3fe55fff} }, +/**/ {{0xf03a3a09, 0x3fe93f1a} }, +/**/ {{0x5f13234b, 0x3ff447b0} }, +/**/ {{0x70df7e20, 0x3bf1b8b2} },}, +/**/ {{{0x0331b46a, 0x3fe58000} }, +/**/ {{0x38e83134, 0x3fe9732f} }, +/**/ {{0x68d8b41b, 0x3ff41e30} }, +/**/ {{0xb90bc28b, 0xbbee24d8} },}, +/**/ {{{0xfc14848e, 0x3fe59fff} }, +/**/ {{0x8471b489, 0x3fe9a796} }, +/**/ {{0x5de3aa73, 0x3ff3f518} }, +/**/ {{0xe0761536, 0xbbecacd9} },}, +/**/ {{{0xfb7cd395, 0x3fe5bfff} }, +/**/ {{0x24a8b955, 0x3fe9dc52} }, +/**/ {{0x4f8fff15, 0x3ff3cc66} }, +/**/ {{0x82045611, 0xbbf67c97} },}, +/**/ {{{0x000dcc40, 0x3fe5e000} }, +/**/ {{0x4df5b93e, 0x3fea1163} }, +/**/ {{0x75853228, 0x3ff3a418} }, +/**/ {{0xd481f350, 0xbbf585da} },}, +/**/ {{{0x02efd2fc, 0x3fe60000} }, +/**/ {{0x30d16323, 0x3fea46cb} }, +/**/ {{0x187962ae, 0x3ff37c2d} }, +/**/ {{0xa5f77bb0, 0x3bf004c3} },}, +/**/ {{{0xfeb8088a, 0x3fe61fff} }, +/**/ {{0x053920c0, 0x3fea7c8b} }, +/**/ {{0x891769a9, 0x3ff354a2} }, +/**/ {{0x3fee3029, 0x3bbc6b30} },}, +/**/ {{{0x00f3ca06, 0x3fe64000} }, +/**/ {{0x28a1911a, 0x3feab2a4} }, +/**/ {{0x0a6f0a4a, 0x3ff32d77} }, +/**/ {{0xfac5081a, 0x3bf2a6f8} },}, +/**/ {{{0xfe9ec2f4, 0x3fe65fff} }, +/**/ {{0xd4ce7239, 0x3feae917} }, +/**/ {{0x0751a948, 0x3ff306a9} }, +/**/ {{0x51ab9dbd, 0xbbe950b5} },}, +/**/ {{{0x03d43966, 0x3fe68000} }, +/**/ {{0x708b998a, 0x3feb1fe7} }, +/**/ {{0xd7a153c7, 0x3ff2e036} }, +/**/ {{0xa1e4a14e, 0x3bdd36e2} },}, +/**/ {{{0xfab67783, 0x3fe69fff} }, +/**/ {{0x2e575464, 0x3feb5714} }, +/**/ {{0x05006cb6, 0x3ff2ba1f} }, +/**/ {{0x473c2e31, 0x3bea9a4a} },}, +/**/ {{{0xfcb65f89, 0x3fe6bfff} }, +/**/ {{0x981efd2f, 0x3feb8e9f} }, +/**/ {{0xe948d9f7, 0x3ff2945f} }, +/**/ {{0xe802df72, 0xbbca5294} },}, +/**/ {{{0xfc5609a9, 0x3fe6dfff} }, +/**/ {{0xfaed6ff1, 0x3febc68a} }, +/**/ {{0x1533411e, 0x3ff26ef8} }, +/**/ {{0xf51bc566, 0xbbf89153} },}, +/**/ {{{0xfc4eef86, 0x3fe6ffff} }, +/**/ {{0xc62205fe, 0x3febfed7} }, +/**/ {{0x0e70978c, 0x3ff249e6} }, +/**/ {{0xa2b9ff56, 0x3bc39021} },}, +/**/ {{{0x004d98b3, 0x3fe72000} }, +/**/ {{0x716968ad, 0x3fec3787} }, +/**/ {{0x61be7751, 0x3ff22528} }, +/**/ {{0x74ee2211, 0x3befc9c5} },}, +/**/ {{{0xfc155075, 0x3fe73fff} }, +/**/ {{0x5ec6fd4e, 0x3fec709b} }, +/**/ {{0xb5d53311, 0x3ff200bd} }, +/**/ {{0xa269ae63, 0x3be28a4d} },}, +/**/ {{{0x0498c203, 0x3fe76000} }, +/**/ {{0x323d08c1, 0x3fecaa15} }, +/**/ {{0x93433f65, 0x3ff1dca4} }, +/**/ {{0x14a28fb7, 0x3bf8cae4} },}, +/**/ {{{0xff1e5636, 0x3fe77fff} }, +/**/ {{0x4147c12c, 0x3fece3f6} }, +/**/ {{0xbfe294a8, 0x3ff1b8db} }, +/**/ {{0x4b56a744, 0xbbe7e19c} },}, +/**/ {{{0x0226d45a, 0x3fe7a000} }, +/**/ {{0x4120eb7f, 0x3fed1e40} }, +/**/ {{0xd15f8278, 0x3ff19561} }, +/**/ {{0x032c5d4c, 0x3be64b28} },}, +/**/ {{{0x0250a5aa, 0x3fe7c000} }, +/**/ {{0xb112a1e1, 0x3fed58f4} }, +/**/ {{0x8a59d565, 0x3ff17235} }, +/**/ {{0xb8dc7867, 0xbbe716de} },}, +/**/ {{{0x0482f82e, 0x3fe7e000} }, +/**/ {{0x3576bdf0, 0x3fed9415} }, +/**/ {{0xa22a1c5b, 0x3ff14f55} }, +/**/ {{0xe1305604, 0x3bf207e1} },}, +/**/ {{{0x0205003e, 0x3fe80000} }, +/**/ {{0x64d69ff7, 0x3fedcfa3} }, +/**/ {{0xe37eb26f, 0x3ff12cc0} }, +/**/ {{0xe32395f8, 0xbbd52ec6} },}, +/**/ {{{0xfbf99411, 0x3fe81fff} }, +/**/ {{0xebf98f51, 0x3fee0ba0} }, +/**/ {{0x16ddd5d6, 0x3ff10a76} }, +/**/ {{0x59866045, 0xbbece0d6} },}, +/**/ {{{0x0248e3a3, 0x3fe84000} }, +/**/ {{0x9bb7f565, 0x3fee480f} }, +/**/ {{0xfb84e05c, 0x3ff0e873} }, +/**/ {{0x1595df92, 0x3bf4e5e8} },}, +/**/ {{{0x0145c157, 0x3fe86000} }, +/**/ {{0x0a10b3ab, 0x3fee84f1} }, +/**/ {{0x7cbd7b1e, 0x3ff0c6b9} }, +/**/ {{0xd5f121d0, 0xbbe19de6} },}, +/**/ {{{0x022631b9, 0x3fe88000} }, +/**/ {{0x0be1f047, 0x3feec247} }, +/**/ {{0x6d0b3ee6, 0x3ff0a545} }, +/**/ {{0xa3ba2c6f, 0xbbc272b1} },}, +/**/ {{{0x045f7828, 0x3fe8a000} }, +/**/ {{0x6c45ba1c, 0x3fef0013} }, +/**/ {{0xaf2a0f09, 0x3ff08416} }, +/**/ {{0x5b63c799, 0x3be82b56} },}, +/**/ {{{0xffc686cf, 0x3fe8bfff} }, +/**/ {{0xf03c824b, 0x3fef3e57} }, +/**/ {{0x33502220, 0x3ff0632c} }, +/**/ {{0x2dbeeb25, 0xbbd039ad} },}, +/**/ {{{0xfd8644c6, 0x3fe8dfff} }, +/**/ {{0x8774261d, 0x3fef7d16} }, +/**/ {{0xdd5b3019, 0x3ff04284} }, +/**/ {{0xe1eba933, 0x3bd79f33} },}, +/**/ {{{0xfe4e7937, 0x3fe8ffff} }, +/**/ {{0x1a99a641, 0x3fefbc51} }, +/**/ {{0x9f69840b, 0x3ff0221f} }, +/**/ {{0x7beee018, 0xbbea9e84} },}, +/**/ {{{0x0435251f, 0x3fe92000} }, +/**/ {{0x9eb22390, 0x3feffc09} }, +/**/ {{0x6f7c51e8, 0x3ff001fb} }, +/**/ {{0x31032e0a, 0xbb5a12e7} },}, + }; + +#endif +#endif diff --git a/libgcc-math/flt-32/e_acosf.c b/libgcc-math/flt-32/e_acosf.c new file mode 100644 index 00000000000..0d85c4210dc --- /dev/null +++ b/libgcc-math/flt-32/e_acosf.c @@ -0,0 +1,89 @@ +/* e_acosf.c -- float version of e_acos.c. + * Conversion to float by Ian Lance Taylor, Cygnus Support, ian@cygnus.com. + */ + +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ + +#if defined(LIBM_SCCS) && !defined(lint) +static char rcsid[] = "$NetBSD: e_acosf.c,v 1.5 1995/05/12 04:57:16 jtc Exp $"; +#endif + +#include "math.h" +#include "math_private.h" + +#ifdef __STDC__ +static const float +#else +static float +#endif +one = 1.0000000000e+00, /* 0x3F800000 */ +pi = 3.1415925026e+00, /* 0x40490fda */ +pio2_hi = 1.5707962513e+00, /* 0x3fc90fda */ +pio2_lo = 7.5497894159e-08, /* 0x33a22168 */ +pS0 = 1.6666667163e-01, /* 0x3e2aaaab */ +pS1 = -3.2556581497e-01, /* 0xbea6b090 */ +pS2 = 2.0121252537e-01, /* 0x3e4e0aa8 */ +pS3 = -4.0055535734e-02, /* 0xbd241146 */ +pS4 = 7.9153501429e-04, /* 0x3a4f7f04 */ +pS5 = 3.4793309169e-05, /* 0x3811ef08 */ +qS1 = -2.4033949375e+00, /* 0xc019d139 */ +qS2 = 2.0209457874e+00, /* 0x4001572d */ +qS3 = -6.8828397989e-01, /* 0xbf303361 */ +qS4 = 7.7038154006e-02; /* 0x3d9dc62e */ + +#ifdef __STDC__ + float __ieee754_acosf(float x) +#else + float __ieee754_acosf(x) + float x; +#endif +{ + float z,p,q,r,w,s,c,df; + int32_t hx,ix; + GET_FLOAT_WORD(hx,x); + ix = hx&0x7fffffff; + if(ix==0x3f800000) { /* |x|==1 */ + if(hx>0) return 0.0; /* acos(1) = 0 */ + else return pi+(float)2.0*pio2_lo; /* acos(-1)= pi */ + } else if(ix>0x3f800000) { /* |x| >= 1 */ + return (x-x)/(x-x); /* acos(|x|>1) is NaN */ + } + if(ix<0x3f000000) { /* |x| < 0.5 */ + if(ix<=0x23000000) return pio2_hi+pio2_lo;/*if|x|<2**-57*/ + z = x*x; + p = z*(pS0+z*(pS1+z*(pS2+z*(pS3+z*(pS4+z*pS5))))); + q = one+z*(qS1+z*(qS2+z*(qS3+z*qS4))); + r = p/q; + return pio2_hi - (x - (pio2_lo-x*r)); + } else if (hx<0) { /* x < -0.5 */ + z = (one+x)*(float)0.5; + p = z*(pS0+z*(pS1+z*(pS2+z*(pS3+z*(pS4+z*pS5))))); + q = one+z*(qS1+z*(qS2+z*(qS3+z*qS4))); + s = __ieee754_sqrtf(z); + r = p/q; + w = r*s-pio2_lo; + return pi - (float)2.0*(s+w); + } else { /* x > 0.5 */ + int32_t idf; + z = (one-x)*(float)0.5; + s = __ieee754_sqrtf(z); + df = s; + GET_FLOAT_WORD(idf,df); + SET_FLOAT_WORD(df,idf&0xfffff000); + c = (z-df*df)/(s+df); + p = z*(pS0+z*(pS1+z*(pS2+z*(pS3+z*(pS4+z*pS5))))); + q = one+z*(qS1+z*(qS2+z*(qS3+z*qS4))); + r = p/q; + w = r*s+c; + return (float)2.0*(df+w); + } +} diff --git a/libgcc-math/flt-32/e_asinf.c b/libgcc-math/flt-32/e_asinf.c new file mode 100644 index 00000000000..b0c835c83c0 --- /dev/null +++ b/libgcc-math/flt-32/e_asinf.c @@ -0,0 +1,110 @@ +/* e_asinf.c -- float version of e_asin.c. + * Conversion to float by Ian Lance Taylor, Cygnus Support, ian@cygnus.com. + */ + +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ + +/* + Modifications for single precision expansion are + Copyright (C) 2001 Stephen L. Moshier + and are incorporated herein by permission of the author. The author + reserves the right to distribute this material elsewhere under different + copying permissions. These modifications are distributed here under + the following terms: + + This library is free software; you can redistribute it and/or + modify it under the terms of the GNU Lesser General Public + License as published by the Free Software Foundation; either + version 2.1 of the License, or (at your option) any later version. + + This library is distributed in the hope that it will be useful, + but WITHOUT ANY WARRANTY; without even the implied warranty of + MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU + Lesser General Public License for more details. + + You should have received a copy of the GNU Lesser General Public + License along with this library; if not, write to the Free Software + Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307 USA */ + +#if defined(LIBM_SCCS) && !defined(lint) +static char rcsid[] = "$NetBSD: e_asinf.c,v 1.5 1995/05/12 04:57:25 jtc Exp $"; +#endif + +#include "math.h" +#include "math_private.h" + +#ifdef __STDC__ +static const float +#else +static float +#endif +one = 1.0000000000e+00, /* 0x3F800000 */ +huge = 1.000e+30, + +pio2_hi = 1.57079637050628662109375f, +pio2_lo = -4.37113900018624283e-8f, +pio4_hi = 0.785398185253143310546875f, + +/* asin x = x + x^3 p(x^2) + -0.5 <= x <= 0.5; + Peak relative error 4.8e-9 */ +p0 = 1.666675248e-1f, +p1 = 7.495297643e-2f, +p2 = 4.547037598e-2f, +p3 = 2.417951451e-2f, +p4 = 4.216630880e-2f; + +#ifdef __STDC__ + float __ieee754_asinf(float x) +#else + float __ieee754_asinf(x) + float x; +#endif +{ + float t,w,p,q,c,r,s; + int32_t hx,ix; + GET_FLOAT_WORD(hx,x); + ix = hx&0x7fffffff; + if(ix==0x3f800000) { + /* asin(1)=+-pi/2 with inexact */ + return x*pio2_hi+x*pio2_lo; + } else if(ix> 0x3f800000) { /* |x|>= 1 */ + return (x-x)/(x-x); /* asin(|x|>1) is NaN */ + } else if (ix<0x3f000000) { /* |x|<0.5 */ + if(ix<0x32000000) { /* if |x| < 2**-27 */ + if(huge+x>one) return x;/* return x with inexact if x!=0*/ + } else { + t = x*x; + w = t * (p0 + t * (p1 + t * (p2 + t * (p3 + t * p4)))); + return x+x*w; + } + } + /* 1> |x|>= 0.5 */ + w = one-fabsf(x); + t = w*0.5f; + p = t * (p0 + t * (p1 + t * (p2 + t * (p3 + t * p4)))); + s = __ieee754_sqrtf(t); + if(ix>=0x3F79999A) { /* if |x| > 0.975 */ + t = pio2_hi-(2.0f*(s+s*p)-pio2_lo); + } else { + int32_t iw; + w = s; + GET_FLOAT_WORD(iw,w); + SET_FLOAT_WORD(w,iw&0xfffff000); + c = (t-w*w)/(s+w); + r = p; + p = 2.0f*s*r-(pio2_lo-2.0f*c); + q = pio4_hi-2.0f*w; + t = pio4_hi-(p-q); + } + if(hx>0) return t; else return -t; +} diff --git a/libgcc-math/flt-32/e_atan2f.c b/libgcc-math/flt-32/e_atan2f.c new file mode 100644 index 00000000000..c0cafb16b8e --- /dev/null +++ b/libgcc-math/flt-32/e_atan2f.c @@ -0,0 +1,105 @@ +/* e_atan2f.c -- float version of e_atan2.c. + * Conversion to float by Ian Lance Taylor, Cygnus Support, ian@cygnus.com. + */ + +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ + +#if defined(LIBM_SCCS) && !defined(lint) +static char rcsid[] = "$NetBSD: e_atan2f.c,v 1.4 1995/05/10 20:44:53 jtc Exp $"; +#endif + +#include "math.h" +#include "math_private.h" + +#ifdef __STDC__ +static const float +#else +static float +#endif +tiny = 1.0e-30, +zero = 0.0, +pi_o_4 = 7.8539818525e-01, /* 0x3f490fdb */ +pi_o_2 = 1.5707963705e+00, /* 0x3fc90fdb */ +pi = 3.1415927410e+00, /* 0x40490fdb */ +pi_lo = -8.7422776573e-08; /* 0xb3bbbd2e */ + +#ifdef __STDC__ + float __ieee754_atan2f(float y, float x) +#else + float __ieee754_atan2f(y,x) + float y,x; +#endif +{ + float z; + int32_t k,m,hx,hy,ix,iy; + + GET_FLOAT_WORD(hx,x); + ix = hx&0x7fffffff; + GET_FLOAT_WORD(hy,y); + iy = hy&0x7fffffff; + if((ix>0x7f800000)|| + (iy>0x7f800000)) /* x or y is NaN */ + return x+y; + if(hx==0x3f800000) return __atanf(y); /* x=1.0 */ + m = ((hy>>31)&1)|((hx>>30)&2); /* 2*sign(x)+sign(y) */ + + /* when y = 0 */ + if(iy==0) { + switch(m) { + case 0: + case 1: return y; /* atan(+-0,+anything)=+-0 */ + case 2: return pi+tiny;/* atan(+0,-anything) = pi */ + case 3: return -pi-tiny;/* atan(-0,-anything) =-pi */ + } + } + /* when x = 0 */ + if(ix==0) return (hy<0)? -pi_o_2-tiny: pi_o_2+tiny; + + /* when x is INF */ + if(ix==0x7f800000) { + if(iy==0x7f800000) { + switch(m) { + case 0: return pi_o_4+tiny;/* atan(+INF,+INF) */ + case 1: return -pi_o_4-tiny;/* atan(-INF,+INF) */ + case 2: return (float)3.0*pi_o_4+tiny;/*atan(+INF,-INF)*/ + case 3: return (float)-3.0*pi_o_4-tiny;/*atan(-INF,-INF)*/ + } + } else { + switch(m) { + case 0: return zero ; /* atan(+...,+INF) */ + case 1: return -zero ; /* atan(-...,+INF) */ + case 2: return pi+tiny ; /* atan(+...,-INF) */ + case 3: return -pi-tiny ; /* atan(-...,-INF) */ + } + } + } + /* when y is INF */ + if(iy==0x7f800000) return (hy<0)? -pi_o_2-tiny: pi_o_2+tiny; + + /* compute y/x */ + k = (iy-ix)>>23; + if(k > 60) z=pi_o_2+(float)0.5*pi_lo; /* |y/x| > 2**60 */ + else if(hx<0&&k<-60) z=0.0; /* |y|/x < -2**60 */ + else z=__atanf(fabsf(y/x)); /* safe to do y/x */ + switch (m) { + case 0: return z ; /* atan(+,+) */ + case 1: { + u_int32_t zh; + GET_FLOAT_WORD(zh,z); + SET_FLOAT_WORD(z,zh ^ 0x80000000); + } + return z ; /* atan(-,+) */ + case 2: return pi-(z-pi_lo);/* atan(+,-) */ + default: /* case 3 */ + return (z-pi_lo)-pi;/* atan(-,-) */ + } +} diff --git a/libgcc-math/flt-32/e_expf.c b/libgcc-math/flt-32/e_expf.c new file mode 100644 index 00000000000..b9cd53c0333 --- /dev/null +++ b/libgcc-math/flt-32/e_expf.c @@ -0,0 +1,140 @@ +/* Single-precision floating point e^x. + Copyright (C) 1997, 1998, 2005, 2006 Free Software Foundation, Inc. + This file is part of the GNU C Library. + Contributed by Geoffrey Keating + + The GNU C Library is free software; you can redistribute it and/or + modify it under the terms of the GNU Lesser General Public + License as published by the Free Software Foundation; either + version 2.1 of the License, or (at your option) any later version. + + The GNU C Library is distributed in the hope that it will be useful, + but WITHOUT ANY WARRANTY; without even the implied warranty of + MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU + Lesser General Public License for more details. + + You should have received a copy of the GNU Lesser General Public + License along with the GNU C Library; if not, write to the Free + Software Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA + 02111-1307 USA. */ + +/* How this works: + + The input value, x, is written as + + x = n * ln(2) + t/512 + delta[t] + x; + + where: + - n is an integer, 127 >= n >= -150; + - t is an integer, 177 >= t >= -177 + - delta is based on a table entry, delta[t] < 2^-28 + - x is whatever is left, |x| < 2^-10 + + Then e^x is approximated as + + e^x = 2^n ( e^(t/512 + delta[t]) + + ( e^(t/512 + delta[t]) + * ( p(x + delta[t] + n * ln(2)) - delta ) ) ) + + where + - p(x) is a polynomial approximating e(x)-1; + - e^(t/512 + delta[t]) is obtained from a table. + + The table used is the same one as for the double precision version; + since we have the table, we might as well use it. + + It turns out to be faster to do calculations in double precision than + to perform an 'accurate table method' expf, because of the range reduction + overhead (compare exp2f). + */ +#ifndef _GNU_SOURCE +#define _GNU_SOURCE +#endif +#include +#include +#include +#include +#include +#include + +extern const float __exp_deltatable[178]; +extern const double __exp_atable[355] /* __attribute__((mode(DF))) */; + +static const volatile float TWOM100 = 7.88860905e-31; +static const volatile float TWO127 = 1.7014118346e+38; + +float +__ieee754_expf (float x) +{ + static const float himark = 88.72283935546875; + static const float lomark = -103.972084045410; + /* Check for usual case. */ + if (isless (x, himark) && isgreater (x, lomark)) + { + static const float THREEp42 = 13194139533312.0; + static const float THREEp22 = 12582912.0; + /* 1/ln(2). */ +#undef M_1_LN2 + static const float M_1_LN2 = 1.44269502163f; + /* ln(2) */ +#undef M_LN2 + static const double M_LN2 = .6931471805599452862; + + int tval; + double x22, t, result, dx; + float n, delta; + union ieee754_double ex2_u; + fenv_t oldenv; + + feholdexcept (&oldenv); +#ifdef FE_TONEAREST + fesetround (FE_TONEAREST); +#endif + + /* Calculate n. */ + n = x * M_1_LN2 + THREEp22; + n -= THREEp22; + dx = x - n*M_LN2; + + /* Calculate t/512. */ + t = dx + THREEp42; + t -= THREEp42; + dx -= t; + + /* Compute tval = t. */ + tval = (int) (t * 512.0); + + if (t >= 0) + delta = - __exp_deltatable[tval]; + else + delta = __exp_deltatable[-tval]; + + /* Compute ex2 = 2^n e^(t/512+delta[t]). */ + ex2_u.d = __exp_atable[tval+177]; + ex2_u.ieee.exponent += (int) n; + + /* Approximate e^(dx+delta) - 1, using a second-degree polynomial, + with maximum error in [-2^-10-2^-28,2^-10+2^-28] + less than 5e-11. */ + x22 = (0.5000000496709180453 * dx + 1.0000001192102037084) * dx + delta; + + /* Return result. */ + fesetenv (&oldenv); + + result = x22 * ex2_u.d + ex2_u.d; + return (float) result; + } + /* Exceptional cases: */ + else if (isless (x, himark)) + { + if (__isinff (x)) + /* e^-inf == 0, with no error. */ + return 0; + else + /* Underflow */ + return TWOM100 * TWOM100; + } + else + /* Return x, if x is a NaN or Inf; or overflow, otherwise. */ + return TWO127*x; +} diff --git a/libgcc-math/flt-32/e_log10f.c b/libgcc-math/flt-32/e_log10f.c new file mode 100644 index 00000000000..cea3d9156b4 --- /dev/null +++ b/libgcc-math/flt-32/e_log10f.c @@ -0,0 +1,67 @@ +/* e_log10f.c -- float version of e_log10.c. + * Conversion to float by Ian Lance Taylor, Cygnus Support, ian@cygnus.com. + */ + +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ + +#if defined(LIBM_SCCS) && !defined(lint) +static char rcsid[] = "$NetBSD: e_log10f.c,v 1.5 1995/05/10 20:45:53 jtc Exp $"; +#endif + +#include "math.h" +#include "math_private.h" + +#ifdef __STDC__ +static const float +#else +static float +#endif +two25 = 3.3554432000e+07, /* 0x4c000000 */ +ivln10 = 4.3429449201e-01, /* 0x3ede5bd9 */ +log10_2hi = 3.0102920532e-01, /* 0x3e9a2080 */ +log10_2lo = 7.9034151668e-07; /* 0x355427db */ + +#ifdef __STDC__ +static const float zero = 0.0; +#else +static float zero = 0.0; +#endif + +#ifdef __STDC__ + float __ieee754_log10f(float x) +#else + float __ieee754_log10f(x) + float x; +#endif +{ + float y,z; + int32_t i,k,hx; + + GET_FLOAT_WORD(hx,x); + + k=0; + if (hx < 0x00800000) { /* x < 2**-126 */ + if ((hx&0x7fffffff)==0) + return -two25/(x-x); /* log(+-0)=-inf */ + if (hx<0) return (x-x)/(x-x); /* log(-#) = NaN */ + k -= 25; x *= two25; /* subnormal number, scale up x */ + GET_FLOAT_WORD(hx,x); + } + if (hx >= 0x7f800000) return x+x; + k += (hx>>23)-127; + i = ((u_int32_t)k&0x80000000)>>31; + hx = (hx&0x007fffff)|((0x7f-i)<<23); + y = (float)(k+i); + SET_FLOAT_WORD(x,hx); + z = y*log10_2lo + ivln10*__ieee754_logf(x); + return z+y*log10_2hi; +} diff --git a/libgcc-math/flt-32/e_logf.c b/libgcc-math/flt-32/e_logf.c new file mode 100644 index 00000000000..de8f869df49 --- /dev/null +++ b/libgcc-math/flt-32/e_logf.c @@ -0,0 +1,99 @@ +/* e_logf.c -- float version of e_log.c. + * Conversion to float by Ian Lance Taylor, Cygnus Support, ian@cygnus.com. + */ + +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ + +#if defined(LIBM_SCCS) && !defined(lint) +static char rcsid[] = "$NetBSD: e_logf.c,v 1.4 1995/05/10 20:45:54 jtc Exp $"; +#endif + +#include "math.h" +#include "math_private.h" + +#ifdef __STDC__ +static const float +#else +static float +#endif +ln2_hi = 6.9313812256e-01, /* 0x3f317180 */ +ln2_lo = 9.0580006145e-06, /* 0x3717f7d1 */ +two25 = 3.355443200e+07, /* 0x4c000000 */ +Lg1 = 6.6666668653e-01, /* 3F2AAAAB */ +Lg2 = 4.0000000596e-01, /* 3ECCCCCD */ +Lg3 = 2.8571429849e-01, /* 3E924925 */ +Lg4 = 2.2222198546e-01, /* 3E638E29 */ +Lg5 = 1.8183572590e-01, /* 3E3A3325 */ +Lg6 = 1.5313838422e-01, /* 3E1CD04F */ +Lg7 = 1.4798198640e-01; /* 3E178897 */ + +#ifdef __STDC__ +static const float zero = 0.0; +#else +static float zero = 0.0; +#endif + +#ifdef __STDC__ + float __ieee754_logf(float x) +#else + float __ieee754_logf(x) + float x; +#endif +{ + float hfsq,f,s,z,R,w,t1,t2,dk; + int32_t k,ix,i,j; + + GET_FLOAT_WORD(ix,x); + + k=0; + if (ix < 0x00800000) { /* x < 2**-126 */ + if ((ix&0x7fffffff)==0) + return -two25/(x-x); /* log(+-0)=-inf */ + if (ix<0) return (x-x)/(x-x); /* log(-#) = NaN */ + k -= 25; x *= two25; /* subnormal number, scale up x */ + GET_FLOAT_WORD(ix,x); + } + if (ix >= 0x7f800000) return x+x; + k += (ix>>23)-127; + ix &= 0x007fffff; + i = (ix+(0x95f64<<3))&0x800000; + SET_FLOAT_WORD(x,ix|(i^0x3f800000)); /* normalize x or x/2 */ + k += (i>>23); + f = x-(float)1.0; + if((0x007fffff&(15+ix))<16) { /* |f| < 2**-20 */ + if(f==zero) { + if(k==0) return zero; else {dk=(float)k; + return dk*ln2_hi+dk*ln2_lo;} + } + R = f*f*((float)0.5-(float)0.33333333333333333*f); + if(k==0) return f-R; else {dk=(float)k; + return dk*ln2_hi-((R-dk*ln2_lo)-f);} + } + s = f/((float)2.0+f); + dk = (float)k; + z = s*s; + i = ix-(0x6147a<<3); + w = z*z; + j = (0x6b851<<3)-ix; + t1= w*(Lg2+w*(Lg4+w*Lg6)); + t2= z*(Lg1+w*(Lg3+w*(Lg5+w*Lg7))); + i |= j; + R = t2+t1; + if(i>0) { + hfsq=(float)0.5*f*f; + if(k==0) return f-(hfsq-s*(hfsq+R)); else + return dk*ln2_hi-((hfsq-(s*(hfsq+R)+dk*ln2_lo))-f); + } else { + if(k==0) return f-s*(f-R); else + return dk*ln2_hi-((s*(f-R)-dk*ln2_lo)-f); + } +} diff --git a/libgcc-math/flt-32/e_powf.c b/libgcc-math/flt-32/e_powf.c new file mode 100644 index 00000000000..fb0bbc6068b --- /dev/null +++ b/libgcc-math/flt-32/e_powf.c @@ -0,0 +1,257 @@ +/* e_powf.c -- float version of e_pow.c. + * Conversion to float by Ian Lance Taylor, Cygnus Support, ian@cygnus.com. + */ + +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ + +#if defined(LIBM_SCCS) && !defined(lint) +static char rcsid[] = "$NetBSD: e_powf.c,v 1.7 1996/04/08 15:43:44 phil Exp $"; +#endif + +#include "math.h" +#include "math_private.h" + +static const float huge = 1.0e+30, tiny = 1.0e-30; + +#ifdef __STDC__ +static const float +#else +static float +#endif +bp[] = {1.0, 1.5,}, +dp_h[] = { 0.0, 5.84960938e-01,}, /* 0x3f15c000 */ +dp_l[] = { 0.0, 1.56322085e-06,}, /* 0x35d1cfdc */ +zero = 0.0, +one = 1.0, +two = 2.0, +two24 = 16777216.0, /* 0x4b800000 */ + /* poly coefs for (3/2)*(log(x)-2s-2/3*s**3 */ +L1 = 6.0000002384e-01, /* 0x3f19999a */ +L2 = 4.2857143283e-01, /* 0x3edb6db7 */ +L3 = 3.3333334327e-01, /* 0x3eaaaaab */ +L4 = 2.7272811532e-01, /* 0x3e8ba305 */ +L5 = 2.3066075146e-01, /* 0x3e6c3255 */ +L6 = 2.0697501302e-01, /* 0x3e53f142 */ +P1 = 1.6666667163e-01, /* 0x3e2aaaab */ +P2 = -2.7777778450e-03, /* 0xbb360b61 */ +P3 = 6.6137559770e-05, /* 0x388ab355 */ +P4 = -1.6533901999e-06, /* 0xb5ddea0e */ +P5 = 4.1381369442e-08, /* 0x3331bb4c */ +lg2 = 6.9314718246e-01, /* 0x3f317218 */ +lg2_h = 6.93145752e-01, /* 0x3f317200 */ +lg2_l = 1.42860654e-06, /* 0x35bfbe8c */ +ovt = 4.2995665694e-08, /* -(128-log2(ovfl+.5ulp)) */ +cp = 9.6179670095e-01, /* 0x3f76384f =2/(3ln2) */ +cp_h = 9.6179199219e-01, /* 0x3f763800 =head of cp */ +cp_l = 4.7017383622e-06, /* 0x369dc3a0 =tail of cp_h */ +ivln2 = 1.4426950216e+00, /* 0x3fb8aa3b =1/ln2 */ +ivln2_h = 1.4426879883e+00, /* 0x3fb8aa00 =16b 1/ln2*/ +ivln2_l = 7.0526075433e-06; /* 0x36eca570 =1/ln2 tail*/ + +#ifdef __STDC__ + float __ieee754_powf(float x, float y) +#else + float __ieee754_powf(x,y) + float x, y; +#endif +{ + float z,ax,z_h,z_l,p_h,p_l; + float y1,t1,t2,r,s,t,u,v,w; + int32_t i,j,k,yisint,n; + int32_t hx,hy,ix,iy,is; + + GET_FLOAT_WORD(hx,x); + GET_FLOAT_WORD(hy,y); + ix = hx&0x7fffffff; iy = hy&0x7fffffff; + + /* y==zero: x**0 = 1 */ + if(iy==0) return one; + + /* x==+-1 */ + if(x == 1.0) return one; + if(x == -1.0 && __isinff(y)) return one; + + /* +-NaN return x+y */ + if(ix > 0x7f800000 || + iy > 0x7f800000) + return x+y; + + /* determine if y is an odd int when x < 0 + * yisint = 0 ... y is not an integer + * yisint = 1 ... y is an odd int + * yisint = 2 ... y is an even int + */ + yisint = 0; + if(hx<0) { + if(iy>=0x4b800000) yisint = 2; /* even integer y */ + else if(iy>=0x3f800000) { + k = (iy>>23)-0x7f; /* exponent */ + j = iy>>(23-k); + if((j<<(23-k))==iy) yisint = 2-(j&1); + } + } + + /* special value of y */ + if (iy==0x7f800000) { /* y is +-inf */ + if (ix==0x3f800000) + return y - y; /* inf**+-1 is NaN */ + else if (ix > 0x3f800000)/* (|x|>1)**+-inf = inf,0 */ + return (hy>=0)? y: zero; + else /* (|x|<1)**-,+inf = inf,0 */ + return (hy<0)?-y: zero; + } + if(iy==0x3f800000) { /* y is +-1 */ + if(hy<0) return one/x; else return x; + } + if(hy==0x40000000) return x*x; /* y is 2 */ + if(hy==0x3f000000) { /* y is 0.5 */ + if(hx>=0) /* x >= +0 */ + return __ieee754_sqrtf(x); + } + + ax = fabsf(x); + /* special value of x */ + if(ix==0x7f800000||ix==0||ix==0x3f800000){ + z = ax; /*x is +-0,+-inf,+-1*/ + if(hy<0) z = one/z; /* z = (1/|x|) */ + if(hx<0) { + if(((ix-0x3f800000)|yisint)==0) { + z = (z-z)/(z-z); /* (-1)**non-int is NaN */ + } else if(yisint==1) + z = -z; /* (x<0)**odd = -(|x|**odd) */ + } + return z; + } + + /* (x<0)**(non-int) is NaN */ + if(((((u_int32_t)hx>>31)-1)|yisint)==0) return (x-x)/(x-x); + + /* |y| is huge */ + if(iy>0x4d000000) { /* if |y| > 2**27 */ + /* over/underflow if x is not close to one */ + if(ix<0x3f7ffff8) return (hy<0)? huge*huge:tiny*tiny; + if(ix>0x3f800007) return (hy>0)? huge*huge:tiny*tiny; + /* now |1-x| is tiny <= 2**-20, suffice to compute + log(x) by x-x^2/2+x^3/3-x^4/4 */ + t = x-1; /* t has 20 trailing zeros */ + w = (t*t)*((float)0.5-t*((float)0.333333333333-t*(float)0.25)); + u = ivln2_h*t; /* ivln2_h has 16 sig. bits */ + v = t*ivln2_l-w*ivln2; + t1 = u+v; + GET_FLOAT_WORD(is,t1); + SET_FLOAT_WORD(t1,is&0xfffff000); + t2 = v-(t1-u); + } else { + float s2,s_h,s_l,t_h,t_l; + n = 0; + /* take care subnormal number */ + if(ix<0x00800000) + {ax *= two24; n -= 24; GET_FLOAT_WORD(ix,ax); } + n += ((ix)>>23)-0x7f; + j = ix&0x007fffff; + /* determine interval */ + ix = j|0x3f800000; /* normalize ix */ + if(j<=0x1cc471) k=0; /* |x|>1)|0x20000000)+0x0040000+(k<<21)); + t_l = ax - (t_h-bp[k]); + s_l = v*((u-s_h*t_h)-s_h*t_l); + /* compute log(ax) */ + s2 = s*s; + r = s2*s2*(L1+s2*(L2+s2*(L3+s2*(L4+s2*(L5+s2*L6))))); + r += s_l*(s_h+s); + s2 = s_h*s_h; + t_h = (float)3.0+s2+r; + GET_FLOAT_WORD(is,t_h); + SET_FLOAT_WORD(t_h,is&0xfffff000); + t_l = r-((t_h-(float)3.0)-s2); + /* u+v = s*(1+...) */ + u = s_h*t_h; + v = s_l*t_h+t_l*s; + /* 2/(3log2)*(s+...) */ + p_h = u+v; + GET_FLOAT_WORD(is,p_h); + SET_FLOAT_WORD(p_h,is&0xfffff000); + p_l = v-(p_h-u); + z_h = cp_h*p_h; /* cp_h+cp_l = 2/(3*log2) */ + z_l = cp_l*p_h+p_l*cp+dp_l[k]; + /* log2(ax) = (s+..)*2/(3*log2) = n + dp_h + z_h + z_l */ + t = (float)n; + t1 = (((z_h+z_l)+dp_h[k])+t); + GET_FLOAT_WORD(is,t1); + SET_FLOAT_WORD(t1,is&0xfffff000); + t2 = z_l-(((t1-t)-dp_h[k])-z_h); + } + + s = one; /* s (sign of result -ve**odd) = -1 else = 1 */ + if(((((u_int32_t)hx>>31)-1)|(yisint-1))==0) + s = -one; /* (-ve)**(odd int) */ + + /* split up y into y1+y2 and compute (y1+y2)*(t1+t2) */ + GET_FLOAT_WORD(is,y); + SET_FLOAT_WORD(y1,is&0xfffff000); + p_l = (y-y1)*t1+y*t2; + p_h = y1*t1; + z = p_l+p_h; + GET_FLOAT_WORD(j,z); + if (j>0x43000000) /* if z > 128 */ + return s*huge*huge; /* overflow */ + else if (j==0x43000000) { /* if z == 128 */ + if(p_l+ovt>z-p_h) return s*huge*huge; /* overflow */ + } + else if ((j&0x7fffffff)>0x43160000) /* z <= -150 */ + return s*tiny*tiny; /* underflow */ + else if ((u_int32_t) j==0xc3160000){ /* z == -150 */ + if(p_l<=z-p_h) return s*tiny*tiny; /* underflow */ + } + /* + * compute 2**(p_h+p_l) + */ + i = j&0x7fffffff; + k = (i>>23)-0x7f; + n = 0; + if(i>0x3f000000) { /* if |z| > 0.5, set n = [z+0.5] */ + n = j+(0x00800000>>(k+1)); + k = ((n&0x7fffffff)>>23)-0x7f; /* new k for n */ + SET_FLOAT_WORD(t,n&~(0x007fffff>>k)); + n = ((n&0x007fffff)|0x00800000)>>(23-k); + if(j<0) n = -n; + p_h -= t; + } + t = p_l+p_h; + GET_FLOAT_WORD(is,t); + SET_FLOAT_WORD(t,is&0xfffff000); + u = t*lg2_h; + v = (p_l-(t-p_h))*lg2+t*lg2_l; + z = u+v; + w = v-(z-u); + t = z*z; + t1 = z - t*(P1+t*(P2+t*(P3+t*(P4+t*P5)))); + r = (z*t1)/(t1-two)-(w+z*w); + z = one-(r-z); + GET_FLOAT_WORD(j,z); + j += (n<<23); + if((j>>23)<=0) z = __scalbnf(z,n); /* subnormal output */ + else SET_FLOAT_WORD(z,j); + return s*z; +} diff --git a/libgcc-math/flt-32/e_rem_pio2f.c b/libgcc-math/flt-32/e_rem_pio2f.c new file mode 100644 index 00000000000..4b8c4466bdb --- /dev/null +++ b/libgcc-math/flt-32/e_rem_pio2f.c @@ -0,0 +1,196 @@ +/* e_rem_pio2f.c -- float version of e_rem_pio2.c + * Conversion to float by Ian Lance Taylor, Cygnus Support, ian@cygnus.com. + */ + +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ + +#if defined(LIBM_SCCS) && !defined(lint) +static char rcsid[] = "$NetBSD: e_rem_pio2f.c,v 1.5 1995/05/10 20:46:03 jtc Exp $"; +#endif + +/* __ieee754_rem_pio2f(x,y) + * + * return the remainder of x rem pi/2 in y[0]+y[1] + * use __kernel_rem_pio2f() + */ + +#include "math.h" +#include "math_private.h" + +/* + * Table of constants for 2/pi, 396 Hex digits (476 decimal) of 2/pi + */ +#ifdef __STDC__ +static const int32_t two_over_pi[] = { +#else +static int32_t two_over_pi[] = { +#endif +0xA2, 0xF9, 0x83, 0x6E, 0x4E, 0x44, 0x15, 0x29, 0xFC, +0x27, 0x57, 0xD1, 0xF5, 0x34, 0xDD, 0xC0, 0xDB, 0x62, +0x95, 0x99, 0x3C, 0x43, 0x90, 0x41, 0xFE, 0x51, 0x63, +0xAB, 0xDE, 0xBB, 0xC5, 0x61, 0xB7, 0x24, 0x6E, 0x3A, +0x42, 0x4D, 0xD2, 0xE0, 0x06, 0x49, 0x2E, 0xEA, 0x09, +0xD1, 0x92, 0x1C, 0xFE, 0x1D, 0xEB, 0x1C, 0xB1, 0x29, +0xA7, 0x3E, 0xE8, 0x82, 0x35, 0xF5, 0x2E, 0xBB, 0x44, +0x84, 0xE9, 0x9C, 0x70, 0x26, 0xB4, 0x5F, 0x7E, 0x41, +0x39, 0x91, 0xD6, 0x39, 0x83, 0x53, 0x39, 0xF4, 0x9C, +0x84, 0x5F, 0x8B, 0xBD, 0xF9, 0x28, 0x3B, 0x1F, 0xF8, +0x97, 0xFF, 0xDE, 0x05, 0x98, 0x0F, 0xEF, 0x2F, 0x11, +0x8B, 0x5A, 0x0A, 0x6D, 0x1F, 0x6D, 0x36, 0x7E, 0xCF, +0x27, 0xCB, 0x09, 0xB7, 0x4F, 0x46, 0x3F, 0x66, 0x9E, +0x5F, 0xEA, 0x2D, 0x75, 0x27, 0xBA, 0xC7, 0xEB, 0xE5, +0xF1, 0x7B, 0x3D, 0x07, 0x39, 0xF7, 0x8A, 0x52, 0x92, +0xEA, 0x6B, 0xFB, 0x5F, 0xB1, 0x1F, 0x8D, 0x5D, 0x08, +0x56, 0x03, 0x30, 0x46, 0xFC, 0x7B, 0x6B, 0xAB, 0xF0, +0xCF, 0xBC, 0x20, 0x9A, 0xF4, 0x36, 0x1D, 0xA9, 0xE3, +0x91, 0x61, 0x5E, 0xE6, 0x1B, 0x08, 0x65, 0x99, 0x85, +0x5F, 0x14, 0xA0, 0x68, 0x40, 0x8D, 0xFF, 0xD8, 0x80, +0x4D, 0x73, 0x27, 0x31, 0x06, 0x06, 0x15, 0x56, 0xCA, +0x73, 0xA8, 0xC9, 0x60, 0xE2, 0x7B, 0xC0, 0x8C, 0x6B, +}; + +/* This array is like the one in e_rem_pio2.c, but the numbers are + single precision and the last 8 bits are forced to 0. */ +#ifdef __STDC__ +static const int32_t npio2_hw[] = { +#else +static int32_t npio2_hw[] = { +#endif +0x3fc90f00, 0x40490f00, 0x4096cb00, 0x40c90f00, 0x40fb5300, 0x4116cb00, +0x412fed00, 0x41490f00, 0x41623100, 0x417b5300, 0x418a3a00, 0x4196cb00, +0x41a35c00, 0x41afed00, 0x41bc7e00, 0x41c90f00, 0x41d5a000, 0x41e23100, +0x41eec200, 0x41fb5300, 0x4203f200, 0x420a3a00, 0x42108300, 0x4216cb00, +0x421d1400, 0x42235c00, 0x4229a500, 0x422fed00, 0x42363600, 0x423c7e00, +0x4242c700, 0x42490f00 +}; + +/* + * invpio2: 24 bits of 2/pi + * pio2_1: first 17 bit of pi/2 + * pio2_1t: pi/2 - pio2_1 + * pio2_2: second 17 bit of pi/2 + * pio2_2t: pi/2 - (pio2_1+pio2_2) + * pio2_3: third 17 bit of pi/2 + * pio2_3t: pi/2 - (pio2_1+pio2_2+pio2_3) + */ + +#ifdef __STDC__ +static const float +#else +static float +#endif +zero = 0.0000000000e+00, /* 0x00000000 */ +half = 5.0000000000e-01, /* 0x3f000000 */ +two8 = 2.5600000000e+02, /* 0x43800000 */ +invpio2 = 6.3661980629e-01, /* 0x3f22f984 */ +pio2_1 = 1.5707855225e+00, /* 0x3fc90f80 */ +pio2_1t = 1.0804334124e-05, /* 0x37354443 */ +pio2_2 = 1.0804273188e-05, /* 0x37354400 */ +pio2_2t = 6.0770999344e-11, /* 0x2e85a308 */ +pio2_3 = 6.0770943833e-11, /* 0x2e85a300 */ +pio2_3t = 6.1232342629e-17; /* 0x248d3132 */ + +#ifdef __STDC__ + int32_t __ieee754_rem_pio2f(float x, float *y) +#else + int32_t __ieee754_rem_pio2f(x,y) + float x,y[]; +#endif +{ + float z,w,t,r,fn; + float tx[3]; + int32_t e0,i,j,nx,n,ix,hx; + + GET_FLOAT_WORD(hx,x); + ix = hx&0x7fffffff; + if(ix<=0x3f490fd8) /* |x| ~<= pi/4 , no need for reduction */ + {y[0] = x; y[1] = 0; return 0;} + if(ix<0x4016cbe4) { /* |x| < 3pi/4, special case with n=+-1 */ + if(hx>0) { + z = x - pio2_1; + if((ix&0xfffffff0)!=0x3fc90fd0) { /* 24+24 bit pi OK */ + y[0] = z - pio2_1t; + y[1] = (z-y[0])-pio2_1t; + } else { /* near pi/2, use 24+24+24 bit pi */ + z -= pio2_2; + y[0] = z - pio2_2t; + y[1] = (z-y[0])-pio2_2t; + } + return 1; + } else { /* negative x */ + z = x + pio2_1; + if((ix&0xfffffff0)!=0x3fc90fd0) { /* 24+24 bit pi OK */ + y[0] = z + pio2_1t; + y[1] = (z-y[0])+pio2_1t; + } else { /* near pi/2, use 24+24+24 bit pi */ + z += pio2_2; + y[0] = z + pio2_2t; + y[1] = (z-y[0])+pio2_2t; + } + return -1; + } + } + if(ix<=0x43490f80) { /* |x| ~<= 2^7*(pi/2), medium size */ + t = fabsf(x); + n = (int32_t) (t*invpio2+half); + fn = (float)n; + r = t-fn*pio2_1; + w = fn*pio2_1t; /* 1st round good to 40 bit */ + if(n<32&&(int32_t)(ix&0xffffff00)!=npio2_hw[n-1]) { + y[0] = r-w; /* quick check no cancellation */ + } else { + u_int32_t high; + j = ix>>23; + y[0] = r-w; + GET_FLOAT_WORD(high,y[0]); + i = j-((high>>23)&0xff); + if(i>8) { /* 2nd iteration needed, good to 57 */ + t = r; + w = fn*pio2_2; + r = t-w; + w = fn*pio2_2t-((t-r)-w); + y[0] = r-w; + GET_FLOAT_WORD(high,y[0]); + i = j-((high>>23)&0xff); + if(i>25) { /* 3rd iteration need, 74 bits acc */ + t = r; /* will cover all possible cases */ + w = fn*pio2_3; + r = t-w; + w = fn*pio2_3t-((t-r)-w); + y[0] = r-w; + } + } + } + y[1] = (r-y[0])-w; + if(hx<0) {y[0] = -y[0]; y[1] = -y[1]; return -n;} + else return n; + } + /* + * all other (large) arguments + */ + if(ix>=0x7f800000) { /* x is inf or NaN */ + y[0]=y[1]=x-x; return 0; + } + /* set z = scalbn(|x|,ilogb(x)-7) */ + e0 = (ix>>23)-134; /* e0 = ilogb(z)-7; */ + SET_FLOAT_WORD(z, ix - ((int32_t)(e0<<23))); + for(i=0;i<2;i++) { + tx[i] = (float)((int32_t)(z)); + z = (z-tx[i])*two8; + } + tx[2] = z; + nx = 3; + while(tx[nx-1]==zero) nx--; /* skip zero term */ + n = __kernel_rem_pio2f(tx,y,e0,nx,2,two_over_pi); + if(hx<0) {y[0] = -y[0]; y[1] = -y[1]; return -n;} + return n; +} diff --git a/libgcc-math/flt-32/e_sqrtf.c b/libgcc-math/flt-32/e_sqrtf.c new file mode 100644 index 00000000000..7648ef4bca2 --- /dev/null +++ b/libgcc-math/flt-32/e_sqrtf.c @@ -0,0 +1,97 @@ +/* e_sqrtf.c -- float version of e_sqrt.c. + * Conversion to float by Ian Lance Taylor, Cygnus Support, ian@cygnus.com. + */ + +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ + +#if defined(LIBM_SCCS) && !defined(lint) +static char rcsid[] = "$NetBSD: e_sqrtf.c,v 1.4 1995/05/10 20:46:19 jtc Exp $"; +#endif + +#include "math.h" +#include "math_private.h" + +#ifdef __STDC__ +static const float one = 1.0, tiny=1.0e-30; +#else +static float one = 1.0, tiny=1.0e-30; +#endif + +#ifdef __STDC__ + float __ieee754_sqrtf(float x) +#else + float __ieee754_sqrtf(x) + float x; +#endif +{ + float z; + int32_t sign = (int)0x80000000; + int32_t ix,s,q,m,t,i; + u_int32_t r; + + GET_FLOAT_WORD(ix,x); + + /* take care of Inf and NaN */ + if((ix&0x7f800000)==0x7f800000) { + return x*x+x; /* sqrt(NaN)=NaN, sqrt(+inf)=+inf + sqrt(-inf)=sNaN */ + } + /* take care of zero */ + if(ix<=0) { + if((ix&(~sign))==0) return x;/* sqrt(+-0) = +-0 */ + else if(ix<0) + return (x-x)/(x-x); /* sqrt(-ve) = sNaN */ + } + /* normalize x */ + m = (ix>>23); + if(m==0) { /* subnormal x */ + for(i=0;(ix&0x00800000)==0;i++) ix<<=1; + m -= i-1; + } + m -= 127; /* unbias exponent */ + ix = (ix&0x007fffff)|0x00800000; + if(m&1) /* odd m, double x to make it even */ + ix += ix; + m >>= 1; /* m = [m/2] */ + + /* generate sqrt(x) bit by bit */ + ix += ix; + q = s = 0; /* q = sqrt(x) */ + r = 0x01000000; /* r = moving bit from right to left */ + + while(r!=0) { + t = s+r; + if(t<=ix) { + s = t+r; + ix -= t; + q += r; + } + ix += ix; + r>>=1; + } + + /* use floating add to find out rounding direction */ + if(ix!=0) { + z = one-tiny; /* trigger inexact flag */ + if (z>=one) { + z = one+tiny; + if (z>one) + q += 2; + else + q += (q&1); + } + } + ix = (q>>1)+0x3f000000; + ix += (m <<23); + SET_FLOAT_WORD(z,ix); + return z; +} diff --git a/libgcc-math/flt-32/k_cosf.c b/libgcc-math/flt-32/k_cosf.c new file mode 100644 index 00000000000..b232cab11f5 --- /dev/null +++ b/libgcc-math/flt-32/k_cosf.c @@ -0,0 +1,64 @@ +/* k_cosf.c -- float version of k_cos.c + * Conversion to float by Ian Lance Taylor, Cygnus Support, ian@cygnus.com. + */ + +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ + +#if defined(LIBM_SCCS) && !defined(lint) +static char rcsid[] = "$NetBSD: k_cosf.c,v 1.4 1995/05/10 20:46:23 jtc Exp $"; +#endif + +#include "math.h" +#include "math_private.h" + +#ifdef __STDC__ +static const float +#else +static float +#endif +one = 1.0000000000e+00, /* 0x3f800000 */ +C1 = 4.1666667908e-02, /* 0x3d2aaaab */ +C2 = -1.3888889225e-03, /* 0xbab60b61 */ +C3 = 2.4801587642e-05, /* 0x37d00d01 */ +C4 = -2.7557314297e-07, /* 0xb493f27c */ +C5 = 2.0875723372e-09, /* 0x310f74f6 */ +C6 = -1.1359647598e-11; /* 0xad47d74e */ + +#ifdef __STDC__ + float __kernel_cosf(float x, float y) +#else + float __kernel_cosf(x, y) + float x,y; +#endif +{ + float a,hz,z,r,qx; + int32_t ix; + GET_FLOAT_WORD(ix,x); + ix &= 0x7fffffff; /* ix = |x|'s high word*/ + if(ix<0x32000000) { /* if x < 2**27 */ + if(((int)x)==0) return one; /* generate inexact */ + } + z = x*x; + r = z*(C1+z*(C2+z*(C3+z*(C4+z*(C5+z*C6))))); + if(ix < 0x3e99999a) /* if |x| < 0.3 */ + return one - ((float)0.5*z - (z*r - x*y)); + else { + if(ix > 0x3f480000) { /* x > 0.78125 */ + qx = (float)0.28125; + } else { + SET_FLOAT_WORD(qx,ix-0x01000000); /* x/4 */ + } + hz = (float)0.5*z-qx; + a = one-qx; + return a - (hz - (z*r-x*y)); + } +} diff --git a/libgcc-math/flt-32/k_rem_pio2f.c b/libgcc-math/flt-32/k_rem_pio2f.c new file mode 100644 index 00000000000..2783480fcbf --- /dev/null +++ b/libgcc-math/flt-32/k_rem_pio2f.c @@ -0,0 +1,213 @@ +/* k_rem_pio2f.c -- float version of k_rem_pio2.c + * Conversion to float by Ian Lance Taylor, Cygnus Support, ian@cygnus.com. + */ + +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ + +#if defined(LIBM_SCCS) && !defined(lint) +static char rcsid[] = "$NetBSD: k_rem_pio2f.c,v 1.4 1995/05/10 20:46:28 jtc Exp $"; +#endif + +#include "math.h" +#include "math_private.h" + +/* In the float version, the input parameter x contains 8 bit + integers, not 24 bit integers. 113 bit precision is not supported. */ + +#ifdef __STDC__ +static const int init_jk[] = {4,7,9}; /* initial value for jk */ +#else +static int init_jk[] = {4,7,9}; +#endif + +#ifdef __STDC__ +static const float PIo2[] = { +#else +static float PIo2[] = { +#endif + 1.5703125000e+00, /* 0x3fc90000 */ + 4.5776367188e-04, /* 0x39f00000 */ + 2.5987625122e-05, /* 0x37da0000 */ + 7.5437128544e-08, /* 0x33a20000 */ + 6.0026650317e-11, /* 0x2e840000 */ + 7.3896444519e-13, /* 0x2b500000 */ + 5.3845816694e-15, /* 0x27c20000 */ + 5.6378512969e-18, /* 0x22d00000 */ + 8.3009228831e-20, /* 0x1fc40000 */ + 3.2756352257e-22, /* 0x1bc60000 */ + 6.3331015649e-25, /* 0x17440000 */ +}; + +#ifdef __STDC__ +static const float +#else +static float +#endif +zero = 0.0, +one = 1.0, +two8 = 2.5600000000e+02, /* 0x43800000 */ +twon8 = 3.9062500000e-03; /* 0x3b800000 */ + +#ifdef __STDC__ + int __kernel_rem_pio2f(float *x, float *y, int e0, int nx, int prec, const int32_t *ipio2) +#else + int __kernel_rem_pio2f(x,y,e0,nx,prec,ipio2) + float x[], y[]; int e0,nx,prec; int32_t ipio2[]; +#endif +{ + int32_t jz,jx,jv,jp,jk,carry,n,iq[20],i,j,k,m,q0,ih; + float z,fw,f[20],fq[20],q[20]; + + /* initialize jk*/ + jk = init_jk[prec]; + jp = jk; + + /* determine jx,jv,q0, note that 3>q0 */ + jx = nx-1; + jv = (e0-3)/8; if(jv<0) jv=0; + q0 = e0-8*(jv+1); + + /* set up f[0] to f[jx+jk] where f[jx+jk] = ipio2[jv+jk] */ + j = jv-jx; m = jx+jk; + for(i=0;i<=m;i++,j++) f[i] = (j<0)? zero : (float) ipio2[j]; + + /* compute q[0],q[1],...q[jk] */ + for (i=0;i<=jk;i++) { + for(j=0,fw=0.0;j<=jx;j++) fw += x[j]*f[jx+i-j]; q[i] = fw; + } + + jz = jk; +recompute: + /* distill q[] into iq[] reversingly */ + for(i=0,j=jz,z=q[jz];j>0;i++,j--) { + fw = (float)((int32_t)(twon8* z)); + iq[i] = (int32_t)(z-two8*fw); + z = q[j-1]+fw; + } + + /* compute n */ + z = __scalbnf(z,q0); /* actual value of z */ + z -= (float)8.0*__floorf(z*(float)0.125); /* trim off integer >= 8 */ + n = (int32_t) z; + z -= (float)n; + ih = 0; + if(q0>0) { /* need iq[jz-1] to determine n */ + i = (iq[jz-1]>>(8-q0)); n += i; + iq[jz-1] -= i<<(8-q0); + ih = iq[jz-1]>>(7-q0); + } + else if(q0==0) ih = iq[jz-1]>>8; + else if(z>=(float)0.5) ih=2; + + if(ih>0) { /* q > 0.5 */ + n += 1; carry = 0; + for(i=0;i0) { /* rare case: chance is 1 in 12 */ + switch(q0) { + case 1: + iq[jz-1] &= 0x7f; break; + case 2: + iq[jz-1] &= 0x3f; break; + } + } + if(ih==2) { + z = one - z; + if(carry!=0) z -= __scalbnf(one,q0); + } + } + + /* check if recomputation is needed */ + if(z==zero) { + j = 0; + for (i=jz-1;i>=jk;i--) j |= iq[i]; + if(j==0) { /* need recomputation */ + for(k=1;iq[jk-k]==0;k++); /* k = no. of terms needed */ + + for(i=jz+1;i<=jz+k;i++) { /* add q[jz+1] to q[jz+k] */ + f[jx+i] = (float) ipio2[jv+i]; + for(j=0,fw=0.0;j<=jx;j++) fw += x[j]*f[jx+i-j]; + q[i] = fw; + } + jz += k; + goto recompute; + } + } + + /* chop off zero terms */ + if(z==(float)0.0) { + jz -= 1; q0 -= 8; + while(iq[jz]==0) { jz--; q0-=8;} + } else { /* break z into 8-bit if necessary */ + z = __scalbnf(z,-q0); + if(z>=two8) { + fw = (float)((int32_t)(twon8*z)); + iq[jz] = (int32_t)(z-two8*fw); + jz += 1; q0 += 8; + iq[jz] = (int32_t) fw; + } else iq[jz] = (int32_t) z ; + } + + /* convert integer "bit" chunk to floating-point value */ + fw = __scalbnf(one,q0); + for(i=jz;i>=0;i--) { + q[i] = fw*(float)iq[i]; fw*=twon8; + } + + /* compute PIo2[0,...,jp]*q[jz,...,0] */ + for(i=jz;i>=0;i--) { + for(fw=0.0,k=0;k<=jp&&k<=jz-i;k++) fw += PIo2[k]*q[i+k]; + fq[jz-i] = fw; + } + + /* compress fq[] into y[] */ + switch(prec) { + case 0: + fw = 0.0; + for (i=jz;i>=0;i--) fw += fq[i]; + y[0] = (ih==0)? fw: -fw; + break; + case 1: + case 2: + fw = 0.0; + for (i=jz;i>=0;i--) fw += fq[i]; + y[0] = (ih==0)? fw: -fw; + fw = fq[0]-fw; + for (i=1;i<=jz;i++) fw += fq[i]; + y[1] = (ih==0)? fw: -fw; + break; + case 3: /* painful */ + for (i=jz;i>0;i--) { + fw = fq[i-1]+fq[i]; + fq[i] += fq[i-1]-fw; + fq[i-1] = fw; + } + for (i=jz;i>1;i--) { + fw = fq[i-1]+fq[i]; + fq[i] += fq[i-1]-fw; + fq[i-1] = fw; + } + for (fw=0.0,i=jz;i>=2;i--) fw += fq[i]; + if(ih==0) { + y[0] = fq[0]; y[1] = fq[1]; y[2] = fw; + } else { + y[0] = -fq[0]; y[1] = -fq[1]; y[2] = -fw; + } + } + return n&7; +} diff --git a/libgcc-math/flt-32/k_sinf.c b/libgcc-math/flt-32/k_sinf.c new file mode 100644 index 00000000000..4fec15e830e --- /dev/null +++ b/libgcc-math/flt-32/k_sinf.c @@ -0,0 +1,54 @@ +/* k_sinf.c -- float version of k_sin.c + * Conversion to float by Ian Lance Taylor, Cygnus Support, ian@cygnus.com. + */ + +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ + +#if defined(LIBM_SCCS) && !defined(lint) +static char rcsid[] = "$NetBSD: k_sinf.c,v 1.4 1995/05/10 20:46:33 jtc Exp $"; +#endif + +#include "math.h" +#include "math_private.h" + +#ifdef __STDC__ +static const float +#else +static float +#endif +half = 5.0000000000e-01,/* 0x3f000000 */ +S1 = -1.6666667163e-01, /* 0xbe2aaaab */ +S2 = 8.3333337680e-03, /* 0x3c088889 */ +S3 = -1.9841270114e-04, /* 0xb9500d01 */ +S4 = 2.7557314297e-06, /* 0x3638ef1b */ +S5 = -2.5050759689e-08, /* 0xb2d72f34 */ +S6 = 1.5896910177e-10; /* 0x2f2ec9d3 */ + +#ifdef __STDC__ + float __kernel_sinf(float x, float y, int iy) +#else + float __kernel_sinf(x, y, iy) + float x,y; int iy; /* iy=0 if y is zero */ +#endif +{ + float z,r,v; + int32_t ix; + GET_FLOAT_WORD(ix,x); + ix &= 0x7fffffff; /* high word of x */ + if(ix<0x32000000) /* |x| < 2**-27 */ + {if((int)x==0) return x;} /* generate inexact */ + z = x*x; + v = z*x; + r = S2+z*(S3+z*(S4+z*(S5+z*S6))); + if(iy==0) return x+v*(S1+z*r); + else return x-((z*(half*y-v*r)-y)-v*S1); +} diff --git a/libgcc-math/flt-32/k_tanf.c b/libgcc-math/flt-32/k_tanf.c new file mode 100644 index 00000000000..eb1a670939b --- /dev/null +++ b/libgcc-math/flt-32/k_tanf.c @@ -0,0 +1,101 @@ +/* k_tanf.c -- float version of k_tan.c + * Conversion to float by Ian Lance Taylor, Cygnus Support, ian@cygnus.com. + */ + +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ + +#if defined(LIBM_SCCS) && !defined(lint) +static char rcsid[] = "$NetBSD: k_tanf.c,v 1.4 1995/05/10 20:46:39 jtc Exp $"; +#endif + +#include "math.h" +#include "math_private.h" +#ifdef __STDC__ +static const float +#else +static float +#endif +one = 1.0000000000e+00, /* 0x3f800000 */ +pio4 = 7.8539812565e-01, /* 0x3f490fda */ +pio4lo= 3.7748947079e-08, /* 0x33222168 */ +T[] = { + 3.3333334327e-01, /* 0x3eaaaaab */ + 1.3333334029e-01, /* 0x3e088889 */ + 5.3968254477e-02, /* 0x3d5d0dd1 */ + 2.1869488060e-02, /* 0x3cb327a4 */ + 8.8632395491e-03, /* 0x3c11371f */ + 3.5920790397e-03, /* 0x3b6b6916 */ + 1.4562094584e-03, /* 0x3abede48 */ + 5.8804126456e-04, /* 0x3a1a26c8 */ + 2.4646313977e-04, /* 0x398137b9 */ + 7.8179444245e-05, /* 0x38a3f445 */ + 7.1407252108e-05, /* 0x3895c07a */ + -1.8558637748e-05, /* 0xb79bae5f */ + 2.5907305826e-05, /* 0x37d95384 */ +}; + +#ifdef __STDC__ + float __kernel_tanf(float x, float y, int iy) +#else + float __kernel_tanf(x, y, iy) + float x,y; int iy; +#endif +{ + float z,r,v,w,s; + int32_t ix,hx; + GET_FLOAT_WORD(hx,x); + ix = hx&0x7fffffff; /* high word of |x| */ + if(ix<0x31800000) /* x < 2**-28 */ + {if((int)x==0) { /* generate inexact */ + if((ix|(iy+1))==0) return one/fabsf(x); + else return (iy==1)? x: -one/x; + } + } + if(ix>=0x3f2ca140) { /* |x|>=0.6744 */ + if(hx<0) {x = -x; y = -y;} + z = pio4-x; + w = pio4lo-y; + x = z+w; y = 0.0; + } + z = x*x; + w = z*z; + /* Break x^5*(T[1]+x^2*T[2]+...) into + * x^5(T[1]+x^4*T[3]+...+x^20*T[11]) + + * x^5(x^2*(T[2]+x^4*T[4]+...+x^22*[T12])) + */ + r = T[1]+w*(T[3]+w*(T[5]+w*(T[7]+w*(T[9]+w*T[11])))); + v = z*(T[2]+w*(T[4]+w*(T[6]+w*(T[8]+w*(T[10]+w*T[12]))))); + s = z*x; + r = y + z*(s*(r+v)+y); + r += T[0]*s; + w = x+r; + if(ix>=0x3f2ca140) { + v = (float)iy; + return (float)(1-((hx>>30)&2))*(v-(float)2.0*(x-(w*w/(w+v)-r))); + } + if(iy==1) return w; + else { /* if allow error up to 2 ulp, + simply return -1.0/(x+r) here */ + /* compute -1.0/(x+r) accurately */ + float a,t; + int32_t i; + z = w; + GET_FLOAT_WORD(i,z); + SET_FLOAT_WORD(z,i&0xfffff000); + v = r-(z - x); /* z+v = r+x */ + t = a = -(float)1.0/w; /* a = -1.0/w */ + GET_FLOAT_WORD(i,t); + SET_FLOAT_WORD(t,i&0xfffff000); + s = (float)1.0+t*z; + return t+a*(s+t*v); + } +} diff --git a/libgcc-math/flt-32/s_atanf.c b/libgcc-math/flt-32/s_atanf.c new file mode 100644 index 00000000000..a68933fa6ad --- /dev/null +++ b/libgcc-math/flt-32/s_atanf.c @@ -0,0 +1,120 @@ +/* s_atanf.c -- float version of s_atan.c. + * Conversion to float by Ian Lance Taylor, Cygnus Support, ian@cygnus.com. + */ + +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ + +#if defined(LIBM_SCCS) && !defined(lint) +static char rcsid[] = "$NetBSD: s_atanf.c,v 1.4 1995/05/10 20:46:47 jtc Exp $"; +#endif + +#include "math.h" +#include "math_private.h" + +#ifdef __STDC__ +static const float atanhi[] = { +#else +static float atanhi[] = { +#endif + 4.6364760399e-01, /* atan(0.5)hi 0x3eed6338 */ + 7.8539812565e-01, /* atan(1.0)hi 0x3f490fda */ + 9.8279368877e-01, /* atan(1.5)hi 0x3f7b985e */ + 1.5707962513e+00, /* atan(inf)hi 0x3fc90fda */ +}; + +#ifdef __STDC__ +static const float atanlo[] = { +#else +static float atanlo[] = { +#endif + 5.0121582440e-09, /* atan(0.5)lo 0x31ac3769 */ + 3.7748947079e-08, /* atan(1.0)lo 0x33222168 */ + 3.4473217170e-08, /* atan(1.5)lo 0x33140fb4 */ + 7.5497894159e-08, /* atan(inf)lo 0x33a22168 */ +}; + +#ifdef __STDC__ +static const float aT[] = { +#else +static float aT[] = { +#endif + 3.3333334327e-01, /* 0x3eaaaaaa */ + -2.0000000298e-01, /* 0xbe4ccccd */ + 1.4285714924e-01, /* 0x3e124925 */ + -1.1111110449e-01, /* 0xbde38e38 */ + 9.0908870101e-02, /* 0x3dba2e6e */ + -7.6918758452e-02, /* 0xbd9d8795 */ + 6.6610731184e-02, /* 0x3d886b35 */ + -5.8335702866e-02, /* 0xbd6ef16b */ + 4.9768779427e-02, /* 0x3d4bda59 */ + -3.6531571299e-02, /* 0xbd15a221 */ + 1.6285819933e-02, /* 0x3c8569d7 */ +}; + +#ifdef __STDC__ + static const float +#else + static float +#endif +one = 1.0, +huge = 1.0e30; + +#ifdef __STDC__ + float __atanf(float x) +#else + float __atanf(x) + float x; +#endif +{ + float w,s1,s2,z; + int32_t ix,hx,id; + + GET_FLOAT_WORD(hx,x); + ix = hx&0x7fffffff; + if(ix>=0x50800000) { /* if |x| >= 2^34 */ + if(ix>0x7f800000) + return x+x; /* NaN */ + if(hx>0) return atanhi[3]+atanlo[3]; + else return -atanhi[3]-atanlo[3]; + } if (ix < 0x3ee00000) { /* |x| < 0.4375 */ + if (ix < 0x31000000) { /* |x| < 2^-29 */ + if(huge+x>one) return x; /* raise inexact */ + } + id = -1; + } else { + x = fabsf(x); + if (ix < 0x3f980000) { /* |x| < 1.1875 */ + if (ix < 0x3f300000) { /* 7/16 <=|x|<11/16 */ + id = 0; x = ((float)2.0*x-one)/((float)2.0+x); + } else { /* 11/16<=|x|< 19/16 */ + id = 1; x = (x-one)/(x+one); + } + } else { + if (ix < 0x401c0000) { /* |x| < 2.4375 */ + id = 2; x = (x-(float)1.5)/(one+(float)1.5*x); + } else { /* 2.4375 <= |x| < 2^66 */ + id = 3; x = -(float)1.0/x; + } + }} + /* end of argument reduction */ + z = x*x; + w = z*z; + /* break sum from i=0 to 10 aT[i]z**(i+1) into odd and even poly */ + s1 = z*(aT[0]+w*(aT[2]+w*(aT[4]+w*(aT[6]+w*(aT[8]+w*aT[10]))))); + s2 = w*(aT[1]+w*(aT[3]+w*(aT[5]+w*(aT[7]+w*aT[9])))); + if (id<0) return x - x*(s1+s2); + else { + z = atanhi[id] - ((x*(s1+s2) - atanlo[id]) - x); + return (hx<0)? -z:z; + } +} +weak_alias (__atanf, atanf) diff --git a/libgcc-math/flt-32/s_cosf.c b/libgcc-math/flt-32/s_cosf.c new file mode 100644 index 00000000000..86c59d440ca --- /dev/null +++ b/libgcc-math/flt-32/s_cosf.c @@ -0,0 +1,60 @@ +/* s_cosf.c -- float version of s_cos.c. + * Conversion to float by Ian Lance Taylor, Cygnus Support, ian@cygnus.com. + */ + +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ + +#if defined(LIBM_SCCS) && !defined(lint) +static char rcsid[] = "$NetBSD: s_cosf.c,v 1.4 1995/05/10 20:47:03 jtc Exp $"; +#endif + +#include "math.h" +#include "math_private.h" + +#ifdef __STDC__ +static const float one=1.0; +#else +static float one=1.0; +#endif + +#ifdef __STDC__ + float __cosf(float x) +#else + float __cosf(x) + float x; +#endif +{ + float y[2],z=0.0; + int32_t n,ix; + + GET_FLOAT_WORD(ix,x); + + /* |x| ~< pi/4 */ + ix &= 0x7fffffff; + if(ix <= 0x3f490fd8) return __kernel_cosf(x,z); + + /* cos(Inf or NaN) is NaN */ + else if (ix>=0x7f800000) return x-x; + + /* argument reduction needed */ + else { + n = __ieee754_rem_pio2f(x,y); + switch(n&3) { + case 0: return __kernel_cosf(y[0],y[1]); + case 1: return -__kernel_sinf(y[0],y[1],1); + case 2: return -__kernel_cosf(y[0],y[1]); + default: + return __kernel_sinf(y[0],y[1],1); + } + } +} +weak_alias (__cosf, cosf) diff --git a/libgcc-math/flt-32/s_floorf.c b/libgcc-math/flt-32/s_floorf.c new file mode 100644 index 00000000000..e8822b08849 --- /dev/null +++ b/libgcc-math/flt-32/s_floorf.c @@ -0,0 +1,71 @@ +/* s_floorf.c -- float version of s_floor.c. + * Conversion to float by Ian Lance Taylor, Cygnus Support, ian@cygnus.com. + */ + +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ + +#if defined(LIBM_SCCS) && !defined(lint) +static char rcsid[] = "$NetBSD: s_floorf.c,v 1.4 1995/05/10 20:47:22 jtc Exp $"; +#endif + +/* + * floorf(x) + * Return x rounded toward -inf to integral value + * Method: + * Bit twiddling. + * Exception: + * Inexact flag raised if x not equal to floorf(x). + */ + +#include "math.h" +#include "math_private.h" + +#ifdef __STDC__ +static const float huge = 1.0e30; +#else +static float huge = 1.0e30; +#endif + +#ifdef __STDC__ + float __floorf(float x) +#else + float __floorf(x) + float x; +#endif +{ + int32_t i0,j0; + u_int32_t i; + GET_FLOAT_WORD(i0,x); + j0 = ((i0>>23)&0xff)-0x7f; + if(j0<23) { + if(j0<0) { /* raise inexact if x != 0 */ + if(huge+x>(float)0.0) {/* return 0*sign(x) if |x|<1 */ + if(i0>=0) {i0=0;} + else if((i0&0x7fffffff)!=0) + { i0=0xbf800000;} + } + } else { + i = (0x007fffff)>>j0; + if((i0&i)==0) return x; /* x is integral */ + if(huge+x>(float)0.0) { /* raise inexact flag */ + if(i0<0) i0 += (0x00800000)>>j0; + i0 &= (~i); + } + } + } else { + if(j0==0x80) return x+x; /* inf or NaN */ + else return x; /* x is integral */ + } + SET_FLOAT_WORD(x,i0); + return x; +} +weak_alias (__floorf, floorf) diff --git a/libgcc-math/flt-32/s_isinff.c b/libgcc-math/flt-32/s_isinff.c new file mode 100644 index 00000000000..03a95fcc0fc --- /dev/null +++ b/libgcc-math/flt-32/s_isinff.c @@ -0,0 +1,29 @@ +/* + * Written by J.T. Conklin . + * Public domain. + */ + +#if defined(LIBM_SCCS) && !defined(lint) +static char rcsid[] = "$NetBSD: s_isinff.c,v 1.3 1995/05/11 23:20:21 jtc Exp $"; +#endif + +/* + * isinff(x) returns 1 if x is inf, -1 if x is -inf, else 0; + * no branching! + */ + +#include "math.h" +#include "math_private.h" + +int +__isinff (float x) +{ + int32_t ix,t; + GET_FLOAT_WORD(ix,x); + t = ix & 0x7fffffff; + t ^= 0x7f800000; + t |= -t; + return ~(t >> 31) & (ix >> 30); +} +hidden_def (__isinff) +weak_alias (__isinff, isinff) diff --git a/libgcc-math/flt-32/s_scalbnf.c b/libgcc-math/flt-32/s_scalbnf.c new file mode 100644 index 00000000000..f9366bb5104 --- /dev/null +++ b/libgcc-math/flt-32/s_scalbnf.c @@ -0,0 +1,63 @@ +/* s_scalbnf.c -- float version of s_scalbn.c. + * Conversion to float by Ian Lance Taylor, Cygnus Support, ian@cygnus.com. + */ + +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ + +#if defined(LIBM_SCCS) && !defined(lint) +static char rcsid[] = "$NetBSD: s_scalbnf.c,v 1.4 1995/05/10 20:48:10 jtc Exp $"; +#endif + +#include "math.h" +#include "math_private.h" + +#ifdef __STDC__ +static const float +#else +static float +#endif +two25 = 3.355443200e+07, /* 0x4c000000 */ +twom25 = 2.9802322388e-08, /* 0x33000000 */ +huge = 1.0e+30, +tiny = 1.0e-30; + +#ifdef __STDC__ + float __scalbnf (float x, int n) +#else + float __scalbnf (x,n) + float x; int n; +#endif +{ + int32_t k,ix; + GET_FLOAT_WORD(ix,x); + k = (ix&0x7f800000)>>23; /* extract exponent */ + if (k==0) { /* 0 or subnormal x */ + if ((ix&0x7fffffff)==0) return x; /* +-0 */ + x *= two25; + GET_FLOAT_WORD(ix,x); + k = ((ix&0x7f800000)>>23) - 25; + } + if (k==0xff) return x+x; /* NaN or Inf */ + k = k+n; + if (n> 50000 || k > 0xfe) + return huge*__builtin_copysignf(huge,x); /* overflow */ + if (n< -50000) + return tiny*__builtin_copysignf(tiny,x); /*underflow*/ + if (k > 0) /* normal result */ + {SET_FLOAT_WORD(x,(ix&0x807fffff)|(k<<23)); return x;} + if (k <= -25) + return tiny*__builtin_copysignf(tiny,x); /*underflow*/ + k += 25; /* subnormal result */ + SET_FLOAT_WORD(x,(ix&0x807fffff)|(k<<23)); + return x*twom25; +} +weak_alias (__scalbnf, scalbnf) diff --git a/libgcc-math/flt-32/s_sinf.c b/libgcc-math/flt-32/s_sinf.c new file mode 100644 index 00000000000..76a7c21fcb1 --- /dev/null +++ b/libgcc-math/flt-32/s_sinf.c @@ -0,0 +1,54 @@ +/* s_sinf.c -- float version of s_sin.c. + * Conversion to float by Ian Lance Taylor, Cygnus Support, ian@cygnus.com. + */ + +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ + +#if defined(LIBM_SCCS) && !defined(lint) +static char rcsid[] = "$NetBSD: s_sinf.c,v 1.4 1995/05/10 20:48:16 jtc Exp $"; +#endif + +#include "math.h" +#include "math_private.h" + +#ifdef __STDC__ + float __sinf(float x) +#else + float __sinf(x) + float x; +#endif +{ + float y[2],z=0.0; + int32_t n, ix; + + GET_FLOAT_WORD(ix,x); + + /* |x| ~< pi/4 */ + ix &= 0x7fffffff; + if(ix <= 0x3f490fd8) return __kernel_sinf(x,z,0); + + /* sin(Inf or NaN) is NaN */ + else if (ix>=0x7f800000) return x-x; + + /* argument reduction needed */ + else { + n = __ieee754_rem_pio2f(x,y); + switch(n&3) { + case 0: return __kernel_sinf(y[0],y[1],1); + case 1: return __kernel_cosf(y[0],y[1]); + case 2: return -__kernel_sinf(y[0],y[1],1); + default: + return -__kernel_cosf(y[0],y[1]); + } + } +} +weak_alias (__sinf, sinf) diff --git a/libgcc-math/flt-32/s_tanf.c b/libgcc-math/flt-32/s_tanf.c new file mode 100644 index 00000000000..e8f6016c32c --- /dev/null +++ b/libgcc-math/flt-32/s_tanf.c @@ -0,0 +1,49 @@ +/* s_tanf.c -- float version of s_tan.c. + * Conversion to float by Ian Lance Taylor, Cygnus Support, ian@cygnus.com. + */ + +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ + +#if defined(LIBM_SCCS) && !defined(lint) +static char rcsid[] = "$NetBSD: s_tanf.c,v 1.4 1995/05/10 20:48:20 jtc Exp $"; +#endif + +#include "math.h" +#include "math_private.h" + +#ifdef __STDC__ + float __tanf(float x) +#else + float __tanf(x) + float x; +#endif +{ + float y[2],z=0.0; + int32_t n, ix; + + GET_FLOAT_WORD(ix,x); + + /* |x| ~< pi/4 */ + ix &= 0x7fffffff; + if(ix <= 0x3f490fda) return __kernel_tanf(x,z,1); + + /* tan(Inf or NaN) is NaN */ + else if (ix>=0x7f800000) return x-x; /* NaN */ + + /* argument reduction needed */ + else { + n = __ieee754_rem_pio2f(x,y); + return __kernel_tanf(y[0],y[1],1-((n&1)<<1)); /* 1 -- n even + -1 -- n odd */ + } +} +weak_alias (__tanf, tanf) diff --git a/libgcc-math/flt-32/t_exp2f.h b/libgcc-math/flt-32/t_exp2f.h new file mode 100644 index 00000000000..f4b94b04982 --- /dev/null +++ b/libgcc-math/flt-32/t_exp2f.h @@ -0,0 +1,352 @@ +/* Accurate tables for exp2f(). + Copyright (C) 1998 Free Software Foundation, Inc. + This file is part of the GNU C Library. + Contributed by Geoffrey Keating + + The GNU C Library is free software; you can redistribute it and/or + modify it under the terms of the GNU Lesser General Public + License as published by the Free Software Foundation; either + version 2.1 of the License, or (at your option) any later version. + + The GNU C Library is distributed in the hope that it will be useful, + but WITHOUT ANY WARRANTY; without even the implied warranty of + MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU + Lesser General Public License for more details. + + You should have received a copy of the GNU Lesser General Public + License along with the GNU C Library; if not, write to the Free + Software Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA + 02111-1307 USA. */ + +/* This table has the property that, for all integers -128 <= i <= 127, + exp(i/256.0 + __exp2f_deltatable[i-128]) == __exp2f_atable[i+128] + r + for some -2^-35 < r < 2^-35 (abs(r) < 2^-36 if i <= 0); and that + __exp2f_deltatable[i+128] == t * 2^-30 + for integer t so that abs(t) <= 43447 * 2^0. */ + +#define W30 (9.31322575e-10) +static const float __exp2f_deltatable[256] = { + -810*W30, 283*W30, -1514*W30, 1304*W30, + -1148*W30, -98*W30, -744*W30, -156*W30, + -419*W30, -155*W30, 474*W30, 167*W30, + -1984*W30, -826*W30, 692*W30, 781*W30, + -578*W30, -411*W30, -129*W30, -1500*W30, + 654*W30, -141*W30, -816*W30, -53*W30, + 148*W30, 493*W30, -2214*W30, 760*W30, + 260*W30, 750*W30, -1300*W30, 1424*W30, + -1445*W30, -339*W30, -680*W30, -349*W30, + -922*W30, 531*W30, 193*W30, -2892*W30, + 290*W30, -2145*W30, -276*W30, 485*W30, + -695*W30, 215*W30, -7093*W30, 412*W30, + -4596*W30, 367*W30, 592*W30, -615*W30, + -97*W30, -1066*W30, 972*W30, -226*W30, + -625*W30, -374*W30, -5647*W30, -180*W30, + 20349*W30, -447*W30, 111*W30, -4164*W30, + -87*W30, -21*W30, -251*W30, 66*W30, + -517*W30, 2093*W30, -263*W30, 182*W30, + -601*W30, 475*W30, -483*W30, -1251*W30, + -373*W30, 1471*W30, -92*W30, -215*W30, + -97*W30, -190*W30, 0*W30, -290*W30, + -2647*W30, 1940*W30, -582*W30, 28*W30, + 833*W30, 1493*W30, 34*W30, 321*W30, + 3327*W30, -35*W30, 177*W30, -135*W30, + -796*W30, -428*W30, 129*W30, 9332*W30, + -12*W30, -69*W30, -1743*W30, 6508*W30, + -60*W30, 359*W30, 43447*W30, 15*W30, + -23*W30, -305*W30, -375*W30, -652*W30, + 667*W30, 269*W30, -1575*W30, 185*W30, + -329*W30, 200*W30, 6002*W30, 163*W30, + -647*W30, 19*W30, -603*W30, -755*W30, + 742*W30, -438*W30, 3587*W30, 2560*W30, + 0*W30, -520*W30, -241*W30, -299*W30, + -1270*W30, -991*W30, -1138*W30, 255*W30, + -1192*W30, 1722*W30, 1023*W30, 3700*W30, + -1388*W30, -1551*W30, -2549*W30, 27*W30, + 282*W30, 673*W30, 113*W30, 1561*W30, + 72*W30, 873*W30, 87*W30, -395*W30, + -433*W30, 629*W30, 3440*W30, -284*W30, + -592*W30, -103*W30, -46*W30, -3844*W30, + 1712*W30, 303*W30, 1555*W30, -631*W30, + -1400*W30, -961*W30, -854*W30, -276*W30, + 407*W30, 833*W30, -345*W30, -1501*W30, + 121*W30, -1581*W30, 400*W30, 150*W30, + 1224*W30, -139*W30, -563*W30, 879*W30, + 933*W30, 2939*W30, 788*W30, 211*W30, + 530*W30, -192*W30, 706*W30, -13347*W30, + 1065*W30, 3*W30, 111*W30, -208*W30, + -360*W30, -532*W30, -291*W30, 483*W30, + 987*W30, -33*W30, -1373*W30, -166*W30, + -1174*W30, -3955*W30, 1601*W30, -280*W30, + 1405*W30, 600*W30, -1659*W30, -23*W30, + 390*W30, 449*W30, 570*W30, -13143*W30, + -9*W30, -1646*W30, 1201*W30, 294*W30, + 2181*W30, -1173*W30, 1388*W30, -4504*W30, + 190*W30, -2304*W30, 211*W30, 239*W30, + 48*W30, -817*W30, 1018*W30, 1828*W30, + -663*W30, 1408*W30, 408*W30, -36*W30, + 1295*W30, -230*W30, 1341*W30, 9*W30, + 40*W30, 705*W30, 186*W30, 376*W30, + 557*W30, 5866*W30, 363*W30, -1558*W30, + 718*W30, 669*W30, 1369*W30, -2972*W30, + -468*W30, -121*W30, -219*W30, 667*W30, + 29954*W30, 366*W30, 48*W30, -203*W30 +}; + +static const float __exp2f_atable[256] /* __attribute__((mode(SF))) */ = { + 0.707106411447, /* 0x0.b504ecfff */ + 0.709024071690, /* 0x0.b58299fff */ + 0.710945606239, /* 0x0.b60088000 */ + 0.712874472142, /* 0x0.b67ef1000 */ + 0.714806139464, /* 0x0.b6fd88fff */ + 0.716744661340, /* 0x0.b77c94000 */ + 0.718687653549, /* 0x0.b7fbea000 */ + 0.720636486992, /* 0x0.b87ba1fff */ + 0.722590208040, /* 0x0.b8fbabfff */ + 0.724549472323, /* 0x0.b97c12fff */ + 0.726514220228, /* 0x0.b9fcd5fff */ + 0.728483855735, /* 0x0.ba7deb000 */ + 0.730457961549, /* 0x0.baff4afff */ + 0.732438981522, /* 0x0.bb811efff */ + 0.734425544748, /* 0x0.bc0350000 */ + 0.736416816713, /* 0x0.bc85d0000 */ + 0.738412797450, /* 0x0.bd089efff */ + 0.740414917465, /* 0x0.bd8bd4fff */ + 0.742422521111, /* 0x0.be0f66fff */ + 0.744434773914, /* 0x0.be9346fff */ + 0.746454179287, /* 0x0.bf179f000 */ + 0.748477637755, /* 0x0.bf9c3afff */ + 0.750506639473, /* 0x0.c02133fff */ + 0.752541840064, /* 0x0.c0a694fff */ + 0.754582285889, /* 0x0.c12c4e000 */ + 0.756628334525, /* 0x0.c1b265000 */ + 0.758678436269, /* 0x0.c238bffff */ + 0.760736882681, /* 0x0.c2bfa6fff */ + 0.762799203401, /* 0x0.c346cf000 */ + 0.764867603790, /* 0x0.c3ce5d000 */ + 0.766940355298, /* 0x0.c45633fff */ + 0.769021093841, /* 0x0.c4de90fff */ + 0.771104693409, /* 0x0.c5671dfff */ + 0.773195922364, /* 0x0.c5f02afff */ + 0.775292098512, /* 0x0.c6798afff */ + 0.777394294745, /* 0x0.c70350000 */ + 0.779501736166, /* 0x0.c78d6d000 */ + 0.781615912910, /* 0x0.c817fafff */ + 0.783734917628, /* 0x0.c8a2d9fff */ + 0.785858273516, /* 0x0.c92e02000 */ + 0.787990570071, /* 0x0.c9b9c0000 */ + 0.790125787245, /* 0x0.ca45aefff */ + 0.792268991467, /* 0x0.cad223fff */ + 0.794417440881, /* 0x0.cb5ef0fff */ + 0.796570718287, /* 0x0.cbec0efff */ + 0.798730909811, /* 0x0.cc79a0fff */ + 0.800892710672, /* 0x0.cd074dfff */ + 0.803068041795, /* 0x0.cd95ddfff */ + 0.805242776881, /* 0x0.ce2464000 */ + 0.807428598393, /* 0x0.ceb3a3fff */ + 0.809617877002, /* 0x0.cf431dfff */ + 0.811812341211, /* 0x0.cfd2eefff */ + 0.814013659956, /* 0x0.d06333000 */ + 0.816220164311, /* 0x0.d0f3ce000 */ + 0.818434238424, /* 0x0.d184e7fff */ + 0.820652604094, /* 0x0.d21649fff */ + 0.822877407074, /* 0x0.d2a818000 */ + 0.825108587751, /* 0x0.d33a51000 */ + 0.827342867839, /* 0x0.d3ccbdfff */ + 0.829588949684, /* 0x0.d45ff1000 */ + 0.831849217401, /* 0x0.d4f411fff */ + 0.834093391880, /* 0x0.d58724fff */ + 0.836355149750, /* 0x0.d61b5f000 */ + 0.838620424257, /* 0x0.d6afd3fff */ + 0.840896368027, /* 0x0.d744fc000 */ + 0.843176305293, /* 0x0.d7da66fff */ + 0.845462262643, /* 0x0.d87037000 */ + 0.847754716864, /* 0x0.d90673fff */ + 0.850052893157, /* 0x0.d99d10fff */ + 0.852359056469, /* 0x0.da3433fff */ + 0.854668736446, /* 0x0.dacb91fff */ + 0.856986224651, /* 0x0.db6373000 */ + 0.859309315673, /* 0x0.dbfbb1fff */ + 0.861639738080, /* 0x0.dc946bfff */ + 0.863975346095, /* 0x0.dd2d7d000 */ + 0.866317391394, /* 0x0.ddc6f9fff */ + 0.868666708472, /* 0x0.de60f1000 */ + 0.871022939695, /* 0x0.defb5c000 */ + 0.873383641229, /* 0x0.df9611fff */ + 0.875751554968, /* 0x0.e03141000 */ + 0.878126025200, /* 0x0.e0ccde000 */ + 0.880506813521, /* 0x0.e168e4fff */ + 0.882894217966, /* 0x0.e2055afff */ + 0.885287821299, /* 0x0.e2a239000 */ + 0.887686729423, /* 0x0.e33f6ffff */ + 0.890096127973, /* 0x0.e3dd56fff */ + 0.892507970338, /* 0x0.e47b67000 */ + 0.894928157336, /* 0x0.e51a03000 */ + 0.897355020043, /* 0x0.e5b90efff */ + 0.899788379682, /* 0x0.e65888000 */ + 0.902227103705, /* 0x0.e6f85afff */ + 0.904673457151, /* 0x0.e798ae000 */ + 0.907128036008, /* 0x0.e8398afff */ + 0.909585535528, /* 0x0.e8da99000 */ + 0.912051796915, /* 0x0.e97c3a000 */ + 0.914524436003, /* 0x0.ea1e46000 */ + 0.917003571999, /* 0x0.eac0bf000 */ + 0.919490039339, /* 0x0.eb63b2fff */ + 0.921983361257, /* 0x0.ec071a000 */ + 0.924488604054, /* 0x0.ecab48fff */ + 0.926989555360, /* 0x0.ed4f30000 */ + 0.929502844812, /* 0x0.edf3e6000 */ + 0.932021975503, /* 0x0.ee98fdfff */ + 0.934553921208, /* 0x0.ef3eecfff */ + 0.937083780759, /* 0x0.efe4b8fff */ + 0.939624726786, /* 0x0.f08b3f000 */ + 0.942198514924, /* 0x0.f133ebfff */ + 0.944726586343, /* 0x0.f1d99a000 */ + 0.947287976728, /* 0x0.f28176fff */ + 0.949856162070, /* 0x0.f329c5fff */ + 0.952431440345, /* 0x0.f3d28bfff */ + 0.955013573175, /* 0x0.f47bc5000 */ + 0.957603693021, /* 0x0.f52584000 */ + 0.960199773321, /* 0x0.f5cfa7000 */ + 0.962801992906, /* 0x0.f67a31000 */ + 0.965413510788, /* 0x0.f72556fff */ + 0.968030691152, /* 0x0.f7d0dc000 */ + 0.970655620084, /* 0x0.f87ce2fff */ + 0.973290979849, /* 0x0.f92998fff */ + 0.975926160805, /* 0x0.f9d64bfff */ + 0.978571653370, /* 0x0.fa83ac000 */ + 0.981225252139, /* 0x0.fb3193fff */ + 0.983885228626, /* 0x0.fbdfe6fff */ + 0.986552715296, /* 0x0.fc8eb7fff */ + 0.989228487027, /* 0x0.fd3e14000 */ + 0.991909801964, /* 0x0.fdedcd000 */ + 0.994601726545, /* 0x0.fe9e38000 */ + 0.997297704209, /* 0x0.ff4ee6fff */ + 1.000000000000, /* 0x1.000000000 */ + 1.002710938457, /* 0x1.00b1aa000 */ + 1.005429744692, /* 0x1.0163d7ffe */ + 1.008155703526, /* 0x1.02167dffe */ + 1.010888457284, /* 0x1.02c995fff */ + 1.013629436498, /* 0x1.037d38000 */ + 1.016377568250, /* 0x1.043152000 */ + 1.019134163841, /* 0x1.04e5f9ffe */ + 1.021896362316, /* 0x1.059b00000 */ + 1.024668931945, /* 0x1.0650b3ffe */ + 1.027446627635, /* 0x1.0706be001 */ + 1.030234098408, /* 0x1.07bd6bffe */ + 1.033023953416, /* 0x1.087441ffe */ + 1.035824656494, /* 0x1.092bce000 */ + 1.038632392900, /* 0x1.09e3d0001 */ + 1.041450142840, /* 0x1.0a9c79ffe */ + 1.044273972530, /* 0x1.0b558a001 */ + 1.047105550795, /* 0x1.0c0f1c001 */ + 1.049944162390, /* 0x1.0cc924001 */ + 1.052791833895, /* 0x1.0d83c4001 */ + 1.055645227426, /* 0x1.0e3ec3fff */ + 1.058507919326, /* 0x1.0efa60001 */ + 1.061377286898, /* 0x1.0fb66bfff */ + 1.064254641510, /* 0x1.1072fdffe */ + 1.067140102389, /* 0x1.113018000 */ + 1.070034146304, /* 0x1.11edc1fff */ + 1.072937250162, /* 0x1.12ac04001 */ + 1.075843691823, /* 0x1.136a7dfff */ + 1.078760385496, /* 0x1.1429a3ffe */ + 1.081685543070, /* 0x1.14e958000 */ + 1.084618330005, /* 0x1.15a98c000 */ + 1.087556362176, /* 0x1.166a18001 */ + 1.090508937863, /* 0x1.172b98001 */ + 1.093464612954, /* 0x1.17ed4bfff */ + 1.096430182434, /* 0x1.18afa5ffe */ + 1.099401354802, /* 0x1.19725e000 */ + 1.102381587017, /* 0x1.1a35adfff */ + 1.105370759965, /* 0x1.1af994000 */ + 1.108367800686, /* 0x1.1bbdfdffe */ + 1.111373305331, /* 0x1.1c82f6000 */ + 1.114387035385, /* 0x1.1d4878001 */ + 1.117408752440, /* 0x1.1e0e7ffff */ + 1.120437502874, /* 0x1.1ed4fe000 */ + 1.123474478729, /* 0x1.1f9c06000 */ + 1.126521706601, /* 0x1.2063ba001 */ + 1.129574775716, /* 0x1.212bd0001 */ + 1.132638812065, /* 0x1.21f49e000 */ + 1.135709524130, /* 0x1.22bddbffe */ + 1.138789534565, /* 0x1.2387b5fff */ + 1.141876101508, /* 0x1.2451fe000 */ + 1.144971728301, /* 0x1.251cddffe */ + 1.148077130296, /* 0x1.25e861ffe */ + 1.151189923305, /* 0x1.26b462001 */ + 1.154312610610, /* 0x1.278107ffe */ + 1.157440662410, /* 0x1.284e08001 */ + 1.160578370109, /* 0x1.291baa001 */ + 1.163725256932, /* 0x1.29e9e6000 */ + 1.166879892324, /* 0x1.2ab8a3ffe */ + 1.170044302935, /* 0x1.2b8805fff */ + 1.173205971694, /* 0x1.2c5739ffe */ + 1.176397800428, /* 0x1.2d2867ffe */ + 1.179586529747, /* 0x1.2df962001 */ + 1.182784795737, /* 0x1.2ecafbffe */ + 1.185991406414, /* 0x1.2f9d21ffe */ + 1.189206838636, /* 0x1.306fdc001 */ + 1.192430973067, /* 0x1.314328000 */ + 1.195664167430, /* 0x1.32170c001 */ + 1.198906540890, /* 0x1.32eb8a001 */ + 1.202157497408, /* 0x1.33c098000 */ + 1.205416083326, /* 0x1.349625fff */ + 1.208683252332, /* 0x1.356c43fff */ + 1.211961269402, /* 0x1.364318001 */ + 1.215246438983, /* 0x1.371a64000 */ + 1.218539118740, /* 0x1.37f22dffe */ + 1.221847295770, /* 0x1.38cafc000 */ + 1.225158572187, /* 0x1.39a3fdfff */ + 1.228481650325, /* 0x1.3a7dc5ffe */ + 1.231811761846, /* 0x1.3b5803fff */ + 1.235149741144, /* 0x1.3c32c5ffe */ + 1.238499879811, /* 0x1.3d0e53ffe */ + 1.241858124726, /* 0x1.3dea69fff */ + 1.245225191102, /* 0x1.3ec713fff */ + 1.248601436624, /* 0x1.3fa458000 */ + 1.251975655584, /* 0x1.40817a001 */ + 1.255380749731, /* 0x1.4160a2001 */ + 1.258783102010, /* 0x1.423f9bffe */ + 1.262198328973, /* 0x1.431f6e000 */ + 1.265619754780, /* 0x1.43ffa7fff */ + 1.269052743928, /* 0x1.44e0a4001 */ + 1.272490739830, /* 0x1.45c1f4000 */ + 1.275942921659, /* 0x1.46a432001 */ + 1.279397487615, /* 0x1.478697ffe */ + 1.282870173427, /* 0x1.486a2dffe */ + 1.286346316319, /* 0x1.494dfdffe */ + 1.289836049094, /* 0x1.4a32b2001 */ + 1.293333172770, /* 0x1.4b17e1ffe */ + 1.296839594835, /* 0x1.4bfdadfff */ + 1.300354957560, /* 0x1.4ce40fffe */ + 1.303882122055, /* 0x1.4dcb38001 */ + 1.307417988757, /* 0x1.4eb2f1ffe */ + 1.310960650439, /* 0x1.4f9b1dfff */ + 1.314516782746, /* 0x1.50842bfff */ + 1.318079948424, /* 0x1.516daffff */ + 1.321653246888, /* 0x1.5257de000 */ + 1.325237751030, /* 0x1.5342c8001 */ + 1.328829526907, /* 0x1.542e2c000 */ + 1.332433700535, /* 0x1.551a5fffe */ + 1.336045145966, /* 0x1.56070dffe */ + 1.339667558645, /* 0x1.56f473ffe */ + 1.343300342533, /* 0x1.57e287ffe */ + 1.346941947961, /* 0x1.58d130001 */ + 1.350594043714, /* 0x1.59c087ffe */ + 1.354256033883, /* 0x1.5ab085fff */ + 1.357932448365, /* 0x1.5ba175ffe */ + 1.361609339707, /* 0x1.5c926dfff */ + 1.365299344044, /* 0x1.5d8441ffe */ + 1.369003057507, /* 0x1.5e76fc001 */ + 1.372714757920, /* 0x1.5f6a3c000 */ + 1.376437187179, /* 0x1.605e2fffe */ + 1.380165219333, /* 0x1.615282001 */ + 1.383909463864, /* 0x1.6247e3ffe */ + 1.387661933907, /* 0x1.633dd0000 */ + 1.391424179060, /* 0x1.64345fffe */ + 1.395197510706, /* 0x1.652ba9fff */ + 1.399006724329, /* 0x1.66254dffe */ + 1.402773022651, /* 0x1.671c22000 */ + 1.406576037403, /* 0x1.68155dfff */ + 1.410389423392, /* 0x1.690f48001 */ +}; diff --git a/libgcc-math/i386/Makefile.am b/libgcc-math/i386/Makefile.am new file mode 100644 index 00000000000..26704c384ad --- /dev/null +++ b/libgcc-math/i386/Makefile.am @@ -0,0 +1,117 @@ +## Makefile for the i386 directory of the libgcc-math library. +## +## Copyright (C) 2006 +## Free Software Foundation, Inc. +## + +# May be used by various substitution variables. +gcc_version := $(shell cat $(top_srcdir)/../gcc/BASE-VER) + + +noinst_LTLIBRARIES = libsse2.la + +libsse2_la_CFLAGS = -I@srcdir@/../include -include @srcdir@/sse2.h \ + -Wall -O2 -g -msse2 -msseregparm -mfpmath=sse -march=pentium3 \ + -fno-math-errno -fno-trapping-math -ffinite-math-only \ + -fno-rounding-math -fno-signaling-nans -D__NO_MATH_INLINES + +libsse2_la_SOURCES = \ + @srcdir@/../flt-32/e_acosf.c \ + @srcdir@/../flt-32/e_asinf.c \ + @srcdir@/../flt-32/e_atan2f.c \ + @srcdir@/../flt-32/s_atanf.c \ + @srcdir@/../flt-32/s_cosf.c \ + @srcdir@/../flt-32/e_expf.c \ + @srcdir@/../flt-32/e_log10f.c \ + @srcdir@/../flt-32/e_logf.c \ + @srcdir@/../flt-32/e_powf.c \ + @srcdir@/../flt-32/s_sinf.c \ + @srcdir@/../flt-32/s_tanf.c \ + @srcdir@/../flt-32/k_cosf.c \ + @srcdir@/../flt-32/k_rem_pio2f.c \ + @srcdir@/../flt-32/k_sinf.c \ + @srcdir@/../flt-32/k_tanf.c \ + @srcdir@/../flt-32/e_rem_pio2f.c \ + @srcdir@/../flt-32/e_sqrtf.c \ + @srcdir@/../flt-32/s_scalbnf.c \ + @srcdir@/../flt-32/s_floorf.c \ + @srcdir@/../flt-32/s_isinff.c \ + @srcdir@/../dbl-64/t_exp.c \ + @srcdir@/../dbl-64/e_asin.c \ + @srcdir@/../dbl-64/e_atan2.c \ + @srcdir@/../dbl-64/s_atan.c \ + @srcdir@/../dbl-64/branred.c \ + @srcdir@/../dbl-64/doasin.c \ + @srcdir@/../dbl-64/dosincos.c \ + @srcdir@/../dbl-64/e_exp.c \ + @srcdir@/../dbl-64/halfulp.c \ + @srcdir@/../dbl-64/k_rem_pio2.c \ + @srcdir@/../dbl-64/e_log10.c \ + @srcdir@/../dbl-64/e_log.c \ + @srcdir@/../dbl-64/mpa.c \ + @srcdir@/../dbl-64/mpatan2.c \ + @srcdir@/../dbl-64/mpatan.c \ + @srcdir@/../dbl-64/mpexp.c \ + @srcdir@/../dbl-64/mplog.c \ + @srcdir@/../dbl-64/mpsqrt.c \ + @srcdir@/../dbl-64/mptan.c \ + @srcdir@/../dbl-64/e_pow.c \ + @srcdir@/../dbl-64/e_rem_pio2.c \ + @srcdir@/../dbl-64/s_sin.c \ + @srcdir@/../dbl-64/sincos32.c \ + @srcdir@/../dbl-64/slowexp.c \ + @srcdir@/../dbl-64/slowpow.c \ + @srcdir@/../dbl-64/e_sqrt.c \ + @srcdir@/../dbl-64/s_tan.c \ + @srcdir@/../dbl-64/s_scalbn.c \ + @srcdir@/../dbl-64/s_floor.c \ + @srcdir@/../dbl-64/s_isinf.c + + +# XXX hack alert +# From libffi/Makefile.am + +# Work around what appears to be a GNU make bug handling MAKEFLAGS +# values defined in terms of make variables, as is the case for CC and +# friends when we are called from the top level Makefile. +AM_MAKEFLAGS = \ + "AR_FLAGS=$(AR_FLAGS)" \ + "CC_FOR_BUILD=$(CC_FOR_BUILD)" \ + "CFLAGS=$(CFLAGS)" \ + "CXXFLAGS=$(CXXFLAGS)" \ + "CFLAGS_FOR_BUILD=$(CFLAGS_FOR_BUILD)" \ + "CFLAGS_FOR_TARGET=$(CFLAGS_FOR_TARGET)" \ + "INSTALL=$(INSTALL)" \ + "INSTALL_DATA=$(INSTALL_DATA)" \ + "INSTALL_PROGRAM=$(INSTALL_PROGRAM)" \ + "INSTALL_SCRIPT=$(INSTALL_SCRIPT)" \ + "JC1FLAGS=$(JC1FLAGS)" \ + "LDFLAGS=$(LDFLAGS)" \ + "LIBCFLAGS=$(LIBCFLAGS)" \ + "LIBCFLAGS_FOR_TARGET=$(LIBCFLAGS_FOR_TARGET)" \ + "MAKE=$(MAKE)" \ + "MAKEINFO=$(MAKEINFO) $(MAKEINFOFLAGS)" \ + "PICFLAG=$(PICFLAG)" \ + "PICFLAG_FOR_TARGET=$(PICFLAG_FOR_TARGET)" \ + "SHELL=$(SHELL)" \ + "RUNTESTFLAGS=$(RUNTESTFLAGS)" \ + "exec_prefix=$(exec_prefix)" \ + "infodir=$(infodir)" \ + "libdir=$(libdir)" \ + "prefix=$(prefix)" \ + "includedir=$(includedir)" \ + "AR=$(AR)" \ + "AS=$(AS)" \ + "CC=$(CC)" \ + "CXX=$(CXX)" \ + "LD=$(LD)" \ + "LIBCFLAGS=$(LIBCFLAGS)" \ + "NM=$(NM)" \ + "PICFLAG=$(PICFLAG)" \ + "RANLIB=$(RANLIB)" \ + "DESTDIR=$(DESTDIR)" + +MAKEOVERRIDES= + +## ################################################################ + diff --git a/libgcc-math/i386/Makefile.in b/libgcc-math/i386/Makefile.in new file mode 100644 index 00000000000..cf9be0eb1dc --- /dev/null +++ b/libgcc-math/i386/Makefile.in @@ -0,0 +1,953 @@ +# Makefile.in generated by automake 1.9.6 from Makefile.am. +# @configure_input@ + +# Copyright (C) 1994, 1995, 1996, 1997, 1998, 1999, 2000, 2001, 2002, +# 2003, 2004, 2005 Free Software Foundation, Inc. +# This Makefile.in is free software; the Free Software Foundation +# gives unlimited permission to copy and/or distribute it, +# with or without modifications, as long as this notice is preserved. + +# This program is distributed in the hope that it will be useful, +# but WITHOUT ANY WARRANTY, to the extent permitted by law; without +# even the implied warranty of MERCHANTABILITY or FITNESS FOR A +# PARTICULAR PURPOSE. + +@SET_MAKE@ + +srcdir = @srcdir@ +top_srcdir = @top_srcdir@ +VPATH = @srcdir@ +pkgdatadir = $(datadir)/@PACKAGE@ +pkglibdir = $(libdir)/@PACKAGE@ +pkgincludedir = $(includedir)/@PACKAGE@ +top_builddir = .. +am__cd = CDPATH="$${ZSH_VERSION+.}$(PATH_SEPARATOR)" && cd +INSTALL = @INSTALL@ +install_sh_DATA = $(install_sh) -c -m 644 +install_sh_PROGRAM = $(install_sh) -c +install_sh_SCRIPT = $(install_sh) -c +INSTALL_HEADER = $(INSTALL_DATA) +transform = $(program_transform_name) +NORMAL_INSTALL = : +PRE_INSTALL = : +POST_INSTALL = : +NORMAL_UNINSTALL = : +PRE_UNINSTALL = : +POST_UNINSTALL = : +build_triplet = @build@ +host_triplet = @host@ +target_triplet = @target@ +subdir = i386 +DIST_COMMON = $(srcdir)/Makefile.am $(srcdir)/Makefile.in +ACLOCAL_M4 = $(top_srcdir)/aclocal.m4 +am__aclocal_m4_deps = $(top_srcdir)/../config/depstand.m4 \ + $(top_srcdir)/../config/lead-dot.m4 \ + $(top_srcdir)/../libtool.m4 $(top_srcdir)/configure.ac +am__configure_deps = $(am__aclocal_m4_deps) $(CONFIGURE_DEPENDENCIES) \ + $(ACLOCAL_M4) +mkinstalldirs = $(SHELL) $(top_srcdir)/../mkinstalldirs +CONFIG_CLEAN_FILES = +LTLIBRARIES = $(noinst_LTLIBRARIES) +libsse2_la_LIBADD = +am_libsse2_la_OBJECTS = libsse2_la-e_acosf.lo libsse2_la-e_asinf.lo \ + libsse2_la-e_atan2f.lo libsse2_la-s_atanf.lo \ + libsse2_la-s_cosf.lo libsse2_la-e_expf.lo \ + libsse2_la-e_log10f.lo libsse2_la-e_logf.lo \ + libsse2_la-e_powf.lo libsse2_la-s_sinf.lo libsse2_la-s_tanf.lo \ + libsse2_la-k_cosf.lo libsse2_la-k_rem_pio2f.lo \ + libsse2_la-k_sinf.lo libsse2_la-k_tanf.lo \ + libsse2_la-e_rem_pio2f.lo libsse2_la-e_sqrtf.lo \ + libsse2_la-s_scalbnf.lo libsse2_la-s_floorf.lo \ + libsse2_la-s_isinff.lo libsse2_la-t_exp.lo \ + libsse2_la-e_asin.lo libsse2_la-e_atan2.lo \ + libsse2_la-s_atan.lo libsse2_la-branred.lo \ + libsse2_la-doasin.lo libsse2_la-dosincos.lo \ + libsse2_la-e_exp.lo libsse2_la-halfulp.lo \ + libsse2_la-k_rem_pio2.lo libsse2_la-e_log10.lo \ + libsse2_la-e_log.lo libsse2_la-mpa.lo libsse2_la-mpatan2.lo \ + libsse2_la-mpatan.lo libsse2_la-mpexp.lo libsse2_la-mplog.lo \ + libsse2_la-mpsqrt.lo libsse2_la-mptan.lo libsse2_la-e_pow.lo \ + libsse2_la-e_rem_pio2.lo libsse2_la-s_sin.lo \ + libsse2_la-sincos32.lo libsse2_la-slowexp.lo \ + libsse2_la-slowpow.lo libsse2_la-e_sqrt.lo libsse2_la-s_tan.lo \ + libsse2_la-s_scalbn.lo libsse2_la-s_floor.lo \ + libsse2_la-s_isinf.lo +libsse2_la_OBJECTS = $(am_libsse2_la_OBJECTS) +DEFAULT_INCLUDES = -I. -I$(srcdir) +depcomp = $(SHELL) $(top_srcdir)/../depcomp +am__depfiles_maybe = depfiles +COMPILE = $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) \ + $(CPPFLAGS) $(AM_CFLAGS) $(CFLAGS) +LTCOMPILE = $(LIBTOOL) --mode=compile $(CC) $(DEFS) \ + $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) \ + $(AM_CFLAGS) $(CFLAGS) +CCLD = $(CC) +LINK = $(LIBTOOL) --mode=link $(CCLD) $(AM_CFLAGS) $(CFLAGS) \ + $(AM_LDFLAGS) $(LDFLAGS) -o $@ +SOURCES = $(libsse2_la_SOURCES) +DIST_SOURCES = $(libsse2_la_SOURCES) +ETAGS = etags +CTAGS = ctags +DISTFILES = $(DIST_COMMON) $(DIST_SOURCES) $(TEXINFOS) $(EXTRA_DIST) +ACLOCAL = @ACLOCAL@ +AMDEP_FALSE = @AMDEP_FALSE@ +AMDEP_TRUE = @AMDEP_TRUE@ +AMTAR = @AMTAR@ +AUTOCONF = @AUTOCONF@ +AUTOHEADER = @AUTOHEADER@ +AUTOMAKE = @AUTOMAKE@ +AWK = @AWK@ +BUILD_LIBGCC_MATH_FALSE = @BUILD_LIBGCC_MATH_FALSE@ +BUILD_LIBGCC_MATH_TRUE = @BUILD_LIBGCC_MATH_TRUE@ +CC = @CC@ +CCAS = @CCAS@ +CCASFLAGS = @CCASFLAGS@ +CCDEPMODE = @CCDEPMODE@ +CFLAGS = @CFLAGS@ +CPP = @CPP@ +CPPFLAGS = @CPPFLAGS@ +CYGPATH_W = @CYGPATH_W@ +DEFS = @DEFS@ +DEPDIR = @DEPDIR@ +ECHO_C = @ECHO_C@ +ECHO_N = @ECHO_N@ +ECHO_T = @ECHO_T@ +EXEEXT = @EXEEXT@ +INSTALL_DATA = @INSTALL_DATA@ +INSTALL_PROGRAM = @INSTALL_PROGRAM@ +INSTALL_SCRIPT = @INSTALL_SCRIPT@ +INSTALL_STRIP_PROGRAM = @INSTALL_STRIP_PROGRAM@ +LIBGCCM_USE_SYMVER_FALSE = @LIBGCCM_USE_SYMVER_FALSE@ +LIBGCCM_USE_SYMVER_TRUE = @LIBGCCM_USE_SYMVER_TRUE@ +LIBOBJS = @LIBOBJS@ +LIBS = @LIBS@ +LIBTOOL = @LIBTOOL@ +LN_S = @LN_S@ +LTLIBOBJS = @LTLIBOBJS@ +MAINT = @MAINT@ +MAINTAINER_MODE_FALSE = @MAINTAINER_MODE_FALSE@ +MAINTAINER_MODE_TRUE = @MAINTAINER_MODE_TRUE@ +MAKEINFO = @MAKEINFO@ +OBJEXT = @OBJEXT@ +PACKAGE = @PACKAGE@ +PACKAGE_BUGREPORT = @PACKAGE_BUGREPORT@ +PACKAGE_NAME = @PACKAGE_NAME@ +PACKAGE_STRING = @PACKAGE_STRING@ +PACKAGE_TARNAME = @PACKAGE_TARNAME@ +PACKAGE_VERSION = @PACKAGE_VERSION@ +PATH_SEPARATOR = @PATH_SEPARATOR@ +RANLIB = @RANLIB@ +SET_MAKE = @SET_MAKE@ +SHELL = @SHELL@ +STRIP = @STRIP@ +TARGET_ILP32_FALSE = @TARGET_ILP32_FALSE@ +TARGET_ILP32_TRUE = @TARGET_ILP32_TRUE@ +VERSION = @VERSION@ +ac_ct_CC = @ac_ct_CC@ +ac_ct_RANLIB = @ac_ct_RANLIB@ +ac_ct_STRIP = @ac_ct_STRIP@ +am__fastdepCC_FALSE = @am__fastdepCC_FALSE@ +am__fastdepCC_TRUE = @am__fastdepCC_TRUE@ +am__include = @am__include@ +am__leading_dot = @am__leading_dot@ +am__quote = @am__quote@ +am__tar = @am__tar@ +am__untar = @am__untar@ +arch_libraries = @arch_libraries@ +arch_maps = @arch_maps@ +arch_subdirs = @arch_subdirs@ +bindir = @bindir@ +build = @build@ +build_alias = @build_alias@ +build_cpu = @build_cpu@ +build_os = @build_os@ +build_vendor = @build_vendor@ +datadir = @datadir@ +enable_shared = @enable_shared@ +enable_static = @enable_static@ +exec_prefix = @exec_prefix@ +host = @host@ +host_alias = @host_alias@ +host_cpu = @host_cpu@ +host_os = @host_os@ +host_vendor = @host_vendor@ +includedir = @includedir@ +infodir = @infodir@ +install_sh = @install_sh@ +libdir = @libdir@ +libexecdir = @libexecdir@ +localstatedir = @localstatedir@ +mandir = @mandir@ +mkdir_p = @mkdir_p@ +multi_basedir = @multi_basedir@ +oldincludedir = @oldincludedir@ +prefix = @prefix@ +program_transform_name = @program_transform_name@ +sbindir = @sbindir@ +sharedstatedir = @sharedstatedir@ +sysconfdir = @sysconfdir@ +target = @target@ +target_alias = @target_alias@ +target_cpu = @target_cpu@ +target_os = @target_os@ +target_vendor = @target_vendor@ +toolexecdir = @toolexecdir@ +toolexeclibdir = @toolexeclibdir@ + +# May be used by various substitution variables. +gcc_version := $(shell cat $(top_srcdir)/../gcc/BASE-VER) +noinst_LTLIBRARIES = libsse2.la +libsse2_la_CFLAGS = -I@srcdir@/../include -include @srcdir@/sse2.h \ + -Wall -O2 -g -msse2 -msseregparm -mfpmath=sse -march=pentium3 \ + -fno-math-errno -fno-trapping-math -ffinite-math-only \ + -fno-rounding-math -fno-signaling-nans -D__NO_MATH_INLINES + +libsse2_la_SOURCES = \ + @srcdir@/../flt-32/e_acosf.c \ + @srcdir@/../flt-32/e_asinf.c \ + @srcdir@/../flt-32/e_atan2f.c \ + @srcdir@/../flt-32/s_atanf.c \ + @srcdir@/../flt-32/s_cosf.c \ + @srcdir@/../flt-32/e_expf.c \ + @srcdir@/../flt-32/e_log10f.c \ + @srcdir@/../flt-32/e_logf.c \ + @srcdir@/../flt-32/e_powf.c \ + @srcdir@/../flt-32/s_sinf.c \ + @srcdir@/../flt-32/s_tanf.c \ + @srcdir@/../flt-32/k_cosf.c \ + @srcdir@/../flt-32/k_rem_pio2f.c \ + @srcdir@/../flt-32/k_sinf.c \ + @srcdir@/../flt-32/k_tanf.c \ + @srcdir@/../flt-32/e_rem_pio2f.c \ + @srcdir@/../flt-32/e_sqrtf.c \ + @srcdir@/../flt-32/s_scalbnf.c \ + @srcdir@/../flt-32/s_floorf.c \ + @srcdir@/../flt-32/s_isinff.c \ + @srcdir@/../dbl-64/t_exp.c \ + @srcdir@/../dbl-64/e_asin.c \ + @srcdir@/../dbl-64/e_atan2.c \ + @srcdir@/../dbl-64/s_atan.c \ + @srcdir@/../dbl-64/branred.c \ + @srcdir@/../dbl-64/doasin.c \ + @srcdir@/../dbl-64/dosincos.c \ + @srcdir@/../dbl-64/e_exp.c \ + @srcdir@/../dbl-64/halfulp.c \ + @srcdir@/../dbl-64/k_rem_pio2.c \ + @srcdir@/../dbl-64/e_log10.c \ + @srcdir@/../dbl-64/e_log.c \ + @srcdir@/../dbl-64/mpa.c \ + @srcdir@/../dbl-64/mpatan2.c \ + @srcdir@/../dbl-64/mpatan.c \ + @srcdir@/../dbl-64/mpexp.c \ + @srcdir@/../dbl-64/mplog.c \ + @srcdir@/../dbl-64/mpsqrt.c \ + @srcdir@/../dbl-64/mptan.c \ + @srcdir@/../dbl-64/e_pow.c \ + @srcdir@/../dbl-64/e_rem_pio2.c \ + @srcdir@/../dbl-64/s_sin.c \ + @srcdir@/../dbl-64/sincos32.c \ + @srcdir@/../dbl-64/slowexp.c \ + @srcdir@/../dbl-64/slowpow.c \ + @srcdir@/../dbl-64/e_sqrt.c \ + @srcdir@/../dbl-64/s_tan.c \ + @srcdir@/../dbl-64/s_scalbn.c \ + @srcdir@/../dbl-64/s_floor.c \ + @srcdir@/../dbl-64/s_isinf.c + + +# XXX hack alert +# From libffi/Makefile.am + +# Work around what appears to be a GNU make bug handling MAKEFLAGS +# values defined in terms of make variables, as is the case for CC and +# friends when we are called from the top level Makefile. +AM_MAKEFLAGS = \ + "AR_FLAGS=$(AR_FLAGS)" \ + "CC_FOR_BUILD=$(CC_FOR_BUILD)" \ + "CFLAGS=$(CFLAGS)" \ + "CXXFLAGS=$(CXXFLAGS)" \ + "CFLAGS_FOR_BUILD=$(CFLAGS_FOR_BUILD)" \ + "CFLAGS_FOR_TARGET=$(CFLAGS_FOR_TARGET)" \ + "INSTALL=$(INSTALL)" \ + "INSTALL_DATA=$(INSTALL_DATA)" \ + "INSTALL_PROGRAM=$(INSTALL_PROGRAM)" \ + "INSTALL_SCRIPT=$(INSTALL_SCRIPT)" \ + "JC1FLAGS=$(JC1FLAGS)" \ + "LDFLAGS=$(LDFLAGS)" \ + "LIBCFLAGS=$(LIBCFLAGS)" \ + "LIBCFLAGS_FOR_TARGET=$(LIBCFLAGS_FOR_TARGET)" \ + "MAKE=$(MAKE)" \ + "MAKEINFO=$(MAKEINFO) $(MAKEINFOFLAGS)" \ + "PICFLAG=$(PICFLAG)" \ + "PICFLAG_FOR_TARGET=$(PICFLAG_FOR_TARGET)" \ + "SHELL=$(SHELL)" \ + "RUNTESTFLAGS=$(RUNTESTFLAGS)" \ + "exec_prefix=$(exec_prefix)" \ + "infodir=$(infodir)" \ + "libdir=$(libdir)" \ + "prefix=$(prefix)" \ + "includedir=$(includedir)" \ + "AR=$(AR)" \ + "AS=$(AS)" \ + "CC=$(CC)" \ + "CXX=$(CXX)" \ + "LD=$(LD)" \ + "LIBCFLAGS=$(LIBCFLAGS)" \ + "NM=$(NM)" \ + "PICFLAG=$(PICFLAG)" \ + "RANLIB=$(RANLIB)" \ + "DESTDIR=$(DESTDIR)" + +MAKEOVERRIDES = +all: all-am + +.SUFFIXES: +.SUFFIXES: .c .lo .o .obj +$(srcdir)/Makefile.in: @MAINTAINER_MODE_TRUE@ $(srcdir)/Makefile.am $(am__configure_deps) + @for dep in $?; do \ + case '$(am__configure_deps)' in \ + *$$dep*) \ + cd $(top_builddir) && $(MAKE) $(AM_MAKEFLAGS) am--refresh \ + && exit 0; \ + exit 1;; \ + esac; \ + done; \ + echo ' cd $(top_srcdir) && $(AUTOMAKE) --gnu i386/Makefile'; \ + cd $(top_srcdir) && \ + $(AUTOMAKE) --gnu i386/Makefile +.PRECIOUS: Makefile +Makefile: $(srcdir)/Makefile.in $(top_builddir)/config.status + @case '$?' in \ + *config.status*) \ + cd $(top_builddir) && $(MAKE) $(AM_MAKEFLAGS) am--refresh;; \ + *) \ + echo ' cd $(top_builddir) && $(SHELL) ./config.status $(subdir)/$@ $(am__depfiles_maybe)'; \ + cd $(top_builddir) && $(SHELL) ./config.status $(subdir)/$@ $(am__depfiles_maybe);; \ + esac; + +$(top_builddir)/config.status: $(top_srcdir)/configure $(CONFIG_STATUS_DEPENDENCIES) + cd $(top_builddir) && $(MAKE) $(AM_MAKEFLAGS) am--refresh + +$(top_srcdir)/configure: @MAINTAINER_MODE_TRUE@ $(am__configure_deps) + cd $(top_builddir) && $(MAKE) $(AM_MAKEFLAGS) am--refresh +$(ACLOCAL_M4): @MAINTAINER_MODE_TRUE@ $(am__aclocal_m4_deps) + cd $(top_builddir) && $(MAKE) $(AM_MAKEFLAGS) am--refresh + +clean-noinstLTLIBRARIES: + -test -z "$(noinst_LTLIBRARIES)" || rm -f $(noinst_LTLIBRARIES) + @list='$(noinst_LTLIBRARIES)'; for p in $$list; do \ + dir="`echo $$p | sed -e 's|/[^/]*$$||'`"; \ + test "$$dir" != "$$p" || dir=.; \ + echo "rm -f \"$${dir}/so_locations\""; \ + rm -f "$${dir}/so_locations"; \ + done +libsse2.la: $(libsse2_la_OBJECTS) $(libsse2_la_DEPENDENCIES) + $(LINK) $(libsse2_la_LDFLAGS) $(libsse2_la_OBJECTS) $(libsse2_la_LIBADD) $(LIBS) + +mostlyclean-compile: + -rm -f *.$(OBJEXT) + +distclean-compile: + -rm -f *.tab.c + +@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/libsse2_la-branred.Plo@am__quote@ +@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/libsse2_la-doasin.Plo@am__quote@ +@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/libsse2_la-dosincos.Plo@am__quote@ +@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/libsse2_la-e_acosf.Plo@am__quote@ +@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/libsse2_la-e_asin.Plo@am__quote@ +@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/libsse2_la-e_asinf.Plo@am__quote@ +@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/libsse2_la-e_atan2.Plo@am__quote@ +@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/libsse2_la-e_atan2f.Plo@am__quote@ +@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/libsse2_la-e_exp.Plo@am__quote@ +@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/libsse2_la-e_expf.Plo@am__quote@ +@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/libsse2_la-e_log.Plo@am__quote@ +@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/libsse2_la-e_log10.Plo@am__quote@ +@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/libsse2_la-e_log10f.Plo@am__quote@ +@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/libsse2_la-e_logf.Plo@am__quote@ +@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/libsse2_la-e_pow.Plo@am__quote@ +@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/libsse2_la-e_powf.Plo@am__quote@ +@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/libsse2_la-e_rem_pio2.Plo@am__quote@ +@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/libsse2_la-e_rem_pio2f.Plo@am__quote@ +@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/libsse2_la-e_sqrt.Plo@am__quote@ +@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/libsse2_la-e_sqrtf.Plo@am__quote@ +@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/libsse2_la-halfulp.Plo@am__quote@ +@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/libsse2_la-k_cosf.Plo@am__quote@ +@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/libsse2_la-k_rem_pio2.Plo@am__quote@ +@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/libsse2_la-k_rem_pio2f.Plo@am__quote@ +@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/libsse2_la-k_sinf.Plo@am__quote@ +@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/libsse2_la-k_tanf.Plo@am__quote@ +@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/libsse2_la-mpa.Plo@am__quote@ +@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/libsse2_la-mpatan.Plo@am__quote@ +@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/libsse2_la-mpatan2.Plo@am__quote@ +@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/libsse2_la-mpexp.Plo@am__quote@ +@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/libsse2_la-mplog.Plo@am__quote@ +@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/libsse2_la-mpsqrt.Plo@am__quote@ +@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/libsse2_la-mptan.Plo@am__quote@ +@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/libsse2_la-s_atan.Plo@am__quote@ +@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/libsse2_la-s_atanf.Plo@am__quote@ +@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/libsse2_la-s_cosf.Plo@am__quote@ +@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/libsse2_la-s_floor.Plo@am__quote@ +@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/libsse2_la-s_floorf.Plo@am__quote@ +@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/libsse2_la-s_isinf.Plo@am__quote@ +@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/libsse2_la-s_isinff.Plo@am__quote@ +@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/libsse2_la-s_scalbn.Plo@am__quote@ +@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/libsse2_la-s_scalbnf.Plo@am__quote@ +@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/libsse2_la-s_sin.Plo@am__quote@ +@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/libsse2_la-s_sinf.Plo@am__quote@ +@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/libsse2_la-s_tan.Plo@am__quote@ +@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/libsse2_la-s_tanf.Plo@am__quote@ +@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/libsse2_la-sincos32.Plo@am__quote@ +@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/libsse2_la-slowexp.Plo@am__quote@ +@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/libsse2_la-slowpow.Plo@am__quote@ +@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/libsse2_la-t_exp.Plo@am__quote@ + +.c.o: +@am__fastdepCC_TRUE@ if $(COMPILE) -MT $@ -MD -MP -MF "$(DEPDIR)/$*.Tpo" -c -o $@ $<; \ +@am__fastdepCC_TRUE@ then mv -f "$(DEPDIR)/$*.Tpo" "$(DEPDIR)/$*.Po"; else rm -f "$(DEPDIR)/$*.Tpo"; exit 1; fi +@AMDEP_TRUE@@am__fastdepCC_FALSE@ source='$<' object='$@' libtool=no @AMDEPBACKSLASH@ +@AMDEP_TRUE@@am__fastdepCC_FALSE@ DEPDIR=$(DEPDIR) $(CCDEPMODE) $(depcomp) @AMDEPBACKSLASH@ +@am__fastdepCC_FALSE@ $(COMPILE) -c $< + +.c.obj: +@am__fastdepCC_TRUE@ if $(COMPILE) -MT $@ -MD -MP -MF "$(DEPDIR)/$*.Tpo" -c -o $@ `$(CYGPATH_W) '$<'`; \ +@am__fastdepCC_TRUE@ then mv -f "$(DEPDIR)/$*.Tpo" "$(DEPDIR)/$*.Po"; else rm -f "$(DEPDIR)/$*.Tpo"; exit 1; fi +@AMDEP_TRUE@@am__fastdepCC_FALSE@ source='$<' object='$@' libtool=no @AMDEPBACKSLASH@ +@AMDEP_TRUE@@am__fastdepCC_FALSE@ DEPDIR=$(DEPDIR) $(CCDEPMODE) $(depcomp) @AMDEPBACKSLASH@ +@am__fastdepCC_FALSE@ $(COMPILE) -c `$(CYGPATH_W) '$<'` + +.c.lo: +@am__fastdepCC_TRUE@ if $(LTCOMPILE) -MT $@ -MD -MP -MF "$(DEPDIR)/$*.Tpo" -c -o $@ $<; \ +@am__fastdepCC_TRUE@ then mv -f "$(DEPDIR)/$*.Tpo" "$(DEPDIR)/$*.Plo"; else rm -f "$(DEPDIR)/$*.Tpo"; exit 1; fi +@AMDEP_TRUE@@am__fastdepCC_FALSE@ source='$<' object='$@' libtool=yes @AMDEPBACKSLASH@ +@AMDEP_TRUE@@am__fastdepCC_FALSE@ DEPDIR=$(DEPDIR) $(CCDEPMODE) $(depcomp) @AMDEPBACKSLASH@ +@am__fastdepCC_FALSE@ $(LTCOMPILE) -c -o $@ $< + +libsse2_la-e_acosf.lo: @srcdir@/../flt-32/e_acosf.c +@am__fastdepCC_TRUE@ if $(LIBTOOL) --mode=compile $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(libsse2_la_CFLAGS) $(CFLAGS) -MT libsse2_la-e_acosf.lo -MD -MP -MF "$(DEPDIR)/libsse2_la-e_acosf.Tpo" -c -o libsse2_la-e_acosf.lo `test -f '@srcdir@/../flt-32/e_acosf.c' || echo '$(srcdir)/'`@srcdir@/../flt-32/e_acosf.c; \ +@am__fastdepCC_TRUE@ then mv -f "$(DEPDIR)/libsse2_la-e_acosf.Tpo" "$(DEPDIR)/libsse2_la-e_acosf.Plo"; else rm -f "$(DEPDIR)/libsse2_la-e_acosf.Tpo"; exit 1; fi +@AMDEP_TRUE@@am__fastdepCC_FALSE@ source='@srcdir@/../flt-32/e_acosf.c' object='libsse2_la-e_acosf.lo' libtool=yes @AMDEPBACKSLASH@ +@AMDEP_TRUE@@am__fastdepCC_FALSE@ DEPDIR=$(DEPDIR) $(CCDEPMODE) $(depcomp) @AMDEPBACKSLASH@ +@am__fastdepCC_FALSE@ $(LIBTOOL) --mode=compile $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(libsse2_la_CFLAGS) $(CFLAGS) -c -o libsse2_la-e_acosf.lo `test -f '@srcdir@/../flt-32/e_acosf.c' || echo '$(srcdir)/'`@srcdir@/../flt-32/e_acosf.c + +libsse2_la-e_asinf.lo: @srcdir@/../flt-32/e_asinf.c +@am__fastdepCC_TRUE@ if $(LIBTOOL) --mode=compile $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(libsse2_la_CFLAGS) $(CFLAGS) -MT libsse2_la-e_asinf.lo -MD -MP -MF "$(DEPDIR)/libsse2_la-e_asinf.Tpo" -c -o libsse2_la-e_asinf.lo `test -f '@srcdir@/../flt-32/e_asinf.c' || echo '$(srcdir)/'`@srcdir@/../flt-32/e_asinf.c; \ +@am__fastdepCC_TRUE@ then mv -f "$(DEPDIR)/libsse2_la-e_asinf.Tpo" "$(DEPDIR)/libsse2_la-e_asinf.Plo"; else rm -f "$(DEPDIR)/libsse2_la-e_asinf.Tpo"; exit 1; fi +@AMDEP_TRUE@@am__fastdepCC_FALSE@ source='@srcdir@/../flt-32/e_asinf.c' object='libsse2_la-e_asinf.lo' libtool=yes @AMDEPBACKSLASH@ +@AMDEP_TRUE@@am__fastdepCC_FALSE@ DEPDIR=$(DEPDIR) $(CCDEPMODE) $(depcomp) @AMDEPBACKSLASH@ +@am__fastdepCC_FALSE@ $(LIBTOOL) --mode=compile $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(libsse2_la_CFLAGS) $(CFLAGS) -c -o libsse2_la-e_asinf.lo `test -f '@srcdir@/../flt-32/e_asinf.c' || echo '$(srcdir)/'`@srcdir@/../flt-32/e_asinf.c + +libsse2_la-e_atan2f.lo: @srcdir@/../flt-32/e_atan2f.c +@am__fastdepCC_TRUE@ if $(LIBTOOL) --mode=compile $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(libsse2_la_CFLAGS) $(CFLAGS) -MT libsse2_la-e_atan2f.lo -MD -MP -MF "$(DEPDIR)/libsse2_la-e_atan2f.Tpo" -c -o libsse2_la-e_atan2f.lo `test -f '@srcdir@/../flt-32/e_atan2f.c' || echo '$(srcdir)/'`@srcdir@/../flt-32/e_atan2f.c; \ +@am__fastdepCC_TRUE@ then mv -f "$(DEPDIR)/libsse2_la-e_atan2f.Tpo" "$(DEPDIR)/libsse2_la-e_atan2f.Plo"; else rm -f "$(DEPDIR)/libsse2_la-e_atan2f.Tpo"; exit 1; fi +@AMDEP_TRUE@@am__fastdepCC_FALSE@ source='@srcdir@/../flt-32/e_atan2f.c' object='libsse2_la-e_atan2f.lo' libtool=yes @AMDEPBACKSLASH@ +@AMDEP_TRUE@@am__fastdepCC_FALSE@ DEPDIR=$(DEPDIR) $(CCDEPMODE) $(depcomp) @AMDEPBACKSLASH@ +@am__fastdepCC_FALSE@ $(LIBTOOL) --mode=compile $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(libsse2_la_CFLAGS) $(CFLAGS) -c -o libsse2_la-e_atan2f.lo `test -f '@srcdir@/../flt-32/e_atan2f.c' || echo '$(srcdir)/'`@srcdir@/../flt-32/e_atan2f.c + +libsse2_la-s_atanf.lo: @srcdir@/../flt-32/s_atanf.c +@am__fastdepCC_TRUE@ if $(LIBTOOL) --mode=compile $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(libsse2_la_CFLAGS) $(CFLAGS) -MT libsse2_la-s_atanf.lo -MD -MP -MF "$(DEPDIR)/libsse2_la-s_atanf.Tpo" -c -o libsse2_la-s_atanf.lo `test -f '@srcdir@/../flt-32/s_atanf.c' || echo '$(srcdir)/'`@srcdir@/../flt-32/s_atanf.c; \ +@am__fastdepCC_TRUE@ then mv -f "$(DEPDIR)/libsse2_la-s_atanf.Tpo" "$(DEPDIR)/libsse2_la-s_atanf.Plo"; else rm -f "$(DEPDIR)/libsse2_la-s_atanf.Tpo"; exit 1; fi +@AMDEP_TRUE@@am__fastdepCC_FALSE@ source='@srcdir@/../flt-32/s_atanf.c' object='libsse2_la-s_atanf.lo' libtool=yes @AMDEPBACKSLASH@ +@AMDEP_TRUE@@am__fastdepCC_FALSE@ DEPDIR=$(DEPDIR) $(CCDEPMODE) $(depcomp) @AMDEPBACKSLASH@ +@am__fastdepCC_FALSE@ $(LIBTOOL) --mode=compile $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(libsse2_la_CFLAGS) $(CFLAGS) -c -o libsse2_la-s_atanf.lo `test -f '@srcdir@/../flt-32/s_atanf.c' || echo '$(srcdir)/'`@srcdir@/../flt-32/s_atanf.c + +libsse2_la-s_cosf.lo: @srcdir@/../flt-32/s_cosf.c +@am__fastdepCC_TRUE@ if $(LIBTOOL) --mode=compile $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(libsse2_la_CFLAGS) $(CFLAGS) -MT libsse2_la-s_cosf.lo -MD -MP -MF "$(DEPDIR)/libsse2_la-s_cosf.Tpo" -c -o libsse2_la-s_cosf.lo `test -f '@srcdir@/../flt-32/s_cosf.c' || echo '$(srcdir)/'`@srcdir@/../flt-32/s_cosf.c; \ +@am__fastdepCC_TRUE@ then mv -f "$(DEPDIR)/libsse2_la-s_cosf.Tpo" "$(DEPDIR)/libsse2_la-s_cosf.Plo"; else rm -f "$(DEPDIR)/libsse2_la-s_cosf.Tpo"; exit 1; fi +@AMDEP_TRUE@@am__fastdepCC_FALSE@ source='@srcdir@/../flt-32/s_cosf.c' object='libsse2_la-s_cosf.lo' libtool=yes @AMDEPBACKSLASH@ +@AMDEP_TRUE@@am__fastdepCC_FALSE@ DEPDIR=$(DEPDIR) $(CCDEPMODE) $(depcomp) @AMDEPBACKSLASH@ +@am__fastdepCC_FALSE@ $(LIBTOOL) --mode=compile $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(libsse2_la_CFLAGS) $(CFLAGS) -c -o libsse2_la-s_cosf.lo `test -f '@srcdir@/../flt-32/s_cosf.c' || echo '$(srcdir)/'`@srcdir@/../flt-32/s_cosf.c + +libsse2_la-e_expf.lo: @srcdir@/../flt-32/e_expf.c +@am__fastdepCC_TRUE@ if $(LIBTOOL) --mode=compile $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(libsse2_la_CFLAGS) $(CFLAGS) -MT libsse2_la-e_expf.lo -MD -MP -MF "$(DEPDIR)/libsse2_la-e_expf.Tpo" -c -o libsse2_la-e_expf.lo `test -f '@srcdir@/../flt-32/e_expf.c' || echo '$(srcdir)/'`@srcdir@/../flt-32/e_expf.c; \ +@am__fastdepCC_TRUE@ then mv -f "$(DEPDIR)/libsse2_la-e_expf.Tpo" "$(DEPDIR)/libsse2_la-e_expf.Plo"; else rm -f "$(DEPDIR)/libsse2_la-e_expf.Tpo"; exit 1; fi +@AMDEP_TRUE@@am__fastdepCC_FALSE@ source='@srcdir@/../flt-32/e_expf.c' object='libsse2_la-e_expf.lo' libtool=yes @AMDEPBACKSLASH@ +@AMDEP_TRUE@@am__fastdepCC_FALSE@ DEPDIR=$(DEPDIR) $(CCDEPMODE) $(depcomp) @AMDEPBACKSLASH@ +@am__fastdepCC_FALSE@ $(LIBTOOL) --mode=compile $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(libsse2_la_CFLAGS) $(CFLAGS) -c -o libsse2_la-e_expf.lo `test -f '@srcdir@/../flt-32/e_expf.c' || echo '$(srcdir)/'`@srcdir@/../flt-32/e_expf.c + +libsse2_la-e_log10f.lo: @srcdir@/../flt-32/e_log10f.c +@am__fastdepCC_TRUE@ if $(LIBTOOL) --mode=compile $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(libsse2_la_CFLAGS) $(CFLAGS) -MT libsse2_la-e_log10f.lo -MD -MP -MF "$(DEPDIR)/libsse2_la-e_log10f.Tpo" -c -o libsse2_la-e_log10f.lo `test -f '@srcdir@/../flt-32/e_log10f.c' || echo '$(srcdir)/'`@srcdir@/../flt-32/e_log10f.c; \ +@am__fastdepCC_TRUE@ then mv -f "$(DEPDIR)/libsse2_la-e_log10f.Tpo" "$(DEPDIR)/libsse2_la-e_log10f.Plo"; else rm -f "$(DEPDIR)/libsse2_la-e_log10f.Tpo"; exit 1; fi +@AMDEP_TRUE@@am__fastdepCC_FALSE@ source='@srcdir@/../flt-32/e_log10f.c' object='libsse2_la-e_log10f.lo' libtool=yes @AMDEPBACKSLASH@ +@AMDEP_TRUE@@am__fastdepCC_FALSE@ DEPDIR=$(DEPDIR) $(CCDEPMODE) $(depcomp) @AMDEPBACKSLASH@ +@am__fastdepCC_FALSE@ $(LIBTOOL) --mode=compile $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(libsse2_la_CFLAGS) $(CFLAGS) -c -o libsse2_la-e_log10f.lo `test -f '@srcdir@/../flt-32/e_log10f.c' || echo '$(srcdir)/'`@srcdir@/../flt-32/e_log10f.c + +libsse2_la-e_logf.lo: @srcdir@/../flt-32/e_logf.c +@am__fastdepCC_TRUE@ if $(LIBTOOL) --mode=compile $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(libsse2_la_CFLAGS) $(CFLAGS) -MT libsse2_la-e_logf.lo -MD -MP -MF "$(DEPDIR)/libsse2_la-e_logf.Tpo" -c -o libsse2_la-e_logf.lo `test -f '@srcdir@/../flt-32/e_logf.c' || echo '$(srcdir)/'`@srcdir@/../flt-32/e_logf.c; \ +@am__fastdepCC_TRUE@ then mv -f "$(DEPDIR)/libsse2_la-e_logf.Tpo" "$(DEPDIR)/libsse2_la-e_logf.Plo"; else rm -f "$(DEPDIR)/libsse2_la-e_logf.Tpo"; exit 1; fi +@AMDEP_TRUE@@am__fastdepCC_FALSE@ source='@srcdir@/../flt-32/e_logf.c' object='libsse2_la-e_logf.lo' libtool=yes @AMDEPBACKSLASH@ +@AMDEP_TRUE@@am__fastdepCC_FALSE@ DEPDIR=$(DEPDIR) $(CCDEPMODE) $(depcomp) @AMDEPBACKSLASH@ +@am__fastdepCC_FALSE@ $(LIBTOOL) --mode=compile $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(libsse2_la_CFLAGS) $(CFLAGS) -c -o libsse2_la-e_logf.lo `test -f '@srcdir@/../flt-32/e_logf.c' || echo '$(srcdir)/'`@srcdir@/../flt-32/e_logf.c + +libsse2_la-e_powf.lo: @srcdir@/../flt-32/e_powf.c +@am__fastdepCC_TRUE@ if $(LIBTOOL) --mode=compile $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(libsse2_la_CFLAGS) $(CFLAGS) -MT libsse2_la-e_powf.lo -MD -MP -MF "$(DEPDIR)/libsse2_la-e_powf.Tpo" -c -o libsse2_la-e_powf.lo `test -f '@srcdir@/../flt-32/e_powf.c' || echo '$(srcdir)/'`@srcdir@/../flt-32/e_powf.c; \ +@am__fastdepCC_TRUE@ then mv -f "$(DEPDIR)/libsse2_la-e_powf.Tpo" "$(DEPDIR)/libsse2_la-e_powf.Plo"; else rm -f "$(DEPDIR)/libsse2_la-e_powf.Tpo"; exit 1; fi +@AMDEP_TRUE@@am__fastdepCC_FALSE@ source='@srcdir@/../flt-32/e_powf.c' object='libsse2_la-e_powf.lo' libtool=yes @AMDEPBACKSLASH@ +@AMDEP_TRUE@@am__fastdepCC_FALSE@ DEPDIR=$(DEPDIR) $(CCDEPMODE) $(depcomp) @AMDEPBACKSLASH@ +@am__fastdepCC_FALSE@ $(LIBTOOL) --mode=compile $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(libsse2_la_CFLAGS) $(CFLAGS) -c -o libsse2_la-e_powf.lo `test -f '@srcdir@/../flt-32/e_powf.c' || echo '$(srcdir)/'`@srcdir@/../flt-32/e_powf.c + +libsse2_la-s_sinf.lo: @srcdir@/../flt-32/s_sinf.c +@am__fastdepCC_TRUE@ if $(LIBTOOL) --mode=compile $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(libsse2_la_CFLAGS) $(CFLAGS) -MT libsse2_la-s_sinf.lo -MD -MP -MF "$(DEPDIR)/libsse2_la-s_sinf.Tpo" -c -o libsse2_la-s_sinf.lo `test -f '@srcdir@/../flt-32/s_sinf.c' || echo '$(srcdir)/'`@srcdir@/../flt-32/s_sinf.c; \ +@am__fastdepCC_TRUE@ then mv -f "$(DEPDIR)/libsse2_la-s_sinf.Tpo" "$(DEPDIR)/libsse2_la-s_sinf.Plo"; else rm -f "$(DEPDIR)/libsse2_la-s_sinf.Tpo"; exit 1; fi +@AMDEP_TRUE@@am__fastdepCC_FALSE@ source='@srcdir@/../flt-32/s_sinf.c' object='libsse2_la-s_sinf.lo' libtool=yes @AMDEPBACKSLASH@ +@AMDEP_TRUE@@am__fastdepCC_FALSE@ DEPDIR=$(DEPDIR) $(CCDEPMODE) $(depcomp) @AMDEPBACKSLASH@ +@am__fastdepCC_FALSE@ $(LIBTOOL) --mode=compile $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(libsse2_la_CFLAGS) $(CFLAGS) -c -o libsse2_la-s_sinf.lo `test -f '@srcdir@/../flt-32/s_sinf.c' || echo '$(srcdir)/'`@srcdir@/../flt-32/s_sinf.c + +libsse2_la-s_tanf.lo: @srcdir@/../flt-32/s_tanf.c +@am__fastdepCC_TRUE@ if $(LIBTOOL) --mode=compile $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(libsse2_la_CFLAGS) $(CFLAGS) -MT libsse2_la-s_tanf.lo -MD -MP -MF "$(DEPDIR)/libsse2_la-s_tanf.Tpo" -c -o libsse2_la-s_tanf.lo `test -f '@srcdir@/../flt-32/s_tanf.c' || echo '$(srcdir)/'`@srcdir@/../flt-32/s_tanf.c; \ +@am__fastdepCC_TRUE@ then mv -f "$(DEPDIR)/libsse2_la-s_tanf.Tpo" "$(DEPDIR)/libsse2_la-s_tanf.Plo"; else rm -f "$(DEPDIR)/libsse2_la-s_tanf.Tpo"; exit 1; fi +@AMDEP_TRUE@@am__fastdepCC_FALSE@ source='@srcdir@/../flt-32/s_tanf.c' object='libsse2_la-s_tanf.lo' libtool=yes @AMDEPBACKSLASH@ +@AMDEP_TRUE@@am__fastdepCC_FALSE@ DEPDIR=$(DEPDIR) $(CCDEPMODE) $(depcomp) @AMDEPBACKSLASH@ +@am__fastdepCC_FALSE@ $(LIBTOOL) --mode=compile $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(libsse2_la_CFLAGS) $(CFLAGS) -c -o libsse2_la-s_tanf.lo `test -f '@srcdir@/../flt-32/s_tanf.c' || echo '$(srcdir)/'`@srcdir@/../flt-32/s_tanf.c + +libsse2_la-k_cosf.lo: @srcdir@/../flt-32/k_cosf.c +@am__fastdepCC_TRUE@ if $(LIBTOOL) --mode=compile $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(libsse2_la_CFLAGS) $(CFLAGS) -MT libsse2_la-k_cosf.lo -MD -MP -MF "$(DEPDIR)/libsse2_la-k_cosf.Tpo" -c -o libsse2_la-k_cosf.lo `test -f '@srcdir@/../flt-32/k_cosf.c' || echo '$(srcdir)/'`@srcdir@/../flt-32/k_cosf.c; \ +@am__fastdepCC_TRUE@ then mv -f "$(DEPDIR)/libsse2_la-k_cosf.Tpo" "$(DEPDIR)/libsse2_la-k_cosf.Plo"; else rm -f "$(DEPDIR)/libsse2_la-k_cosf.Tpo"; exit 1; fi +@AMDEP_TRUE@@am__fastdepCC_FALSE@ source='@srcdir@/../flt-32/k_cosf.c' object='libsse2_la-k_cosf.lo' libtool=yes @AMDEPBACKSLASH@ +@AMDEP_TRUE@@am__fastdepCC_FALSE@ DEPDIR=$(DEPDIR) $(CCDEPMODE) $(depcomp) @AMDEPBACKSLASH@ +@am__fastdepCC_FALSE@ $(LIBTOOL) --mode=compile $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(libsse2_la_CFLAGS) $(CFLAGS) -c -o libsse2_la-k_cosf.lo `test -f '@srcdir@/../flt-32/k_cosf.c' || echo '$(srcdir)/'`@srcdir@/../flt-32/k_cosf.c + +libsse2_la-k_rem_pio2f.lo: @srcdir@/../flt-32/k_rem_pio2f.c +@am__fastdepCC_TRUE@ if $(LIBTOOL) --mode=compile $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(libsse2_la_CFLAGS) $(CFLAGS) -MT libsse2_la-k_rem_pio2f.lo -MD -MP -MF "$(DEPDIR)/libsse2_la-k_rem_pio2f.Tpo" -c -o libsse2_la-k_rem_pio2f.lo `test -f '@srcdir@/../flt-32/k_rem_pio2f.c' || echo '$(srcdir)/'`@srcdir@/../flt-32/k_rem_pio2f.c; \ +@am__fastdepCC_TRUE@ then mv -f "$(DEPDIR)/libsse2_la-k_rem_pio2f.Tpo" "$(DEPDIR)/libsse2_la-k_rem_pio2f.Plo"; else rm -f "$(DEPDIR)/libsse2_la-k_rem_pio2f.Tpo"; exit 1; fi +@AMDEP_TRUE@@am__fastdepCC_FALSE@ source='@srcdir@/../flt-32/k_rem_pio2f.c' object='libsse2_la-k_rem_pio2f.lo' libtool=yes @AMDEPBACKSLASH@ +@AMDEP_TRUE@@am__fastdepCC_FALSE@ DEPDIR=$(DEPDIR) $(CCDEPMODE) $(depcomp) @AMDEPBACKSLASH@ +@am__fastdepCC_FALSE@ $(LIBTOOL) --mode=compile $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(libsse2_la_CFLAGS) $(CFLAGS) -c -o libsse2_la-k_rem_pio2f.lo `test -f '@srcdir@/../flt-32/k_rem_pio2f.c' || echo '$(srcdir)/'`@srcdir@/../flt-32/k_rem_pio2f.c + +libsse2_la-k_sinf.lo: @srcdir@/../flt-32/k_sinf.c +@am__fastdepCC_TRUE@ if $(LIBTOOL) --mode=compile $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(libsse2_la_CFLAGS) $(CFLAGS) -MT libsse2_la-k_sinf.lo -MD -MP -MF "$(DEPDIR)/libsse2_la-k_sinf.Tpo" -c -o libsse2_la-k_sinf.lo `test -f '@srcdir@/../flt-32/k_sinf.c' || echo '$(srcdir)/'`@srcdir@/../flt-32/k_sinf.c; \ +@am__fastdepCC_TRUE@ then mv -f "$(DEPDIR)/libsse2_la-k_sinf.Tpo" "$(DEPDIR)/libsse2_la-k_sinf.Plo"; else rm -f "$(DEPDIR)/libsse2_la-k_sinf.Tpo"; exit 1; fi +@AMDEP_TRUE@@am__fastdepCC_FALSE@ source='@srcdir@/../flt-32/k_sinf.c' object='libsse2_la-k_sinf.lo' libtool=yes @AMDEPBACKSLASH@ +@AMDEP_TRUE@@am__fastdepCC_FALSE@ DEPDIR=$(DEPDIR) $(CCDEPMODE) $(depcomp) @AMDEPBACKSLASH@ +@am__fastdepCC_FALSE@ $(LIBTOOL) --mode=compile $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(libsse2_la_CFLAGS) $(CFLAGS) -c -o libsse2_la-k_sinf.lo `test -f '@srcdir@/../flt-32/k_sinf.c' || echo '$(srcdir)/'`@srcdir@/../flt-32/k_sinf.c + +libsse2_la-k_tanf.lo: @srcdir@/../flt-32/k_tanf.c +@am__fastdepCC_TRUE@ if $(LIBTOOL) --mode=compile $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(libsse2_la_CFLAGS) $(CFLAGS) -MT libsse2_la-k_tanf.lo -MD -MP -MF "$(DEPDIR)/libsse2_la-k_tanf.Tpo" -c -o libsse2_la-k_tanf.lo `test -f '@srcdir@/../flt-32/k_tanf.c' || echo '$(srcdir)/'`@srcdir@/../flt-32/k_tanf.c; \ +@am__fastdepCC_TRUE@ then mv -f "$(DEPDIR)/libsse2_la-k_tanf.Tpo" "$(DEPDIR)/libsse2_la-k_tanf.Plo"; else rm -f "$(DEPDIR)/libsse2_la-k_tanf.Tpo"; exit 1; fi +@AMDEP_TRUE@@am__fastdepCC_FALSE@ source='@srcdir@/../flt-32/k_tanf.c' object='libsse2_la-k_tanf.lo' libtool=yes @AMDEPBACKSLASH@ +@AMDEP_TRUE@@am__fastdepCC_FALSE@ DEPDIR=$(DEPDIR) $(CCDEPMODE) $(depcomp) @AMDEPBACKSLASH@ +@am__fastdepCC_FALSE@ $(LIBTOOL) --mode=compile $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(libsse2_la_CFLAGS) $(CFLAGS) -c -o libsse2_la-k_tanf.lo `test -f '@srcdir@/../flt-32/k_tanf.c' || echo '$(srcdir)/'`@srcdir@/../flt-32/k_tanf.c + +libsse2_la-e_rem_pio2f.lo: @srcdir@/../flt-32/e_rem_pio2f.c +@am__fastdepCC_TRUE@ if $(LIBTOOL) --mode=compile $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(libsse2_la_CFLAGS) $(CFLAGS) -MT libsse2_la-e_rem_pio2f.lo -MD -MP -MF "$(DEPDIR)/libsse2_la-e_rem_pio2f.Tpo" -c -o libsse2_la-e_rem_pio2f.lo `test -f '@srcdir@/../flt-32/e_rem_pio2f.c' || echo '$(srcdir)/'`@srcdir@/../flt-32/e_rem_pio2f.c; \ +@am__fastdepCC_TRUE@ then mv -f "$(DEPDIR)/libsse2_la-e_rem_pio2f.Tpo" "$(DEPDIR)/libsse2_la-e_rem_pio2f.Plo"; else rm -f "$(DEPDIR)/libsse2_la-e_rem_pio2f.Tpo"; exit 1; fi +@AMDEP_TRUE@@am__fastdepCC_FALSE@ source='@srcdir@/../flt-32/e_rem_pio2f.c' object='libsse2_la-e_rem_pio2f.lo' libtool=yes @AMDEPBACKSLASH@ +@AMDEP_TRUE@@am__fastdepCC_FALSE@ DEPDIR=$(DEPDIR) $(CCDEPMODE) $(depcomp) @AMDEPBACKSLASH@ +@am__fastdepCC_FALSE@ $(LIBTOOL) --mode=compile $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(libsse2_la_CFLAGS) $(CFLAGS) -c -o libsse2_la-e_rem_pio2f.lo `test -f '@srcdir@/../flt-32/e_rem_pio2f.c' || echo '$(srcdir)/'`@srcdir@/../flt-32/e_rem_pio2f.c + +libsse2_la-e_sqrtf.lo: @srcdir@/../flt-32/e_sqrtf.c +@am__fastdepCC_TRUE@ if $(LIBTOOL) --mode=compile $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(libsse2_la_CFLAGS) $(CFLAGS) -MT libsse2_la-e_sqrtf.lo -MD -MP -MF "$(DEPDIR)/libsse2_la-e_sqrtf.Tpo" -c -o libsse2_la-e_sqrtf.lo `test -f '@srcdir@/../flt-32/e_sqrtf.c' || echo '$(srcdir)/'`@srcdir@/../flt-32/e_sqrtf.c; \ +@am__fastdepCC_TRUE@ then mv -f "$(DEPDIR)/libsse2_la-e_sqrtf.Tpo" "$(DEPDIR)/libsse2_la-e_sqrtf.Plo"; else rm -f "$(DEPDIR)/libsse2_la-e_sqrtf.Tpo"; exit 1; fi +@AMDEP_TRUE@@am__fastdepCC_FALSE@ source='@srcdir@/../flt-32/e_sqrtf.c' object='libsse2_la-e_sqrtf.lo' libtool=yes @AMDEPBACKSLASH@ +@AMDEP_TRUE@@am__fastdepCC_FALSE@ DEPDIR=$(DEPDIR) $(CCDEPMODE) $(depcomp) @AMDEPBACKSLASH@ +@am__fastdepCC_FALSE@ $(LIBTOOL) --mode=compile $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(libsse2_la_CFLAGS) $(CFLAGS) -c -o libsse2_la-e_sqrtf.lo `test -f '@srcdir@/../flt-32/e_sqrtf.c' || echo '$(srcdir)/'`@srcdir@/../flt-32/e_sqrtf.c + +libsse2_la-s_scalbnf.lo: @srcdir@/../flt-32/s_scalbnf.c +@am__fastdepCC_TRUE@ if $(LIBTOOL) --mode=compile $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(libsse2_la_CFLAGS) $(CFLAGS) -MT libsse2_la-s_scalbnf.lo -MD -MP -MF "$(DEPDIR)/libsse2_la-s_scalbnf.Tpo" -c -o libsse2_la-s_scalbnf.lo `test -f '@srcdir@/../flt-32/s_scalbnf.c' || echo '$(srcdir)/'`@srcdir@/../flt-32/s_scalbnf.c; \ +@am__fastdepCC_TRUE@ then mv -f "$(DEPDIR)/libsse2_la-s_scalbnf.Tpo" "$(DEPDIR)/libsse2_la-s_scalbnf.Plo"; else rm -f "$(DEPDIR)/libsse2_la-s_scalbnf.Tpo"; exit 1; fi +@AMDEP_TRUE@@am__fastdepCC_FALSE@ source='@srcdir@/../flt-32/s_scalbnf.c' object='libsse2_la-s_scalbnf.lo' libtool=yes @AMDEPBACKSLASH@ +@AMDEP_TRUE@@am__fastdepCC_FALSE@ DEPDIR=$(DEPDIR) $(CCDEPMODE) $(depcomp) @AMDEPBACKSLASH@ +@am__fastdepCC_FALSE@ $(LIBTOOL) --mode=compile $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(libsse2_la_CFLAGS) $(CFLAGS) -c -o libsse2_la-s_scalbnf.lo `test -f '@srcdir@/../flt-32/s_scalbnf.c' || echo '$(srcdir)/'`@srcdir@/../flt-32/s_scalbnf.c + +libsse2_la-s_floorf.lo: @srcdir@/../flt-32/s_floorf.c +@am__fastdepCC_TRUE@ if $(LIBTOOL) --mode=compile $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(libsse2_la_CFLAGS) $(CFLAGS) -MT libsse2_la-s_floorf.lo -MD -MP -MF "$(DEPDIR)/libsse2_la-s_floorf.Tpo" -c -o libsse2_la-s_floorf.lo `test -f '@srcdir@/../flt-32/s_floorf.c' || echo '$(srcdir)/'`@srcdir@/../flt-32/s_floorf.c; \ +@am__fastdepCC_TRUE@ then mv -f "$(DEPDIR)/libsse2_la-s_floorf.Tpo" "$(DEPDIR)/libsse2_la-s_floorf.Plo"; else rm -f "$(DEPDIR)/libsse2_la-s_floorf.Tpo"; exit 1; fi +@AMDEP_TRUE@@am__fastdepCC_FALSE@ source='@srcdir@/../flt-32/s_floorf.c' object='libsse2_la-s_floorf.lo' libtool=yes @AMDEPBACKSLASH@ +@AMDEP_TRUE@@am__fastdepCC_FALSE@ DEPDIR=$(DEPDIR) $(CCDEPMODE) $(depcomp) @AMDEPBACKSLASH@ +@am__fastdepCC_FALSE@ $(LIBTOOL) --mode=compile $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(libsse2_la_CFLAGS) $(CFLAGS) -c -o libsse2_la-s_floorf.lo `test -f '@srcdir@/../flt-32/s_floorf.c' || echo '$(srcdir)/'`@srcdir@/../flt-32/s_floorf.c + +libsse2_la-s_isinff.lo: @srcdir@/../flt-32/s_isinff.c +@am__fastdepCC_TRUE@ if $(LIBTOOL) --mode=compile $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(libsse2_la_CFLAGS) $(CFLAGS) -MT libsse2_la-s_isinff.lo -MD -MP -MF "$(DEPDIR)/libsse2_la-s_isinff.Tpo" -c -o libsse2_la-s_isinff.lo `test -f '@srcdir@/../flt-32/s_isinff.c' || echo '$(srcdir)/'`@srcdir@/../flt-32/s_isinff.c; \ +@am__fastdepCC_TRUE@ then mv -f "$(DEPDIR)/libsse2_la-s_isinff.Tpo" "$(DEPDIR)/libsse2_la-s_isinff.Plo"; else rm -f "$(DEPDIR)/libsse2_la-s_isinff.Tpo"; exit 1; fi +@AMDEP_TRUE@@am__fastdepCC_FALSE@ source='@srcdir@/../flt-32/s_isinff.c' object='libsse2_la-s_isinff.lo' libtool=yes @AMDEPBACKSLASH@ +@AMDEP_TRUE@@am__fastdepCC_FALSE@ DEPDIR=$(DEPDIR) $(CCDEPMODE) $(depcomp) @AMDEPBACKSLASH@ +@am__fastdepCC_FALSE@ $(LIBTOOL) --mode=compile $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(libsse2_la_CFLAGS) $(CFLAGS) -c -o libsse2_la-s_isinff.lo `test -f '@srcdir@/../flt-32/s_isinff.c' || echo '$(srcdir)/'`@srcdir@/../flt-32/s_isinff.c + +libsse2_la-t_exp.lo: @srcdir@/../dbl-64/t_exp.c +@am__fastdepCC_TRUE@ if $(LIBTOOL) --mode=compile $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(libsse2_la_CFLAGS) $(CFLAGS) -MT libsse2_la-t_exp.lo -MD -MP -MF "$(DEPDIR)/libsse2_la-t_exp.Tpo" -c -o libsse2_la-t_exp.lo `test -f '@srcdir@/../dbl-64/t_exp.c' || echo '$(srcdir)/'`@srcdir@/../dbl-64/t_exp.c; \ +@am__fastdepCC_TRUE@ then mv -f "$(DEPDIR)/libsse2_la-t_exp.Tpo" "$(DEPDIR)/libsse2_la-t_exp.Plo"; else rm -f "$(DEPDIR)/libsse2_la-t_exp.Tpo"; exit 1; fi +@AMDEP_TRUE@@am__fastdepCC_FALSE@ source='@srcdir@/../dbl-64/t_exp.c' object='libsse2_la-t_exp.lo' libtool=yes @AMDEPBACKSLASH@ +@AMDEP_TRUE@@am__fastdepCC_FALSE@ DEPDIR=$(DEPDIR) $(CCDEPMODE) $(depcomp) @AMDEPBACKSLASH@ +@am__fastdepCC_FALSE@ $(LIBTOOL) --mode=compile $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(libsse2_la_CFLAGS) $(CFLAGS) -c -o libsse2_la-t_exp.lo `test -f '@srcdir@/../dbl-64/t_exp.c' || echo '$(srcdir)/'`@srcdir@/../dbl-64/t_exp.c + +libsse2_la-e_asin.lo: @srcdir@/../dbl-64/e_asin.c +@am__fastdepCC_TRUE@ if $(LIBTOOL) --mode=compile $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(libsse2_la_CFLAGS) $(CFLAGS) -MT libsse2_la-e_asin.lo -MD -MP -MF "$(DEPDIR)/libsse2_la-e_asin.Tpo" -c -o libsse2_la-e_asin.lo `test -f '@srcdir@/../dbl-64/e_asin.c' || echo '$(srcdir)/'`@srcdir@/../dbl-64/e_asin.c; \ +@am__fastdepCC_TRUE@ then mv -f "$(DEPDIR)/libsse2_la-e_asin.Tpo" "$(DEPDIR)/libsse2_la-e_asin.Plo"; else rm -f "$(DEPDIR)/libsse2_la-e_asin.Tpo"; exit 1; fi +@AMDEP_TRUE@@am__fastdepCC_FALSE@ source='@srcdir@/../dbl-64/e_asin.c' object='libsse2_la-e_asin.lo' libtool=yes @AMDEPBACKSLASH@ +@AMDEP_TRUE@@am__fastdepCC_FALSE@ DEPDIR=$(DEPDIR) $(CCDEPMODE) $(depcomp) @AMDEPBACKSLASH@ +@am__fastdepCC_FALSE@ $(LIBTOOL) --mode=compile $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(libsse2_la_CFLAGS) $(CFLAGS) -c -o libsse2_la-e_asin.lo `test -f '@srcdir@/../dbl-64/e_asin.c' || echo '$(srcdir)/'`@srcdir@/../dbl-64/e_asin.c + +libsse2_la-e_atan2.lo: @srcdir@/../dbl-64/e_atan2.c +@am__fastdepCC_TRUE@ if $(LIBTOOL) --mode=compile $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(libsse2_la_CFLAGS) $(CFLAGS) -MT libsse2_la-e_atan2.lo -MD -MP -MF "$(DEPDIR)/libsse2_la-e_atan2.Tpo" -c -o libsse2_la-e_atan2.lo `test -f '@srcdir@/../dbl-64/e_atan2.c' || echo '$(srcdir)/'`@srcdir@/../dbl-64/e_atan2.c; \ +@am__fastdepCC_TRUE@ then mv -f "$(DEPDIR)/libsse2_la-e_atan2.Tpo" "$(DEPDIR)/libsse2_la-e_atan2.Plo"; else rm -f "$(DEPDIR)/libsse2_la-e_atan2.Tpo"; exit 1; fi +@AMDEP_TRUE@@am__fastdepCC_FALSE@ source='@srcdir@/../dbl-64/e_atan2.c' object='libsse2_la-e_atan2.lo' libtool=yes @AMDEPBACKSLASH@ +@AMDEP_TRUE@@am__fastdepCC_FALSE@ DEPDIR=$(DEPDIR) $(CCDEPMODE) $(depcomp) @AMDEPBACKSLASH@ +@am__fastdepCC_FALSE@ $(LIBTOOL) --mode=compile $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(libsse2_la_CFLAGS) $(CFLAGS) -c -o libsse2_la-e_atan2.lo `test -f '@srcdir@/../dbl-64/e_atan2.c' || echo '$(srcdir)/'`@srcdir@/../dbl-64/e_atan2.c + +libsse2_la-s_atan.lo: @srcdir@/../dbl-64/s_atan.c +@am__fastdepCC_TRUE@ if $(LIBTOOL) --mode=compile $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(libsse2_la_CFLAGS) $(CFLAGS) -MT libsse2_la-s_atan.lo -MD -MP -MF "$(DEPDIR)/libsse2_la-s_atan.Tpo" -c -o libsse2_la-s_atan.lo `test -f '@srcdir@/../dbl-64/s_atan.c' || echo '$(srcdir)/'`@srcdir@/../dbl-64/s_atan.c; \ +@am__fastdepCC_TRUE@ then mv -f "$(DEPDIR)/libsse2_la-s_atan.Tpo" "$(DEPDIR)/libsse2_la-s_atan.Plo"; else rm -f "$(DEPDIR)/libsse2_la-s_atan.Tpo"; exit 1; fi +@AMDEP_TRUE@@am__fastdepCC_FALSE@ source='@srcdir@/../dbl-64/s_atan.c' object='libsse2_la-s_atan.lo' libtool=yes @AMDEPBACKSLASH@ +@AMDEP_TRUE@@am__fastdepCC_FALSE@ DEPDIR=$(DEPDIR) $(CCDEPMODE) $(depcomp) @AMDEPBACKSLASH@ +@am__fastdepCC_FALSE@ $(LIBTOOL) --mode=compile $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(libsse2_la_CFLAGS) $(CFLAGS) -c -o libsse2_la-s_atan.lo `test -f '@srcdir@/../dbl-64/s_atan.c' || echo '$(srcdir)/'`@srcdir@/../dbl-64/s_atan.c + +libsse2_la-branred.lo: @srcdir@/../dbl-64/branred.c +@am__fastdepCC_TRUE@ if $(LIBTOOL) --mode=compile $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(libsse2_la_CFLAGS) $(CFLAGS) -MT libsse2_la-branred.lo -MD -MP -MF "$(DEPDIR)/libsse2_la-branred.Tpo" -c -o libsse2_la-branred.lo `test -f '@srcdir@/../dbl-64/branred.c' || echo '$(srcdir)/'`@srcdir@/../dbl-64/branred.c; \ +@am__fastdepCC_TRUE@ then mv -f "$(DEPDIR)/libsse2_la-branred.Tpo" "$(DEPDIR)/libsse2_la-branred.Plo"; else rm -f "$(DEPDIR)/libsse2_la-branred.Tpo"; exit 1; fi +@AMDEP_TRUE@@am__fastdepCC_FALSE@ source='@srcdir@/../dbl-64/branred.c' object='libsse2_la-branred.lo' libtool=yes @AMDEPBACKSLASH@ +@AMDEP_TRUE@@am__fastdepCC_FALSE@ DEPDIR=$(DEPDIR) $(CCDEPMODE) $(depcomp) @AMDEPBACKSLASH@ +@am__fastdepCC_FALSE@ $(LIBTOOL) --mode=compile $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(libsse2_la_CFLAGS) $(CFLAGS) -c -o libsse2_la-branred.lo `test -f '@srcdir@/../dbl-64/branred.c' || echo '$(srcdir)/'`@srcdir@/../dbl-64/branred.c + +libsse2_la-doasin.lo: @srcdir@/../dbl-64/doasin.c +@am__fastdepCC_TRUE@ if $(LIBTOOL) --mode=compile $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(libsse2_la_CFLAGS) $(CFLAGS) -MT libsse2_la-doasin.lo -MD -MP -MF "$(DEPDIR)/libsse2_la-doasin.Tpo" -c -o libsse2_la-doasin.lo `test -f '@srcdir@/../dbl-64/doasin.c' || echo '$(srcdir)/'`@srcdir@/../dbl-64/doasin.c; \ +@am__fastdepCC_TRUE@ then mv -f "$(DEPDIR)/libsse2_la-doasin.Tpo" "$(DEPDIR)/libsse2_la-doasin.Plo"; else rm -f "$(DEPDIR)/libsse2_la-doasin.Tpo"; exit 1; fi +@AMDEP_TRUE@@am__fastdepCC_FALSE@ source='@srcdir@/../dbl-64/doasin.c' object='libsse2_la-doasin.lo' libtool=yes @AMDEPBACKSLASH@ +@AMDEP_TRUE@@am__fastdepCC_FALSE@ DEPDIR=$(DEPDIR) $(CCDEPMODE) $(depcomp) @AMDEPBACKSLASH@ +@am__fastdepCC_FALSE@ $(LIBTOOL) --mode=compile $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(libsse2_la_CFLAGS) $(CFLAGS) -c -o libsse2_la-doasin.lo `test -f '@srcdir@/../dbl-64/doasin.c' || echo '$(srcdir)/'`@srcdir@/../dbl-64/doasin.c + +libsse2_la-dosincos.lo: @srcdir@/../dbl-64/dosincos.c +@am__fastdepCC_TRUE@ if $(LIBTOOL) --mode=compile $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(libsse2_la_CFLAGS) $(CFLAGS) -MT libsse2_la-dosincos.lo -MD -MP -MF "$(DEPDIR)/libsse2_la-dosincos.Tpo" -c -o libsse2_la-dosincos.lo `test -f '@srcdir@/../dbl-64/dosincos.c' || echo '$(srcdir)/'`@srcdir@/../dbl-64/dosincos.c; \ +@am__fastdepCC_TRUE@ then mv -f "$(DEPDIR)/libsse2_la-dosincos.Tpo" "$(DEPDIR)/libsse2_la-dosincos.Plo"; else rm -f "$(DEPDIR)/libsse2_la-dosincos.Tpo"; exit 1; fi +@AMDEP_TRUE@@am__fastdepCC_FALSE@ source='@srcdir@/../dbl-64/dosincos.c' object='libsse2_la-dosincos.lo' libtool=yes @AMDEPBACKSLASH@ +@AMDEP_TRUE@@am__fastdepCC_FALSE@ DEPDIR=$(DEPDIR) $(CCDEPMODE) $(depcomp) @AMDEPBACKSLASH@ +@am__fastdepCC_FALSE@ $(LIBTOOL) --mode=compile $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(libsse2_la_CFLAGS) $(CFLAGS) -c -o libsse2_la-dosincos.lo `test -f '@srcdir@/../dbl-64/dosincos.c' || echo '$(srcdir)/'`@srcdir@/../dbl-64/dosincos.c + +libsse2_la-e_exp.lo: @srcdir@/../dbl-64/e_exp.c +@am__fastdepCC_TRUE@ if $(LIBTOOL) --mode=compile $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(libsse2_la_CFLAGS) $(CFLAGS) -MT libsse2_la-e_exp.lo -MD -MP -MF "$(DEPDIR)/libsse2_la-e_exp.Tpo" -c -o libsse2_la-e_exp.lo `test -f '@srcdir@/../dbl-64/e_exp.c' || echo '$(srcdir)/'`@srcdir@/../dbl-64/e_exp.c; \ +@am__fastdepCC_TRUE@ then mv -f "$(DEPDIR)/libsse2_la-e_exp.Tpo" "$(DEPDIR)/libsse2_la-e_exp.Plo"; else rm -f "$(DEPDIR)/libsse2_la-e_exp.Tpo"; exit 1; fi +@AMDEP_TRUE@@am__fastdepCC_FALSE@ source='@srcdir@/../dbl-64/e_exp.c' object='libsse2_la-e_exp.lo' libtool=yes @AMDEPBACKSLASH@ +@AMDEP_TRUE@@am__fastdepCC_FALSE@ DEPDIR=$(DEPDIR) $(CCDEPMODE) $(depcomp) @AMDEPBACKSLASH@ +@am__fastdepCC_FALSE@ $(LIBTOOL) --mode=compile $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(libsse2_la_CFLAGS) $(CFLAGS) -c -o libsse2_la-e_exp.lo `test -f '@srcdir@/../dbl-64/e_exp.c' || echo '$(srcdir)/'`@srcdir@/../dbl-64/e_exp.c + +libsse2_la-halfulp.lo: @srcdir@/../dbl-64/halfulp.c +@am__fastdepCC_TRUE@ if $(LIBTOOL) --mode=compile $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(libsse2_la_CFLAGS) $(CFLAGS) -MT libsse2_la-halfulp.lo -MD -MP -MF "$(DEPDIR)/libsse2_la-halfulp.Tpo" -c -o libsse2_la-halfulp.lo `test -f '@srcdir@/../dbl-64/halfulp.c' || echo '$(srcdir)/'`@srcdir@/../dbl-64/halfulp.c; \ +@am__fastdepCC_TRUE@ then mv -f "$(DEPDIR)/libsse2_la-halfulp.Tpo" "$(DEPDIR)/libsse2_la-halfulp.Plo"; else rm -f "$(DEPDIR)/libsse2_la-halfulp.Tpo"; exit 1; fi +@AMDEP_TRUE@@am__fastdepCC_FALSE@ source='@srcdir@/../dbl-64/halfulp.c' object='libsse2_la-halfulp.lo' libtool=yes @AMDEPBACKSLASH@ +@AMDEP_TRUE@@am__fastdepCC_FALSE@ DEPDIR=$(DEPDIR) $(CCDEPMODE) $(depcomp) @AMDEPBACKSLASH@ +@am__fastdepCC_FALSE@ $(LIBTOOL) --mode=compile $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(libsse2_la_CFLAGS) $(CFLAGS) -c -o libsse2_la-halfulp.lo `test -f '@srcdir@/../dbl-64/halfulp.c' || echo '$(srcdir)/'`@srcdir@/../dbl-64/halfulp.c + +libsse2_la-k_rem_pio2.lo: @srcdir@/../dbl-64/k_rem_pio2.c +@am__fastdepCC_TRUE@ if $(LIBTOOL) --mode=compile $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(libsse2_la_CFLAGS) $(CFLAGS) -MT libsse2_la-k_rem_pio2.lo -MD -MP -MF "$(DEPDIR)/libsse2_la-k_rem_pio2.Tpo" -c -o libsse2_la-k_rem_pio2.lo `test -f '@srcdir@/../dbl-64/k_rem_pio2.c' || echo '$(srcdir)/'`@srcdir@/../dbl-64/k_rem_pio2.c; \ +@am__fastdepCC_TRUE@ then mv -f "$(DEPDIR)/libsse2_la-k_rem_pio2.Tpo" "$(DEPDIR)/libsse2_la-k_rem_pio2.Plo"; else rm -f "$(DEPDIR)/libsse2_la-k_rem_pio2.Tpo"; exit 1; fi +@AMDEP_TRUE@@am__fastdepCC_FALSE@ source='@srcdir@/../dbl-64/k_rem_pio2.c' object='libsse2_la-k_rem_pio2.lo' libtool=yes @AMDEPBACKSLASH@ +@AMDEP_TRUE@@am__fastdepCC_FALSE@ DEPDIR=$(DEPDIR) $(CCDEPMODE) $(depcomp) @AMDEPBACKSLASH@ +@am__fastdepCC_FALSE@ $(LIBTOOL) --mode=compile $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(libsse2_la_CFLAGS) $(CFLAGS) -c -o libsse2_la-k_rem_pio2.lo `test -f '@srcdir@/../dbl-64/k_rem_pio2.c' || echo '$(srcdir)/'`@srcdir@/../dbl-64/k_rem_pio2.c + +libsse2_la-e_log10.lo: @srcdir@/../dbl-64/e_log10.c +@am__fastdepCC_TRUE@ if $(LIBTOOL) --mode=compile $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(libsse2_la_CFLAGS) $(CFLAGS) -MT libsse2_la-e_log10.lo -MD -MP -MF "$(DEPDIR)/libsse2_la-e_log10.Tpo" -c -o libsse2_la-e_log10.lo `test -f '@srcdir@/../dbl-64/e_log10.c' || echo '$(srcdir)/'`@srcdir@/../dbl-64/e_log10.c; \ +@am__fastdepCC_TRUE@ then mv -f "$(DEPDIR)/libsse2_la-e_log10.Tpo" "$(DEPDIR)/libsse2_la-e_log10.Plo"; else rm -f "$(DEPDIR)/libsse2_la-e_log10.Tpo"; exit 1; fi +@AMDEP_TRUE@@am__fastdepCC_FALSE@ source='@srcdir@/../dbl-64/e_log10.c' object='libsse2_la-e_log10.lo' libtool=yes @AMDEPBACKSLASH@ +@AMDEP_TRUE@@am__fastdepCC_FALSE@ DEPDIR=$(DEPDIR) $(CCDEPMODE) $(depcomp) @AMDEPBACKSLASH@ +@am__fastdepCC_FALSE@ $(LIBTOOL) --mode=compile $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(libsse2_la_CFLAGS) $(CFLAGS) -c -o libsse2_la-e_log10.lo `test -f '@srcdir@/../dbl-64/e_log10.c' || echo '$(srcdir)/'`@srcdir@/../dbl-64/e_log10.c + +libsse2_la-e_log.lo: @srcdir@/../dbl-64/e_log.c +@am__fastdepCC_TRUE@ if $(LIBTOOL) --mode=compile $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(libsse2_la_CFLAGS) $(CFLAGS) -MT libsse2_la-e_log.lo -MD -MP -MF "$(DEPDIR)/libsse2_la-e_log.Tpo" -c -o libsse2_la-e_log.lo `test -f '@srcdir@/../dbl-64/e_log.c' || echo '$(srcdir)/'`@srcdir@/../dbl-64/e_log.c; \ +@am__fastdepCC_TRUE@ then mv -f "$(DEPDIR)/libsse2_la-e_log.Tpo" "$(DEPDIR)/libsse2_la-e_log.Plo"; else rm -f "$(DEPDIR)/libsse2_la-e_log.Tpo"; exit 1; fi +@AMDEP_TRUE@@am__fastdepCC_FALSE@ source='@srcdir@/../dbl-64/e_log.c' object='libsse2_la-e_log.lo' libtool=yes @AMDEPBACKSLASH@ +@AMDEP_TRUE@@am__fastdepCC_FALSE@ DEPDIR=$(DEPDIR) $(CCDEPMODE) $(depcomp) @AMDEPBACKSLASH@ +@am__fastdepCC_FALSE@ $(LIBTOOL) --mode=compile $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(libsse2_la_CFLAGS) $(CFLAGS) -c -o libsse2_la-e_log.lo `test -f '@srcdir@/../dbl-64/e_log.c' || echo '$(srcdir)/'`@srcdir@/../dbl-64/e_log.c + +libsse2_la-mpa.lo: @srcdir@/../dbl-64/mpa.c +@am__fastdepCC_TRUE@ if $(LIBTOOL) --mode=compile $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(libsse2_la_CFLAGS) $(CFLAGS) -MT libsse2_la-mpa.lo -MD -MP -MF "$(DEPDIR)/libsse2_la-mpa.Tpo" -c -o libsse2_la-mpa.lo `test -f '@srcdir@/../dbl-64/mpa.c' || echo '$(srcdir)/'`@srcdir@/../dbl-64/mpa.c; \ +@am__fastdepCC_TRUE@ then mv -f "$(DEPDIR)/libsse2_la-mpa.Tpo" "$(DEPDIR)/libsse2_la-mpa.Plo"; else rm -f "$(DEPDIR)/libsse2_la-mpa.Tpo"; exit 1; fi +@AMDEP_TRUE@@am__fastdepCC_FALSE@ source='@srcdir@/../dbl-64/mpa.c' object='libsse2_la-mpa.lo' libtool=yes @AMDEPBACKSLASH@ +@AMDEP_TRUE@@am__fastdepCC_FALSE@ DEPDIR=$(DEPDIR) $(CCDEPMODE) $(depcomp) @AMDEPBACKSLASH@ +@am__fastdepCC_FALSE@ $(LIBTOOL) --mode=compile $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(libsse2_la_CFLAGS) $(CFLAGS) -c -o libsse2_la-mpa.lo `test -f '@srcdir@/../dbl-64/mpa.c' || echo '$(srcdir)/'`@srcdir@/../dbl-64/mpa.c + +libsse2_la-mpatan2.lo: @srcdir@/../dbl-64/mpatan2.c +@am__fastdepCC_TRUE@ if $(LIBTOOL) --mode=compile $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(libsse2_la_CFLAGS) $(CFLAGS) -MT libsse2_la-mpatan2.lo -MD -MP -MF "$(DEPDIR)/libsse2_la-mpatan2.Tpo" -c -o libsse2_la-mpatan2.lo `test -f '@srcdir@/../dbl-64/mpatan2.c' || echo '$(srcdir)/'`@srcdir@/../dbl-64/mpatan2.c; \ +@am__fastdepCC_TRUE@ then mv -f "$(DEPDIR)/libsse2_la-mpatan2.Tpo" "$(DEPDIR)/libsse2_la-mpatan2.Plo"; else rm -f "$(DEPDIR)/libsse2_la-mpatan2.Tpo"; exit 1; fi +@AMDEP_TRUE@@am__fastdepCC_FALSE@ source='@srcdir@/../dbl-64/mpatan2.c' object='libsse2_la-mpatan2.lo' libtool=yes @AMDEPBACKSLASH@ +@AMDEP_TRUE@@am__fastdepCC_FALSE@ DEPDIR=$(DEPDIR) $(CCDEPMODE) $(depcomp) @AMDEPBACKSLASH@ +@am__fastdepCC_FALSE@ $(LIBTOOL) --mode=compile $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(libsse2_la_CFLAGS) $(CFLAGS) -c -o libsse2_la-mpatan2.lo `test -f '@srcdir@/../dbl-64/mpatan2.c' || echo '$(srcdir)/'`@srcdir@/../dbl-64/mpatan2.c + +libsse2_la-mpatan.lo: @srcdir@/../dbl-64/mpatan.c +@am__fastdepCC_TRUE@ if $(LIBTOOL) --mode=compile $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(libsse2_la_CFLAGS) $(CFLAGS) -MT libsse2_la-mpatan.lo -MD -MP -MF "$(DEPDIR)/libsse2_la-mpatan.Tpo" -c -o libsse2_la-mpatan.lo `test -f '@srcdir@/../dbl-64/mpatan.c' || echo '$(srcdir)/'`@srcdir@/../dbl-64/mpatan.c; \ +@am__fastdepCC_TRUE@ then mv -f "$(DEPDIR)/libsse2_la-mpatan.Tpo" "$(DEPDIR)/libsse2_la-mpatan.Plo"; else rm -f "$(DEPDIR)/libsse2_la-mpatan.Tpo"; exit 1; fi +@AMDEP_TRUE@@am__fastdepCC_FALSE@ source='@srcdir@/../dbl-64/mpatan.c' object='libsse2_la-mpatan.lo' libtool=yes @AMDEPBACKSLASH@ +@AMDEP_TRUE@@am__fastdepCC_FALSE@ DEPDIR=$(DEPDIR) $(CCDEPMODE) $(depcomp) @AMDEPBACKSLASH@ +@am__fastdepCC_FALSE@ $(LIBTOOL) --mode=compile $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(libsse2_la_CFLAGS) $(CFLAGS) -c -o libsse2_la-mpatan.lo `test -f '@srcdir@/../dbl-64/mpatan.c' || echo '$(srcdir)/'`@srcdir@/../dbl-64/mpatan.c + +libsse2_la-mpexp.lo: @srcdir@/../dbl-64/mpexp.c +@am__fastdepCC_TRUE@ if $(LIBTOOL) --mode=compile $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(libsse2_la_CFLAGS) $(CFLAGS) -MT libsse2_la-mpexp.lo -MD -MP -MF "$(DEPDIR)/libsse2_la-mpexp.Tpo" -c -o libsse2_la-mpexp.lo `test -f '@srcdir@/../dbl-64/mpexp.c' || echo '$(srcdir)/'`@srcdir@/../dbl-64/mpexp.c; \ +@am__fastdepCC_TRUE@ then mv -f "$(DEPDIR)/libsse2_la-mpexp.Tpo" "$(DEPDIR)/libsse2_la-mpexp.Plo"; else rm -f "$(DEPDIR)/libsse2_la-mpexp.Tpo"; exit 1; fi +@AMDEP_TRUE@@am__fastdepCC_FALSE@ source='@srcdir@/../dbl-64/mpexp.c' object='libsse2_la-mpexp.lo' libtool=yes @AMDEPBACKSLASH@ +@AMDEP_TRUE@@am__fastdepCC_FALSE@ DEPDIR=$(DEPDIR) $(CCDEPMODE) $(depcomp) @AMDEPBACKSLASH@ +@am__fastdepCC_FALSE@ $(LIBTOOL) --mode=compile $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(libsse2_la_CFLAGS) $(CFLAGS) -c -o libsse2_la-mpexp.lo `test -f '@srcdir@/../dbl-64/mpexp.c' || echo '$(srcdir)/'`@srcdir@/../dbl-64/mpexp.c + +libsse2_la-mplog.lo: @srcdir@/../dbl-64/mplog.c +@am__fastdepCC_TRUE@ if $(LIBTOOL) --mode=compile $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(libsse2_la_CFLAGS) $(CFLAGS) -MT libsse2_la-mplog.lo -MD -MP -MF "$(DEPDIR)/libsse2_la-mplog.Tpo" -c -o libsse2_la-mplog.lo `test -f '@srcdir@/../dbl-64/mplog.c' || echo '$(srcdir)/'`@srcdir@/../dbl-64/mplog.c; \ +@am__fastdepCC_TRUE@ then mv -f "$(DEPDIR)/libsse2_la-mplog.Tpo" "$(DEPDIR)/libsse2_la-mplog.Plo"; else rm -f "$(DEPDIR)/libsse2_la-mplog.Tpo"; exit 1; fi +@AMDEP_TRUE@@am__fastdepCC_FALSE@ source='@srcdir@/../dbl-64/mplog.c' object='libsse2_la-mplog.lo' libtool=yes @AMDEPBACKSLASH@ +@AMDEP_TRUE@@am__fastdepCC_FALSE@ DEPDIR=$(DEPDIR) $(CCDEPMODE) $(depcomp) @AMDEPBACKSLASH@ +@am__fastdepCC_FALSE@ $(LIBTOOL) --mode=compile $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(libsse2_la_CFLAGS) $(CFLAGS) -c -o libsse2_la-mplog.lo `test -f '@srcdir@/../dbl-64/mplog.c' || echo '$(srcdir)/'`@srcdir@/../dbl-64/mplog.c + +libsse2_la-mpsqrt.lo: @srcdir@/../dbl-64/mpsqrt.c +@am__fastdepCC_TRUE@ if $(LIBTOOL) --mode=compile $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(libsse2_la_CFLAGS) $(CFLAGS) -MT libsse2_la-mpsqrt.lo -MD -MP -MF "$(DEPDIR)/libsse2_la-mpsqrt.Tpo" -c -o libsse2_la-mpsqrt.lo `test -f '@srcdir@/../dbl-64/mpsqrt.c' || echo '$(srcdir)/'`@srcdir@/../dbl-64/mpsqrt.c; \ +@am__fastdepCC_TRUE@ then mv -f "$(DEPDIR)/libsse2_la-mpsqrt.Tpo" "$(DEPDIR)/libsse2_la-mpsqrt.Plo"; else rm -f "$(DEPDIR)/libsse2_la-mpsqrt.Tpo"; exit 1; fi +@AMDEP_TRUE@@am__fastdepCC_FALSE@ source='@srcdir@/../dbl-64/mpsqrt.c' object='libsse2_la-mpsqrt.lo' libtool=yes @AMDEPBACKSLASH@ +@AMDEP_TRUE@@am__fastdepCC_FALSE@ DEPDIR=$(DEPDIR) $(CCDEPMODE) $(depcomp) @AMDEPBACKSLASH@ +@am__fastdepCC_FALSE@ $(LIBTOOL) --mode=compile $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(libsse2_la_CFLAGS) $(CFLAGS) -c -o libsse2_la-mpsqrt.lo `test -f '@srcdir@/../dbl-64/mpsqrt.c' || echo '$(srcdir)/'`@srcdir@/../dbl-64/mpsqrt.c + +libsse2_la-mptan.lo: @srcdir@/../dbl-64/mptan.c +@am__fastdepCC_TRUE@ if $(LIBTOOL) --mode=compile $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(libsse2_la_CFLAGS) $(CFLAGS) -MT libsse2_la-mptan.lo -MD -MP -MF "$(DEPDIR)/libsse2_la-mptan.Tpo" -c -o libsse2_la-mptan.lo `test -f '@srcdir@/../dbl-64/mptan.c' || echo '$(srcdir)/'`@srcdir@/../dbl-64/mptan.c; \ +@am__fastdepCC_TRUE@ then mv -f "$(DEPDIR)/libsse2_la-mptan.Tpo" "$(DEPDIR)/libsse2_la-mptan.Plo"; else rm -f "$(DEPDIR)/libsse2_la-mptan.Tpo"; exit 1; fi +@AMDEP_TRUE@@am__fastdepCC_FALSE@ source='@srcdir@/../dbl-64/mptan.c' object='libsse2_la-mptan.lo' libtool=yes @AMDEPBACKSLASH@ +@AMDEP_TRUE@@am__fastdepCC_FALSE@ DEPDIR=$(DEPDIR) $(CCDEPMODE) $(depcomp) @AMDEPBACKSLASH@ +@am__fastdepCC_FALSE@ $(LIBTOOL) --mode=compile $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(libsse2_la_CFLAGS) $(CFLAGS) -c -o libsse2_la-mptan.lo `test -f '@srcdir@/../dbl-64/mptan.c' || echo '$(srcdir)/'`@srcdir@/../dbl-64/mptan.c + +libsse2_la-e_pow.lo: @srcdir@/../dbl-64/e_pow.c +@am__fastdepCC_TRUE@ if $(LIBTOOL) --mode=compile $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(libsse2_la_CFLAGS) $(CFLAGS) -MT libsse2_la-e_pow.lo -MD -MP -MF "$(DEPDIR)/libsse2_la-e_pow.Tpo" -c -o libsse2_la-e_pow.lo `test -f '@srcdir@/../dbl-64/e_pow.c' || echo '$(srcdir)/'`@srcdir@/../dbl-64/e_pow.c; \ +@am__fastdepCC_TRUE@ then mv -f "$(DEPDIR)/libsse2_la-e_pow.Tpo" "$(DEPDIR)/libsse2_la-e_pow.Plo"; else rm -f "$(DEPDIR)/libsse2_la-e_pow.Tpo"; exit 1; fi +@AMDEP_TRUE@@am__fastdepCC_FALSE@ source='@srcdir@/../dbl-64/e_pow.c' object='libsse2_la-e_pow.lo' libtool=yes @AMDEPBACKSLASH@ +@AMDEP_TRUE@@am__fastdepCC_FALSE@ DEPDIR=$(DEPDIR) $(CCDEPMODE) $(depcomp) @AMDEPBACKSLASH@ +@am__fastdepCC_FALSE@ $(LIBTOOL) --mode=compile $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(libsse2_la_CFLAGS) $(CFLAGS) -c -o libsse2_la-e_pow.lo `test -f '@srcdir@/../dbl-64/e_pow.c' || echo '$(srcdir)/'`@srcdir@/../dbl-64/e_pow.c + +libsse2_la-e_rem_pio2.lo: @srcdir@/../dbl-64/e_rem_pio2.c +@am__fastdepCC_TRUE@ if $(LIBTOOL) --mode=compile $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(libsse2_la_CFLAGS) $(CFLAGS) -MT libsse2_la-e_rem_pio2.lo -MD -MP -MF "$(DEPDIR)/libsse2_la-e_rem_pio2.Tpo" -c -o libsse2_la-e_rem_pio2.lo `test -f '@srcdir@/../dbl-64/e_rem_pio2.c' || echo '$(srcdir)/'`@srcdir@/../dbl-64/e_rem_pio2.c; \ +@am__fastdepCC_TRUE@ then mv -f "$(DEPDIR)/libsse2_la-e_rem_pio2.Tpo" "$(DEPDIR)/libsse2_la-e_rem_pio2.Plo"; else rm -f "$(DEPDIR)/libsse2_la-e_rem_pio2.Tpo"; exit 1; fi +@AMDEP_TRUE@@am__fastdepCC_FALSE@ source='@srcdir@/../dbl-64/e_rem_pio2.c' object='libsse2_la-e_rem_pio2.lo' libtool=yes @AMDEPBACKSLASH@ +@AMDEP_TRUE@@am__fastdepCC_FALSE@ DEPDIR=$(DEPDIR) $(CCDEPMODE) $(depcomp) @AMDEPBACKSLASH@ +@am__fastdepCC_FALSE@ $(LIBTOOL) --mode=compile $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(libsse2_la_CFLAGS) $(CFLAGS) -c -o libsse2_la-e_rem_pio2.lo `test -f '@srcdir@/../dbl-64/e_rem_pio2.c' || echo '$(srcdir)/'`@srcdir@/../dbl-64/e_rem_pio2.c + +libsse2_la-s_sin.lo: @srcdir@/../dbl-64/s_sin.c +@am__fastdepCC_TRUE@ if $(LIBTOOL) --mode=compile $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(libsse2_la_CFLAGS) $(CFLAGS) -MT libsse2_la-s_sin.lo -MD -MP -MF "$(DEPDIR)/libsse2_la-s_sin.Tpo" -c -o libsse2_la-s_sin.lo `test -f '@srcdir@/../dbl-64/s_sin.c' || echo '$(srcdir)/'`@srcdir@/../dbl-64/s_sin.c; \ +@am__fastdepCC_TRUE@ then mv -f "$(DEPDIR)/libsse2_la-s_sin.Tpo" "$(DEPDIR)/libsse2_la-s_sin.Plo"; else rm -f "$(DEPDIR)/libsse2_la-s_sin.Tpo"; exit 1; fi +@AMDEP_TRUE@@am__fastdepCC_FALSE@ source='@srcdir@/../dbl-64/s_sin.c' object='libsse2_la-s_sin.lo' libtool=yes @AMDEPBACKSLASH@ +@AMDEP_TRUE@@am__fastdepCC_FALSE@ DEPDIR=$(DEPDIR) $(CCDEPMODE) $(depcomp) @AMDEPBACKSLASH@ +@am__fastdepCC_FALSE@ $(LIBTOOL) --mode=compile $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(libsse2_la_CFLAGS) $(CFLAGS) -c -o libsse2_la-s_sin.lo `test -f '@srcdir@/../dbl-64/s_sin.c' || echo '$(srcdir)/'`@srcdir@/../dbl-64/s_sin.c + +libsse2_la-sincos32.lo: @srcdir@/../dbl-64/sincos32.c +@am__fastdepCC_TRUE@ if $(LIBTOOL) --mode=compile $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(libsse2_la_CFLAGS) $(CFLAGS) -MT libsse2_la-sincos32.lo -MD -MP -MF "$(DEPDIR)/libsse2_la-sincos32.Tpo" -c -o libsse2_la-sincos32.lo `test -f '@srcdir@/../dbl-64/sincos32.c' || echo '$(srcdir)/'`@srcdir@/../dbl-64/sincos32.c; \ +@am__fastdepCC_TRUE@ then mv -f "$(DEPDIR)/libsse2_la-sincos32.Tpo" "$(DEPDIR)/libsse2_la-sincos32.Plo"; else rm -f "$(DEPDIR)/libsse2_la-sincos32.Tpo"; exit 1; fi +@AMDEP_TRUE@@am__fastdepCC_FALSE@ source='@srcdir@/../dbl-64/sincos32.c' object='libsse2_la-sincos32.lo' libtool=yes @AMDEPBACKSLASH@ +@AMDEP_TRUE@@am__fastdepCC_FALSE@ DEPDIR=$(DEPDIR) $(CCDEPMODE) $(depcomp) @AMDEPBACKSLASH@ +@am__fastdepCC_FALSE@ $(LIBTOOL) --mode=compile $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(libsse2_la_CFLAGS) $(CFLAGS) -c -o libsse2_la-sincos32.lo `test -f '@srcdir@/../dbl-64/sincos32.c' || echo '$(srcdir)/'`@srcdir@/../dbl-64/sincos32.c + +libsse2_la-slowexp.lo: @srcdir@/../dbl-64/slowexp.c +@am__fastdepCC_TRUE@ if $(LIBTOOL) --mode=compile $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(libsse2_la_CFLAGS) $(CFLAGS) -MT libsse2_la-slowexp.lo -MD -MP -MF "$(DEPDIR)/libsse2_la-slowexp.Tpo" -c -o libsse2_la-slowexp.lo `test -f '@srcdir@/../dbl-64/slowexp.c' || echo '$(srcdir)/'`@srcdir@/../dbl-64/slowexp.c; \ +@am__fastdepCC_TRUE@ then mv -f "$(DEPDIR)/libsse2_la-slowexp.Tpo" "$(DEPDIR)/libsse2_la-slowexp.Plo"; else rm -f "$(DEPDIR)/libsse2_la-slowexp.Tpo"; exit 1; fi +@AMDEP_TRUE@@am__fastdepCC_FALSE@ source='@srcdir@/../dbl-64/slowexp.c' object='libsse2_la-slowexp.lo' libtool=yes @AMDEPBACKSLASH@ +@AMDEP_TRUE@@am__fastdepCC_FALSE@ DEPDIR=$(DEPDIR) $(CCDEPMODE) $(depcomp) @AMDEPBACKSLASH@ +@am__fastdepCC_FALSE@ $(LIBTOOL) --mode=compile $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(libsse2_la_CFLAGS) $(CFLAGS) -c -o libsse2_la-slowexp.lo `test -f '@srcdir@/../dbl-64/slowexp.c' || echo '$(srcdir)/'`@srcdir@/../dbl-64/slowexp.c + +libsse2_la-slowpow.lo: @srcdir@/../dbl-64/slowpow.c +@am__fastdepCC_TRUE@ if $(LIBTOOL) --mode=compile $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(libsse2_la_CFLAGS) $(CFLAGS) -MT libsse2_la-slowpow.lo -MD -MP -MF "$(DEPDIR)/libsse2_la-slowpow.Tpo" -c -o libsse2_la-slowpow.lo `test -f '@srcdir@/../dbl-64/slowpow.c' || echo '$(srcdir)/'`@srcdir@/../dbl-64/slowpow.c; \ +@am__fastdepCC_TRUE@ then mv -f "$(DEPDIR)/libsse2_la-slowpow.Tpo" "$(DEPDIR)/libsse2_la-slowpow.Plo"; else rm -f "$(DEPDIR)/libsse2_la-slowpow.Tpo"; exit 1; fi +@AMDEP_TRUE@@am__fastdepCC_FALSE@ source='@srcdir@/../dbl-64/slowpow.c' object='libsse2_la-slowpow.lo' libtool=yes @AMDEPBACKSLASH@ +@AMDEP_TRUE@@am__fastdepCC_FALSE@ DEPDIR=$(DEPDIR) $(CCDEPMODE) $(depcomp) @AMDEPBACKSLASH@ +@am__fastdepCC_FALSE@ $(LIBTOOL) --mode=compile $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(libsse2_la_CFLAGS) $(CFLAGS) -c -o libsse2_la-slowpow.lo `test -f '@srcdir@/../dbl-64/slowpow.c' || echo '$(srcdir)/'`@srcdir@/../dbl-64/slowpow.c + +libsse2_la-e_sqrt.lo: @srcdir@/../dbl-64/e_sqrt.c +@am__fastdepCC_TRUE@ if $(LIBTOOL) --mode=compile $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(libsse2_la_CFLAGS) $(CFLAGS) -MT libsse2_la-e_sqrt.lo -MD -MP -MF "$(DEPDIR)/libsse2_la-e_sqrt.Tpo" -c -o libsse2_la-e_sqrt.lo `test -f '@srcdir@/../dbl-64/e_sqrt.c' || echo '$(srcdir)/'`@srcdir@/../dbl-64/e_sqrt.c; \ +@am__fastdepCC_TRUE@ then mv -f "$(DEPDIR)/libsse2_la-e_sqrt.Tpo" "$(DEPDIR)/libsse2_la-e_sqrt.Plo"; else rm -f "$(DEPDIR)/libsse2_la-e_sqrt.Tpo"; exit 1; fi +@AMDEP_TRUE@@am__fastdepCC_FALSE@ source='@srcdir@/../dbl-64/e_sqrt.c' object='libsse2_la-e_sqrt.lo' libtool=yes @AMDEPBACKSLASH@ +@AMDEP_TRUE@@am__fastdepCC_FALSE@ DEPDIR=$(DEPDIR) $(CCDEPMODE) $(depcomp) @AMDEPBACKSLASH@ +@am__fastdepCC_FALSE@ $(LIBTOOL) --mode=compile $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(libsse2_la_CFLAGS) $(CFLAGS) -c -o libsse2_la-e_sqrt.lo `test -f '@srcdir@/../dbl-64/e_sqrt.c' || echo '$(srcdir)/'`@srcdir@/../dbl-64/e_sqrt.c + +libsse2_la-s_tan.lo: @srcdir@/../dbl-64/s_tan.c +@am__fastdepCC_TRUE@ if $(LIBTOOL) --mode=compile $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(libsse2_la_CFLAGS) $(CFLAGS) -MT libsse2_la-s_tan.lo -MD -MP -MF "$(DEPDIR)/libsse2_la-s_tan.Tpo" -c -o libsse2_la-s_tan.lo `test -f '@srcdir@/../dbl-64/s_tan.c' || echo '$(srcdir)/'`@srcdir@/../dbl-64/s_tan.c; \ +@am__fastdepCC_TRUE@ then mv -f "$(DEPDIR)/libsse2_la-s_tan.Tpo" "$(DEPDIR)/libsse2_la-s_tan.Plo"; else rm -f "$(DEPDIR)/libsse2_la-s_tan.Tpo"; exit 1; fi +@AMDEP_TRUE@@am__fastdepCC_FALSE@ source='@srcdir@/../dbl-64/s_tan.c' object='libsse2_la-s_tan.lo' libtool=yes @AMDEPBACKSLASH@ +@AMDEP_TRUE@@am__fastdepCC_FALSE@ DEPDIR=$(DEPDIR) $(CCDEPMODE) $(depcomp) @AMDEPBACKSLASH@ +@am__fastdepCC_FALSE@ $(LIBTOOL) --mode=compile $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(libsse2_la_CFLAGS) $(CFLAGS) -c -o libsse2_la-s_tan.lo `test -f '@srcdir@/../dbl-64/s_tan.c' || echo '$(srcdir)/'`@srcdir@/../dbl-64/s_tan.c + +libsse2_la-s_scalbn.lo: @srcdir@/../dbl-64/s_scalbn.c +@am__fastdepCC_TRUE@ if $(LIBTOOL) --mode=compile $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(libsse2_la_CFLAGS) $(CFLAGS) -MT libsse2_la-s_scalbn.lo -MD -MP -MF "$(DEPDIR)/libsse2_la-s_scalbn.Tpo" -c -o libsse2_la-s_scalbn.lo `test -f '@srcdir@/../dbl-64/s_scalbn.c' || echo '$(srcdir)/'`@srcdir@/../dbl-64/s_scalbn.c; \ +@am__fastdepCC_TRUE@ then mv -f "$(DEPDIR)/libsse2_la-s_scalbn.Tpo" "$(DEPDIR)/libsse2_la-s_scalbn.Plo"; else rm -f "$(DEPDIR)/libsse2_la-s_scalbn.Tpo"; exit 1; fi +@AMDEP_TRUE@@am__fastdepCC_FALSE@ source='@srcdir@/../dbl-64/s_scalbn.c' object='libsse2_la-s_scalbn.lo' libtool=yes @AMDEPBACKSLASH@ +@AMDEP_TRUE@@am__fastdepCC_FALSE@ DEPDIR=$(DEPDIR) $(CCDEPMODE) $(depcomp) @AMDEPBACKSLASH@ +@am__fastdepCC_FALSE@ $(LIBTOOL) --mode=compile $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(libsse2_la_CFLAGS) $(CFLAGS) -c -o libsse2_la-s_scalbn.lo `test -f '@srcdir@/../dbl-64/s_scalbn.c' || echo '$(srcdir)/'`@srcdir@/../dbl-64/s_scalbn.c + +libsse2_la-s_floor.lo: @srcdir@/../dbl-64/s_floor.c +@am__fastdepCC_TRUE@ if $(LIBTOOL) --mode=compile $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(libsse2_la_CFLAGS) $(CFLAGS) -MT libsse2_la-s_floor.lo -MD -MP -MF "$(DEPDIR)/libsse2_la-s_floor.Tpo" -c -o libsse2_la-s_floor.lo `test -f '@srcdir@/../dbl-64/s_floor.c' || echo '$(srcdir)/'`@srcdir@/../dbl-64/s_floor.c; \ +@am__fastdepCC_TRUE@ then mv -f "$(DEPDIR)/libsse2_la-s_floor.Tpo" "$(DEPDIR)/libsse2_la-s_floor.Plo"; else rm -f "$(DEPDIR)/libsse2_la-s_floor.Tpo"; exit 1; fi +@AMDEP_TRUE@@am__fastdepCC_FALSE@ source='@srcdir@/../dbl-64/s_floor.c' object='libsse2_la-s_floor.lo' libtool=yes @AMDEPBACKSLASH@ +@AMDEP_TRUE@@am__fastdepCC_FALSE@ DEPDIR=$(DEPDIR) $(CCDEPMODE) $(depcomp) @AMDEPBACKSLASH@ +@am__fastdepCC_FALSE@ $(LIBTOOL) --mode=compile $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(libsse2_la_CFLAGS) $(CFLAGS) -c -o libsse2_la-s_floor.lo `test -f '@srcdir@/../dbl-64/s_floor.c' || echo '$(srcdir)/'`@srcdir@/../dbl-64/s_floor.c + +libsse2_la-s_isinf.lo: @srcdir@/../dbl-64/s_isinf.c +@am__fastdepCC_TRUE@ if $(LIBTOOL) --mode=compile $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(libsse2_la_CFLAGS) $(CFLAGS) -MT libsse2_la-s_isinf.lo -MD -MP -MF "$(DEPDIR)/libsse2_la-s_isinf.Tpo" -c -o libsse2_la-s_isinf.lo `test -f '@srcdir@/../dbl-64/s_isinf.c' || echo '$(srcdir)/'`@srcdir@/../dbl-64/s_isinf.c; \ +@am__fastdepCC_TRUE@ then mv -f "$(DEPDIR)/libsse2_la-s_isinf.Tpo" "$(DEPDIR)/libsse2_la-s_isinf.Plo"; else rm -f "$(DEPDIR)/libsse2_la-s_isinf.Tpo"; exit 1; fi +@AMDEP_TRUE@@am__fastdepCC_FALSE@ source='@srcdir@/../dbl-64/s_isinf.c' object='libsse2_la-s_isinf.lo' libtool=yes @AMDEPBACKSLASH@ +@AMDEP_TRUE@@am__fastdepCC_FALSE@ DEPDIR=$(DEPDIR) $(CCDEPMODE) $(depcomp) @AMDEPBACKSLASH@ +@am__fastdepCC_FALSE@ $(LIBTOOL) --mode=compile $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(libsse2_la_CFLAGS) $(CFLAGS) -c -o libsse2_la-s_isinf.lo `test -f '@srcdir@/../dbl-64/s_isinf.c' || echo '$(srcdir)/'`@srcdir@/../dbl-64/s_isinf.c + +mostlyclean-libtool: + -rm -f *.lo + +clean-libtool: + -rm -rf .libs _libs + +distclean-libtool: + -rm -f libtool +uninstall-info-am: + +ID: $(HEADERS) $(SOURCES) $(LISP) $(TAGS_FILES) + list='$(SOURCES) $(HEADERS) $(LISP) $(TAGS_FILES)'; \ + unique=`for i in $$list; do \ + if test -f "$$i"; then echo $$i; else echo $(srcdir)/$$i; fi; \ + done | \ + $(AWK) ' { files[$$0] = 1; } \ + END { for (i in files) print i; }'`; \ + mkid -fID $$unique +tags: TAGS + +TAGS: $(HEADERS) $(SOURCES) $(TAGS_DEPENDENCIES) \ + $(TAGS_FILES) $(LISP) + tags=; \ + here=`pwd`; \ + list='$(SOURCES) $(HEADERS) $(LISP) $(TAGS_FILES)'; \ + unique=`for i in $$list; do \ + if test -f "$$i"; then echo $$i; else echo $(srcdir)/$$i; fi; \ + done | \ + $(AWK) ' { files[$$0] = 1; } \ + END { for (i in files) print i; }'`; \ + if test -z "$(ETAGS_ARGS)$$tags$$unique"; then :; else \ + test -n "$$unique" || unique=$$empty_fix; \ + $(ETAGS) $(ETAGSFLAGS) $(AM_ETAGSFLAGS) $(ETAGS_ARGS) \ + $$tags $$unique; \ + fi +ctags: CTAGS +CTAGS: $(HEADERS) $(SOURCES) $(TAGS_DEPENDENCIES) \ + $(TAGS_FILES) $(LISP) + tags=; \ + here=`pwd`; \ + list='$(SOURCES) $(HEADERS) $(LISP) $(TAGS_FILES)'; \ + unique=`for i in $$list; do \ + if test -f "$$i"; then echo $$i; else echo $(srcdir)/$$i; fi; \ + done | \ + $(AWK) ' { files[$$0] = 1; } \ + END { for (i in files) print i; }'`; \ + test -z "$(CTAGS_ARGS)$$tags$$unique" \ + || $(CTAGS) $(CTAGSFLAGS) $(AM_CTAGSFLAGS) $(CTAGS_ARGS) \ + $$tags $$unique + +GTAGS: + here=`$(am__cd) $(top_builddir) && pwd` \ + && cd $(top_srcdir) \ + && gtags -i $(GTAGS_ARGS) $$here + +distclean-tags: + -rm -f TAGS ID GTAGS GRTAGS GSYMS GPATH tags + +distdir: $(DISTFILES) + @srcdirstrip=`echo "$(srcdir)" | sed 's|.|.|g'`; \ + topsrcdirstrip=`echo "$(top_srcdir)" | sed 's|.|.|g'`; \ + list='$(DISTFILES)'; for file in $$list; do \ + case $$file in \ + $(srcdir)/*) file=`echo "$$file" | sed "s|^$$srcdirstrip/||"`;; \ + $(top_srcdir)/*) file=`echo "$$file" | sed "s|^$$topsrcdirstrip/|$(top_builddir)/|"`;; \ + esac; \ + if test -f $$file || test -d $$file; then d=.; else d=$(srcdir); fi; \ + dir=`echo "$$file" | sed -e 's,/[^/]*$$,,'`; \ + if test "$$dir" != "$$file" && test "$$dir" != "."; then \ + dir="/$$dir"; \ + $(mkdir_p) "$(distdir)$$dir"; \ + else \ + dir=''; \ + fi; \ + if test -d $$d/$$file; then \ + if test -d $(srcdir)/$$file && test $$d != $(srcdir); then \ + cp -pR $(srcdir)/$$file $(distdir)$$dir || exit 1; \ + fi; \ + cp -pR $$d/$$file $(distdir)$$dir || exit 1; \ + else \ + test -f $(distdir)/$$file \ + || cp -p $$d/$$file $(distdir)/$$file \ + || exit 1; \ + fi; \ + done +check-am: all-am +check: check-am +all-am: Makefile $(LTLIBRARIES) +installdirs: +install: install-am +install-exec: install-exec-am +install-data: install-data-am +uninstall: uninstall-am + +install-am: all-am + @$(MAKE) $(AM_MAKEFLAGS) install-exec-am install-data-am + +installcheck: installcheck-am +install-strip: + $(MAKE) $(AM_MAKEFLAGS) INSTALL_PROGRAM="$(INSTALL_STRIP_PROGRAM)" \ + install_sh_PROGRAM="$(INSTALL_STRIP_PROGRAM)" INSTALL_STRIP_FLAG=-s \ + `test -z '$(STRIP)' || \ + echo "INSTALL_PROGRAM_ENV=STRIPPROG='$(STRIP)'"` install +mostlyclean-generic: + +clean-generic: + +distclean-generic: + -test -z "$(CONFIG_CLEAN_FILES)" || rm -f $(CONFIG_CLEAN_FILES) + +maintainer-clean-generic: + @echo "This command is intended for maintainers to use" + @echo "it deletes files that may require special tools to rebuild." +clean: clean-am + +clean-am: clean-generic clean-libtool clean-noinstLTLIBRARIES \ + mostlyclean-am + +distclean: distclean-am + -rm -rf ./$(DEPDIR) + -rm -f Makefile +distclean-am: clean-am distclean-compile distclean-generic \ + distclean-libtool distclean-tags + +dvi: dvi-am + +dvi-am: + +html: html-am + +info: info-am + +info-am: + +install-data-am: + +install-exec-am: + +install-info: install-info-am + +install-man: + +installcheck-am: + +maintainer-clean: maintainer-clean-am + -rm -rf ./$(DEPDIR) + -rm -f Makefile +maintainer-clean-am: distclean-am maintainer-clean-generic + +mostlyclean: mostlyclean-am + +mostlyclean-am: mostlyclean-compile mostlyclean-generic \ + mostlyclean-libtool + +pdf: pdf-am + +pdf-am: + +ps: ps-am + +ps-am: + +uninstall-am: uninstall-info-am + +.PHONY: CTAGS GTAGS all all-am check check-am clean clean-generic \ + clean-libtool clean-noinstLTLIBRARIES ctags distclean \ + distclean-compile distclean-generic distclean-libtool \ + distclean-tags distdir dvi dvi-am html html-am info info-am \ + install install-am install-data install-data-am install-exec \ + install-exec-am install-info install-info-am install-man \ + install-strip installcheck installcheck-am installdirs \ + maintainer-clean maintainer-clean-generic mostlyclean \ + mostlyclean-compile mostlyclean-generic mostlyclean-libtool \ + pdf pdf-am ps ps-am tags uninstall uninstall-am \ + uninstall-info-am + +# Tell versions [3.59,3.63) of GNU make to not export all variables. +# Otherwise a system limit (for SysV at least) may be exceeded. +.NOEXPORT: diff --git a/libgcc-math/i386/endian.h b/libgcc-math/i386/endian.h new file mode 100644 index 00000000000..4dec8beb200 --- /dev/null +++ b/libgcc-math/i386/endian.h @@ -0,0 +1,57 @@ +/* endian.h file crafted from relevant parts of libc include/endian.h + string/endian.h and arch-specific bits/endian.h. + Copyright (C) 2006 Free Software Foundation, Inc. + +This file is part of GCC. + +GCC is free software; you can redistribute it and/or modify it under +the terms of the GNU General Public License as published by the Free +Software Foundation; either version 2, or (at your option) any later +version. + +In addition to the permissions in the GNU General Public License, the +Free Software Foundation gives you unlimited permission to link the +compiled version of this file into combinations with other programs, +and to distribute those combinations without any restriction coming +from the use of this file. (The General Public License restrictions +do apply in other respects; for example, they cover modification of +the file, and distribution when not linked into a combine +executable.) + +GCC is distributed in the hope that it will be useful, but WITHOUT ANY +WARRANTY; without even the implied warranty of MERCHANTABILITY or +FITNESS FOR A PARTICULAR PURPOSE. See the GNU General Public License +for more details. + +You should have received a copy of the GNU General Public License +along with GCC; see the file COPYING. If not, write to the Free +Software Foundation, 51 Franklin Street, Fifth Floor, Boston, MA +02110-1301, USA. */ + +#ifndef LIBGCCM_ENDIAN_H +#define LIBGCCM_ENDIAN_H + +#define __BIG_ENDIAN 4321 +#define __LITTLE_ENDIAN 1234 +#define BIG_ENDIAN 4321 +#define LITTLE_ENDIAN 1234 + +/* Change this. */ +#define __FLOAT_WORD_ORDER 1234 +#define __BYTE_ORDER 1234 + +#if __FLOAT_WORD_ORDER == BIG_ENDIAN +# define BIG_ENDI 1 +# undef LITTLE_ENDI +# define HIGH_HALF 0 +# define LOW_HALF 1 +#else +# if __FLOAT_WORD_ORDER == LITTLE_ENDIAN +# undef BIG_ENDI +# define LITTLE_ENDI 1 +# define HIGH_HALF 1 +# define LOW_HALF 0 +# endif +#endif + +#endif diff --git a/libgcc-math/i386/sse2.h b/libgcc-math/i386/sse2.h new file mode 100644 index 00000000000..30428827a8a --- /dev/null +++ b/libgcc-math/i386/sse2.h @@ -0,0 +1,94 @@ +/* This re-writes the math routines in flt-32 and dbl-64 to have their + exported symbols prefix with __libm_sse2 for an SSE2 ABI implementation. + Copyright (C) 2006 Free Software Foundation, Inc. + +This file is part of GCC. + +GCC is free software; you can redistribute it and/or modify it under +the terms of the GNU General Public License as published by the Free +Software Foundation; either version 2, or (at your option) any later +version. + +In addition to the permissions in the GNU General Public License, the +Free Software Foundation gives you unlimited permission to link the +compiled version of this file into combinations with other programs, +and to distribute those combinations without any restriction coming +from the use of this file. (The General Public License restrictions +do apply in other respects; for example, they cover modification of +the file, and distribution when not linked into a combine +executable.) + +GCC is distributed in the hope that it will be useful, but WITHOUT ANY +WARRANTY; without even the implied warranty of MERCHANTABILITY or +FITNESS FOR A PARTICULAR PURPOSE. See the GNU General Public License +for more details. + +You should have received a copy of the GNU General Public License +along with GCC; see the file COPYING. If not, write to the Free +Software Foundation, 51 Franklin Street, Fifth Floor, Boston, MA +02110-1301, USA. */ + +#include "libc-symbols.h" + +#undef weak_alias +#undef strong_alias +#undef hidden_def +#define weak_alias(a,b) +#define strong_alias(a,b) +#define hidden_def(a) + +/* s_atanf.c */ +#define __atanf __libm_sse2_atanf + +/* e_asinf.c */ +#define __ieee754_acosf __libm_sse2_acosf +#define __ieee754_asinf __libm_sse2_asinf + +/* e_atan2f.c */ +#define __ieee754_atan2f __libm_sse2_atan2f +#define __ieee754_expf __libm_sse2_expf + +/* e_log10f.c */ +#define __ieee754_log10f __libm_sse2_log10f + +/* e_logf.c */ +#define __ieee754_logf __libm_sse2_logf + +/* e_powf.c */ +#define __ieee754_powf __libm_sse2_powf + +/* s_sinf.c */ +#define __sinf __libm_sse2_sinf +#define __cosf __libm_sse2_cosf + +/* s_tanf.c */ +#define __tanf __libm_sse2_tanf + +/* s_atan.c */ +#define atan __libm_sse2_atan + +/* e_asin.c */ +#define __ieee754_acos __libm_sse2_acos +#define __ieee754_asin __libm_sse2_asin + +/* e_atan2.c */ +#define __ieee754_atan2 __libm_sse2_atan2 + +/* e_exp.c */ +#define __ieee754_exp __libm_sse2_exp + +/* e_log10.c */ +#define __ieee754_log10 __libm_sse2_log10 + +/* e_log.c */ +#define __ieee754_log __libm_sse2_log + +/* e_pow.c */ +#define __ieee754_pow __libm_sse2_pow + +/* s_sin.c */ +#define __cos __libm_sse2_cos +#define __sin __libm_sse2_sin + +/* s_tan.c */ +#define tan __libm_sse2_tan diff --git a/libgcc-math/i386/sse2.map b/libgcc-math/i386/sse2.map new file mode 100644 index 00000000000..735469a28ce --- /dev/null +++ b/libgcc-math/i386/sse2.map @@ -0,0 +1,11 @@ +LIBGCC_MATH_1.0 { + global: + __libm_sse2_acos; __libm_sse2_asin; __libm_sse2_atan2; __libm_sse2_atan; + __libm_sse2_exp; __libm_sse2_log; __libm_sse2_log10; __libm_sse2_log; + __libm_sse2_pow; __libm_sse2_cos; __libm_sse2_sin; __libm_sse2_tan; + __libm_sse2_acosf; __libm_sse2_asinf; __libm_sse2_atan2f; + __libm_sse2_atanf; __libm_sse2_cosf; __libm_sse2_expf; __libm_sse2_log10f; + __libm_sse2_logf; __libm_sse2_powf; __libm_sse2_sinf; __libm_sse2_tanf; + local: + *; +}; diff --git a/libgcc-math/include/ieee754.h b/libgcc-math/include/ieee754.h new file mode 100644 index 00000000000..30b1ac50c2d --- /dev/null +++ b/libgcc-math/include/ieee754.h @@ -0,0 +1,136 @@ +/* Copyright (C) 1992, 1995, 1996, 1999, 2006 Free Software Foundation, Inc. + +This file is part of GCC. + +GCC is free software; you can redistribute it and/or modify it under +the terms of the GNU General Public License as published by the Free +Software Foundation; either version 2, or (at your option) any later +version. + +In addition to the permissions in the GNU General Public License, the +Free Software Foundation gives you unlimited permission to link the +compiled version of this file into combinations with other programs, +and to distribute those combinations without any restriction coming +from the use of this file. (The General Public License restrictions +do apply in other respects; for example, they cover modification of +the file, and distribution when not linked into a combine +executable.) + +GCC is distributed in the hope that it will be useful, but WITHOUT ANY +WARRANTY; without even the implied warranty of MERCHANTABILITY or +FITNESS FOR A PARTICULAR PURPOSE. See the GNU General Public License +for more details. + +You should have received a copy of the GNU General Public License +along with GCC; see the file COPYING. If not, write to the Free +Software Foundation, 51 Franklin Street, Fifth Floor, Boston, MA +02110-1301, USA. */ + +#ifndef _IEEE754_H + +#define _IEEE754_H 1 +#include + +union ieee754_float + { + float f; + + /* This is the IEEE 754 single-precision format. */ + struct + { +#if __BYTE_ORDER == __BIG_ENDIAN + unsigned int negative:1; + unsigned int exponent:8; + unsigned int mantissa:23; +#endif /* Big endian. */ +#if __BYTE_ORDER == __LITTLE_ENDIAN + unsigned int mantissa:23; + unsigned int exponent:8; + unsigned int negative:1; +#endif /* Little endian. */ + } ieee; + + /* This format makes it easier to see if a NaN is a signalling NaN. */ + struct + { +#if __BYTE_ORDER == __BIG_ENDIAN + unsigned int negative:1; + unsigned int exponent:8; + unsigned int quiet_nan:1; + unsigned int mantissa:22; +#endif /* Big endian. */ +#if __BYTE_ORDER == __LITTLE_ENDIAN + unsigned int mantissa:22; + unsigned int quiet_nan:1; + unsigned int exponent:8; + unsigned int negative:1; +#endif /* Little endian. */ + } ieee_nan; + }; + +#define IEEE754_FLOAT_BIAS 0x7f /* Added to exponent. */ + + +union ieee754_double + { + double d; + + /* This is the IEEE 754 double-precision format. */ + struct + { +#if __BYTE_ORDER == __BIG_ENDIAN + unsigned int negative:1; + unsigned int exponent:11; + /* Together these comprise the mantissa. */ + unsigned int mantissa0:20; + unsigned int mantissa1:32; +#endif /* Big endian. */ +#if __BYTE_ORDER == __LITTLE_ENDIAN +# if __FLOAT_WORD_ORDER == BIG_ENDIAN + unsigned int mantissa0:20; + unsigned int exponent:11; + unsigned int negative:1; + unsigned int mantissa1:32; +# else + /* Together these comprise the mantissa. */ + unsigned int mantissa1:32; + unsigned int mantissa0:20; + unsigned int exponent:11; + unsigned int negative:1; +# endif +#endif /* Little endian. */ + } ieee; + + /* This format makes it easier to see if a NaN is a signalling NaN. */ + struct + { +#if __BYTE_ORDER == __BIG_ENDIAN + unsigned int negative:1; + unsigned int exponent:11; + unsigned int quiet_nan:1; + /* Together these comprise the mantissa. */ + unsigned int mantissa0:19; + unsigned int mantissa1:32; +#else +# if __FLOAT_WORD_ORDER == BIG_ENDIAN + unsigned int mantissa0:19; + unsigned int quiet_nan:1; + unsigned int exponent:11; + unsigned int negative:1; + unsigned int mantissa1:32; +# else + /* Together these comprise the mantissa. */ + unsigned int mantissa1:32; + unsigned int mantissa0:19; + unsigned int quiet_nan:1; + unsigned int exponent:11; + unsigned int negative:1; +# endif +#endif + } ieee_nan; + }; + +#define IEEE754_DOUBLE_BIAS 0x3ff /* Added to exponent. */ + + +#endif /* ieee754.h */ diff --git a/libgcc-math/include/libc-symbols.h b/libgcc-math/include/libc-symbols.h new file mode 100644 index 00000000000..6d616143456 --- /dev/null +++ b/libgcc-math/include/libc-symbols.h @@ -0,0 +1,50 @@ +/* Definitions for symbol handling done by flt-32 and dbl-64 sources. +Copyright (C) 2006 Free Software Foundation, Inc. + +This file is part of GCC. + +GCC is free software; you can redistribute it and/or modify it under +the terms of the GNU General Public License as published by the Free +Software Foundation; either version 2, or (at your option) any later +version. + +In addition to the permissions in the GNU General Public License, the +Free Software Foundation gives you unlimited permission to link the +compiled version of this file into combinations with other programs, +and to distribute those combinations without any restriction coming +from the use of this file. (The General Public License restrictions +do apply in other respects; for example, they cover modification of +the file, and distribution when not linked into a combine +executable.) + +GCC is distributed in the hope that it will be useful, but WITHOUT ANY +WARRANTY; without even the implied warranty of MERCHANTABILITY or +FITNESS FOR A PARTICULAR PURPOSE. See the GNU General Public License +for more details. + +You should have received a copy of the GNU General Public License +along with GCC; see the file COPYING. If not, write to the Free +Software Foundation, 51 Franklin Street, Fifth Floor, Boston, MA +02110-1301, USA. */ + + +/* Define ALIASNAME as a strong alias for NAME. */ +# define strong_alias(name, aliasname) _strong_alias(name, aliasname) +# define _strong_alias(name, aliasname) \ + extern __typeof (name) aliasname __attribute__ ((alias (#name))); + +/* This comes between the return type and function name in + a function definition to make that definition weak. */ +# define weak_function __attribute__ ((weak)) +# define weak_const_function __attribute__ ((weak, __const__)) + +/* Define ALIASNAME as a weak alias for NAME. + If weak aliases are not available, this defines a strong alias. */ +# define weak_alias(name, aliasname) _weak_alias (name, aliasname) +# define _weak_alias(name, aliasname) \ + extern __typeof (name) aliasname __attribute__ ((weak, alias (#name))); + +/* Declare SYMBOL as weak undefined symbol (resolved to 0 if not defined). */ +# define weak_extern(symbol) _weak_extern (weak symbol) +# define _weak_extern(expr) _Pragma (#expr) + diff --git a/libgcc-math/include/math_private.h b/libgcc-math/include/math_private.h new file mode 100644 index 00000000000..413a0a81f6c --- /dev/null +++ b/libgcc-math/include/math_private.h @@ -0,0 +1,322 @@ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ + +/* + * from: @(#)fdlibm.h 5.1 93/09/24 + * $Id: math_private.h,v 1.18 2003/08/28 00:10:15 drepper Exp $ + */ + +#ifndef _MATH_PRIVATE_H_ +#define _MATH_PRIVATE_H_ + +#include +#include + +/* The original fdlibm code used statements like: + n0 = ((*(int*)&one)>>29)^1; * index of high word * + ix0 = *(n0+(int*)&x); * high word of x * + ix1 = *((1-n0)+(int*)&x); * low word of x * + to dig two 32 bit words out of the 64 bit IEEE floating point + value. That is non-ANSI, and, moreover, the gcc instruction + scheduler gets it wrong. We instead use the following macros. + Unlike the original code, we determine the endianness at compile + time, not at run time; I don't see much benefit to selecting + endianness at run time. */ + +/* A union which permits us to convert between a double and two 32 bit + ints. */ + +#if __FLOAT_WORD_ORDER == BIG_ENDIAN + +typedef union +{ + double value; + struct + { + u_int32_t msw; + u_int32_t lsw; + } parts; +} ieee_double_shape_type; + +#endif + +#if __FLOAT_WORD_ORDER == LITTLE_ENDIAN + +typedef union +{ + double value; + struct + { + u_int32_t lsw; + u_int32_t msw; + } parts; +} ieee_double_shape_type; + +#endif + +/* Get two 32 bit ints from a double. */ + +#define EXTRACT_WORDS(ix0,ix1,d) \ +do { \ + ieee_double_shape_type ew_u; \ + ew_u.value = (d); \ + (ix0) = ew_u.parts.msw; \ + (ix1) = ew_u.parts.lsw; \ +} while (0) + +/* Get the more significant 32 bit int from a double. */ + +#define GET_HIGH_WORD(i,d) \ +do { \ + ieee_double_shape_type gh_u; \ + gh_u.value = (d); \ + (i) = gh_u.parts.msw; \ +} while (0) + +/* Get the less significant 32 bit int from a double. */ + +#define GET_LOW_WORD(i,d) \ +do { \ + ieee_double_shape_type gl_u; \ + gl_u.value = (d); \ + (i) = gl_u.parts.lsw; \ +} while (0) + +/* Set a double from two 32 bit ints. */ + +#define INSERT_WORDS(d,ix0,ix1) \ +do { \ + ieee_double_shape_type iw_u; \ + iw_u.parts.msw = (ix0); \ + iw_u.parts.lsw = (ix1); \ + (d) = iw_u.value; \ +} while (0) + +/* Set the more significant 32 bits of a double from an int. */ + +#define SET_HIGH_WORD(d,v) \ +do { \ + ieee_double_shape_type sh_u; \ + sh_u.value = (d); \ + sh_u.parts.msw = (v); \ + (d) = sh_u.value; \ +} while (0) + +/* Set the less significant 32 bits of a double from an int. */ + +#define SET_LOW_WORD(d,v) \ +do { \ + ieee_double_shape_type sl_u; \ + sl_u.value = (d); \ + sl_u.parts.lsw = (v); \ + (d) = sl_u.value; \ +} while (0) + +/* A union which permits us to convert between a float and a 32 bit + int. */ + +typedef union +{ + float value; + u_int32_t word; +} ieee_float_shape_type; + +/* Get a 32 bit int from a float. */ + +#define GET_FLOAT_WORD(i,d) \ +do { \ + ieee_float_shape_type gf_u; \ + gf_u.value = (d); \ + (i) = gf_u.word; \ +} while (0) + +/* Set a float from a 32 bit int. */ + +#define SET_FLOAT_WORD(d,i) \ +do { \ + ieee_float_shape_type sf_u; \ + sf_u.word = (i); \ + (d) = sf_u.value; \ +} while (0) + +/* Get long double macros from a separate header. Not. */ +#define NO_LONG_DOUBLE + +/* ieee style elementary functions */ +extern double __ieee754_sqrt (double); +extern double __ieee754_acos (double); +extern double __ieee754_acosh (double); +extern double __ieee754_log (double); +extern double __ieee754_atanh (double); +extern double __ieee754_asin (double); +extern double __ieee754_atan2 (double,double); +extern double __ieee754_exp (double); +extern double __ieee754_exp2 (double); +extern double __ieee754_exp10 (double); +extern double __ieee754_cosh (double); +extern double __ieee754_fmod (double,double); +extern double __ieee754_pow (double,double); +extern double __ieee754_lgamma_r (double,int *); +extern double __ieee754_gamma_r (double,int *); +extern double __ieee754_lgamma (double); +extern double __ieee754_gamma (double); +extern double __ieee754_log10 (double); +extern double __ieee754_log2 (double); +extern double __ieee754_sinh (double); +extern double __ieee754_hypot (double,double); +extern double __ieee754_j0 (double); +extern double __ieee754_j1 (double); +extern double __ieee754_y0 (double); +extern double __ieee754_y1 (double); +extern double __ieee754_jn (int,double); +extern double __ieee754_yn (int,double); +extern double __ieee754_remainder (double,double); +extern int32_t __ieee754_rem_pio2 (double,double*); +extern double __ieee754_scalb (double,double); + +/* fdlibm kernel function */ +extern double __kernel_standard (double,double,int); +extern double __kernel_sin (double,double,int); +extern double __kernel_cos (double,double); +extern double __kernel_tan (double,double,int); +extern int __kernel_rem_pio2 (double*,double*,int,int,int, const int32_t*); + +/* internal functions. */ +extern double __copysign (double x, double __y); + + +/* ieee style elementary float functions */ +extern float __ieee754_sqrtf (float); +extern float __ieee754_acosf (float); +extern float __ieee754_acoshf (float); +extern float __ieee754_logf (float); +extern float __ieee754_atanhf (float); +extern float __ieee754_asinf (float); +extern float __ieee754_atan2f (float,float); +extern float __ieee754_expf (float); +extern float __ieee754_exp2f (float); +extern float __ieee754_exp10f (float); +extern float __ieee754_coshf (float); +extern float __ieee754_fmodf (float,float); +extern float __ieee754_powf (float,float); +extern float __ieee754_lgammaf_r (float,int *); +extern float __ieee754_gammaf_r (float,int *); +extern float __ieee754_lgammaf (float); +extern float __ieee754_gammaf (float); +extern float __ieee754_log10f (float); +extern float __ieee754_log2f (float); +extern float __ieee754_sinhf (float); +extern float __ieee754_hypotf (float,float); +extern float __ieee754_j0f (float); +extern float __ieee754_j1f (float); +extern float __ieee754_y0f (float); +extern float __ieee754_y1f (float); +extern float __ieee754_jnf (int,float); +extern float __ieee754_ynf (int,float); +extern float __ieee754_remainderf (float,float); +extern int32_t __ieee754_rem_pio2f (float,float*); +extern float __ieee754_scalbf (float,float); + + +/* float versions of fdlibm kernel functions */ +extern float __kernel_sinf (float,float,int); +extern float __kernel_cosf (float,float); +extern float __kernel_tanf (float,float,int); +extern int __kernel_rem_pio2f (float*,float*,int,int,int, const int32_t*); + +/* internal functions. */ +extern float __copysignf (float x, float __y); + + +/* ieee style elementary long double functions */ +extern long double __ieee754_sqrtl (long double); +extern long double __ieee754_acosl (long double); +extern long double __ieee754_acoshl (long double); +extern long double __ieee754_logl (long double); +extern long double __ieee754_atanhl (long double); +extern long double __ieee754_asinl (long double); +extern long double __ieee754_atan2l (long double,long double); +extern long double __ieee754_expl (long double); +extern long double __ieee754_exp2l (long double); +extern long double __ieee754_exp10l (long double); +extern long double __ieee754_coshl (long double); +extern long double __ieee754_fmodl (long double,long double); +extern long double __ieee754_powl (long double,long double); +extern long double __ieee754_lgammal_r (long double,int *); +extern long double __ieee754_gammal_r (long double,int *); +extern long double __ieee754_lgammal (long double); +extern long double __ieee754_gammal (long double); +extern long double __ieee754_log10l (long double); +extern long double __ieee754_log2l (long double); +extern long double __ieee754_sinhl (long double); +extern long double __ieee754_hypotl (long double,long double); +extern long double __ieee754_j0l (long double); +extern long double __ieee754_j1l (long double); +extern long double __ieee754_y0l (long double); +extern long double __ieee754_y1l (long double); +extern long double __ieee754_jnl (int,long double); +extern long double __ieee754_ynl (int,long double); +extern long double __ieee754_remainderl (long double,long double); +extern int __ieee754_rem_pio2l (long double,long double*); +extern long double __ieee754_scalbl (long double,long double); + +/* long double versions of fdlibm kernel functions */ +extern long double __kernel_sinl (long double,long double,int); +extern long double __kernel_cosl (long double,long double); +extern long double __kernel_tanl (long double,long double,int); +extern void __kernel_sincosl (long double,long double, + long double *,long double *, int); +extern int __kernel_rem_pio2l (long double*,long double*,int,int, + int,const int*); + +#ifndef NO_LONG_DOUBLE +/* prototypes required to compile the ldbl-96 support without warnings */ +extern int __finitel (long double); +extern int __ilogbl (long double); +extern int __isinfl (long double); +extern int __isnanl (long double); +extern long double __atanl (long double); +extern long double __copysignl (long double, long double); +extern long double __expm1l (long double); +extern long double __floorl (long double); +extern long double __frexpl (long double, int *); +extern long double __ldexpl (long double, int); +extern long double __log1pl (long double); +extern long double __nanl (const char *); +extern long double __rintl (long double); +extern long double __scalbnl (long double, int); +extern long double __sqrtl (long double x); +extern long double fabsl (long double x); +extern void __sincosl (long double, long double *, long double *); +extern long double __logbl (long double x); +extern long double __significandl (long double x); +#endif + +/* Prototypes for functions of the IBM Accurate Mathematical Library. */ +extern double __exp1 (double __x, double __xx, double __error); +extern double __sin (double __x); +extern double __cos (double __x); +extern int __branred (double __x, double *__a, double *__aa); +extern void __doasin (double __x, double __dx, double __v[]); +extern void __dubsin (double __x, double __dx, double __v[]); +extern void __dubcos (double __x, double __dx, double __v[]); +extern double __halfulp (double __x, double __y); +extern double __sin32 (double __x, double __res, double __res1); +extern double __cos32 (double __x, double __res, double __res1); +extern double __mpsin (double __x, double __dx); +extern double __mpcos (double __x, double __dx); +extern double __mpsin1 (double __x); +extern double __mpcos1 (double __x); +extern double __slowexp (double __x); +extern double __slowpow (double __x, double __y, double __z); +extern void __docos (double __x, double __dx, double __v[]); + +#endif /* _MATH_PRIVATE_H_ */ diff --git a/libgcc-math/libtool-version b/libgcc-math/libtool-version new file mode 100644 index 00000000000..782aa9a7213 --- /dev/null +++ b/libgcc-math/libtool-version @@ -0,0 +1,6 @@ +# This file is used to maintain libtool version info for libgcc-math. See +# the libtool manual to understand the meaning of the fields. This is +# a separate file so that version updates don't involve re-running +# automake. +# CURRENT:REVISION:AGE +0:0:0 -- 2.30.2