From ccd77233892ace44fd4852999e66534d1c2283ea Mon Sep 17 00:00:00 2001 From: Tim King Date: Tue, 17 Apr 2012 16:07:22 +0000 Subject: [PATCH] Merges branches/arithmetic/atom-database r2979 through 3247 into trunk. Below is a highlight of the changes: - This introduces a new normal form to arithmetic. -- Equalities and disequalities are in solved form. Roughly speaking this means: (= x (+ y z)) is in normal form. (See the comments in normal_form.h for what this formally requires.) -- The normal form for inequality atoms always uses GEQ and GT instead of GEQ and LEQ. Integer atoms always use GEQ. - Constraint was added to TheoryArith. -- A constraint is a triple of (k x v) where: --- k is the type of the constraint (either LowerBound, UpperBound, Equality or Disequality), --- x is an ArithVar, and --- v is a DeltaRational value. -- Constraints are always attached to a ConstraintDatabase. -- A Constraint has its negation in the ConstraintDatabase [at least for now]. -- Every constraint belongs to a set of constraints for each ArithVar sorted by the delta rational values. -- This set can be iterated over and provides efficient access to other constraints for this variable. -- A literal may be attached to a constraint. -- Constraints with attached literals may be marked as being asserted to the theory (sat context dependent). -- Constraints can be propagated. -- Every constraint has a proof (sat context dependent). -- Proofs can be explained for either conflicts or propagations (if the node was propagated). (These proofs may be different.) -- Equalities and disequalities can be marked as being split (user context dependent) - This removes and replaces: -- src/theory/arith/arith_prop_manager.* -- src/theory/arith/atom_database.* -- src/theory/arith/ordered_set.h - Added isZero(), isOne() and isNegativeOne() to Rational and Integer. - Added operator+ to CDList::const_iterator. - Added const_iterator to CDQueue. - Changes to regression tests. --- src/context/cdlist.h | 10 + src/context/cdqueue.h | 10 + src/context/cdtrail_queue.h | 6 +- src/prop/cryptominisat/MTRand/Makefile.in | 141 +- src/prop/cryptominisat/Makefile.in | 369 ++--- src/prop/cryptominisat/Solver/Makefile.in | 198 +-- src/prop/cryptominisat/man/Makefile.in | 141 +- src/prop/cryptominisat/mtl/Makefile.in | 141 +- src/smt/smt_engine.cpp | 3 + src/theory/arith/Makefile.am | 8 +- src/theory/arith/arith_prop_manager.cpp | 173 --- src/theory/arith/arith_prop_manager.h | 184 --- src/theory/arith/arith_rewriter.cpp | 34 +- src/theory/arith/arith_rewriter.h | 1 - src/theory/arith/arith_static_learner.cpp | 2 +- src/theory/arith/arith_utilities.h | 127 +- src/theory/arith/arithvar.h | 12 +- src/theory/arith/arithvar_set.h | 38 +- src/theory/arith/atom_database.cpp | 542 ------- src/theory/arith/atom_database.h | 165 --- src/theory/arith/constraint.cpp | 1130 +++++++++++++++ src/theory/arith/constraint.h | 837 +++++++++++ src/theory/arith/constraint_forward.h | 42 + src/theory/arith/delta_rational.h | 12 +- src/theory/arith/difference_manager.cpp | 169 ++- src/theory/arith/difference_manager.h | 117 +- src/theory/arith/dio_solver.cpp | 28 +- src/theory/arith/dio_solver.h | 18 +- src/theory/arith/linear_equality.cpp | 47 +- src/theory/arith/linear_equality.h | 13 +- src/theory/arith/normal_form.cpp | 1132 +++++++++++---- src/theory/arith/normal_form.h | 460 +++--- src/theory/arith/ordered_set.h | 116 -- src/theory/arith/partial_model.cpp | 208 +-- src/theory/arith/partial_model.h | 107 +- src/theory/arith/simplex.cpp | 137 +- src/theory/arith/simplex.h | 52 +- src/theory/arith/tableau.cpp | 1 - src/theory/arith/theory_arith.cpp | 849 +++++++---- src/theory/arith/theory_arith.h | 88 +- src/theory/theory.cpp | 5 + src/theory/theory.h | 1 + src/util/integer_cln_imp.h | 12 + src/util/integer_gmp_imp.h | 12 + src/util/options.cpp | 8 + src/util/options.h | 12 +- src/util/rational_cln_imp.h | 8 + src/util/rational_gmp_imp.h | 8 + .../regress0/arith/integers/Makefile.am | 11 +- test/regress/regress0/uflia/Makefile.am | 4 +- test/regress/regress0/uflia/error0.smt2 | 1281 +++++++++++++++++ .../regress0/uflia/xs-09-16-3-4-1-5.smt | 29 + test/unit/theory/theory_arith_white.h | 96 +- 53 files changed, 6130 insertions(+), 3225 deletions(-) delete mode 100644 src/theory/arith/arith_prop_manager.cpp delete mode 100644 src/theory/arith/arith_prop_manager.h delete mode 100644 src/theory/arith/atom_database.cpp delete mode 100644 src/theory/arith/atom_database.h create mode 100644 src/theory/arith/constraint.cpp create mode 100644 src/theory/arith/constraint.h create mode 100644 src/theory/arith/constraint_forward.h delete mode 100644 src/theory/arith/ordered_set.h create mode 100644 test/regress/regress0/uflia/error0.smt2 create mode 100644 test/regress/regress0/uflia/xs-09-16-3-4-1-5.smt diff --git a/src/context/cdlist.h b/src/context/cdlist.h index c22d617b0..9d7709589 100644 --- a/src/context/cdlist.h +++ b/src/context/cdlist.h @@ -384,6 +384,16 @@ public: /** Prefix decrement */ const_iterator& operator--() { --d_it; return *this; } + /** operator+ */ + const_iterator operator+(long signed int off) const { + return const_iterator(d_it + off); + } + + /** operator+ */ + const_iterator operator+(long unsigned int off) const { + return const_iterator(d_it + off); + } + // Postfix operations on iterators: requires a Proxy object to // hold the intermediate value for dereferencing class Proxy { diff --git a/src/context/cdqueue.h b/src/context/cdqueue.h index d8f6c42f1..b43217cfe 100644 --- a/src/context/cdqueue.h +++ b/src/context/cdqueue.h @@ -151,6 +151,16 @@ public: return ParentType::d_list[ParentType::d_size - 1]; } + typedef typename ParentType::const_iterator const_iterator; + + const_iterator begin() const { + return ParentType::begin() + d_iter; + } + + const_iterator end() const { + return ParentType::end(); + } + };/* class CDQueue<> */ }/* CVC4::context namespace */ diff --git a/src/context/cdtrail_queue.h b/src/context/cdtrail_queue.h index 3f6887d29..94d758ced 100644 --- a/src/context/cdtrail_queue.h +++ b/src/context/cdtrail_queue.h @@ -80,11 +80,15 @@ public: d_iter = d_iter + 1; } - const T& operator[](size_t index){ + const T& operator[](size_t index) const{ Assert(index < d_list.size()); return d_list[index]; } + size_t size() const{ + return d_list.size(); + } + };/* class CDTrailQueue<> */ }/* CVC4::context namespace */ diff --git a/src/prop/cryptominisat/MTRand/Makefile.in b/src/prop/cryptominisat/MTRand/Makefile.in index 1693a70f2..8cc478cdf 100644 --- a/src/prop/cryptominisat/MTRand/Makefile.in +++ b/src/prop/cryptominisat/MTRand/Makefile.in @@ -34,36 +34,17 @@ PRE_UNINSTALL = : POST_UNINSTALL = : build_triplet = @build@ host_triplet = @host@ -target_triplet = @target@ -subdir = src/prop/cryptominisat/MTRand +subdir = MTRand DIST_COMMON = $(pkgincludesub_HEADERS) $(srcdir)/Makefile.am \ $(srcdir)/Makefile.in ACLOCAL_M4 = $(top_srcdir)/aclocal.m4 -am__aclocal_m4_deps = $(top_srcdir)/config/antlr.m4 \ - $(top_srcdir)/config/ax_prog_doxygen.m4 \ - $(top_srcdir)/config/ax_tls.m4 \ - $(top_srcdir)/config/bindings.m4 $(top_srcdir)/config/boost.m4 \ - $(top_srcdir)/config/cudd.m4 $(top_srcdir)/config/cvc4.m4 \ - $(top_srcdir)/config/gcc_version.m4 \ - $(top_srcdir)/config/libtool.m4 \ - $(top_srcdir)/config/ltoptions.m4 \ - $(top_srcdir)/config/ltsugar.m4 \ - $(top_srcdir)/config/ltversion.m4 \ - $(top_srcdir)/config/lt~obsolete.m4 \ - $(top_srcdir)/config/pkg.m4 $(top_srcdir)/config/readline.m4 \ - $(top_srcdir)/configure.ac +am__aclocal_m4_deps = $(top_srcdir)/configure.in am__configure_deps = $(am__aclocal_m4_deps) $(CONFIGURE_DEPENDENCIES) \ $(ACLOCAL_M4) mkinstalldirs = $(install_sh) -d -CONFIG_HEADER = $(top_builddir)/cvc4autoconfig.h +CONFIG_HEADER = $(top_builddir)/config.h CONFIG_CLEAN_FILES = CONFIG_CLEAN_VPATH_FILES = -AM_V_GEN = $(am__v_GEN_$(V)) -am__v_GEN_ = $(am__v_GEN_$(AM_DEFAULT_VERBOSITY)) -am__v_GEN_0 = @echo " GEN " $@; -AM_V_at = $(am__v_at_$(V)) -am__v_at_ = $(am__v_at_$(AM_DEFAULT_VERBOSITY)) -am__v_at_0 = @ SOURCES = DIST_SOURCES = am__vpath_adj_setup = srcdirstrip=`echo "$(srcdir)" | sed 's|.|.|g'`; @@ -94,128 +75,54 @@ CTAGS = ctags DISTFILES = $(DIST_COMMON) $(DIST_SOURCES) $(TEXINFOS) $(EXTRA_DIST) ACLOCAL = @ACLOCAL@ AMTAR = @AMTAR@ -AM_DEFAULT_VERBOSITY = @AM_DEFAULT_VERBOSITY@ -ANTLR = @ANTLR@ -ANTLR_HOME = @ANTLR_HOME@ -ANTLR_INCLUDES = @ANTLR_INCLUDES@ -ANTLR_LDFLAGS = @ANTLR_LDFLAGS@ AR = @AR@ -AS = @AS@ AUTOCONF = @AUTOCONF@ AUTOHEADER = @AUTOHEADER@ AUTOMAKE = @AUTOMAKE@ AWK = @AWK@ -BOOST_CPPFLAGS = @BOOST_CPPFLAGS@ -BOOST_LDPATH = @BOOST_LDPATH@ -BOOST_ROOT = @BOOST_ROOT@ -BOOST_THREAD_LDFLAGS = @BOOST_THREAD_LDFLAGS@ -BOOST_THREAD_LDPATH = @BOOST_THREAD_LDPATH@ -BOOST_THREAD_LIBS = @BOOST_THREAD_LIBS@ -BUILDING_SHARED = @BUILDING_SHARED@ -BUILDING_STATIC = @BUILDING_STATIC@ -CAMLP4O = @CAMLP4O@ CC = @CC@ CCDEPMODE = @CCDEPMODE@ CFLAGS = @CFLAGS@ -CLN_CFLAGS = @CLN_CFLAGS@ -CLN_LIBS = @CLN_LIBS@ CPP = @CPP@ CPPFLAGS = @CPPFLAGS@ -CSHARP_CPPFLAGS = @CSHARP_CPPFLAGS@ -CUDD_CPPFLAGS = @CUDD_CPPFLAGS@ -CUDD_LDFLAGS = @CUDD_LDFLAGS@ -CUDD_LIBS = @CUDD_LIBS@ -CVC4_BINDINGS_LIBRARY_VERSION = @CVC4_BINDINGS_LIBRARY_VERSION@ -CVC4_BUILD_LIBCOMPAT = @CVC4_BUILD_LIBCOMPAT@ -CVC4_COMPAT_LIBRARY_VERSION = @CVC4_COMPAT_LIBRARY_VERSION@ -CVC4_HAS_THREADS = @CVC4_HAS_THREADS@ -CVC4_LANGUAGE_BINDINGS = @CVC4_LANGUAGE_BINDINGS@ -CVC4_LIBRARY_VERSION = @CVC4_LIBRARY_VERSION@ -CVC4_PARSER_LIBRARY_VERSION = @CVC4_PARSER_LIBRARY_VERSION@ -CVC4_TLS = @CVC4_TLS@ -CVC4_TLS_SUPPORTED = @CVC4_TLS_SUPPORTED@ -CVC4_USE_CLN_IMP = @CVC4_USE_CLN_IMP@ -CVC4_USE_GMP_IMP = @CVC4_USE_GMP_IMP@ CXX = @CXX@ CXXCPP = @CXXCPP@ CXXDEPMODE = @CXXDEPMODE@ CXXFLAGS = @CXXFLAGS@ -CXXTEST = @CXXTEST@ -CXXTESTGEN = @CXXTESTGEN@ CYGPATH_W = @CYGPATH_W@ DEFS = @DEFS@ DEPDIR = @DEPDIR@ -DISTCHECK_CONFIGURE_FLAGS = @DISTCHECK_CONFIGURE_FLAGS@ DLLTOOL = @DLLTOOL@ -DOXYGEN_EXTRACT_PRIVATE = @DOXYGEN_EXTRACT_PRIVATE@ -DOXYGEN_EXTRACT_STATIC = @DOXYGEN_EXTRACT_STATIC@ -DOXYGEN_PAPER_SIZE = @DOXYGEN_PAPER_SIZE@ DSYMUTIL = @DSYMUTIL@ DUMPBIN = @DUMPBIN@ -DX_CONFIG = @DX_CONFIG@ -DX_DOCDIR = @DX_DOCDIR@ -DX_DOT = @DX_DOT@ -DX_DOXYGEN = @DX_DOXYGEN@ -DX_DVIPS = @DX_DVIPS@ -DX_EGREP = @DX_EGREP@ -DX_ENV = @DX_ENV@ -DX_FLAG_DX_CURRENT_FEATURE = @DX_FLAG_DX_CURRENT_FEATURE@ -DX_FLAG_chi = @DX_FLAG_chi@ -DX_FLAG_chm = @DX_FLAG_chm@ -DX_FLAG_doc = @DX_FLAG_doc@ -DX_FLAG_dot = @DX_FLAG_dot@ -DX_FLAG_html = @DX_FLAG_html@ -DX_FLAG_man = @DX_FLAG_man@ -DX_FLAG_pdf = @DX_FLAG_pdf@ -DX_FLAG_ps = @DX_FLAG_ps@ -DX_FLAG_rtf = @DX_FLAG_rtf@ -DX_FLAG_xml = @DX_FLAG_xml@ -DX_HHC = @DX_HHC@ -DX_LATEX = @DX_LATEX@ -DX_MAKEINDEX = @DX_MAKEINDEX@ -DX_PDFLATEX = @DX_PDFLATEX@ -DX_PERL = @DX_PERL@ -DX_PROJECT = @DX_PROJECT@ ECHO_C = @ECHO_C@ ECHO_N = @ECHO_N@ ECHO_T = @ECHO_T@ EGREP = @EGREP@ EXEEXT = @EXEEXT@ FGREP = @FGREP@ -FLAG_VISIBILITY_HIDDEN = @FLAG_VISIBILITY_HIDDEN@ GREP = @GREP@ INSTALL = @INSTALL@ INSTALL_DATA = @INSTALL_DATA@ INSTALL_PROGRAM = @INSTALL_PROGRAM@ INSTALL_SCRIPT = @INSTALL_SCRIPT@ INSTALL_STRIP_PROGRAM = @INSTALL_STRIP_PROGRAM@ -JAR = @JAR@ -JAVA = @JAVA@ -JAVAC = @JAVAC@ -JAVAH = @JAVAH@ -JAVA_CPPFLAGS = @JAVA_CPPFLAGS@ LD = @LD@ LDFLAGS = @LDFLAGS@ -LFSC = @LFSC@ -LFSCARGS = @LFSCARGS@ LIBOBJS = @LIBOBJS@ LIBS = @LIBS@ LIBTOOL = @LIBTOOL@ LIPO = @LIPO@ LN_S = @LN_S@ LTLIBOBJS = @LTLIBOBJS@ -MAINT = @MAINT@ MAKEINFO = @MAKEINFO@ MANIFEST_TOOL = @MANIFEST_TOOL@ -MAN_DATE = @MAN_DATE@ MKDIR_P = @MKDIR_P@ NM = @NM@ NMEDIT = @NMEDIT@ OBJDUMP = @OBJDUMP@ OBJEXT = @OBJEXT@ -OCAMLC = @OCAMLC@ -OCAMLFIND = @OCAMLFIND@ -OCAMLMKTOP = @OCAMLMKTOP@ +OPENMP_CXXFLAGS = @OPENMP_CXXFLAGS@ OTOOL = @OTOOL@ OTOOL64 = @OTOOL64@ PACKAGE = @PACKAGE@ @@ -226,33 +133,12 @@ PACKAGE_TARNAME = @PACKAGE_TARNAME@ PACKAGE_URL = @PACKAGE_URL@ PACKAGE_VERSION = @PACKAGE_VERSION@ PATH_SEPARATOR = @PATH_SEPARATOR@ -PERL = @PERL@ -PERL_CPPFLAGS = @PERL_CPPFLAGS@ -PHP_CPPFLAGS = @PHP_CPPFLAGS@ -PKG_CONFIG = @PKG_CONFIG@ -PYTHON = @PYTHON@ -PYTHON_CONFIG = @PYTHON_CONFIG@ -PYTHON_CXXFLAGS = @PYTHON_CXXFLAGS@ -PYTHON_EXEC_PREFIX = @PYTHON_EXEC_PREFIX@ -PYTHON_INCLUDE = @PYTHON_INCLUDE@ -PYTHON_PLATFORM = @PYTHON_PLATFORM@ -PYTHON_PREFIX = @PYTHON_PREFIX@ -PYTHON_VERSION = @PYTHON_VERSION@ RANLIB = @RANLIB@ -READLINE_LIBS = @READLINE_LIBS@ -RUBY_CPPFLAGS = @RUBY_CPPFLAGS@ SED = @SED@ SET_MAKE = @SET_MAKE@ SHELL = @SHELL@ -STATIC_BINARY = @STATIC_BINARY@ STRIP = @STRIP@ -SWIG = @SWIG@ -TCL_CPPFLAGS = @TCL_CPPFLAGS@ -TEST_CPPFLAGS = @TEST_CPPFLAGS@ -TEST_CXXFLAGS = @TEST_CXXFLAGS@ -TEST_LDFLAGS = @TEST_LDFLAGS@ VERSION = @VERSION@ -WNO_CONVERSION_NULL = @WNO_CONVERSION_NULL@ abs_builddir = @abs_builddir@ abs_srcdir = @abs_srcdir@ abs_top_builddir = @abs_top_builddir@ @@ -292,26 +178,17 @@ libexecdir = @libexecdir@ localedir = @localedir@ localstatedir = @localstatedir@ mandir = @mandir@ -mk_include = @mk_include@ mkdir_p = @mkdir_p@ oldincludedir = @oldincludedir@ pdfdir = @pdfdir@ -pkgpyexecdir = @pkgpyexecdir@ -pkgpythondir = @pkgpythondir@ prefix = @prefix@ program_transform_name = @program_transform_name@ psdir = @psdir@ -pyexecdir = @pyexecdir@ -pythondir = @pythondir@ sbindir = @sbindir@ sharedstatedir = @sharedstatedir@ srcdir = @srcdir@ sysconfdir = @sysconfdir@ -target = @target@ target_alias = @target_alias@ -target_cpu = @target_cpu@ -target_os = @target_os@ -target_vendor = @target_vendor@ top_build_prefix = @top_build_prefix@ top_builddir = @top_builddir@ top_srcdir = @top_srcdir@ @@ -320,7 +197,7 @@ pkgincludesub_HEADERS = MersenneTwister.h all: all-am .SUFFIXES: -$(srcdir)/Makefile.in: @MAINTAINER_MODE_TRUE@ $(srcdir)/Makefile.am $(am__configure_deps) +$(srcdir)/Makefile.in: $(srcdir)/Makefile.am $(am__configure_deps) @for dep in $?; do \ case '$(am__configure_deps)' in \ *$$dep*) \ @@ -329,9 +206,9 @@ $(srcdir)/Makefile.in: @MAINTAINER_MODE_TRUE@ $(srcdir)/Makefile.am $(am__confi exit 1;; \ esac; \ done; \ - echo ' cd $(top_srcdir) && $(AUTOMAKE) --foreign src/prop/cryptominisat/MTRand/Makefile'; \ + echo ' cd $(top_srcdir) && $(AUTOMAKE) --gnu MTRand/Makefile'; \ $(am__cd) $(top_srcdir) && \ - $(AUTOMAKE) --foreign src/prop/cryptominisat/MTRand/Makefile + $(AUTOMAKE) --gnu MTRand/Makefile .PRECIOUS: Makefile Makefile: $(srcdir)/Makefile.in $(top_builddir)/config.status @case '$?' in \ @@ -345,9 +222,9 @@ Makefile: $(srcdir)/Makefile.in $(top_builddir)/config.status $(top_builddir)/config.status: $(top_srcdir)/configure $(CONFIG_STATUS_DEPENDENCIES) cd $(top_builddir) && $(MAKE) $(AM_MAKEFLAGS) am--refresh -$(top_srcdir)/configure: @MAINTAINER_MODE_TRUE@ $(am__configure_deps) +$(top_srcdir)/configure: $(am__configure_deps) cd $(top_builddir) && $(MAKE) $(AM_MAKEFLAGS) am--refresh -$(ACLOCAL_M4): @MAINTAINER_MODE_TRUE@ $(am__aclocal_m4_deps) +$(ACLOCAL_M4): $(am__aclocal_m4_deps) cd $(top_builddir) && $(MAKE) $(AM_MAKEFLAGS) am--refresh $(am__aclocal_m4_deps): diff --git a/src/prop/cryptominisat/Makefile.in b/src/prop/cryptominisat/Makefile.in index a6806f0b4..2d9ee8bf8 100644 --- a/src/prop/cryptominisat/Makefile.in +++ b/src/prop/cryptominisat/Makefile.in @@ -33,37 +33,21 @@ PRE_UNINSTALL = : POST_UNINSTALL = : build_triplet = @build@ host_triplet = @host@ -target_triplet = @target@ -subdir = src/prop/cryptominisat -DIST_COMMON = README $(srcdir)/Makefile.am $(srcdir)/Makefile.in \ - AUTHORS INSTALL NEWS TODO config.guess config.sub depcomp \ - install-sh ltmain.sh missing +subdir = . +DIST_COMMON = README $(am__configure_deps) $(srcdir)/Makefile.am \ + $(srcdir)/Makefile.in $(srcdir)/config.h.in \ + $(top_srcdir)/configure AUTHORS INSTALL NEWS TODO config.guess \ + config.sub depcomp install-sh ltmain.sh missing ACLOCAL_M4 = $(top_srcdir)/aclocal.m4 -am__aclocal_m4_deps = $(top_srcdir)/config/antlr.m4 \ - $(top_srcdir)/config/ax_prog_doxygen.m4 \ - $(top_srcdir)/config/ax_tls.m4 \ - $(top_srcdir)/config/bindings.m4 $(top_srcdir)/config/boost.m4 \ - $(top_srcdir)/config/cudd.m4 $(top_srcdir)/config/cvc4.m4 \ - $(top_srcdir)/config/gcc_version.m4 \ - $(top_srcdir)/config/libtool.m4 \ - $(top_srcdir)/config/ltoptions.m4 \ - $(top_srcdir)/config/ltsugar.m4 \ - $(top_srcdir)/config/ltversion.m4 \ - $(top_srcdir)/config/lt~obsolete.m4 \ - $(top_srcdir)/config/pkg.m4 $(top_srcdir)/config/readline.m4 \ - $(top_srcdir)/configure.ac +am__aclocal_m4_deps = $(top_srcdir)/configure.in am__configure_deps = $(am__aclocal_m4_deps) $(CONFIGURE_DEPENDENCIES) \ $(ACLOCAL_M4) +am__CONFIG_DISTCLEAN_FILES = config.status config.cache config.log \ + configure.lineno config.status.lineno mkinstalldirs = $(install_sh) -d -CONFIG_HEADER = $(top_builddir)/cvc4autoconfig.h +CONFIG_HEADER = config.h CONFIG_CLEAN_FILES = CONFIG_CLEAN_VPATH_FILES = -AM_V_GEN = $(am__v_GEN_$(V)) -am__v_GEN_ = $(am__v_GEN_$(AM_DEFAULT_VERBOSITY)) -am__v_GEN_0 = @echo " GEN " $@; -AM_V_at = $(am__v_at_$(V)) -am__v_at_ = $(am__v_at_$(AM_DEFAULT_VERBOSITY)) -am__v_at_0 = @ SOURCES = DIST_SOURCES = RECURSIVE_TARGETS = all-recursive check-recursive dvi-recursive \ @@ -77,11 +61,17 @@ RECURSIVE_CLEAN_TARGETS = mostlyclean-recursive clean-recursive \ distclean-recursive maintainer-clean-recursive AM_RECURSIVE_TARGETS = $(RECURSIVE_TARGETS:-recursive=) \ $(RECURSIVE_CLEAN_TARGETS:-recursive=) tags TAGS ctags CTAGS \ - distdir + distdir dist dist-all distcheck ETAGS = etags CTAGS = ctags DIST_SUBDIRS = $(SUBDIRS) DISTFILES = $(DIST_COMMON) $(DIST_SOURCES) $(TEXINFOS) $(EXTRA_DIST) +distdir = $(PACKAGE)-$(VERSION) +top_distdir = $(distdir) +am__remove_distdir = \ + { test ! -d "$(distdir)" \ + || { find "$(distdir)" -type d ! -perm -200 -exec chmod u+w {} ';' \ + && rm -fr "$(distdir)"; }; } am__relativize = \ dir0=`pwd`; \ sed_first='s,^\([^/]*\)/.*$$,\1,'; \ @@ -107,130 +97,60 @@ am__relativize = \ dir1=`echo "$$dir1" | sed -e "$$sed_rest"`; \ done; \ reldir="$$dir2" +DIST_ARCHIVES = $(distdir).tar.gz +GZIP_ENV = --best +distuninstallcheck_listfiles = find . -type f -print +distcleancheck_listfiles = find . -type f -print ACLOCAL = @ACLOCAL@ AMTAR = @AMTAR@ -AM_DEFAULT_VERBOSITY = @AM_DEFAULT_VERBOSITY@ -ANTLR = @ANTLR@ -ANTLR_HOME = @ANTLR_HOME@ -ANTLR_INCLUDES = @ANTLR_INCLUDES@ -ANTLR_LDFLAGS = @ANTLR_LDFLAGS@ AR = @AR@ -AS = @AS@ AUTOCONF = @AUTOCONF@ AUTOHEADER = @AUTOHEADER@ AUTOMAKE = @AUTOMAKE@ AWK = @AWK@ -BOOST_CPPFLAGS = @BOOST_CPPFLAGS@ -BOOST_LDPATH = @BOOST_LDPATH@ -BOOST_ROOT = @BOOST_ROOT@ -BOOST_THREAD_LDFLAGS = @BOOST_THREAD_LDFLAGS@ -BOOST_THREAD_LDPATH = @BOOST_THREAD_LDPATH@ -BOOST_THREAD_LIBS = @BOOST_THREAD_LIBS@ -BUILDING_SHARED = @BUILDING_SHARED@ -BUILDING_STATIC = @BUILDING_STATIC@ -CAMLP4O = @CAMLP4O@ CC = @CC@ CCDEPMODE = @CCDEPMODE@ CFLAGS = @CFLAGS@ -CLN_CFLAGS = @CLN_CFLAGS@ -CLN_LIBS = @CLN_LIBS@ CPP = @CPP@ CPPFLAGS = @CPPFLAGS@ -CSHARP_CPPFLAGS = @CSHARP_CPPFLAGS@ -CUDD_CPPFLAGS = @CUDD_CPPFLAGS@ -CUDD_LDFLAGS = @CUDD_LDFLAGS@ -CUDD_LIBS = @CUDD_LIBS@ -CVC4_BINDINGS_LIBRARY_VERSION = @CVC4_BINDINGS_LIBRARY_VERSION@ -CVC4_BUILD_LIBCOMPAT = @CVC4_BUILD_LIBCOMPAT@ -CVC4_COMPAT_LIBRARY_VERSION = @CVC4_COMPAT_LIBRARY_VERSION@ -CVC4_HAS_THREADS = @CVC4_HAS_THREADS@ -CVC4_LANGUAGE_BINDINGS = @CVC4_LANGUAGE_BINDINGS@ -CVC4_LIBRARY_VERSION = @CVC4_LIBRARY_VERSION@ -CVC4_PARSER_LIBRARY_VERSION = @CVC4_PARSER_LIBRARY_VERSION@ -CVC4_TLS = @CVC4_TLS@ -CVC4_TLS_SUPPORTED = @CVC4_TLS_SUPPORTED@ -CVC4_USE_CLN_IMP = @CVC4_USE_CLN_IMP@ -CVC4_USE_GMP_IMP = @CVC4_USE_GMP_IMP@ CXX = @CXX@ CXXCPP = @CXXCPP@ CXXDEPMODE = @CXXDEPMODE@ CXXFLAGS = @CXXFLAGS@ -CXXTEST = @CXXTEST@ -CXXTESTGEN = @CXXTESTGEN@ CYGPATH_W = @CYGPATH_W@ DEFS = @DEFS@ DEPDIR = @DEPDIR@ -DISTCHECK_CONFIGURE_FLAGS = @DISTCHECK_CONFIGURE_FLAGS@ DLLTOOL = @DLLTOOL@ -DOXYGEN_EXTRACT_PRIVATE = @DOXYGEN_EXTRACT_PRIVATE@ -DOXYGEN_EXTRACT_STATIC = @DOXYGEN_EXTRACT_STATIC@ -DOXYGEN_PAPER_SIZE = @DOXYGEN_PAPER_SIZE@ DSYMUTIL = @DSYMUTIL@ DUMPBIN = @DUMPBIN@ -DX_CONFIG = @DX_CONFIG@ -DX_DOCDIR = @DX_DOCDIR@ -DX_DOT = @DX_DOT@ -DX_DOXYGEN = @DX_DOXYGEN@ -DX_DVIPS = @DX_DVIPS@ -DX_EGREP = @DX_EGREP@ -DX_ENV = @DX_ENV@ -DX_FLAG_DX_CURRENT_FEATURE = @DX_FLAG_DX_CURRENT_FEATURE@ -DX_FLAG_chi = @DX_FLAG_chi@ -DX_FLAG_chm = @DX_FLAG_chm@ -DX_FLAG_doc = @DX_FLAG_doc@ -DX_FLAG_dot = @DX_FLAG_dot@ -DX_FLAG_html = @DX_FLAG_html@ -DX_FLAG_man = @DX_FLAG_man@ -DX_FLAG_pdf = @DX_FLAG_pdf@ -DX_FLAG_ps = @DX_FLAG_ps@ -DX_FLAG_rtf = @DX_FLAG_rtf@ -DX_FLAG_xml = @DX_FLAG_xml@ -DX_HHC = @DX_HHC@ -DX_LATEX = @DX_LATEX@ -DX_MAKEINDEX = @DX_MAKEINDEX@ -DX_PDFLATEX = @DX_PDFLATEX@ -DX_PERL = @DX_PERL@ -DX_PROJECT = @DX_PROJECT@ ECHO_C = @ECHO_C@ ECHO_N = @ECHO_N@ ECHO_T = @ECHO_T@ EGREP = @EGREP@ EXEEXT = @EXEEXT@ FGREP = @FGREP@ -FLAG_VISIBILITY_HIDDEN = @FLAG_VISIBILITY_HIDDEN@ GREP = @GREP@ INSTALL = @INSTALL@ INSTALL_DATA = @INSTALL_DATA@ INSTALL_PROGRAM = @INSTALL_PROGRAM@ INSTALL_SCRIPT = @INSTALL_SCRIPT@ INSTALL_STRIP_PROGRAM = @INSTALL_STRIP_PROGRAM@ -JAR = @JAR@ -JAVA = @JAVA@ -JAVAC = @JAVAC@ -JAVAH = @JAVAH@ -JAVA_CPPFLAGS = @JAVA_CPPFLAGS@ LD = @LD@ LDFLAGS = @LDFLAGS@ -LFSC = @LFSC@ -LFSCARGS = @LFSCARGS@ LIBOBJS = @LIBOBJS@ LIBS = @LIBS@ LIBTOOL = @LIBTOOL@ LIPO = @LIPO@ LN_S = @LN_S@ LTLIBOBJS = @LTLIBOBJS@ -MAINT = @MAINT@ MAKEINFO = @MAKEINFO@ MANIFEST_TOOL = @MANIFEST_TOOL@ -MAN_DATE = @MAN_DATE@ MKDIR_P = @MKDIR_P@ NM = @NM@ NMEDIT = @NMEDIT@ OBJDUMP = @OBJDUMP@ OBJEXT = @OBJEXT@ -OCAMLC = @OCAMLC@ -OCAMLFIND = @OCAMLFIND@ -OCAMLMKTOP = @OCAMLMKTOP@ +OPENMP_CXXFLAGS = @OPENMP_CXXFLAGS@ OTOOL = @OTOOL@ OTOOL64 = @OTOOL64@ PACKAGE = @PACKAGE@ @@ -241,33 +161,12 @@ PACKAGE_TARNAME = @PACKAGE_TARNAME@ PACKAGE_URL = @PACKAGE_URL@ PACKAGE_VERSION = @PACKAGE_VERSION@ PATH_SEPARATOR = @PATH_SEPARATOR@ -PERL = @PERL@ -PERL_CPPFLAGS = @PERL_CPPFLAGS@ -PHP_CPPFLAGS = @PHP_CPPFLAGS@ -PKG_CONFIG = @PKG_CONFIG@ -PYTHON = @PYTHON@ -PYTHON_CONFIG = @PYTHON_CONFIG@ -PYTHON_CXXFLAGS = @PYTHON_CXXFLAGS@ -PYTHON_EXEC_PREFIX = @PYTHON_EXEC_PREFIX@ -PYTHON_INCLUDE = @PYTHON_INCLUDE@ -PYTHON_PLATFORM = @PYTHON_PLATFORM@ -PYTHON_PREFIX = @PYTHON_PREFIX@ -PYTHON_VERSION = @PYTHON_VERSION@ RANLIB = @RANLIB@ -READLINE_LIBS = @READLINE_LIBS@ -RUBY_CPPFLAGS = @RUBY_CPPFLAGS@ SED = @SED@ SET_MAKE = @SET_MAKE@ SHELL = @SHELL@ -STATIC_BINARY = @STATIC_BINARY@ STRIP = @STRIP@ -SWIG = @SWIG@ -TCL_CPPFLAGS = @TCL_CPPFLAGS@ -TEST_CPPFLAGS = @TEST_CPPFLAGS@ -TEST_CXXFLAGS = @TEST_CXXFLAGS@ -TEST_LDFLAGS = @TEST_LDFLAGS@ VERSION = @VERSION@ -WNO_CONVERSION_NULL = @WNO_CONVERSION_NULL@ abs_builddir = @abs_builddir@ abs_srcdir = @abs_srcdir@ abs_top_builddir = @abs_top_builddir@ @@ -307,26 +206,17 @@ libexecdir = @libexecdir@ localedir = @localedir@ localstatedir = @localstatedir@ mandir = @mandir@ -mk_include = @mk_include@ mkdir_p = @mkdir_p@ oldincludedir = @oldincludedir@ pdfdir = @pdfdir@ -pkgpyexecdir = @pkgpyexecdir@ -pkgpythondir = @pkgpythondir@ prefix = @prefix@ program_transform_name = @program_transform_name@ psdir = @psdir@ -pyexecdir = @pyexecdir@ -pythondir = @pythondir@ sbindir = @sbindir@ sharedstatedir = @sharedstatedir@ srcdir = @srcdir@ sysconfdir = @sysconfdir@ -target = @target@ target_alias = @target_alias@ -target_cpu = @target_cpu@ -target_os = @target_os@ -target_vendor = @target_vendor@ top_build_prefix = @top_build_prefix@ top_builddir = @top_builddir@ top_srcdir = @top_srcdir@ @@ -339,46 +229,71 @@ SUBDIRS = Solver mtl MTRand man EXTRA_DIST = HOWTO_VisualCpp HOWTO_MinGW32 \ LICENSE-GPL LICENSE-MIT TODO -all: all-recursive +all: config.h + $(MAKE) $(AM_MAKEFLAGS) all-recursive .SUFFIXES: -$(srcdir)/Makefile.in: @MAINTAINER_MODE_TRUE@ $(srcdir)/Makefile.am $(am__configure_deps) +am--refresh: + @: +$(srcdir)/Makefile.in: $(srcdir)/Makefile.am $(am__configure_deps) @for dep in $?; do \ case '$(am__configure_deps)' in \ *$$dep*) \ - ( cd $(top_builddir) && $(MAKE) $(AM_MAKEFLAGS) am--refresh ) \ - && { if test -f $@; then exit 0; else break; fi; }; \ + echo ' cd $(srcdir) && $(AUTOMAKE) --foreign'; \ + $(am__cd) $(srcdir) && $(AUTOMAKE) --foreign \ + && exit 0; \ exit 1;; \ esac; \ done; \ - echo ' cd $(top_srcdir) && $(AUTOMAKE) --foreign src/prop/cryptominisat/Makefile'; \ + echo ' cd $(top_srcdir) && $(AUTOMAKE) --foreign Makefile'; \ $(am__cd) $(top_srcdir) && \ - $(AUTOMAKE) --foreign src/prop/cryptominisat/Makefile + $(AUTOMAKE) --foreign Makefile .PRECIOUS: Makefile Makefile: $(srcdir)/Makefile.in $(top_builddir)/config.status @case '$?' in \ *config.status*) \ - cd $(top_builddir) && $(MAKE) $(AM_MAKEFLAGS) am--refresh;; \ + echo ' $(SHELL) ./config.status'; \ + $(SHELL) ./config.status;; \ *) \ - echo ' cd $(top_builddir) && $(SHELL) ./config.status $(subdir)/$@ $(am__depfiles_maybe)'; \ - cd $(top_builddir) && $(SHELL) ./config.status $(subdir)/$@ $(am__depfiles_maybe);; \ + echo ' cd $(top_builddir) && $(SHELL) ./config.status $@ $(am__depfiles_maybe)'; \ + cd $(top_builddir) && $(SHELL) ./config.status $@ $(am__depfiles_maybe);; \ esac; $(top_builddir)/config.status: $(top_srcdir)/configure $(CONFIG_STATUS_DEPENDENCIES) - cd $(top_builddir) && $(MAKE) $(AM_MAKEFLAGS) am--refresh + $(SHELL) ./config.status --recheck -$(top_srcdir)/configure: @MAINTAINER_MODE_TRUE@ $(am__configure_deps) - cd $(top_builddir) && $(MAKE) $(AM_MAKEFLAGS) am--refresh -$(ACLOCAL_M4): @MAINTAINER_MODE_TRUE@ $(am__aclocal_m4_deps) - cd $(top_builddir) && $(MAKE) $(AM_MAKEFLAGS) am--refresh +$(top_srcdir)/configure: $(am__configure_deps) + $(am__cd) $(srcdir) && $(AUTOCONF) +$(ACLOCAL_M4): $(am__aclocal_m4_deps) + $(am__cd) $(srcdir) && $(ACLOCAL) $(ACLOCAL_AMFLAGS) $(am__aclocal_m4_deps): +config.h: stamp-h1 + @if test ! -f $@; then \ + rm -f stamp-h1; \ + $(MAKE) $(AM_MAKEFLAGS) stamp-h1; \ + else :; fi + +stamp-h1: $(srcdir)/config.h.in $(top_builddir)/config.status + @rm -f stamp-h1 + cd $(top_builddir) && $(SHELL) ./config.status config.h +$(srcdir)/config.h.in: $(am__configure_deps) + ($(am__cd) $(top_srcdir) && $(AUTOHEADER)) + rm -f stamp-h1 + touch $@ + +distclean-hdr: + -rm -f config.h stamp-h1 + mostlyclean-libtool: -rm -f *.lo clean-libtool: -rm -rf .libs _libs +distclean-libtool: + -rm -f libtool config.lt + # This directory's subdirectories are mostly independent; you can cd # into them and run `make' without going through this Makefile. # To change the values of `make' variables: instead of editing Makefiles, @@ -459,7 +374,7 @@ ID: $(HEADERS) $(SOURCES) $(LISP) $(TAGS_FILES) mkid -fID $$unique tags: TAGS -TAGS: tags-recursive $(HEADERS) $(SOURCES) $(TAGS_DEPENDENCIES) \ +TAGS: tags-recursive $(HEADERS) $(SOURCES) config.h.in $(TAGS_DEPENDENCIES) \ $(TAGS_FILES) $(LISP) set x; \ here=`pwd`; \ @@ -476,7 +391,7 @@ TAGS: tags-recursive $(HEADERS) $(SOURCES) $(TAGS_DEPENDENCIES) \ set "$$@" "$$include_option=$$here/$$subdir/TAGS"; \ fi; \ done; \ - list='$(SOURCES) $(HEADERS) $(LISP) $(TAGS_FILES)'; \ + list='$(SOURCES) $(HEADERS) config.h.in $(LISP) $(TAGS_FILES)'; \ unique=`for i in $$list; do \ if test -f "$$i"; then echo $$i; else echo $(srcdir)/$$i; fi; \ done | \ @@ -494,9 +409,9 @@ TAGS: tags-recursive $(HEADERS) $(SOURCES) $(TAGS_DEPENDENCIES) \ fi; \ fi ctags: CTAGS -CTAGS: ctags-recursive $(HEADERS) $(SOURCES) $(TAGS_DEPENDENCIES) \ +CTAGS: ctags-recursive $(HEADERS) $(SOURCES) config.h.in $(TAGS_DEPENDENCIES) \ $(TAGS_FILES) $(LISP) - list='$(SOURCES) $(HEADERS) $(LISP) $(TAGS_FILES)'; \ + list='$(SOURCES) $(HEADERS) config.h.in $(LISP) $(TAGS_FILES)'; \ unique=`for i in $$list; do \ if test -f "$$i"; then echo $$i; else echo $(srcdir)/$$i; fi; \ done | \ @@ -515,6 +430,8 @@ distclean-tags: -rm -f TAGS ID GTAGS GRTAGS GSYMS GPATH tags distdir: $(DISTFILES) + $(am__remove_distdir) + test -d "$(distdir)" || mkdir "$(distdir)" @srcdirstrip=`echo "$(srcdir)" | sed 's/[].[^$$\\*]/\\\\&/g'`; \ topsrcdirstrip=`echo "$(top_srcdir)" | sed 's/[].[^$$\\*]/\\\\&/g'`; \ list='$(DISTFILES)'; \ @@ -572,9 +489,124 @@ distdir: $(DISTFILES) || exit 1; \ fi; \ done + -test -n "$(am__skip_mode_fix)" \ + || find "$(distdir)" -type d ! -perm -755 \ + -exec chmod u+rwx,go+rx {} \; -o \ + ! -type d ! -perm -444 -links 1 -exec chmod a+r {} \; -o \ + ! -type d ! -perm -400 -exec chmod a+r {} \; -o \ + ! -type d ! -perm -444 -exec $(install_sh) -c -m a+r {} {} \; \ + || chmod -R a+r "$(distdir)" +dist-gzip: distdir + tardir=$(distdir) && $(am__tar) | GZIP=$(GZIP_ENV) gzip -c >$(distdir).tar.gz + $(am__remove_distdir) + +dist-bzip2: distdir + tardir=$(distdir) && $(am__tar) | bzip2 -9 -c >$(distdir).tar.bz2 + $(am__remove_distdir) + +dist-lzma: distdir + tardir=$(distdir) && $(am__tar) | lzma -9 -c >$(distdir).tar.lzma + $(am__remove_distdir) + +dist-xz: distdir + tardir=$(distdir) && $(am__tar) | xz -c >$(distdir).tar.xz + $(am__remove_distdir) + +dist-tarZ: distdir + tardir=$(distdir) && $(am__tar) | compress -c >$(distdir).tar.Z + $(am__remove_distdir) + +dist-shar: distdir + shar $(distdir) | GZIP=$(GZIP_ENV) gzip -c >$(distdir).shar.gz + $(am__remove_distdir) + +dist-zip: distdir + -rm -f $(distdir).zip + zip -rq $(distdir).zip $(distdir) + $(am__remove_distdir) + +dist dist-all: distdir + tardir=$(distdir) && $(am__tar) | GZIP=$(GZIP_ENV) gzip -c >$(distdir).tar.gz + $(am__remove_distdir) + +# This target untars the dist file and tries a VPATH configuration. Then +# it guarantees that the distribution is self-contained by making another +# tarfile. +distcheck: dist + case '$(DIST_ARCHIVES)' in \ + *.tar.gz*) \ + GZIP=$(GZIP_ENV) gzip -dc $(distdir).tar.gz | $(am__untar) ;;\ + *.tar.bz2*) \ + bzip2 -dc $(distdir).tar.bz2 | $(am__untar) ;;\ + *.tar.lzma*) \ + lzma -dc $(distdir).tar.lzma | $(am__untar) ;;\ + *.tar.xz*) \ + xz -dc $(distdir).tar.xz | $(am__untar) ;;\ + *.tar.Z*) \ + uncompress -c $(distdir).tar.Z | $(am__untar) ;;\ + *.shar.gz*) \ + GZIP=$(GZIP_ENV) gzip -dc $(distdir).shar.gz | unshar ;;\ + *.zip*) \ + unzip $(distdir).zip ;;\ + esac + chmod -R a-w $(distdir); chmod a+w $(distdir) + mkdir $(distdir)/_build + mkdir $(distdir)/_inst + chmod a-w $(distdir) + test -d $(distdir)/_build || exit 0; \ + dc_install_base=`$(am__cd) $(distdir)/_inst && pwd | sed -e 's,^[^:\\/]:[\\/],/,'` \ + && dc_destdir="$${TMPDIR-/tmp}/am-dc-$$$$/" \ + && am__cwd=`pwd` \ + && $(am__cd) $(distdir)/_build \ + && ../configure --srcdir=.. --prefix="$$dc_install_base" \ + $(DISTCHECK_CONFIGURE_FLAGS) \ + && $(MAKE) $(AM_MAKEFLAGS) \ + && $(MAKE) $(AM_MAKEFLAGS) dvi \ + && $(MAKE) $(AM_MAKEFLAGS) check \ + && $(MAKE) $(AM_MAKEFLAGS) install \ + && $(MAKE) $(AM_MAKEFLAGS) installcheck \ + && $(MAKE) $(AM_MAKEFLAGS) uninstall \ + && $(MAKE) $(AM_MAKEFLAGS) distuninstallcheck_dir="$$dc_install_base" \ + distuninstallcheck \ + && chmod -R a-w "$$dc_install_base" \ + && ({ \ + (cd ../.. && umask 077 && mkdir "$$dc_destdir") \ + && $(MAKE) $(AM_MAKEFLAGS) DESTDIR="$$dc_destdir" install \ + && $(MAKE) $(AM_MAKEFLAGS) DESTDIR="$$dc_destdir" uninstall \ + && $(MAKE) $(AM_MAKEFLAGS) DESTDIR="$$dc_destdir" \ + distuninstallcheck_dir="$$dc_destdir" distuninstallcheck; \ + } || { rm -rf "$$dc_destdir"; exit 1; }) \ + && rm -rf "$$dc_destdir" \ + && $(MAKE) $(AM_MAKEFLAGS) dist \ + && rm -rf $(DIST_ARCHIVES) \ + && $(MAKE) $(AM_MAKEFLAGS) distcleancheck \ + && cd "$$am__cwd" \ + || exit 1 + $(am__remove_distdir) + @(echo "$(distdir) archives ready for distribution: "; \ + list='$(DIST_ARCHIVES)'; for i in $$list; do echo $$i; done) | \ + sed -e 1h -e 1s/./=/g -e 1p -e 1x -e '$$p' -e '$$x' +distuninstallcheck: + @$(am__cd) '$(distuninstallcheck_dir)' \ + && test `$(distuninstallcheck_listfiles) | wc -l` -le 1 \ + || { echo "ERROR: files left after uninstall:" ; \ + if test -n "$(DESTDIR)"; then \ + echo " (check DESTDIR support)"; \ + fi ; \ + $(distuninstallcheck_listfiles) ; \ + exit 1; } >&2 +distcleancheck: distclean + @if test '$(srcdir)' = . ; then \ + echo "ERROR: distcleancheck can only run from a VPATH build" ; \ + exit 1 ; \ + fi + @test `$(distcleancheck_listfiles) | wc -l` -eq 0 \ + || { echo "ERROR: files left in build directory after distclean:" ; \ + $(distcleancheck_listfiles) ; \ + exit 1; } >&2 check-am: all-am check: check-recursive -all-am: Makefile all-local +all-am: Makefile config.h all-local installdirs: installdirs-recursive installdirs-am: install: install-recursive @@ -607,8 +639,10 @@ clean: clean-recursive clean-am: clean-generic clean-libtool mostlyclean-am distclean: distclean-recursive + -rm -f $(am__CONFIG_DISTCLEAN_FILES) -rm -f Makefile -distclean-am: clean-am distclean-generic distclean-tags +distclean-am: clean-am distclean-generic distclean-hdr \ + distclean-libtool distclean-tags dvi: dvi-recursive @@ -651,6 +685,8 @@ install-ps-am: installcheck-am: maintainer-clean: maintainer-clean-recursive + -rm -f $(am__CONFIG_DISTCLEAN_FILES) + -rm -rf $(top_srcdir)/autom4te.cache -rm -f Makefile maintainer-clean-am: distclean-am maintainer-clean-generic @@ -668,22 +704,25 @@ ps-am: uninstall-am: -.MAKE: $(RECURSIVE_CLEAN_TARGETS) $(RECURSIVE_TARGETS) ctags-recursive \ - install-am install-strip tags-recursive +.MAKE: $(RECURSIVE_CLEAN_TARGETS) $(RECURSIVE_TARGETS) all \ + ctags-recursive install-am install-strip tags-recursive .PHONY: $(RECURSIVE_CLEAN_TARGETS) $(RECURSIVE_TARGETS) CTAGS GTAGS \ - all all-am all-local check check-am clean clean-generic \ - clean-libtool ctags ctags-recursive distclean \ - distclean-generic distclean-libtool distclean-tags distdir dvi \ - dvi-am html html-am info info-am install install-am \ - install-data install-data-am install-dvi install-dvi-am \ - install-exec install-exec-am install-html install-html-am \ - install-info install-info-am install-man install-pdf \ - install-pdf-am install-ps install-ps-am install-strip \ - installcheck installcheck-am installdirs installdirs-am \ - maintainer-clean maintainer-clean-generic mostlyclean \ - mostlyclean-generic mostlyclean-libtool pdf pdf-am ps ps-am \ - tags tags-recursive uninstall uninstall-am + all all-am all-local am--refresh check check-am clean \ + clean-generic clean-libtool ctags ctags-recursive dist \ + dist-all dist-bzip2 dist-gzip dist-lzma dist-shar dist-tarZ \ + dist-xz dist-zip distcheck distclean distclean-generic \ + distclean-hdr distclean-libtool distclean-tags distcleancheck \ + distdir distuninstallcheck dvi dvi-am html html-am info \ + info-am install install-am install-data install-data-am \ + install-dvi install-dvi-am install-exec install-exec-am \ + install-html install-html-am install-info install-info-am \ + install-man install-pdf install-pdf-am install-ps \ + install-ps-am install-strip installcheck installcheck-am \ + installdirs installdirs-am maintainer-clean \ + maintainer-clean-generic mostlyclean mostlyclean-generic \ + mostlyclean-libtool pdf pdf-am ps ps-am tags tags-recursive \ + uninstall uninstall-am all-local: Solver diff --git a/src/prop/cryptominisat/Solver/Makefile.in b/src/prop/cryptominisat/Solver/Makefile.in index 02344edd7..dd524fba2 100644 --- a/src/prop/cryptominisat/Solver/Makefile.in +++ b/src/prop/cryptominisat/Solver/Makefile.in @@ -36,29 +36,16 @@ PRE_UNINSTALL = : POST_UNINSTALL = : build_triplet = @build@ host_triplet = @host@ -target_triplet = @target@ bin_PROGRAMS = cryptominisat$(EXEEXT) -subdir = src/prop/cryptominisat/Solver +subdir = Solver DIST_COMMON = $(pkgincludesub_HEADERS) $(srcdir)/Makefile.am \ $(srcdir)/Makefile.in ACLOCAL_M4 = $(top_srcdir)/aclocal.m4 -am__aclocal_m4_deps = $(top_srcdir)/config/antlr.m4 \ - $(top_srcdir)/config/ax_prog_doxygen.m4 \ - $(top_srcdir)/config/ax_tls.m4 \ - $(top_srcdir)/config/bindings.m4 $(top_srcdir)/config/boost.m4 \ - $(top_srcdir)/config/cudd.m4 $(top_srcdir)/config/cvc4.m4 \ - $(top_srcdir)/config/gcc_version.m4 \ - $(top_srcdir)/config/libtool.m4 \ - $(top_srcdir)/config/ltoptions.m4 \ - $(top_srcdir)/config/ltsugar.m4 \ - $(top_srcdir)/config/ltversion.m4 \ - $(top_srcdir)/config/lt~obsolete.m4 \ - $(top_srcdir)/config/pkg.m4 $(top_srcdir)/config/readline.m4 \ - $(top_srcdir)/configure.ac +am__aclocal_m4_deps = $(top_srcdir)/configure.in am__configure_deps = $(am__aclocal_m4_deps) $(CONFIGURE_DEPENDENCIES) \ $(ACLOCAL_M4) mkinstalldirs = $(install_sh) -d -CONFIG_HEADER = $(top_builddir)/cvc4autoconfig.h +CONFIG_HEADER = $(top_builddir)/config.h CONFIG_CLEAN_FILES = CONFIG_CLEAN_VPATH_FILES = am__vpath_adj_setup = srcdirstrip=`echo "$(srcdir)" | sed 's|.|.|g'`; @@ -94,47 +81,29 @@ am_libcryptominisat_la_OBJECTS = ClauseCleaner.lo FailedLitSearcher.lo \ ClauseVivifier.lo CompleteDetachReattacher.lo DimacsParser.lo \ OnlyNonLearntBins.lo SolverConf.lo DataSync.lo BothCache.lo libcryptominisat_la_OBJECTS = $(am_libcryptominisat_la_OBJECTS) -AM_V_lt = $(am__v_lt_$(V)) -am__v_lt_ = $(am__v_lt_$(AM_DEFAULT_VERBOSITY)) -am__v_lt_0 = --silent -libcryptominisat_la_LINK = $(LIBTOOL) $(AM_V_lt) --tag=CXX \ - $(AM_LIBTOOLFLAGS) $(LIBTOOLFLAGS) --mode=link $(CXXLD) \ - $(AM_CXXFLAGS) $(CXXFLAGS) $(libcryptominisat_la_LDFLAGS) \ - $(LDFLAGS) -o $@ +libcryptominisat_la_LINK = $(LIBTOOL) --tag=CXX $(AM_LIBTOOLFLAGS) \ + $(LIBTOOLFLAGS) --mode=link $(CXXLD) $(AM_CXXFLAGS) \ + $(CXXFLAGS) $(libcryptominisat_la_LDFLAGS) $(LDFLAGS) -o $@ PROGRAMS = $(bin_PROGRAMS) am_cryptominisat_OBJECTS = Main.$(OBJEXT) cryptominisat_OBJECTS = $(am_cryptominisat_OBJECTS) cryptominisat_DEPENDENCIES = libcryptominisat.la -cryptominisat_LINK = $(LIBTOOL) $(AM_V_lt) --tag=CXX \ - $(AM_LIBTOOLFLAGS) $(LIBTOOLFLAGS) --mode=link $(CXXLD) \ - $(AM_CXXFLAGS) $(CXXFLAGS) $(cryptominisat_LDFLAGS) $(LDFLAGS) \ - -o $@ +cryptominisat_LINK = $(LIBTOOL) --tag=CXX $(AM_LIBTOOLFLAGS) \ + $(LIBTOOLFLAGS) --mode=link $(CXXLD) $(AM_CXXFLAGS) \ + $(CXXFLAGS) $(cryptominisat_LDFLAGS) $(LDFLAGS) -o $@ DEFAULT_INCLUDES = -I.@am__isrc@ -I$(top_builddir) -depcomp = $(SHELL) $(top_srcdir)/config/depcomp +depcomp = $(SHELL) $(top_srcdir)/depcomp am__depfiles_maybe = depfiles am__mv = mv -f CXXCOMPILE = $(CXX) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) \ $(AM_CPPFLAGS) $(CPPFLAGS) $(AM_CXXFLAGS) $(CXXFLAGS) -LTCXXCOMPILE = $(LIBTOOL) $(AM_V_lt) --tag=CXX $(AM_LIBTOOLFLAGS) \ - $(LIBTOOLFLAGS) --mode=compile $(CXX) $(DEFS) \ - $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) \ - $(AM_CXXFLAGS) $(CXXFLAGS) -AM_V_CXX = $(am__v_CXX_$(V)) -am__v_CXX_ = $(am__v_CXX_$(AM_DEFAULT_VERBOSITY)) -am__v_CXX_0 = @echo " CXX " $@; -AM_V_at = $(am__v_at_$(V)) -am__v_at_ = $(am__v_at_$(AM_DEFAULT_VERBOSITY)) -am__v_at_0 = @ +LTCXXCOMPILE = $(LIBTOOL) --tag=CXX $(AM_LIBTOOLFLAGS) $(LIBTOOLFLAGS) \ + --mode=compile $(CXX) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) \ + $(AM_CPPFLAGS) $(CPPFLAGS) $(AM_CXXFLAGS) $(CXXFLAGS) CXXLD = $(CXX) -CXXLINK = $(LIBTOOL) $(AM_V_lt) --tag=CXX $(AM_LIBTOOLFLAGS) \ - $(LIBTOOLFLAGS) --mode=link $(CXXLD) $(AM_CXXFLAGS) \ - $(CXXFLAGS) $(AM_LDFLAGS) $(LDFLAGS) -o $@ -AM_V_CXXLD = $(am__v_CXXLD_$(V)) -am__v_CXXLD_ = $(am__v_CXXLD_$(AM_DEFAULT_VERBOSITY)) -am__v_CXXLD_0 = @echo " CXXLD " $@; -AM_V_GEN = $(am__v_GEN_$(V)) -am__v_GEN_ = $(am__v_GEN_$(AM_DEFAULT_VERBOSITY)) -am__v_GEN_0 = @echo " GEN " $@; +CXXLINK = $(LIBTOOL) --tag=CXX $(AM_LIBTOOLFLAGS) $(LIBTOOLFLAGS) \ + --mode=link $(CXXLD) $(AM_CXXFLAGS) $(CXXFLAGS) $(AM_LDFLAGS) \ + $(LDFLAGS) -o $@ SOURCES = $(libcryptominisat_la_SOURCES) $(cryptominisat_SOURCES) DIST_SOURCES = $(libcryptominisat_la_SOURCES) $(cryptominisat_SOURCES) HEADERS = $(pkgincludesub_HEADERS) @@ -143,128 +112,54 @@ CTAGS = ctags DISTFILES = $(DIST_COMMON) $(DIST_SOURCES) $(TEXINFOS) $(EXTRA_DIST) ACLOCAL = @ACLOCAL@ AMTAR = @AMTAR@ -AM_DEFAULT_VERBOSITY = @AM_DEFAULT_VERBOSITY@ -ANTLR = @ANTLR@ -ANTLR_HOME = @ANTLR_HOME@ -ANTLR_INCLUDES = @ANTLR_INCLUDES@ -ANTLR_LDFLAGS = @ANTLR_LDFLAGS@ AR = @AR@ -AS = @AS@ AUTOCONF = @AUTOCONF@ AUTOHEADER = @AUTOHEADER@ AUTOMAKE = @AUTOMAKE@ AWK = @AWK@ -BOOST_CPPFLAGS = @BOOST_CPPFLAGS@ -BOOST_LDPATH = @BOOST_LDPATH@ -BOOST_ROOT = @BOOST_ROOT@ -BOOST_THREAD_LDFLAGS = @BOOST_THREAD_LDFLAGS@ -BOOST_THREAD_LDPATH = @BOOST_THREAD_LDPATH@ -BOOST_THREAD_LIBS = @BOOST_THREAD_LIBS@ -BUILDING_SHARED = @BUILDING_SHARED@ -BUILDING_STATIC = @BUILDING_STATIC@ -CAMLP4O = @CAMLP4O@ CC = @CC@ CCDEPMODE = @CCDEPMODE@ CFLAGS = @CFLAGS@ -CLN_CFLAGS = @CLN_CFLAGS@ -CLN_LIBS = @CLN_LIBS@ CPP = @CPP@ CPPFLAGS = @CPPFLAGS@ -CSHARP_CPPFLAGS = @CSHARP_CPPFLAGS@ -CUDD_CPPFLAGS = @CUDD_CPPFLAGS@ -CUDD_LDFLAGS = @CUDD_LDFLAGS@ -CUDD_LIBS = @CUDD_LIBS@ -CVC4_BINDINGS_LIBRARY_VERSION = @CVC4_BINDINGS_LIBRARY_VERSION@ -CVC4_BUILD_LIBCOMPAT = @CVC4_BUILD_LIBCOMPAT@ -CVC4_COMPAT_LIBRARY_VERSION = @CVC4_COMPAT_LIBRARY_VERSION@ -CVC4_HAS_THREADS = @CVC4_HAS_THREADS@ -CVC4_LANGUAGE_BINDINGS = @CVC4_LANGUAGE_BINDINGS@ -CVC4_LIBRARY_VERSION = @CVC4_LIBRARY_VERSION@ -CVC4_PARSER_LIBRARY_VERSION = @CVC4_PARSER_LIBRARY_VERSION@ -CVC4_TLS = @CVC4_TLS@ -CVC4_TLS_SUPPORTED = @CVC4_TLS_SUPPORTED@ -CVC4_USE_CLN_IMP = @CVC4_USE_CLN_IMP@ -CVC4_USE_GMP_IMP = @CVC4_USE_GMP_IMP@ CXX = @CXX@ CXXCPP = @CXXCPP@ CXXDEPMODE = @CXXDEPMODE@ CXXFLAGS = @CXXFLAGS@ -CXXTEST = @CXXTEST@ -CXXTESTGEN = @CXXTESTGEN@ CYGPATH_W = @CYGPATH_W@ DEFS = @DEFS@ DEPDIR = @DEPDIR@ -DISTCHECK_CONFIGURE_FLAGS = @DISTCHECK_CONFIGURE_FLAGS@ DLLTOOL = @DLLTOOL@ -DOXYGEN_EXTRACT_PRIVATE = @DOXYGEN_EXTRACT_PRIVATE@ -DOXYGEN_EXTRACT_STATIC = @DOXYGEN_EXTRACT_STATIC@ -DOXYGEN_PAPER_SIZE = @DOXYGEN_PAPER_SIZE@ DSYMUTIL = @DSYMUTIL@ DUMPBIN = @DUMPBIN@ -DX_CONFIG = @DX_CONFIG@ -DX_DOCDIR = @DX_DOCDIR@ -DX_DOT = @DX_DOT@ -DX_DOXYGEN = @DX_DOXYGEN@ -DX_DVIPS = @DX_DVIPS@ -DX_EGREP = @DX_EGREP@ -DX_ENV = @DX_ENV@ -DX_FLAG_DX_CURRENT_FEATURE = @DX_FLAG_DX_CURRENT_FEATURE@ -DX_FLAG_chi = @DX_FLAG_chi@ -DX_FLAG_chm = @DX_FLAG_chm@ -DX_FLAG_doc = @DX_FLAG_doc@ -DX_FLAG_dot = @DX_FLAG_dot@ -DX_FLAG_html = @DX_FLAG_html@ -DX_FLAG_man = @DX_FLAG_man@ -DX_FLAG_pdf = @DX_FLAG_pdf@ -DX_FLAG_ps = @DX_FLAG_ps@ -DX_FLAG_rtf = @DX_FLAG_rtf@ -DX_FLAG_xml = @DX_FLAG_xml@ -DX_HHC = @DX_HHC@ -DX_LATEX = @DX_LATEX@ -DX_MAKEINDEX = @DX_MAKEINDEX@ -DX_PDFLATEX = @DX_PDFLATEX@ -DX_PERL = @DX_PERL@ -DX_PROJECT = @DX_PROJECT@ ECHO_C = @ECHO_C@ ECHO_N = @ECHO_N@ ECHO_T = @ECHO_T@ EGREP = @EGREP@ EXEEXT = @EXEEXT@ FGREP = @FGREP@ -FLAG_VISIBILITY_HIDDEN = @FLAG_VISIBILITY_HIDDEN@ GREP = @GREP@ INSTALL = @INSTALL@ INSTALL_DATA = @INSTALL_DATA@ INSTALL_PROGRAM = @INSTALL_PROGRAM@ INSTALL_SCRIPT = @INSTALL_SCRIPT@ INSTALL_STRIP_PROGRAM = @INSTALL_STRIP_PROGRAM@ -JAR = @JAR@ -JAVA = @JAVA@ -JAVAC = @JAVAC@ -JAVAH = @JAVAH@ -JAVA_CPPFLAGS = @JAVA_CPPFLAGS@ LD = @LD@ LDFLAGS = @LDFLAGS@ -LFSC = @LFSC@ -LFSCARGS = @LFSCARGS@ LIBOBJS = @LIBOBJS@ LIBS = @LIBS@ LIBTOOL = @LIBTOOL@ LIPO = @LIPO@ LN_S = @LN_S@ LTLIBOBJS = @LTLIBOBJS@ -MAINT = @MAINT@ MAKEINFO = @MAKEINFO@ MANIFEST_TOOL = @MANIFEST_TOOL@ -MAN_DATE = @MAN_DATE@ MKDIR_P = @MKDIR_P@ NM = @NM@ NMEDIT = @NMEDIT@ OBJDUMP = @OBJDUMP@ OBJEXT = @OBJEXT@ -OCAMLC = @OCAMLC@ -OCAMLFIND = @OCAMLFIND@ -OCAMLMKTOP = @OCAMLMKTOP@ +OPENMP_CXXFLAGS = @OPENMP_CXXFLAGS@ OTOOL = @OTOOL@ OTOOL64 = @OTOOL64@ PACKAGE = @PACKAGE@ @@ -275,33 +170,12 @@ PACKAGE_TARNAME = @PACKAGE_TARNAME@ PACKAGE_URL = @PACKAGE_URL@ PACKAGE_VERSION = @PACKAGE_VERSION@ PATH_SEPARATOR = @PATH_SEPARATOR@ -PERL = @PERL@ -PERL_CPPFLAGS = @PERL_CPPFLAGS@ -PHP_CPPFLAGS = @PHP_CPPFLAGS@ -PKG_CONFIG = @PKG_CONFIG@ -PYTHON = @PYTHON@ -PYTHON_CONFIG = @PYTHON_CONFIG@ -PYTHON_CXXFLAGS = @PYTHON_CXXFLAGS@ -PYTHON_EXEC_PREFIX = @PYTHON_EXEC_PREFIX@ -PYTHON_INCLUDE = @PYTHON_INCLUDE@ -PYTHON_PLATFORM = @PYTHON_PLATFORM@ -PYTHON_PREFIX = @PYTHON_PREFIX@ -PYTHON_VERSION = @PYTHON_VERSION@ RANLIB = @RANLIB@ -READLINE_LIBS = @READLINE_LIBS@ -RUBY_CPPFLAGS = @RUBY_CPPFLAGS@ SED = @SED@ SET_MAKE = @SET_MAKE@ SHELL = @SHELL@ -STATIC_BINARY = @STATIC_BINARY@ STRIP = @STRIP@ -SWIG = @SWIG@ -TCL_CPPFLAGS = @TCL_CPPFLAGS@ -TEST_CPPFLAGS = @TEST_CPPFLAGS@ -TEST_CXXFLAGS = @TEST_CXXFLAGS@ -TEST_LDFLAGS = @TEST_LDFLAGS@ VERSION = @VERSION@ -WNO_CONVERSION_NULL = @WNO_CONVERSION_NULL@ abs_builddir = @abs_builddir@ abs_srcdir = @abs_srcdir@ abs_top_builddir = @abs_top_builddir@ @@ -341,26 +215,17 @@ libexecdir = @libexecdir@ localedir = @localedir@ localstatedir = @localstatedir@ mandir = @mandir@ -mk_include = @mk_include@ mkdir_p = @mkdir_p@ oldincludedir = @oldincludedir@ pdfdir = @pdfdir@ -pkgpyexecdir = @pkgpyexecdir@ -pkgpythondir = @pkgpythondir@ prefix = @prefix@ program_transform_name = @program_transform_name@ psdir = @psdir@ -pyexecdir = @pyexecdir@ -pythondir = @pythondir@ sbindir = @sbindir@ sharedstatedir = @sharedstatedir@ srcdir = @srcdir@ sysconfdir = @sysconfdir@ -target = @target@ target_alias = @target_alias@ -target_cpu = @target_cpu@ -target_os = @target_os@ -target_vendor = @target_vendor@ top_build_prefix = @top_build_prefix@ top_builddir = @top_builddir@ top_srcdir = @top_srcdir@ @@ -398,7 +263,7 @@ all: all-am .SUFFIXES: .SUFFIXES: .cpp .lo .o .obj -$(srcdir)/Makefile.in: @MAINTAINER_MODE_TRUE@ $(srcdir)/Makefile.am $(am__configure_deps) +$(srcdir)/Makefile.in: $(srcdir)/Makefile.am $(am__configure_deps) @for dep in $?; do \ case '$(am__configure_deps)' in \ *$$dep*) \ @@ -407,9 +272,9 @@ $(srcdir)/Makefile.in: @MAINTAINER_MODE_TRUE@ $(srcdir)/Makefile.am $(am__confi exit 1;; \ esac; \ done; \ - echo ' cd $(top_srcdir) && $(AUTOMAKE) --foreign src/prop/cryptominisat/Solver/Makefile'; \ + echo ' cd $(top_srcdir) && $(AUTOMAKE) --gnu Solver/Makefile'; \ $(am__cd) $(top_srcdir) && \ - $(AUTOMAKE) --foreign src/prop/cryptominisat/Solver/Makefile + $(AUTOMAKE) --gnu Solver/Makefile .PRECIOUS: Makefile Makefile: $(srcdir)/Makefile.in $(top_builddir)/config.status @case '$?' in \ @@ -423,9 +288,9 @@ Makefile: $(srcdir)/Makefile.in $(top_builddir)/config.status $(top_builddir)/config.status: $(top_srcdir)/configure $(CONFIG_STATUS_DEPENDENCIES) cd $(top_builddir) && $(MAKE) $(AM_MAKEFLAGS) am--refresh -$(top_srcdir)/configure: @MAINTAINER_MODE_TRUE@ $(am__configure_deps) +$(top_srcdir)/configure: $(am__configure_deps) cd $(top_builddir) && $(MAKE) $(AM_MAKEFLAGS) am--refresh -$(ACLOCAL_M4): @MAINTAINER_MODE_TRUE@ $(am__aclocal_m4_deps) +$(ACLOCAL_M4): $(am__aclocal_m4_deps) cd $(top_builddir) && $(MAKE) $(AM_MAKEFLAGS) am--refresh $(am__aclocal_m4_deps): install-libLTLIBRARIES: $(lib_LTLIBRARIES) @@ -460,7 +325,7 @@ clean-libLTLIBRARIES: rm -f "$${dir}/so_locations"; \ done libcryptominisat.la: $(libcryptominisat_la_OBJECTS) $(libcryptominisat_la_DEPENDENCIES) - $(AM_V_CXXLD)$(libcryptominisat_la_LINK) -rpath $(libdir) $(libcryptominisat_la_OBJECTS) $(libcryptominisat_la_LIBADD) $(LIBS) + $(libcryptominisat_la_LINK) -rpath $(libdir) $(libcryptominisat_la_OBJECTS) $(libcryptominisat_la_LIBADD) $(LIBS) install-binPROGRAMS: $(bin_PROGRAMS) @$(NORMAL_INSTALL) test -z "$(bindir)" || $(MKDIR_P) "$(DESTDIR)$(bindir)" @@ -506,7 +371,7 @@ clean-binPROGRAMS: rm -f $$list cryptominisat$(EXEEXT): $(cryptominisat_OBJECTS) $(cryptominisat_DEPENDENCIES) @rm -f cryptominisat$(EXEEXT) - $(AM_V_CXXLD)$(cryptominisat_LINK) $(cryptominisat_OBJECTS) $(cryptominisat_LDADD) $(LIBS) + $(cryptominisat_LINK) $(cryptominisat_OBJECTS) $(cryptominisat_LDADD) $(LIBS) mostlyclean-compile: -rm -f *.$(OBJEXT) @@ -541,25 +406,22 @@ distclean-compile: @AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/XorSubsumer.Plo@am__quote@ .cpp.o: -@am__fastdepCXX_TRUE@ $(AM_V_CXX)$(CXXCOMPILE) -MT $@ -MD -MP -MF $(DEPDIR)/$*.Tpo -c -o $@ $< -@am__fastdepCXX_TRUE@ $(AM_V_at)$(am__mv) $(DEPDIR)/$*.Tpo $(DEPDIR)/$*.Po -@am__fastdepCXX_FALSE@ $(AM_V_CXX) @AM_BACKSLASH@ +@am__fastdepCXX_TRUE@ $(CXXCOMPILE) -MT $@ -MD -MP -MF $(DEPDIR)/$*.Tpo -c -o $@ $< +@am__fastdepCXX_TRUE@ $(am__mv) $(DEPDIR)/$*.Tpo $(DEPDIR)/$*.Po @AMDEP_TRUE@@am__fastdepCXX_FALSE@ source='$<' object='$@' libtool=no @AMDEPBACKSLASH@ @AMDEP_TRUE@@am__fastdepCXX_FALSE@ DEPDIR=$(DEPDIR) $(CXXDEPMODE) $(depcomp) @AMDEPBACKSLASH@ @am__fastdepCXX_FALSE@ $(CXXCOMPILE) -c -o $@ $< .cpp.obj: -@am__fastdepCXX_TRUE@ $(AM_V_CXX)$(CXXCOMPILE) -MT $@ -MD -MP -MF $(DEPDIR)/$*.Tpo -c -o $@ `$(CYGPATH_W) '$<'` -@am__fastdepCXX_TRUE@ $(AM_V_at)$(am__mv) $(DEPDIR)/$*.Tpo $(DEPDIR)/$*.Po -@am__fastdepCXX_FALSE@ $(AM_V_CXX) @AM_BACKSLASH@ +@am__fastdepCXX_TRUE@ $(CXXCOMPILE) -MT $@ -MD -MP -MF $(DEPDIR)/$*.Tpo -c -o $@ `$(CYGPATH_W) '$<'` +@am__fastdepCXX_TRUE@ $(am__mv) $(DEPDIR)/$*.Tpo $(DEPDIR)/$*.Po @AMDEP_TRUE@@am__fastdepCXX_FALSE@ source='$<' object='$@' libtool=no @AMDEPBACKSLASH@ @AMDEP_TRUE@@am__fastdepCXX_FALSE@ DEPDIR=$(DEPDIR) $(CXXDEPMODE) $(depcomp) @AMDEPBACKSLASH@ @am__fastdepCXX_FALSE@ $(CXXCOMPILE) -c -o $@ `$(CYGPATH_W) '$<'` .cpp.lo: -@am__fastdepCXX_TRUE@ $(AM_V_CXX)$(LTCXXCOMPILE) -MT $@ -MD -MP -MF $(DEPDIR)/$*.Tpo -c -o $@ $< -@am__fastdepCXX_TRUE@ $(AM_V_at)$(am__mv) $(DEPDIR)/$*.Tpo $(DEPDIR)/$*.Plo -@am__fastdepCXX_FALSE@ $(AM_V_CXX) @AM_BACKSLASH@ +@am__fastdepCXX_TRUE@ $(LTCXXCOMPILE) -MT $@ -MD -MP -MF $(DEPDIR)/$*.Tpo -c -o $@ $< +@am__fastdepCXX_TRUE@ $(am__mv) $(DEPDIR)/$*.Tpo $(DEPDIR)/$*.Plo @AMDEP_TRUE@@am__fastdepCXX_FALSE@ source='$<' object='$@' libtool=yes @AMDEPBACKSLASH@ @AMDEP_TRUE@@am__fastdepCXX_FALSE@ DEPDIR=$(DEPDIR) $(CXXDEPMODE) $(depcomp) @AMDEPBACKSLASH@ @am__fastdepCXX_FALSE@ $(LTCXXCOMPILE) -c -o $@ $< diff --git a/src/prop/cryptominisat/man/Makefile.in b/src/prop/cryptominisat/man/Makefile.in index 7dc705cf1..5542511eb 100644 --- a/src/prop/cryptominisat/man/Makefile.in +++ b/src/prop/cryptominisat/man/Makefile.in @@ -33,35 +33,16 @@ PRE_UNINSTALL = : POST_UNINSTALL = : build_triplet = @build@ host_triplet = @host@ -target_triplet = @target@ -subdir = src/prop/cryptominisat/man +subdir = man DIST_COMMON = $(srcdir)/Makefile.am $(srcdir)/Makefile.in ACLOCAL_M4 = $(top_srcdir)/aclocal.m4 -am__aclocal_m4_deps = $(top_srcdir)/config/antlr.m4 \ - $(top_srcdir)/config/ax_prog_doxygen.m4 \ - $(top_srcdir)/config/ax_tls.m4 \ - $(top_srcdir)/config/bindings.m4 $(top_srcdir)/config/boost.m4 \ - $(top_srcdir)/config/cudd.m4 $(top_srcdir)/config/cvc4.m4 \ - $(top_srcdir)/config/gcc_version.m4 \ - $(top_srcdir)/config/libtool.m4 \ - $(top_srcdir)/config/ltoptions.m4 \ - $(top_srcdir)/config/ltsugar.m4 \ - $(top_srcdir)/config/ltversion.m4 \ - $(top_srcdir)/config/lt~obsolete.m4 \ - $(top_srcdir)/config/pkg.m4 $(top_srcdir)/config/readline.m4 \ - $(top_srcdir)/configure.ac +am__aclocal_m4_deps = $(top_srcdir)/configure.in am__configure_deps = $(am__aclocal_m4_deps) $(CONFIGURE_DEPENDENCIES) \ $(ACLOCAL_M4) mkinstalldirs = $(install_sh) -d -CONFIG_HEADER = $(top_builddir)/cvc4autoconfig.h +CONFIG_HEADER = $(top_builddir)/config.h CONFIG_CLEAN_FILES = CONFIG_CLEAN_VPATH_FILES = -AM_V_GEN = $(am__v_GEN_$(V)) -am__v_GEN_ = $(am__v_GEN_$(AM_DEFAULT_VERBOSITY)) -am__v_GEN_0 = @echo " GEN " $@; -AM_V_at = $(am__v_at_$(V)) -am__v_at_ = $(am__v_at_$(AM_DEFAULT_VERBOSITY)) -am__v_at_0 = @ SOURCES = DIST_SOURCES = am__vpath_adj_setup = srcdirstrip=`echo "$(srcdir)" | sed 's|.|.|g'`; @@ -92,128 +73,54 @@ MANS = $(man_MANS) DISTFILES = $(DIST_COMMON) $(DIST_SOURCES) $(TEXINFOS) $(EXTRA_DIST) ACLOCAL = @ACLOCAL@ AMTAR = @AMTAR@ -AM_DEFAULT_VERBOSITY = @AM_DEFAULT_VERBOSITY@ -ANTLR = @ANTLR@ -ANTLR_HOME = @ANTLR_HOME@ -ANTLR_INCLUDES = @ANTLR_INCLUDES@ -ANTLR_LDFLAGS = @ANTLR_LDFLAGS@ AR = @AR@ -AS = @AS@ AUTOCONF = @AUTOCONF@ AUTOHEADER = @AUTOHEADER@ AUTOMAKE = @AUTOMAKE@ AWK = @AWK@ -BOOST_CPPFLAGS = @BOOST_CPPFLAGS@ -BOOST_LDPATH = @BOOST_LDPATH@ -BOOST_ROOT = @BOOST_ROOT@ -BOOST_THREAD_LDFLAGS = @BOOST_THREAD_LDFLAGS@ -BOOST_THREAD_LDPATH = @BOOST_THREAD_LDPATH@ -BOOST_THREAD_LIBS = @BOOST_THREAD_LIBS@ -BUILDING_SHARED = @BUILDING_SHARED@ -BUILDING_STATIC = @BUILDING_STATIC@ -CAMLP4O = @CAMLP4O@ CC = @CC@ CCDEPMODE = @CCDEPMODE@ CFLAGS = @CFLAGS@ -CLN_CFLAGS = @CLN_CFLAGS@ -CLN_LIBS = @CLN_LIBS@ CPP = @CPP@ CPPFLAGS = @CPPFLAGS@ -CSHARP_CPPFLAGS = @CSHARP_CPPFLAGS@ -CUDD_CPPFLAGS = @CUDD_CPPFLAGS@ -CUDD_LDFLAGS = @CUDD_LDFLAGS@ -CUDD_LIBS = @CUDD_LIBS@ -CVC4_BINDINGS_LIBRARY_VERSION = @CVC4_BINDINGS_LIBRARY_VERSION@ -CVC4_BUILD_LIBCOMPAT = @CVC4_BUILD_LIBCOMPAT@ -CVC4_COMPAT_LIBRARY_VERSION = @CVC4_COMPAT_LIBRARY_VERSION@ -CVC4_HAS_THREADS = @CVC4_HAS_THREADS@ -CVC4_LANGUAGE_BINDINGS = @CVC4_LANGUAGE_BINDINGS@ -CVC4_LIBRARY_VERSION = @CVC4_LIBRARY_VERSION@ -CVC4_PARSER_LIBRARY_VERSION = @CVC4_PARSER_LIBRARY_VERSION@ -CVC4_TLS = @CVC4_TLS@ -CVC4_TLS_SUPPORTED = @CVC4_TLS_SUPPORTED@ -CVC4_USE_CLN_IMP = @CVC4_USE_CLN_IMP@ -CVC4_USE_GMP_IMP = @CVC4_USE_GMP_IMP@ CXX = @CXX@ CXXCPP = @CXXCPP@ CXXDEPMODE = @CXXDEPMODE@ CXXFLAGS = @CXXFLAGS@ -CXXTEST = @CXXTEST@ -CXXTESTGEN = @CXXTESTGEN@ CYGPATH_W = @CYGPATH_W@ DEFS = @DEFS@ DEPDIR = @DEPDIR@ -DISTCHECK_CONFIGURE_FLAGS = @DISTCHECK_CONFIGURE_FLAGS@ DLLTOOL = @DLLTOOL@ -DOXYGEN_EXTRACT_PRIVATE = @DOXYGEN_EXTRACT_PRIVATE@ -DOXYGEN_EXTRACT_STATIC = @DOXYGEN_EXTRACT_STATIC@ -DOXYGEN_PAPER_SIZE = @DOXYGEN_PAPER_SIZE@ DSYMUTIL = @DSYMUTIL@ DUMPBIN = @DUMPBIN@ -DX_CONFIG = @DX_CONFIG@ -DX_DOCDIR = @DX_DOCDIR@ -DX_DOT = @DX_DOT@ -DX_DOXYGEN = @DX_DOXYGEN@ -DX_DVIPS = @DX_DVIPS@ -DX_EGREP = @DX_EGREP@ -DX_ENV = @DX_ENV@ -DX_FLAG_DX_CURRENT_FEATURE = @DX_FLAG_DX_CURRENT_FEATURE@ -DX_FLAG_chi = @DX_FLAG_chi@ -DX_FLAG_chm = @DX_FLAG_chm@ -DX_FLAG_doc = @DX_FLAG_doc@ -DX_FLAG_dot = @DX_FLAG_dot@ -DX_FLAG_html = @DX_FLAG_html@ -DX_FLAG_man = @DX_FLAG_man@ -DX_FLAG_pdf = @DX_FLAG_pdf@ -DX_FLAG_ps = @DX_FLAG_ps@ -DX_FLAG_rtf = @DX_FLAG_rtf@ -DX_FLAG_xml = @DX_FLAG_xml@ -DX_HHC = @DX_HHC@ -DX_LATEX = @DX_LATEX@ -DX_MAKEINDEX = @DX_MAKEINDEX@ -DX_PDFLATEX = @DX_PDFLATEX@ -DX_PERL = @DX_PERL@ -DX_PROJECT = @DX_PROJECT@ ECHO_C = @ECHO_C@ ECHO_N = @ECHO_N@ ECHO_T = @ECHO_T@ EGREP = @EGREP@ EXEEXT = @EXEEXT@ FGREP = @FGREP@ -FLAG_VISIBILITY_HIDDEN = @FLAG_VISIBILITY_HIDDEN@ GREP = @GREP@ INSTALL = @INSTALL@ INSTALL_DATA = @INSTALL_DATA@ INSTALL_PROGRAM = @INSTALL_PROGRAM@ INSTALL_SCRIPT = @INSTALL_SCRIPT@ INSTALL_STRIP_PROGRAM = @INSTALL_STRIP_PROGRAM@ -JAR = @JAR@ -JAVA = @JAVA@ -JAVAC = @JAVAC@ -JAVAH = @JAVAH@ -JAVA_CPPFLAGS = @JAVA_CPPFLAGS@ LD = @LD@ LDFLAGS = @LDFLAGS@ -LFSC = @LFSC@ -LFSCARGS = @LFSCARGS@ LIBOBJS = @LIBOBJS@ LIBS = @LIBS@ LIBTOOL = @LIBTOOL@ LIPO = @LIPO@ LN_S = @LN_S@ LTLIBOBJS = @LTLIBOBJS@ -MAINT = @MAINT@ MAKEINFO = @MAKEINFO@ MANIFEST_TOOL = @MANIFEST_TOOL@ -MAN_DATE = @MAN_DATE@ MKDIR_P = @MKDIR_P@ NM = @NM@ NMEDIT = @NMEDIT@ OBJDUMP = @OBJDUMP@ OBJEXT = @OBJEXT@ -OCAMLC = @OCAMLC@ -OCAMLFIND = @OCAMLFIND@ -OCAMLMKTOP = @OCAMLMKTOP@ +OPENMP_CXXFLAGS = @OPENMP_CXXFLAGS@ OTOOL = @OTOOL@ OTOOL64 = @OTOOL64@ PACKAGE = @PACKAGE@ @@ -224,33 +131,12 @@ PACKAGE_TARNAME = @PACKAGE_TARNAME@ PACKAGE_URL = @PACKAGE_URL@ PACKAGE_VERSION = @PACKAGE_VERSION@ PATH_SEPARATOR = @PATH_SEPARATOR@ -PERL = @PERL@ -PERL_CPPFLAGS = @PERL_CPPFLAGS@ -PHP_CPPFLAGS = @PHP_CPPFLAGS@ -PKG_CONFIG = @PKG_CONFIG@ -PYTHON = @PYTHON@ -PYTHON_CONFIG = @PYTHON_CONFIG@ -PYTHON_CXXFLAGS = @PYTHON_CXXFLAGS@ -PYTHON_EXEC_PREFIX = @PYTHON_EXEC_PREFIX@ -PYTHON_INCLUDE = @PYTHON_INCLUDE@ -PYTHON_PLATFORM = @PYTHON_PLATFORM@ -PYTHON_PREFIX = @PYTHON_PREFIX@ -PYTHON_VERSION = @PYTHON_VERSION@ RANLIB = @RANLIB@ -READLINE_LIBS = @READLINE_LIBS@ -RUBY_CPPFLAGS = @RUBY_CPPFLAGS@ SED = @SED@ SET_MAKE = @SET_MAKE@ SHELL = @SHELL@ -STATIC_BINARY = @STATIC_BINARY@ STRIP = @STRIP@ -SWIG = @SWIG@ -TCL_CPPFLAGS = @TCL_CPPFLAGS@ -TEST_CPPFLAGS = @TEST_CPPFLAGS@ -TEST_CXXFLAGS = @TEST_CXXFLAGS@ -TEST_LDFLAGS = @TEST_LDFLAGS@ VERSION = @VERSION@ -WNO_CONVERSION_NULL = @WNO_CONVERSION_NULL@ abs_builddir = @abs_builddir@ abs_srcdir = @abs_srcdir@ abs_top_builddir = @abs_top_builddir@ @@ -290,26 +176,17 @@ libexecdir = @libexecdir@ localedir = @localedir@ localstatedir = @localstatedir@ mandir = @mandir@ -mk_include = @mk_include@ mkdir_p = @mkdir_p@ oldincludedir = @oldincludedir@ pdfdir = @pdfdir@ -pkgpyexecdir = @pkgpyexecdir@ -pkgpythondir = @pkgpythondir@ prefix = @prefix@ program_transform_name = @program_transform_name@ psdir = @psdir@ -pyexecdir = @pyexecdir@ -pythondir = @pythondir@ sbindir = @sbindir@ sharedstatedir = @sharedstatedir@ srcdir = @srcdir@ sysconfdir = @sysconfdir@ -target = @target@ target_alias = @target_alias@ -target_cpu = @target_cpu@ -target_os = @target_os@ -target_vendor = @target_vendor@ top_build_prefix = @top_build_prefix@ top_builddir = @top_builddir@ top_srcdir = @top_srcdir@ @@ -318,7 +195,7 @@ EXTRA_DIST = $(man_MANS) all: all-am .SUFFIXES: -$(srcdir)/Makefile.in: @MAINTAINER_MODE_TRUE@ $(srcdir)/Makefile.am $(am__configure_deps) +$(srcdir)/Makefile.in: $(srcdir)/Makefile.am $(am__configure_deps) @for dep in $?; do \ case '$(am__configure_deps)' in \ *$$dep*) \ @@ -327,9 +204,9 @@ $(srcdir)/Makefile.in: @MAINTAINER_MODE_TRUE@ $(srcdir)/Makefile.am $(am__confi exit 1;; \ esac; \ done; \ - echo ' cd $(top_srcdir) && $(AUTOMAKE) --foreign src/prop/cryptominisat/man/Makefile'; \ + echo ' cd $(top_srcdir) && $(AUTOMAKE) --gnu man/Makefile'; \ $(am__cd) $(top_srcdir) && \ - $(AUTOMAKE) --foreign src/prop/cryptominisat/man/Makefile + $(AUTOMAKE) --gnu man/Makefile .PRECIOUS: Makefile Makefile: $(srcdir)/Makefile.in $(top_builddir)/config.status @case '$?' in \ @@ -343,9 +220,9 @@ Makefile: $(srcdir)/Makefile.in $(top_builddir)/config.status $(top_builddir)/config.status: $(top_srcdir)/configure $(CONFIG_STATUS_DEPENDENCIES) cd $(top_builddir) && $(MAKE) $(AM_MAKEFLAGS) am--refresh -$(top_srcdir)/configure: @MAINTAINER_MODE_TRUE@ $(am__configure_deps) +$(top_srcdir)/configure: $(am__configure_deps) cd $(top_builddir) && $(MAKE) $(AM_MAKEFLAGS) am--refresh -$(ACLOCAL_M4): @MAINTAINER_MODE_TRUE@ $(am__aclocal_m4_deps) +$(ACLOCAL_M4): $(am__aclocal_m4_deps) cd $(top_builddir) && $(MAKE) $(AM_MAKEFLAGS) am--refresh $(am__aclocal_m4_deps): diff --git a/src/prop/cryptominisat/mtl/Makefile.in b/src/prop/cryptominisat/mtl/Makefile.in index 7d8c8ce1b..eb9b73e19 100644 --- a/src/prop/cryptominisat/mtl/Makefile.in +++ b/src/prop/cryptominisat/mtl/Makefile.in @@ -34,36 +34,17 @@ PRE_UNINSTALL = : POST_UNINSTALL = : build_triplet = @build@ host_triplet = @host@ -target_triplet = @target@ -subdir = src/prop/cryptominisat/mtl +subdir = mtl DIST_COMMON = $(pkgincludesub_HEADERS) $(srcdir)/Makefile.am \ $(srcdir)/Makefile.in ACLOCAL_M4 = $(top_srcdir)/aclocal.m4 -am__aclocal_m4_deps = $(top_srcdir)/config/antlr.m4 \ - $(top_srcdir)/config/ax_prog_doxygen.m4 \ - $(top_srcdir)/config/ax_tls.m4 \ - $(top_srcdir)/config/bindings.m4 $(top_srcdir)/config/boost.m4 \ - $(top_srcdir)/config/cudd.m4 $(top_srcdir)/config/cvc4.m4 \ - $(top_srcdir)/config/gcc_version.m4 \ - $(top_srcdir)/config/libtool.m4 \ - $(top_srcdir)/config/ltoptions.m4 \ - $(top_srcdir)/config/ltsugar.m4 \ - $(top_srcdir)/config/ltversion.m4 \ - $(top_srcdir)/config/lt~obsolete.m4 \ - $(top_srcdir)/config/pkg.m4 $(top_srcdir)/config/readline.m4 \ - $(top_srcdir)/configure.ac +am__aclocal_m4_deps = $(top_srcdir)/configure.in am__configure_deps = $(am__aclocal_m4_deps) $(CONFIGURE_DEPENDENCIES) \ $(ACLOCAL_M4) mkinstalldirs = $(install_sh) -d -CONFIG_HEADER = $(top_builddir)/cvc4autoconfig.h +CONFIG_HEADER = $(top_builddir)/config.h CONFIG_CLEAN_FILES = CONFIG_CLEAN_VPATH_FILES = -AM_V_GEN = $(am__v_GEN_$(V)) -am__v_GEN_ = $(am__v_GEN_$(AM_DEFAULT_VERBOSITY)) -am__v_GEN_0 = @echo " GEN " $@; -AM_V_at = $(am__v_at_$(V)) -am__v_at_ = $(am__v_at_$(AM_DEFAULT_VERBOSITY)) -am__v_at_0 = @ SOURCES = DIST_SOURCES = am__vpath_adj_setup = srcdirstrip=`echo "$(srcdir)" | sed 's|.|.|g'`; @@ -94,128 +75,54 @@ CTAGS = ctags DISTFILES = $(DIST_COMMON) $(DIST_SOURCES) $(TEXINFOS) $(EXTRA_DIST) ACLOCAL = @ACLOCAL@ AMTAR = @AMTAR@ -AM_DEFAULT_VERBOSITY = @AM_DEFAULT_VERBOSITY@ -ANTLR = @ANTLR@ -ANTLR_HOME = @ANTLR_HOME@ -ANTLR_INCLUDES = @ANTLR_INCLUDES@ -ANTLR_LDFLAGS = @ANTLR_LDFLAGS@ AR = @AR@ -AS = @AS@ AUTOCONF = @AUTOCONF@ AUTOHEADER = @AUTOHEADER@ AUTOMAKE = @AUTOMAKE@ AWK = @AWK@ -BOOST_CPPFLAGS = @BOOST_CPPFLAGS@ -BOOST_LDPATH = @BOOST_LDPATH@ -BOOST_ROOT = @BOOST_ROOT@ -BOOST_THREAD_LDFLAGS = @BOOST_THREAD_LDFLAGS@ -BOOST_THREAD_LDPATH = @BOOST_THREAD_LDPATH@ -BOOST_THREAD_LIBS = @BOOST_THREAD_LIBS@ -BUILDING_SHARED = @BUILDING_SHARED@ -BUILDING_STATIC = @BUILDING_STATIC@ -CAMLP4O = @CAMLP4O@ CC = @CC@ CCDEPMODE = @CCDEPMODE@ CFLAGS = @CFLAGS@ -CLN_CFLAGS = @CLN_CFLAGS@ -CLN_LIBS = @CLN_LIBS@ CPP = @CPP@ CPPFLAGS = @CPPFLAGS@ -CSHARP_CPPFLAGS = @CSHARP_CPPFLAGS@ -CUDD_CPPFLAGS = @CUDD_CPPFLAGS@ -CUDD_LDFLAGS = @CUDD_LDFLAGS@ -CUDD_LIBS = @CUDD_LIBS@ -CVC4_BINDINGS_LIBRARY_VERSION = @CVC4_BINDINGS_LIBRARY_VERSION@ -CVC4_BUILD_LIBCOMPAT = @CVC4_BUILD_LIBCOMPAT@ -CVC4_COMPAT_LIBRARY_VERSION = @CVC4_COMPAT_LIBRARY_VERSION@ -CVC4_HAS_THREADS = @CVC4_HAS_THREADS@ -CVC4_LANGUAGE_BINDINGS = @CVC4_LANGUAGE_BINDINGS@ -CVC4_LIBRARY_VERSION = @CVC4_LIBRARY_VERSION@ -CVC4_PARSER_LIBRARY_VERSION = @CVC4_PARSER_LIBRARY_VERSION@ -CVC4_TLS = @CVC4_TLS@ -CVC4_TLS_SUPPORTED = @CVC4_TLS_SUPPORTED@ -CVC4_USE_CLN_IMP = @CVC4_USE_CLN_IMP@ -CVC4_USE_GMP_IMP = @CVC4_USE_GMP_IMP@ CXX = @CXX@ CXXCPP = @CXXCPP@ CXXDEPMODE = @CXXDEPMODE@ CXXFLAGS = @CXXFLAGS@ -CXXTEST = @CXXTEST@ -CXXTESTGEN = @CXXTESTGEN@ CYGPATH_W = @CYGPATH_W@ DEFS = @DEFS@ DEPDIR = @DEPDIR@ -DISTCHECK_CONFIGURE_FLAGS = @DISTCHECK_CONFIGURE_FLAGS@ DLLTOOL = @DLLTOOL@ -DOXYGEN_EXTRACT_PRIVATE = @DOXYGEN_EXTRACT_PRIVATE@ -DOXYGEN_EXTRACT_STATIC = @DOXYGEN_EXTRACT_STATIC@ -DOXYGEN_PAPER_SIZE = @DOXYGEN_PAPER_SIZE@ DSYMUTIL = @DSYMUTIL@ DUMPBIN = @DUMPBIN@ -DX_CONFIG = @DX_CONFIG@ -DX_DOCDIR = @DX_DOCDIR@ -DX_DOT = @DX_DOT@ -DX_DOXYGEN = @DX_DOXYGEN@ -DX_DVIPS = @DX_DVIPS@ -DX_EGREP = @DX_EGREP@ -DX_ENV = @DX_ENV@ -DX_FLAG_DX_CURRENT_FEATURE = @DX_FLAG_DX_CURRENT_FEATURE@ -DX_FLAG_chi = @DX_FLAG_chi@ -DX_FLAG_chm = @DX_FLAG_chm@ -DX_FLAG_doc = @DX_FLAG_doc@ -DX_FLAG_dot = @DX_FLAG_dot@ -DX_FLAG_html = @DX_FLAG_html@ -DX_FLAG_man = @DX_FLAG_man@ -DX_FLAG_pdf = @DX_FLAG_pdf@ -DX_FLAG_ps = @DX_FLAG_ps@ -DX_FLAG_rtf = @DX_FLAG_rtf@ -DX_FLAG_xml = @DX_FLAG_xml@ -DX_HHC = @DX_HHC@ -DX_LATEX = @DX_LATEX@ -DX_MAKEINDEX = @DX_MAKEINDEX@ -DX_PDFLATEX = @DX_PDFLATEX@ -DX_PERL = @DX_PERL@ -DX_PROJECT = @DX_PROJECT@ ECHO_C = @ECHO_C@ ECHO_N = @ECHO_N@ ECHO_T = @ECHO_T@ EGREP = @EGREP@ EXEEXT = @EXEEXT@ FGREP = @FGREP@ -FLAG_VISIBILITY_HIDDEN = @FLAG_VISIBILITY_HIDDEN@ GREP = @GREP@ INSTALL = @INSTALL@ INSTALL_DATA = @INSTALL_DATA@ INSTALL_PROGRAM = @INSTALL_PROGRAM@ INSTALL_SCRIPT = @INSTALL_SCRIPT@ INSTALL_STRIP_PROGRAM = @INSTALL_STRIP_PROGRAM@ -JAR = @JAR@ -JAVA = @JAVA@ -JAVAC = @JAVAC@ -JAVAH = @JAVAH@ -JAVA_CPPFLAGS = @JAVA_CPPFLAGS@ LD = @LD@ LDFLAGS = @LDFLAGS@ -LFSC = @LFSC@ -LFSCARGS = @LFSCARGS@ LIBOBJS = @LIBOBJS@ LIBS = @LIBS@ LIBTOOL = @LIBTOOL@ LIPO = @LIPO@ LN_S = @LN_S@ LTLIBOBJS = @LTLIBOBJS@ -MAINT = @MAINT@ MAKEINFO = @MAKEINFO@ MANIFEST_TOOL = @MANIFEST_TOOL@ -MAN_DATE = @MAN_DATE@ MKDIR_P = @MKDIR_P@ NM = @NM@ NMEDIT = @NMEDIT@ OBJDUMP = @OBJDUMP@ OBJEXT = @OBJEXT@ -OCAMLC = @OCAMLC@ -OCAMLFIND = @OCAMLFIND@ -OCAMLMKTOP = @OCAMLMKTOP@ +OPENMP_CXXFLAGS = @OPENMP_CXXFLAGS@ OTOOL = @OTOOL@ OTOOL64 = @OTOOL64@ PACKAGE = @PACKAGE@ @@ -226,33 +133,12 @@ PACKAGE_TARNAME = @PACKAGE_TARNAME@ PACKAGE_URL = @PACKAGE_URL@ PACKAGE_VERSION = @PACKAGE_VERSION@ PATH_SEPARATOR = @PATH_SEPARATOR@ -PERL = @PERL@ -PERL_CPPFLAGS = @PERL_CPPFLAGS@ -PHP_CPPFLAGS = @PHP_CPPFLAGS@ -PKG_CONFIG = @PKG_CONFIG@ -PYTHON = @PYTHON@ -PYTHON_CONFIG = @PYTHON_CONFIG@ -PYTHON_CXXFLAGS = @PYTHON_CXXFLAGS@ -PYTHON_EXEC_PREFIX = @PYTHON_EXEC_PREFIX@ -PYTHON_INCLUDE = @PYTHON_INCLUDE@ -PYTHON_PLATFORM = @PYTHON_PLATFORM@ -PYTHON_PREFIX = @PYTHON_PREFIX@ -PYTHON_VERSION = @PYTHON_VERSION@ RANLIB = @RANLIB@ -READLINE_LIBS = @READLINE_LIBS@ -RUBY_CPPFLAGS = @RUBY_CPPFLAGS@ SED = @SED@ SET_MAKE = @SET_MAKE@ SHELL = @SHELL@ -STATIC_BINARY = @STATIC_BINARY@ STRIP = @STRIP@ -SWIG = @SWIG@ -TCL_CPPFLAGS = @TCL_CPPFLAGS@ -TEST_CPPFLAGS = @TEST_CPPFLAGS@ -TEST_CXXFLAGS = @TEST_CXXFLAGS@ -TEST_LDFLAGS = @TEST_LDFLAGS@ VERSION = @VERSION@ -WNO_CONVERSION_NULL = @WNO_CONVERSION_NULL@ abs_builddir = @abs_builddir@ abs_srcdir = @abs_srcdir@ abs_top_builddir = @abs_top_builddir@ @@ -292,26 +178,17 @@ libexecdir = @libexecdir@ localedir = @localedir@ localstatedir = @localstatedir@ mandir = @mandir@ -mk_include = @mk_include@ mkdir_p = @mkdir_p@ oldincludedir = @oldincludedir@ pdfdir = @pdfdir@ -pkgpyexecdir = @pkgpyexecdir@ -pkgpythondir = @pkgpythondir@ prefix = @prefix@ program_transform_name = @program_transform_name@ psdir = @psdir@ -pyexecdir = @pyexecdir@ -pythondir = @pythondir@ sbindir = @sbindir@ sharedstatedir = @sharedstatedir@ srcdir = @srcdir@ sysconfdir = @sysconfdir@ -target = @target@ target_alias = @target_alias@ -target_cpu = @target_cpu@ -target_os = @target_os@ -target_vendor = @target_vendor@ top_build_prefix = @top_build_prefix@ top_builddir = @top_builddir@ top_srcdir = @top_srcdir@ @@ -320,7 +197,7 @@ pkgincludesub_HEADERS = Alg.h Heap.h Vec.h all: all-am .SUFFIXES: -$(srcdir)/Makefile.in: @MAINTAINER_MODE_TRUE@ $(srcdir)/Makefile.am $(am__configure_deps) +$(srcdir)/Makefile.in: $(srcdir)/Makefile.am $(am__configure_deps) @for dep in $?; do \ case '$(am__configure_deps)' in \ *$$dep*) \ @@ -329,9 +206,9 @@ $(srcdir)/Makefile.in: @MAINTAINER_MODE_TRUE@ $(srcdir)/Makefile.am $(am__confi exit 1;; \ esac; \ done; \ - echo ' cd $(top_srcdir) && $(AUTOMAKE) --foreign src/prop/cryptominisat/mtl/Makefile'; \ + echo ' cd $(top_srcdir) && $(AUTOMAKE) --gnu mtl/Makefile'; \ $(am__cd) $(top_srcdir) && \ - $(AUTOMAKE) --foreign src/prop/cryptominisat/mtl/Makefile + $(AUTOMAKE) --gnu mtl/Makefile .PRECIOUS: Makefile Makefile: $(srcdir)/Makefile.in $(top_builddir)/config.status @case '$?' in \ @@ -345,9 +222,9 @@ Makefile: $(srcdir)/Makefile.in $(top_builddir)/config.status $(top_builddir)/config.status: $(top_srcdir)/configure $(CONFIG_STATUS_DEPENDENCIES) cd $(top_builddir) && $(MAKE) $(AM_MAKEFLAGS) am--refresh -$(top_srcdir)/configure: @MAINTAINER_MODE_TRUE@ $(am__configure_deps) +$(top_srcdir)/configure: $(am__configure_deps) cd $(top_builddir) && $(MAKE) $(AM_MAKEFLAGS) am--refresh -$(ACLOCAL_M4): @MAINTAINER_MODE_TRUE@ $(am__aclocal_m4_deps) +$(ACLOCAL_M4): $(am__aclocal_m4_deps) cd $(top_builddir) && $(MAKE) $(AM_MAKEFLAGS) am--refresh $(am__aclocal_m4_deps): diff --git a/src/smt/smt_engine.cpp b/src/smt/smt_engine.cpp index e73af60e9..97407a425 100644 --- a/src/smt/smt_engine.cpp +++ b/src/smt/smt_engine.cpp @@ -291,6 +291,9 @@ SmtEngine::SmtEngine(ExprManager* em) throw(AssertionException) : setTimeLimit(Options::current()->cumulativeMillisecondLimit, true); } + + d_propEngine->assertFormula(NodeManager::currentNM()->mkConst(true)); + d_propEngine->assertFormula(NodeManager::currentNM()->mkConst(false).notNode()); } void SmtEngine::shutdown() { diff --git a/src/theory/arith/Makefile.am b/src/theory/arith/Makefile.am index 4cff4a782..b97a6f384 100644 --- a/src/theory/arith/Makefile.am +++ b/src/theory/arith/Makefile.am @@ -12,11 +12,10 @@ libarith_la_SOURCES = \ arith_rewriter.cpp \ arith_static_learner.h \ arith_static_learner.cpp \ - arith_prop_manager.h \ - arith_prop_manager.cpp \ arithvar_node_map.h \ - atom_database.h \ - atom_database.cpp \ + constraint_forward.h \ + constraint.h \ + constraint.cpp \ difference_manager.h \ difference_manager.cpp \ normal_form.h\ @@ -28,7 +27,6 @@ libarith_la_SOURCES = \ partial_model.cpp \ linear_equality.h \ linear_equality.cpp \ - ordered_set.h \ arithvar_set.h \ tableau.h \ tableau.cpp \ diff --git a/src/theory/arith/arith_prop_manager.cpp b/src/theory/arith/arith_prop_manager.cpp deleted file mode 100644 index dc9b0ddb9..000000000 --- a/src/theory/arith/arith_prop_manager.cpp +++ /dev/null @@ -1,173 +0,0 @@ -/********************* */ -/*! \file arith_prop_manager.cpp - ** \verbatim - ** Original author: taking - ** Major contributors: none - ** Minor contributors (to current version): none - ** This file is part of the CVC4 prototype. - ** Copyright (c) 2009, 2010, 2011 The Analysis of Computer Systems Group (ACSys) - ** Courant Institute of Mathematical Sciences - ** New York University - ** See the file COPYING in the top-level source directory for licensing - ** information.\endverbatim - ** - ** \brief [[ Add one-line brief description here ]] - ** - ** [[ Add lengthier description here ]] - ** \todo document this file - **/ - - -#include "theory/arith/arith_prop_manager.h" - -#include "theory/arith/arith_utilities.h" -#include "context/context.h" -#include "context/cdlist.h" -#include "context/cdhashmap.h" -#include "context/cdo.h" - -using namespace CVC4::kind; -using namespace std; - - -namespace CVC4 { -namespace theory { -namespace arith { - -bool ArithPropManager::isAsserted(TNode n) const{ - Node satValue = d_valuation.getSatValue(n); - if(satValue.isNull()){ - return false; - }else{ - //Assert(satValue.getConst()); - return true; - } -} - - -Node ArithPropManager::strictlyWeakerAssertedUpperBound(ArithVar v, const DeltaRational& b) const{ - Node bound = boundAsNode(true, v, b); - - Assert(b.getInfinitesimalPart() <= 0); - bool largeEpsilon = (b.getInfinitesimalPart() < -1); - - Node weaker = bound; - do { - if(largeEpsilon){ - weaker = d_atomDatabase.getBestImpliedUpperBound(weaker); - largeEpsilon = false; - }else{ - weaker = d_atomDatabase.getWeakerImpliedUpperBound(weaker); - } - }while(!weaker.isNull() && !isAsserted(weaker)); - return weaker; -} - -Node ArithPropManager::strictlyWeakerAssertedLowerBound(ArithVar v, const DeltaRational& b) const{ - Debug("ArithPropManager") << "strictlyWeakerAssertedLowerBound" << endl; - Node bound = boundAsNode(false, v, b); - - Assert(b.getInfinitesimalPart() >= 0); - bool largeEpsilon = (b.getInfinitesimalPart() > 1); - - Node weaker = bound; - Debug("ArithPropManager") << bound << b << endl; - do { - if(largeEpsilon){ - weaker = d_atomDatabase.getBestImpliedLowerBound(weaker); - largeEpsilon = false; - }else{ - weaker = d_atomDatabase.getWeakerImpliedLowerBound(weaker); - } - }while(!weaker.isNull() && !isAsserted(weaker)); - Debug("ArithPropManager") << "res: " << weaker << endl; - return weaker; -} - -Node ArithPropManager::getBestImpliedLowerBound(ArithVar v, const DeltaRational& b) const{ - Node bound = boundAsNode(false, v, b); - return d_atomDatabase.getBestImpliedLowerBound(bound); -} -Node ArithPropManager::getBestImpliedUpperBound(ArithVar v, const DeltaRational& b) const{ - Node bound = boundAsNode(true, v, b); - return d_atomDatabase.getBestImpliedUpperBound(bound); -} - -Node ArithPropManager::boundAsNode(bool upperbound, ArithVar var, const DeltaRational& b) const { - Assert((!upperbound) || (b.getInfinitesimalPart() <= 0) ); - Assert(upperbound || (b.getInfinitesimalPart() >= 0) ); - - Node varAsNode = d_arithvarNodeMap.asNode(var); - Kind kind; - bool negate; - if(upperbound){ - negate = b.getInfinitesimalPart() < 0; - kind = negate ? GEQ : LEQ; - } else{ - negate = b.getInfinitesimalPart() > 0; - kind = negate ? LEQ : GEQ; - } - - Node righthand = mkRationalNode(b.getNoninfinitesimalPart()); - Node bAsNode = NodeBuilder<2>(kind) << varAsNode << righthand; - - if(negate){ - bAsNode = NodeBuilder<1>(NOT) << bAsNode; - } - - return bAsNode; -} - -bool ArithPropManager::propagateArithVar(bool upperbound, ArithVar var, const DeltaRational& b, TNode reason){ - bool success = false; - - ++d_statistics.d_propagateArithVarCalls; - - Node bAsNode = boundAsNode(upperbound, var ,b); - - Node bestImplied = upperbound ? - d_atomDatabase.getBestImpliedUpperBound(bAsNode): - d_atomDatabase.getBestImpliedLowerBound(bAsNode); - - Debug("ArithPropManager") << upperbound <<","<< var <<","<< b <<","<< reason << endl - << bestImplied << endl; - - if(!bestImplied.isNull()){ - bool asserted = isAsserted(bestImplied); - - if( !asserted && !isPropagated(bestImplied)){ - propagate(bestImplied, reason, false); - ++d_statistics.d_addedPropagation; - success = true; - }else if(!asserted){ - ++d_statistics.d_alreadyPropagatedNode; - }else if(!isPropagated(bestImplied)){ - ++d_statistics.d_alreadySetSatLiteral; - } - } - return success; -} - -ArithPropManager::Statistics::Statistics(): - d_propagateArithVarCalls("arith::prop-manager::propagateArithVarCalls",0), - d_addedPropagation("arith::prop-manager::addedPropagation",0), - d_alreadySetSatLiteral("arith::prop-manager::alreadySetSatLiteral",0), - d_alreadyPropagatedNode("arith::prop-manager::alreadyPropagatedNode",0) -{ - StatisticsRegistry::registerStat(&d_propagateArithVarCalls); - StatisticsRegistry::registerStat(&d_alreadySetSatLiteral); - StatisticsRegistry::registerStat(&d_alreadyPropagatedNode); - StatisticsRegistry::registerStat(&d_addedPropagation); -} - -ArithPropManager::Statistics::~Statistics() -{ - StatisticsRegistry::unregisterStat(&d_propagateArithVarCalls); - StatisticsRegistry::unregisterStat(&d_alreadySetSatLiteral); - StatisticsRegistry::unregisterStat(&d_alreadyPropagatedNode); - StatisticsRegistry::unregisterStat(&d_addedPropagation); -} - -}; /* namesapce arith */ -}; /* namespace theory */ -}; /* namespace CVC4 */ diff --git a/src/theory/arith/arith_prop_manager.h b/src/theory/arith/arith_prop_manager.h deleted file mode 100644 index 900a0ed58..000000000 --- a/src/theory/arith/arith_prop_manager.h +++ /dev/null @@ -1,184 +0,0 @@ -/********************* */ -/*! \file arith_prop_manager.h - ** \verbatim - ** Original author: taking - ** Major contributors: none - ** Minor contributors (to current version): none - ** This file is part of the CVC4 prototype. - ** Copyright (c) 2009, 2010, 2011 The Analysis of Computer Systems Group (ACSys) - ** Courant Institute of Mathematical Sciences - ** New York University - ** See the file COPYING in the top-level source directory for licensing - ** information.\endverbatim - ** - ** \brief [[ Add one-line brief description here ]] - ** - ** [[ Add lengthier description here ]] - ** \todo document this file - **/ - -#include "cvc4_private.h" - -#ifndef __CVC4__THEORY__ARITH__ARITH_PROP_MANAGER_H -#define __CVC4__THEORY__ARITH__ARITH_PROP_MANAGER_H - -#include "theory/valuation.h" -#include "theory/arith/arithvar.h" -#include "theory/arith/arithvar_node_map.h" -#include "theory/arith/atom_database.h" -#include "theory/arith/delta_rational.h" -#include "context/context.h" -#include "context/cdlist.h" -#include "context/cdhashmap.h" -#include "context/cdo.h" -#include "theory/rewriter.h" -#include "util/stats.h" - -namespace CVC4 { -namespace theory { -namespace arith { - -class PropManager { -public: - struct PropUnit { - // consequent <= antecedent - // i.e. the antecedent is the explanation of the consequent. - Node consequent; - Node antecedent; - bool flag; - PropUnit(Node c, Node a, bool f) : - consequent(c), antecedent(a), flag(f) - {} - }; - -private: - context::CDList d_propagated; - context::CDO d_propagatedPos; - - /* This maps the node a theory engine will request on an explain call to - * to its corresponding PropUnit. - * This is node is potentially both the consequent or Rewriter::rewrite(consequent). - */ - typedef context::CDHashMap ExplainMap; - ExplainMap d_explanationMap; - - size_t getIndex(TNode n) const { - Assert(isPropagated(n)); - return (*(d_explanationMap.find(n))).second; - } - -public: - - PropManager(context::Context* c): - d_propagated(c), - d_propagatedPos(c, 0), - d_explanationMap(c) - { } - - const PropUnit& getUnit(TNode n) const { - return d_propagated[getIndex(n)]; - } - - bool isPropagated(TNode n) const { - return d_explanationMap.find(n) != d_explanationMap.end(); - } - - bool isFlagged(TNode n) const { - return getUnit(n).flag; - } - - void propagate(TNode n, Node reason, bool flag) { - Assert(!isPropagated(n)); - - if(flag){ - Node rewritten = Rewriter::rewrite(n); - d_explanationMap.insert(rewritten, d_propagated.size()); - }else{ - //If !flag, then the rewriter is idempotent on n. - Assert(Rewriter::rewrite(n) == n); - } - d_explanationMap.insert(n, d_propagated.size()); - d_propagated.push_back(PropUnit(n, reason, flag)); - - Debug("ArithPropManager") << n << std::endl << "<="<< reason<< std::endl; - } - - bool hasMorePropagations() const { - return d_propagatedPos < d_propagated.size(); - } - - const PropUnit& getNextPropagation() { - Assert(hasMorePropagations()); - const PropUnit& prop = d_propagated[d_propagatedPos]; - d_propagatedPos = d_propagatedPos + 1; - return prop; - } - - TNode explain(TNode n) const { - return getUnit(n).antecedent; - } - -};/* class PropManager */ - -class ArithPropManager : public PropManager { -private: - const ArithVarNodeMap& d_arithvarNodeMap; - const ArithAtomDatabase& d_atomDatabase; - Valuation d_valuation; - -public: - ArithPropManager(context::Context* c, - const ArithVarNodeMap& map, - const ArithAtomDatabase& db, - Valuation v): - PropManager(c), d_arithvarNodeMap(map), d_atomDatabase(db), d_valuation(v) - {} - - /** - * Returns true if the node has a value in sat solver in the current context. - * In debug mode this fails an Assert() if the node has a negative assignment. - */ - bool isAsserted(TNode n) const; - - /** Returns true if a bound was added. */ - bool propagateArithVar(bool upperbound, ArithVar var, const DeltaRational& b, TNode reason); - - Node boundAsNode(bool upperbound, ArithVar var, const DeltaRational& b) const; - - Node strictlyWeakerLowerBound(TNode n) const{ - return d_atomDatabase.getWeakerImpliedLowerBound(n); - } - Node strictlyWeakerUpperBound(TNode n) const{ - return d_atomDatabase.getWeakerImpliedUpperBound(n); - } - - Node strictlyWeakerAssertedUpperBound(ArithVar v, const DeltaRational& b) const; - - Node strictlyWeakerAssertedLowerBound(ArithVar v, const DeltaRational& b) const; - - Node getBestImpliedLowerBound(ArithVar v, const DeltaRational& b) const; - Node getBestImpliedUpperBound(ArithVar v, const DeltaRational& b) const; - - bool containsLiteral(TNode n) const { - return d_atomDatabase.containsLiteral(n); - } - -private: - class Statistics { - public: - IntStat d_propagateArithVarCalls; - IntStat d_addedPropagation; - IntStat d_alreadySetSatLiteral; - IntStat d_alreadyPropagatedNode; - - Statistics(); - ~Statistics(); - }; - Statistics d_statistics; -}; - -}/* CVC4::theory::arith namespace */ -}/* CVC4::theory namespace */ -}/* CVC4 namespace */ - -#endif /* __CVC4__THEORY__ARITH__ARITH_PROP_MANAGER_H */ diff --git a/src/theory/arith/arith_rewriter.cpp b/src/theory/arith/arith_rewriter.cpp index 30568c3ca..863eb5c31 100644 --- a/src/theory/arith/arith_rewriter.cpp +++ b/src/theory/arith/arith_rewriter.cpp @@ -204,34 +204,30 @@ RewriteResponse ArithRewriter::postRewriteMult(TNode t){ return RewriteResponse(REWRITE_DONE, res.getNode()); } -RewriteResponse ArithRewriter::postRewriteAtomConstantRHS(TNode t){ - TNode left = t[0]; - TNode right = t[1]; +// RewriteResponse ArithRewriter::postRewriteAtomConstantRHS(TNode t){ +// TNode left = t[0]; +// TNode right = t[1]; - Comparison cmp = Comparison::mkNormalComparison(t.getKind(), Polynomial::parsePolynomial(left), Constant(right)); +// Polynomial pLeft = Polynomial::parsePolynomial(left); + - Assert(cmp.isNormalForm()); - return RewriteResponse(REWRITE_DONE, cmp.getNode()); -} +// Comparison cmp = Comparison::mkComparison(t.getKind(), Polynomial::parsePolynomial(left), Constant(right)); + +// Assert(cmp.isNormalForm()); +// return RewriteResponse(REWRITE_DONE, cmp.getNode()); +// } RewriteResponse ArithRewriter::postRewriteAtom(TNode atom){ // left |><| right TNode left = atom[0]; TNode right = atom[1]; - if(right.getMetaKind() == kind::metakind::CONSTANT){ - return postRewriteAtomConstantRHS(atom); - }else{ - Polynomial pleft = Polynomial::parsePolynomial(left); - Polynomial pright = Polynomial::parsePolynomial(right); - - Polynomial diff = pleft - pright; - - Constant cZero = Constant::mkConstant(Rational(0)); - Node reduction = NodeManager::currentNM()->mkNode(atom.getKind(), diff.getNode(), cZero.getNode()); + Polynomial pleft = Polynomial::parsePolynomial(left); + Polynomial pright = Polynomial::parsePolynomial(right); - return postRewriteAtomConstantRHS(reduction); - } + Comparison cmp = Comparison::mkComparison(atom.getKind(), pleft, pright); + Assert(cmp.isNormalForm()); + return RewriteResponse(REWRITE_DONE, cmp.getNode()); } RewriteResponse ArithRewriter::preRewriteAtom(TNode atom){ diff --git a/src/theory/arith/arith_rewriter.h b/src/theory/arith/arith_rewriter.h index 07c009b2e..748ed8686 100644 --- a/src/theory/arith/arith_rewriter.h +++ b/src/theory/arith/arith_rewriter.h @@ -66,7 +66,6 @@ private: static RewriteResponse preRewriteAtom(TNode t); static RewriteResponse postRewriteAtom(TNode t); - static RewriteResponse postRewriteAtomConstantRHS(TNode t); static bool isAtom(TNode n); diff --git a/src/theory/arith/arith_static_learner.cpp b/src/theory/arith/arith_static_learner.cpp index 2f4f6e32b..8ecc3abdc 100644 --- a/src/theory/arith/arith_static_learner.cpp +++ b/src/theory/arith/arith_static_learner.cpp @@ -261,7 +261,7 @@ void ArithStaticLearner::iteMinMax(TNode n, NodeBuilder<>& learned){ Assert(isRelationOperator(n[0].getKind())); TNode c = n[0]; - Kind k = simplifiedKind(c); + Kind k = oldSimplifiedKind(c); TNode t = n[1]; TNode e = n[2]; TNode cleft = (c.getKind() == NOT) ? c[0][0] : c[0]; diff --git a/src/theory/arith/arith_utilities.h b/src/theory/arith/arith_utilities.h index a5d94ec40..af32c3f87 100644 --- a/src/theory/arith/arith_utilities.h +++ b/src/theory/arith/arith_utilities.h @@ -168,17 +168,17 @@ inline int deltaCoeff(Kind k){ * - (NOT (GT left right)) -> LEQ * If none of these match, it returns UNDEFINED_KIND. */ - inline Kind simplifiedKind(TNode assertion){ - switch(assertion.getKind()){ + inline Kind oldSimplifiedKind(TNode literal){ + switch(literal.getKind()){ case kind::LT: case kind::GT: case kind::LEQ: case kind::GEQ: case kind::EQUAL: - return assertion.getKind(); + return literal.getKind(); case kind::NOT: { - TNode atom = assertion[0]; + TNode atom = literal[0]; switch(atom.getKind()){ case kind::LEQ: //(not (LEQ x c)) <=> (GT x c) return kind::GT; @@ -201,57 +201,58 @@ inline int deltaCoeff(Kind k){ } } -template -inline TNode getSide(TNode assertion, Kind simpleKind){ - switch(simpleKind){ - case kind::LT: - case kind::GT: - case kind::DISTINCT: - return selectLeft ? (assertion[0])[0] : (assertion[0])[1]; - case kind::LEQ: - case kind::GEQ: - case kind::EQUAL: - return selectLeft ? assertion[0] : assertion[1]; - default: - Unreachable(); - return TNode::null(); - } -} - -inline DeltaRational determineRightConstant(TNode assertion, Kind simpleKind){ - TNode right = getSide(assertion, simpleKind); - - Assert(right.getKind() == kind::CONST_RATIONAL); - const Rational& noninf = right.getConst(); - Rational inf = Rational(Integer(deltaCoeff(simpleKind))); - return DeltaRational(noninf, inf); -} - -inline DeltaRational asDeltaRational(TNode n){ - Kind simp = simplifiedKind(n); - return determineRightConstant(n, simp); -} - - /** - * Takes two nodes with exactly 2 children, - * the second child of both are of kind CONST_RATIONAL, - * and compares value of the two children. - * This is for comparing inequality nodes. - * RightHandRationalLT((<= x 50), (< x 75)) == true - */ -struct RightHandRationalLT -{ - bool operator()(TNode s1, TNode s2) const - { - TNode rh1 = s1[1]; - TNode rh2 = s2[1]; - const Rational& c1 = rh1.getConst(); - const Rational& c2 = rh2.getConst(); - int cmpRes = c1.cmp(c2); - return cmpRes < 0; - } -}; +// template +// inline TNode getSide(TNode assertion, Kind simpleKind){ +// switch(simpleKind){ +// case kind::LT: +// case kind::GT: +// case kind::DISTINCT: +// return selectLeft ? (assertion[0])[0] : (assertion[0])[1]; +// case kind::LEQ: +// case kind::GEQ: +// case kind::EQUAL: +// return selectLeft ? assertion[0] : assertion[1]; +// default: +// Unreachable(); +// return TNode::null(); +// } +// } + +// inline DeltaRational determineRightConstant(TNode assertion, Kind simpleKind){ +// TNode right = getSide(assertion, simpleKind); + +// Assert(right.getKind() == kind::CONST_RATIONAL); +// const Rational& noninf = right.getConst(); + +// Rational inf = Rational(Integer(deltaCoeff(simpleKind))); +// return DeltaRational(noninf, inf); +// } + +// inline DeltaRational asDeltaRational(TNode n){ +// Kind simp = simplifiedKind(n); +// return determineRightConstant(n, simp); +// } + +// /** +// * Takes two nodes with exactly 2 children, +// * the second child of both are of kind CONST_RATIONAL, +// * and compares value of the two children. +// * This is for comparing inequality nodes. +// * RightHandRationalLT((<= x 50), (< x 75)) == true +// */ +// struct RightHandRationalLT +// { +// bool operator()(TNode s1, TNode s2) const +// { +// TNode rh1 = s1[1]; +// TNode rh2 = s2[1]; +// const Rational& c1 = rh1.getConst(); +// const Rational& c2 = rh2.getConst(); +// int cmpRes = c1.cmp(c2); +// return cmpRes < 0; +// } +// }; inline Node negateConjunctionAsClause(TNode conjunction){ Assert(conjunction.getKind() == kind::AND); @@ -278,6 +279,24 @@ inline Node maybeUnaryConvert(NodeBuilder<>& builder){ } } +inline void flattenAnd(Node n, std::vector& out){ + Assert(n.getKind() == kind::AND); + for(Node::iterator i=n.begin(), i_end=n.end(); i != i_end; ++i){ + Node curr = *i; + if(curr.getKind() == kind::AND){ + flattenAnd(curr, out); + }else{ + out.push_back(curr); + } + } +} + +inline Node flattenAnd(Node n){ + std::vector out; + flattenAnd(n, out); + return NodeManager::currentNM()->mkNode(kind::AND, out); +} + }; /* namesapce arith */ }; /* namespace theory */ }; /* namespace CVC4 */ diff --git a/src/theory/arith/arithvar.h b/src/theory/arith/arithvar.h index 52dc9fd6a..432f9f0c2 100644 --- a/src/theory/arith/arithvar.h +++ b/src/theory/arith/arithvar.h @@ -47,7 +47,17 @@ typedef __gnu_cxx::hash_map ArithVarToNodeMap; */ class ArithVarCallBack { public: - virtual void callback(ArithVar x) = 0; + virtual void operator()(ArithVar x) = 0; +}; + +class TNodeCallBack { +public: + virtual void operator()(TNode n) = 0; +}; + +class NodeCallBack { +public: + virtual void operator()(Node n) = 0; }; }; /* namesapce arith */ diff --git a/src/theory/arith/arithvar_set.h b/src/theory/arith/arithvar_set.h index b502849fd..b9ae48b16 100644 --- a/src/theory/arith/arithvar_set.h +++ b/src/theory/arith/arithvar_set.h @@ -322,43 +322,27 @@ public: class CDArithVarSet { private: - class RemoveIntWrapper{ - private: - ArithVar d_var; - ArithVarCallBack& d_onDestruction; - - public: - RemoveIntWrapper(ArithVar v, ArithVarCallBack& onDestruction): - d_var(v), d_onDestruction(onDestruction) - {} - - ~RemoveIntWrapper(){ - d_onDestruction.callback(d_var); - } - }; - - std::vector d_set; - context::CDList d_list; - - class OnDestruction : public ArithVarCallBack { + class RemoveIntCleanup { private: std::vector& d_set; public: - OnDestruction(std::vector& set): - d_set(set) + RemoveIntCleanup(std::vector& set) + : d_set(set) {} - void callback(ArithVar x){ - Assert(x < d_set.size()); + void operator()(ArithVar* p){ + ArithVar x = *p; + Assert(d_set[x]); d_set[x] = false; } }; - OnDestruction d_callback; + std::vector d_set; + context::CDList d_list; public: - CDArithVarSet(context::Context* c) : - d_list(c), d_callback(d_set) + CDArithVarSet(context::Context* c) + : d_set(), d_list(c, true, RemoveIntCleanup(d_set)) { } /** This cannot be const as garbage collection is done lazily. */ @@ -375,7 +359,7 @@ public: if(x >= d_set.size()){ d_set.resize(x+1, false); } - d_list.push_back(RemoveIntWrapper(x, d_callback)); + d_list.push_back(x); d_set[x] = true; } }; diff --git a/src/theory/arith/atom_database.cpp b/src/theory/arith/atom_database.cpp deleted file mode 100644 index 3476eb8f5..000000000 --- a/src/theory/arith/atom_database.cpp +++ /dev/null @@ -1,542 +0,0 @@ -/********************* */ -/*! \file atom_database.cpp - ** \verbatim - ** Original author: taking - ** Major contributors: none - ** Minor contributors (to current version): mdeters - ** This file is part of the CVC4 prototype. - ** Copyright (c) 2009, 2010, 2011 The Analysis of Computer Systems Group (ACSys) - ** Courant Institute of Mathematical Sciences - ** New York University - ** See the file COPYING in the top-level source directory for licensing - ** information.\endverbatim - ** - ** \brief [[ Add one-line brief description here ]] - ** - ** [[ Add lengthier description here ]] - ** \todo document this file - **/ - -#include "theory/arith/atom_database.h" -#include "theory/arith/arith_utilities.h" - -#include - -using namespace std; -using namespace CVC4::kind; - -namespace CVC4 { -namespace theory { -namespace arith { - -ArithAtomDatabase::ArithAtomDatabase(context::Context* cxt, OutputChannel& out) : - d_arithOut(out), d_setsMap() -{ } - -bool ArithAtomDatabase::leftIsSetup(TNode left) const{ - return d_setsMap.find(left) != d_setsMap.end(); -} - -const ArithAtomDatabase::VariablesSets& ArithAtomDatabase::getVariablesSets(TNode left) const{ - Assert(leftIsSetup(left)); - NodeToSetsMap::const_iterator i = d_setsMap.find(left); - return i->second; -} -ArithAtomDatabase::VariablesSets& ArithAtomDatabase::getVariablesSets(TNode left){ - Assert(leftIsSetup(left)); - NodeToSetsMap::iterator i = d_setsMap.find(left); - return i->second; -} -EqualValueSet& ArithAtomDatabase::getEqualValueSet(TNode left){ - Assert(leftIsSetup(left)); - return getVariablesSets(left).d_eqValueSet; -} - -const EqualValueSet& ArithAtomDatabase::getEqualValueSet(TNode left) const{ - Assert(leftIsSetup(left)); - return getVariablesSets(left).d_eqValueSet; -} - -BoundValueSet& ArithAtomDatabase::getBoundValueSet(TNode left){ - Assert(leftIsSetup(left)); - return getVariablesSets(left).d_boundValueSet; -} - -const BoundValueSet& ArithAtomDatabase::getBoundValueSet(TNode left) const{ - Assert(leftIsSetup(left)); - return getVariablesSets(left).d_boundValueSet; -} - -bool ArithAtomDatabase::hasAnyAtoms(TNode v) const{ - Assert(!leftIsSetup(v) - || !(getEqualValueSet(v)).empty() - || !(getBoundValueSet(v)).empty()); - - return leftIsSetup(v); -} - -void ArithAtomDatabase::setupLefthand(TNode left){ - Assert(!leftIsSetup(left)); - - d_setsMap[left] = VariablesSets(); -} - -bool ArithAtomDatabase::containsLiteral(TNode lit) const{ - switch(lit.getKind()){ - case NOT: return containsAtom(lit[0]); - default: return containsAtom(lit); - } -} - -bool ArithAtomDatabase::containsAtom(TNode atom) const{ - switch(atom.getKind()){ - case EQUAL: return containsEquality(atom); - case LEQ: return containsLeq(atom); - case GEQ: return containsGeq(atom); - default: - Unreachable(); - } -} - -bool ArithAtomDatabase::containsEquality(TNode atom) const{ - TNode left = atom[0]; - const EqualValueSet& eqSet = getEqualValueSet(left); - return eqSet.find(atom) != eqSet.end(); -} - -bool ArithAtomDatabase::containsLeq(TNode atom) const{ - TNode left = atom[0]; - const Rational& value = rightHandRational(atom); - - const BoundValueSet& bvSet = getBoundValueSet(left); - BoundValueSet::const_iterator i = bvSet.find(value); - if(i == bvSet.end()){ - return false; - }else{ - const BoundValueEntry& entry = i->second; - return entry.hasLeq(); - } -} - -bool ArithAtomDatabase::containsGeq(TNode atom) const{ - TNode left = atom[0]; - const Rational& value = rightHandRational(atom); - - const BoundValueSet& bvSet = getBoundValueSet(left); - BoundValueSet::const_iterator i = bvSet.find(value); - if(i == bvSet.end()){ - return false; - }else{ - const BoundValueEntry& entry = i->second; - return entry.hasGeq(); - } -} - -void ArithAtomDatabase::addAtom(TNode atom){ - TNode left = atom[0]; - TNode right = atom[1]; - - if(!leftIsSetup(left)){ - setupLefthand(left); - } - - const Rational& value = rightHandRational(atom); - - switch(atom.getKind()){ - case EQUAL: - { - Assert(!containsEquality(atom)); - addImplicationsUsingEqualityAndEqualityValues(atom); - addImplicationsUsingEqualityAndBoundValues(atom); - - pair res = getEqualValueSet(left).insert(atom); - Assert(res.second); - break; - } - case LEQ: - { - addImplicationsUsingLeqAndEqualityValues(atom); - addImplicationsUsingLeqAndBoundValues(atom); - - BoundValueSet& bvSet = getBoundValueSet(left); - if(hasBoundValueEntry(atom)){ - BoundValueSet::iterator i = bvSet.find(value); - BoundValueEntry& inSet = i->second; - inSet.addLeq(atom); - }else{ - bvSet.insert(make_pair(value, BoundValueEntry::mkFromLeq(atom))); - } - break; - } - case GEQ: - { - addImplicationsUsingGeqAndEqualityValues(atom); - addImplicationsUsingGeqAndBoundValues(atom); - - BoundValueSet& bvSet = getBoundValueSet(left); - if(hasBoundValueEntry(atom)){ - BoundValueSet::iterator i = bvSet.find(value); - BoundValueEntry& inSet = i->second; - inSet.addGeq(atom); - }else{ - bvSet.insert(make_pair(value, BoundValueEntry::mkFromGeq(atom))); - } - break; - } - default: - Unreachable(); - } -} - -bool ArithAtomDatabase::hasBoundValueEntry(TNode atom){ - TNode left = atom[0]; - const Rational& value = rightHandRational(atom); - BoundValueSet& bvSet = getBoundValueSet(left); - return bvSet.find(value) != bvSet.end(); -} - -bool rightHandRationalIsEqual(TNode a, TNode b){ - TNode secondA = a[1]; - TNode secondB = b[1]; - - const Rational& qA = secondA.getConst(); - const Rational& qB = secondB.getConst(); - - return qA == qB; -} - - -bool rightHandRationalIsLT(TNode a, TNode b){ - //This version is sticking around because it is easier to read! - return RightHandRationalLT()(a,b); -} - -void ArithAtomDatabase::addImplicationsUsingEqualityAndEqualityValues(TNode atom){ - Assert(atom.getKind() == EQUAL); - TNode left = atom[0]; - EqualValueSet& eqSet = getEqualValueSet(left); - - Node negation = NodeManager::currentNM()->mkNode(NOT, atom); - - for(EqualValueSet::iterator eqIter = eqSet.begin(), endIter = eqSet.end(); - eqIter != endIter; ++eqIter){ - TNode eq = *eqIter; - Assert(eq != atom); - addImplication(eq, negation); - } -} - -// if weaker, do not return an equivalent node -// if strict, get the strongest bound implied by (< x value) -// if !strict, get the strongest bound implied by (<= x value) -Node getUpperBound(const BoundValueSet& bvSet, const Rational& value, bool strict, bool weaker){ - BoundValueSet::const_iterator bv = bvSet.lower_bound(value); - if(bv == bvSet.end()){ - return Node::null(); - } - - if((bv->second).getValue() == value){ - const BoundValueEntry& entry = bv->second; - if(strict && entry.hasGeq() && !weaker){ - return NodeBuilder<1>(NOT) << entry.getGeq(); - }else if(entry.hasLeq() && (strict || !weaker)){ - return entry.getLeq(); - } - } - ++bv; - if(bv == bvSet.end()){ - return Node::null(); - } - Assert(bv->second.getValue() > value); - const BoundValueEntry& entry = bv->second; - if(entry.hasGeq()){ - return NodeBuilder<1>(NOT) << entry.getGeq(); - }else{ - Assert(entry.hasLeq()); - return entry.getLeq(); - } -} - - - - -// if weaker, do not return an equivalent node -// if strict, get the strongest bound implied by (> x value) -// if !strict, get the strongest bound implied by (>= x value) -Node getLowerBound(const BoundValueSet& bvSet, const Rational& value, bool strict, bool weaker){ - static int time = 0; - ++time; - - if(bvSet.empty()){ - return Node::null(); - } - Debug("getLowerBound") << "getLowerBound" << bvSet.size() << " " << value << " " << strict << weaker << endl; - - BoundValueSet::const_iterator bv = bvSet.lower_bound(value); - if(bv == bvSet.end()){ - Debug("getLowerBound") << "got end " << value << " " << (bvSet.rbegin()->second).getValue() << endl; - Assert(value > (bvSet.rbegin()->second).getValue()); - }else{ - Debug("getLowerBound") << value << ", " << bv->second.getValue() << endl; - Assert(value <= bv->second.getValue()); - } - - if(bv != bvSet.end() && (bv->second).getValue() == value){ - const BoundValueEntry& entry = bv->second; - Debug("getLowerBound") << entry.hasLeq() << entry.hasGeq() << endl; - if(strict && entry.hasLeq() && !weaker){ - return NodeBuilder<1>(NOT) << entry.getLeq(); - }else if(entry.hasGeq() && (strict || !weaker)){ - return entry.getGeq(); - } - } - if(bv == bvSet.begin()){ - return Node::null(); - }else{ - --bv; - // (and (>= x v) (>= v v')) then (> x v') - Assert(bv->second.getValue() < value); - const BoundValueEntry& entry = bv->second; - if(entry.hasLeq()){ - return NodeBuilder<1>(NOT) << entry.getLeq(); - }else{ - Assert(entry.hasGeq()); - return entry.getGeq(); - } - } -} - -void ArithAtomDatabase::addImplicationsUsingEqualityAndBoundValues(TNode atom){ - Assert(atom.getKind() == EQUAL); - Node left = atom[0]; - - const Rational& value = rightHandRational(atom); - - BoundValueSet& bvSet = getBoundValueSet(left); - Node ub = getUpperBound(bvSet, value, false, false); - Node lb = getLowerBound(bvSet, value, false, false); - - if(!ub.isNull()){ - addImplication(atom, ub); - } - - if(!lb.isNull()){ - addImplication(atom, lb); - } -} - -void ArithAtomDatabase::addImplicationsUsingLeqAndBoundValues(TNode atom) -{ - Assert(atom.getKind() == LEQ); - Node negation = NodeManager::currentNM()->mkNode(NOT, atom); - - Node ub = getImpliedUpperBoundUsingLeq(atom, false); - Node lb = getImpliedLowerBoundUsingGT(negation, false); - - if(!ub.isNull()){ - addImplication(atom, ub); - } - - if(!lb.isNull()){ - addImplication(negation, lb); - } -} - -void ArithAtomDatabase::addImplicationsUsingLeqAndEqualityValues(TNode atom) { - Assert(atom.getKind() == LEQ); - Node negation = NodeManager::currentNM()->mkNode(NOT, atom); - - TNode left = atom[0]; - EqualValueSet& eqSet = getEqualValueSet(left); - - //TODO Improve this later - for(EqualValueSet::iterator eqIter = eqSet.begin(); eqIter != eqSet.end(); ++eqIter){ - TNode eq = *eqIter; - if(rightHandRationalIsEqual(atom, eq)){ - // (x = b' /\ b = b') => x <= b - addImplication(eq, atom); - }else if(rightHandRationalIsLT(atom, eq)){ - // (x = b' /\ b' > b) => x > b - addImplication(eq, negation); - }else{ - // (x = b' /\ b' < b) => x <= b - addImplication(eq, atom); - } - } -} - - -void ArithAtomDatabase::addImplicationsUsingGeqAndBoundValues(TNode atom){ - Assert(atom.getKind() == GEQ); - Node negation = NodeManager::currentNM()->mkNode(NOT, atom); - - Node lb = getImpliedLowerBoundUsingGeq(atom, false); //What is implied by (>= left value) - Node ub = getImpliedUpperBoundUsingLT(negation, false); - - if(!lb.isNull()){ - addImplication(atom, lb); - } - - if(!ub.isNull()){ - addImplication(negation, ub); - } -} -void ArithAtomDatabase::addImplicationsUsingGeqAndEqualityValues(TNode atom){ - - Assert(atom.getKind() == GEQ); - Node negation = NodeManager::currentNM()->mkNode(NOT, atom); - Node left = atom[0]; - EqualValueSet& eqSet = getEqualValueSet(left); - - //TODO Improve this later - for(EqualValueSet::iterator eqIter = eqSet.begin(); eqIter != eqSet.end(); ++eqIter){ - TNode eq = *eqIter; - if(rightHandRationalIsEqual(atom, eq)){ - // (x = b' /\ b = b') => x >= b - addImplication(eq, atom); - }else if(rightHandRationalIsLT(eq, atom)){ - // (x = b' /\ b' < b) => x < b - addImplication(eq, negation); - }else{ - // (x = b' /\ b' > b) => x >= b - addImplication(eq, atom); - } - } -} - -void ArithAtomDatabase::addImplication(TNode a, TNode b){ - Node imp = NodeBuilder<2>(IMPLIES) << a << b; - - Debug("arith::unate") << "ArithAtomDatabase::addImplication" - << "(" << a << ", " << b <<")" << endl; - - d_arithOut.lemma(imp); -} - - -Node ArithAtomDatabase::getImpliedUpperBoundUsingLeq(TNode leq, bool weaker) const { - Assert(leq.getKind() == LEQ); - Node left = leq[0]; - - if(!leftIsSetup(left)) return Node::null(); - - const Rational& value = rightHandRational(leq); - const BoundValueSet& bvSet = getBoundValueSet(left); - - Node ub = getUpperBound(bvSet, value, false, weaker); - return ub; -} - -Node ArithAtomDatabase::getImpliedUpperBoundUsingLT(TNode lt, bool weaker) const { - Assert(lt.getKind() == NOT && lt[0].getKind() == GEQ); - Node atom = lt[0]; - Node left = atom[0]; - - if(!leftIsSetup(left)) return Node::null(); - - const Rational& value = rightHandRational(atom); - const BoundValueSet& bvSet = getBoundValueSet(left); - - return getUpperBound(bvSet, value, true, weaker); -} - -Node ArithAtomDatabase::getBestImpliedUpperBound(TNode upperBound) const { - Node result = Node::null(); - if(upperBound.getKind() == LEQ ){ - result = getImpliedUpperBoundUsingLeq(upperBound, false); - }else if(upperBound.getKind() == NOT && upperBound[0].getKind() == GEQ){ - result = getImpliedUpperBoundUsingLT(upperBound, false); - }else if(upperBound.getKind() == LT){ - Node geq = NodeBuilder<2>(GEQ) << upperBound[0] << upperBound[1]; - Node lt = NodeBuilder<1>(NOT) << geq; - result = getImpliedUpperBoundUsingLT(lt, false); - }else{ - Unreachable(); - } - - Debug("arith::unate") << upperBound <<" -> " << result << std::endl; - return result; -} - -Node ArithAtomDatabase::getWeakerImpliedUpperBound(TNode upperBound) const { - Node result = Node::null(); - if(upperBound.getKind() == LEQ ){ - result = getImpliedUpperBoundUsingLeq(upperBound, true); - }else if(upperBound.getKind() == NOT && upperBound[0].getKind() == GEQ){ - result = getImpliedUpperBoundUsingLT(upperBound, true); - }else if(upperBound.getKind() == LT){ - Node geq = NodeBuilder<2>(GEQ) << upperBound[0] << upperBound[1]; - Node lt = NodeBuilder<1>(NOT) << geq; - result = getImpliedUpperBoundUsingLT(lt, true); - }else{ - Unreachable(); - } - Assert(upperBound != result); - Debug("arith::unate") << upperBound <<" -> " << result << std::endl; - return result; -} - -Node ArithAtomDatabase::getImpliedLowerBoundUsingGT(TNode gt, bool weaker) const { - Assert(gt.getKind() == NOT && gt[0].getKind() == LEQ); - Node atom = gt[0]; - Node left = atom[0]; - - if(!leftIsSetup(left)) return Node::null(); - - const Rational& value = rightHandRational(atom); - const BoundValueSet& bvSet = getBoundValueSet(left); - - return getLowerBound(bvSet, value, true, weaker); -} - -Node ArithAtomDatabase::getImpliedLowerBoundUsingGeq(TNode geq, bool weaker) const { - Assert(geq.getKind() == GEQ); - Node left = geq[0]; - - if(!leftIsSetup(left)) return Node::null(); - - const Rational& value = rightHandRational(geq); - const BoundValueSet& bvSet = getBoundValueSet(left); - - return getLowerBound(bvSet, value, false, weaker); -} - -Node ArithAtomDatabase::getBestImpliedLowerBound(TNode lowerBound) const { - Node result = Node::null(); - if(lowerBound.getKind() == GEQ ){ - result = getImpliedLowerBoundUsingGeq(lowerBound, false); - }else if(lowerBound.getKind() == NOT && lowerBound[0].getKind() == LEQ){ - result = getImpliedLowerBoundUsingGT(lowerBound, false); - }else if(lowerBound.getKind() == GT){ - Node leq = NodeBuilder<2>(LEQ)<(NOT) << leq; - result = getImpliedLowerBoundUsingGT(gt, false); - }else{ - Unreachable(); - } - Debug("arith::unate") << lowerBound <<" -> " << result << std::endl; - return result; -} - -Node ArithAtomDatabase::getWeakerImpliedLowerBound(TNode lowerBound) const { - Node result = Node::null(); - if(lowerBound.getKind() == GEQ ){ - result = getImpliedLowerBoundUsingGeq(lowerBound, true); - }else if(lowerBound.getKind() == NOT && lowerBound[0].getKind() == LEQ){ - result = getImpliedLowerBoundUsingGT(lowerBound, true); - }else if(lowerBound.getKind() == GT){ - Node leq = NodeBuilder<2>(LEQ)<(NOT) << leq; - result = getImpliedLowerBoundUsingGT(gt, true); - }else{ - Unreachable(); - } - Assert(result != lowerBound); - - Debug("arith::unate") << lowerBound <<" -> " << result << std::endl; - return result; -} - -}; /* namesapce arith */ -}; /* namespace theory */ -}; /* namespace CVC4 */ diff --git a/src/theory/arith/atom_database.h b/src/theory/arith/atom_database.h deleted file mode 100644 index 4da8d7975..000000000 --- a/src/theory/arith/atom_database.h +++ /dev/null @@ -1,165 +0,0 @@ -/********************* */ -/*! \file atom_database.h - ** \verbatim - ** Original author: taking - ** Major contributors: none - ** Minor contributors (to current version): mdeters - ** This file is part of the CVC4 prototype. - ** Copyright (c) 2009, 2010, 2011 The Analysis of Computer Systems Group (ACSys) - ** Courant Institute of Mathematical Sciences - ** New York University - ** See the file COPYING in the top-level source directory for licensing - ** information.\endverbatim - ** - ** \brief ArithAtomDatabase keeps a database of the arithmetic atoms. - ** Importantly, ArithAtomDatabase also handles unate propagations, - ** i.e. it constructs implications of the form - ** "if x < c and c < b, then x < b" (where c and b are constants). - ** - ** ArithAtomDatabase detects unate implications amongst the atoms - ** associated with the theory of arithmetic and informs the SAT solver of the - ** implication. A unate implication is an implication of the form: - ** "if x < c and c < b, then x < b" (where c and b are constants). - ** Unate implications are always 2-SAT clauses. - ** ArithAtomDatabase sends the implications to the SAT solver in an - ** online fashion. - ** This means that atoms may be added during solving or before. - ** - ** ArithAtomDatabase maintains sorted lists containing all atoms associated - ** for each unique left hand side, the "x" in the inequality "x < c". - ** The lists are sorted by the value of the right hand side which must be a - ** rational constant. - ** - ** ArithAtomDatabase tries to send out a minimal number of additional - ** lemmas per atom added. Let (x < a), (x < b), (x < c) be arithmetic atoms s.t. - ** a < b < c. - ** If the the order of adding the atoms is (x < a), (x < b), and (x < c), then - ** then set of all lemmas added is: - ** {(=> (x (x (x (x (x - -namespace CVC4 { -namespace theory { -namespace arith { - -class ArithAtomDatabase { -private: - /** - * OutputChannel for the theory of arithmetic. - * The propagator uses this to pass implications back to the SAT solver. - */ - OutputChannel& d_arithOut; - - struct VariablesSets { - BoundValueSet d_boundValueSet; - EqualValueSet d_eqValueSet; - }; - - typedef __gnu_cxx::hash_map NodeToSetsMap; - NodeToSetsMap d_setsMap; - -public: - ArithAtomDatabase(context::Context* cxt, OutputChannel& arith); - - /** - * Adds an atom to the propagator. - * Any resulting lemmas will be output via d_arithOut. - */ - void addAtom(TNode atom); - - /** Returns true if v has been added as a left hand side in an atom */ - bool hasAnyAtoms(TNode v) const; - - bool containsLiteral(TNode lit) const; - bool containsAtom(TNode atom) const; - bool containsEquality(TNode atom) const; - bool containsLeq(TNode atom) const; - bool containsGeq(TNode atom) const; - - /** Check to make sure an lhs has been properly set-up. */ - bool leftIsSetup(TNode left) const; - -private: - - VariablesSets& getVariablesSets(TNode left); - BoundValueSet& getBoundValueSet(TNode left); - EqualValueSet& getEqualValueSet(TNode left); - - const VariablesSets& getVariablesSets(TNode left) const; - const BoundValueSet& getBoundValueSet(TNode left) const; - const EqualValueSet& getEqualValueSet(TNode left) const; - - /** Sends an implication (=> a b) to the PropEngine via d_arithOut. */ - void addImplication(TNode a, TNode b); - - /** Initializes the lists associated with a unique lhs. */ - void setupLefthand(TNode left); - - - /** - * The addImplicationsUsingKAndJList(...) - * functions are the work horses of the unate part of ArithAtomDatabase. - * These take an atom of the kind K that has just been added - * to its associated list, and the ordered list of Js associated with the lhs, - * and uses these to deduce unate implications. - * (K and J vary over EQUAL, LEQ, and GEQ.) - * - * Input: - * atom - the atom being inserted of kind K - * Jset - the list of atoms of kind J associated with the lhs. - * - * Unfortunately, these tend to be an absolute bear to read because - * of all of the special casing and C++ iterator manipulation required. - */ - - void addImplicationsUsingEqualityAndEqualityValues(TNode eq); - void addImplicationsUsingEqualityAndBoundValues(TNode eq); - - void addImplicationsUsingLeqAndEqualityValues(TNode leq); - void addImplicationsUsingLeqAndBoundValues(TNode leq); - - void addImplicationsUsingGeqAndEqualityValues(TNode geq); - void addImplicationsUsingGeqAndBoundValues(TNode geq); - - bool hasBoundValueEntry(TNode n); - - Node getImpliedUpperBoundUsingLeq(TNode leq, bool weaker) const; - Node getImpliedUpperBoundUsingLT(TNode lt, bool weaker) const; - - Node getImpliedLowerBoundUsingGeq(TNode geq, bool weaker) const; - Node getImpliedLowerBoundUsingGT(TNode gt, bool weaker) const; - -public: - Node getBestImpliedUpperBound(TNode upperBound) const; - Node getBestImpliedLowerBound(TNode lowerBound) const; - - - Node getWeakerImpliedUpperBound(TNode upperBound) const; - Node getWeakerImpliedLowerBound(TNode lowerBound) const; -}; - -}/* CVC4::theory::arith namespace */ -}/* CVC4::theory namespace */ -}/* CVC4 namespace */ - -#endif /* __CVC4__THEORY__ARITH__ARITH_ATOM_DATABASE_H */ diff --git a/src/theory/arith/constraint.cpp b/src/theory/arith/constraint.cpp new file mode 100644 index 000000000..f78ecdddf --- /dev/null +++ b/src/theory/arith/constraint.cpp @@ -0,0 +1,1130 @@ + +#include "cvc4_private.h" +#include "theory/arith/constraint.h" +#include "theory/arith/arith_utilities.h" +#include "theory/arith/normal_form.h" + +#include +#include + +using namespace std; +using namespace CVC4::kind; + +namespace CVC4 { +namespace theory { +namespace arith { + +/** Given a simplifiedKind this returns the corresponding ConstraintType. */ +//ConstraintType constraintTypeOfLiteral(Kind k); +ConstraintType constraintTypeOfComparison(const Comparison& cmp){ + Kind k = cmp.comparisonKind(); + switch(k){ + case LT: + case LEQ: + { + Polynomial l = cmp.getLeft(); + if(l.leadingCoefficientIsPositive()){ // (< x c) + return UpperBound; + }else{ + return LowerBound; // (< (-x) c) + } + } + case GT: + case GEQ: + { + Polynomial l = cmp.getLeft(); + if(l.leadingCoefficientIsPositive()){ + return LowerBound; // (> x c) + }else{ + return UpperBound; // (> (-x) c) + } + } + case EQUAL: + return Equality; + case DISTINCT: + return Disequality; + default: + Unhandled(k); + } +} + +ConstraintValue::ConstraintValue(ArithVar x, ConstraintType t, const DeltaRational& v) + : d_variable(x), + d_type(t), + d_value(v), + d_database(NULL), + d_literal(Node::null()), + d_negation(NullConstraint), + d_canBePropagated(false), + d_assertionOrder(AssertionOrderSentinel), + d_proof(ProofIdSentinel), + d_split(false), + d_variablePosition() +{ + Assert(!initialized()); +} + + +std::ostream& operator<<(std::ostream& o, const Constraint c){ + return o << *c; +} + +std::ostream& operator<<(std::ostream& o, const ConstraintType t){ + switch(t){ + case LowerBound: + return o << ">="; + case UpperBound: + return o << "<="; + case Equality: + return o << "="; + case Disequality: + return o << "!="; + default: + Unreachable(); + } +} + +std::ostream& operator<<(std::ostream& o, const ConstraintValue& c){ + o << c.getVariable() << ' ' << c.getType() << ' ' << c.getValue(); + if(c.hasLiteral()){ + o << "(node " << c.getLiteral() << ')'; + } + return o; +} + +std::ostream& operator<<(std::ostream& o, const ValueCollection& vc){ + o << "{"; + bool pending = false; + if(vc.hasEquality()){ + o << "eq: " << vc.getEquality(); + pending = true; + } + if(vc.hasLowerBound()){ + if(pending){ + o << ", "; + } + o << "lb: " << vc.getLowerBound(); + pending = true; + } + if(vc.hasUpperBound()){ + if(pending){ + o << ", "; + } + o << "ub: " << vc.getUpperBound(); + pending = true; + } + if(vc.hasDisequality()){ + if(pending){ + o << ", "; + } + o << "de: " << vc.getDisequality(); + } + return o << "}"; +} + +void ConstraintValue::debugPrint() const { + cout << *this << endl; +} + +void ValueCollection::push_into(std::vector& vec) const { + Debug("arith::constraint") << "push_into " << *this << endl; + if(hasEquality()){ + vec.push_back(d_equality); + } + if(hasLowerBound()){ + vec.push_back(d_lowerBound); + } + if(hasUpperBound()){ + vec.push_back(d_upperBound); + } + if(hasDisequality()){ + vec.push_back(d_disequality); + } +} + +ValueCollection ValueCollection::mkFromConstraint(Constraint c){ + ValueCollection ret; + Assert(ret.empty()); + switch(c->getType()){ + case LowerBound: + ret.d_lowerBound = c; + break; + case UpperBound: + ret.d_upperBound = c; + break; + case Equality: + ret.d_equality = c; + break; + case Disequality: + ret.d_disequality = c; + break; + default: + Unreachable(); + } + return ret; +} + +bool ValueCollection::hasConstraintOfType(ConstraintType t) const{ + switch(t){ + case LowerBound: + return hasLowerBound(); + case UpperBound: + return hasUpperBound(); + case Equality: + return hasEquality(); + case Disequality: + return hasDisequality(); + default: + Unreachable(); + } +} + +ArithVar ValueCollection::getVariable() const{ + Assert(!empty()); + return nonNull()->getVariable(); +} + +const DeltaRational& ValueCollection::getValue() const{ + Assert(!empty()); + return nonNull()->getValue(); +} + +void ValueCollection::add(Constraint c){ + Assert(c != NullConstraint); + + Assert(empty() || getVariable() == c->getVariable()); + Assert(empty() || getValue() == c->getValue()); + + switch(c->getType()){ + case LowerBound: + Assert(!hasLowerBound()); + d_lowerBound = c; + break; + case Equality: + Assert(!hasEquality()); + d_equality = c; + break; + case UpperBound: + Assert(!hasUpperBound()); + d_upperBound = c; + break; + case Disequality: + Assert(!hasDisequality()); + d_disequality = c; + break; + default: + Unreachable(); + } +} + +Constraint ValueCollection::getConstraintOfType(ConstraintType t) const{ + switch(t){ + case LowerBound: + Assert(hasLowerBound()); + return d_lowerBound; + case Equality: + Assert(hasEquality()); + return d_equality; + case UpperBound: + Assert(hasUpperBound()); + return d_upperBound; + case Disequality: + Assert(hasDisequality()); + return d_disequality; + default: + Unreachable(); + } +} + +void ValueCollection::remove(ConstraintType t){ + switch(t){ + case LowerBound: + Assert(hasLowerBound()); + d_lowerBound = NullConstraint; + break; + case Equality: + Assert(hasEquality()); + d_equality = NullConstraint; + break; + case UpperBound: + Assert(hasUpperBound()); + d_upperBound = NullConstraint; + break; + case Disequality: + Assert(hasDisequality()); + d_disequality = NullConstraint; + break; + default: + Unreachable(); + } +} + +bool ValueCollection::empty() const{ + return + !(hasLowerBound() || + hasUpperBound() || + hasEquality() || + hasDisequality()); +} + +Constraint ValueCollection::nonNull() const{ + //This can be optimized by caching, but this is not necessary yet! + /* "Premature optimization is the root of all evil." */ + if(hasLowerBound()){ + return d_lowerBound; + }else if(hasUpperBound()){ + return d_upperBound; + }else if(hasEquality()){ + return d_equality; + }else if(hasDisequality()){ + return d_disequality; + }else{ + return NullConstraint; + } +} + +bool ConstraintValue::initialized() const { + return d_database != NULL; +} + +void ConstraintValue::initialize(ConstraintDatabase* db, SortedConstraintMapIterator v, Constraint negation){ + Assert(!initialized()); + d_database = db; + d_variablePosition = v; + d_negation = negation; +} + +ConstraintValue::~ConstraintValue() { + Assert(safeToGarbageCollect()); + + if(initialized()){ + ValueCollection& vc = d_variablePosition->second; + Debug("arith::constraint") << "removing" << vc << endl; + + vc.remove(getType()); + + if(vc.empty()){ + Debug("arith::constraint") << "erasing" << vc << endl; + SortedConstraintMap& perVariable = d_database->getVariableSCM(getVariable()); + perVariable.erase(d_variablePosition); + } + + if(hasLiteral()){ + d_database->d_nodetoConstraintMap.erase(getLiteral()); + } + } +} + +const ValueCollection& ConstraintValue::getValueCollection() const{ + return d_variablePosition->second; +} + +Constraint ConstraintValue::getCeiling() { + Debug("getCeiling") << "ConstraintValue::getCeiling on " << *this << endl; + Assert(getValue().getInfinitesimalPart().sgn() > 0); + + DeltaRational ceiling(getValue().ceiling()); + +#warning "Optimize via the iterator" + return d_database->getConstraint(getVariable(), getType(), ceiling); +} + +Constraint ConstraintValue::getFloor() { + Assert(getValue().getInfinitesimalPart().sgn() < 0); + + DeltaRational floor(Rational(getValue().floor())); + +#warning "Optimize via the iterator" + return d_database->getConstraint(getVariable(), getType(), floor); +} + +void ConstraintValue::setCanBePropagated() { + Assert(!canBePropagated()); + d_database->pushCanBePropagatedWatch(this); +} + +void ConstraintValue::setAssertedToTheTheory() { + Assert(hasLiteral()); + Assert(!assertedToTheTheory()); + Assert(!d_negation->assertedToTheTheory()); + d_database->pushAssertionOrderWatch(this); +} + +bool ConstraintValue::isSelfExplaining() const { + return d_proof == d_database->d_selfExplainingProof; +} + +bool ConstraintValue::hasEqualityEngineProof() const { + return d_proof == d_database->d_equalityEngineProof; +} + +bool ConstraintValue::sanityChecking(Node n) const { + Comparison cmp = Comparison::parseNormalForm(n); + Kind k = cmp.comparisonKind(); + Polynomial pleft = cmp.normalizedVariablePart(); + Assert(k == EQUAL || k == DISTINCT || pleft.leadingCoefficientIsPositive()); + Assert(k != EQUAL || Monomial::isMember(n[0])); + Assert(k != DISTINCT || Monomial::isMember(n[0][0])); + + TNode left = pleft.getNode(); + DeltaRational right = cmp.normalizedDeltaRational(); + + const ArithVarNodeMap& av2node = d_database->getArithVarNodeMap(); + + Debug("nf::tmp") << cmp.getNode() << endl; + Debug("nf::tmp") << k << endl; + Debug("nf::tmp") << pleft.getNode() << endl; + Debug("nf::tmp") << left << endl; + Debug("nf::tmp") << right << endl; + Debug("nf::tmp") << getValue() << endl; + Debug("nf::tmp") << av2node.hasArithVar(left) << endl; + Debug("nf::tmp") << av2node.asArithVar(left) << endl; + Debug("nf::tmp") << getVariable() << endl; + + + if(av2node.hasArithVar(left) && + av2node.asArithVar(left) == getVariable() && + getValue() == right){ + switch(getType()){ + case LowerBound: + case UpperBound: + //Be overapproximate + return k == GT || k == GEQ ||k == LT || k == LEQ; + case Equality: + return k == EQUAL; + case Disequality: + return k == DISTINCT; + default: + Unreachable(); + } + }else{ + return false; + } +} + +Constraint ConstraintValue::makeNegation(ArithVar v, ConstraintType t, const DeltaRational& r){ + switch(t){ + case LowerBound: + { + Assert(r.infinitesimalSgn() >= 0); + if(r.infinitesimalSgn() > 0){ + Assert(r.getInfinitesimalPart() == 1); + // make (not (v > r)), which is (v <= r) + DeltaRational dropInf(r.getNoninfinitesimalPart(), 0); + return new ConstraintValue(v, UpperBound, dropInf); + }else{ + Assert(r.infinitesimalSgn() == 0); + // make (not (v >= r)), which is (v < r) + DeltaRational addInf(r.getNoninfinitesimalPart(), -1); + return new ConstraintValue(v, UpperBound, addInf); + } + } + case UpperBound: + { + Assert(r.infinitesimalSgn() <= 0); + if(r.infinitesimalSgn() < 0){ + Assert(r.getInfinitesimalPart() == -1); + // make (not (v < r)), which is (v >= r) + DeltaRational dropInf(r.getNoninfinitesimalPart(), 0); + return new ConstraintValue(v, LowerBound, dropInf); + }else{ + Assert(r.infinitesimalSgn() == 0); + // make (not (v <= r)), which is (v > r) + DeltaRational addInf(r.getNoninfinitesimalPart(), 1); + return new ConstraintValue(v, LowerBound, addInf); + } + } + case Equality: + return new ConstraintValue(v, Disequality, r); + case Disequality: + return new ConstraintValue(v, Equality, r); + default: + Unreachable(); + return NullConstraint; + } +} + +ConstraintDatabase::ConstraintDatabase(context::Context* satContext, context::Context* userContext, const ArithVarNodeMap& av2nodeMap, + DifferenceManager& dm) + : d_varDatabases(), + d_toPropagate(satContext), + d_proofs(satContext, false), + d_watches(new Watches(satContext, userContext)), + d_av2nodeMap(av2nodeMap), + d_differenceManager(dm), + d_satContext(satContext), + d_satAllocationLevel(d_satContext->getLevel()) +{ + d_selfExplainingProof = d_proofs.size(); + d_proofs.push_back(NullConstraint); + + d_equalityEngineProof = d_proofs.size(); + d_proofs.push_back(NullConstraint); +} + +Constraint ConstraintDatabase::getConstraint(ArithVar v, ConstraintType t, const DeltaRational& r){ + //This must always return a constraint. + + SortedConstraintMap& scm = getVariableSCM(v); + pair insertAttempt; + insertAttempt = scm.insert(make_pair(r, ValueCollection())); + + SortedConstraintMapIterator pos = insertAttempt.first; + ValueCollection& vc = pos->second; + if(vc.hasConstraintOfType(t)){ + return vc.getConstraintOfType(t); + }else{ + Constraint c = new ConstraintValue(v, t, r); + Constraint negC = ConstraintValue::makeNegation(v, t, r); + + SortedConstraintMapIterator negPos; + if(t == Equality || t == Disequality){ + negPos = pos; + }else{ + pair negInsertAttempt; + negInsertAttempt = scm.insert(make_pair(negC->getValue(), ValueCollection())); + Assert(negInsertAttempt.second); + negPos = negInsertAttempt.first; + } + + c->initialize(this, pos, negC); + negC->initialize(this, negPos, c); + + vc.add(c); + negPos->second.add(negC); + + return c; + } +} +bool ConstraintDatabase::emptyDatabase(const std::vector& vec){ + std::vector::const_iterator first = vec.begin(); + std::vector::const_iterator last = vec.end(); + return std::find_if(first, last, PerVariableDatabase::IsEmpty) == last; +} + +ConstraintDatabase::~ConstraintDatabase(){ + Assert(d_satAllocationLevel <= d_satContext->getLevel()); + + delete d_watches; + + std::vector constraintList; + + while(!d_varDatabases.empty()){ + PerVariableDatabase* back = d_varDatabases.back(); + + SortedConstraintMap& scm = back->d_constraints; + SortedConstraintMapIterator i = scm.begin(), i_end = scm.end(); + for(; i != i_end; ++i){ + (i->second).push_into(constraintList); + } + while(!constraintList.empty()){ + Constraint c = constraintList.back(); + constraintList.pop_back(); + delete c; + } + Assert(scm.empty()); + d_varDatabases.pop_back(); + delete back; + } + + Assert(d_nodetoConstraintMap.empty()); +} + +void ConstraintDatabase::addVariable(ArithVar v){ + Assert(v == d_varDatabases.size()); + d_varDatabases.push_back(new PerVariableDatabase(v)); +} + +bool ConstraintValue::safeToGarbageCollect() const{ + return !isSplit() + && !canBePropagated() + && !hasProof() + && !assertedToTheTheory(); +} + +Node ConstraintValue::split(){ + Assert(isEquality() || isDisequality()); + + bool isEq = isEquality(); + + Constraint eq = isEq ? this : d_negation; + Constraint diseq = isEq ? d_negation : this; + + TNode eqNode = eq->getLiteral(); + Assert(eqNode.getKind() == kind::EQUAL); + TNode lhs = eqNode[0]; + TNode rhs = eqNode[1]; + + Node ltNode = NodeBuilder<2>(kind::LT) << lhs << rhs; + Node gtNode = NodeBuilder<2>(kind::GT) << lhs << rhs; + + Node lemma = NodeBuilder<3>(OR) << eqNode << ltNode << gtNode; + + + eq->d_database->pushSplitWatch(eq); + diseq->d_database->pushSplitWatch(diseq); + + return lemma; +} + +bool ConstraintDatabase::hasLiteral(TNode literal) const { + return lookup(literal) != NullConstraint; +} + +// Constraint ConstraintDatabase::addLiteral(TNode literal){ +// Assert(!hasLiteral(literal)); +// bool isNot = (literal.getKind() == NOT); +// TNode atom = isNot ? literal[0] : literal; + +// Constraint atomC = addAtom(atom); + +// return isNot ? atomC->d_negation : atomC; +// } + +// Constraint ConstraintDatabase::allocateConstraintForComparison(ArithVar v, const Comparison cmp){ +// Debug("arith::constraint") << "allocateConstraintForLiteral(" << v << ", "<< cmp <<")" << endl; +// Kind kind = cmp.comparisonKind(); +// ConstraintType type = constraintTypeOfLiteral(kind); + +// DeltaRational dr = cmp.getDeltaRational(); +// return new ConstraintValue(v, type, dr); +// } + +Constraint ConstraintDatabase::addLiteral(TNode literal){ + Assert(!hasLiteral(literal)); + bool isNot = (literal.getKind() == NOT); + Node atomNode = (isNot ? literal[0] : literal); + Node negationNode = atomNode.notNode(); + + Assert(!hasLiteral(atomNode)); + Assert(!hasLiteral(negationNode)); + Comparison posCmp = Comparison::parseNormalForm(atomNode); + + ConstraintType posType = constraintTypeOfComparison(posCmp); + + Polynomial nvp = posCmp.normalizedVariablePart(); + Debug("nf::tmp") << "here " << nvp.getNode() << " " << endl; + ArithVar v = d_av2nodeMap.asArithVar(nvp.getNode()); + + DeltaRational posDR = posCmp.normalizedDeltaRational(); + + Constraint posC = new ConstraintValue(v, posType, posDR); + + Debug("arith::constraint") << "addliteral( literal ->" << literal << ")" << endl; + Debug("arith::constraint") << "addliteral( posC ->" << posC << ")" << endl; + + SortedConstraintMap& scm = getVariableSCM(posC->getVariable()); + pair insertAttempt; + insertAttempt = scm.insert(make_pair(posC->getValue(), ValueCollection())); + + SortedConstraintMapIterator posI = insertAttempt.first; + // If the attempt succeeds, i points to a new empty ValueCollection + // If the attempt fails, i points to a pre-existing ValueCollection + + if(posI->second.hasConstraintOfType(posC->getType())){ + //This is the situation where the Constraint exists, but + //the literal has not been associated with it. + Constraint hit = posI->second.getConstraintOfType(posC->getType()); + Debug("arith::constraint") << "hit " << hit << endl; + Debug("arith::constraint") << "posC " << posC << endl; + + delete posC; + + hit->setLiteral(atomNode); + hit->getNegation()->setLiteral(negationNode); + return isNot ? hit->getNegation(): hit; + }else{ + Comparison negCmp = Comparison::parseNormalForm(negationNode); + + ConstraintType negType = constraintTypeOfComparison(negCmp); + DeltaRational negDR = negCmp.normalizedDeltaRational(); + + Constraint negC = new ConstraintValue(v, negType, negDR); + + SortedConstraintMapIterator negI; + + if(posC->isEquality()){ + negI = posI; + }else{ + Assert(posC->isLowerBound() || posC->isUpperBound()); + + pair negInsertAttempt; + negInsertAttempt = scm.insert(make_pair(negC->getValue(), ValueCollection())); + + Debug("nf::tmp") << "sdhjfgdhjkldfgljkhdfg" << endl; + Debug("nf::tmp") << negC << endl; + Debug("nf::tmp") << negC->getValue() << endl; + + //This should always succeed as the DeltaRational for the negation is unique! + Assert(negInsertAttempt.second); + + negI = negInsertAttempt.first; + } + + (posI->second).add(posC); + (negI->second).add(negC); + + posC->initialize(this, posI, negC); + negC->initialize(this, negI, posC); + + posC->setLiteral(atomNode); + negC->setLiteral(negationNode); + + return isNot ? negC : posC; + } +} + +// ConstraintType constraintTypeOfLiteral(Kind k){ +// switch(k){ +// case LT: +// case LEQ: +// return UpperBound; +// case GT: +// case GEQ: +// return LowerBound; +// case EQUAL: +// return Equality; +// case DISTINCT: +// return Disequality; +// default: +// Unreachable(); +// } +// } + +Constraint ConstraintDatabase::lookup(TNode literal) const{ + NodetoConstraintMap::const_iterator iter = d_nodetoConstraintMap.find(literal); + if(iter == d_nodetoConstraintMap.end()){ + return NullConstraint; + }else{ + return iter->second; + } +} + +void ConstraintValue::selfExplaining(){ + markAsTrue(); +} + +void ConstraintValue::propagate(){ + Assert(hasProof()); + Assert(canBePropagated()); + Assert(!assertedToTheTheory()); + Assert(!isSelfExplaining()); + + d_database->d_toPropagate.push(this); +} + +void ConstraintValue::propagate(Constraint a){ + Assert(!hasProof()); + Assert(canBePropagated()); + + markAsTrue(a); + propagate(); +} + +void ConstraintValue::propagate(Constraint a, Constraint b){ + Assert(!hasProof()); + Assert(canBePropagated()); + + markAsTrue(a, b); + propagate(); +} + +void ConstraintValue::propagate(const std::vector& b){ + Assert(!hasProof()); + Assert(canBePropagated()); + + markAsTrue(b); + propagate(); +} + +void ConstraintValue::impliedBy(Constraint a){ + Assert(!isTrue()); + Assert(!getNegation()->isTrue()); + + markAsTrue(a); + if(canBePropagated()){ + propagate(); + } +} + +void ConstraintValue::impliedBy(Constraint a, Constraint b){ + Assert(!isTrue()); + Assert(!getNegation()->isTrue()); + + markAsTrue(a, b); + if(canBePropagated()){ + propagate(); + } +} + +void ConstraintValue::impliedBy(const std::vector& b){ + Assert(!isTrue()); + Assert(!getNegation()->isTrue()); + + markAsTrue(b); + if(canBePropagated()){ + propagate(); + } +} + +void ConstraintValue::setEqualityEngineProof(){ + Assert(truthIsUnknown()); + Assert(hasLiteral()); + d_database->pushProofWatch(this, d_database->d_equalityEngineProof); +} + +void ConstraintValue::markAsTrue(){ + Assert(truthIsUnknown()); + Assert(hasLiteral()); + Assert(assertedToTheTheory()); + d_database->pushProofWatch(this, d_database->d_selfExplainingProof); +} + +void ConstraintValue::markAsTrue(Constraint imp){ + Assert(truthIsUnknown()); + Assert(imp->hasProof()); + + d_database->d_proofs.push_back(NullConstraint); + d_database->d_proofs.push_back(imp); + ProofId proof = d_database->d_proofs.size() - 1; + d_database->pushProofWatch(this, proof); +} + +void ConstraintValue::markAsTrue(Constraint impA, Constraint impB){ + Assert(truthIsUnknown()); + Assert(impA->hasProof()); + Assert(impB->hasProof()); + + d_database->d_proofs.push_back(NullConstraint); + d_database->d_proofs.push_back(impA); + d_database->d_proofs.push_back(impB); + ProofId proof = d_database->d_proofs.size() - 1; + + d_database->pushProofWatch(this, proof); +} + +void ConstraintValue::markAsTrue(const vector& a){ + Assert(truthIsUnknown()); + Assert(a.size() >= 1); + d_database->d_proofs.push_back(NullConstraint); + for(vector::const_iterator i = a.begin(), end = a.end(); i != end; ++i){ + Constraint c_i = *i; + Assert(c_i->hasProof()); + d_database->d_proofs.push_back(c_i); + } + + ProofId proof = d_database->d_proofs.size() - 1; + + d_database->pushProofWatch(this, proof); +} + +SortedConstraintMap& ConstraintValue::constraintSet() const{ + Assert(d_database->variableDatabaseIsSetup(d_variable)); + return (d_database->d_varDatabases[d_variable])->d_constraints; +} + +bool ConstraintValue::proofIsEmpty() const{ + Assert(hasProof()); + bool result = d_database->d_proofs[d_proof] == NullConstraint; + Assert((!result) || isSelfExplaining() || hasEqualityEngineProof()); + return result; +} + +void ConstraintValue::explainBefore(NodeBuilder<>& nb, AssertionOrder order) const{ + Assert(hasProof()); + Assert(!isSelfExplaining() || assertedToTheTheory()); + + if(assertedBefore(order)){ + nb << getLiteral(); + }else if(hasEqualityEngineProof()){ + d_database->eeExplain(this, nb); + }else{ + Assert(!isSelfExplaining()); + ProofId p = d_proof; + Constraint antecedent = d_database->d_proofs[p]; + + for(; antecedent != NullConstraint; antecedent = d_database->d_proofs[--p] ){ + antecedent->explainBefore(nb, order); + } + } +} +Node ConstraintValue::explainBefore(AssertionOrder order) const{ + Assert(hasProof()); + Assert(!isSelfExplaining() || assertedBefore(order)); + if(assertedBefore(order)){ + return getLiteral(); + }else if(hasEqualityEngineProof()){ + return d_database->eeExplain(this); + }else{ + Assert(!proofIsEmpty()); + //Force the selection of the layer above if the node is assertedToTheTheory()! + if(d_database->d_proofs[d_proof-1] == NullConstraint){ + Constraint antecedent = d_database->d_proofs[d_proof]; + return antecedent->explainBefore(order); + }else{ + NodeBuilder<> nb(kind::AND); + Assert(!isSelfExplaining()); + + ProofId p = d_proof; + Constraint antecedent = d_database->d_proofs[p]; + for(; antecedent != NullConstraint; antecedent = d_database->d_proofs[--p] ){ + antecedent->explainBefore(nb, order); + } + return nb; + } + } +} + +Node ConstraintValue::explainConflict(Constraint a, Constraint b){ + NodeBuilder<> nb(kind::AND); + a->explainForConflict(nb); + b->explainForConflict(nb); + return nb; +} + +Node ConstraintValue::explainConflict(Constraint a, Constraint b, Constraint c){ + NodeBuilder<> nb(kind::AND); + a->explainForConflict(nb); + b->explainForConflict(nb); + c->explainForConflict(nb); + return nb; +} + +Constraint ConstraintValue::getStrictlyWeakerLowerBound(bool hasLiteral, bool asserted) const { + Assert(initialized()); + Assert(!asserted || hasLiteral); + + SortedConstraintMapConstIterator i = d_variablePosition; + const SortedConstraintMap& scm = constraintSet(); + SortedConstraintMapConstIterator i_begin = scm.begin(); + while(i != i_begin){ + --i; + const ValueCollection& vc = i->second; + if(vc.hasLowerBound()){ + Constraint weaker = vc.getLowerBound(); + + // asserted -> hasLiteral + // hasLiteral -> weaker->hasLiteral() + // asserted -> weaker->assertedToTheTheory() + if((!hasLiteral || (weaker->hasLiteral())) && + (!asserted || ( weaker->assertedToTheTheory()))){ + return weaker; + } + } + } + return NullConstraint; +} + +Constraint ConstraintValue::getStrictlyWeakerUpperBound(bool hasLiteral, bool asserted) const { + SortedConstraintMapConstIterator i = d_variablePosition; + const SortedConstraintMap& scm = constraintSet(); + SortedConstraintMapConstIterator i_end = scm.end(); + + ++i; + for(; i != i_end; ++i){ + const ValueCollection& vc = i->second; + if(vc.hasUpperBound()){ + Constraint weaker = vc.getUpperBound(); + if((!hasLiteral || (weaker->hasLiteral())) && + (!asserted || ( weaker->assertedToTheTheory()))){ + return weaker; + } + } + } + + return NullConstraint; +} + +Constraint ConstraintDatabase::getBestImpliedBound(ArithVar v, ConstraintType t, const DeltaRational& r) const { + Assert(variableDatabaseIsSetup(v)); + Assert(t == UpperBound || t == LowerBound); + + SortedConstraintMap& scm = getVariableSCM(v); + if(t == UpperBound){ + SortedConstraintMapConstIterator i = scm.lower_bound(r); + SortedConstraintMapConstIterator i_end = scm.end(); + Assert(i == i_end || r <= i->first); + for(; i != i_end; i++){ + Assert(r <= i->first); + const ValueCollection& vc = i->second; + if(vc.hasUpperBound()){ + return vc.getUpperBound(); + } + } + return NullConstraint; + }else{ + Assert(t == LowerBound); + if(scm.empty()){ + return NullConstraint; + }else{ + SortedConstraintMapConstIterator i = scm.lower_bound(r); + SortedConstraintMapConstIterator i_begin = scm.begin(); + SortedConstraintMapConstIterator i_end = scm.end(); + Assert(i == i_end || r <= i->first); + + int fdj = 0; + + if(i == i_end){ + --i; + Debug("getBestImpliedBound") << fdj++ << " " << r << " " << i->first << endl; + }else if( (i->first) > r){ + if(i == i_begin){ + return NullConstraint; + }else{ + --i; + Debug("getBestImpliedBound") << fdj++ << " " << r << " " << i->first << endl; + } + } + + do{ + Debug("getBestImpliedBound") << fdj++ << " " << r << " " << i->first << endl; + Assert(r >= i->first); + const ValueCollection& vc = i->second; + + if(vc.hasLowerBound()){ + return vc.getLowerBound(); + } + + if(i == i_begin){ + break; + }else{ + --i; + } + }while(true); + return NullConstraint; + } + } +} +Node ConstraintDatabase::eeExplain(const ConstraintValue* const c) const{ + Assert(c->hasLiteral()); + return d_differenceManager.explain(c->getLiteral()); +} + +void ConstraintDatabase::eeExplain(const ConstraintValue* const c, NodeBuilder<>& nb) const{ + Assert(c->hasLiteral()); + d_differenceManager.explain(c->getLiteral(), nb); +} + +bool ConstraintDatabase::variableDatabaseIsSetup(ArithVar v) const { + return v < d_varDatabases.size(); +} + + +ConstraintDatabase::Watches::Watches(context::Context* satContext, context::Context* userContext): + d_proofWatches(satContext), + d_canBePropagatedWatches(satContext), + d_assertionOrderWatches(satContext), + d_splitWatches(userContext) +{} + + +void ConstraintValue::setLiteral(Node n) { + Assert(!hasLiteral()); + Assert(sanityChecking(n)); + d_literal = n; + NodetoConstraintMap& map = d_database->d_nodetoConstraintMap; + Assert(map.find(n) == map.end()); + map.insert(make_pair(d_literal, this)); +} + +void implies(std::vector& out, Constraint a, Constraint b){ + Node la = a->getLiteral(); + Node lb = b->getLiteral(); + + Node neg_la = (la.getKind() == kind::NOT)? la[0] : la.notNode(); + + Assert(lb != neg_la); + Node orderOr = (lb < neg_la) ? lb.orNode(neg_la) : neg_la.orNode(lb); + out.push_back(orderOr); +} + +void mutuallyExclusive(std::vector& out, Constraint a, Constraint b){ + Node la = a->getLiteral(); + Node lb = b->getLiteral(); + + Node neg_la = (la.getKind() == kind::NOT)? la[0] : la.notNode(); + Node neg_lb = (lb.getKind() == kind::NOT)? lb[0] : lb.notNode(); + + Assert(neg_la != neg_lb); + Node orderOr = (neg_la < neg_lb) ? neg_la.orNode(neg_lb) : neg_lb.orNode(neg_la); + out.push_back(orderOr); +} + +void ConstraintDatabase::outputAllUnateLemmas(std::vector& out, ArithVar v) const{ + SortedConstraintMap& scm = getVariableSCM(v); + + SortedConstraintMapConstIterator outer; + SortedConstraintMapConstIterator scm_end = scm.end(); + + vector equalities; + for(outer = scm.begin(); outer != scm_end; ++outer){ + const ValueCollection& vc = outer->second; + if(vc.hasEquality()){ + Constraint eq = vc.getEquality(); + if(eq->hasLiteral()){ + equalities.push_back(eq); + } + } + } + + Constraint prev = NullConstraint; + //get transitive unates + //Only lower bounds or upperbounds should be done. + for(outer = scm.begin(); outer != scm_end; ++outer){ + const ValueCollection& vc = outer->second; + + if(vc.hasUpperBound()){ + Constraint ub = vc.getUpperBound(); + if(ub->hasLiteral()){ + if(prev != NullConstraint){ + implies(out, prev, ub); + } + prev = ub; + } + } + } + vector::const_iterator i, j, eq_end = equalities.end(); + for(i = equalities.begin(); i != eq_end; ++i){ + Constraint at_i = *i; + for(j= i + 1; j != eq_end; ++j){ + Constraint at_j = *j; + + mutuallyExclusive(out, at_i, at_j); + } + } + + for(i = equalities.begin(); i != eq_end; ++i){ + Constraint eq = *i; + const ValueCollection& vc = eq->getValueCollection(); + Assert(vc.hasEquality() && vc.getEquality()->hasLiteral()); + + bool hasLB = vc.hasLowerBound() && vc.getLowerBound()->hasLiteral(); + bool hasUB = vc.hasUpperBound() && vc.getUpperBound()->hasLiteral(); + + Constraint lb = hasLB ? + vc.getLowerBound() : eq->getStrictlyWeakerLowerBound(true, false); + Constraint ub = hasUB ? + vc.getUpperBound() : eq->getStrictlyWeakerUpperBound(true, false); + + if(hasUB && hasLB && !eq->isSplit()){ + out.push_back(eq->split()); + } + if(lb != NullConstraint){ + implies(out, eq, lb); + } + if(ub != NullConstraint){ + implies(out, eq, ub); + } + } + } + +void ConstraintDatabase::outputAllUnateLemmas(std::vector& lemmas) const{ + for(ArithVar v = 0, N = d_varDatabases.size(); v < N; ++v){ + outputAllUnateLemmas(lemmas, v); + } +} + + +}/* arith namespace */ +}/* theory namespace */ +}/* CVC4 namespace */ diff --git a/src/theory/arith/constraint.h b/src/theory/arith/constraint.h new file mode 100644 index 000000000..e1939159b --- /dev/null +++ b/src/theory/arith/constraint.h @@ -0,0 +1,837 @@ +/********************* */ +/*! \file constraint.h + ** \verbatim + ** Original author: taking + ** Major contributors: none + ** Minor contributors (to current version): none + ** This file is part of the CVC4 prototype. + ** Copyright (c) 2009, 2010, 2011 The Analysis of Computer Systems Group (ACSys) + ** Courant Institute of Mathematical Sciences + ** New York University + ** See the file COPYING in the top-level source directory for licensing + ** information.\endverbatim + ** + ** \brief Defines Constraint and ConstraintDatabase which is the internal representation of variables in arithmetic + ** + ** This file defines Constraint and ConstraintDatabase. + ** A Constraint is the internal representation of literals in TheoryArithmetic. + ** Constraints are fundamentally a triple: + ** - ArithVar associated with the constraint, + ** - a DeltaRational value, + ** - and a ConstraintType. + ** + ** Literals: + ** The constraint may also keep track of a node corresponding to the + ** Constraint. + ** This can be accessed by getLiteral() in O(1) if it has been set. + ** This node must be in normal form and may be used for communication with + ** the TheoryEngine. + ** + ** In addition, Constraints keep track of the following: + ** - A Constrain that is the negation of the Constraint. + ** - An iterator into a set of Constraints for the ArithVar sorted by + ** DeltaRational value. + ** - A context dependent internal proof of the node that can be used for + ** explanations. + ** - Whether an equality/disequality has been split in the user context via a + ** lemma. + ** - Whether a constraint, be be used in explanations sent to the context + ** + ** Looking up constraints: + ** - All of the Constraints with associated nodes in the ConstraintDatabase can + ** be accessed via a single hashtable lookup until the Constraint is removed. + ** - Nodes that have not been associated to a constraints can be + ** inserted/associated to existing nodes in O(log n) time. + ** + ** Implications: + ** - A Constraint can be used to find unate implications. + ** - A unate implication is an implication based purely on the ArithVar matching + ** and the DeltaRational value. + ** (implies (<= x c) (<= x d)) given c <= d + ** - This is done using the iterator into the sorted set of constraints. + ** - Given a tight constraint and previous tightest constraint, this will + ** efficiently propagate internally. + ** + ** Additing and Removing Constraints + ** - Adding Constraints takes O(log n) time where n is the number of + ** constraints associated with the ArithVar. + ** - Removing Constraints takes O(1) time. + ** + ** Internals: + ** - Constraints are pointers to ConstraintValues. + ** - Undefined Constraints are NullConstraint. + **/ + +#include "cvc4_private.h" + +#ifndef __CVC4__THEORY__ARITH__CONSTRAINT_H +#define __CVC4__THEORY__ARITH__CONSTRAINT_H + +#include "expr/node.h" + +#include "context/context.h" +#include "context/cdlist.h" +#include "context/cdqueue.h" + +#include "theory/arith/arithvar.h" +#include "theory/arith/arithvar_node_map.h" +#include "theory/arith/delta_rational.h" + +#include "theory/arith/difference_manager.h" + +#include "theory/arith/constraint_forward.h" + +#include +#include +#include +#include + +namespace CVC4 { +namespace theory { +namespace arith { + +/** + * The types of constraints. + * The convex constraints are the constraints are LowerBound, Equality, + * and UpperBound. + */ +enum ConstraintType {LowerBound, Equality, UpperBound, Disequality}; + + +typedef context::CDList CDConstraintList; + +typedef __gnu_cxx::hash_map NodetoConstraintMap; + +typedef size_t ProofId; +static ProofId ProofIdSentinel = std::numeric_limits::max(); + +typedef size_t AssertionOrder; +static AssertionOrder AssertionOrderSentinel = std::numeric_limits::max(); + +/** + * A ValueCollection binds together convex constraints that have the same + * DeltaRational value. + */ +class ValueCollection { +private: + + Constraint d_lowerBound; + Constraint d_upperBound; + Constraint d_equality; + Constraint d_disequality; + +public: + ValueCollection() + : d_lowerBound(NullConstraint), + d_upperBound(NullConstraint), + d_equality(NullConstraint), + d_disequality(NullConstraint) + {} + + static ValueCollection mkFromConstraint(Constraint c); + + bool hasLowerBound() const{ + return d_lowerBound != NullConstraint; + } + bool hasUpperBound() const{ + return d_upperBound != NullConstraint; + } + bool hasEquality() const{ + return d_equality != NullConstraint; + } + bool hasDisequality() const { + return d_disequality != NullConstraint; + } + + bool hasConstraintOfType(ConstraintType t) const; + + Constraint getLowerBound() const { + Assert(hasLowerBound()); + return d_lowerBound; + } + Constraint getUpperBound() const { + Assert(hasUpperBound()); + return d_upperBound; + } + Constraint getEquality() const { + Assert(hasEquality()); + return d_equality; + } + Constraint getDisequality() const { + Assert(hasDisequality()); + return d_disequality; + } + + Constraint getConstraintOfType(ConstraintType t) const; + + /** Returns true if any of the constraints are non-null. */ + bool empty() const; + + /** + * Remove the constraint of the type t from the collection. + * Returns true if the ValueCollection is now empty. + * If true is returned, d_value is now NULL. + */ + void remove(ConstraintType t); + + /** + * Adds a constraint to the set. + * The collection must not have a constraint of that type already. + */ + void add(Constraint c); + + void push_into(std::vector& vec) const; + + Constraint nonNull() const; + + ArithVar getVariable() const; + const DeltaRational& getValue() const; +}; + +/** + * A Map of ValueCollections sorted by the associated DeltaRational values. + * + * Discussion: + * While it is more natural to consider this a set, this cannot be a set as in + * sets the type of both iterator and const_iterator in sets are + * "constant iterators". We require iterators that dereference to + * ValueCollection&. + * + * See: + * http://gcc.gnu.org/onlinedocs/libstdc++/ext/lwg-defects.html#103 + */ +typedef std::map SortedConstraintMap; +typedef SortedConstraintMap::iterator SortedConstraintMapIterator; +typedef SortedConstraintMap::const_iterator SortedConstraintMapConstIterator; + +/** A Pair associating a variables and a Sorted ConstraintSet. */ +struct PerVariableDatabase{ + ArithVar d_var; + SortedConstraintMap d_constraints; + + // x ? c_1, x ? c_2, x ? c_3, ... + // where ? is a non-empty subset of {lb, ub, eq} + // c_1 < c_2 < c_3 < ... + + PerVariableDatabase(ArithVar v) : d_var(v), d_constraints() {} + + bool empty() const { + return d_constraints.empty(); + } + + static bool IsEmpty(const PerVariableDatabase& p){ + return p.empty(); + } +}; + +class ConstraintValue { +private: + /** The ArithVar associated with the constraint. */ + const ArithVar d_variable; + + /** The type of the Constraint. */ + const ConstraintType d_type; + + /** The DeltaRational value with the constraint. */ + const DeltaRational d_value; + + /** A pointer to the associated database for the Constraint. */ + ConstraintDatabase * d_database; + + /** + * The node to be communicated with the TheoryEngine. + * + * This is not context dependent, but may be set once. + * + * This must be set if the constraint canbePropgated(). + * This must be set if the constraint assertedToTheTheory(). + * Otherwise, this may be null(). + */ + Node d_literal; + + /** Pointer to the negation of the Constraint. */ + Constraint d_negation; + + /** + * This is true if the associated node can be propagated. + * + * This should be enabled if the node has been preregistered. + * + * Sat Context Dependent. + * This is initially false. + */ + bool d_canBePropagated; + + /** + * This is the order the constraint was asserted to the theory. + * If this has been set, the node can be used in conflicts. + * If this is c.d_assertedOrder < d.d_assertedOrder, then c can be used in the + * explanation of d. + * + * This should be set after the literal is dequeued by Theory::get(). + * + * Sat Context Dependent. + * This is initially AssertionOrderSentinel. + */ + AssertionOrder d_assertionOrder; + + /** + * This points at the proof for the constraint in the current context. + * + * Sat Context Dependent. + * This is initially ProofIdSentinel. + */ + ProofId d_proof; + + /** + * True if the equality has been split. + * Only meaningful if ContraintType == Equality. + * + * User Context Dependent. + * This is initially false. + */ + bool d_split; + + /** + * Position in sorted constraint set for the variable. + * Unset if d_type is Disequality. + */ + SortedConstraintMapIterator d_variablePosition; + + friend class ConstraintDatabase; + + /** + * This begins construction of a minimal constraint. + * + * This should only be called by ConstraintDatabase. + * + * Because of circular dependencies a Constraint is not fully valid until + * initialize has been called on it. + */ + ConstraintValue(ArithVar x, ConstraintType t, const DeltaRational& v); + + /** + * Destructor for a constraint. + * This should only be called if safeToGarbageCollect() is true. + */ + ~ConstraintValue(); + + bool initialized() const; + + /** + * This initializes the fields that cannot be set in the constructor due to + * circular dependencies. + */ + void initialize(ConstraintDatabase* db, SortedConstraintMapIterator v, Constraint negation); + + class ProofCleanup { + public: + inline void operator()(Constraint* p){ + Constraint constraint = *p; + Assert(constraint->d_proof != ProofIdSentinel); + constraint->d_proof = ProofIdSentinel; + } + }; + + class CanBePropagatedCleanup { + public: + inline void operator()(Constraint* p){ + Constraint constraint = *p; + Assert(constraint->d_canBePropagated); + constraint->d_canBePropagated = false; + } + }; + + class AssertionOrderCleanup { + public: + inline void operator()(Constraint* p){ + Constraint constraint = *p; + Assert(constraint->assertedToTheTheory()); + constraint->d_assertionOrder = AssertionOrderSentinel; + Assert(!constraint->assertedToTheTheory()); + } + }; + + class SplitCleanup { + public: + inline void operator()(Constraint* p){ + Constraint constraint = *p; + Assert(constraint->d_split); + constraint->d_split = false; + } + }; + + /** Returns true if the node is safe to garbage collect. */ + bool safeToGarbageCollect() const; + + /** + * Returns true if the node correctly corresponds to the constraint that is + * being set. + */ + bool sanityChecking(Node n) const; + + /** Returns a reference to the map for d_variable. */ + SortedConstraintMap& constraintSet() const; + +public: + + ConstraintType getType() const { + return d_type; + } + + ArithVar getVariable() const { + return d_variable; + } + + const DeltaRational& getValue() const { + return d_value; + } + + Constraint getNegation() const { + return d_negation; + } + + bool isEquality() const{ + return d_type == Equality; + } + bool isDisequality() const{ + return d_type == Disequality; + } + bool isLowerBound() const{ + return d_type == LowerBound; + } + bool isUpperBound() const{ + return d_type == UpperBound; + } + + bool isSplit() const { + return d_split; + } + + /** + * Splits the node in the user context. + * Returns a lemma that is assumed to be true fro the rest of the user context. + * Constraint must be an equality or disequality. + */ + Node split(); + + bool canBePropagated() const { + return d_canBePropagated; + } + void setCanBePropagated(); + + /** + * Light wrapper for calling setCanBePropagated(), + * on this and this-d_negation. + */ + void setPreregistered(){ + setCanBePropagated(); + d_negation->setCanBePropagated(); + } + + bool assertedToTheTheory() const { + return d_assertionOrder < AssertionOrderSentinel; + } + + bool assertedBefore(AssertionOrder time) const { + return d_assertionOrder < time; + } + + + void setAssertedToTheTheory(); + + + bool hasLiteral() const { + return !d_literal.isNull(); + } + + void setLiteral(Node n); + + Node getLiteral() const { + Assert(hasLiteral()); + return d_literal; + } + + /** + * Set the node as selfExplaining(). + * The node must be assertedToTheTheory(). + */ + void selfExplaining(); + + /** Returns true if the node is selfExplaining.*/ + bool isSelfExplaining() const; + + /** + * Set the constraint to be a EqualityEngine proof. + */ + void setEqualityEngineProof(); + bool hasEqualityEngineProof() const; + + /** + * Returns a explanation of the constraint that is appropriate for conflicts. + * + * This is not appropraite for propagation! + * + * This is the minimum fringe of the implication tree s.t. + * every constraint is assertedToTheTheory() or hasEqualityEngineProof(). + */ + Node explainForConflict() const{ + return explainBefore(AssertionOrderSentinel); + } + + /** + * Writes an explanation of a constraint into the node builder. + * Pushes back an explanation that is acceptable to send to the sat solver. + * nb is assumed to be an AND. + * + * This is the minimum fringe of the implication tree s.t. + * every constraint is assertedToTheTheory() or hasEqualityEngineProof(). + * + * This is not appropraite for propagation! + * Use explainForPropagation() instead. + */ + void explainForConflict(NodeBuilder<>& nb) const{ + explainBefore(nb, AssertionOrderSentinel); + } + + /** Utility function built from explainForConflict. */ + static Node explainConflict(Constraint a, Constraint b); + static Node explainConflict(Constraint a, Constraint b, Constraint c); + + /** + * Returns an explanation of a propagation by the ConstraintDatabase. + * The constraint must have a proof. + * The constraint cannot be selfExplaining(). + * + * This is the minimum fringe of the implication tree (excluding the constraint itself) + * s.t. every constraint is assertedToTheTheory() or hasEqualityEngineProof(). + */ + Node explainForPropagation() const { + Assert(hasProof()); + Assert(!isSelfExplaining()); + return explainBefore(d_assertionOrder); + } + +private: + Node explainBefore(AssertionOrder order) const; + + /** + * Returns an explanation of that was assertedBefore(order). + * The constraint must have a proof. + * The constraint cannot be selfExplaining(). + * + * This is the minimum fringe of the implication tree + * s.t. every constraint is assertedBefore(order) or hasEqualityEngineProof(). + */ + void explainBefore(NodeBuilder<>& nb, AssertionOrder order) const; + +public: + bool hasProof() const { + return d_proof != ProofIdSentinel; + } + bool negationHasProof() const { + return d_negation->hasProof(); + } + + bool truthIsUnknown() const { + return !hasProof() && !negationHasProof(); + } + + bool isTrue() const { + return hasProof(); + } + + Constraint getCeiling(); + + Constraint getFloor(); + + + static Constraint makeNegation(ArithVar v, ConstraintType t, const DeltaRational& r); + + const ValueCollection& getValueCollection() const; + + + Constraint getStrictlyWeakerUpperBound(bool hasLiteral, bool mustBeAsserted) const; + Constraint getStrictlyWeakerLowerBound(bool hasLiteral, bool mustBeAsserted) const; + + /** + * Marks the node as having a proof a. + * Adds the node the database's propagation queue. + * + * Preconditions: + * canBePropagated() + * !assertedToTheTheory() + */ + void propagate(Constraint a); + void propagate(Constraint a, Constraint b); + void propagate(const std::vector& b); + /** + * The only restriction is that this is not known be true. + * This propgates if there is a node. + */ + void impliedBy(Constraint a); + void impliedBy(Constraint a, Constraint b); + void impliedBy(const std::vector& b); + + + /** The node must have a proof already and be eligible for propagation! */ + void propagate(); + +private: + /** + * Marks the node as having a proof and being selfExplaining. + * Neither the node nor its negation can have a proof. + * This is internal! + */ + void markAsTrue(); + /** + * Marks the node as having a proof a. + * This is safe if the node does not have + */ + void markAsTrue(Constraint a); + + void markAsTrue(Constraint a, Constraint b); + void markAsTrue(const std::vector& b); + +public: + + +private: + + void debugPrint() const; + + /** + * The proof of the node is empty. + * The proof must be a special proof. Either + * isSelfExplaining() or + * hasEqualityEngineProof() + */ + bool proofIsEmpty() const; + +}; /* class ConstraintValue */ + +std::ostream& operator<<(std::ostream& o, const ConstraintValue& c); +std::ostream& operator<<(std::ostream& o, const Constraint c); +std::ostream& operator<<(std::ostream& o, const ConstraintType t); +std::ostream& operator<<(std::ostream& o, const ValueCollection& c); + + + +class ConstraintDatabase { +private: + /** + * The map from ArithVars to their unique databases. + * When the vector changes size, we cannot allow the maps to move so this + * is a vector of pointers. + */ + std::vector d_varDatabases; + + SortedConstraintMap& getVariableSCM(ArithVar v) const{ + Assert(variableDatabaseIsSetup(v)); + return d_varDatabases[v]->d_constraints; + } + + /** Maps literals to constraints.*/ + NodetoConstraintMap d_nodetoConstraintMap; + + /** + * A queue of propagated constraints. + * + * As Constraint are pointers, the elements of the queue do not require destruction. + */ + context::CDQueue d_toPropagate; + + /** + * Proof Lists. + * Proofs are lists of valid constraints terminated by the first smaller + * sentinel value in the proof list. + * The proof at p in d_proofs[p] of length n is + * (NullConstraint, d_proofs[p-(n-1)], ... , d_proofs[p-1], d_proofs[p]) + * The proof at p corresponds to the conjunction: + * (and x_i) + * + * So the proof of a Constraint c corresponds to the horn clause: + * (implies (and x_i) c) + * where (and x_i) is the proof at c.d_proofs. + * + * Constraints are pointers so this list is designed not to require any + * destruction. + */ + CDConstraintList d_proofs; + + /** + * This is a special proof for marking that nodes are their own explanation + * from the perspective of the theory. + * These must always be asserted to the theory. + * + * This proof is always a member of the list. + */ + ProofId d_selfExplainingProof; + + /** + * Marks a node as being proved by the equality engine. + * The equality engine will be asked for the explanation of such nodes. + * + * This is a special proof that is always a member of the list. + */ + ProofId d_equalityEngineProof; + + typedef context::CDList ProofCleanupList; + typedef context::CDList CBPList; + typedef context::CDList AOList; + typedef context::CDList SplitList; + + /** + * The watch lists are collected together as they need to be garbage collected + * carefully. + */ + struct Watches{ + /** + * Contains the exact list of atoms that have a proof. + */ + ProofCleanupList d_proofWatches; + + /** + * Contains the exact list of constraints that can be used for propagation. + */ + CBPList d_canBePropagatedWatches; + + /** + * Contains the exact list of constraints that have been asserted to the theory. + */ + AOList d_assertionOrderWatches; + + + /** + * Contains the exact list of atoms that have been preregistered. + * This is a pointer as it must be destroyed before the elements of + * d_varDatabases. + */ + SplitList d_splitWatches; + Watches(context::Context* satContext, context::Context* userContext); + }; + Watches* d_watches; + + void pushSplitWatch(Constraint c){ + Assert(!c->d_split); + c->d_split = true; + d_watches->d_splitWatches.push_back(c); + } + + void pushCanBePropagatedWatch(Constraint c){ + Assert(!c->d_canBePropagated); + c->d_canBePropagated = true; + d_watches->d_canBePropagatedWatches.push_back(c); + } + + void pushAssertionOrderWatch(Constraint c){ + Assert(!c->assertedToTheTheory()); + c->d_assertionOrder = d_watches->d_assertionOrderWatches.size(); + d_watches->d_assertionOrderWatches.push_back(c); + } + + void pushProofWatch(Constraint c, ProofId pid){ + Assert(c->d_proof == ProofIdSentinel); + c->d_proof = pid; + d_watches->d_proofWatches.push_back(c); + } + + /** Returns true if all of the entries of the vector are empty. */ + static bool emptyDatabase(const std::vector& vec); + + /** Map from nodes to arithvars. */ + const ArithVarNodeMap& d_av2nodeMap; + + const ArithVarNodeMap& getArithVarNodeMap() const{ + return d_av2nodeMap; + } + + DifferenceManager& d_differenceManager; + + //Constraint allocateConstraintForLiteral(ArithVar v, Node literal); + + const context::Context * const d_satContext; + const int d_satAllocationLevel; + + friend class ConstraintValue; + +public: + + ConstraintDatabase( context::Context* satContext, + context::Context* userContext, + const ArithVarNodeMap& av2nodeMap, + DifferenceManager& dm); + + ~ConstraintDatabase(); + + Constraint addLiteral(TNode lit); + //Constraint addAtom(TNode atom); + + /** + * If hasLiteral() is true, returns the constraint. + * Otherwise, returns NullConstraint. + */ + Constraint lookup(TNode literal) const; + + /** + * Returns true if the literal has been added to the database. + * This is a hash table lookup. + * It does not look in the database for an equivalent corresponding constraint. + */ + bool hasLiteral(TNode literal) const; + + bool hasMorePropagations() const{ + return !d_toPropagate.empty(); + } + + Constraint nextPropagation(){ + Assert(hasMorePropagations()); + + Constraint p = d_toPropagate.front(); + d_toPropagate.pop(); + + return p; + } + + void addVariable(ArithVar v); + bool variableDatabaseIsSetup(ArithVar v) const; + + Node eeExplain(ConstConstraint c) const; + void eeExplain(ConstConstraint c, NodeBuilder<>& nb) const; + + /** + * Returns a constraint with the variable v, the constraint type t, and a value + * dominated by r (explained below) if such a constraint exists in the database. + * If no such constraint exists, NullConstraint is returned. + * + * t must be either UpperBound or LowerBound. + * The returned value v is dominatated: + * If t is UpperBound, r <= v + * If t is LowerBound, r >= v + */ + Constraint getBestImpliedBound(ArithVar v, ConstraintType t, const DeltaRational& r) const; + + /** + * Returns a constraint with the variable v, the constraint type t and the value r. + * If there is such a constraint in the database already, it is returned. + * If there is no such constraint, this constraint is added to the database. + * + */ + Constraint getConstraint(ArithVar v, ConstraintType t, const DeltaRational& r); + + + /** + * Outputs a minimal set of unate implications on the output channel + * for all variables. + */ + void outputAllUnateLemmas(std::vector& lemmas) const; + + void outputAllUnateLemmas(std::vector& lemmas, ArithVar v) const; + +}; /* ConstraintDatabase */ + +}/* CVC4::theory::arith namespace */ +}/* CVC4::theory namespace */ +}/* CVC4 namespace */ + +#endif /* __CVC4__THEORY__ARITH__CONSTRAINT_H */ diff --git a/src/theory/arith/constraint_forward.h b/src/theory/arith/constraint_forward.h new file mode 100644 index 000000000..dd0c1f2f6 --- /dev/null +++ b/src/theory/arith/constraint_forward.h @@ -0,0 +1,42 @@ +/********************* */ +/*! \file constraint_forward.h + ** \verbatim + ** Original author: taking + ** Major contributors: none + ** Minor contributors (to current version): none + ** This file is part of the CVC4 prototype. + ** Copyright (c) 2009, 2010, 2011 The Analysis of Computer Systems Group (ACSys) + ** Courant Institute of Mathematical Sciences + ** New York University + ** See the file COPYING in the top-level source directory for licensing + ** information.\endverbatim + ** + ** \brief Forward declarations of the ConstraintValue and ConstraintDatabase classes. + ** + ** This is the forward declarations of the ConstraintValue and ConstraintDatabase + ** and the typedef for Constraint. This is used to break circular dependencies and + ** minimize interaction between header files. + **/ + +#include "cvc4_private.h" + +#ifndef __CVC4__THEORY__ARITH__CONSTRAINT_FORWARD_H +#define __CVC4__THEORY__ARITH__CONSTRAINT_FORWARD_H + +namespace CVC4 { +namespace theory { +namespace arith { + +class ConstraintValue; +typedef ConstraintValue* Constraint; +typedef const ConstraintValue* const ConstConstraint; + +static const Constraint NullConstraint = NULL; + +class ConstraintDatabase; + +}/* CVC4::theory::arith namespace */ +}/* CVC4::theory namespace */ +}/* CVC4 namespace */ + +#endif /* __CVC4__THEORY__ARITH__CONSTRAINT_FORWARD_H */ diff --git a/src/theory/arith/delta_rational.h b/src/theory/arith/delta_rational.h index a46dde1cf..12110fab4 100644 --- a/src/theory/arith/delta_rational.h +++ b/src/theory/arith/delta_rational.h @@ -55,14 +55,18 @@ public: } int sgn() const { - int x = getNoninfinitesimalPart().sgn(); - if(x == 0){ - return getInfinitesimalPart().sgn(); + int s = getNoninfinitesimalPart().sgn(); + if(s == 0){ + return infinitesimalSgn(); }else{ - return x; + return s; } } + int infinitesimalSgn() const { + return getInfinitesimalPart().sgn(); + } + int cmp(const DeltaRational& other) const{ int cmp = c.cmp(other.c); if(cmp == 0){ diff --git a/src/theory/arith/difference_manager.cpp b/src/theory/arith/difference_manager.cpp index b67240d4c..70588bc16 100644 --- a/src/theory/arith/difference_manager.cpp +++ b/src/theory/arith/difference_manager.cpp @@ -1,23 +1,131 @@ #include "theory/arith/difference_manager.h" #include "theory/uf/equality_engine_impl.h" +#include "theory/arith/constraint.h" +#include "theory/arith/arith_utilities.h" + namespace CVC4 { namespace theory { namespace arith { -DifferenceManager::DifferenceManager(context::Context* c, PropManager& pm) - : d_literalsQueue(c), - d_queue(pm), +DifferenceManager::DifferenceManager(context::Context* c, ConstraintDatabase& cd, TNodeCallBack& setup) + : d_conflict(c), + d_literalsQueue(c), + d_propagatations(c), + d_explanationMap(c), + d_constraintDatabase(cd), + d_setupLiteral(setup), d_notify(*this), d_ee(d_notify, c, "theory::arith::DifferenceManager"), d_false(NodeManager::currentNM()->mkConst(false)), d_hasSharedTerms(c, false) {} -void DifferenceManager::propagate(TNode x){ +void DifferenceManager::differenceIsZero(Constraint lb, Constraint ub){ + Assert(lb->isLowerBound()); + Assert(ub->isUpperBound()); + Assert(lb->getVariable() == ub->getVariable()); + Assert(lb->getValue().sgn() == 0); + Assert(ub->getValue().sgn() == 0); + + ArithVar s = lb->getVariable(); + Node reason = ConstraintValue::explainConflict(lb,ub); + + assertLiteral(true, s, reason); +} + +void DifferenceManager::differenceIsZero(Constraint eq){ + Assert(eq->isEquality()); + Assert(eq->getValue().sgn() == 0); + + ArithVar s = eq->getVariable(); + + //Explain for conflict is correct as these proofs are generated and stored eagerly + //These will be safe for propagation later as well + Node reason = eq->explainForConflict(); + + assertLiteral(true, s, reason); +} + +void DifferenceManager::differenceCannotBeZero(Constraint c){ + ArithVar s = c->getVariable(); + + //Explain for conflict is correct as these proofs are generated and stored eagerly + //These will be safe for propagation later as well + Node reason = c->explainForConflict(); + assertLiteral(false, s, reason); +} + + +bool DifferenceManager::propagate(TNode x){ Debug("arith::differenceManager")<< "DifferenceManager::propagate("<hasProof() << " " + << (x == rewritten) << " " + << c->canBePropagated() << " " + << c->negationHasProof() << std::endl; + + if(c->negationHasProof()){ + Node expC = explainInternal(x); + Node neg = c->getNegation()->explainForConflict(); + Node conf = expC.andNode(neg); + Node final = flattenAnd(conf); + + d_conflict.set(final); + Debug("arith::differenceManager") << "differenceManager found a conflict " << final << std::endl; + return false; + } + + // Cases for propagation + // C : c has a proof + // S : x == rewritten + // P : c can be propagated + // + // CSP + // 000 : propagate x, and mark C it as being explained + // 001 : propagate x, and propagate c after marking it as being explained + // 01* : propagate x, mark c but do not propagate c + // 10* : propagate x, do not mark c and do not propagate c + // 11* : drop the constraint, do not propagate x or c + + if(!c->hasProof() && x != rewritten){ + pushBack(x, rewritten); + + c->setEqualityEngineProof(); + if(c->canBePropagated() && !c->assertedToTheTheory()){ + c->propagate(); + } + }else if(!c->hasProof() && x == rewritten){ + pushBack(x, rewritten); + c->setEqualityEngineProof(); + }else if(c->hasProof() && x != rewritten){ + pushBack(x, rewritten); + }else{ + Assert(c->hasProof() && x == rewritten); + } + return true; } void DifferenceManager::explain(TNode literal, std::vector& assumptions) { @@ -37,33 +145,44 @@ void DifferenceManager::explain(TNode literal, std::vector& assumptions) d_ee.explainEquality(lhs, rhs, assumptions); } -Node mkAnd(const std::vector& conjunctions) { - Assert(conjunctions.size() > 0); +void DifferenceManager::enqueueIntoNB(const std::set s, NodeBuilder<>& nb){ + std::set::const_iterator it = s.begin(); + std::set::const_iterator it_end = s.end(); + for(; it != it_end; ++it) { + nb << *it; + } +} - std::set all; - all.insert(conjunctions.begin(), conjunctions.end()); +Node DifferenceManager::explainInternal(TNode internal){ + std::vector assumptions; + explain(internal, assumptions); - if (all.size() == 1) { - // All the same, or just one - return conjunctions[0]; - } + std::set assumptionSet; + assumptionSet.insert(assumptions.begin(), assumptions.end()); - NodeBuilder<> conjunction(kind::AND); - std::set::const_iterator it = all.begin(); - std::set::const_iterator it_end = all.end(); - while (it != it_end) { - conjunction << *it; - ++ it; + if (assumptionSet.size() == 1) { + // All the same, or just one + return assumptions[0]; + }else{ + NodeBuilder<> conjunction(kind::AND); + enqueueIntoNB(assumptionSet, conjunction); + return conjunction; } - - return conjunction; +} +Node DifferenceManager::explain(TNode external){ + Node internal = externalToInternal(external); + return explainInternal(internal); } +void DifferenceManager::explain(TNode external, NodeBuilder<>& out){ + Node internal = externalToInternal(external); -Node DifferenceManager::explain(TNode lit){ std::vector assumptions; - explain(lit, assumptions); - return mkAnd(assumptions); + explain(internal, assumptions); + std::set assumptionSet; + assumptionSet.insert(assumptions.begin(), assumptions.end()); + + enqueueIntoNB(assumptionSet, out); } void DifferenceManager::addDifference(ArithVar s, Node x, Node y){ @@ -90,7 +209,7 @@ void DifferenceManager::addAssertionToEqualityEngine(bool eq, ArithVar s, TNode void DifferenceManager::dequeueLiterals(){ Assert(d_hasSharedTerms); - while(!d_literalsQueue.empty()){ + while(!d_literalsQueue.empty() && !inConflict()){ const LiteralsQueueElem& front = d_literalsQueue.front(); d_literalsQueue.dequeue(); diff --git a/src/theory/arith/difference_manager.h b/src/theory/arith/difference_manager.h index c6e7f314d..7862a6b31 100644 --- a/src/theory/arith/difference_manager.h +++ b/src/theory/arith/difference_manager.h @@ -6,20 +6,52 @@ #define __CVC4__THEORY__ARITH__DIFFERENCE_MANAGER_H #include "theory/arith/arithvar.h" +#include "theory/arith/constraint_forward.h" #include "theory/uf/equality_engine.h" #include "context/cdo.h" #include "context/cdlist.h" #include "context/context.h" #include "context/cdtrail_queue.h" #include "util/stats.h" -#include "theory/arith/arith_prop_manager.h" namespace CVC4 { namespace theory { namespace arith { +/** + * This implements a CDMaybe. + * This has either been set in the context or it has not. + * T must have a default constructor and support assignment. + */ +template +class CDMaybe { +private: + typedef std::pair BoolTPair; + context::CDO d_data; + +public: + CDMaybe(context::Context* c) : d_data(c, std::make_pair(false, T())) + {} + + bool isSet() const { + return d_data.get().first; + } + + void set(const T& d){ + Assert(!isSet()); + d_data.set(std::make_pair(true, d)); + } + + const T& get() const{ + Assert(isSet()); + return d_data.get().second; + } +}; + class DifferenceManager { private: + CDMaybe d_conflict; + struct Difference { bool isSlack; TNode x; @@ -40,8 +72,7 @@ private: bool notify(TNode propagation) { Debug("arith::differences") << "DifferenceNotifyClass::notify(" << propagation << ")" << std::endl; // Just forward to dm - d_dm.propagate(propagation); - return true; + return d_dm.propagate(propagation); } void notify(TNode t1, TNode t2) { @@ -63,13 +94,69 @@ private: /** Stores the queue of assertions. This keeps the Node backing the reasons */ context::CDTrailQueue d_literalsQueue; - PropManager& d_queue; + //PropManager& d_queue; + + /** Store the propagations. */ + context::CDTrailQueue d_propagatations; + + /* This maps the node a theory engine will request on an explain call to + * to its corresponding PropUnit. + * This is node is potentially both the propagation or Rewriter::rewrite(propagation). + */ + typedef context::CDHashMap ExplainMap; + ExplainMap d_explanationMap; + + ConstraintDatabase& d_constraintDatabase; + TNodeCallBack& d_setupLiteral; + +public: + + bool inConflict() const{ + return d_conflict.isSet(); + }; + Node conflict() const{ + Assert(inConflict()); + return d_conflict.get(); + } + + bool hasMorePropagations() const { + return !d_propagatations.empty(); + } + + const Node getNextPropagation() { + Assert(hasMorePropagations()); + Node prop = d_propagatations.front(); + d_propagatations.dequeue(); + return prop; + } + + bool canExplain(TNode n) const { + return d_explanationMap.find(n) != d_explanationMap.end(); + } + +private: + Node externalToInternal(TNode n) const{ + Assert(canExplain(n)); + size_t pos = (*(d_explanationMap.find(n))).second; + return d_propagatations[pos]; + } + + void pushBack(TNode n){ + d_explanationMap.insert(n, d_propagatations.size()); + d_propagatations.enqueue(n); + } + + void pushBack(TNode n, TNode r){ + d_explanationMap.insert(r, d_propagatations.size()); + d_explanationMap.insert(n, d_propagatations.size()); + d_propagatations.enqueue(n); + } DifferenceNotifyClass d_notify; theory::uf::EqualityEngine d_ee; - void propagate(TNode x); + bool propagate(TNode x); void explain(TNode literal, std::vector& assumptions); Node d_false; @@ -96,11 +183,16 @@ private: void enableSharedTerms(); void dequeueLiterals(); + void enqueueIntoNB(const std::set all, NodeBuilder<>& nb); + + Node explainInternal(TNode internal); + public: - DifferenceManager(context::Context*, PropManager&); + DifferenceManager(context::Context* satContext, ConstraintDatabase&, TNodeCallBack&); Node explain(TNode literal); + void explain(TNode lit, NodeBuilder<>& out); void addDifference(ArithVar s, Node x, Node y); @@ -112,13 +204,14 @@ public: } } - void differenceIsZero(ArithVar s, TNode reason){ - assertLiteral(true, s, reason); - } + /** Assert an equality. */ + void differenceIsZero(Constraint eq); - void differenceCannotBeZero(ArithVar s, TNode reason){ - assertLiteral(false, s, reason); - } + /** Assert a conjunction from lb and ub. */ + void differenceIsZero(Constraint lb, Constraint ub); + + /** Assert that the value cannot be zero. */ + void differenceCannotBeZero(Constraint c); void addSharedTerm(Node x); };/* class DifferenceManager */ diff --git a/src/theory/arith/dio_solver.cpp b/src/theory/arith/dio_solver.cpp index 1e47d6cdd..1b3a5cac7 100644 --- a/src/theory/arith/dio_solver.cpp +++ b/src/theory/arith/dio_solver.cpp @@ -76,6 +76,22 @@ DioSolver::Statistics::~Statistics(){ StatisticsRegistry::unregisterStat(&d_cutTimer); } +bool DioSolver::queueConditions(TrailIndex t){ + /* debugPrintTrail(t); */ + Debug("queueConditions") << !inConflict() << std::endl; + Debug("queueConditions") << gcdIsOne(t) << std::endl; + Debug("queueConditions") << !debugAnySubstitionApplies(t) << std::endl; + Debug("queueConditions") << !triviallySat(t) << std::endl; + Debug("queueConditions") << !triviallyUnsat(t) << std::endl; + + return + !inConflict() && + gcdIsOne(t) && + !debugAnySubstitionApplies(t) && + !triviallySat(t) && + !triviallyUnsat(t); +} + size_t DioSolver::allocateVariableInPool() { Assert(d_lastUsedVariable <= d_variablePool.size()); if(d_lastUsedVariable == d_variablePool.size()){ @@ -125,9 +141,10 @@ bool DioSolver::acceptableOriginalNodes(Node n){ }else if(k == kind::AND){ Node ub = n[0]; Node lb = n[1]; - Kind kub = simplifiedKind(ub); - Kind klb = simplifiedKind(lb); - return (kub == kind::LEQ || kub==kind::LT) && (klb == kind::GEQ || klb == kind::GT); + Kind kub = Comparison::comparisonKind(ub); + Kind klb = Comparison::comparisonKind(lb); + Debug("nf::tmp") << n << endl; + return (kub == kind::GEQ || kub==kind::LT) && (klb == kind::GEQ || klb == kind::LT); }else{ return false; } @@ -135,11 +152,11 @@ bool DioSolver::acceptableOriginalNodes(Node n){ void DioSolver::pushInputConstraint(const Comparison& eq, Node reason){ Assert(!debugEqualityInInputEquations(reason)); - Assert(eq.isIntegral()); + Assert(eq.debugIsIntegral()); Assert(eq.getNode().getKind() == kind::EQUAL); Assert(acceptableOriginalNodes(reason)); - SumPair sp = SumPair::comparisonToSumPair(eq); + SumPair sp = eq.toSumPair(); uint32_t length = sp.maxLength(); if(length > d_maxInputCoefficientLength){ d_maxInputCoefficientLength = length; @@ -573,7 +590,6 @@ DioSolver::TrailIndex DioSolver::applyAllSubstitutionsToIndex(DioSolver::TrailIn bool DioSolver::debugSubstitutionApplies(DioSolver::SubIndex si, DioSolver::TrailIndex ti){ Variable var = d_subs[si].d_eliminated; - TrailIndex subIndex = d_subs[si].d_constraint; const SumPair& curr = d_trail[ti].d_eq; Polynomial vsum = curr.getPolynomial(); diff --git a/src/theory/arith/dio_solver.h b/src/theory/arith/dio_solver.h index 677040615..c5a0f534f 100644 --- a/src/theory/arith/dio_solver.h +++ b/src/theory/arith/dio_solver.h @@ -338,22 +338,8 @@ private: /** Returns true if the queue of nodes to process is empty. */ bool queueEmpty() const; - bool queueConditions(TrailIndex t){ - /* debugPrintTrail(t); */ - - /* std::cout << !inConflict() << std::endl; */ - /* std::cout << gcdIsOne(t) << std::endl; */ - /* std::cout << !debugAnySubstitionApplies(t) << std::endl; */ - /* std::cout << !triviallySat(t) << std::endl; */ - /* std::cout << !triviallyUnsat(t) << std::endl; */ - - return - !inConflict() && - gcdIsOne(t) && - !debugAnySubstitionApplies(t) && - !triviallySat(t) && - !triviallyUnsat(t); - } + bool queueConditions(TrailIndex t); + void pushToQueueBack(TrailIndex t){ Assert(queueConditions(t)); diff --git a/src/theory/arith/linear_equality.cpp b/src/theory/arith/linear_equality.cpp index c84e61285..ca7cd69c4 100644 --- a/src/theory/arith/linear_equality.cpp +++ b/src/theory/arith/linear_equality.cpp @@ -26,8 +26,8 @@ namespace theory { namespace arith { /* Explicitly instatiate this function. */ -template void LinearEqualityModule::explainNonbasics(ArithVar basic, NodeBuilder<>& output); -template void LinearEqualityModule::explainNonbasics(ArithVar basic, NodeBuilder<>& output); +template void LinearEqualityModule::propagateNonbasics(ArithVar basic, Constraint c); +template void LinearEqualityModule::propagateNonbasics(ArithVar basic, Constraint c); LinearEqualityModule::Statistics::Statistics(): d_statPivots("theory::arith::pivots",0), @@ -71,7 +71,7 @@ void LinearEqualityModule::update(ArithVar x_i, const DeltaRational& v){ DeltaRational nAssignment = assignment+(diff * a_ji); d_partialModel.setAssignment(x_j, nAssignment); - d_basicVariableUpdates.callback(x_j); + d_basicVariableUpdates(x_j); } d_partialModel.setAssignment(x_i, v); @@ -119,7 +119,7 @@ void LinearEqualityModule::pivotAndUpdate(ArithVar x_i, ArithVar x_j, DeltaRatio DeltaRational nextAssignment = d_partialModel.getAssignment(x_k) + (theta * a_kj); d_partialModel.setAssignment(x_k, nextAssignment); - d_basicVariableUpdates.callback(x_k); + d_basicVariableUpdates(x_k); } } @@ -131,7 +131,7 @@ void LinearEqualityModule::pivotAndUpdate(ArithVar x_i, ArithVar x_j, DeltaRatio //(d_statistics.d_avgNumRowsNotContainingOnPivot).addEntry(difference); d_tableau.pivot(x_i, x_j); - d_basicVariableUpdates.callback(x_j); + d_basicVariableUpdates(x_j); if(Debug.isOn("tableau")){ d_tableau.printTableau(); @@ -255,12 +255,17 @@ bool LinearEqualityModule::hasBounds(ArithVar basic, bool upperBound){ } template -void LinearEqualityModule::explainNonbasics(ArithVar basic, NodeBuilder<>& output){ +void LinearEqualityModule::propagateNonbasics(ArithVar basic, Constraint c){ Assert(d_tableau.isBasic(basic)); + Assert(c->getVariable() == basic); + Assert(!c->assertedToTheTheory()); + Assert(c->canBePropagated()); + Assert(!c->hasProof()); Debug("arith::explainNonbasics") << "LinearEqualityModule::explainNonbasics(" << basic <<") start" << endl; + vector bounds; Tableau::RowIterator iter = d_tableau.rowIterator(basic); for(; !iter.atEnd(); ++iter){ @@ -269,30 +274,42 @@ void LinearEqualityModule::explainNonbasics(ArithVar basic, NodeBuilder<>& outpu if(nonbasic == basic) continue; const Rational& a_ij = entry.getCoefficient(); - TNode bound = TNode::null(); int sgn = a_ij.sgn(); Assert(sgn != 0); + Constraint bound = NullConstraint; if(upperBound){ if(sgn < 0){ - bound = d_partialModel.getLowerConstraint(nonbasic); + bound = d_partialModel.getLowerBoundConstraint(nonbasic); + //d_partialModel.explainLowerBound(nonbasic, output); + //bound = d_partialModel.explainLowerBound(nonbasic); }else{ Assert(sgn > 0); - bound = d_partialModel.getUpperConstraint(nonbasic); + bound = d_partialModel.getUpperBoundConstraint(nonbasic); + //d_partialModel.explainUpperBound(nonbasic, output); + //bound = d_partialModel.explainUpperBound(nonbasic); } }else{ if(sgn < 0){ - bound = d_partialModel.getUpperConstraint(nonbasic); + bound = d_partialModel.getUpperBoundConstraint(nonbasic); + //d_partialModel.explainUpperBound(nonbasic, output); + //bound = d_partialModel.explainUpperBound(nonbasic); }else{ Assert(sgn > 0); - bound = d_partialModel.getLowerConstraint(nonbasic); + bound = d_partialModel.getLowerBoundConstraint(nonbasic); + //d_partialModel.explainLowerBound(nonbasic, output); + //bound = d_partialModel.explainLowerBound(nonbasic); } } - Assert(!bound.isNull()); - Debug("arith::explainNonbasics") << "\t" << nonbasic << " " << sgn << " " << bound - << endl; - output << bound; + Assert(bound != NullConstraint); + Debug("arith::explainNonbasics") << "explainNonbasics" << bound << " for " << c << endl; + bounds.push_back(bound); + //Assert(!bound.isNull()); + // Debug("arith::explainNonbasics") << "\t" << nonbasic << " " << sgn << " " << bound + // << endl; + // output << bound; } + c->propagate(bounds); Debug("arith::explainNonbasics") << "LinearEqualityModule::explainNonbasics(" << basic << ") done" << endl; } diff --git a/src/theory/arith/linear_equality.h b/src/theory/arith/linear_equality.h index 4d1d917b3..b5d439769 100644 --- a/src/theory/arith/linear_equality.h +++ b/src/theory/arith/linear_equality.h @@ -36,6 +36,7 @@ #include "theory/arith/arithvar.h" #include "theory/arith/partial_model.h" #include "theory/arith/tableau.h" +#include "theory/arith/constraint.h" #include "util/stats.h" @@ -101,14 +102,16 @@ private: * of the basic variable basic, using the non-basic variables in the row. */ template - void explainNonbasics(ArithVar basic, NodeBuilder<>& output); + void propagateNonbasics(ArithVar basic, Constraint c); public: - void explainNonbasicsLowerBound(ArithVar basic, NodeBuilder<>& output){ - explainNonbasics(basic, output); + void propagateNonbasicsLowerBound(ArithVar basic, Constraint c){ + Assert(c->isLowerBound()); + propagateNonbasics(basic, c); } - void explainNonbasicsUpperBound(ArithVar basic, NodeBuilder<>& output){ - explainNonbasics(basic, output); + void propagateNonbasicsUpperBound(ArithVar basic, Constraint c){ + Assert(c->isUpperBound()); + propagateNonbasics(basic, c); } /** diff --git a/src/theory/arith/normal_form.cpp b/src/theory/arith/normal_form.cpp index 31cd8cd70..6f8a46236 100644 --- a/src/theory/arith/normal_form.cpp +++ b/src/theory/arith/normal_form.cpp @@ -18,6 +18,7 @@ **/ #include "theory/arith/normal_form.h" +#include "theory/arith/arith_utilities.h" #include using namespace std; @@ -122,15 +123,25 @@ Monomial Monomial::parseMonomial(Node n) { return Monomial(VarList::parseVarList(n)); } } -Monomial Monomial::operator*(const Constant& c) const { - if(c.isZero()){ +Monomial Monomial::operator*(const Rational& q) const { + if(q.isZero()){ return mkZero(); }else{ - Constant newConstant = this->getConstant() * c; + Constant newConstant = this->getConstant() * q; return Monomial::mkMonomial(newConstant, getVarList()); } } +Monomial Monomial::operator*(const Constant& c) const { + return (*this) * c.getValue(); + // if(c.isZero()){ + // return mkZero(); + // }else{ + // Constant newConstant = this->getConstant() * c; + // return Monomial::mkMonomial(newConstant, getVarList()); + // } +} + Monomial Monomial::operator*(const Monomial& mono) const { Constant newConstant = this->getConstant() * mono.getConstant(); VarList newVL = this->getVarList() * mono.getVarList(); @@ -188,15 +199,15 @@ Polynomial Polynomial::operator-(const Polynomial& vl) const { return *this + (vl*negOne); } -Polynomial Polynomial::operator*(const Constant& c) const{ - if(c.isZero()){ +Polynomial Polynomial::operator*(const Rational& q) const{ + if(q.isZero()){ return Polynomial::mkZero(); - }else if(c.isOne()){ + }else if(q.isOne()){ return *this; }else{ std::vector newMonos; for(iterator i = this->begin(), end = this->end(); i != end; ++i) { - newMonos.push_back((*i)*c); + newMonos.push_back((*i)*q); } Assert(Monomial::isStrictlySorted(newMonos)); @@ -204,6 +215,23 @@ Polynomial Polynomial::operator*(const Constant& c) const{ } } +Polynomial Polynomial::operator*(const Constant& c) const{ + return (*this) * c.getValue(); + // if(c.isZero()){ + // return Polynomial::mkZero(); + // }else if(c.isOne()){ + // return *this; + // }else{ + // std::vector newMonos; + // for(iterator i = this->begin(), end = this->end(); i != end; ++i) { + // newMonos.push_back((*i)*c); + // } + + // Assert(Monomial::isStrictlySorted(newMonos)); + // return Polynomial::mkPolynomial(newMonos); + // } +} + Polynomial Polynomial::operator*(const Monomial& mono) const { if(mono.isZero()) { return Polynomial(mono); //Don't multiply by zero @@ -248,10 +276,29 @@ Monomial Polynomial::selectAbsMinimum() const { return min; } +bool Polynomial::leadingCoefficientIsAbsOne() const { + return getHead().absCoefficientIsOne(); +} +bool Polynomial::leadingCoefficientIsPositive() const { + return getHead().getConstant().isPositive(); +} + +bool Polynomial::denominatorLCMIsOne() const { + return denominatorLCM().isOne(); +} + +bool Polynomial::numeratorGCDIsOne() const { + return gcd().isOne(); +} + Integer Polynomial::gcd() const { + Assert(isIntegral()); + return numeratorGCD(); +} + +Integer Polynomial::numeratorGCD() const { //We'll use the standardization that gcd(0, 0) = 0 //So that the gcd of the zero polynomial is gcd{0} = 0 - Assert(isIntegral()); iterator i=begin(), e=end(); Assert(i!=e); @@ -273,355 +320,918 @@ Integer Polynomial::denominatorLCM() const { return tmp; } + +Constant Polynomial::getCoefficient(const VarList& vl) const{ + //TODO improve to binary search... + for(iterator iter=begin(), myend=end(); iter != myend; ++iter){ + Monomial m = *iter; + VarList curr = m.getVarList(); + if(curr == vl){ + return m.getConstant(); + } + } + return Constant::mkConstant(0); +} + +Node Polynomial::computeQR(const Polynomial& p, const Integer& div){ + Assert(p.isIntegral()); + std::vector q_vec, r_vec; + Integer tmp_q, tmp_r; + for(iterator iter = p.begin(), pend = p.end(); iter != pend; ++iter){ + Monomial curr = *iter; + VarList vl = curr.getVarList(); + Constant c = curr.getConstant(); + + const Integer& a = c.getValue().getNumerator(); + Integer::floorQR(tmp_q, tmp_r, a, div); + Constant q=Constant::mkConstant(tmp_q); + Constant r=Constant::mkConstant(tmp_r); + if(!q.isZero()){ + q_vec.push_back(Monomial::mkMonomial(q, vl)); + } + if(!r.isZero()){ + r_vec.push_back(Monomial::mkMonomial(r, vl)); + } + } + + Polynomial p_q = Polynomial::mkPolynomial(q_vec); + Polynomial p_r = Polynomial::mkPolynomial(r_vec); + + return NodeManager::currentNM()->mkNode(kind::PLUS, p_q.getNode(), p_r.getNode()); +} + + +Monomial Polynomial::minimumVariableMonomial() const{ + Assert(!isConstant()); + if(singleton()){ + return getHead(); + }else{ + iterator i = begin(); + Monomial first = *i; + if( first.isConstant() ){ + ++i; + Assert(i != end()); + return *i; + }else{ + return first; + } + } +} + +bool Polynomial::variableMonomialAreStrictlyGreater(const Monomial& m) const{ + if(isConstant()){ + return true; + }else{ + Monomial minimum = minimumVariableMonomial(); + Debug("nf::tmp") << "minimum " << minimum.getNode() << endl; + Debug("nf::tmp") << "m " << m.getNode() << endl; + return m < minimum; + } +} + +Node SumPair::computeQR(const SumPair& sp, const Integer& div){ + Assert(sp.isIntegral()); + + const Integer& constant = sp.getConstant().getValue().getNumerator(); + + Integer constant_q, constant_r; + Integer::floorQR(constant_q, constant_r, constant, div); + + Node p_qr = Polynomial::computeQR(sp.getPolynomial(), div); + Assert(p_qr.getKind() == kind::PLUS); + Assert(p_qr.getNumChildren() == 2); + + Polynomial p_q = Polynomial::parsePolynomial(p_qr[0]); + Polynomial p_r = Polynomial::parsePolynomial(p_qr[1]); + + SumPair sp_q(p_q, Constant::mkConstant(constant_q)); + SumPair sp_r(p_r, Constant::mkConstant(constant_r)); + + return NodeManager::currentNM()->mkNode(kind::PLUS, sp_q.getNode(), sp_r.getNode()); +} + +SumPair SumPair::mkSumPair(const Polynomial& p){ + if(p.isConstant()){ + Constant leadingConstant = p.getHead().getConstant(); + return SumPair(Polynomial::mkZero(), leadingConstant); + }else if(p.containsConstant()){ + Assert(!p.singleton()); + return SumPair(p.getTail(), p.getHead().getConstant()); + }else{ + return SumPair(p, Constant::mkZero()); + } +} + +Comparison::Comparison(TNode n) + : NodeWrapper(n) +{ + Assert(isNormalForm()); +} + + + +SumPair Comparison::toSumPair() const { + Kind cmpKind = comparisonKind(); + switch(cmpKind){ + case kind::LT: + case kind::LEQ: + case kind::GT: + case kind::GEQ: + { + TNode lit = getNode(); + TNode atom = (cmpKind == kind::LT || cmpKind == kind::LEQ) ? lit[0] : lit; + Polynomial p = Polynomial::parsePolynomial(atom[0]); + Constant c = Constant::mkConstant(atom[1]); + if(p.leadingCoefficientIsPositive()){ + return SumPair(p, -c); + }else{ + return SumPair(-p, c); + } + } + case kind::EQUAL: + case kind::DISTINCT: + { + Polynomial left = getLeft(); + Polynomial right = getRight(); + Debug("nf::tmp") << "left: " << left.getNode() << endl; + Debug("nf::tmp") << "right: " << right.getNode() << endl; + if(right.isConstant()){ + return SumPair(left, -right.getHead().getConstant()); + }else if(right.containsConstant()){ + Assert(!right.singleton()); + + Polynomial noConstant = right.getTail(); + return SumPair(left - noConstant, -right.getHead().getConstant()); + }else{ + return SumPair(left - right, Constant::mkZero()); + } + } + default: + Unhandled(cmpKind); + } +} + +Polynomial Comparison::normalizedVariablePart() const { + Kind cmpKind = comparisonKind(); + switch(cmpKind){ + case kind::LT: + case kind::LEQ: + case kind::GT: + case kind::GEQ: + { + TNode lit = getNode(); + TNode atom = (cmpKind == kind::LT || cmpKind == kind::LEQ) ? lit[0] : lit; + Polynomial p = Polynomial::parsePolynomial(atom[0]); + if(p.leadingCoefficientIsPositive()){ + return p; + }else{ + return -p; + } + } + case kind::EQUAL: + case kind::DISTINCT: + { + Polynomial left = getLeft(); + Polynomial right = getRight(); + if(right.isConstant()){ + return left; + }else if(right.containsConstant()){ + Polynomial noConstant = right.getTail(); + return left - noConstant; + }else{ + return left - right; + } + } + default: + Unhandled(cmpKind); + } +} + +DeltaRational Comparison::normalizedDeltaRational() const { + Kind cmpKind = comparisonKind(); + int delta = deltaCoeff(cmpKind); + switch(cmpKind){ + case kind::LT: + case kind::LEQ: + case kind::GT: + case kind::GEQ: + { + Node lit = getNode(); + Node atom = (cmpKind == kind::LT || cmpKind == kind::LEQ) ? lit[0] : lit; + Polynomial left = Polynomial::parsePolynomial(atom[0]); + const Rational& q = atom[1].getConst(); + if(left.leadingCoefficientIsPositive()){ + return DeltaRational(q, delta); + }else{ + return DeltaRational(-q, -delta); + } + } + case kind::EQUAL: + case kind::DISTINCT: + { + Monomial firstRight = getRight().getHead(); + if(firstRight.isConstant()){ + return DeltaRational(firstRight.getConstant().getValue(), 0); + }else{ + return DeltaRational(0, 0); + } + } + default: + Unhandled(cmpKind); + } +} + +Comparison Comparison::parseNormalForm(TNode n) { + Comparison result(n); + Assert(result.isNormalForm()); + return result; +} + Node Comparison::toNode(Kind k, const Polynomial& l, const Constant& r) { + Assert(isRelationOperator(k)); + switch(k) { + case kind::GEQ: + case kind::GT: + return NodeManager::currentNM()->mkNode(k, l.getNode(), r.getNode()); + default: + Unhandled(k); + } +} + +Node Comparison::toNode(Kind k, const Polynomial& l, const Polynomial& r) { Assert(isRelationOperator(k)); switch(k) { case kind::GEQ: case kind::EQUAL: + case kind::GT: + return NodeManager::currentNM()->mkNode(k, l.getNode(), r.getNode()); case kind::LEQ: - return NodeManager::currentNM()->mkNode(k, l.getNode(),r.getNode()); + return toNode(kind::GEQ, r, l).notNode(); case kind::LT: - return NodeManager::currentNM()->mkNode(kind::NOT, toNode(kind::GEQ,l,r)); - case kind::GT: - return NodeManager::currentNM()->mkNode(kind::NOT, toNode(kind::LEQ,l,r)); + return toNode(kind::GT, r, l).notNode(); + case kind::DISTINCT: + return toNode(kind::EQUAL, r, l).notNode(); default: Unreachable(); } } -Comparison Comparison::parseNormalForm(TNode n) { - if(n.getKind() == kind::CONST_BOOLEAN) { - return Comparison(n.getConst()); - } else { - bool negated = n.getKind() == kind::NOT; - Node relation = negated ? n[0] : n; - Assert( !negated || - relation.getKind() == kind::LEQ || - relation.getKind() == kind::GEQ); - - Polynomial left = Polynomial::parsePolynomial(relation[0]); - Constant right(relation[1]); - - Kind newOperator = relation.getKind(); - if(negated) { - if(newOperator == kind::LEQ) { - newOperator = kind::GT; - } else { - newOperator = kind::LT; - } - } - return Comparison(n, newOperator, left, right); +bool Comparison::rightIsConstant() const { + if(getNode().getKind() == kind::NOT){ + return getNode()[0][1].getKind() == kind::CONST_RATIONAL; + }else{ + return getNode()[1].getKind() == kind::CONST_RATIONAL; } } -bool Comparison::pbComparison(Kind k, TNode left, const Rational& right, bool& result) { - AssertArgument(left.getType().isPseudoboolean(), left); - switch(k) { +Polynomial Comparison::getLeft() const { + TNode left; + Kind k = comparisonKind(); + switch(k){ case kind::LT: - if(right > 1) { - result = true; - return true; - } else if(right <= 0) { - result = false; - return true; - } - break; case kind::LEQ: - if(right >= 1) { - result = true; - return true; - } else if(right < 0) { - result = false; - return true; - } + case kind::DISTINCT: + left = getNode()[0][0]; break; case kind::EQUAL: - if(right != 0 && right != 1) { - result = false; - return true; - } - break; + case kind::GT: case kind::GEQ: - if(right > 1) { - result = false; - return true; - } else if(right <= 0) { - result = true; - return true; - } + left = getNode()[0]; + break; + default: + Unhandled(k); + } + return Polynomial::parsePolynomial(left); +} + +Polynomial Comparison::getRight() const { + TNode right; + Kind k = comparisonKind(); + switch(k){ + case kind::LT: + case kind::LEQ: + case kind::DISTINCT: + right = getNode()[0][1]; break; + case kind::EQUAL: case kind::GT: - if(right >= 1) { - result = false; - return true; - } else if(right < 0) { - result = true; - return true; - } + case kind::GEQ: + right = getNode()[1]; break; default: - CheckArgument(false, k, "Bad comparison operator ?!"); + Unhandled(k); } - - return false; + return Polynomial::parsePolynomial(right); } -// Comparison Comparison::mkComparison(Kind k, const Polynomial& left, const Constant& right) { -// Assert(isRelationOperator(k)); -// if(left.isConstant()) { -// const Rational& lConst = left.getNode().getConst(); -// const Rational& rConst = right.getNode().getConst(); -// bool res = evaluateConstantPredicate(k, lConst, rConst); -// return Comparison(res); -// } - -// if(left.getNode().getType().isPseudoboolean()) { -// bool result; -// if(pbComparison(k, left.getNode(), right.getNode().getConst(), result)) { -// return Comparison(result); -// } -// } +// Polynomial Comparison::getLeft() const { +// Node n = getNode(); +// Node left = (n.getKind() == kind::NOT ? n[0]: n)[0]; +// return Polynomial::parsePolynomial(left); +// } -// return Comparison(toNode(k, left, right), k, left, right); +// Polynomial Comparison::getRight() const { +// Node n = getNode(); +// Node right = (n.getKind() == kind::NOT ? n[0]: n)[1]; +// return Polynomial::parsePolynomial(right); // } -Comparison Comparison::mkComparison(Kind k, const Polynomial& left, const Constant& right) { - Assert(isRelationOperator(k)); - return Comparison(toNode(k, left, right), k, left, right); +bool Comparison::isNormalForm() const { + Node n = getNode(); + Kind cmpKind = comparisonKind(n); + Debug("nf::tmp") << "isNormalForm " << n << " " << cmpKind << endl; + switch(cmpKind){ + case kind::CONST_BOOLEAN: + return true; + case kind::GT: + return isNormalGT(); + case kind::GEQ: + return isNormalGEQ(); + case kind::EQUAL: + return isNormalEquality(); + case kind::LT: + return isNormalLT(); + case kind::LEQ: + return isNormalLEQ(); + case kind::DISTINCT: + return isNormalDistinct(); + default: + return false; + } } -Comparison Comparison::addConstant(const Constant& constant) const { - Assert(!isBoolean()); - Monomial mono(constant); - Polynomial constAsPoly( mono ); - Polynomial newLeft = getLeft() + constAsPoly; - Constant newRight = getRight() + constant; - return mkComparison(oper, newLeft, newRight); +/** This must be (> qpolynomial constant) */ +bool Comparison::isNormalGT() const { + Node n = getNode(); + Assert(n.getKind() == kind::GT); + if(!rightIsConstant()){ + return false; + }else{ + Polynomial left = getLeft(); + if(left.containsConstant()){ + return false; + }else if(!left.leadingCoefficientIsAbsOne()){ + return false; + }else{ + return !left.isIntegral(); + } + } } -bool Comparison::constantInLefthand() const{ - return getLeft().containsConstant(); +/** This must be (not (> qpolynomial constant)) */ +bool Comparison::isNormalLEQ() const { + Node n = getNode(); + Debug("nf::tmp") << "isNormalLEQ " << n << endl; + Assert(n.getKind() == kind::NOT); + Assert(n[0].getKind() == kind::GT); + if(!rightIsConstant()){ + return false; + }else{ + Polynomial left = getLeft(); + if(left.containsConstant()){ + return false; + }else if(!left.leadingCoefficientIsAbsOne()){ + return false; + }else{ + return !left.isIntegral(); + } + } } -Comparison Comparison::cancelLefthandConstant() const { - if(constantInLefthand()){ - Monomial constantHead = getLeft().getHead(); - Assert(constantHead.isConstant()); - Constant constant = constantHead.getConstant(); - Constant negativeConstantHead = -constant; - return addConstant(negativeConstantHead); +/** This must be (>= qpolynomial constant) or (>= zpolynomial constant) */ +bool Comparison::isNormalGEQ() const { + Node n = getNode(); + Assert(n.getKind() == kind::GEQ); + + Debug("nf::tmp") << "isNormalGEQ " << n << " " << rightIsConstant() << endl; + + if(!rightIsConstant()){ + return false; }else{ - return *this; + Polynomial left = getLeft(); + if(left.containsConstant()){ + return false; + }else{ + if(left.isIntegral()){ + return left.denominatorLCMIsOne() && left.numeratorGCDIsOne(); + }else{ + Debug("nf::tmp") << "imme sdfhkdjfh "<< left.leadingCoefficientIsAbsOne() << endl; + return left.leadingCoefficientIsAbsOne(); + } + } } } -Comparison Comparison::multiplyConstant(const Constant& constant) const { - Assert(!isBoolean()); - Kind newOper = (constant.getValue() < 0) ? reverseRelationKind(oper) : oper; +/** This must be (not (>= qpolynomial constant)) or (not (>= zpolynomial constant)) */ +bool Comparison::isNormalLT() const { + Node n = getNode(); + Assert(n.getKind() == kind::NOT); + Assert(n[0].getKind() == kind::GEQ); - return mkComparison(newOper, left*Monomial(constant), right*constant); + if(!rightIsConstant()){ + return false; + }else{ + Polynomial left = getLeft(); + if(left.containsConstant()){ + return false; + }else{ + if(left.isIntegral()){ + return left.denominatorLCMIsOne() && left.numeratorGCDIsOne(); + }else{ + return left.leadingCoefficientIsAbsOne(); + } + } + } } -Integer Comparison::denominatorLCM() const { - // Get the coefficients to be all integers. - Integer leftDenominatorLCM = left.denominatorLCM(); - Integer rightDenominator = right.getValue().getDenominator(); - Integer denominatorLCM = leftDenominatorLCM.lcm(rightDenominator); - Assert(denominatorLCM.sgn() > 0); - return denominatorLCM; -} -Comparison Comparison::multiplyByDenominatorLCM() const{ - return multiplyConstant(Constant::mkConstant(denominatorLCM())); -} +bool Comparison::isNormalEqualityOrDisequality() const { + Polynomial pleft = getLeft(); -Comparison Comparison::normalizeLeadingCoefficientPositive() const { - if(getLeft().getHead().getConstant().isNegative()){ - return multiplyConstant(Constant::mkConstant(-1)); + if(pleft.numMonomials() == 1){ + Monomial mleft = pleft.getHead(); + if(mleft.isConstant()){ + return false; + }else{ + Polynomial pright = getRight(); + if(allIntegralVariables()){ + const Rational& lcoeff = mleft.getConstant().getValue(); + if(pright.isConstant()){ + return pright.isIntegral() && lcoeff.isOne(); + } + Polynomial varRight = pright.containsConstant() ? pright.getTail() : pright; + if(lcoeff.sgn() <= 0){ + return false; + }else{ + Integer lcm = lcoeff.getDenominator().lcm(varRight.denominatorLCM()); + Integer g = lcoeff.getNumerator().gcd(varRight.numeratorGCD()); + Debug("nf::tmp") << lcm << " " << g << endl; + if(!lcm.isOne()){ + return false; + }else if(!g.isOne()){ + return false; + }else{ + Monomial absMinRight = varRight.selectAbsMinimum(); + Debug("nf::tmp") << mleft.getNode() << " " << absMinRight.getNode() << endl; + if( mleft.absLessThan(absMinRight) ){ + return true; + }else{ + return (!absMinRight.absLessThan(mleft)) && mleft < absMinRight; + } + } + } + }else{ + if(mleft.coefficientIsOne()){ + Debug("nf::tmp") + << "dfklj " << mleft.getNode() << endl + << pright.getNode() << endl + << pright.variableMonomialAreStrictlyGreater(mleft) + << endl; + return pright.variableMonomialAreStrictlyGreater(mleft); + }else{ + return false; + } + } + } }else{ - return *this; + return false; } } -bool Comparison::isIntegral() const { - return getRight().isIntegral() && getLeft().isIntegral(); +/** This must be (= qvarlist qpolynomial) or (= zmonomial zpolynomial)*/ +bool Comparison::isNormalEquality() const { + Assert(getNode().getKind() == kind::EQUAL); + + return isNormalEqualityOrDisequality(); } -bool Comparison::isConstant() const { - return getLeft().isConstant(); +/** + * This must be (not (= qvarlist qpolynomial)) or + * (not (= zmonomial zpolynomial)). + */ +bool Comparison::isNormalDistinct() const { + Assert(getNode().getKind() == kind::NOT); + Assert(getNode()[0].getKind() == kind::EQUAL); + + return isNormalEqualityOrDisequality(); } -Comparison Comparison::evaluateConstant() const { - Assert(left.isConstant()); - const Rational& rConst = getRight().getValue(); - const Rational& lConst = getLeft().getHead().getConstant().getValue(); - bool res = evaluateConstantPredicate(getKind(), lConst, rConst); - return Comparison(res); +Node Comparison::mkRatEquality(const Polynomial& p){ + Assert(!p.isConstant()); + Assert(!p.allIntegralVariables()); + + Monomial minimalVList = p.minimumVariableMonomial(); + Constant coeffInv = -(minimalVList.getConstant().inverse()); + + Polynomial newRight = (p - minimalVList) * coeffInv; + Polynomial newLeft(minimalVList.getVarList()); + + return toNode(kind::EQUAL, newLeft, newRight); } -Comparison Comparison::divideByLefthandGCD() const { - Assert(isIntegral()); +Node Comparison::mkRatInequality(Kind k, const Polynomial& p){ + Assert(k == kind::GEQ || k == kind::GT); + Assert(!p.isConstant()); + Assert(!p.allIntegralVariables()); + + SumPair sp = SumPair::mkSumPair(p); + Polynomial left = sp.getPolynomial(); + Constant right = - sp.getConstant(); + + Monomial minimalVList = left.getHead(); + Assert(!minimalVList.isConstant()); + + Constant coeffInv = minimalVList.getConstant().inverse().abs(); + Polynomial newLeft = left * coeffInv; + Constant newRight = right * (coeffInv); + + return toNode(k, newLeft, newRight); +} + +Node Comparison::mkIntInequality(Kind k, const Polynomial& p){ + Assert(kind::GT == k || kind::GEQ == k); + Assert(!p.isConstant()); + Assert(p.allIntegralVariables()); + + SumPair sp = SumPair::mkSumPair(p); + Polynomial left = sp.getPolynomial(); + Rational right = - (sp.getConstant().getValue()); + + Monomial m = left.getHead(); + Assert(!m.isConstant()); + + Integer lcm = left.denominatorLCM(); + Integer g = left.numeratorGCD(); + Rational mult(lcm,g); - Integer zr = getRight().getValue().getNumerator(); - Integer gcd = getLeft().gcd(); - Polynomial newLeft = getLeft().exactDivide(gcd); + Polynomial newLeft = left * mult; + Rational rightMult = right * mult; - Constant newRight = Constant::mkConstant(Rational(zr,gcd)); - return mkComparison(getKind(), newLeft, newRight); + + if(rightMult.isIntegral()){ + if(k == kind::GT){ + // (> p z) + // (>= p (+ z 1)) + Constant rightMultPlusOne = Constant::mkConstant(rightMult + 1); + return toNode(kind::GEQ, newLeft, rightMultPlusOne); + }else{ + Constant newRight = Constant::mkConstant(rightMult); + return toNode(kind::GEQ, newLeft, newRight); + } + }else{ + //(>= l (/ n d)) + //(>= l (ceil (/ n d))) + //This also hold for GT as (ceil (/ n d)) > (/ n d) + Integer ceilr = rightMult.ceiling(); + Constant ceilRight = Constant::mkConstant(ceilr); + return toNode(kind::GEQ, newLeft, ceilRight); + } } -Comparison Comparison::divideByLeadingCoefficient() const { - //Handle the rational/mixed case - Monomial head = getLeft().getHead(); - Constant leadingCoefficient = head.getConstant(); - Assert(!leadingCoefficient.isZero()); +Node Comparison::mkIntEquality(const Polynomial& p){ + Assert(!p.isConstant()); + Assert(p.allIntegralVariables()); + + SumPair sp = SumPair::mkSumPair(p); + Polynomial varPart = sp.getPolynomial(); + Constant constPart = sp.getConstant(); + + Integer lcm = varPart.denominatorLCM(); + Integer g = varPart.numeratorGCD(); + Constant mult = Constant::mkConstant(Rational(lcm,g)); - Constant inverse = leadingCoefficient.inverse(); + Constant constMult = constPart * mult; - return multiplyConstant(inverse); + if(constMult.isIntegral()){ + Polynomial varPartMult = varPart * mult; + + Monomial m = varPartMult.selectAbsMinimum(); + bool mIsPositive = m.getConstant().isPositive(); + + Polynomial noM = (varPartMult + (- m)) + Polynomial(constMult); + + // m + noM = 0 + Polynomial newRight = mIsPositive ? -noM : noM; + Polynomial newLeft = mIsPositive ? m : -m; + + Assert(newRight.isIntegral()); + return toNode(kind::EQUAL, newLeft, newRight); + }else{ + return mkBoolNode(false); + } } -Comparison Comparison::tightenIntegralConstraint() const { - Assert(getLeft().isIntegral()); +Comparison Comparison::mkComparison(Kind k, const Polynomial& l, const Polynomial& r){ - if(getRight().isIntegral()){ - return *this; + //Make this special case fast for sharing! + if((k == kind::EQUAL || k == kind::DISTINCT) && l.isVarList() && r.isVarList()){ + VarList vLeft = l.asVarList(); + VarList vRight = r.asVarList(); + + if(vLeft == vRight){ + return Comparison(k == kind::EQUAL); + }else{ + Node eqNode = vLeft < vRight ? toNode( kind::EQUAL, l, r) : toNode( kind::EQUAL, r, l); + Node forK = (k == kind::DISTINCT) ? eqNode.notNode() : eqNode; + return Comparison(forK); + } + } + + //General case + Polynomial diff = l - r; + if(diff.isConstant()){ + bool res = evaluateConstantPredicate(k, diff.asConstant(), Rational(0)); + return Comparison(res); }else{ - switch(getKind()){ + Node result = Node::null(); + bool isInteger = diff.allIntegralVariables(); + switch(k){ case kind::EQUAL: - //If the gcd of the left hand side does not cleanly divide the right hand side, - //this is unsatisfiable in the theory of Integers. - return Comparison(false); - case kind::GEQ: - case kind::GT: + result = isInteger ? mkIntEquality(diff) : mkRatEquality(diff); + break; + case kind::DISTINCT: { - //(>= l (/ n d)) - //(>= l (ceil (/ n d))) - //This also hold for GT as (ceil (/ n d)) > (/ n d) - Integer ceilr = getRight().getValue().ceiling(); - Constant newRight = Constant::mkConstant(ceilr); - return Comparison(toNode(kind::GEQ, getLeft(), newRight),kind::GEQ, getLeft(),newRight); + Node eq = isInteger ? mkIntEquality(diff) : mkRatEquality(diff); + result = eq.notNode(); } + break; case kind::LEQ: case kind::LT: { - //(<= l (/ n d)) - //(<= l (floor (/ n d))) - //This also hold for LT as (floor (/ n d)) < (/ n d) - Integer floor = getRight().getValue().floor(); - Constant newRight = Constant::mkConstant(floor); - return Comparison(toNode(kind::LEQ, getLeft(), newRight),kind::LEQ, getLeft(),newRight); + Polynomial neg = - diff; + Kind negKind = (k == kind::LEQ ? kind::GEQ : kind::GT); + result = isInteger ? + mkIntInequality(negKind, neg) : mkRatInequality(negKind, neg); } + break; + case kind::GEQ: + case kind::GT: + result = isInteger ? + mkIntInequality(k, diff) : mkRatInequality(k, diff); + break; default: - Unreachable(); + Unhandled(k); + } + Assert(!result.isNull()); + if(result.getKind() == kind::NOT && result[0].getKind() == kind::CONST_BOOLEAN){ + return Comparison(!(result[0].getConst())); + }else{ + Comparison cmp(result); + Assert(cmp.isNormalForm()); + return cmp; } } } -bool Comparison::isIntegerNormalForm() const{ - if(constantInLefthand()){ return false; } - else if(getLeft().getHead().getConstant().isNegative()){ return false; } - else if(!isIntegral()){ return false; } - else { - return getLeft().gcd() == 1; - } -} -bool Comparison::isMixedNormalForm() const { - if(constantInLefthand()){ return false; } - else if(allIntegralVariables()) { return false; } - else{ - return getLeft().getHead().getConstant().getValue() == 1; - } -} +// Comparison Comparison::normalize(Comparison c) { +// if(c.isConstant()){ +// return c.evaluateConstant(); +// }else{ +// Comparison c0 = c.constantInLefthand() ? c.cancelLefthandConstant() : c; +// Comparison c1 = c0.normalizeLeadingCoefficientPositive(); +// if(c1.allIntegralVariables()){ +// //All Integer Variable Case +// Comparison integer0 = c1.multiplyByDenominatorLCM(); +// Comparison integer1 = integer0.divideByLefthandGCD(); +// Comparison integer2 = integer1.tightenIntegralConstraint(); +// Assert(integer2.isBoolean() || integer2.isIntegerNormalForm()); +// return integer2; +// }else{ +// //Mixed case +// Comparison mixed = c1.divideByLeadingCoefficient(); +// Assert(mixed.isMixedNormalForm()); +// return mixed; +// } +// } +// } -Comparison Comparison::normalize(Comparison c) { - if(c.isConstant()){ - return c.evaluateConstant(); - }else{ - Comparison c0 = c.constantInLefthand() ? c.cancelLefthandConstant() : c; - Comparison c1 = c0.normalizeLeadingCoefficientPositive(); - if(c1.allIntegralVariables()){ - //All Integer Variable Case - Comparison integer0 = c1.multiplyByDenominatorLCM(); - Comparison integer1 = integer0.divideByLefthandGCD(); - Comparison integer2 = integer1.tightenIntegralConstraint(); - Assert(integer2.isBoolean() || integer2.isIntegerNormalForm()); - return integer2; - }else{ - //Mixed case - Comparison mixed = c1.divideByLeadingCoefficient(); - Assert(mixed.isMixedNormalForm()); - return mixed; - } - } +bool Comparison::isBoolean() const { + return getNode().getKind() == kind::CONST_BOOLEAN; } -Comparison Comparison::mkNormalComparison(Kind k, const Polynomial& left, const Constant& right) { - Comparison cmp = mkComparison(k,left,right); - Comparison normalized = cmp.normalize(cmp); - Assert(normalized.isNormalForm()); - return normalized; + +bool Comparison::debugIsIntegral() const{ + return getLeft().isIntegral() && getRight().isIntegral(); } -Node Polynomial::computeQR(const Polynomial& p, const Integer& div){ - Assert(p.isIntegral()); - std::vector q_vec, r_vec; - Integer tmp_q, tmp_r; - for(iterator iter = p.begin(), pend = p.end(); iter != pend; ++iter){ - Monomial curr = *iter; - VarList vl = curr.getVarList(); - Constant c = curr.getConstant(); +// Comparison Comparison::mkComparison(Kind k, const Polynomial& left, const Constant& right) { +// Assert(isRelationOperator(k)); +// if(left.isConstant()) { +// const Rational& lConst = left.getNode().getConst(); +// const Rational& rConst = right.getNode().getConst(); +// bool res = evaluateConstantPredicate(k, lConst, rConst); +// return Comparison(res); +// } - const Integer& a = c.getValue().getNumerator(); - Integer::floorQR(tmp_q, tmp_r, a, div); - Constant q=Constant::mkConstant(tmp_q); - Constant r=Constant::mkConstant(tmp_r); - if(!q.isZero()){ - q_vec.push_back(Monomial::mkMonomial(q, vl)); - } - if(!r.isZero()){ - r_vec.push_back(Monomial::mkMonomial(r, vl)); - } - } +// if(left.getNode().getType().isPseudoboolean()) { +// bool result; +// if(pbComparison(k, left.getNode(), right.getNode().getConst(), result)) { +// return Comparison(result); +// } +// } - Polynomial p_q = Polynomial::mkPolynomial(q_vec); - Polynomial p_r = Polynomial::mkPolynomial(r_vec); +// return Comparison(toNode(k, left, right), k, left, right); +// } - return NodeManager::currentNM()->mkNode(kind::PLUS, p_q.getNode(), p_r.getNode()); -} +// Comparison Comparison::mkComparison(Kind k, const Polynomial& left, const Polynomial& right) { +// Assert(isRelationOperator(k)); +// return Comparison(toNode(k, left, right), k, left, right); +// } -Node SumPair::computeQR(const SumPair& sp, const Integer& div){ - Assert(sp.isIntegral()); - const Integer& constant = sp.getConstant().getValue().getNumerator(); +// bool Comparison::constantInLefthand() const{ +// return getLeft().containsConstant(); +// } - Integer constant_q, constant_r; - Integer::floorQR(constant_q, constant_r, constant, div); +// Comparison Comparison::cancelLefthandConstant() const { +// if(constantInLefthand()){ +// Monomial constantHead = getLeft().getHead(); +// Assert(constantHead.isConstant()); - Node p_qr = Polynomial::computeQR(sp.getPolynomial(), div); - Assert(p_qr.getKind() == kind::PLUS); - Assert(p_qr.getNumChildren() == 2); +// Constant constant = constantHead.getConstant(); +// Constant negativeConstantHead = -constant; +// return addConstant(negativeConstantHead); +// }else{ +// return *this; +// } +// } - Polynomial p_q = Polynomial::parsePolynomial(p_qr[0]); - Polynomial p_r = Polynomial::parsePolynomial(p_qr[1]); +// Integer OrderedPolynomialPair::denominatorLCM() const { +// // Get the coefficients to be all integers. +// Integer firstDenominatorLCM = getFirst().denominatorLCM(); +// Integer secondDenominatorLCM = getSecond().denominatorLCM(); +// Integer denominatorLCM = secondDenominatorLCM.lcm(secondDenominatorLCM); +// Assert(denominatorLCM.sgn() > 0); +// return denominatorLCM; +// } - SumPair sp_q(p_q, Constant::mkConstant(constant_q)); - SumPair sp_r(p_r, Constant::mkConstant(constant_r)); +// bool Comparison::isIntegral() const { +// return getRight().isIntegral() && getLeft().isIntegral(); +// } - return NodeManager::currentNM()->mkNode(kind::PLUS, sp_q.getNode(), sp_r.getNode()); -} +// bool OrderedPolynomialPair::isConstant() const { +// return getFirst().isConstant() && getSecond().isConstant(); +// } -Constant Polynomial::getCoefficient(const VarList& vl) const{ - //TODO improve to binary search... - for(iterator iter=begin(), myend=end(); iter != myend; ++iter){ - Monomial m = *iter; - VarList curr = m.getVarList(); - if(curr == vl){ - return m.getConstant(); +// bool OrderedPolynomialPair::evaluateConstant(Kind k) const { +// Assert(getFirst().isConstant()); +// Assert(getSecond().isConstant()); + +// const Rational& firstConst = getFirst().asConstant(); +// const Rational& secondConst = getSecond().asConstant(); + +// return evaluateConstantPredicate(k, firstConst, secondConst); +// } + +// OrderedPolynomialPair OrderedPolynomialPair::divideByGCD() const { +// Assert(isIntegral()); + +// Integer fGcd = getFirst().gcd(); +// Integer sGcd = getSecond().gcd(); + +// Integer gcd = fGcd.gcd(sGcd); +// Polynomial newFirst = getFirst().exactDivide(gcd); +// Polynomial newSecond = getSecond().exactDivide(gcd); + +// return OrderedPolynomialPair(newFirst, newSecond); +// } + +// OrderedPolynomialPair OrderedPolynomialPair::divideByLeadingFirstCoefficient() const { +// //Handle the rational/mixed case +// Monomial head = getFirst().getHead(); +// Constant leadingCoefficient = head.getConstant(); +// Assert(!leadingCoefficient.isZero()); + +// Constant inverse = leadingCoefficient.inverse(); + +// return multiplyConstant(inverse); +// } + +// OrderedPolynomialPair OrderedPolynomialPair::multiplyConstant(const Constant& c) const { +// return OrderedPolynomialPair(getFirst() * c, getSecond() * c); +// } + +// Comparison Comparison::divideByLeadingCoefficient() const { +// //Handle the rational/mixed case +// Monomial head = getLeft().getHead(); +// Constant leadingCoefficient = head.getConstant(); +// Assert(!leadingCoefficient.isZero()); + +// Constant inverse = leadingCoefficient.inverse(); + +// return multiplyConstant(inverse); +// } + + + +// Comparison Comparison::tightenIntegralConstraint() const { +// Assert(getLeft().isIntegral()); + +// if(getRight().isIntegral()){ +// return *this; +// }else{ +// switch(getKind()){ +// case kind::EQUAL: +// //If the gcd of the left hand side does not cleanly divide the right hand side, +// //this is unsatisfiable in the theory of Integers. +// return Comparison(false); +// case kind::GEQ: +// case kind::GT: +// { +// //(>= l (/ n d)) +// //(>= l (ceil (/ n d))) +// //This also hold for GT as (ceil (/ n d)) > (/ n d) +// Integer ceilr = getRight().getValue().ceiling(); +// Constant newRight = Constant::mkConstant(ceilr); +// return Comparison(toNode(kind::GEQ, getLeft(), newRight),kind::GEQ, getLeft(),newRight); +// } +// case kind::LEQ: +// case kind::LT: +// { +// //(<= l (/ n d)) +// //(<= l (floor (/ n d))) +// //This also hold for LT as (floor (/ n d)) < (/ n d) +// Integer floor = getRight().getValue().floor(); +// Constant newRight = Constant::mkConstant(floor); +// return Comparison(toNode(kind::LEQ, getLeft(), newRight),kind::LEQ, getLeft(),newRight); +// } +// default: +// Unreachable(); +// } +// } +// } + +// bool Comparison::isIntegerNormalForm() const{ +// if(constantInLefthand()){ return false; } +// else if(getLeft().getHead().getConstant().isNegative()){ return false; } +// else if(!isIntegral()){ return false; } +// else { +// return getLeft().gcd() == 1; +// } +// } +// bool Comparison::isMixedNormalForm() const { +// if(constantInLefthand()){ return false; } +// else if(allIntegralVariables()) { return false; } +// else{ +// return getLeft().getHead().getConstant().getValue() == 1; +// } +// } + +// Comparison Comparison::normalize(Comparison c) { +// if(c.isConstant()){ +// return c.evaluateConstant(); +// }else{ +// Comparison c0 = c.constantInLefthand() ? c.cancelLefthandConstant() : c; +// Comparison c1 = c0.normalizeLeadingCoefficientPositive(); +// if(c1.allIntegralVariables()){ +// //All Integer Variable Case +// Comparison integer0 = c1.multiplyByDenominatorLCM(); +// Comparison integer1 = integer0.divideByLefthandGCD(); +// Comparison integer2 = integer1.tightenIntegralConstraint(); +// Assert(integer2.isBoolean() || integer2.isIntegerNormalForm()); +// return integer2; +// }else{ +// //Mixed case +// Comparison mixed = c1.divideByLeadingCoefficient(); +// Assert(mixed.isMixedNormalForm()); +// return mixed; +// } +// } +// } + +// Comparison Comparison::mkNormalComparison(Kind k, const Polynomial& left, const Constant& right) { +// Comparison cmp = mkComparison(k,left,right); +// Comparison normalized = cmp.normalize(cmp); +// Assert(normalized.isNormalForm()); +// return normalized; +// } + + +Kind Comparison::comparisonKind(TNode literal){ + switch(literal.getKind()){ + case kind::CONST_BOOLEAN: + case kind::GT: + case kind::GEQ: + case kind::EQUAL: + return literal.getKind(); + case kind::NOT: + { + TNode negatedAtom = literal[0]; + switch(negatedAtom.getKind()){ + case kind::GT: //(not (GT x c)) <=> (LEQ x c) + return kind::LEQ; + case kind::GEQ: //(not (GEQ x c)) <=> (LT x c) + return kind::LT; + case kind::EQUAL: + return kind::DISTINCT; + default: + return kind::UNDEFINED_KIND; + } } + default: + return kind::UNDEFINED_KIND; } - return Constant::mkConstant(0); } } //namespace arith diff --git a/src/theory/arith/normal_form.h b/src/theory/arith/normal_form.h index a5e1e0cec..434be42a2 100644 --- a/src/theory/arith/normal_form.h +++ b/src/theory/arith/normal_form.h @@ -49,7 +49,7 @@ namespace arith { * * variable := n * where - * n.getMetaKind() == metakind::VARIABLE + * n.getMetaKind() == metakind::VARIABLE or is foreign * n.getType() \in {Integer, Real} * * constant := n @@ -71,24 +71,45 @@ namespace arith { * isStrictlySorted monoOrder [monomial] * forall (\x -> x != 0) [monomial] * - * rational_restricted_cmp := (|><| qpolynomial constant) + * rational_cmp := (|><| qpolynomial constant) * where - * |><| is GEQ, EQ, or EQ + * |><| is GEQ, or GT * not (exists constantMonomial (monomialList qpolynomial)) * (exists realMonomial (monomialList qpolynomial)) - * monomialCoefficient (head (monomialList qpolynomial)) == 1 + * abs(monomialCoefficient (head (monomialList qpolynomial))) == 1 * - * integer_restricted_cmp := (|><| zpolynomial constant) + * integer_cmp := (<= zpolynomial constant) * where - * |><| is GEQ, EQ, or EQ * not (exists constantMonomial (monomialList zpolynomial)) - * (forall integerMonomial (monomialList qpolynomial)) + * (forall integerMonomial (monomialList zpolynomial)) + * the gcd of all numerators of coefficients is 1 * the denominator of all coefficients and the constant is 1 + * + * rational_eq := (= qvarlist qpolynomial) + * where + * let allMonomials = (cons qvarlist (monomialList zpolynomial)) + * let variableMonomials = (drop constantMonomial allMonomials) + * isStrictlySorted variableMonomials + * exists realMonomial variableMonomials + * is not empty qvarlist + * + * integer_eq := (= zmonomial zpolynomial) + * where + * let allMonomials = (cons zmonomial (monomialList zpolynomial)) + * let variableMonomials = (drop constantMonomial allMonomials) + * not (constantMonomial zmonomial) + * (forall integerMonomial allMonomials) + * isStrictlySorted variableMonomials * the gcd of all numerators of coefficients is 1 + * the denominator of all coefficients and the constant is 1 + * the coefficient of monomial is positive + * the value of the coefficient of monomial is minimal in variableMonomials * * comparison := TRUE | FALSE - * | rational_restricted_cmp | (not rational_restricted_cmp) - * | integer_restricted_cmp | (not integer_restricted_cmp) + * | rational_cmp | (not rational_cmp) + * | rational_eq | (not rational_eq) + * | integer_cmp | (not integer_cmp) + * | integer_eq | (not integer_eq) * * Normal Form for terms := polynomial * Normal Form for atoms := comparison @@ -138,6 +159,15 @@ namespace arith { * Section 3: Guard Conditions Misc. * * + * variable_order x y = + * if (meta_kind_variable x) and (meta_kind_variable y) + * then node_order x y + * else if (meta_kind_variable x) + * then false + * else if (meta_kind_variable y) + * then true + * else node_order x y + * * var_list_len vl = * match vl with * variable -> 1 @@ -214,7 +244,27 @@ public: return getNode().getType().isInteger(); } - bool operator<(const Variable& v) const { return getNode() < v.getNode();} + bool isMetaKindVariable() const { + return getNode().getMetaKind() == kind::metakind::VARIABLE; + } + + bool operator<(const Variable& v) const { + bool thisIsVariable = isMetaKindVariable(); + bool vIsVariable = v.isMetaKindVariable(); + + if(thisIsVariable == vIsVariable){ + bool thisIsInteger = isIntegral(); + bool vIsInteger = v.isIntegral(); + if(thisIsInteger == vIsInteger){ + return getNode() < v.getNode(); + }else{ + return thisIsInteger && !vIsInteger; + } + }else{ + return thisIsVariable && !vIsVariable; + } + } + bool operator==(const Variable& v) const { return getNode() == v.getNode();} };/* class Variable */ @@ -240,6 +290,14 @@ public: return Constant(mkRationalNode(rat)); } + static Constant mkZero() { + return mkConstant(Rational(0)); + } + + static Constant mkOne() { + return mkConstant(Rational(1)); + } + const Rational& getValue() const { return getNode().getConst(); } @@ -254,6 +312,10 @@ public: bool isOne() const { return getValue() == 1; } + Constant operator*(const Rational& other) const { + return mkConstant(getValue() * other); + } + Constant operator*(const Constant& other) const { return mkConstant(getValue() * other.getValue()); } @@ -572,9 +634,18 @@ public: return coefficientIsOne() || constant.getValue() == -1; } + bool constantIsPositive() const { + return getConstant().isPositive(); + } + + Monomial operator*(const Rational& q) const; Monomial operator*(const Constant& c) const; Monomial operator*(const Monomial& mono) const; + Monomial operator-() const{ + return (*this) * Rational(-1); + } + int cmp(const Monomial& mono) const { return getVarList().cmp(mono.getVarList()); @@ -636,6 +707,8 @@ public: };/* class Monomial */ +class SumPair; +class Comparison;; class Polynomial : public NodeWrapper { private: @@ -795,6 +868,9 @@ public: return mkPolynomial(subrange); } + Monomial minimumVariableMonomial() const; + bool variableMonomialAreStrictlyGreater(const Monomial& m) const; + void printList() const { if(Debug.isOn("normal-form")){ Debug("normal-form") << "start list" << std::endl; @@ -834,12 +910,24 @@ public: */ Monomial selectAbsMinimum() const; + /** Returns true if the absolute value of the head coefficient is one. */ + bool leadingCoefficientIsAbsOne() const; + bool leadingCoefficientIsPositive() const; + bool denominatorLCMIsOne() const; + bool numeratorGCDIsOne() const; + /** * Returns the Least Common Multiple of the denominators of the coefficients * of the monomials. */ Integer denominatorLCM() const; + /** + * Returns the GCD of the numerators of the monomials. + * Requires this to be an isIntegral() polynomial. + */ + Integer numeratorGCD() const; + /** * Returns the GCD of the coefficients of the monomials. * Requires this to be an isIntegral() polynomial. @@ -856,7 +944,11 @@ public: Polynomial operator+(const Polynomial& vl) const; Polynomial operator-(const Polynomial& vl) const; + Polynomial operator-() const{ + return (*this) * Rational(-1); + } + Polynomial operator*(const Rational& q) const; Polynomial operator*(const Constant& c) const; Polynomial operator*(const Monomial& mono) const; @@ -905,168 +997,31 @@ public: return 1; } } -};/* class Polynomial */ - - -class Comparison : public NodeWrapper { -private: - Kind oper; - Polynomial left; - Constant right; - - static Node toNode(Kind k, const Polynomial& l, const Constant& r); - - Comparison(TNode n, Kind k, const Polynomial& l, const Constant& r): - NodeWrapper(n), oper(k), left(l), right(r) - { } - - /** - * Possibly simplify a comparison with a pseudoboolean-typed LHS. k - * is one of LT, LEQ, EQUAL, GEQ, GT, and left must be PB-typed. If - * possible, "left k right" is fully evaluated, "true" is returned, - * and the result of the evaluation is returned in "result". If no - * evaluation is possible, false is returned and "result" is - * untouched. - * - * For example, pbComparison(kind::EQUAL, "x", 0.5, result) returns - * true, and updates "result" to false, since pseudoboolean variable - * "x" can never equal 0.5. pbComparison(kind::GEQ, "x", 1, result) - * returns false, since "x" can be >= 1, but could also be less. - */ - static bool pbComparison(Kind k, TNode left, const Rational& right, bool& result); - Kind getKind() const { return oper; } - -public: - Comparison(bool val) : - NodeWrapper(NodeManager::currentNM()->mkConst(val)), - oper(kind::CONST_BOOLEAN), - left(Polynomial::mkZero()), - right(Constant::mkConstant(0)) - { } - - Comparison(Kind k, const Polynomial& l, const Constant& r): - NodeWrapper(toNode(k, l, r)), oper(k), left(l), right(r) - { - Assert(isRelationOperator(oper)); - Assert(!left.containsConstant()); - Assert(left.getHead().getConstant().isOne()); - } - - static Comparison mkComparison(Kind k, const Polynomial& left, const Constant& right); - - /** - * Returns the left hand side of the comparison. - * This is a polynomial that always contains all of the variables. - */ - const Polynomial& getLeft() const { return left; } - - /** - * Returns the right hand constatn of the comparison. - * If in normal form, this is the only constant term. - */ - const Constant& getRight() const { return right; } - - /** Returns true if the comparison is a boolean constant. */ - bool isBoolean() const { - return (oper == kind::CONST_BOOLEAN); - } - - /** Returns true if all of the variables are integers. */ - bool allIntegralVariables() const { - return getLeft().allIntegralVariables(); + const Rational& asConstant() const{ + Assert(isConstant()); + return getNode().getConst(); + //return getHead().getConstant().getValue(); } - /** - * Returns true if the comparison is either a boolean term, - * in integer normal form or mixed normal form. - */ - bool isNormalForm() const { - if(isBoolean()) { - return true; - } else if(allIntegralVariables()) { - return isIntegerNormalForm(); - } else{ - return isMixedNormalForm(); + bool isVarList() const { + if(singleton()){ + return VarList::isMember(getNode()); + }else{ + return false; } } -private: - /** Normal form check if at least one variable is real. */ - bool isMixedNormalForm() const; - - /** Normal form check is all variables are real.*/ - bool isIntegerNormalForm() const; - -public: - /** - * Returns true if the left hand side is the sum of a non-zero constant - * and a polynomial.*/ - bool constantInLefthand() const; - - /** - * Returns a polynomial that is equivalent to the original but does not contain - * a constant in the top level sum on the left hand side. - */ - Comparison cancelLefthandConstant() const; - - - /** Returns true if the polynomial is a constant. */ - bool isConstant() const; - - /** Reduces a constant comparison to a boolean comaprison.*/ - Comparison evaluateConstant() const; - - - /** - * Returns true if all of the variables are integers, the coefficients are integers, - * and the right hand coefficient is an integer. - */ - bool isIntegral() const; - - /** - * Returns the Least Common Multiple of the monomials - * on the lefthand side and the constant on the right. - */ - Integer denominatorLCM() const; - - /** Multiplies the comparison by the denominatorLCM(). */ - Comparison multiplyByDenominatorLCM() const; - - /** If the leading coefficient is negative, multiply by -1. */ - Comparison normalizeLeadingCoefficientPositive() const; - - /** Divides the Comaprison by the gcd of the lefthand.*/ - Comparison divideByLefthandGCD() const; - - /** Divides the Comparison by the leading coefficient. */ - Comparison divideByLeadingCoefficient() const; - - /** - * If the left hand is integral and the right hand is not, - * the comparison is tightened to the nearest integer. - */ - Comparison tightenIntegralConstraint() const; - - Comparison addConstant(const Constant& constant) const; - - /* Multiply a non-boolean comparison by a constant term. */ - Comparison multiplyConstant(const Constant& constant) const; - - static Comparison parseNormalForm(TNode n); - - /* Returns a logically equivalent comparison in normal form. */ - static Comparison normalize(Comparison c); + VarList asVarList() const { + Assert(isVarList()); + return getHead().getVarList(); + } - /** Makes a comparison that is in normal form. */ - static Comparison mkNormalComparison(Kind k, const Polynomial& left, const Constant& right); + friend class SumPair; + friend class Comparison;; - inline static bool isNormalAtom(TNode n){ - Comparison parse = Comparison::parseNormalForm(n); - return parse.isNormalForm(); - } +};/* class Polynomial */ -};/* class Comparison */ /** * SumPair is a utility class that extends polynomials for use in computations. @@ -1147,6 +1102,8 @@ public: return (*this) + (other * Constant::mkConstant(-1)); } + static SumPair mkSumPair(const Polynomial& p); + static SumPair mkSumPair(const Variable& var){ return SumPair(Polynomial::mkPolynomial(var)); } @@ -1187,12 +1144,183 @@ public: static Node computeQR(const SumPair& sp, const Integer& div); +};/* class SumPair */ + +/* class OrderedPolynomialPair { */ +/* private: */ +/* Polynomial d_first; */ +/* Polynomial d_second; */ +/* public: */ +/* OrderedPolynomialPair(const Polynomial& f, const Polynomial& s) */ +/* : d_first(f), */ +/* d_second(s) */ +/* {} */ + +/* /\** Returns the first part of the pair. *\/ */ +/* const Polynomial& getFirst() const { */ +/* return d_first; */ +/* } */ + +/* /\** Returns the second part of the pair. *\/ */ +/* const Polynomial& getSecond() const { */ +/* return d_second; */ +/* } */ + +/* OrderedPolynomialPair operator*(const Constant& c) const; */ +/* OrderedPolynomialPair operator+(const Polynomial& p) const; */ + +/* /\** Returns true if both of the polynomials are constant. *\/ */ +/* bool isConstant() const; */ + +/* /\** */ +/* * Evaluates an isConstant() ordered pair as if */ +/* * (k getFirst() getRight()) */ +/* *\/ */ +/* bool evaluateConstant(Kind k) const; */ + +/* /\** */ +/* * Returns the Least Common Multiple of the monomials */ +/* * on the lefthand side and the constant on the right. */ +/* *\/ */ +/* Integer denominatorLCM() const; */ + +/* /\** Constructs a SumPair. *\/ */ +/* SumPair toSumPair() const; */ + + +/* OrderedPolynomialPair divideByGCD() const; */ +/* OrderedPolynomialPair multiplyConstant(const Constant& c) const; */ + +/* /\** */ +/* * Returns true if all of the variables are integers, */ +/* * and the coefficients are integers. */ +/* *\/ */ +/* bool isIntegral() const; */ + +/* /\** Returns true if all of the variables are integers. *\/ */ +/* bool allIntegralVariables() const { */ +/* return getFirst().allIntegralVariables() && getSecond().allIntegralVariables(); */ +/* } */ +/* }; */ + +class Comparison : public NodeWrapper { +private: + + static Node toNode(Kind k, const Polynomial& l, const Constant& c); + static Node toNode(Kind k, const Polynomial& l, const Polynomial& r); + + Comparison(TNode n); + + /** + * Creates a node in normal form equivalent to (= l 0). + * All variables in l are integral. + */ + static Node mkIntEquality(const Polynomial& l); + + /** + * Creates a comparison equivalent to (k l 0). + * k is either GT or GEQ. + * All variables in l are integral. + */ + static Node mkIntInequality(Kind k, const Polynomial& l); - static SumPair comparisonToSumPair(const Comparison& cmp){ - return SumPair(cmp.getLeft(), - cmp.getRight()); + /** + * Creates a node equivalent to (= l 0). + * It is not the case that all variables in l are integral. + */ + static Node mkRatEquality(const Polynomial& l); + + /** + * Creates a comparison equivalent to (k l 0). + * k is either GT or GEQ. + * It is not the case that all variables in l are integral. + */ + static Node mkRatInequality(Kind k, const Polynomial& l); + +public: + + Comparison(bool val) : + NodeWrapper(NodeManager::currentNM()->mkConst(val)) + { } + + /** + * Given a literal to TheoryArith return a single kind to + * to indicate its underlying structure. + * The function returns the following in each case: + * - (K left right) -> K where is either EQUAL, GT, or GEQ + * - (CONST_BOOLEAN b) -> CONST_BOOLEAN + * - (NOT (EQUAL left right)) -> DISTINCT + * - (NOT (GT left right)) -> LEQ + * - (NOT (GEQ left right)) -> LT + * If none of these match, it returns UNDEFINED_KIND. + */ + static Kind comparisonKind(TNode literal); + + Kind comparisonKind() const { return comparisonKind(getNode()); } + + static Comparison mkComparison(Kind k, const Polynomial& l, const Polynomial& r); + + /** Returns true if the comparison is a boolean constant. */ + bool isBoolean() const; + + /** + * Returns true if the comparison is either a boolean term, + * in integer normal form or mixed normal form. + */ + bool isNormalForm() const; + +private: + bool isNormalGT() const; + bool isNormalGEQ() const; + + bool isNormalLT() const; + bool isNormalLEQ() const; + + bool isNormalEquality() const; + bool isNormalDistinct() const; + bool isNormalEqualityOrDisequality() const; + + bool allIntegralVariables() const { + return getLeft().allIntegralVariables() && getRight().allIntegralVariables(); } + bool rightIsConstant() const; -};/* class SumPair */ +public: + Polynomial getLeft() const; + Polynomial getRight() const; + + /* /\** Normal form check if at least one variable is real. *\/ */ + /* bool isMixedCompareNormalForm() const; */ + + /* /\** Normal form check if at least one variable is real. *\/ */ + /* bool isMixedEqualsNormalForm() const; */ + + /* /\** Normal form check is all variables are integer.*\/ */ + /* bool isIntegerCompareNormalForm() const; */ + + /* /\** Normal form check is all variables are integer.*\/ */ + /* bool isIntegerEqualsNormalForm() const; */ + + + /** + * Returns true if all of the variables are integers, the coefficients are integers, + * and the right hand coefficient is an integer. + */ + bool debugIsIntegral() const; + + static Comparison parseNormalForm(TNode n); + + inline static bool isNormalAtom(TNode n){ + Comparison parse = Comparison::parseNormalForm(n); + return parse.isNormalForm(); + } + + SumPair toSumPair() const; + + Polynomial normalizedVariablePart() const; + DeltaRational normalizedDeltaRational() const; + +};/* class Comparison */ }/* CVC4::theory::arith namespace */ }/* CVC4::theory namespace */ diff --git a/src/theory/arith/ordered_set.h b/src/theory/arith/ordered_set.h deleted file mode 100644 index 8887daa8d..000000000 --- a/src/theory/arith/ordered_set.h +++ /dev/null @@ -1,116 +0,0 @@ -/********************* */ -/*! \file ordered_set.h - ** \verbatim - ** Original author: taking - ** Major contributors: none - ** Minor contributors (to current version): none - ** This file is part of the CVC4 prototype. - ** Copyright (c) 2009, 2010, 2011 The Analysis of Computer Systems Group (ACSys) - ** Courant Institute of Mathematical Sciences - ** New York University - ** See the file COPYING in the top-level source directory for licensing - ** information.\endverbatim - ** - ** \brief [[ Add one-line brief description here ]] - ** - ** [[ Add lengthier description here ]] - ** \todo document this file - **/ - -#include "cvc4_private.h" - -#ifndef __CVC4__THEORY__ARITH__ORDERED_SET_H -#define __CVC4__THEORY__ARITH__ORDERED_SET_H - -#include -#include -#include "expr/kind.h" -#include "expr/node.h" -#include "util/Assert.h" -#include "theory/arith/arith_utilities.h" - - -namespace CVC4 { -namespace theory { -namespace arith { - -inline const Rational& rightHandRational(TNode ineq){ - Assert(ineq.getKind() == kind::LEQ - || ineq.getKind() == kind::GEQ - || ineq.getKind() == kind::EQUAL); - TNode righthand = ineq[1]; - Assert(righthand.getKind() == kind::CONST_RATIONAL); - return righthand.getConst(); -} - -class BoundValueEntry { -private: - const Rational& value; - TNode d_leq, d_geq; - - BoundValueEntry(const Rational& v, TNode l, TNode g): - value(v), - d_leq(l), - d_geq(g) - {} - -public: - Node getLeq() const{ - Assert(hasLeq()); - return d_leq; - } - Node getGeq() const{ - Assert(hasGeq()); - return d_geq; - } - - static BoundValueEntry mkFromLeq(TNode leq){ - Assert(leq.getKind() == kind::LEQ); - return BoundValueEntry(rightHandRational(leq), leq, TNode::null()); - } - - static BoundValueEntry mkFromGeq(TNode geq){ - Assert(geq.getKind() == kind::GEQ); - return BoundValueEntry(rightHandRational(geq), TNode::null(), geq); - } - - void addLeq(TNode leq){ - Assert(leq.getKind() == kind::LEQ); - Assert(rightHandRational(leq) == getValue()); - // [MGD] With context-dependent pre-registration, we could get the - // same one twice - Assert(!hasLeq() || d_leq == leq); - d_leq = leq; - } - - void addGeq(TNode geq){ - Assert(geq.getKind() == kind::GEQ); - Assert(rightHandRational(geq) == getValue()); - // [MGD] With context-dependent pre-registration, we could get the - // same one twice - Assert(!hasGeq() || d_geq == geq); - d_geq = geq; - } - - bool hasGeq() const { return d_geq != TNode::null(); } - bool hasLeq() const { return d_leq != TNode::null(); } - - - const Rational& getValue() const{ - return value; - } - - bool operator<(const BoundValueEntry& other){ - return value < other.value; - } -}; - -typedef std::map BoundValueSet; - -typedef std::set EqualValueSet; - -}/* CVC4::theory::arith namespace */ -}/* CVC4::theory namespace */ -}/* CVC4 namespace */ - -#endif /* __CVC4__THEORY__ARITH__ORDERED_SET_H */ diff --git a/src/theory/arith/partial_model.cpp b/src/theory/arith/partial_model.cpp index 65b0083d9..32c9f6adc 100644 --- a/src/theory/arith/partial_model.cpp +++ b/src/theory/arith/partial_model.cpp @@ -20,6 +20,7 @@ #include "theory/arith/partial_model.h" #include "util/output.h" +#include "theory/arith/constraint.h" using namespace std; @@ -27,62 +28,26 @@ namespace CVC4 { namespace theory { namespace arith { - - -bool ArithPartialModel::boundsAreEqual(ArithVar x){ +ArithPartialModel::ArithPartialModel(context::Context* c) + : d_mapSize(0), + d_hasSafeAssignment(), + d_assignment(), + d_safeAssignment(), + d_ubc(c), + d_lbc(c), + d_deltaIsSafe(false), + d_delta(-1,1), + d_history() +{ } + +bool ArithPartialModel::boundsAreEqual(ArithVar x) const{ if(hasLowerBound(x) && hasUpperBound(x)){ - return d_upperBound[x] == d_lowerBound[x]; + return getUpperBound(x) == getLowerBound(x); }else{ return false; } } -void ArithPartialModel::zeroDifferenceDetected(ArithVar x){ - Assert(d_dm.isDifferenceSlack(x)); - Assert(upperBoundIsZero(x)); - Assert(lowerBoundIsZero(x)); - - Node lb = getLowerConstraint(x); - Node ub = getUpperConstraint(x); - Node reason = lb != ub ? lb.andNode(ub) : lb; - d_dm.differenceIsZero(x, reason); -} - -void ArithPartialModel::setUpperBound(ArithVar x, const DeltaRational& r){ - d_deltaIsSafe = false; - - Debug("partial_model") << "setUpperBound(" << x << "," << r << ")" << endl; - d_hasHadABound[x] = true; - d_upperBound.set(x,r); - - if(d_dm.isDifferenceSlack(x)){ - int sgn = r.sgn(); - if(sgn < 0){ - d_dm.differenceCannotBeZero(x, getUpperConstraint(x)); - }else if(sgn == 0 && lowerBoundIsZero(x)){ - zeroDifferenceDetected(x); - } - } -} - -void ArithPartialModel::setLowerBound(ArithVar x, const DeltaRational& r){ - d_deltaIsSafe = false; - - Debug("partial_model") << "setLowerBound(" << x << "," << r << ")" << endl; - d_hasHadABound[x] = true; - d_lowerBound.set(x,r); - - - if(d_dm.isDifferenceSlack(x)){ - int sgn = r.sgn(); - if(sgn > 0){ - d_dm.differenceCannotBeZero(x, getLowerConstraint(x)); - }else if(sgn == 0 && upperBoundIsZero(x)){ - zeroDifferenceDetected(x); - } - } -} - void ArithPartialModel::setAssignment(ArithVar x, const DeltaRational& r){ Debug("partial_model") << "pm: updating the assignment to" << x << " now " << r <getValue(); } -const DeltaRational& ArithPartialModel::getLowerBound(ArithVar x) { +const DeltaRational& ArithPartialModel::getLowerBound(ArithVar x) const { Assert(inMaps(x)); Assert(hasLowerBound(x)); - return d_lowerBound[x]; + return getLowerBoundConstraint(x)->getValue(); } const DeltaRational& ArithPartialModel::getSafeAssignment(ArithVar x) const{ @@ -182,144 +139,93 @@ const DeltaRational& ArithPartialModel::getAssignment(ArithVar x) const{ } - -void ArithPartialModel::setLowerConstraint(ArithVar x, TNode constraint){ - Debug("partial_model") << "setLowerConstraint(" - << x << ":" << constraint << ")" << endl; +void ArithPartialModel::setLowerBoundConstraint(Constraint c){ + AssertArgument(c != NullConstraint, "Cannot set a lower bound to NullConstraint."); + AssertArgument(c->isEquality() || c->isLowerBound(), + "Constraint type must be set to an equality or UpperBound."); + ArithVar x = c->getVariable(); + Debug("partial_model") << "setLowerBoundConstraint(" << x << ":" << c << ")" << endl; Assert(inMaps(x)); - d_lowerConstraint.set(x,constraint); + Assert(greaterThanLowerBound(x, c->getValue())); + d_lbc.set(x, c); } -void ArithPartialModel::setUpperConstraint(ArithVar x, TNode constraint){ - Debug("partial_model") << "setUpperConstraint(" - << x << ":" << constraint << ")" << endl; - Assert(inMaps(x)); - d_upperConstraint.set(x, constraint); -} +void ArithPartialModel::setUpperBoundConstraint(Constraint c){ + AssertArgument(c != NullConstraint, "Cannot set a upper bound to NullConstraint."); + AssertArgument(c->isEquality() || c->isUpperBound(), + "Constraint type must be set to an equality or UpperBound."); -TNode ArithPartialModel::getLowerConstraint(ArithVar x){ + ArithVar x = c->getVariable(); + Debug("partial_model") << "setUpperBoundConstraint(" << x << ":" << c << ")" << endl; Assert(inMaps(x)); - Assert(hasLowerBound(x)); - return d_lowerConstraint[x]; -} + Assert(lessThanUpperBound(x, c->getValue())); -TNode ArithPartialModel::getUpperConstraint(ArithVar x){ - Assert(inMaps(x)); - Assert(hasUpperBound(x)); - return d_upperConstraint[x]; + d_ubc.set(x, c); } -int ArithPartialModel::cmpToLowerBound(ArithVar x, const DeltaRational& c){ +int ArithPartialModel::cmpToLowerBound(ArithVar x, const DeltaRational& c) const{ if(!hasLowerBound(x)){ // l = -\intfy // ? c < -\infty |- _|_ return 1; }else{ - return c.cmp(d_lowerBound[x]); + return c.cmp(getLowerBound(x)); } } -int ArithPartialModel::cmpToUpperBound(ArithVar x, const DeltaRational& c){ +int ArithPartialModel::cmpToUpperBound(ArithVar x, const DeltaRational& c) const{ if(!hasUpperBound(x)){ //u = \intfy // ? c > \infty |- _|_ return -1; }else{ - return c.cmp(d_upperBound[x]); + return c.cmp(getUpperBound(x)); } } -// bool ArithPartialModel::belowLowerBound(ArithVar x, const DeltaRational& c, bool strict){ -// if(!hasLowerBound(x)){ -// // l = -\intfy -// // ? c < -\infty |- _|_ -// return false; -// } -// if(strict){ -// return c < d_lowerBound[x]; -// }else{ -// return c <= d_lowerBound[x]; -// } -// } - -// bool ArithPartialModel::aboveUpperBound(ArithVar x, const DeltaRational& c, bool strict){ -// if(!hasUpperBound(x)){ -// // u = \intfy -// // ? c > \infty |- _|_ -// return false; -// } -// if(strict){ -// return c > d_upperBound[x]; -// }else{ -// return c >= d_upperBound[x]; -// } -// } - bool ArithPartialModel::equalsLowerBound(ArithVar x, const DeltaRational& c){ if(!hasLowerBound(x)){ return false; }else{ - return c == d_lowerBound[x]; + return c == getLowerBound(x); } } bool ArithPartialModel::equalsUpperBound(ArithVar x, const DeltaRational& c){ if(!hasUpperBound(x)){ return false; }else{ - return c == d_upperBound[x]; + return c == getUpperBound(x); } } -bool ArithPartialModel::hasEitherBound(ArithVar x){ +bool ArithPartialModel::hasEitherBound(ArithVar x) const{ return hasLowerBound(x) || hasUpperBound(x); } -bool ArithPartialModel::strictlyBelowUpperBound(ArithVar x){ +bool ArithPartialModel::strictlyBelowUpperBound(ArithVar x) const{ Assert(inMaps(x)); if(!hasUpperBound(x)){ // u = \infty return true; + }else{ + return d_assignment[x] < getUpperBound(x); } - return d_assignment[x] < d_upperBound[x]; } -bool ArithPartialModel::strictlyAboveLowerBound(ArithVar x){ +bool ArithPartialModel::strictlyAboveLowerBound(ArithVar x) const{ Assert(inMaps(x)); if(!hasLowerBound(x)){ // l = -\infty return true; + }else{ + return getLowerBound(x) < d_assignment[x]; } - return d_lowerBound[x] < d_assignment[x]; } -// /** -// * x <= u -// * ? c < u -// */ -// bool ArithPartialModel::strictlyBelowUpperBound(ArithVar x, const DeltaRational& c){ -// Assert(inMaps(x)); -// if(!hasUpperBound(x)){ // u = \infty -// return true; -// } -// return c < d_upperBound[x]; -// } - -// /** -// * x <= u -// * ? c < u -// */ -// bool ArithPartialModel::strictlyAboveLowerBound(ArithVar x, const DeltaRational& c){ -// Assert(inMaps(x)); -// if(!hasLowerBound(x)){ // l = -\infty -// return true; -// } -// return d_lowerBound[x] < c; -// } - -bool ArithPartialModel::assignmentIsConsistent(ArithVar x){ +bool ArithPartialModel::assignmentIsConsistent(ArithVar x) const{ const DeltaRational& beta = getAssignment(x); //l_i <= beta(x_i) <= u_i - return cmpToLowerBound(x,beta) >= 0 && cmpToUpperBound(x,beta) <= 0; + return greaterThanLowerBound(x,beta) && lessThanUpperBound(x,beta); } @@ -355,13 +261,13 @@ void ArithPartialModel::printModel(ArithVar x){ Debug("model") << "no lb "; }else{ Debug("model") << getLowerBound(x) << " "; - Debug("model") << getLowerConstraint(x) << " "; + Debug("model") << getLowerBoundConstraint(x) << " "; } if(!hasUpperBound(x)){ Debug("model") << "no ub "; }else{ Debug("model") << getUpperBound(x) << " "; - Debug("model") << getUpperConstraint(x) << " "; + Debug("model") << getUpperBoundConstraint(x) << " "; } } diff --git a/src/theory/arith/partial_model.h b/src/theory/arith/partial_model.h index 7e2211595..fc8423e36 100644 --- a/src/theory/arith/partial_model.h +++ b/src/theory/arith/partial_model.h @@ -19,16 +19,18 @@ #include "cvc4_private.h" +#include "expr/node.h" + #include "context/context.h" #include "context/cdvector.h" +#include "context/cdo.h" + #include "theory/arith/arithvar.h" #include "theory/arith/delta_rational.h" -#include "expr/attribute.h" -#include "expr/node.h" +#include "theory/arith/constraint_forward.h" -#include "theory/arith/difference_manager.h" -#include +#include #ifndef __CVC4__THEORY__ARITH__PARTIAL_MODEL_H #define __CVC4__THEORY__ARITH__PARTIAL_MODEL_H @@ -41,19 +43,14 @@ class ArithPartialModel { private: unsigned d_mapSize; - //Maps from ArithVar -> T - - std::vector d_hasHadABound; + //Maps from ArithVar -> T std::vector d_hasSafeAssignment; std::vector d_assignment; std::vector d_safeAssignment; - context::CDVector d_upperBound; - context::CDVector d_lowerBound; - context::CDVector d_upperConstraint; - context::CDVector d_lowerConstraint; - + context::CDVector d_ubc; + context::CDVector d_lbc; bool d_deltaIsSafe; Rational d_delta; @@ -64,30 +61,20 @@ private: typedef std::vector HistoryList; HistoryList d_history; - DifferenceManager& d_dm; public: - ArithPartialModel(context::Context* c, DifferenceManager& dm): - d_mapSize(0), - d_hasHadABound(), - d_hasSafeAssignment(), - d_assignment(), - d_safeAssignment(), - d_upperBound(c), - d_lowerBound(c), - d_upperConstraint(c), - d_lowerConstraint(c), - d_deltaIsSafe(false), - d_delta(-1,1), - d_history(), - d_dm(dm) - { } - - void setLowerConstraint(ArithVar x, TNode constraint); - void setUpperConstraint(ArithVar x, TNode constraint); - TNode getLowerConstraint(ArithVar x); - TNode getUpperConstraint(ArithVar x); + ArithPartialModel(context::Context* c); + + void setLowerBoundConstraint(Constraint lb); + void setUpperBoundConstraint(Constraint ub); + + inline Constraint getUpperBoundConstraint(ArithVar x) const{ + return d_ubc[x]; + } + inline Constraint getLowerBoundConstraint(ArithVar x) const{ + return d_lbc[x]; + } /* Initializes a variable to a safe value.*/ @@ -112,14 +99,7 @@ public: return hasUpperBound(x) && getUpperBound(x).sgn() == 0; } -private: - void zeroDifferenceDetected(ArithVar x); - -public: - bool boundsAreEqual(ArithVar x); - - void setUpperBound(ArithVar x, const DeltaRational& r); - void setLowerBound(ArithVar x, const DeltaRational& r); + bool boundsAreEqual(ArithVar x) const; /* Sets an unsafe variable assignment */ void setAssignment(ArithVar x, const DeltaRational& r); @@ -127,8 +107,8 @@ public: /** Must know that the bound exists before calling this! */ - const DeltaRational& getUpperBound(ArithVar x); - const DeltaRational& getLowerBound(ArithVar x); + const DeltaRational& getUpperBound(ArithVar x) const; + const DeltaRational& getLowerBound(ArithVar x) const; const DeltaRational& getAssignment(ArithVar x) const; @@ -141,61 +121,60 @@ public: * If lowerbound = - \infty: * return 1 */ - int cmpToLowerBound(ArithVar x, const DeltaRational& c); + int cmpToLowerBound(ArithVar x, const DeltaRational& c) const; - inline bool strictlyLessThanLowerBound(ArithVar x, const DeltaRational& c){ + inline bool strictlyLessThanLowerBound(ArithVar x, const DeltaRational& c) const{ return cmpToLowerBound(x, c) < 0; } - inline bool lessThanLowerBound(ArithVar x, const DeltaRational& c){ + inline bool lessThanLowerBound(ArithVar x, const DeltaRational& c) const{ return cmpToLowerBound(x, c) <= 0; } - inline bool strictlyGreaterThanLowerBound(ArithVar x, const DeltaRational& c){ + inline bool strictlyGreaterThanLowerBound(ArithVar x, const DeltaRational& c) const{ return cmpToLowerBound(x, c) > 0; } + inline bool greaterThanLowerBound(ArithVar x, const DeltaRational& c) const{ + return cmpToLowerBound(x, c) >= 0; + } /** * If upperbound < \infty: * return getAssignment(x).cmp(getUpperBound(x)) * If upperbound = \infty: * return -1 */ - int cmpToUpperBound(ArithVar x, const DeltaRational& c); + int cmpToUpperBound(ArithVar x, const DeltaRational& c) const; - inline bool strictlyLessThanUpperBound(ArithVar x, const DeltaRational& c){ + inline bool strictlyLessThanUpperBound(ArithVar x, const DeltaRational& c) const{ return cmpToUpperBound(x, c) < 0; } - inline bool lessThanUpperBound(ArithVar x, const DeltaRational& c){ + inline bool lessThanUpperBound(ArithVar x, const DeltaRational& c) const{ return cmpToUpperBound(x, c) <= 0; } - inline bool strictlyGreaterThanUpperBound(ArithVar x, const DeltaRational& c){ + inline bool strictlyGreaterThanUpperBound(ArithVar x, const DeltaRational& c) const{ return cmpToUpperBound(x, c) > 0; } - inline bool greaterThanUpperBound(ArithVar x, const DeltaRational& c){ + inline bool greaterThanUpperBound(ArithVar x, const DeltaRational& c) const{ return cmpToUpperBound(x, c) >= 0; } - bool strictlyBelowUpperBound(ArithVar x); - bool strictlyAboveLowerBound(ArithVar x); - bool assignmentIsConsistent(ArithVar x); + bool strictlyBelowUpperBound(ArithVar x) const; + bool strictlyAboveLowerBound(ArithVar x) const; + bool assignmentIsConsistent(ArithVar x) const; void printModel(ArithVar x); /** returns true iff x has both a lower and upper bound. */ - bool hasEitherBound(ArithVar x); - inline bool hasLowerBound(ArithVar x){ - return !d_lowerConstraint[x].isNull(); + bool hasEitherBound(ArithVar x) const; + inline bool hasLowerBound(ArithVar x) const{ + return d_lbc[x] != NullConstraint; } - inline bool hasUpperBound(ArithVar x){ - return !d_upperConstraint[x].isNull(); - } - - bool hasEverHadABound(ArithVar var){ - return d_hasHadABound[var]; + inline bool hasUpperBound(ArithVar x) const{ + return d_ubc[x] != NullConstraint; } const Rational& getDelta(){ diff --git a/src/theory/arith/simplex.cpp b/src/theory/arith/simplex.cpp index 7fce748dc..5837d4793 100644 --- a/src/theory/arith/simplex.cpp +++ b/src/theory/arith/simplex.cpp @@ -33,15 +33,13 @@ static const uint32_t NUM_CHECKS = 10; static const bool CHECK_AFTER_PIVOT = true; static const uint32_t VARORDER_CHECK_PERIOD = 200; -SimplexDecisionProcedure::SimplexDecisionProcedure(ArithPropManager& propManager, - LinearEqualityModule& linEq) : +SimplexDecisionProcedure::SimplexDecisionProcedure(LinearEqualityModule& linEq, NodeCallBack& conflictChannel) : d_linEq(linEq), d_partialModel(d_linEq.getPartialModel()), d_tableau(d_linEq.getTableau()), d_queue(d_partialModel, d_tableau), - d_propManager(propManager), d_numVariables(0), - d_delayedLemmas(), + d_conflictChannel(conflictChannel), d_pivotsInRound(), d_DELTA_ZERO(0,0) { @@ -77,7 +75,7 @@ SimplexDecisionProcedure::Statistics::Statistics(): d_weakeningSuccesses("theory::arith::weakening::success",0), d_weakenings("theory::arith::weakening::total",0), d_weakenTime("theory::arith::weakening::time"), - d_delayedConflicts("theory::arith::delayedConflicts",0) + d_simplexConflicts("theory::arith::simplexConflicts",0) { StatisticsRegistry::registerStat(&d_statUpdateConflicts); @@ -99,7 +97,7 @@ SimplexDecisionProcedure::Statistics::Statistics(): StatisticsRegistry::registerStat(&d_weakenings); StatisticsRegistry::registerStat(&d_weakenTime); - StatisticsRegistry::registerStat(&d_delayedConflicts); + StatisticsRegistry::registerStat(&d_simplexConflicts); } SimplexDecisionProcedure::Statistics::~Statistics(){ @@ -123,7 +121,7 @@ SimplexDecisionProcedure::Statistics::~Statistics(){ StatisticsRegistry::unregisterStat(&d_weakenings); StatisticsRegistry::unregisterStat(&d_weakenTime); - StatisticsRegistry::unregisterStat(&d_delayedConflicts); + StatisticsRegistry::unregisterStat(&d_simplexConflicts); } @@ -203,7 +201,7 @@ Node betterConflict(TNode x, TNode y){ else return y; } -Node SimplexDecisionProcedure::findConflictOnTheQueue(SearchPeriod type, bool returnFirst) { +bool SimplexDecisionProcedure::findConflictOnTheQueue(SearchPeriod type) { TimerStat::CodeTimer codeTimer(d_statistics.d_findConflictOnTheQueueTime); switch(type){ @@ -215,7 +213,6 @@ Node SimplexDecisionProcedure::findConflictOnTheQueue(SearchPeriod type, bool re } bool success = false; - Node firstConflict = Node::null(); ArithPriorityQueue::const_iterator i = d_queue.begin(); ArithPriorityQueue::const_iterator end = d_queue.end(); for(; i != end; ++i){ @@ -225,11 +222,7 @@ Node SimplexDecisionProcedure::findConflictOnTheQueue(SearchPeriod type, bool re Node possibleConflict = checkBasicForConflict(x_i); if(!possibleConflict.isNull()){ success = true; - if(returnFirst && firstConflict.isNull()){ - firstConflict = possibleConflict; - }else{ - delayConflictAsLemma(possibleConflict); - } + reportConflict(possibleConflict); } } } @@ -242,13 +235,14 @@ Node SimplexDecisionProcedure::findConflictOnTheQueue(SearchPeriod type, bool re case AfterVarOrderSearch: ++(d_statistics.d_successAfterVarOrderSearch); break; } } - return firstConflict; + return success; } -Node SimplexDecisionProcedure::findModel(){ +bool SimplexDecisionProcedure::findModel(){ if(d_queue.empty()){ - return Node::null(); + return false; } + bool foundConflict = false; static CVC4_THREADLOCAL(unsigned int) instance = 0; instance = instance + 1; @@ -256,45 +250,44 @@ Node SimplexDecisionProcedure::findModel(){ d_queue.transitionToDifferenceMode(); - Node possibleConflict = Node::null(); if(d_queue.size() > 1){ - possibleConflict = findConflictOnTheQueue(BeforeDiffSearch); + foundConflict = findConflictOnTheQueue(BeforeDiffSearch); } - if(possibleConflict.isNull()){ + if(!foundConflict){ uint32_t numHueristicPivots = d_numVariables + 1; uint32_t pivotsRemaining = numHueristicPivots; uint32_t pivotsPerCheck = (numHueristicPivots/NUM_CHECKS) + (NUM_CHECKS-1); while(!d_queue.empty() && - possibleConflict.isNull() && + !foundConflict && pivotsRemaining > 0){ uint32_t pivotsToDo = min(pivotsPerCheck, pivotsRemaining); - possibleConflict = searchForFeasibleSolution(pivotsToDo); + foundConflict = searchForFeasibleSolution(pivotsToDo); pivotsRemaining -= pivotsToDo; //Once every CHECK_PERIOD examine the entire queue for conflicts - if(possibleConflict.isNull()){ - possibleConflict = findConflictOnTheQueue(DuringDiffSearch); + if(!foundConflict){ + foundConflict = findConflictOnTheQueue(DuringDiffSearch); }else{ - findConflictOnTheQueue(AfterDiffSearch, false); + findConflictOnTheQueue(AfterDiffSearch); } } } - if(!d_queue.empty() && possibleConflict.isNull()){ + if(!d_queue.empty() && !foundConflict){ d_queue.transitionToVariableOrderMode(); - while(!d_queue.empty() && possibleConflict.isNull()){ - possibleConflict = searchForFeasibleSolution(VARORDER_CHECK_PERIOD); + while(!d_queue.empty() && !foundConflict){ + foundConflict = searchForFeasibleSolution(VARORDER_CHECK_PERIOD); //Once every CHECK_PERIOD examine the entire queue for conflicts - if(possibleConflict.isNull()){ - possibleConflict = findConflictOnTheQueue(DuringVarOrderSearch); - }else{ - findConflictOnTheQueue(AfterVarOrderSearch, false); + if(!foundConflict){ + foundConflict = findConflictOnTheQueue(DuringVarOrderSearch); + } else{ + findConflictOnTheQueue(AfterVarOrderSearch); } } } - Assert(!possibleConflict.isNull() || d_queue.empty()); + Assert(foundConflict || d_queue.empty()); // Curiously the invariant that we always do a full check // means that the assignment we can always empty these queues. @@ -309,7 +302,7 @@ Node SimplexDecisionProcedure::findModel(){ Debug("arith::findModel") << "end findModel() " << instance << endl; - return possibleConflict; + return foundConflict; } Node SimplexDecisionProcedure::checkBasicForConflict(ArithVar basic){ @@ -333,7 +326,7 @@ Node SimplexDecisionProcedure::checkBasicForConflict(ArithVar basic){ //corresponds to Check() in dM06 //template -Node SimplexDecisionProcedure::searchForFeasibleSolution(uint32_t remainingIterations){ +bool SimplexDecisionProcedure::searchForFeasibleSolution(uint32_t remainingIterations){ Debug("arith") << "searchForFeasibleSolution" << endl; Assert(remainingIterations > 0); @@ -344,7 +337,7 @@ Node SimplexDecisionProcedure::searchForFeasibleSolution(uint32_t remainingItera Debug("arith::update::select") << "selectSmallestInconsistentVar()=" << x_i << endl; if(x_i == ARITHVAR_SENTINEL){ Debug("arith_update") << "No inconsistent variables" << endl; - return Node::null(); //sat + return false; //sat } --remainingIterations; @@ -369,7 +362,9 @@ Node SimplexDecisionProcedure::searchForFeasibleSolution(uint32_t remainingItera x_j = selectSlackUpperBound(x_i, pf); if(x_j == ARITHVAR_SENTINEL ){ ++(d_statistics.d_statUpdateConflicts); - return generateConflictBelowLowerBound(x_i); //unsat + Node conflict = generateConflictBelowLowerBound(x_i); //unsat + reportConflict(conflict); + return true; } DeltaRational l_i = d_partialModel.getLowerBound(x_i); d_linEq.pivotAndUpdate(x_i, x_j, l_i); @@ -378,7 +373,9 @@ Node SimplexDecisionProcedure::searchForFeasibleSolution(uint32_t remainingItera x_j = selectSlackLowerBound(x_i, pf); if(x_j == ARITHVAR_SENTINEL ){ ++(d_statistics.d_statUpdateConflicts); - return generateConflictAboveUpperBound(x_i); //unsat + Node conflict = generateConflictAboveUpperBound(x_i); //unsat + reportConflict(conflict); + return true; } DeltaRational u_i = d_partialModel.getUpperBound(x_i); d_linEq.pivotAndUpdate(x_i, x_j, u_i); @@ -389,38 +386,50 @@ Node SimplexDecisionProcedure::searchForFeasibleSolution(uint32_t remainingItera if(CHECK_AFTER_PIVOT){ Node possibleConflict = checkBasicForConflict(x_j); if(!possibleConflict.isNull()){ - return possibleConflict; + reportConflict(possibleConflict); + return true; // unsat } } } Assert(remainingIterations == 0); - return Node::null(); + return false; } -TNode SimplexDecisionProcedure::weakestExplanation(bool aboveUpper, DeltaRational& surplus, ArithVar v, const Rational& coeff, bool& anyWeakening, ArithVar basic){ +Constraint SimplexDecisionProcedure::weakestExplanation(bool aboveUpper, DeltaRational& surplus, ArithVar v, const Rational& coeff, bool& anyWeakening, ArithVar basic){ int sgn = coeff.sgn(); bool ub = aboveUpper?(sgn < 0) : (sgn > 0); - TNode exp = ub ? - d_partialModel.getUpperConstraint(v) : - d_partialModel.getLowerConstraint(v); - DeltaRational bound = ub? - d_partialModel.getUpperBound(v) : - d_partialModel.getLowerBound(v); + + Constraint c = ub ? + d_partialModel.getUpperBoundConstraint(v) : + d_partialModel.getLowerBoundConstraint(v); + +// #warning "revisit" +// Node exp = ub ? +// d_partialModel.explainUpperBound(v) : +// d_partialModel.explainLowerBound(v); bool weakened; do{ + const DeltaRational& bound = c->getValue(); + weakened = false; - Node weaker = ub? - d_propManager.strictlyWeakerAssertedUpperBound(v, bound): - d_propManager.strictlyWeakerAssertedLowerBound(v, bound); + Constraint weaker = ub? + c->getStrictlyWeakerUpperBound(true, true): + c->getStrictlyWeakerLowerBound(true, true); + + // Node weaker = ub? + // d_propManager.strictlyWeakerAssertedUpperBound(v, bound): + // d_propManager.strictlyWeakerAssertedLowerBound(v, bound); - if(!weaker.isNull()){ - DeltaRational weakerBound = asDeltaRational(weaker); + if(weaker != NullConstraint){ + //if(!weaker.isNull()){ + const DeltaRational& weakerBound = weaker->getValue(); + //DeltaRational weakerBound = asDeltaRational(weaker); DeltaRational diff = aboveUpper ? bound - weakerBound : weakerBound - bound; //if var == basic, @@ -438,24 +447,16 @@ TNode SimplexDecisionProcedure::weakestExplanation(bool aboveUpper, DeltaRationa Debug("weak") << " basic: "; } Debug("weak") << " " << surplus << " "<< diff << endl - << " " << bound << exp << endl + << " " << bound << c << endl << " " << weakerBound << weaker << endl; - if(exp.getKind() == AND){ - Debug("weak") << "VICTORY" << endl; - } - Assert(diff > d_DELTA_ZERO); - exp = weaker; - bound = weakerBound; + c = weaker; } } }while(weakened); - if(exp.getKind() == AND){ - Debug("weak") << "boo: " << exp << endl; - } - return exp; + return c; } Node SimplexDecisionProcedure::weakenConflict(bool aboveUpper, ArithVar basicVar){ @@ -479,7 +480,15 @@ Node SimplexDecisionProcedure::weakenConflict(bool aboveUpper, ArithVar basicVar const TableauEntry& entry = *i; ArithVar v = entry.getColVar(); const Rational& coeff = entry.getCoefficient(); - conflict << weakestExplanation(aboveUpper, surplus, v, coeff, anyWeakenings, basicVar); + bool weakening = false; + Constraint c = weakestExplanation(aboveUpper, surplus, v, coeff, weakening, basicVar); + Debug("weak") << "weak : " << weakening << " " << c->assertedToTheTheory() + << c << endl + << c->explainForConflict() << endl; + anyWeakenings = anyWeakenings || weakening; + + Debug("weak") << "weak : " << c->explainForConflict() << endl; + c->explainForConflict(conflict); } ++d_statistics.d_weakeningAttempts; if(anyWeakenings){ diff --git a/src/theory/arith/simplex.h b/src/theory/arith/simplex.h index 39c0bc20b..4e5ba3d9e 100644 --- a/src/theory/arith/simplex.h +++ b/src/theory/arith/simplex.h @@ -56,11 +56,11 @@ #include "theory/arith/delta_rational.h" #include "theory/arith/tableau.h" #include "theory/arith/partial_model.h" -#include "theory/arith/arith_prop_manager.h" #include "theory/arith/linear_equality.h" -#include "util/options.h" +#include "context/cdlist.h" +#include "util/options.h" #include "util/stats.h" #include @@ -91,13 +91,11 @@ private: /** Contains a superset of the basic variables in violation of their bounds. */ ArithPriorityQueue d_queue; - /** A link to the propagation manager. This is used to generate weaker conflicts. */ - ArithPropManager& d_propManager; - /** Number of variables in the system. This is used for tuning heuristics. */ ArithVar d_numVariables; - std::queue d_delayedLemmas; + /** This is the call back channel for Simplex to report conflicts. */ + NodeCallBack& d_conflictChannel; /** Maps a variable to how many times they have been used as a pivot in the simplex search. */ ArithVarMultiset d_pivotsInRound; @@ -106,8 +104,7 @@ private: DeltaRational d_DELTA_ZERO; public: - SimplexDecisionProcedure(ArithPropManager& propManager, - LinearEqualityModule& linEq); + SimplexDecisionProcedure(LinearEqualityModule& linEq, NodeCallBack& conflictChannel); /** * This must be called when the value of a basic variable may now voilate one @@ -123,14 +120,15 @@ public: * This is done by a simplex search through the possible bases of the tableau. * * If all of the variables can be made consistent with their bounds - * Node::null() is returned. Otherwise a minimized conflict is returned. + * false is returned. Otherwise true is returned, and at least 1 conflict + * was reported on the conflictCallback passed to the Module. * * Tableau pivoting is performed so variables may switch from being basic to * nonbasic and vice versa. * * Corresponds to the "check()" procedure in [Cav06]. */ - Node findModel(); + bool findModel(); private: @@ -158,6 +156,7 @@ private: * during the VarOrder stage of findModel. */ static ArithVar minColLength(const SimplexDecisionProcedure& simp, ArithVar x, ArithVar y); + /** * minBoundAndRowCount is a PreferenceFunction for preferring a variable * without an asserted bound over variables with an asserted bound. @@ -173,11 +172,11 @@ private: private: - Node searchForFeasibleSolution(uint32_t maxIterations); + bool searchForFeasibleSolution(uint32_t maxIterations); enum SearchPeriod {BeforeDiffSearch, DuringDiffSearch, AfterDiffSearch, DuringVarOrderSearch, AfterVarOrderSearch}; - Node findConflictOnTheQueue(SearchPeriod period, bool returnFirst = true); + bool findConflictOnTheQueue(SearchPeriod period); /** @@ -217,29 +216,12 @@ private: public: void increaseMax() {d_numVariables++;} - /** Returns true if the simplex procedure has more delayed lemmas in its queue.*/ - bool hasMoreLemmas() const { - return !d_delayedLemmas.empty(); - } - /** Returns the next delayed lemmas on the queue.*/ - Node popLemma(){ - Assert(hasMoreLemmas()); - Node lemma = d_delayedLemmas.front(); - d_delayedLemmas.pop(); - return lemma; - } - private: - /** Adds a lemma to the queue. */ - void pushLemma(Node lemma){ - d_delayedLemmas.push(lemma); - ++(d_statistics.d_delayedConflicts); - } - /** Adds a conflict as a lemma to the queue. */ - void delayConflictAsLemma(Node conflict){ - Node negatedConflict = negateConjunctionAsClause(conflict); - pushLemma(negatedConflict); + /** Reports a conflict to on the output channel. */ + void reportConflict(Node conflict){ + d_conflictChannel(conflict); + ++(d_statistics.d_simplexConflicts); } template @@ -259,7 +241,7 @@ private: Node checkBasicForConflict(ArithVar b); Node weakenConflict(bool aboveUpper, ArithVar basicVar); - TNode weakestExplanation(bool aboveUpper, DeltaRational& surplus, ArithVar v, const Rational& coeff, bool& anyWeakening, ArithVar basic); + Constraint weakestExplanation(bool aboveUpper, DeltaRational& surplus, ArithVar v, const Rational& coeff, bool& anyWeakening, ArithVar basic); @@ -280,7 +262,7 @@ private: TimerStat d_weakenTime; - IntStat d_delayedConflicts; + IntStat d_simplexConflicts; Statistics(); ~Statistics(); diff --git a/src/theory/arith/tableau.cpp b/src/theory/arith/tableau.cpp index ef3206650..567d8215e 100644 --- a/src/theory/arith/tableau.cpp +++ b/src/theory/arith/tableau.cpp @@ -78,7 +78,6 @@ void Tableau::pivot(ArithVar oldBasic, ArithVar newBasic){ Assert(!isBasic(newBasic)); Assert(mergeBufferIsEmpty()); - //cout << oldBasic << "," << newBasic << endl; Debug("tableau") << "Tableau::pivot(" << oldBasic <<", " << newBasic <<")" << endl; rowPivot(oldBasic, newBasic); diff --git a/src/theory/arith/theory_arith.cpp b/src/theory/arith/theory_arith.cpp index 3b29cbcd1..11a1a4a4a 100644 --- a/src/theory/arith/theory_arith.cpp +++ b/src/theory/arith/theory_arith.cpp @@ -23,14 +23,13 @@ #include "expr/node_builder.h" #include "theory/valuation.h" +#include "theory/rewriter.h" #include "util/rational.h" #include "util/integer.h" #include "util/boolean_simplification.h" -#include "theory/rewriter.h" - #include "theory/arith/arith_utilities.h" #include "theory/arith/delta_rational.h" #include "theory/arith/partial_model.h" @@ -38,11 +37,9 @@ #include "theory/arith/arithvar_set.h" #include "theory/arith/arith_rewriter.h" -#include "theory/arith/atom_database.h" - +#include "theory/arith/constraint.h" #include "theory/arith/theory_arith.h" #include "theory/arith/normal_form.h" -#include "theory/arith/arith_prop_manager.h" #include @@ -59,12 +56,12 @@ const uint32_t RESET_START = 2; TheoryArith::TheoryArith(context::Context* c, context::UserContext* u, OutputChannel& out, Valuation valuation) : Theory(THEORY_ARITH, c, u, out, valuation), d_hasDoneWorkSinceCut(false), - d_atomsInContext(c), d_learner(d_pbSubstitutions), + d_setupLiteralCallback(this), d_nextIntegerCheckVar(0), d_constantIntegerVariables(c), - d_diseq(c), - d_partialModel(c, d_differenceManager), + d_diseqQueue(c, false), + d_partialModel(c), d_tableau(), d_linEq(d_partialModel, d_tableau, d_basicVarModelUpdateCallBack), d_diosolver(c), @@ -73,10 +70,11 @@ TheoryArith::TheoryArith(context::Context* c, context::UserContext* u, OutputCha d_rowHasBeenAdded(false), d_tableauResetDensity(1.6), d_tableauResetPeriod(10), - d_atomDatabase(c, out), - d_propManager(c, d_arithvarNodeMap, d_atomDatabase, valuation), - d_differenceManager(c, d_propManager), - d_simplex(d_propManager, d_linEq), + d_conflicts(c), + d_conflictCallBack(d_conflicts), + d_differenceManager(c, d_constraintDatabase, d_setupLiteralCallback), + d_simplex(d_linEq, d_conflictCallBack), + d_constraintDatabase(c, u, d_arithvarNodeMap, d_differenceManager), d_basicVarModelUpdateCallBack(d_simplex), d_DELTA_ZERO(0), d_statistics() @@ -152,13 +150,34 @@ TheoryArith::Statistics::~Statistics(){ StatisticsRegistry::unregisterStat(&d_boundPropagations); } +void TheoryArith::zeroDifferenceDetected(ArithVar x){ + Assert(d_differenceManager.isDifferenceSlack(x)); + Assert(d_partialModel.upperBoundIsZero(x)); + Assert(d_partialModel.lowerBoundIsZero(x)); + + Constraint lb = d_partialModel.getLowerBoundConstraint(x); + Constraint ub = d_partialModel.getUpperBoundConstraint(x); + + if(lb->isEquality()){ + d_differenceManager.differenceIsZero(lb); + }else if(ub->isEquality()){ + d_differenceManager.differenceIsZero(ub); + }else{ + d_differenceManager.differenceIsZero(lb, ub); + } +} + /* procedure AssertLower( x_i >= c_i ) */ -Node TheoryArith::AssertLower(ArithVar x_i, DeltaRational& c_i, TNode original){ +Node TheoryArith::AssertLower(Constraint constraint){ + Assert(constraint != NullConstraint); + Assert(constraint->isLowerBound()); + + ArithVar x_i = constraint->getVariable(); + const DeltaRational& c_i = constraint->getValue(); + Debug("arith") << "AssertLower(" << x_i << " " << c_i << ")"<< std::endl; - if(isInteger(x_i)){ - c_i = DeltaRational(c_i.ceiling()); - } + Assert(!isInteger(x_i) || c_i.isIntegral()); //TODO Relax to less than? if(d_partialModel.lessThanLowerBound(x_i, c_i)){ @@ -167,9 +186,8 @@ Node TheoryArith::AssertLower(ArithVar x_i, DeltaRational& c_i, TNode original){ int cmpToUB = d_partialModel.cmpToUpperBound(x_i, c_i); if(cmpToUB > 0){ // c_i < \lowerbound(x_i) - Node ubc = d_partialModel.getUpperConstraint(x_i); - Node conflict = NodeManager::currentNM()->mkNode(AND, ubc, original); - //d_out->conflict(conflict); + Constraint ubc = d_partialModel.getUpperBoundConstraint(x_i); + Node conflict = ConstraintValue::explainConflict(ubc, constraint); Debug("arith") << "AssertLower conflict " << conflict << endl; ++(d_statistics.d_statAssertLowerConflicts); return conflict; @@ -177,22 +195,36 @@ Node TheoryArith::AssertLower(ArithVar x_i, DeltaRational& c_i, TNode original){ if(isInteger(x_i)){ d_constantIntegerVariables.push_back(x_i); } - //check to make sure x_i != c_i has not been asserted - Node left = d_arithvarNodeMap.asNode(x_i); - // if lowerbound and upperbound are equal, then the infinitesimal must be 0 - Assert(c_i.getInfinitesimalPart().isZero()); - Node right = mkRationalNode(c_i.getNoninfinitesimalPart()); - - Node diseq = left.eqNode(right).notNode(); - if (d_diseq.find(diseq) != d_diseq.end()) { - Node ub = d_partialModel.getUpperConstraint(x_i); - return disequalityConflict(diseq, ub , original); + const ValueCollection& vc = constraint->getValueCollection(); + if(vc.hasDisequality()){ + Assert(vc.hasEquality()); + const Constraint eq = vc.getEquality(); + const Constraint diseq = vc.getDisequality(); + if(diseq->isTrue()){ + const Constraint ub = vc.getUpperBound(); + Node conflict = ConstraintValue::explainConflict(diseq, ub, constraint); + + ++(d_statistics.d_statDisequalityConflicts); + Debug("eq") << " assert lower conflict " << conflict << endl; + return conflict; + }else if(!eq->isTrue()){ + Debug("eq") << "lb == ub, propagate eq" << eq << endl; + eq->impliedBy(constraint, d_partialModel.getUpperBoundConstraint(x_i)); + } } } - d_partialModel.setLowerConstraint(x_i,original); - d_partialModel.setLowerBound(x_i, c_i); + d_partialModel.setLowerBoundConstraint(constraint); + + if(d_differenceManager.isDifferenceSlack(x_i)){ + int sgn = c_i.sgn(); + if(sgn > 0){ + d_differenceManager.differenceCannotBeZero(constraint); + }else if(sgn == 0 && d_partialModel.upperBoundIsZero(x_i)){ + zeroDifferenceDetected(x_i); + } + } d_updatedBounds.softAdd(x_i); @@ -210,12 +242,18 @@ Node TheoryArith::AssertLower(ArithVar x_i, DeltaRational& c_i, TNode original){ } /* procedure AssertUpper( x_i <= c_i) */ -Node TheoryArith::AssertUpper(ArithVar x_i, DeltaRational& c_i, TNode original){ +Node TheoryArith::AssertUpper(Constraint constraint){ + ArithVar x_i = constraint->getVariable(); + const DeltaRational& c_i = constraint->getValue(); + Debug("arith") << "AssertUpper(" << x_i << " " << c_i << ")"<< std::endl; + AssertArgument(constraint != NullConstraint, + "AssertUpper() called on a NullConstraint."); + Assert(constraint->isUpperBound()); - if(isInteger(x_i)){ - c_i = DeltaRational(c_i.floor()); - } + //Too strong because of rounding with integers + //Assert(!constraint->hasLiteral() || original == constraint->getLiteral()); + Assert(!isInteger(x_i) || c_i.isIntegral()); Debug("arith") << "AssertUpper(" << x_i << " " << c_i << ")"<< std::endl; @@ -226,8 +264,8 @@ Node TheoryArith::AssertUpper(ArithVar x_i, DeltaRational& c_i, TNode original){ // cmpToLb = \lowerbound(x_i).cmp(c_i) int cmpToLB = d_partialModel.cmpToLowerBound(x_i, c_i); if( cmpToLB < 0 ){ // \upperbound(x_i) < \lowerbound(x_i) - Node lbc = d_partialModel.getLowerConstraint(x_i); - Node conflict = NodeManager::currentNM()->mkNode(AND, lbc, original); + Constraint lbc = d_partialModel.getLowerBoundConstraint(x_i); + Node conflict = ConstraintValue::explainConflict(lbc, constraint); Debug("arith") << "AssertUpper conflict " << conflict << endl; ++(d_statistics.d_statAssertUpperConflicts); return conflict; @@ -236,22 +274,34 @@ Node TheoryArith::AssertUpper(ArithVar x_i, DeltaRational& c_i, TNode original){ d_constantIntegerVariables.push_back(x_i); } - //check to make sure x_i != c_i has not been asserted - Node left = d_arithvarNodeMap.asNode(x_i); - - // if lowerbound and upperbound are equal, then the infinitesimal must be 0 - Assert(c_i.getInfinitesimalPart().isZero()); - Node right = mkRationalNode(c_i.getNoninfinitesimalPart()); - - Node diseq = left.eqNode(right).notNode(); - if (d_diseq.find(diseq) != d_diseq.end()) { - Node lb = d_partialModel.getLowerConstraint(x_i); - return disequalityConflict(diseq, lb , original); + const ValueCollection& vc = constraint->getValueCollection(); + if(vc.hasDisequality()){ + Assert(vc.hasEquality()); + const Constraint diseq = vc.getDisequality(); + const Constraint eq = vc.getEquality(); + if(diseq->isTrue()){ + const Constraint lb = vc.getLowerBound(); + Node conflict = ConstraintValue::explainConflict(diseq, lb, constraint); + Debug("eq") << " assert upper conflict " << conflict << endl; + return conflict; + }else if(!eq->isTrue()){ + Debug("eq") << "lb == ub, propagate eq" << eq << endl; + eq->impliedBy(constraint, d_partialModel.getLowerBoundConstraint(x_i)); + } } + } - d_partialModel.setUpperConstraint(x_i,original); - d_partialModel.setUpperBound(x_i, c_i); + d_partialModel.setUpperBoundConstraint(constraint); + + if(d_differenceManager.isDifferenceSlack(x_i)){ + int sgn = c_i.sgn(); + if(sgn < 0){ + d_differenceManager.differenceCannotBeZero(constraint); + }else if(sgn == 0 && d_partialModel.lowerBoundIsZero(x_i)){ + zeroDifferenceDetected(x_i); + } + } d_updatedBounds.softAdd(x_i); @@ -269,11 +319,19 @@ Node TheoryArith::AssertUpper(ArithVar x_i, DeltaRational& c_i, TNode original){ } -/* procedure AssertLower( x_i == c_i ) */ -Node TheoryArith::AssertEquality(ArithVar x_i, DeltaRational& c_i, TNode original){ +/* procedure AssertEquality( x_i == c_i ) */ +Node TheoryArith::AssertEquality(Constraint constraint){ + AssertArgument(constraint != NullConstraint, + "AssertUpper() called on a NullConstraint."); + + ArithVar x_i = constraint->getVariable(); + const DeltaRational& c_i = constraint->getValue(); Debug("arith") << "AssertEquality(" << x_i << " " << c_i << ")"<< std::endl; + //Should be fine in integers + Assert(!isInteger(x_i) || c_i.isIntegral()); + int cmpToLB = d_partialModel.cmpToLowerBound(x_i, c_i); int cmpToUB = d_partialModel.cmpToUpperBound(x_i, c_i); @@ -284,16 +342,16 @@ Node TheoryArith::AssertEquality(ArithVar x_i, DeltaRational& c_i, TNode origina } if(cmpToUB > 0){ - Node ubc = d_partialModel.getUpperConstraint(x_i); - Node conflict = NodeManager::currentNM()->mkNode(AND, ubc, original); - Debug("arith") << "AssertLower conflict " << conflict << endl; + Constraint ubc = d_partialModel.getUpperBoundConstraint(x_i); + Node conflict = ConstraintValue::explainConflict(ubc, constraint); + Debug("arith") << "AssertEquality conflicts with upper bound " << conflict << endl; return conflict; } if(cmpToLB < 0){ - Node lbc = d_partialModel.getLowerConstraint(x_i); - Node conflict = NodeManager::currentNM()->mkNode(AND, lbc, original); - Debug("arith") << "AssertUpper conflict " << conflict << endl; + Constraint lbc = d_partialModel.getLowerBoundConstraint(x_i); + Node conflict = ConstraintValue::explainConflict(lbc, constraint); + Debug("arith") << "AssertEquality conflicts with lower bound" << conflict << endl; return conflict; } @@ -309,11 +367,17 @@ Node TheoryArith::AssertEquality(ArithVar x_i, DeltaRational& c_i, TNode origina // Don't bother to check whether x_i != c_i is in d_diseq // The a and (not a) should never be on the fact queue - d_partialModel.setLowerConstraint(x_i,original); - d_partialModel.setLowerBound(x_i, c_i); + d_partialModel.setUpperBoundConstraint(constraint); + d_partialModel.setLowerBoundConstraint(constraint); - d_partialModel.setUpperConstraint(x_i,original); - d_partialModel.setUpperBound(x_i, c_i); + if(d_differenceManager.isDifferenceSlack(x_i)){ + int sgn = c_i.sgn(); + if(sgn == 0){ + zeroDifferenceDetected(x_i); + }else{ + d_differenceManager.differenceCannotBeZero(constraint); + } + } d_updatedBounds.softAdd(x_i); @@ -329,6 +393,72 @@ Node TheoryArith::AssertEquality(ArithVar x_i, DeltaRational& c_i, TNode origina } +/* procedure AssertDisequality( x_i != c_i ) */ +Node TheoryArith::AssertDisequality(Constraint constraint){ + + AssertArgument(constraint != NullConstraint, + "AssertUpper() called on a NullConstraint."); + ArithVar x_i = constraint->getVariable(); + const DeltaRational& c_i = constraint->getValue(); + + Debug("arith") << "AssertDisequality(" << x_i << " " << c_i << ")"<< std::endl; + + //Should be fine in integers + Assert(!isInteger(x_i) || c_i.isIntegral()); + + if(d_differenceManager.isDifferenceSlack(x_i)){ + int sgn = c_i.sgn(); + if(sgn == 0){ + d_differenceManager.differenceCannotBeZero(constraint); + } + } + + if(constraint->isSplit()){ + Debug("eq") << "skipping already split " << constraint << endl; + return Node::null(); + } + + const ValueCollection& vc = constraint->getValueCollection(); + if(vc.hasLowerBound() && vc.hasUpperBound()){ + const Constraint lb = vc.getLowerBound(); + const Constraint ub = vc.getUpperBound(); + if(lb->isTrue() && ub->isTrue()){ + //in conflict + Debug("eq") << "explaining" << endl; + ++(d_statistics.d_statDisequalityConflicts); + return ConstraintValue::explainConflict(constraint, lb, ub); + }else if(lb->isTrue()){ + Debug("eq") << "propagate UpperBound " << constraint << lb << ub << endl; + const Constraint negUb = ub->getNegation(); + if(!negUb->isTrue()){ + negUb->impliedBy(constraint, lb); + } + }else if(ub->isTrue()){ + Debug("eq") << "propagate LowerBound " << constraint << lb << ub << endl; + const Constraint negLb = lb->getNegation(); + if(!negLb->isTrue()){ + negLb->impliedBy(constraint, ub); + } + } + } + + + if(c_i == d_partialModel.getAssignment(x_i)){ + Debug("eq") << "lemma now!" << endl; + d_out->lemma(constraint->split()); + return Node::null(); + }else if(d_partialModel.strictlyLessThanLowerBound(x_i, c_i)){ + Debug("eq") << "can drop as less than lb" << constraint << endl; + }else if(d_partialModel.strictlyGreaterThanUpperBound(x_i, c_i)){ + Debug("eq") << "can drop as less than ub" << constraint << endl; + }else{ + Debug("eq") << "push back" << constraint << endl; + d_diseqQueue.push(constraint); + } + return Node::null(); + +} + void TheoryArith::addSharedTerm(TNode n){ d_differenceManager.addSharedTerm(n); if(!n.isConst() && !isSetup(n)){ @@ -360,10 +490,11 @@ Node TheoryArith::ppRewrite(TNode atom) { Debug("pb") << "arith::preprocess() : after pb substitutions and rewriting: " << a << endl; Debug("arith::preprocess") << "arith::preprocess() :" - << "after pb substitutions and rewriting: " << a << endl; + << "after pb substitutions and rewriting: " + << a << endl; } - if (a.getKind() == kind::EQUAL) { + if (a.getKind() == kind::EQUAL && Options::current()->arithRewriteEq) { Node leq = NodeBuilder<2>(kind::LEQ) << a[0] << a[1]; Node geq = NodeBuilder<2>(kind::GEQ) << a[0] << a[1]; Node rewritten = Rewriter::rewrite(leq.andNode(geq)); @@ -383,44 +514,61 @@ Theory::PPAssertStatus TheoryArith::ppAssert(TNode in, SubstitutionMap& outSubst Rational minConstant = 0; Node minMonomial; Node minVar; - unsigned nVars = 0; if (in.getKind() == kind::EQUAL) { - Assert(in[1].getKind() == kind::CONST_RATIONAL); - // Find the variable with the smallest coefficient - Polynomial p = Polynomial::parsePolynomial(in[0]); - Polynomial::iterator it = p.begin(), it_end = p.end(); - for (; it != it_end; ++ it) { - Monomial m = *it; - // Skip the constant - if (m.isConstant()) continue; - // This is a ''variable'' - nVars ++; - // Skip the non-linear stuff - if (!m.getVarList().singleton()) continue; - // Get the minimal one - Rational constant = m.getConstant().getValue(); - Rational absSconstant = constant > 0 ? constant : -constant; - if (minVar.isNull() || absSconstant < minConstant) { - Node var = m.getVarList().getNode(); - if (var.getKind() == kind::VARIABLE) { - minVar = var; - minMonomial = m.getNode(); - minConstant = constant; - } + Comparison cmp = Comparison::parseNormalForm(in); + + Polynomial left = cmp.getLeft(); + Polynomial right = cmp.getRight(); + + Monomial m = left.getHead(); + if (m.getVarList().singleton()){ + VarList vl = m.getVarList(); + Node var = vl.getNode(); + if (var.getKind() == kind::VARIABLE && !vl.isIntegral()) { + minVar = var; } } + //Assert(in[1].getKind() == kind::CONST_RATIONAL); + // Find the variable with the smallest coefficient + //Polynomial p = Polynomial::parsePolynomial(in[0]); + + // Polynomial::iterator it = p.begin(), it_end = p.end(); + // for (; it != it_end; ++ it) { + // Monomial m = *it; + // // Skip the constant + // if (m.isConstant()) continue; + // // This is a ''variable'' + // nVars ++; + // // Skip the non-linear stuff + // if (!m.getVarList().singleton()) continue; + // // Get the minimal one + // Rational constant = m.getConstant().getValue(); + // Rational absSconstant = constant > 0 ? constant : -constant; + // if (minVar.isNull() || absSconstant < minConstant) { + // Node var = m.getVarList().getNode(); + // if (var.getKind() == kind::VARIABLE) { + // minVar = var; + // minMonomial = m.getNode(); + // minConstant = constant; + // } + // } + //} + // Solve for variable if (!minVar.isNull()) { + Polynomial right = cmp.getRight(); + Node eliminateVar = right.getNode(); // ax + p = c -> (ax + p) -ax - c = -ax - Node eliminateVar = NodeManager::currentNM()->mkNode(kind::MINUS, in[0], minMonomial); - if (in[1].getConst() != 0) { - eliminateVar = NodeManager::currentNM()->mkNode(kind::MINUS, eliminateVar, in[1]); - } - // x = (p - ax - c) * -1/a - eliminateVar = NodeManager::currentNM()->mkNode(kind::MULT, eliminateVar, mkRationalNode(- minConstant.inverse())); - // Add the substitution if not recursive - Node rewritten = Rewriter::rewrite(eliminateVar); + // Node eliminateVar = NodeManager::currentNM()->mkNode(kind::MINUS, in[0], minMonomial); + // if (in[1].getConst() != 0) { + // eliminateVar = NodeManager::currentNM()->mkNode(kind::MINUS, eliminateVar, in[1]); + // } + // // x = (p - ax - c) * -1/a + // eliminateVar = NodeManager::currentNM()->mkNode(kind::MULT, eliminateVar, mkRationalNode(- minConstant.inverse())); + // // Add the substitution if not recursive + Node rewritten = eliminateVar; + Assert(rewritten == Rewriter::rewrite(eliminateVar)); if (!rewritten.hasSubterm(minVar)) { Node elim = Rewriter::rewrite(eliminateVar); if (!minVar.getType().isInteger() || elim.getType().isInteger()) { @@ -584,21 +732,22 @@ void TheoryArith::setupPolynomial(const Polynomial& poly) { */ } -void TheoryArith::setupAtom(TNode atom, bool addToDatabase) { +void TheoryArith::setupAtom(TNode atom) { Assert(isRelationOperator(atom.getKind())); Assert(Comparison::isNormalAtom(atom)); Assert(!isSetup(atom)); + Assert(!d_constraintDatabase.hasLiteral(atom)); - Node left = atom[0]; - if(!isSetup(left)){ - Polynomial poly = Polynomial::parsePolynomial(left); - setupPolynomial(poly); - } + Comparison cmp = Comparison::parseNormalForm(atom); + Polynomial nvp = cmp.normalizedVariablePart(); + Assert(!nvp.isZero()); - if(addToDatabase){ - d_atomDatabase.addAtom(atom); + if(!isSetup(nvp.getNode())){ + setupPolynomial(nvp); } + d_constraintDatabase.addLiteral(atom); + markSetup(atom); } @@ -607,12 +756,17 @@ void TheoryArith::preRegisterTerm(TNode n) { if(isRelationOperator(n.getKind())){ if(!isSetup(n)){ - setupAtom(n, Options::current()->arithPropagation); + setupAtom(n); } - addToContext(n); + Constraint c = d_constraintDatabase.lookup(n); + Assert(c != NullConstraint); + + Debug("arith::preregister") << "setup constraint" << c << endl; + Assert(!c->canBePropagated()); + c->setPreregistered(); } - Debug("arith::preregister") << "end arith::preRegisterTerm(" << n <<")" << endl; + Debug("arith::preregister") << "end arith::preRegisterTerm("<< n <<")" << endl; } @@ -642,6 +796,8 @@ ArithVar TheoryArith::requestArithVar(TNode x, bool slack){ d_tableau.increaseSize(); + d_constraintDatabase.addVariable(varX); + Debug("arith::arithvar") << x << " |-> " << varX << endl; return varX; @@ -698,20 +854,22 @@ void TheoryArith::setupInitialValue(ArithVar x){ Debug("arith") << "setupVariable("<(assertion, simpleKind); - - return d_arithvarNodeMap.asArithVar(left); +ArithVar TheoryArith::determineArithVar(const Polynomial& p) const{ + Assert(!p.containsConstant()); + Assert(p.getHead().constantIsPositive()); + TNode n = p.getNode(); + Debug("determineArithVar") << "determineArithVar(" << n << ")" << endl; + return d_arithvarNodeMap.asArithVar(n); } - -Node TheoryArith::disequalityConflict(TNode eq, TNode lb, TNode ub){ - NodeBuilder<3> conflict(kind::AND); - conflict << eq << lb << ub; - ++(d_statistics.d_statDisequalityConflicts); - return conflict; +ArithVar TheoryArith::determineArithVar(TNode assertion) const{ + Debug("determineArithVar") << "determineArithVar " << assertion << endl; + Comparison cmp = Comparison::parseNormalForm(assertion); + Polynomial variablePart = cmp.normalizedVariablePart(); + return determineArithVar(variablePart); } + bool TheoryArith::canSafelyAvoidEqualitySetup(TNode equality){ Assert(equality.getKind() == EQUAL); return d_arithvarNodeMap.hasArithVar(equality[0]); @@ -721,11 +879,11 @@ Comparison TheoryArith::mkIntegerEqualityFromAssignment(ArithVar v){ const DeltaRational& beta = d_partialModel.getAssignment(v); Assert(beta.isIntegral()); - Constant betaAsConstant = Constant::mkConstant(beta.floor()); + Polynomial betaAsPolynomial( Constant::mkConstant(beta.floor()) ); TNode var = d_arithvarNodeMap.asNode(v); Polynomial varAsPolynomial = Polynomial::parsePolynomial(var); - return Comparison::mkComparison(EQUAL, varAsPolynomial, betaAsConstant); + return Comparison::mkComparison(EQUAL, varAsPolynomial, betaAsPolynomial); } Node TheoryArith::dioCutting(){ @@ -755,12 +913,12 @@ Node TheoryArith::dioCutting(){ return Node::null(); }else{ Polynomial p = plane.getPolynomial(); - Constant c = plane.getConstant() * Constant::mkConstant(-1); + Polynomial c(plane.getConstant() * Constant::mkConstant(-1)); Integer gcd = p.gcd(); Assert(p.isIntegral()); Assert(c.isIntegral()); Assert(gcd > 1); - Assert(!gcd.divides(c.getValue().getNumerator())); + Assert(!gcd.divides(c.asConstant().getNumerator())); Comparison leq = Comparison::mkComparison(LEQ, p, c); Comparison geq = Comparison::mkComparison(GEQ, p, c); Node lemma = NodeManager::currentNM()->mkNode(OR, leq.getNode(), geq.getNode()); @@ -782,21 +940,17 @@ Node TheoryArith::callDioSolver(){ Assert(isInteger(v)); Assert(d_partialModel.boundsAreEqual(v)); - TNode lb = d_partialModel.getLowerConstraint(v); - TNode ub = d_partialModel.getUpperConstraint(v); + + Constraint lb = d_partialModel.getLowerBoundConstraint(v); + Constraint ub = d_partialModel.getUpperBoundConstraint(v); Node orig = Node::null(); - if(lb == ub){ - Assert(lb.getKind() == EQUAL); - orig = lb; - }else if(lb.getKind() == EQUAL){ - orig = lb; - }else if(ub.getKind() == EQUAL){ - orig = ub; - }else{ - NodeBuilder<> nb(AND); - nb << ub << lb; - orig = nb; + if(lb->isEquality()){ + orig = lb->explainForConflict(); + }else if(ub->isEquality()){ + orig = ub->explainForConflict(); + }else { + orig = ConstraintValue::explainConflict(ub, lb); } Assert(d_partialModel.assignmentIsConsistent(v)); @@ -819,71 +973,124 @@ Node TheoryArith::callDioSolver(){ } Node TheoryArith::assertionCases(TNode assertion){ - Kind simpleKind = simplifiedKind(assertion); + Constraint constraint = d_constraintDatabase.lookup(assertion); + + Kind simpleKind = Comparison::comparisonKind(assertion); Assert(simpleKind != UNDEFINED_KIND); + Assert(constraint != NullConstraint || + simpleKind == EQUAL || + simpleKind == DISTINCT ); if(simpleKind == EQUAL || simpleKind == DISTINCT){ Node eq = (simpleKind == DISTINCT) ? assertion[0] : assertion; if(!isSetup(eq)){ //The previous code was equivalent to: - setupAtom(eq, false); - //We can try: - //setupAtom(eq, true); - addToContext(eq); + setupAtom(eq); + constraint = d_constraintDatabase.lookup(assertion); + } + } + Assert(constraint != NullConstraint); + + if(constraint->negationHasProof()){ + Constraint negation = constraint->getNegation(); + if(negation->isSelfExplaining()){ + if(Debug.isOn("whytheoryenginewhy")){ + debugPrintFacts(); + } + cout << "Theory engine is sending me both a literal and its negation?" + << "BOOOOOOOOOOOOOOOOOOOOOO!!!!"<< endl; } + Debug("arith::eq") << constraint << endl; + Debug("arith::eq") << negation << endl; + + NodeBuilder<> nb(kind::AND); + nb << assertion; + negation->explainForConflict(nb); + Node conflict = nb; + Debug("arith::eq") << "conflict" << conflict << endl; + return conflict; } + Assert(!constraint->negationHasProof()); - ArithVar x_i = determineLeftVariable(assertion, simpleKind); - DeltaRational c_i = determineRightConstant(assertion, simpleKind); + if(constraint->assertedToTheTheory()){ + //Do nothing + return Node::null(); + } + Assert(!constraint->assertedToTheTheory()); + constraint->setAssertedToTheTheory(); - // bool tightened = false; + ArithVar x_i = constraint->getVariable(); + //DeltaRational c_i = determineRightConstant(assertion, simpleKind); - // //If the variable is an integer tighen the constraint. - // if(isInteger(x_i)){ - // if(simpleKind == LT){ - // tightened = true; - // c_i = DeltaRational(c_i.floor()); - // }else if(simpleKind == GT){ - // tightened = true; - // c_i = DeltaRational(c_i.ceiling()); - // } - // } + //Assert(constraint->getVariable() == determineLeftVariable(assertion, simpleKind)); + //Assert(constraint->getValue() == determineRightConstant(assertion, simpleKind)); + Assert(!constraint->hasLiteral() || constraint->getLiteral() == assertion); Debug("arith::assertions") << "arith assertion @" << getContext()->getLevel() <<"(" << assertion << " \\-> " - << x_i<<" "<< simpleKind <<" "<< c_i << ")" << std::endl; - - switch(simpleKind){ - case LEQ: - case LT: - return AssertUpper(x_i, c_i, assertion); - case GEQ: - case GT: - return AssertLower(x_i, c_i, assertion); - case EQUAL: - return AssertEquality(x_i, c_i, assertion); - case DISTINCT: - { - d_diseq.insert(assertion); - // Check if it conflicts with the the bounds - TNode eq = assertion[0]; - Assert(eq.getKind() == kind::EQUAL); - TNode lhs = eq[0]; - TNode rhs = eq[1]; - Assert(rhs.getKind() == CONST_RATIONAL); - ArithVar lhsVar = determineLeftVariable(eq, kind::EQUAL); - DeltaRational rhsValue = determineRightConstant(eq, kind::EQUAL); - if (d_partialModel.hasLowerBound(lhsVar) && - d_partialModel.hasUpperBound(lhsVar) && - d_partialModel.getLowerBound(lhsVar) == rhsValue && - d_partialModel.getUpperBound(lhsVar) == rhsValue) { - Node lb = d_partialModel.getLowerConstraint(lhsVar); - Node ub = d_partialModel.getUpperConstraint(lhsVar); - return disequalityConflict(assertion, lb, ub); + //<< determineLeftVariable(assertion, simpleKind) + <<" "<< simpleKind <<" " + //<< determineRightConstant(assertion, simpleKind) + << ")" << std::endl; + + + Debug("arith::constraint") << "arith constraint " << constraint << std::endl; + + if(!constraint->hasProof()){ + Debug("arith::constraint") << "marking as constraint as self explaining " << endl; + constraint->selfExplaining(); + }else{ + Debug("arith::constraint") << "already has proof: " << constraint->explainForConflict() << endl; + } + + Assert(!isInteger(x_i) || + simpleKind == EQUAL || + simpleKind == DISTINCT || + simpleKind == GEQ || + simpleKind == LT); + + switch(constraint->getType()){ + case UpperBound: + if(simpleKind == LT && isInteger(x_i)){ + Constraint floorConstraint = constraint->getFloor(); + if(!floorConstraint->isTrue()){ + if(floorConstraint->negationHasProof()){ + return ConstraintValue::explainConflict(constraint, floorConstraint->getNegation()); + }else{ + floorConstraint->impliedBy(constraint); + } } + //c_i = DeltaRational(c_i.floor()); + //return AssertUpper(x_i, c_i, assertion, floorConstraint); + return AssertUpper(floorConstraint); + }else{ + return AssertUpper(constraint); } - return Node::null(); + //return AssertUpper(x_i, c_i, assertion, constraint); + case LowerBound: + if(simpleKind == LT && isInteger(x_i)){ + Constraint ceilingConstraint = constraint->getCeiling(); + if(!ceilingConstraint->isTrue()){ + if(ceilingConstraint->negationHasProof()){ + + return ConstraintValue::explainConflict(constraint, ceilingConstraint->getNegation()); + } + ceilingConstraint->impliedBy(constraint); + } + //c_i = DeltaRational(c_i.ceiling()); + //return AssertLower(x_i, c_i, assertion, ceilingConstraint); + return AssertLower(ceilingConstraint); + }else{ + return AssertLower(constraint); + } + //return AssertLower(x_i, c_i, assertion, constraint); + case Equality: + return AssertEquality(constraint); + //return AssertEquality(x_i, c_i, assertion, constraint); + case Disequality: + return AssertDisequality(constraint); + //return AssertDisequality(x_i, c_i, assertion, constraint); default: Unreachable(); return Node::null(); @@ -930,29 +1137,45 @@ void TheoryArith::check(Effort effortLevel){ d_out->conflict(possibleConflict); return; } + if(d_differenceManager.inConflict()){ + Node c = d_differenceManager.conflict(); + d_partialModel.revertAssignmentChanges(); + Debug("arith::conflict") << "difference manager conflict " << c << endl; + clearUpdates(); + d_out->conflict(c); + return; + } } + if(Debug.isOn("arith::print_assertions")) { debugPrintAssertions(); } bool emmittedConflictOrSplit = false; - Node possibleConflict = d_simplex.findModel(); - if(possibleConflict != Node::null()){ + Assert(d_conflicts.empty()); + bool foundConflict = d_simplex.findModel(); + if(foundConflict){ d_partialModel.revertAssignmentChanges(); clearUpdates(); - Debug("arith::conflict") << "conflict " << possibleConflict << endl; - d_out->conflict(possibleConflict); + Assert(!d_conflicts.empty()); + for(size_t i = 0, i_end = d_conflicts.size(); i < i_end; ++i){ + Node conflict = d_conflicts[i]; + Debug("arith::conflict") << "d_conflicts[" << i << "] " << conflict << endl; + d_out->conflict(conflict); + } emmittedConflictOrSplit = true; }else{ d_partialModel.commitAssignmentChanges(); } + if(!emmittedConflictOrSplit && fullEffort(effortLevel)){ emmittedConflictOrSplit = splitDisequalities(); } + Node possibleConflict = Node::null(); if(!emmittedConflictOrSplit && fullEffort(effortLevel) && !hasIntegerModel()){ if(!emmittedConflictOrSplit && Options::current()->dioSolver){ @@ -1034,29 +1257,43 @@ Node TheoryArith::roundRobinBranch(){ bool TheoryArith::splitDisequalities(){ bool splitSomething = false; - context::CDHashSet::iterator it = d_diseq.begin(); - context::CDHashSet::iterator it_end = d_diseq.end(); - for(; it != it_end; ++ it) { - TNode eq = (*it)[0]; - Assert(eq.getKind() == kind::EQUAL); - TNode lhs = eq[0]; - TNode rhs = eq[1]; - Assert(rhs.getKind() == CONST_RATIONAL); - ArithVar lhsVar = determineLeftVariable(eq, kind::EQUAL); - DeltaRational lhsValue = d_partialModel.getAssignment(lhsVar); - DeltaRational rhsValue = determineRightConstant(eq, kind::EQUAL); - if (lhsValue == rhsValue) { - Debug("arith::lemma") << "Splitting on " << eq << endl; - Debug("arith::lemma") << "LHS value = " << lhsValue << endl; - Debug("arith::lemma") << "RHS value = " << rhsValue << endl; - Node ltNode = NodeBuilder<2>(kind::LT) << lhs << rhs; - Node gtNode = NodeBuilder<2>(kind::GT) << lhs << rhs; - Node lemma = NodeBuilder<3>(OR) << eq << ltNode << gtNode; - ++(d_statistics.d_statDisequalitySplits); - d_out->lemma(lemma); - splitSomething = true; + vector save; + + while(!d_diseqQueue.empty()){ + Constraint front = d_diseqQueue.front(); + d_diseqQueue.pop(); + + if(front->isSplit()){ + Debug("eq") << "split already" << endl; + }else{ + Debug("eq") << "not split already" << endl; + + ArithVar lhsVar = front->getVariable(); + + const DeltaRational& lhsValue = d_partialModel.getAssignment(lhsVar); + const DeltaRational& rhsValue = front->getValue(); + if(lhsValue == rhsValue){ + Debug("arith::lemma") << "Splitting on " << front << endl; + Debug("arith::lemma") << "LHS value = " << lhsValue << endl; + Debug("arith::lemma") << "RHS value = " << rhsValue << endl; + Node lemma = front->split(); + ++(d_statistics.d_statDisequalitySplits); + d_out->lemma(lemma); + splitSomething = true; + }else if(d_partialModel.strictlyLessThanLowerBound(lhsVar, rhsValue)){ + Debug("eq") << "can drop as less than lb" << front << endl; + }else if(d_partialModel.strictlyGreaterThanUpperBound(lhsVar, rhsValue)){ + Debug("eq") << "can drop as greater than ub" << front << endl; + }else{ + Debug("eq") << "save" << front << endl; + save.push_back(front); + } } } + vector::const_iterator i=save.begin(), i_end = save.end(); + for(; i != i_end; ++i){ + d_diseqQueue.push(*i); + } return splitSomething; } @@ -1068,17 +1305,17 @@ void TheoryArith::debugPrintAssertions() { Debug("arith::print_assertions") << "Assertions:" << endl; for (ArithVar i = 0; i < d_variables.size(); ++ i) { if (d_partialModel.hasLowerBound(i)) { - Node lConstr = d_partialModel.getLowerConstraint(i); + Constraint lConstr = d_partialModel.getLowerBoundConstraint(i); Debug("arith::print_assertions") << lConstr << endl; } if (d_partialModel.hasUpperBound(i)) { - Node uConstr = d_partialModel.getUpperConstraint(i); + Constraint uConstr = d_partialModel.getUpperBoundConstraint(i); Debug("arith::print_assertions") << uConstr << endl; } } - context::CDHashSet::iterator it = d_diseq.begin(); - context::CDHashSet::iterator it_end = d_diseq.end(); + context::CDQueue::const_iterator it = d_diseqQueue.begin(); + context::CDQueue::const_iterator it_end = d_diseqQueue.end(); for(; it != it_end; ++ it) { Debug("arith::print_assertions") << *it << endl; } @@ -1097,88 +1334,74 @@ void TheoryArith::debugPrintModel(){ } Node TheoryArith::explain(TNode n) { - Debug("arith::explain") << "explain @" << getContext()->getLevel() << ": " << n << endl; - Assert(d_propManager.isPropagated(n)); - return d_propManager.explain(n); -} + Debug("arith::explain") << "explain @" << getContext()->getLevel() << ": " << n << endl; -void flattenAnd(Node n, std::vector& out){ - Assert(n.getKind() == kind::AND); - for(Node::iterator i=n.begin(), i_end=n.end(); i != i_end; ++i){ - Node curr = *i; - if(curr.getKind() == kind::AND){ - flattenAnd(curr, out); - }else{ - out.push_back(curr); - } + Constraint c = d_constraintDatabase.lookup(n); + if(c != NullConstraint){ + Assert(!c->isSelfExplaining()); + Node exp = c->explainForPropagation(); + Debug("arith::explain") << "constraint explanation" << n << ":" << exp << endl; + return exp; + }else{ + Assert(d_differenceManager.canExplain(n)); + Debug("arith::explain") << "dm explanation" << n << endl; + return d_differenceManager.explain(n); } } -Node flattenAnd(Node n){ - std::vector out; - flattenAnd(n, out); - return NodeManager::currentNM()->mkNode(kind::AND, out); -} void TheoryArith::propagate(Effort e) { - bool propagated = false; if(Options::current()->arithPropagation && hasAnyUpdates()){ propagateCandidates(); }else{ clearUpdates(); } - while(d_propManager.hasMorePropagations()){ - const PropManager::PropUnit next = d_propManager.getNextPropagation(); - bool flag = next.flag; - TNode toProp = next.consequent; + while(d_constraintDatabase.hasMorePropagations()){ + Constraint c = d_constraintDatabase.nextPropagation(); - TNode atom = (toProp.getKind() == kind::NOT) ? toProp[0] : toProp; + if(c->negationHasProof()){ + Node conflict = ConstraintValue::explainConflict(c, c->getNegation()); + cout << "tears " << conflict << endl; + Debug("arith::prop") << "propagate conflict" << conflict << endl; + d_out->conflict(conflict); + return; + }else if(!c->assertedToTheTheory()){ - Debug("arith::propagate") << "propagate @" << getContext()->getLevel() <<" flag: "<< flag << " " << toProp << endl; + Node literal = c->getLiteral(); + Debug("arith::prop") << "propagating @" << getContext()->getLevel() << " " << literal << endl; - if(flag) { - //Currently if the flag is set this came from an equality detected by the - //equality engine in the the difference manager. - if(toProp.getKind() == kind::EQUAL){ - Node normalized = Rewriter::rewrite(toProp); - Node notNormalized = normalized.notNode(); + d_out->propagate(literal); + }else{ + Node literal = c->getLiteral(); + Debug("arith::prop") << "already asserted to the theory " << literal << endl; + } + } - if(d_diseq.find(notNormalized) == d_diseq.end()){ - d_out->propagate(toProp); - propagated = true; - }else{ - Node exp = d_differenceManager.explain(toProp); - Node lp = flattenAnd(exp.andNode(notNormalized)); - Debug("arith::propagate") << "propagate conflict" << lp << endl; - d_out->conflict(lp); + while(d_differenceManager.hasMorePropagations()){ + TNode toProp = d_differenceManager.getNextPropagation(); - propagated = true; - break; - } - }else{ - d_out->propagate(toProp); - propagated = true; - } - }else if(inContextAtom(atom)){ - Node satValue = d_valuation.getSatValue(toProp); - AlwaysAssert(satValue.isNull()); - propagated = true; + //Currently if the flag is set this came from an equality detected by the + //equality engine in the the difference manager. + Node normalized = Rewriter::rewrite(toProp); + + Constraint constraint = d_constraintDatabase.lookup(normalized); + if(constraint == NullConstraint){ + Debug("arith::prop") << "propagating on non-constraint? " << toProp << endl; d_out->propagate(toProp); + }else if(constraint->negationHasProof()){ + Node exp = d_differenceManager.explain(toProp); + Node notNormalized = normalized.getKind() == NOT ? + normalized[0] : normalized.notNode(); + Node lp = flattenAnd(exp.andNode(notNormalized)); + Debug("arith::prop") << "propagate conflict" << lp << endl; + d_out->conflict(lp); + return; }else{ - //Not clear if this is a good time to do this or not... - Debug("arith::propagate") << "Atom is not in context" << toProp << endl; -#warning "enable remove atom in database" - //d_atomDatabase.removeAtom(atom); - } - } + Debug("arith::prop") << "propagating still?" << toProp << endl; - if(!propagated){ - //Opportunistically export previous conflicts - while(d_simplex.hasMoreLemmas()){ - Node lemma = d_simplex.popLemma(); - d_out->lemma(lemma); + d_out->propagate(toProp); } } } @@ -1401,8 +1624,18 @@ void TheoryArith::presolve(){ callCount = callCount + 1; } + if(Options::current()->arithPropagation ){ + vector lemmas; + d_constraintDatabase.outputAllUnateLemmas(lemmas); + vector::const_iterator i = lemmas.begin(), i_end = lemmas.end(); + for(; i != i_end; ++i){ + Node lem = *i; + Debug("arith::oldprop") << " lemma lemma duck " <lemma(lem); + } + } + d_learner.clear(); - check(EFFORT_FULL); } EqualityStatus TheoryArith::getEqualityStatus(TNode a, TNode b) { @@ -1423,27 +1656,71 @@ bool TheoryArith::propagateCandidateBound(ArithVar basic, bool upperBound){ if((upperBound && d_partialModel.strictlyLessThanUpperBound(basic, bound)) || (!upperBound && d_partialModel.strictlyGreaterThanLowerBound(basic, bound))){ - Node bestImplied = upperBound ? - d_propManager.getBestImpliedUpperBound(basic, bound): - d_propManager.getBestImpliedLowerBound(basic, bound); - if(!bestImplied.isNull()){ - bool asserted = d_propManager.isAsserted(bestImplied); - bool propagated = d_propManager.isPropagated(bestImplied); - if( !asserted && !propagated){ +#warning "Policy point" + //We are only going to recreate the functionality for now. + //In the future this can be improved to generate a temporary constraint + //if none exists. + //Experiment with doing this everytime or only when the new constraint + //implies an unknown fact. + + ConstraintType t = upperBound ? UpperBound : LowerBound; + Constraint bestImplied = d_constraintDatabase.getBestImpliedBound(basic, t, bound); - NodeBuilder<> nb(kind::AND); + // Node bestImplied = upperBound ? + // d_apm.getBestImpliedUpperBound(basic, bound): + // d_apm.getBestImpliedLowerBound(basic, bound); + + if(bestImplied != NullConstraint){ + //This should be stronger + Assert(!upperBound || bound <= bestImplied->getValue()); + Assert(!upperBound || d_partialModel.lessThanUpperBound(basic, bestImplied->getValue())); + + Assert( upperBound || bound >= bestImplied->getValue()); + Assert( upperBound || d_partialModel.greaterThanLowerBound(basic, bestImplied->getValue())); + //slightly changed + + // Constraint c = d_constraintDatabase.lookup(bestImplied); + // Assert(c != NullConstraint); + + bool assertedToTheTheory = bestImplied->assertedToTheTheory(); + bool canBePropagated = bestImplied->canBePropagated(); + bool hasProof = bestImplied->hasProof(); + + Debug("arith::prop") << "arith::prop" << basic + //<< " " << assertedValuation + << " " << assertedToTheTheory + << " " << canBePropagated + << " " << hasProof + << endl; + + if(!assertedToTheTheory && canBePropagated && !hasProof ){ if(upperBound){ - d_linEq.explainNonbasicsUpperBound(basic, nb); + Assert(bestImplied != d_partialModel.getUpperBoundConstraint(basic)); + d_linEq.propagateNonbasicsUpperBound(basic, bestImplied); }else{ - d_linEq.explainNonbasicsLowerBound(basic, nb); + Assert(bestImplied != d_partialModel.getLowerBoundConstraint(basic)); + d_linEq.propagateNonbasicsLowerBound(basic, bestImplied); } - Node explanation = nb; - d_propManager.propagate(bestImplied, explanation, false); return true; - }else{ - Debug("arith::prop") << basic << " " << asserted << " " << propagated << endl; } + + // bool asserted = valuationIsAsserted(bestImplied); + // bool propagated = d_theRealPropManager.isPropagated(bestImplied); + // if( !asserted && !propagated){ + + // NodeBuilder<> nb(kind::AND); + // if(upperBound){ + // d_linEq.explainNonbasicsUpperBound(basic, nb); + // }else{ + // d_linEq.explainNonbasicsLowerBound(basic, nb); + // } + // Node explanation = nb; + // d_theRealPropManager.propagate(bestImplied, explanation, false); + // return true; + // }else{ + // Debug("arith::prop") << basic << " " << asserted << " " << propagated << endl; + // } } } return false; diff --git a/src/theory/arith/theory_arith.h b/src/theory/arith/theory_arith.h index 4f111d350..4a5c398bd 100644 --- a/src/theory/arith/theory_arith.h +++ b/src/theory/arith/theory_arith.h @@ -34,14 +34,14 @@ #include "theory/arith/arith_rewriter.h" #include "theory/arith/partial_model.h" #include "theory/arith/linear_equality.h" -#include "theory/arith/atom_database.h" #include "theory/arith/simplex.h" #include "theory/arith/arith_static_learner.h" -#include "theory/arith/arith_prop_manager.h" #include "theory/arith/arithvar_node_map.h" #include "theory/arith/dio_solver.h" #include "theory/arith/difference_manager.h" +#include "theory/arith/constraint.h" + #include "util/stats.h" #include @@ -66,24 +66,6 @@ private: */ bool d_hasDoneWorkSinceCut; - /** - * The set of atoms that are currently in the context. - * This is exactly the union of preregistered atoms and - * equalities from sharing. - * This is used to reconstruct the rest of arithmetic. - */ - CDNodeSet d_atomsInContext; - bool inContextAtom(TNode atom){ - Assert(isRelationOperator(atom.getKind())); - Assert(Comparison::isNormalAtom(atom)); - return d_atomsInContext.contains(atom); - } - void addToContext(TNode atom){ - Assert(isRelationOperator(atom.getKind())); - Assert(Comparison::isNormalAtom(atom)); - d_atomsInContext.insert(atom); - } - /** Static learner. */ ArithStaticLearner d_learner; @@ -111,8 +93,20 @@ private: void setupVariable(const Variable& x); void setupVariableList(const VarList& vl); void setupPolynomial(const Polynomial& poly); - void setupAtom(TNode atom, bool addToDatabase); + void setupAtom(TNode atom); + class SetupLiteralCallBack : public TNodeCallBack { + private: + TheoryArith* d_arith; + public: + SetupLiteralCallBack(TheoryArith* ta) : d_arith(ta){} + void operator()(TNode lit){ + TNode atom = (lit.getKind() == kind::NOT) ? lit[0] : lit; + if(!d_arith->isSetup(atom)){ + d_arith->setupAtom(atom); + } + } + } d_setupLiteralCallback; /** * (For the moment) the type hierarchy goes as: @@ -172,7 +166,9 @@ private: /** * List of all of the inequalities asserted in the current context. */ - context::CDHashSet d_diseq; + //context::CDHashSet d_diseq; + context::CDQueue d_diseqQueue; + /** * Manages information about the assignment and upper and lower bounds on @@ -222,6 +218,23 @@ private: uint32_t d_tableauResetPeriod; static const uint32_t s_TABLEAU_RESET_INCREMENT = 5; + + /** This is only used by simplex at the moment. */ + context::CDList d_conflicts; + class PushCallBack : public NodeCallBack { + private: + context::CDList& d_list; + public: + PushCallBack(context::CDList& l) + : d_list(l) + {} + void operator()(Node n){ + d_list.push_back(n); + } + }; + PushCallBack d_conflictCallBack; + + /** * A copy of the tableau immediately after removing variables * without bounds in presolve(). @@ -232,10 +245,7 @@ private: * The atom database keeps track of the atoms that have been preregistered. * Used to add unate propagations. */ - ArithAtomDatabase d_atomDatabase; - - /** This manager keeps track of information needed to propagate. */ - ArithPropManager d_propManager; + //ArithAtomDatabase d_atomDatabase; /** This keeps track of difference equalities. Mostly for sharing. */ DifferenceManager d_differenceManager; @@ -243,6 +253,10 @@ private: /** This implements the Simplex decision procedure. */ SimplexDecisionProcedure d_simplex; + + /** The constraint database associated with the theory. */ + ConstraintDatabase d_constraintDatabase; + /** Internal model value for the atom */ bool getDeltaAtomValue(TNode n); @@ -291,7 +305,7 @@ private: d_simplex(s) {} - void callback(ArithVar x){ + void operator()(ArithVar x){ d_simplex.updateBasic(x); } }; @@ -305,10 +319,10 @@ private: void propagateArithVar(bool upperbound, ArithVar var ); /** - * Using the simpleKind return the ArithVar associated with the - * left hand side of assertion. + * Using the simpleKind return the ArithVar associated with the assertion. */ - ArithVar determineLeftVariable(TNode assertion, Kind simpleKind); + ArithVar determineArithVar(const Polynomial& p) const; + ArithVar determineArithVar(TNode assertion) const; /** * Splits the disequalities in d_diseq that are violated using lemmas on demand. @@ -317,6 +331,8 @@ private: */ bool splitDisequalities(); + /** A Difference variable is known to be 0.*/ + void zeroDifferenceDetected(ArithVar x); /** @@ -364,9 +380,10 @@ private: * a node describing this conflict is returned. * If this new bound is not in conflict, Node::null() is returned. */ - Node AssertLower(ArithVar x, DeltaRational& c, TNode orig); - Node AssertUpper(ArithVar x, DeltaRational& c, TNode orig); - Node AssertEquality(ArithVar x, DeltaRational& c, TNode orig); + Node AssertLower(Constraint constraint); + Node AssertUpper(Constraint constraint); + Node AssertEquality(Constraint constraint); + Node AssertDisequality(Constraint constraint); /** Tracks the bounds that were updated in the current round. */ PermissiveBackArithVarSet d_updatedBounds; @@ -400,11 +417,6 @@ private: */ Node assertionCases(TNode assertion); - /** - * This is used for reporting conflicts caused by disequalities during assertionCases. - */ - Node disequalityConflict(TNode eq, TNode lb, TNode ub); - /** * Returns the basic variable with the shorted row containg a non-basic variable. * If no such row exists, return ARITHVAR_SENTINEL. diff --git a/src/theory/theory.cpp b/src/theory/theory.cpp index afd311bf2..cde65aa0f 100644 --- a/src/theory/theory.cpp +++ b/src/theory/theory.cpp @@ -83,5 +83,10 @@ void Theory::printFacts(std::ostream& os) const { } } +void Theory::debugPrintFacts() const{ + cout << "Theory::debugPrintFacts()" << endl; + printFacts(cout); +} + }/* CVC4::theory namespace */ }/* CVC4 namespace */ diff --git a/src/theory/theory.h b/src/theory/theory.h index 28fdc8cbe..2b91da3b2 100644 --- a/src/theory/theory.h +++ b/src/theory/theory.h @@ -263,6 +263,7 @@ protected: static TheoryId s_uninterpretedSortOwner; void printFacts(std::ostream& os) const; + void debugPrintFacts() const; public: diff --git a/src/util/integer_cln_imp.h b/src/util/integer_cln_imp.h index 9d67e8fba..d3e5c07ca 100644 --- a/src/util/integer_cln_imp.h +++ b/src/util/integer_cln_imp.h @@ -366,6 +366,18 @@ public: return cln::cl_I_to_int(sgn); } + bool isZero() const { + return cln::zerop(d_value); + } + + bool isOne() const { + return d_value == 1; + } + + bool isNegativeOne() const { + return d_value == -1; + } + //friend std::ostream& operator<<(std::ostream& os, const Integer& n); long getLong() const { diff --git a/src/util/integer_gmp_imp.h b/src/util/integer_gmp_imp.h index ceb585852..74b4adad0 100644 --- a/src/util/integer_gmp_imp.h +++ b/src/util/integer_gmp_imp.h @@ -276,6 +276,18 @@ public: return mpz_sgn(d_value.get_mpz_t()); } + bool isZero() const { + return sgn() == 0; + } + + bool isOne() const { + return mpz_cmp_si(d_value.get_mpz_t(), 1) == 0; + } + + bool isNegativeOne() const { + return mpz_cmp_si(d_value.get_mpz_t(), -1) == 0; + } + /** * Raise this Integer to the power exp. * diff --git a/src/util/options.cpp b/src/util/options.cpp index b6956a31b..b6a306ee0 100644 --- a/src/util/options.cpp +++ b/src/util/options.cpp @@ -110,6 +110,7 @@ Options::Options() : ufSymmetryBreaker(false), ufSymmetryBreakerSetByUser(false), dioSolver(true), + arithRewriteEq(true), lemmaOutputChannel(NULL), lemmaInputChannel(NULL), threads(2),// default should be 1 probably, but say 2 for now @@ -183,6 +184,7 @@ Additional CVC4 options:\n\ --enable-symmetry-breaker turns on UF symmetry breaker (Deharbe et al., CADE 2011) [on by default only for QF_UF]\n\ --disable-symmetry-breaker turns off UF symmetry breaker\n\ --disable-dio-solver turns off Linear Diophantine Equation solver (Griggio, JSAT 2012)\n\ + --disable-arith-rewrite-equalities turns off the preprocessing rewrite turning equalities into a conjunction of inequalities.\n \ --threads=N sets the number of solver threads\n\ --threadN=string configures thread N (0..#threads-1)\n\ --filter-lemma-length=N don't share lemmas strictly longer than N\n\ @@ -356,6 +358,7 @@ enum OptionValue { ARITHMETIC_PIVOT_THRESHOLD, ARITHMETIC_PROP_MAX_LENGTH, ARITHMETIC_DIO_SOLVER, + ARITHMETIC_REWRITE_EQUALITIES, ENABLE_SYMMETRY_BREAKER, DISABLE_SYMMETRY_BREAKER, PARALLEL_THREADS, @@ -445,6 +448,7 @@ static struct option cmdlineOptions[] = { { "print-winner", no_argument , NULL, PRINT_WINNER }, { "disable-arithmetic-propagation", no_argument, NULL, ARITHMETIC_PROPAGATION }, { "disable-dio-solver", no_argument, NULL, ARITHMETIC_DIO_SOLVER }, + { "disable-arith-rewrite-equalities", no_argument, NULL, ARITHMETIC_REWRITE_EQUALITIES }, { "enable-symmetry-breaker", no_argument, NULL, ENABLE_SYMMETRY_BREAKER }, { "disable-symmetry-breaker", no_argument, NULL, DISABLE_SYMMETRY_BREAKER }, { "threads", required_argument, NULL, PARALLEL_THREADS }, @@ -796,6 +800,10 @@ throw(OptionException) { dioSolver = false; break; + case ARITHMETIC_REWRITE_EQUALITIES: + arithRewriteEq = false; + break; + case ENABLE_SYMMETRY_BREAKER: ufSymmetryBreaker = true; ufSymmetryBreakerSetByUser = true; diff --git a/src/util/options.h b/src/util/options.h index 4bf8b5b75..c7fbcd896 100644 --- a/src/util/options.h +++ b/src/util/options.h @@ -156,7 +156,7 @@ struct CVC4_PUBLIC Options { /** Whether we produce proofs. */ bool proof; - + /** Whether we support SmtEngine::getAssignment() for this run. */ bool produceAssignments; @@ -195,7 +195,7 @@ struct CVC4_PUBLIC Options { /** Variable activity decay factor for Minisat */ double satVarDecay; - + /** Clause activity decay factor for Minisat */ double satClauseDecay; @@ -238,6 +238,12 @@ struct CVC4_PUBLIC Options { */ bool dioSolver; + /** + * Whether to split (= x y) into (and (<= x y) (>= x y)) in + * arithmetic preprocessing. + */ + bool arithRewriteEq; + /** The output channel to receive notfication events for new lemmas */ LemmaOutputChannel* lemmaOutputChannel; LemmaInputChannel* lemmaInputChannel; @@ -251,7 +257,7 @@ struct CVC4_PUBLIC Options { /** Thread ID, for internal use in case of multi-threaded run */ int thread_id; - /** + /** * In multi-threaded setting print output of each thread at the * end of run, separated by a divider ("----"). **/ diff --git a/src/util/rational_cln_imp.h b/src/util/rational_cln_imp.h index 69eede0d6..c2da0e7ed 100644 --- a/src/util/rational_cln_imp.h +++ b/src/util/rational_cln_imp.h @@ -196,6 +196,14 @@ public: return cln::zerop(d_value); } + bool isOne() const { + return d_value == 1; + } + + bool isNegativeOne() const { + return d_value == -1; + } + Rational abs() const { if(sgn() < 0){ return -(*this); diff --git a/src/util/rational_gmp_imp.h b/src/util/rational_gmp_imp.h index 751c8f137..ef0720263 100644 --- a/src/util/rational_gmp_imp.h +++ b/src/util/rational_gmp_imp.h @@ -173,6 +173,14 @@ public: return sgn() == 0; } + bool isOne() const { + return mpq_cmp_si(d_value.get_mpq_t(), 1, 1) == 0; + } + + bool isNegativeOne() const { + return mpq_cmp_si(d_value.get_mpq_t(), -1, 1) == 0; + } + Rational abs() const { if(sgn() < 0){ return -(*this); diff --git a/test/regress/regress0/arith/integers/Makefile.am b/test/regress/regress0/arith/integers/Makefile.am index eb3a9dba5..ef0ac53c3 100644 --- a/test/regress/regress0/arith/integers/Makefile.am +++ b/test/regress/regress0/arith/integers/Makefile.am @@ -11,11 +11,12 @@ MAKEFLAGS = -k # These are run for all build profiles. # If a test shouldn't be run in e.g. competition mode, # put it below in "TESTS +=" + TESTS = \ arith-int-004.cvc \ arith-int-007.cvc \ + arith-int-011.cvc \ arith-int-012.cvc \ - arith-int-013.cvc \ arith-int-022.cvc \ arith-int-024.cvc \ arith-int-042.cvc \ @@ -27,9 +28,6 @@ TESTS = \ arith-int-085.cvc \ arith-int-097.cvc -#failing tests -# arith-int-048.cvc - EXTRA_DIST = $(TESTS) \ arith-int-001.cvc \ arith-int-002.cvc \ @@ -39,7 +37,6 @@ EXTRA_DIST = $(TESTS) \ arith-int-008.cvc \ arith-int-009.cvc \ arith-int-010.cvc \ - arith-int-011.cvc \ arith-int-014.cvc \ arith-int-015.cvc \ arith-int-016.cvc \ @@ -118,6 +115,10 @@ EXTRA_DIST = $(TESTS) \ arith-int-099.cvc \ arith-int-100.cvc +FAILING_TESTS = \ + arith-int-048.cvc \ + arith-int-013.cvc + #if CVC4_BUILD_PROFILE_COMPETITION #else #TESTS += \ diff --git a/test/regress/regress0/uflia/Makefile.am b/test/regress/regress0/uflia/Makefile.am index 11f1f8da3..a2349e15a 100644 --- a/test/regress/regress0/uflia/Makefile.am +++ b/test/regress/regress0/uflia/Makefile.am @@ -12,7 +12,9 @@ MAKEFLAGS = -k # put it below in "TESTS +=" # Regression tests for SMT inputs -SMT_TESTS = +SMT_TESTS = \ + xs-09-16-3-4-1-5.smt \ + error0.smt2 # Regression tests for SMT2 inputs SMT2_TESTS = diff --git a/test/regress/regress0/uflia/error0.smt2 b/test/regress/regress0/uflia/error0.smt2 new file mode 100644 index 000000000..614645cb4 --- /dev/null +++ b/test/regress/regress0/uflia/error0.smt2 @@ -0,0 +1,1281 @@ + +(set-logic QF_UFLIA) +(declare-sort U 0) +(set-info :source "Currently this example asserts both a literal and its negation to a theory.") +(set-info :status unsat) +(set-info :category industrial) +(set-info :difficulty 0) +(declare-fun arg0 () Int) +(declare-fun arg1 () Int) +(declare-fun fmt0 () Int) +(declare-fun fmt1 () Int) +(declare-fun distance () Int) +(declare-fun fmt_length () Int) +(declare-fun adr_lo () Int) +(declare-fun adr_medlo () Int) +(declare-fun adr_medhi () Int) +(declare-fun adr_hi () Int) +(declare-fun format (Int) Int) +(declare-fun percent () Int) +(declare-fun s () Int) +(declare-fun s_count (Int) Int) +(declare-fun x () Int) +(declare-fun x_count (Int) Int) +(assert (<= (+ arg0 (* (- 1) arg1) (* 4 (s_count (+ (- 2) (* (- 1) fmt0) fmt1))) (* 4 (x_count (+ (- 2) (* (- 1) fmt0) fmt1)))) 0)) +(assert (>= (+ arg0 (* (- 1) arg1) (* 4 (s_count (+ (- 2) (* (- 1) fmt0) fmt1))) (* 4 (x_count (+ (- 2) (* (- 1) fmt0) fmt1)))) 0)) +(assert (<= adr_hi 6)) +(assert (>= adr_hi 6)) +(assert (<= x 120)) +(assert (>= x 120)) +(assert (<= adr_medhi 5)) +(assert (>= adr_medhi 5)) +(assert (<= percent 37)) +(assert (>= percent 37)) +(assert (<= s 115)) +(assert (>= s 115)) +(assert (<= (+ arg0 (* (- 1) arg1) distance) 0)) +(assert (not (<= (+ arg0 (* (- 1) arg1) distance fmt_length) 4))) +(assert (<= adr_medlo 4)) +(assert (>= adr_medlo 4)) +(assert (<= adr_lo 3)) +(assert (>= adr_lo 3)) +(assert (not (>= (+ fmt0 (* (- 1) fmt1)) (- 1)))) +(assert (<= distance 18)) +(assert (>= distance 18)) +(assert (<= fmt_length 13)) +(assert (>= fmt_length 13)) +(assert (>= (+ arg1 (* (- 1) fmt0)) 0)) +(assert (not (<= (+ fmt0 (* (- 1) fmt1) fmt_length) 1))) +(assert (<= fmt0 0)) +(assert (>= fmt0 0)) +(assert (<= (+ arg0 (* (- 1) fmt0) distance) 0)) +(assert (>= (+ arg0 (* (- 1) fmt0) distance) 0)) +(assert (<= distance 18)) +(assert (>= distance 18)) +(assert (<= fmt_length 13)) +(assert (>= fmt_length 13)) +(assert (<= adr_lo 3)) +(assert (>= adr_lo 3)) +(assert (<= adr_medlo 4)) +(assert (>= adr_medlo 4)) +(assert (<= adr_medhi 5)) +(assert (>= adr_medhi 5)) +(assert (<= adr_hi 6)) +(assert (>= adr_hi 6)) +(assert (<= percent 37)) +(assert (>= percent 37)) +(assert (<= s 115)) +(assert (>= s 115)) +(assert (<= x 120)) +(assert (>= x 120)) +(assert (<= fmt0 0)) +(assert (>= fmt0 0)) +(assert (<= (+ arg0 (* (- 1) fmt0) distance) 0)) +(assert (>= (+ arg0 (* (- 1) fmt0) distance) 0)) +(assert (>= (+ arg1 (* (- 1) fmt0)) 0)) +(assert (not (<= (+ fmt0 (* (- 1) fmt1) fmt_length) 1))) +(assert (not (>= (+ fmt0 (* (- 1) fmt1)) (- 1)))) +(assert (<= (+ arg0 (* (- 1) arg1) distance) 0)) +(assert (not (<= (+ arg0 (* (- 1) arg1) distance fmt_length) 4))) +(assert (<= (+ arg0 (* (- 1) arg1) (* 4 (s_count (+ (- 2) (* (- 1) fmt0) fmt1))) (* 4 (x_count (+ (- 2) (* (- 1) fmt0) fmt1)))) 0)) +(assert (>= (+ arg0 (* (- 1) arg1) (* 4 (s_count (+ (- 2) (* (- 1) fmt0) fmt1))) (* 4 (x_count (+ (- 2) (* (- 1) fmt0) fmt1)))) 0)) +(assert (or (not (and (<= (+ fmt0 (* (- 1) fmt1)) 0) (>= (+ fmt0 (* (- 1) fmt1)) 0))) (<= (+ fmt0 (* (- 1) fmt1)) 0))) +(assert (or (not (and (<= (+ fmt0 (* (- 1) fmt1)) 0) (>= (+ fmt0 (* (- 1) fmt1)) 0))) (>= (+ fmt0 (* (- 1) fmt1)) 0))) +(assert (or (not (<= (+ fmt0 (* (- 1) fmt1)) 0)) (not (>= (+ fmt0 (* (- 1) fmt1)) 0)) (and (<= (+ fmt0 (* (- 1) fmt1)) 0) (>= (+ fmt0 (* (- 1) fmt1)) 0)))) +(assert (or (not (and (<= (+ fmt0 (* (- 1) fmt1)) (- 1)) (>= (+ fmt0 (* (- 1) fmt1)) (- 1)))) (<= (+ fmt0 (* (- 1) fmt1)) (- 1)))) +(assert (or (not (and (<= (+ fmt0 (* (- 1) fmt1)) (- 1)) (>= (+ fmt0 (* (- 1) fmt1)) (- 1)))) (>= (+ fmt0 (* (- 1) fmt1)) (- 1)))) +(assert (or (not (<= (+ fmt0 (* (- 1) fmt1)) (- 1))) (not (>= (+ fmt0 (* (- 1) fmt1)) (- 1))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 1)) (>= (+ fmt0 (* (- 1) fmt1)) (- 1))))) +(assert (or (or (and (<= (+ fmt0 (* (- 1) fmt1)) 0) (>= (+ fmt0 (* (- 1) fmt1)) 0)) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 1)) (>= (+ fmt0 (* (- 1) fmt1)) (- 1)))) (not (and (<= (+ fmt0 (* (- 1) fmt1)) 0) (>= (+ fmt0 (* (- 1) fmt1)) 0))))) +(assert (or (or (and (<= (+ fmt0 (* (- 1) fmt1)) 0) (>= (+ fmt0 (* (- 1) fmt1)) 0)) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 1)) (>= (+ fmt0 (* (- 1) fmt1)) (- 1)))) (not (and (<= (+ fmt0 (* (- 1) fmt1)) (- 1)) (>= (+ fmt0 (* (- 1) fmt1)) (- 1)))))) +(assert (or (and (<= (+ fmt0 (* (- 1) fmt1)) 0) (>= (+ fmt0 (* (- 1) fmt1)) 0)) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 1)) (>= (+ fmt0 (* (- 1) fmt1)) (- 1))) (not (or (and (<= (+ fmt0 (* (- 1) fmt1)) 0) (>= (+ fmt0 (* (- 1) fmt1)) 0)) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 1)) (>= (+ fmt0 (* (- 1) fmt1)) (- 1))))))) +(assert (or (not (and (<= (+ fmt0 (* (- 1) fmt1)) (- 2)) (>= (+ fmt0 (* (- 1) fmt1)) (- 2)))) (<= (+ fmt0 (* (- 1) fmt1)) (- 2)))) +(assert (or (not (and (<= (+ fmt0 (* (- 1) fmt1)) (- 2)) (>= (+ fmt0 (* (- 1) fmt1)) (- 2)))) (>= (+ fmt0 (* (- 1) fmt1)) (- 2)))) +(assert (or (not (<= (+ fmt0 (* (- 1) fmt1)) (- 2))) (not (>= (+ fmt0 (* (- 1) fmt1)) (- 2))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 2)) (>= (+ fmt0 (* (- 1) fmt1)) (- 2))))) +(assert (or (or (or (and (<= (+ fmt0 (* (- 1) fmt1)) 0) (>= (+ fmt0 (* (- 1) fmt1)) 0)) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 1)) (>= (+ fmt0 (* (- 1) fmt1)) (- 1)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 2)) (>= (+ fmt0 (* (- 1) fmt1)) (- 2)))) (not (or (and (<= (+ fmt0 (* (- 1) fmt1)) 0) (>= (+ fmt0 (* (- 1) fmt1)) 0)) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 1)) (>= (+ fmt0 (* (- 1) fmt1)) (- 1))))))) +(assert (or (or (or (and (<= (+ fmt0 (* (- 1) fmt1)) 0) (>= (+ fmt0 (* (- 1) fmt1)) 0)) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 1)) (>= (+ fmt0 (* (- 1) fmt1)) (- 1)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 2)) (>= (+ fmt0 (* (- 1) fmt1)) (- 2)))) (not (and (<= (+ fmt0 (* (- 1) fmt1)) (- 2)) (>= (+ fmt0 (* (- 1) fmt1)) (- 2)))))) +(assert (or (or (and (<= (+ fmt0 (* (- 1) fmt1)) 0) (>= (+ fmt0 (* (- 1) fmt1)) 0)) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 1)) (>= (+ fmt0 (* (- 1) fmt1)) (- 1)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 2)) (>= (+ fmt0 (* (- 1) fmt1)) (- 2))) (not (or (or (and (<= (+ fmt0 (* (- 1) fmt1)) 0) (>= (+ fmt0 (* (- 1) fmt1)) 0)) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 1)) (>= (+ fmt0 (* (- 1) fmt1)) (- 1)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 2)) (>= (+ fmt0 (* (- 1) fmt1)) (- 2))))))) +(assert (or (not (and (<= (+ fmt0 (* (- 1) fmt1)) (- 3)) (>= (+ fmt0 (* (- 1) fmt1)) (- 3)))) (<= (+ fmt0 (* (- 1) fmt1)) (- 3)))) +(assert (or (not (and (<= (+ fmt0 (* (- 1) fmt1)) (- 3)) (>= (+ fmt0 (* (- 1) fmt1)) (- 3)))) (>= (+ fmt0 (* (- 1) fmt1)) (- 3)))) +(assert (or (not (<= (+ fmt0 (* (- 1) fmt1)) (- 3))) (not (>= (+ fmt0 (* (- 1) fmt1)) (- 3))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 3)) (>= (+ fmt0 (* (- 1) fmt1)) (- 3))))) +(assert (or (or (or (or (and (<= (+ fmt0 (* (- 1) fmt1)) 0) (>= (+ fmt0 (* (- 1) fmt1)) 0)) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 1)) (>= (+ fmt0 (* (- 1) fmt1)) (- 1)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 2)) (>= (+ fmt0 (* (- 1) fmt1)) (- 2)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 3)) (>= (+ fmt0 (* (- 1) fmt1)) (- 3)))) (not (or (or (and (<= (+ fmt0 (* (- 1) fmt1)) 0) (>= (+ fmt0 (* (- 1) fmt1)) 0)) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 1)) (>= (+ fmt0 (* (- 1) fmt1)) (- 1)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 2)) (>= (+ fmt0 (* (- 1) fmt1)) (- 2))))))) +(assert (or (or (or (or (and (<= (+ fmt0 (* (- 1) fmt1)) 0) (>= (+ fmt0 (* (- 1) fmt1)) 0)) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 1)) (>= (+ fmt0 (* (- 1) fmt1)) (- 1)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 2)) (>= (+ fmt0 (* (- 1) fmt1)) (- 2)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 3)) (>= (+ fmt0 (* (- 1) fmt1)) (- 3)))) (not (and (<= (+ fmt0 (* (- 1) fmt1)) (- 3)) (>= (+ fmt0 (* (- 1) fmt1)) (- 3)))))) +(assert (or (or (or (and (<= (+ fmt0 (* (- 1) fmt1)) 0) (>= (+ fmt0 (* (- 1) fmt1)) 0)) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 1)) (>= (+ fmt0 (* (- 1) fmt1)) (- 1)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 2)) (>= (+ fmt0 (* (- 1) fmt1)) (- 2)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 3)) (>= (+ fmt0 (* (- 1) fmt1)) (- 3))) (not (or (or (or (and (<= (+ fmt0 (* (- 1) fmt1)) 0) (>= (+ fmt0 (* (- 1) fmt1)) 0)) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 1)) (>= (+ fmt0 (* (- 1) fmt1)) (- 1)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 2)) (>= (+ fmt0 (* (- 1) fmt1)) (- 2)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 3)) (>= (+ fmt0 (* (- 1) fmt1)) (- 3))))))) +(assert (or (not (and (<= (+ fmt0 (* (- 1) fmt1)) (- 4)) (>= (+ fmt0 (* (- 1) fmt1)) (- 4)))) (<= (+ fmt0 (* (- 1) fmt1)) (- 4)))) +(assert (or (not (and (<= (+ fmt0 (* (- 1) fmt1)) (- 4)) (>= (+ fmt0 (* (- 1) fmt1)) (- 4)))) (>= (+ fmt0 (* (- 1) fmt1)) (- 4)))) +(assert (or (not (<= (+ fmt0 (* (- 1) fmt1)) (- 4))) (not (>= (+ fmt0 (* (- 1) fmt1)) (- 4))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 4)) (>= (+ fmt0 (* (- 1) fmt1)) (- 4))))) +(assert (or (or (or (or (or (and (<= (+ fmt0 (* (- 1) fmt1)) 0) (>= (+ fmt0 (* (- 1) fmt1)) 0)) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 1)) (>= (+ fmt0 (* (- 1) fmt1)) (- 1)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 2)) (>= (+ fmt0 (* (- 1) fmt1)) (- 2)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 3)) (>= (+ fmt0 (* (- 1) fmt1)) (- 3)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 4)) (>= (+ fmt0 (* (- 1) fmt1)) (- 4)))) (not (or (or (or (and (<= (+ fmt0 (* (- 1) fmt1)) 0) (>= (+ fmt0 (* (- 1) fmt1)) 0)) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 1)) (>= (+ fmt0 (* (- 1) fmt1)) (- 1)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 2)) (>= (+ fmt0 (* (- 1) fmt1)) (- 2)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 3)) (>= (+ fmt0 (* (- 1) fmt1)) (- 3))))))) +(assert (or (or (or (or (or (and (<= (+ fmt0 (* (- 1) fmt1)) 0) (>= (+ fmt0 (* (- 1) fmt1)) 0)) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 1)) (>= (+ fmt0 (* (- 1) fmt1)) (- 1)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 2)) (>= (+ fmt0 (* (- 1) fmt1)) (- 2)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 3)) (>= (+ fmt0 (* (- 1) fmt1)) (- 3)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 4)) (>= (+ fmt0 (* (- 1) fmt1)) (- 4)))) (not (and (<= (+ fmt0 (* (- 1) fmt1)) (- 4)) (>= (+ fmt0 (* (- 1) fmt1)) (- 4)))))) +(assert (or (or (or (or (and (<= (+ fmt0 (* (- 1) fmt1)) 0) (>= (+ fmt0 (* (- 1) fmt1)) 0)) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 1)) (>= (+ fmt0 (* (- 1) fmt1)) (- 1)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 2)) (>= (+ fmt0 (* (- 1) fmt1)) (- 2)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 3)) (>= (+ fmt0 (* (- 1) fmt1)) (- 3)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 4)) (>= (+ fmt0 (* (- 1) fmt1)) (- 4))) (not (or (or (or (or (and (<= (+ fmt0 (* (- 1) fmt1)) 0) (>= (+ fmt0 (* (- 1) fmt1)) 0)) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 1)) (>= (+ fmt0 (* (- 1) fmt1)) (- 1)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 2)) (>= (+ fmt0 (* (- 1) fmt1)) (- 2)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 3)) (>= (+ fmt0 (* (- 1) fmt1)) (- 3)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 4)) (>= (+ fmt0 (* (- 1) fmt1)) (- 4))))))) +(assert (or (not (and (<= (+ fmt0 (* (- 1) fmt1)) (- 5)) (>= (+ fmt0 (* (- 1) fmt1)) (- 5)))) (<= (+ fmt0 (* (- 1) fmt1)) (- 5)))) +(assert (or (not (and (<= (+ fmt0 (* (- 1) fmt1)) (- 5)) (>= (+ fmt0 (* (- 1) fmt1)) (- 5)))) (>= (+ fmt0 (* (- 1) fmt1)) (- 5)))) +(assert (or (not (<= (+ fmt0 (* (- 1) fmt1)) (- 5))) (not (>= (+ fmt0 (* (- 1) fmt1)) (- 5))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 5)) (>= (+ fmt0 (* (- 1) fmt1)) (- 5))))) +(assert (or (or (or (or (or (or (and (<= (+ fmt0 (* (- 1) fmt1)) 0) (>= (+ fmt0 (* (- 1) fmt1)) 0)) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 1)) (>= (+ fmt0 (* (- 1) fmt1)) (- 1)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 2)) (>= (+ fmt0 (* (- 1) fmt1)) (- 2)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 3)) (>= (+ fmt0 (* (- 1) fmt1)) (- 3)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 4)) (>= (+ fmt0 (* (- 1) fmt1)) (- 4)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 5)) (>= (+ fmt0 (* (- 1) fmt1)) (- 5)))) (not (or (or (or (or (and (<= (+ fmt0 (* (- 1) fmt1)) 0) (>= (+ fmt0 (* (- 1) fmt1)) 0)) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 1)) (>= (+ fmt0 (* (- 1) fmt1)) (- 1)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 2)) (>= (+ fmt0 (* (- 1) fmt1)) (- 2)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 3)) (>= (+ fmt0 (* (- 1) fmt1)) (- 3)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 4)) (>= (+ fmt0 (* (- 1) fmt1)) (- 4))))))) +(assert (or (or (or (or (or (or (and (<= (+ fmt0 (* (- 1) fmt1)) 0) (>= (+ fmt0 (* (- 1) fmt1)) 0)) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 1)) (>= (+ fmt0 (* (- 1) fmt1)) (- 1)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 2)) (>= (+ fmt0 (* (- 1) fmt1)) (- 2)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 3)) (>= (+ fmt0 (* (- 1) fmt1)) (- 3)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 4)) (>= (+ fmt0 (* (- 1) fmt1)) (- 4)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 5)) (>= (+ fmt0 (* (- 1) fmt1)) (- 5)))) (not (and (<= (+ fmt0 (* (- 1) fmt1)) (- 5)) (>= (+ fmt0 (* (- 1) fmt1)) (- 5)))))) +(assert (or (or (or (or (or (and (<= (+ fmt0 (* (- 1) fmt1)) 0) (>= (+ fmt0 (* (- 1) fmt1)) 0)) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 1)) (>= (+ fmt0 (* (- 1) fmt1)) (- 1)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 2)) (>= (+ fmt0 (* (- 1) fmt1)) (- 2)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 3)) (>= (+ fmt0 (* (- 1) fmt1)) (- 3)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 4)) (>= (+ fmt0 (* (- 1) fmt1)) (- 4)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 5)) (>= (+ fmt0 (* (- 1) fmt1)) (- 5))) (not (or (or (or (or (or (and (<= (+ fmt0 (* (- 1) fmt1)) 0) (>= (+ fmt0 (* (- 1) fmt1)) 0)) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 1)) (>= (+ fmt0 (* (- 1) fmt1)) (- 1)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 2)) (>= (+ fmt0 (* (- 1) fmt1)) (- 2)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 3)) (>= (+ fmt0 (* (- 1) fmt1)) (- 3)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 4)) (>= (+ fmt0 (* (- 1) fmt1)) (- 4)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 5)) (>= (+ fmt0 (* (- 1) fmt1)) (- 5))))))) +(assert (or (not (and (<= (+ fmt0 (* (- 1) fmt1)) (- 6)) (>= (+ fmt0 (* (- 1) fmt1)) (- 6)))) (<= (+ fmt0 (* (- 1) fmt1)) (- 6)))) +(assert (or (not (and (<= (+ fmt0 (* (- 1) fmt1)) (- 6)) (>= (+ fmt0 (* (- 1) fmt1)) (- 6)))) (>= (+ fmt0 (* (- 1) fmt1)) (- 6)))) +(assert (or (not (<= (+ fmt0 (* (- 1) fmt1)) (- 6))) (not (>= (+ fmt0 (* (- 1) fmt1)) (- 6))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 6)) (>= (+ fmt0 (* (- 1) fmt1)) (- 6))))) +(assert (or (or (or (or (or (or (or (and (<= (+ fmt0 (* (- 1) fmt1)) 0) (>= (+ fmt0 (* (- 1) fmt1)) 0)) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 1)) (>= (+ fmt0 (* (- 1) fmt1)) (- 1)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 2)) (>= (+ fmt0 (* (- 1) fmt1)) (- 2)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 3)) (>= (+ fmt0 (* (- 1) fmt1)) (- 3)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 4)) (>= (+ fmt0 (* (- 1) fmt1)) (- 4)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 5)) (>= (+ fmt0 (* (- 1) fmt1)) (- 5)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 6)) (>= (+ fmt0 (* (- 1) fmt1)) (- 6)))) (not (or (or (or (or (or (and (<= (+ fmt0 (* (- 1) fmt1)) 0) (>= (+ fmt0 (* (- 1) fmt1)) 0)) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 1)) (>= (+ fmt0 (* (- 1) fmt1)) (- 1)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 2)) (>= (+ fmt0 (* (- 1) fmt1)) (- 2)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 3)) (>= (+ fmt0 (* (- 1) fmt1)) (- 3)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 4)) (>= (+ fmt0 (* (- 1) fmt1)) (- 4)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 5)) (>= (+ fmt0 (* (- 1) fmt1)) (- 5))))))) +(assert (or (or (or (or (or (or (or (and (<= (+ fmt0 (* (- 1) fmt1)) 0) (>= (+ fmt0 (* (- 1) fmt1)) 0)) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 1)) (>= (+ fmt0 (* (- 1) fmt1)) (- 1)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 2)) (>= (+ fmt0 (* (- 1) fmt1)) (- 2)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 3)) (>= (+ fmt0 (* (- 1) fmt1)) (- 3)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 4)) (>= (+ fmt0 (* (- 1) fmt1)) (- 4)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 5)) (>= (+ fmt0 (* (- 1) fmt1)) (- 5)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 6)) (>= (+ fmt0 (* (- 1) fmt1)) (- 6)))) (not (and (<= (+ fmt0 (* (- 1) fmt1)) (- 6)) (>= (+ fmt0 (* (- 1) fmt1)) (- 6)))))) +(assert (or (or (or (or (or (or (and (<= (+ fmt0 (* (- 1) fmt1)) 0) (>= (+ fmt0 (* (- 1) fmt1)) 0)) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 1)) (>= (+ fmt0 (* (- 1) fmt1)) (- 1)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 2)) (>= (+ fmt0 (* (- 1) fmt1)) (- 2)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 3)) (>= (+ fmt0 (* (- 1) fmt1)) (- 3)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 4)) (>= (+ fmt0 (* (- 1) fmt1)) (- 4)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 5)) (>= (+ fmt0 (* (- 1) fmt1)) (- 5)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 6)) (>= (+ fmt0 (* (- 1) fmt1)) (- 6))) (not (or (or (or (or (or (or (and (<= (+ fmt0 (* (- 1) fmt1)) 0) (>= (+ fmt0 (* (- 1) fmt1)) 0)) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 1)) (>= (+ fmt0 (* (- 1) fmt1)) (- 1)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 2)) (>= (+ fmt0 (* (- 1) fmt1)) (- 2)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 3)) (>= (+ fmt0 (* (- 1) fmt1)) (- 3)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 4)) (>= (+ fmt0 (* (- 1) fmt1)) (- 4)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 5)) (>= (+ fmt0 (* (- 1) fmt1)) (- 5)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 6)) (>= (+ fmt0 (* (- 1) fmt1)) (- 6))))))) +(assert (or (not (and (<= (+ fmt0 (* (- 1) fmt1)) (- 7)) (>= (+ fmt0 (* (- 1) fmt1)) (- 7)))) (<= (+ fmt0 (* (- 1) fmt1)) (- 7)))) +(assert (or (not (and (<= (+ fmt0 (* (- 1) fmt1)) (- 7)) (>= (+ fmt0 (* (- 1) fmt1)) (- 7)))) (>= (+ fmt0 (* (- 1) fmt1)) (- 7)))) +(assert (or (not (<= (+ fmt0 (* (- 1) fmt1)) (- 7))) (not (>= (+ fmt0 (* (- 1) fmt1)) (- 7))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 7)) (>= (+ fmt0 (* (- 1) fmt1)) (- 7))))) +(assert (or (or (or (or (or (or (or (or (and (<= (+ fmt0 (* (- 1) fmt1)) 0) (>= (+ fmt0 (* (- 1) fmt1)) 0)) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 1)) (>= (+ fmt0 (* (- 1) fmt1)) (- 1)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 2)) (>= (+ fmt0 (* (- 1) fmt1)) (- 2)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 3)) (>= (+ fmt0 (* (- 1) fmt1)) (- 3)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 4)) (>= (+ fmt0 (* (- 1) fmt1)) (- 4)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 5)) (>= (+ fmt0 (* (- 1) fmt1)) (- 5)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 6)) (>= (+ fmt0 (* (- 1) fmt1)) (- 6)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 7)) (>= (+ fmt0 (* (- 1) fmt1)) (- 7)))) (not (or (or (or (or (or (or (and (<= (+ fmt0 (* (- 1) fmt1)) 0) (>= (+ fmt0 (* (- 1) fmt1)) 0)) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 1)) (>= (+ fmt0 (* (- 1) fmt1)) (- 1)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 2)) (>= (+ fmt0 (* (- 1) fmt1)) (- 2)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 3)) (>= (+ fmt0 (* (- 1) fmt1)) (- 3)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 4)) (>= (+ fmt0 (* (- 1) fmt1)) (- 4)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 5)) (>= (+ fmt0 (* (- 1) fmt1)) (- 5)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 6)) (>= (+ fmt0 (* (- 1) fmt1)) (- 6))))))) +(assert (or (or (or (or (or (or (or (or (and (<= (+ fmt0 (* (- 1) fmt1)) 0) (>= (+ fmt0 (* (- 1) fmt1)) 0)) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 1)) (>= (+ fmt0 (* (- 1) fmt1)) (- 1)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 2)) (>= (+ fmt0 (* (- 1) fmt1)) (- 2)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 3)) (>= (+ fmt0 (* (- 1) fmt1)) (- 3)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 4)) (>= (+ fmt0 (* (- 1) fmt1)) (- 4)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 5)) (>= (+ fmt0 (* (- 1) fmt1)) (- 5)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 6)) (>= (+ fmt0 (* (- 1) fmt1)) (- 6)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 7)) (>= (+ fmt0 (* (- 1) fmt1)) (- 7)))) (not (and (<= (+ fmt0 (* (- 1) fmt1)) (- 7)) (>= (+ fmt0 (* (- 1) fmt1)) (- 7)))))) +(assert (or (or (or (or (or (or (or (and (<= (+ fmt0 (* (- 1) fmt1)) 0) (>= (+ fmt0 (* (- 1) fmt1)) 0)) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 1)) (>= (+ fmt0 (* (- 1) fmt1)) (- 1)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 2)) (>= (+ fmt0 (* (- 1) fmt1)) (- 2)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 3)) (>= (+ fmt0 (* (- 1) fmt1)) (- 3)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 4)) (>= (+ fmt0 (* (- 1) fmt1)) (- 4)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 5)) (>= (+ fmt0 (* (- 1) fmt1)) (- 5)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 6)) (>= (+ fmt0 (* (- 1) fmt1)) (- 6)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 7)) (>= (+ fmt0 (* (- 1) fmt1)) (- 7))) (not (or (or (or (or (or (or (or (and (<= (+ fmt0 (* (- 1) fmt1)) 0) (>= (+ fmt0 (* (- 1) fmt1)) 0)) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 1)) (>= (+ fmt0 (* (- 1) fmt1)) (- 1)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 2)) (>= (+ fmt0 (* (- 1) fmt1)) (- 2)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 3)) (>= (+ fmt0 (* (- 1) fmt1)) (- 3)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 4)) (>= (+ fmt0 (* (- 1) fmt1)) (- 4)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 5)) (>= (+ fmt0 (* (- 1) fmt1)) (- 5)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 6)) (>= (+ fmt0 (* (- 1) fmt1)) (- 6)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 7)) (>= (+ fmt0 (* (- 1) fmt1)) (- 7))))))) +(assert (or (not (and (<= (+ fmt0 (* (- 1) fmt1)) (- 8)) (>= (+ fmt0 (* (- 1) fmt1)) (- 8)))) (<= (+ fmt0 (* (- 1) fmt1)) (- 8)))) +(assert (or (not (and (<= (+ fmt0 (* (- 1) fmt1)) (- 8)) (>= (+ fmt0 (* (- 1) fmt1)) (- 8)))) (>= (+ fmt0 (* (- 1) fmt1)) (- 8)))) +(assert (or (not (<= (+ fmt0 (* (- 1) fmt1)) (- 8))) (not (>= (+ fmt0 (* (- 1) fmt1)) (- 8))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 8)) (>= (+ fmt0 (* (- 1) fmt1)) (- 8))))) +(assert (or (or (or (or (or (or (or (or (or (and (<= (+ fmt0 (* (- 1) fmt1)) 0) (>= (+ fmt0 (* (- 1) fmt1)) 0)) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 1)) (>= (+ fmt0 (* (- 1) fmt1)) (- 1)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 2)) (>= (+ fmt0 (* (- 1) fmt1)) (- 2)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 3)) (>= (+ fmt0 (* (- 1) fmt1)) (- 3)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 4)) (>= (+ fmt0 (* (- 1) fmt1)) (- 4)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 5)) (>= (+ fmt0 (* (- 1) fmt1)) (- 5)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 6)) (>= (+ fmt0 (* (- 1) fmt1)) (- 6)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 7)) (>= (+ fmt0 (* (- 1) fmt1)) (- 7)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 8)) (>= (+ fmt0 (* (- 1) fmt1)) (- 8)))) (not (or (or (or (or (or (or (or (and (<= (+ fmt0 (* (- 1) fmt1)) 0) (>= (+ fmt0 (* (- 1) fmt1)) 0)) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 1)) (>= (+ fmt0 (* (- 1) fmt1)) (- 1)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 2)) (>= (+ fmt0 (* (- 1) fmt1)) (- 2)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 3)) (>= (+ fmt0 (* (- 1) fmt1)) (- 3)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 4)) (>= (+ fmt0 (* (- 1) fmt1)) (- 4)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 5)) (>= (+ fmt0 (* (- 1) fmt1)) (- 5)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 6)) (>= (+ fmt0 (* (- 1) fmt1)) (- 6)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 7)) (>= (+ fmt0 (* (- 1) fmt1)) (- 7))))))) +(assert (or (or (or (or (or (or (or (or (or (and (<= (+ fmt0 (* (- 1) fmt1)) 0) (>= (+ fmt0 (* (- 1) fmt1)) 0)) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 1)) (>= (+ fmt0 (* (- 1) fmt1)) (- 1)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 2)) (>= (+ fmt0 (* (- 1) fmt1)) (- 2)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 3)) (>= (+ fmt0 (* (- 1) fmt1)) (- 3)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 4)) (>= (+ fmt0 (* (- 1) fmt1)) (- 4)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 5)) (>= (+ fmt0 (* (- 1) fmt1)) (- 5)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 6)) (>= (+ fmt0 (* (- 1) fmt1)) (- 6)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 7)) (>= (+ fmt0 (* (- 1) fmt1)) (- 7)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 8)) (>= (+ fmt0 (* (- 1) fmt1)) (- 8)))) (not (and (<= (+ fmt0 (* (- 1) fmt1)) (- 8)) (>= (+ fmt0 (* (- 1) fmt1)) (- 8)))))) +(assert (or (or (or (or (or (or (or (or (and (<= (+ fmt0 (* (- 1) fmt1)) 0) (>= (+ fmt0 (* (- 1) fmt1)) 0)) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 1)) (>= (+ fmt0 (* (- 1) fmt1)) (- 1)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 2)) (>= (+ fmt0 (* (- 1) fmt1)) (- 2)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 3)) (>= (+ fmt0 (* (- 1) fmt1)) (- 3)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 4)) (>= (+ fmt0 (* (- 1) fmt1)) (- 4)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 5)) (>= (+ fmt0 (* (- 1) fmt1)) (- 5)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 6)) (>= (+ fmt0 (* (- 1) fmt1)) (- 6)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 7)) (>= (+ fmt0 (* (- 1) fmt1)) (- 7)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 8)) (>= (+ fmt0 (* (- 1) fmt1)) (- 8))) (not (or (or (or (or (or (or (or (or (and (<= (+ fmt0 (* (- 1) fmt1)) 0) (>= (+ fmt0 (* (- 1) fmt1)) 0)) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 1)) (>= (+ fmt0 (* (- 1) fmt1)) (- 1)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 2)) (>= (+ fmt0 (* (- 1) fmt1)) (- 2)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 3)) (>= (+ fmt0 (* (- 1) fmt1)) (- 3)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 4)) (>= (+ fmt0 (* (- 1) fmt1)) (- 4)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 5)) (>= (+ fmt0 (* (- 1) fmt1)) (- 5)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 6)) (>= (+ fmt0 (* (- 1) fmt1)) (- 6)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 7)) (>= (+ fmt0 (* (- 1) fmt1)) (- 7)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 8)) (>= (+ fmt0 (* (- 1) fmt1)) (- 8))))))) +(assert (or (not (and (<= (+ fmt0 (* (- 1) fmt1)) (- 9)) (>= (+ fmt0 (* (- 1) fmt1)) (- 9)))) (<= (+ fmt0 (* (- 1) fmt1)) (- 9)))) +(assert (or (not (and (<= (+ fmt0 (* (- 1) fmt1)) (- 9)) (>= (+ fmt0 (* (- 1) fmt1)) (- 9)))) (>= (+ fmt0 (* (- 1) fmt1)) (- 9)))) +(assert (or (not (<= (+ fmt0 (* (- 1) fmt1)) (- 9))) (not (>= (+ fmt0 (* (- 1) fmt1)) (- 9))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 9)) (>= (+ fmt0 (* (- 1) fmt1)) (- 9))))) +(assert (or (or (or (or (or (or (or (or (or (or (and (<= (+ fmt0 (* (- 1) fmt1)) 0) (>= (+ fmt0 (* (- 1) fmt1)) 0)) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 1)) (>= (+ fmt0 (* (- 1) fmt1)) (- 1)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 2)) (>= (+ fmt0 (* (- 1) fmt1)) (- 2)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 3)) (>= (+ fmt0 (* (- 1) fmt1)) (- 3)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 4)) (>= (+ fmt0 (* (- 1) fmt1)) (- 4)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 5)) (>= (+ fmt0 (* (- 1) fmt1)) (- 5)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 6)) (>= (+ fmt0 (* (- 1) fmt1)) (- 6)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 7)) (>= (+ fmt0 (* (- 1) fmt1)) (- 7)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 8)) (>= (+ fmt0 (* (- 1) fmt1)) (- 8)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 9)) (>= (+ fmt0 (* (- 1) fmt1)) (- 9)))) (not (or (or (or (or (or (or (or (or (and (<= (+ fmt0 (* (- 1) fmt1)) 0) (>= (+ fmt0 (* (- 1) fmt1)) 0)) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 1)) (>= (+ fmt0 (* (- 1) fmt1)) (- 1)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 2)) (>= (+ fmt0 (* (- 1) fmt1)) (- 2)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 3)) (>= (+ fmt0 (* (- 1) fmt1)) (- 3)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 4)) (>= (+ fmt0 (* (- 1) fmt1)) (- 4)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 5)) (>= (+ fmt0 (* (- 1) fmt1)) (- 5)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 6)) (>= (+ fmt0 (* (- 1) fmt1)) (- 6)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 7)) (>= (+ fmt0 (* (- 1) fmt1)) (- 7)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 8)) (>= (+ fmt0 (* (- 1) fmt1)) (- 8))))))) +(assert (or (or (or (or (or (or (or (or (or (or (and (<= (+ fmt0 (* (- 1) fmt1)) 0) (>= (+ fmt0 (* (- 1) fmt1)) 0)) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 1)) (>= (+ fmt0 (* (- 1) fmt1)) (- 1)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 2)) (>= (+ fmt0 (* (- 1) fmt1)) (- 2)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 3)) (>= (+ fmt0 (* (- 1) fmt1)) (- 3)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 4)) (>= (+ fmt0 (* (- 1) fmt1)) (- 4)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 5)) (>= (+ fmt0 (* (- 1) fmt1)) (- 5)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 6)) (>= (+ fmt0 (* (- 1) fmt1)) (- 6)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 7)) (>= (+ fmt0 (* (- 1) fmt1)) (- 7)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 8)) (>= (+ fmt0 (* (- 1) fmt1)) (- 8)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 9)) (>= (+ fmt0 (* (- 1) fmt1)) (- 9)))) (not (and (<= (+ fmt0 (* (- 1) fmt1)) (- 9)) (>= (+ fmt0 (* (- 1) fmt1)) (- 9)))))) +(assert (or (or (or (or (or (or (or (or (or (and (<= (+ fmt0 (* (- 1) fmt1)) 0) (>= (+ fmt0 (* (- 1) fmt1)) 0)) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 1)) (>= (+ fmt0 (* (- 1) fmt1)) (- 1)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 2)) (>= (+ fmt0 (* (- 1) fmt1)) (- 2)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 3)) (>= (+ fmt0 (* (- 1) fmt1)) (- 3)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 4)) (>= (+ fmt0 (* (- 1) fmt1)) (- 4)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 5)) (>= (+ fmt0 (* (- 1) fmt1)) (- 5)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 6)) (>= (+ fmt0 (* (- 1) fmt1)) (- 6)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 7)) (>= (+ fmt0 (* (- 1) fmt1)) (- 7)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 8)) (>= (+ fmt0 (* (- 1) fmt1)) (- 8)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 9)) (>= (+ fmt0 (* (- 1) fmt1)) (- 9))) (not (or (or (or (or (or (or (or (or (or (and (<= (+ fmt0 (* (- 1) fmt1)) 0) (>= (+ fmt0 (* (- 1) fmt1)) 0)) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 1)) (>= (+ fmt0 (* (- 1) fmt1)) (- 1)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 2)) (>= (+ fmt0 (* (- 1) fmt1)) (- 2)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 3)) (>= (+ fmt0 (* (- 1) fmt1)) (- 3)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 4)) (>= (+ fmt0 (* (- 1) fmt1)) (- 4)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 5)) (>= (+ fmt0 (* (- 1) fmt1)) (- 5)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 6)) (>= (+ fmt0 (* (- 1) fmt1)) (- 6)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 7)) (>= (+ fmt0 (* (- 1) fmt1)) (- 7)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 8)) (>= (+ fmt0 (* (- 1) fmt1)) (- 8)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 9)) (>= (+ fmt0 (* (- 1) fmt1)) (- 9))))))) +(assert (or (not (and (<= (+ fmt0 (* (- 1) fmt1)) (- 10)) (>= (+ fmt0 (* (- 1) fmt1)) (- 10)))) (<= (+ fmt0 (* (- 1) fmt1)) (- 10)))) +(assert (or (not (and (<= (+ fmt0 (* (- 1) fmt1)) (- 10)) (>= (+ fmt0 (* (- 1) fmt1)) (- 10)))) (>= (+ fmt0 (* (- 1) fmt1)) (- 10)))) +(assert (or (not (<= (+ fmt0 (* (- 1) fmt1)) (- 10))) (not (>= (+ fmt0 (* (- 1) fmt1)) (- 10))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 10)) (>= (+ fmt0 (* (- 1) fmt1)) (- 10))))) +(assert (or (or (or (or (or (or (or (or (or (or (or (and (<= (+ fmt0 (* (- 1) fmt1)) 0) (>= (+ fmt0 (* (- 1) fmt1)) 0)) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 1)) (>= (+ fmt0 (* (- 1) fmt1)) (- 1)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 2)) (>= (+ fmt0 (* (- 1) fmt1)) (- 2)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 3)) (>= (+ fmt0 (* (- 1) fmt1)) (- 3)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 4)) (>= (+ fmt0 (* (- 1) fmt1)) (- 4)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 5)) (>= (+ fmt0 (* (- 1) fmt1)) (- 5)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 6)) (>= (+ fmt0 (* (- 1) fmt1)) (- 6)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 7)) (>= (+ fmt0 (* (- 1) fmt1)) (- 7)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 8)) (>= (+ fmt0 (* (- 1) fmt1)) (- 8)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 9)) (>= (+ fmt0 (* (- 1) fmt1)) (- 9)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 10)) (>= (+ fmt0 (* (- 1) fmt1)) (- 10)))) (not (or (or (or (or (or (or (or (or (or (and (<= (+ fmt0 (* (- 1) fmt1)) 0) (>= (+ fmt0 (* (- 1) fmt1)) 0)) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 1)) (>= (+ fmt0 (* (- 1) fmt1)) (- 1)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 2)) (>= (+ fmt0 (* (- 1) fmt1)) (- 2)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 3)) (>= (+ fmt0 (* (- 1) fmt1)) (- 3)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 4)) (>= (+ fmt0 (* (- 1) fmt1)) (- 4)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 5)) (>= (+ fmt0 (* (- 1) fmt1)) (- 5)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 6)) (>= (+ fmt0 (* (- 1) fmt1)) (- 6)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 7)) (>= (+ fmt0 (* (- 1) fmt1)) (- 7)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 8)) (>= (+ fmt0 (* (- 1) fmt1)) (- 8)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 9)) (>= (+ fmt0 (* (- 1) fmt1)) (- 9))))))) +(assert (or (or (or (or (or (or (or (or (or (or (or (and (<= (+ fmt0 (* (- 1) fmt1)) 0) (>= (+ fmt0 (* (- 1) fmt1)) 0)) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 1)) (>= (+ fmt0 (* (- 1) fmt1)) (- 1)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 2)) (>= (+ fmt0 (* (- 1) fmt1)) (- 2)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 3)) (>= (+ fmt0 (* (- 1) fmt1)) (- 3)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 4)) (>= (+ fmt0 (* (- 1) fmt1)) (- 4)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 5)) (>= (+ fmt0 (* (- 1) fmt1)) (- 5)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 6)) (>= (+ fmt0 (* (- 1) fmt1)) (- 6)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 7)) (>= (+ fmt0 (* (- 1) fmt1)) (- 7)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 8)) (>= (+ fmt0 (* (- 1) fmt1)) (- 8)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 9)) (>= (+ fmt0 (* (- 1) fmt1)) (- 9)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 10)) (>= (+ fmt0 (* (- 1) fmt1)) (- 10)))) (not (and (<= (+ fmt0 (* (- 1) fmt1)) (- 10)) (>= (+ fmt0 (* (- 1) fmt1)) (- 10)))))) +(assert (or (or (or (or (or (or (or (or (or (or (and (<= (+ fmt0 (* (- 1) fmt1)) 0) (>= (+ fmt0 (* (- 1) fmt1)) 0)) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 1)) (>= (+ fmt0 (* (- 1) fmt1)) (- 1)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 2)) (>= (+ fmt0 (* (- 1) fmt1)) (- 2)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 3)) (>= (+ fmt0 (* (- 1) fmt1)) (- 3)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 4)) (>= (+ fmt0 (* (- 1) fmt1)) (- 4)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 5)) (>= (+ fmt0 (* (- 1) fmt1)) (- 5)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 6)) (>= (+ fmt0 (* (- 1) fmt1)) (- 6)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 7)) (>= (+ fmt0 (* (- 1) fmt1)) (- 7)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 8)) (>= (+ fmt0 (* (- 1) fmt1)) (- 8)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 9)) (>= (+ fmt0 (* (- 1) fmt1)) (- 9)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 10)) (>= (+ fmt0 (* (- 1) fmt1)) (- 10))) (not (or (or (or (or (or (or (or (or (or (or (and (<= (+ fmt0 (* (- 1) fmt1)) 0) (>= (+ fmt0 (* (- 1) fmt1)) 0)) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 1)) (>= (+ fmt0 (* (- 1) fmt1)) (- 1)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 2)) (>= (+ fmt0 (* (- 1) fmt1)) (- 2)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 3)) (>= (+ fmt0 (* (- 1) fmt1)) (- 3)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 4)) (>= (+ fmt0 (* (- 1) fmt1)) (- 4)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 5)) (>= (+ fmt0 (* (- 1) fmt1)) (- 5)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 6)) (>= (+ fmt0 (* (- 1) fmt1)) (- 6)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 7)) (>= (+ fmt0 (* (- 1) fmt1)) (- 7)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 8)) (>= (+ fmt0 (* (- 1) fmt1)) (- 8)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 9)) (>= (+ fmt0 (* (- 1) fmt1)) (- 9)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 10)) (>= (+ fmt0 (* (- 1) fmt1)) (- 10))))))) +(assert (or (not (and (<= (+ fmt0 (* (- 1) fmt1)) (- 11)) (>= (+ fmt0 (* (- 1) fmt1)) (- 11)))) (<= (+ fmt0 (* (- 1) fmt1)) (- 11)))) +(assert (or (not (and (<= (+ fmt0 (* (- 1) fmt1)) (- 11)) (>= (+ fmt0 (* (- 1) fmt1)) (- 11)))) (>= (+ fmt0 (* (- 1) fmt1)) (- 11)))) +(assert (or (not (<= (+ fmt0 (* (- 1) fmt1)) (- 11))) (not (>= (+ fmt0 (* (- 1) fmt1)) (- 11))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 11)) (>= (+ fmt0 (* (- 1) fmt1)) (- 11))))) +(assert (or (or (or (or (or (or (or (or (or (or (or (or (and (<= (+ fmt0 (* (- 1) fmt1)) 0) (>= (+ fmt0 (* (- 1) fmt1)) 0)) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 1)) (>= (+ fmt0 (* (- 1) fmt1)) (- 1)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 2)) (>= (+ fmt0 (* (- 1) fmt1)) (- 2)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 3)) (>= (+ fmt0 (* (- 1) fmt1)) (- 3)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 4)) (>= (+ fmt0 (* (- 1) fmt1)) (- 4)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 5)) (>= (+ fmt0 (* (- 1) fmt1)) (- 5)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 6)) (>= (+ fmt0 (* (- 1) fmt1)) (- 6)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 7)) (>= (+ fmt0 (* (- 1) fmt1)) (- 7)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 8)) (>= (+ fmt0 (* (- 1) fmt1)) (- 8)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 9)) (>= (+ fmt0 (* (- 1) fmt1)) (- 9)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 10)) (>= (+ fmt0 (* (- 1) fmt1)) (- 10)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 11)) (>= (+ fmt0 (* (- 1) fmt1)) (- 11)))) (not (or (or (or (or (or (or (or (or (or (or (and (<= (+ fmt0 (* (- 1) fmt1)) 0) (>= (+ fmt0 (* (- 1) fmt1)) 0)) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 1)) (>= (+ fmt0 (* (- 1) fmt1)) (- 1)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 2)) (>= (+ fmt0 (* (- 1) fmt1)) (- 2)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 3)) (>= (+ fmt0 (* (- 1) fmt1)) (- 3)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 4)) (>= (+ fmt0 (* (- 1) fmt1)) (- 4)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 5)) (>= (+ fmt0 (* (- 1) fmt1)) (- 5)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 6)) (>= (+ fmt0 (* (- 1) fmt1)) (- 6)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 7)) (>= (+ fmt0 (* (- 1) fmt1)) (- 7)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 8)) (>= (+ fmt0 (* (- 1) fmt1)) (- 8)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 9)) (>= (+ fmt0 (* (- 1) fmt1)) (- 9)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 10)) (>= (+ fmt0 (* (- 1) fmt1)) (- 10))))))) +(assert (or (or (or (or (or (or (or (or (or (or (or (or (and (<= (+ fmt0 (* (- 1) fmt1)) 0) (>= (+ fmt0 (* (- 1) fmt1)) 0)) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 1)) (>= (+ fmt0 (* (- 1) fmt1)) (- 1)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 2)) (>= (+ fmt0 (* (- 1) fmt1)) (- 2)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 3)) (>= (+ fmt0 (* (- 1) fmt1)) (- 3)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 4)) (>= (+ fmt0 (* (- 1) fmt1)) (- 4)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 5)) (>= (+ fmt0 (* (- 1) fmt1)) (- 5)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 6)) (>= (+ fmt0 (* (- 1) fmt1)) (- 6)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 7)) (>= (+ fmt0 (* (- 1) fmt1)) (- 7)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 8)) (>= (+ fmt0 (* (- 1) fmt1)) (- 8)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 9)) (>= (+ fmt0 (* (- 1) fmt1)) (- 9)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 10)) (>= (+ fmt0 (* (- 1) fmt1)) (- 10)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 11)) (>= (+ fmt0 (* (- 1) fmt1)) (- 11)))) (not (and (<= (+ fmt0 (* (- 1) fmt1)) (- 11)) (>= (+ fmt0 (* (- 1) fmt1)) (- 11)))))) +(assert (or (or (or (or (or (or (or (or (or (or (or (and (<= (+ fmt0 (* (- 1) fmt1)) 0) (>= (+ fmt0 (* (- 1) fmt1)) 0)) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 1)) (>= (+ fmt0 (* (- 1) fmt1)) (- 1)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 2)) (>= (+ fmt0 (* (- 1) fmt1)) (- 2)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 3)) (>= (+ fmt0 (* (- 1) fmt1)) (- 3)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 4)) (>= (+ fmt0 (* (- 1) fmt1)) (- 4)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 5)) (>= (+ fmt0 (* (- 1) fmt1)) (- 5)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 6)) (>= (+ fmt0 (* (- 1) fmt1)) (- 6)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 7)) (>= (+ fmt0 (* (- 1) fmt1)) (- 7)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 8)) (>= (+ fmt0 (* (- 1) fmt1)) (- 8)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 9)) (>= (+ fmt0 (* (- 1) fmt1)) (- 9)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 10)) (>= (+ fmt0 (* (- 1) fmt1)) (- 10)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 11)) (>= (+ fmt0 (* (- 1) fmt1)) (- 11))) (not (or (or (or (or (or (or (or (or (or (or (or (and (<= (+ fmt0 (* (- 1) fmt1)) 0) (>= (+ fmt0 (* (- 1) fmt1)) 0)) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 1)) (>= (+ fmt0 (* (- 1) fmt1)) (- 1)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 2)) (>= (+ fmt0 (* (- 1) fmt1)) (- 2)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 3)) (>= (+ fmt0 (* (- 1) fmt1)) (- 3)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 4)) (>= (+ fmt0 (* (- 1) fmt1)) (- 4)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 5)) (>= (+ fmt0 (* (- 1) fmt1)) (- 5)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 6)) (>= (+ fmt0 (* (- 1) fmt1)) (- 6)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 7)) (>= (+ fmt0 (* (- 1) fmt1)) (- 7)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 8)) (>= (+ fmt0 (* (- 1) fmt1)) (- 8)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 9)) (>= (+ fmt0 (* (- 1) fmt1)) (- 9)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 10)) (>= (+ fmt0 (* (- 1) fmt1)) (- 10)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 11)) (>= (+ fmt0 (* (- 1) fmt1)) (- 11))))))) +(assert (or (not (and (<= (+ fmt0 (* (- 1) fmt1)) (- 12)) (>= (+ fmt0 (* (- 1) fmt1)) (- 12)))) (<= (+ fmt0 (* (- 1) fmt1)) (- 12)))) +(assert (or (not (and (<= (+ fmt0 (* (- 1) fmt1)) (- 12)) (>= (+ fmt0 (* (- 1) fmt1)) (- 12)))) (>= (+ fmt0 (* (- 1) fmt1)) (- 12)))) +(assert (or (not (<= (+ fmt0 (* (- 1) fmt1)) (- 12))) (not (>= (+ fmt0 (* (- 1) fmt1)) (- 12))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 12)) (>= (+ fmt0 (* (- 1) fmt1)) (- 12))))) +(assert (or (or (or (or (or (or (or (or (or (or (or (or (and (<= (+ fmt0 (* (- 1) fmt1)) 0) (>= (+ fmt0 (* (- 1) fmt1)) 0)) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 1)) (>= (+ fmt0 (* (- 1) fmt1)) (- 1)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 2)) (>= (+ fmt0 (* (- 1) fmt1)) (- 2)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 3)) (>= (+ fmt0 (* (- 1) fmt1)) (- 3)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 4)) (>= (+ fmt0 (* (- 1) fmt1)) (- 4)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 5)) (>= (+ fmt0 (* (- 1) fmt1)) (- 5)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 6)) (>= (+ fmt0 (* (- 1) fmt1)) (- 6)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 7)) (>= (+ fmt0 (* (- 1) fmt1)) (- 7)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 8)) (>= (+ fmt0 (* (- 1) fmt1)) (- 8)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 9)) (>= (+ fmt0 (* (- 1) fmt1)) (- 9)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 10)) (>= (+ fmt0 (* (- 1) fmt1)) (- 10)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 11)) (>= (+ fmt0 (* (- 1) fmt1)) (- 11)))) (and (<= (+ fmt0 (* (- 1) fmt1)) (- 12)) (>= (+ fmt0 (* (- 1) fmt1)) (- 12))))) +(assert (or (not (and (<= (+ arg1 (* (- 1) fmt0)) 0) (>= (+ arg1 (* (- 1) fmt0)) 0))) (<= (+ arg1 (* (- 1) fmt0)) 0))) +(assert (or (not (and (<= (+ arg1 (* (- 1) fmt0)) 0) (>= (+ arg1 (* (- 1) fmt0)) 0))) (>= (+ arg1 (* (- 1) fmt0)) 0))) +(assert (or (not (<= (+ arg1 (* (- 1) fmt0)) 0)) (not (>= (+ arg1 (* (- 1) fmt0)) 0)) (and (<= (+ arg1 (* (- 1) fmt0)) 0) (>= (+ arg1 (* (- 1) fmt0)) 0)))) +(assert (or (not (and (<= (+ arg1 (* (- 1) fmt0)) 1) (>= (+ arg1 (* (- 1) fmt0)) 1))) (<= (+ arg1 (* (- 1) fmt0)) 1))) +(assert (or (not (and (<= (+ arg1 (* (- 1) fmt0)) 1) (>= (+ arg1 (* (- 1) fmt0)) 1))) (>= (+ arg1 (* (- 1) fmt0)) 1))) +(assert (or (not (<= (+ arg1 (* (- 1) fmt0)) 1)) (not (>= (+ arg1 (* (- 1) fmt0)) 1)) (and (<= (+ arg1 (* (- 1) fmt0)) 1) (>= (+ arg1 (* (- 1) fmt0)) 1)))) +(assert (or (or (and (<= (+ arg1 (* (- 1) fmt0)) 0) (>= (+ arg1 (* (- 1) fmt0)) 0)) (and (<= (+ arg1 (* (- 1) fmt0)) 1) (>= (+ arg1 (* (- 1) fmt0)) 1))) (not (and (<= (+ arg1 (* (- 1) fmt0)) 0) (>= (+ arg1 (* (- 1) fmt0)) 0))))) +(assert (or (or (and (<= (+ arg1 (* (- 1) fmt0)) 0) (>= (+ arg1 (* (- 1) fmt0)) 0)) (and (<= (+ arg1 (* (- 1) fmt0)) 1) (>= (+ arg1 (* (- 1) fmt0)) 1))) (not (and (<= (+ arg1 (* (- 1) fmt0)) 1) (>= (+ arg1 (* (- 1) fmt0)) 1))))) +(assert (or (and (<= (+ arg1 (* (- 1) fmt0)) 0) (>= (+ arg1 (* (- 1) fmt0)) 0)) (and (<= (+ arg1 (* (- 1) fmt0)) 1) (>= (+ arg1 (* (- 1) fmt0)) 1)) (not (or (and (<= (+ arg1 (* (- 1) fmt0)) 0) (>= (+ arg1 (* (- 1) fmt0)) 0)) (and (<= (+ arg1 (* (- 1) fmt0)) 1) (>= (+ arg1 (* (- 1) fmt0)) 1)))))) +(assert (or (not (and (<= (+ arg1 (* (- 1) fmt0)) 2) (>= (+ arg1 (* (- 1) fmt0)) 2))) (<= (+ arg1 (* (- 1) fmt0)) 2))) +(assert (or (not (and (<= (+ arg1 (* (- 1) fmt0)) 2) (>= (+ arg1 (* (- 1) fmt0)) 2))) (>= (+ arg1 (* (- 1) fmt0)) 2))) +(assert (or (not (<= (+ arg1 (* (- 1) fmt0)) 2)) (not (>= (+ arg1 (* (- 1) fmt0)) 2)) (and (<= (+ arg1 (* (- 1) fmt0)) 2) (>= (+ arg1 (* (- 1) fmt0)) 2)))) +(assert (or (or (or (and (<= (+ arg1 (* (- 1) fmt0)) 0) (>= (+ arg1 (* (- 1) fmt0)) 0)) (and (<= (+ arg1 (* (- 1) fmt0)) 1) (>= (+ arg1 (* (- 1) fmt0)) 1))) (and (<= (+ arg1 (* (- 1) fmt0)) 2) (>= (+ arg1 (* (- 1) fmt0)) 2))) (not (or (and (<= (+ arg1 (* (- 1) fmt0)) 0) (>= (+ arg1 (* (- 1) fmt0)) 0)) (and (<= (+ arg1 (* (- 1) fmt0)) 1) (>= (+ arg1 (* (- 1) fmt0)) 1)))))) +(assert (or (or (or (and (<= (+ arg1 (* (- 1) fmt0)) 0) (>= (+ arg1 (* (- 1) fmt0)) 0)) (and (<= (+ arg1 (* (- 1) fmt0)) 1) (>= (+ arg1 (* (- 1) fmt0)) 1))) (and (<= (+ arg1 (* (- 1) fmt0)) 2) (>= (+ arg1 (* (- 1) fmt0)) 2))) (not (and (<= (+ arg1 (* (- 1) fmt0)) 2) (>= (+ arg1 (* (- 1) fmt0)) 2))))) +(assert (or (or (and (<= (+ arg1 (* (- 1) fmt0)) 0) (>= (+ arg1 (* (- 1) fmt0)) 0)) (and (<= (+ arg1 (* (- 1) fmt0)) 1) (>= (+ arg1 (* (- 1) fmt0)) 1))) (and (<= (+ arg1 (* (- 1) fmt0)) 2) (>= (+ arg1 (* (- 1) fmt0)) 2)) (not (or (or (and (<= (+ arg1 (* (- 1) fmt0)) 0) (>= (+ arg1 (* (- 1) fmt0)) 0)) (and (<= (+ arg1 (* (- 1) fmt0)) 1) (>= (+ arg1 (* (- 1) fmt0)) 1))) (and (<= (+ arg1 (* (- 1) fmt0)) 2) (>= (+ arg1 (* (- 1) fmt0)) 2)))))) +(assert (or (not (and (<= (+ arg1 (* (- 1) fmt0)) 3) (>= (+ arg1 (* (- 1) fmt0)) 3))) (<= (+ arg1 (* (- 1) fmt0)) 3))) +(assert (or (not (and (<= (+ arg1 (* (- 1) fmt0)) 3) (>= (+ arg1 (* (- 1) fmt0)) 3))) (>= (+ arg1 (* (- 1) fmt0)) 3))) +(assert (or (not (<= (+ arg1 (* (- 1) fmt0)) 3)) (not (>= (+ arg1 (* (- 1) fmt0)) 3)) (and (<= (+ arg1 (* (- 1) fmt0)) 3) (>= (+ arg1 (* (- 1) fmt0)) 3)))) +(assert (or (or (or (or (and (<= (+ arg1 (* (- 1) fmt0)) 0) (>= (+ arg1 (* (- 1) fmt0)) 0)) (and (<= (+ arg1 (* (- 1) fmt0)) 1) (>= (+ arg1 (* (- 1) fmt0)) 1))) (and (<= (+ arg1 (* (- 1) fmt0)) 2) (>= (+ arg1 (* (- 1) fmt0)) 2))) (and (<= (+ arg1 (* (- 1) fmt0)) 3) (>= (+ arg1 (* (- 1) fmt0)) 3))) (not (or (or (and (<= (+ arg1 (* (- 1) fmt0)) 0) (>= (+ arg1 (* (- 1) fmt0)) 0)) (and (<= (+ arg1 (* (- 1) fmt0)) 1) (>= (+ arg1 (* (- 1) fmt0)) 1))) (and (<= (+ arg1 (* (- 1) fmt0)) 2) (>= (+ arg1 (* (- 1) fmt0)) 2)))))) +(assert (or (or (or (or (and (<= (+ arg1 (* (- 1) fmt0)) 0) (>= (+ arg1 (* (- 1) fmt0)) 0)) (and (<= (+ arg1 (* (- 1) fmt0)) 1) (>= (+ arg1 (* (- 1) fmt0)) 1))) (and (<= (+ arg1 (* (- 1) fmt0)) 2) (>= (+ arg1 (* (- 1) fmt0)) 2))) (and (<= (+ arg1 (* (- 1) fmt0)) 3) (>= (+ arg1 (* (- 1) fmt0)) 3))) (not (and (<= (+ arg1 (* (- 1) fmt0)) 3) (>= (+ arg1 (* (- 1) fmt0)) 3))))) +(assert (or (or (or (and (<= (+ arg1 (* (- 1) fmt0)) 0) (>= (+ arg1 (* (- 1) fmt0)) 0)) (and (<= (+ arg1 (* (- 1) fmt0)) 1) (>= (+ arg1 (* (- 1) fmt0)) 1))) (and (<= (+ arg1 (* (- 1) fmt0)) 2) (>= (+ arg1 (* (- 1) fmt0)) 2))) (and (<= (+ arg1 (* (- 1) fmt0)) 3) (>= (+ arg1 (* (- 1) fmt0)) 3)) (not (or (or (or (and (<= (+ arg1 (* (- 1) fmt0)) 0) (>= (+ arg1 (* (- 1) fmt0)) 0)) (and (<= (+ arg1 (* (- 1) fmt0)) 1) (>= (+ arg1 (* (- 1) fmt0)) 1))) (and (<= (+ arg1 (* (- 1) fmt0)) 2) (>= (+ arg1 (* (- 1) fmt0)) 2))) (and (<= (+ arg1 (* (- 1) fmt0)) 3) (>= (+ arg1 (* (- 1) fmt0)) 3)))))) +(assert (or (not (and (<= (+ arg1 (* (- 1) fmt0)) 4) (>= (+ arg1 (* (- 1) fmt0)) 4))) (<= (+ arg1 (* (- 1) fmt0)) 4))) +(assert (or (not (and (<= (+ arg1 (* (- 1) fmt0)) 4) (>= (+ arg1 (* (- 1) fmt0)) 4))) (>= (+ arg1 (* (- 1) fmt0)) 4))) +(assert (or (not (<= (+ arg1 (* (- 1) fmt0)) 4)) (not (>= (+ arg1 (* (- 1) fmt0)) 4)) (and (<= (+ arg1 (* (- 1) fmt0)) 4) (>= (+ arg1 (* (- 1) fmt0)) 4)))) +(assert (or (or (or (or (or (and (<= (+ arg1 (* (- 1) fmt0)) 0) (>= (+ arg1 (* (- 1) fmt0)) 0)) (and (<= (+ arg1 (* (- 1) fmt0)) 1) (>= (+ arg1 (* (- 1) fmt0)) 1))) (and (<= (+ arg1 (* (- 1) fmt0)) 2) (>= (+ arg1 (* (- 1) fmt0)) 2))) (and (<= (+ arg1 (* (- 1) fmt0)) 3) (>= (+ arg1 (* (- 1) fmt0)) 3))) (and (<= (+ arg1 (* (- 1) fmt0)) 4) (>= (+ arg1 (* (- 1) fmt0)) 4))) (not (or (or (or (and (<= (+ arg1 (* (- 1) fmt0)) 0) (>= (+ arg1 (* (- 1) fmt0)) 0)) (and (<= (+ arg1 (* (- 1) fmt0)) 1) (>= (+ arg1 (* (- 1) fmt0)) 1))) (and (<= (+ arg1 (* (- 1) fmt0)) 2) (>= (+ arg1 (* (- 1) fmt0)) 2))) (and (<= (+ arg1 (* (- 1) fmt0)) 3) (>= (+ arg1 (* (- 1) fmt0)) 3)))))) +(assert (or (or (or (or (or (and (<= (+ arg1 (* (- 1) fmt0)) 0) (>= (+ arg1 (* (- 1) fmt0)) 0)) (and (<= (+ arg1 (* (- 1) fmt0)) 1) (>= (+ arg1 (* (- 1) fmt0)) 1))) (and (<= (+ arg1 (* (- 1) fmt0)) 2) (>= (+ arg1 (* (- 1) fmt0)) 2))) (and (<= (+ arg1 (* (- 1) fmt0)) 3) (>= (+ arg1 (* (- 1) fmt0)) 3))) (and (<= (+ arg1 (* (- 1) fmt0)) 4) (>= (+ arg1 (* (- 1) fmt0)) 4))) (not (and (<= (+ arg1 (* (- 1) fmt0)) 4) (>= (+ arg1 (* (- 1) fmt0)) 4))))) +(assert (or (or (or (or (and (<= (+ arg1 (* (- 1) fmt0)) 0) (>= (+ arg1 (* (- 1) fmt0)) 0)) (and (<= (+ arg1 (* (- 1) fmt0)) 1) (>= (+ arg1 (* (- 1) fmt0)) 1))) (and (<= (+ arg1 (* (- 1) fmt0)) 2) (>= (+ arg1 (* (- 1) fmt0)) 2))) (and (<= (+ arg1 (* (- 1) fmt0)) 3) (>= (+ arg1 (* (- 1) fmt0)) 3))) (and (<= (+ arg1 (* (- 1) fmt0)) 4) (>= (+ arg1 (* (- 1) fmt0)) 4)) (not (or (or (or (or (and (<= (+ arg1 (* (- 1) fmt0)) 0) (>= (+ arg1 (* (- 1) fmt0)) 0)) (and (<= (+ arg1 (* (- 1) fmt0)) 1) (>= (+ arg1 (* (- 1) fmt0)) 1))) (and (<= (+ arg1 (* (- 1) fmt0)) 2) (>= (+ arg1 (* (- 1) fmt0)) 2))) (and (<= (+ arg1 (* (- 1) fmt0)) 3) (>= (+ arg1 (* (- 1) fmt0)) 3))) (and (<= (+ arg1 (* (- 1) fmt0)) 4) (>= (+ arg1 (* (- 1) fmt0)) 4)))))) +(assert (or (not (and (<= (+ arg1 (* (- 1) fmt0)) 5) (>= (+ arg1 (* (- 1) fmt0)) 5))) (<= (+ arg1 (* (- 1) fmt0)) 5))) +(assert (or (not (and (<= (+ arg1 (* (- 1) fmt0)) 5) (>= (+ arg1 (* (- 1) fmt0)) 5))) (>= (+ arg1 (* (- 1) fmt0)) 5))) +(assert (or (not (<= (+ arg1 (* (- 1) fmt0)) 5)) (not (>= (+ arg1 (* (- 1) fmt0)) 5)) (and (<= (+ arg1 (* (- 1) fmt0)) 5) (>= (+ arg1 (* (- 1) fmt0)) 5)))) +(assert (or (or (or (or (or (or (and (<= (+ arg1 (* (- 1) fmt0)) 0) (>= (+ arg1 (* (- 1) fmt0)) 0)) (and (<= (+ arg1 (* (- 1) fmt0)) 1) (>= (+ arg1 (* (- 1) fmt0)) 1))) (and (<= (+ arg1 (* (- 1) fmt0)) 2) (>= (+ arg1 (* (- 1) fmt0)) 2))) (and (<= (+ arg1 (* (- 1) fmt0)) 3) (>= (+ arg1 (* (- 1) fmt0)) 3))) (and (<= (+ arg1 (* (- 1) fmt0)) 4) (>= (+ arg1 (* (- 1) fmt0)) 4))) (and (<= (+ arg1 (* (- 1) fmt0)) 5) (>= (+ arg1 (* (- 1) fmt0)) 5))) (not (or (or (or (or (and (<= (+ arg1 (* (- 1) fmt0)) 0) (>= (+ arg1 (* (- 1) fmt0)) 0)) (and (<= (+ arg1 (* (- 1) fmt0)) 1) (>= (+ arg1 (* (- 1) fmt0)) 1))) (and (<= (+ arg1 (* (- 1) fmt0)) 2) (>= (+ arg1 (* (- 1) fmt0)) 2))) (and (<= (+ arg1 (* (- 1) fmt0)) 3) (>= (+ arg1 (* (- 1) fmt0)) 3))) (and (<= (+ arg1 (* (- 1) fmt0)) 4) (>= (+ arg1 (* (- 1) fmt0)) 4)))))) +(assert (or (or (or (or (or (or (and (<= (+ arg1 (* (- 1) fmt0)) 0) (>= (+ arg1 (* (- 1) fmt0)) 0)) (and (<= (+ arg1 (* (- 1) fmt0)) 1) (>= (+ arg1 (* (- 1) fmt0)) 1))) (and (<= (+ arg1 (* (- 1) fmt0)) 2) (>= (+ arg1 (* (- 1) fmt0)) 2))) (and (<= (+ arg1 (* (- 1) fmt0)) 3) (>= (+ arg1 (* (- 1) fmt0)) 3))) (and (<= (+ arg1 (* (- 1) fmt0)) 4) (>= (+ arg1 (* (- 1) fmt0)) 4))) (and (<= (+ arg1 (* (- 1) fmt0)) 5) (>= (+ arg1 (* (- 1) fmt0)) 5))) (not (and (<= (+ arg1 (* (- 1) fmt0)) 5) (>= (+ arg1 (* (- 1) fmt0)) 5))))) +(assert (or (or (or (or (or (and (<= (+ arg1 (* (- 1) fmt0)) 0) (>= (+ arg1 (* (- 1) fmt0)) 0)) (and (<= (+ arg1 (* (- 1) fmt0)) 1) (>= (+ arg1 (* (- 1) fmt0)) 1))) (and (<= (+ arg1 (* (- 1) fmt0)) 2) (>= (+ arg1 (* (- 1) fmt0)) 2))) (and (<= (+ arg1 (* (- 1) fmt0)) 3) (>= (+ arg1 (* (- 1) fmt0)) 3))) (and (<= (+ arg1 (* (- 1) fmt0)) 4) (>= (+ arg1 (* (- 1) fmt0)) 4))) (and (<= (+ arg1 (* (- 1) fmt0)) 5) (>= (+ arg1 (* (- 1) fmt0)) 5)) (not (or (or (or (or (or (and (<= (+ arg1 (* (- 1) fmt0)) 0) (>= (+ arg1 (* (- 1) fmt0)) 0)) (and (<= (+ arg1 (* (- 1) fmt0)) 1) (>= (+ arg1 (* (- 1) fmt0)) 1))) (and (<= (+ arg1 (* (- 1) fmt0)) 2) (>= (+ arg1 (* (- 1) fmt0)) 2))) (and (<= (+ arg1 (* (- 1) fmt0)) 3) (>= (+ arg1 (* (- 1) fmt0)) 3))) (and (<= (+ arg1 (* (- 1) fmt0)) 4) (>= (+ arg1 (* (- 1) fmt0)) 4))) (and (<= (+ arg1 (* (- 1) fmt0)) 5) (>= (+ arg1 (* (- 1) fmt0)) 5)))))) +(assert (or (not (and (<= (+ arg1 (* (- 1) fmt0)) 6) (>= (+ arg1 (* (- 1) fmt0)) 6))) (<= (+ arg1 (* (- 1) fmt0)) 6))) +(assert (or (not (and (<= (+ arg1 (* (- 1) fmt0)) 6) (>= (+ arg1 (* (- 1) fmt0)) 6))) (>= (+ arg1 (* (- 1) fmt0)) 6))) +(assert (or (not (<= (+ arg1 (* (- 1) fmt0)) 6)) (not (>= (+ arg1 (* (- 1) fmt0)) 6)) (and (<= (+ arg1 (* (- 1) fmt0)) 6) (>= (+ arg1 (* (- 1) fmt0)) 6)))) +(assert (or (or (or (or (or (or (or (and (<= (+ arg1 (* (- 1) fmt0)) 0) (>= (+ arg1 (* (- 1) fmt0)) 0)) (and (<= (+ arg1 (* (- 1) fmt0)) 1) (>= (+ arg1 (* (- 1) fmt0)) 1))) (and (<= (+ arg1 (* (- 1) fmt0)) 2) (>= (+ arg1 (* (- 1) fmt0)) 2))) (and (<= (+ arg1 (* (- 1) fmt0)) 3) (>= (+ arg1 (* (- 1) fmt0)) 3))) (and (<= (+ arg1 (* (- 1) fmt0)) 4) (>= (+ arg1 (* (- 1) fmt0)) 4))) (and (<= (+ arg1 (* (- 1) fmt0)) 5) (>= (+ arg1 (* (- 1) fmt0)) 5))) (and (<= (+ arg1 (* (- 1) fmt0)) 6) (>= (+ arg1 (* (- 1) fmt0)) 6))) (not (or (or (or (or (or (and (<= (+ arg1 (* (- 1) fmt0)) 0) (>= (+ arg1 (* (- 1) fmt0)) 0)) (and (<= (+ arg1 (* (- 1) fmt0)) 1) (>= (+ arg1 (* (- 1) fmt0)) 1))) (and (<= (+ arg1 (* (- 1) fmt0)) 2) (>= (+ arg1 (* (- 1) fmt0)) 2))) (and (<= (+ arg1 (* (- 1) fmt0)) 3) (>= (+ arg1 (* (- 1) fmt0)) 3))) (and (<= (+ arg1 (* (- 1) fmt0)) 4) (>= (+ arg1 (* (- 1) fmt0)) 4))) (and (<= (+ arg1 (* (- 1) fmt0)) 5) (>= (+ arg1 (* (- 1) fmt0)) 5)))))) +(assert (or (or (or (or (or (or (or (and (<= (+ arg1 (* (- 1) fmt0)) 0) (>= (+ arg1 (* (- 1) fmt0)) 0)) (and (<= (+ arg1 (* (- 1) fmt0)) 1) (>= (+ arg1 (* (- 1) fmt0)) 1))) (and (<= (+ arg1 (* (- 1) fmt0)) 2) (>= (+ arg1 (* (- 1) fmt0)) 2))) (and (<= (+ arg1 (* (- 1) fmt0)) 3) (>= (+ arg1 (* (- 1) fmt0)) 3))) (and (<= (+ arg1 (* (- 1) fmt0)) 4) (>= (+ arg1 (* (- 1) fmt0)) 4))) (and (<= (+ arg1 (* (- 1) fmt0)) 5) (>= (+ arg1 (* (- 1) fmt0)) 5))) (and (<= (+ arg1 (* (- 1) fmt0)) 6) (>= (+ arg1 (* (- 1) fmt0)) 6))) (not (and (<= (+ arg1 (* (- 1) fmt0)) 6) (>= (+ arg1 (* (- 1) fmt0)) 6))))) +(assert (or (or (or (or (or (or (and (<= (+ arg1 (* (- 1) fmt0)) 0) (>= (+ arg1 (* (- 1) fmt0)) 0)) (and (<= (+ arg1 (* (- 1) fmt0)) 1) (>= (+ arg1 (* (- 1) fmt0)) 1))) (and (<= (+ arg1 (* (- 1) fmt0)) 2) (>= (+ arg1 (* (- 1) fmt0)) 2))) (and (<= (+ arg1 (* (- 1) fmt0)) 3) (>= (+ arg1 (* (- 1) fmt0)) 3))) (and (<= (+ arg1 (* (- 1) fmt0)) 4) (>= (+ arg1 (* (- 1) fmt0)) 4))) (and (<= (+ arg1 (* (- 1) fmt0)) 5) (>= (+ arg1 (* (- 1) fmt0)) 5))) (and (<= (+ arg1 (* (- 1) fmt0)) 6) (>= (+ arg1 (* (- 1) fmt0)) 6)) (not (or (or (or (or (or (or (and (<= (+ arg1 (* (- 1) fmt0)) 0) (>= (+ arg1 (* (- 1) fmt0)) 0)) (and (<= (+ arg1 (* (- 1) fmt0)) 1) (>= (+ arg1 (* (- 1) fmt0)) 1))) (and (<= (+ arg1 (* (- 1) fmt0)) 2) (>= (+ arg1 (* (- 1) fmt0)) 2))) (and (<= (+ arg1 (* (- 1) fmt0)) 3) (>= (+ arg1 (* (- 1) fmt0)) 3))) (and (<= (+ arg1 (* (- 1) fmt0)) 4) (>= (+ arg1 (* (- 1) fmt0)) 4))) (and (<= (+ arg1 (* (- 1) fmt0)) 5) (>= (+ arg1 (* (- 1) fmt0)) 5))) (and (<= (+ arg1 (* (- 1) fmt0)) 6) (>= (+ arg1 (* (- 1) fmt0)) 6)))))) +(assert (or (not (and (<= (+ arg1 (* (- 1) fmt0)) 7) (>= (+ arg1 (* (- 1) fmt0)) 7))) (<= (+ arg1 (* (- 1) fmt0)) 7))) +(assert (or (not (and (<= (+ arg1 (* (- 1) fmt0)) 7) (>= (+ arg1 (* (- 1) fmt0)) 7))) (>= (+ arg1 (* (- 1) fmt0)) 7))) +(assert (or (not (<= (+ arg1 (* (- 1) fmt0)) 7)) (not (>= (+ arg1 (* (- 1) fmt0)) 7)) (and (<= (+ arg1 (* (- 1) fmt0)) 7) (>= (+ arg1 (* (- 1) fmt0)) 7)))) +(assert (or (or (or (or (or (or (or (or (and (<= (+ arg1 (* (- 1) fmt0)) 0) (>= (+ arg1 (* (- 1) fmt0)) 0)) (and (<= (+ arg1 (* (- 1) fmt0)) 1) (>= (+ arg1 (* (- 1) fmt0)) 1))) (and (<= (+ arg1 (* (- 1) fmt0)) 2) (>= (+ arg1 (* (- 1) fmt0)) 2))) (and (<= (+ arg1 (* (- 1) fmt0)) 3) (>= (+ arg1 (* (- 1) fmt0)) 3))) (and (<= (+ arg1 (* (- 1) fmt0)) 4) (>= (+ arg1 (* (- 1) fmt0)) 4))) (and (<= (+ arg1 (* (- 1) fmt0)) 5) (>= (+ arg1 (* (- 1) fmt0)) 5))) (and (<= (+ arg1 (* (- 1) fmt0)) 6) (>= (+ arg1 (* (- 1) fmt0)) 6))) (and (<= (+ arg1 (* (- 1) fmt0)) 7) (>= (+ arg1 (* (- 1) fmt0)) 7))) (not (or (or (or (or (or (or (and (<= (+ arg1 (* (- 1) fmt0)) 0) (>= (+ arg1 (* (- 1) fmt0)) 0)) (and (<= (+ arg1 (* (- 1) fmt0)) 1) (>= (+ arg1 (* (- 1) fmt0)) 1))) (and (<= (+ arg1 (* (- 1) fmt0)) 2) (>= (+ arg1 (* (- 1) fmt0)) 2))) (and (<= (+ arg1 (* (- 1) fmt0)) 3) (>= (+ arg1 (* (- 1) fmt0)) 3))) (and (<= (+ arg1 (* (- 1) fmt0)) 4) (>= (+ arg1 (* (- 1) fmt0)) 4))) (and (<= (+ arg1 (* (- 1) fmt0)) 5) (>= (+ arg1 (* (- 1) fmt0)) 5))) (and (<= (+ arg1 (* (- 1) fmt0)) 6) (>= (+ arg1 (* (- 1) fmt0)) 6)))))) +(assert (or (or (or (or (or (or (or (or (and (<= (+ arg1 (* (- 1) fmt0)) 0) (>= (+ arg1 (* (- 1) fmt0)) 0)) (and (<= (+ arg1 (* (- 1) fmt0)) 1) (>= (+ arg1 (* (- 1) fmt0)) 1))) (and (<= (+ arg1 (* (- 1) fmt0)) 2) (>= (+ arg1 (* (- 1) fmt0)) 2))) (and (<= (+ arg1 (* (- 1) fmt0)) 3) (>= (+ arg1 (* (- 1) fmt0)) 3))) (and (<= (+ arg1 (* (- 1) fmt0)) 4) (>= (+ arg1 (* (- 1) fmt0)) 4))) (and (<= (+ arg1 (* (- 1) fmt0)) 5) (>= (+ arg1 (* (- 1) fmt0)) 5))) (and (<= (+ arg1 (* (- 1) fmt0)) 6) (>= (+ arg1 (* (- 1) fmt0)) 6))) (and (<= (+ arg1 (* (- 1) fmt0)) 7) (>= (+ arg1 (* (- 1) fmt0)) 7))) (not (and (<= (+ arg1 (* (- 1) fmt0)) 7) (>= (+ arg1 (* (- 1) fmt0)) 7))))) +(assert (or (or (or (or (or (or (or (and (<= (+ arg1 (* (- 1) fmt0)) 0) (>= (+ arg1 (* (- 1) fmt0)) 0)) (and (<= (+ arg1 (* (- 1) fmt0)) 1) (>= (+ arg1 (* (- 1) fmt0)) 1))) (and (<= (+ arg1 (* (- 1) fmt0)) 2) (>= (+ arg1 (* (- 1) fmt0)) 2))) (and (<= (+ arg1 (* (- 1) fmt0)) 3) (>= (+ arg1 (* (- 1) fmt0)) 3))) (and (<= (+ arg1 (* (- 1) fmt0)) 4) (>= (+ arg1 (* (- 1) fmt0)) 4))) (and (<= (+ arg1 (* (- 1) fmt0)) 5) (>= (+ arg1 (* (- 1) fmt0)) 5))) (and (<= (+ arg1 (* (- 1) fmt0)) 6) (>= (+ arg1 (* (- 1) fmt0)) 6))) (and (<= (+ arg1 (* (- 1) fmt0)) 7) (>= (+ arg1 (* (- 1) fmt0)) 7)) (not (or (or (or (or (or (or (or (and (<= (+ arg1 (* (- 1) fmt0)) 0) (>= (+ arg1 (* (- 1) fmt0)) 0)) (and (<= (+ arg1 (* (- 1) fmt0)) 1) (>= (+ arg1 (* (- 1) fmt0)) 1))) (and (<= (+ arg1 (* (- 1) fmt0)) 2) (>= (+ arg1 (* (- 1) fmt0)) 2))) (and (<= (+ arg1 (* (- 1) fmt0)) 3) (>= (+ arg1 (* (- 1) fmt0)) 3))) (and (<= (+ arg1 (* (- 1) fmt0)) 4) (>= (+ arg1 (* (- 1) fmt0)) 4))) (and (<= (+ arg1 (* (- 1) fmt0)) 5) (>= (+ arg1 (* (- 1) fmt0)) 5))) (and (<= (+ arg1 (* (- 1) fmt0)) 6) (>= (+ arg1 (* (- 1) fmt0)) 6))) (and (<= (+ arg1 (* (- 1) fmt0)) 7) (>= (+ arg1 (* (- 1) fmt0)) 7)))))) +(assert (or (not (and (<= (+ arg1 (* (- 1) fmt0)) 8) (>= (+ arg1 (* (- 1) fmt0)) 8))) (<= (+ arg1 (* (- 1) fmt0)) 8))) +(assert (or (not (and (<= (+ arg1 (* (- 1) fmt0)) 8) (>= (+ arg1 (* (- 1) fmt0)) 8))) (>= (+ arg1 (* (- 1) fmt0)) 8))) +(assert (or (not (<= (+ arg1 (* (- 1) fmt0)) 8)) (not (>= (+ arg1 (* (- 1) fmt0)) 8)) (and (<= (+ arg1 (* (- 1) fmt0)) 8) (>= (+ arg1 (* (- 1) fmt0)) 8)))) +(assert (or (or (or (or (or (or (or (or (or (and (<= (+ arg1 (* (- 1) fmt0)) 0) (>= (+ arg1 (* (- 1) fmt0)) 0)) (and (<= (+ arg1 (* (- 1) fmt0)) 1) (>= (+ arg1 (* (- 1) fmt0)) 1))) (and (<= (+ arg1 (* (- 1) fmt0)) 2) (>= (+ arg1 (* (- 1) fmt0)) 2))) (and (<= (+ arg1 (* (- 1) fmt0)) 3) (>= (+ arg1 (* (- 1) fmt0)) 3))) (and (<= (+ arg1 (* (- 1) fmt0)) 4) (>= (+ arg1 (* (- 1) fmt0)) 4))) (and (<= (+ arg1 (* (- 1) fmt0)) 5) (>= (+ arg1 (* (- 1) fmt0)) 5))) (and (<= (+ arg1 (* (- 1) fmt0)) 6) (>= (+ arg1 (* (- 1) fmt0)) 6))) (and (<= (+ arg1 (* (- 1) fmt0)) 7) (>= (+ arg1 (* (- 1) fmt0)) 7))) (and (<= (+ arg1 (* (- 1) fmt0)) 8) (>= (+ arg1 (* (- 1) fmt0)) 8))) (not (or (or (or (or (or (or (or (and (<= (+ arg1 (* (- 1) fmt0)) 0) (>= (+ arg1 (* (- 1) fmt0)) 0)) (and (<= (+ arg1 (* (- 1) fmt0)) 1) (>= (+ arg1 (* (- 1) fmt0)) 1))) (and (<= (+ arg1 (* (- 1) fmt0)) 2) (>= (+ arg1 (* (- 1) fmt0)) 2))) (and (<= (+ arg1 (* (- 1) fmt0)) 3) (>= (+ arg1 (* (- 1) fmt0)) 3))) (and (<= (+ arg1 (* (- 1) fmt0)) 4) (>= (+ arg1 (* (- 1) fmt0)) 4))) (and (<= (+ arg1 (* (- 1) fmt0)) 5) (>= (+ arg1 (* (- 1) fmt0)) 5))) (and (<= (+ arg1 (* (- 1) fmt0)) 6) (>= (+ arg1 (* (- 1) fmt0)) 6))) (and (<= (+ arg1 (* (- 1) fmt0)) 7) (>= (+ arg1 (* (- 1) fmt0)) 7)))))) +(assert (or (or (or (or (or (or (or (or (or (and (<= (+ arg1 (* (- 1) fmt0)) 0) (>= (+ arg1 (* (- 1) fmt0)) 0)) (and (<= (+ arg1 (* (- 1) fmt0)) 1) (>= (+ arg1 (* (- 1) fmt0)) 1))) (and (<= (+ arg1 (* (- 1) fmt0)) 2) (>= (+ arg1 (* (- 1) fmt0)) 2))) (and (<= (+ arg1 (* (- 1) fmt0)) 3) (>= (+ arg1 (* (- 1) fmt0)) 3))) (and (<= (+ arg1 (* (- 1) fmt0)) 4) (>= (+ arg1 (* (- 1) fmt0)) 4))) (and (<= (+ arg1 (* (- 1) fmt0)) 5) (>= (+ arg1 (* (- 1) fmt0)) 5))) (and (<= (+ arg1 (* (- 1) fmt0)) 6) (>= (+ arg1 (* (- 1) fmt0)) 6))) (and (<= (+ arg1 (* (- 1) fmt0)) 7) (>= (+ arg1 (* (- 1) fmt0)) 7))) (and (<= (+ arg1 (* (- 1) fmt0)) 8) (>= (+ arg1 (* (- 1) fmt0)) 8))) (not (and (<= (+ arg1 (* (- 1) fmt0)) 8) (>= (+ arg1 (* (- 1) fmt0)) 8))))) +(assert (or (or (or (or (or (or (or (or (and (<= (+ arg1 (* (- 1) fmt0)) 0) (>= (+ arg1 (* (- 1) fmt0)) 0)) (and (<= (+ arg1 (* (- 1) fmt0)) 1) (>= (+ arg1 (* (- 1) fmt0)) 1))) (and (<= (+ arg1 (* (- 1) fmt0)) 2) (>= (+ arg1 (* (- 1) fmt0)) 2))) (and (<= (+ arg1 (* (- 1) fmt0)) 3) (>= (+ arg1 (* (- 1) fmt0)) 3))) (and (<= (+ arg1 (* (- 1) fmt0)) 4) (>= (+ arg1 (* (- 1) fmt0)) 4))) (and (<= (+ arg1 (* (- 1) fmt0)) 5) (>= (+ arg1 (* (- 1) fmt0)) 5))) (and (<= (+ arg1 (* (- 1) fmt0)) 6) (>= (+ arg1 (* (- 1) fmt0)) 6))) (and (<= (+ arg1 (* (- 1) fmt0)) 7) (>= (+ arg1 (* (- 1) fmt0)) 7))) (and (<= (+ arg1 (* (- 1) fmt0)) 8) (>= (+ arg1 (* (- 1) fmt0)) 8)) (not (or (or (or (or (or (or (or (or (and (<= (+ arg1 (* (- 1) fmt0)) 0) (>= (+ arg1 (* (- 1) fmt0)) 0)) (and (<= (+ arg1 (* (- 1) fmt0)) 1) (>= (+ arg1 (* (- 1) fmt0)) 1))) (and (<= (+ arg1 (* (- 1) fmt0)) 2) (>= (+ arg1 (* (- 1) fmt0)) 2))) (and (<= (+ arg1 (* (- 1) fmt0)) 3) (>= (+ arg1 (* (- 1) fmt0)) 3))) (and (<= (+ arg1 (* (- 1) fmt0)) 4) (>= (+ arg1 (* (- 1) fmt0)) 4))) (and (<= (+ arg1 (* (- 1) fmt0)) 5) (>= (+ arg1 (* (- 1) fmt0)) 5))) (and (<= (+ arg1 (* (- 1) fmt0)) 6) (>= (+ arg1 (* (- 1) fmt0)) 6))) (and (<= (+ arg1 (* (- 1) fmt0)) 7) (>= (+ arg1 (* (- 1) fmt0)) 7))) (and (<= (+ arg1 (* (- 1) fmt0)) 8) (>= (+ arg1 (* (- 1) fmt0)) 8)))))) +(assert (or (not (and (<= (+ arg1 (* (- 1) fmt0)) 9) (>= (+ arg1 (* (- 1) fmt0)) 9))) (<= (+ arg1 (* (- 1) fmt0)) 9))) +(assert (or (not (and (<= (+ arg1 (* (- 1) fmt0)) 9) (>= (+ arg1 (* (- 1) fmt0)) 9))) (>= (+ arg1 (* (- 1) fmt0)) 9))) +(assert (or (not (<= (+ arg1 (* (- 1) fmt0)) 9)) (not (>= (+ arg1 (* (- 1) fmt0)) 9)) (and (<= (+ arg1 (* (- 1) fmt0)) 9) (>= (+ arg1 (* (- 1) fmt0)) 9)))) +(assert (or (or (or (or (or (or (or (or (or (and (<= (+ arg1 (* (- 1) fmt0)) 0) (>= (+ arg1 (* (- 1) fmt0)) 0)) (and (<= (+ arg1 (* (- 1) fmt0)) 1) (>= (+ arg1 (* (- 1) fmt0)) 1))) (and (<= (+ arg1 (* (- 1) fmt0)) 2) (>= (+ arg1 (* (- 1) fmt0)) 2))) (and (<= (+ arg1 (* (- 1) fmt0)) 3) (>= (+ arg1 (* (- 1) fmt0)) 3))) (and (<= (+ arg1 (* (- 1) fmt0)) 4) (>= (+ arg1 (* (- 1) fmt0)) 4))) (and (<= (+ arg1 (* (- 1) fmt0)) 5) (>= (+ arg1 (* (- 1) fmt0)) 5))) (and (<= (+ arg1 (* (- 1) fmt0)) 6) (>= (+ arg1 (* (- 1) fmt0)) 6))) (and (<= (+ arg1 (* (- 1) fmt0)) 7) (>= (+ arg1 (* (- 1) fmt0)) 7))) (and (<= (+ arg1 (* (- 1) fmt0)) 8) (>= (+ arg1 (* (- 1) fmt0)) 8))) (and (<= (+ arg1 (* (- 1) fmt0)) 9) (>= (+ arg1 (* (- 1) fmt0)) 9)))) +(assert (or (not (and (<= (+ percent (* (- 1) (format 0))) 0) (>= (+ percent (* (- 1) (format 0))) 0))) (<= (+ percent (* (- 1) (format 0))) 0))) +(assert (or (not (and (<= (+ percent (* (- 1) (format 0))) 0) (>= (+ percent (* (- 1) (format 0))) 0))) (>= (+ percent (* (- 1) (format 0))) 0))) +(assert (or (not (<= (+ percent (* (- 1) (format 0))) 0)) (not (>= (+ percent (* (- 1) (format 0))) 0)) (and (<= (+ percent (* (- 1) (format 0))) 0) (>= (+ percent (* (- 1) (format 0))) 0)))) +(assert (or (not (and (<= (+ s (* (- 1) (format 0))) 0) (>= (+ s (* (- 1) (format 0))) 0))) (<= (+ s (* (- 1) (format 0))) 0))) +(assert (or (not (and (<= (+ s (* (- 1) (format 0))) 0) (>= (+ s (* (- 1) (format 0))) 0))) (>= (+ s (* (- 1) (format 0))) 0))) +(assert (or (not (<= (+ s (* (- 1) (format 0))) 0)) (not (>= (+ s (* (- 1) (format 0))) 0)) (and (<= (+ s (* (- 1) (format 0))) 0) (>= (+ s (* (- 1) (format 0))) 0)))) +(assert (or (or (and (<= (+ percent (* (- 1) (format 0))) 0) (>= (+ percent (* (- 1) (format 0))) 0)) (and (<= (+ s (* (- 1) (format 0))) 0) (>= (+ s (* (- 1) (format 0))) 0))) (not (and (<= (+ percent (* (- 1) (format 0))) 0) (>= (+ percent (* (- 1) (format 0))) 0))))) +(assert (or (or (and (<= (+ percent (* (- 1) (format 0))) 0) (>= (+ percent (* (- 1) (format 0))) 0)) (and (<= (+ s (* (- 1) (format 0))) 0) (>= (+ s (* (- 1) (format 0))) 0))) (not (and (<= (+ s (* (- 1) (format 0))) 0) (>= (+ s (* (- 1) (format 0))) 0))))) +(assert (or (and (<= (+ percent (* (- 1) (format 0))) 0) (>= (+ percent (* (- 1) (format 0))) 0)) (and (<= (+ s (* (- 1) (format 0))) 0) (>= (+ s (* (- 1) (format 0))) 0)) (not (or (and (<= (+ percent (* (- 1) (format 0))) 0) (>= (+ percent (* (- 1) (format 0))) 0)) (and (<= (+ s (* (- 1) (format 0))) 0) (>= (+ s (* (- 1) (format 0))) 0)))))) +(assert (or (not (and (<= (+ x (* (- 1) (format 0))) 0) (>= (+ x (* (- 1) (format 0))) 0))) (<= (+ x (* (- 1) (format 0))) 0))) +(assert (or (not (and (<= (+ x (* (- 1) (format 0))) 0) (>= (+ x (* (- 1) (format 0))) 0))) (>= (+ x (* (- 1) (format 0))) 0))) +(assert (or (not (<= (+ x (* (- 1) (format 0))) 0)) (not (>= (+ x (* (- 1) (format 0))) 0)) (and (<= (+ x (* (- 1) (format 0))) 0) (>= (+ x (* (- 1) (format 0))) 0)))) +(assert (or (or (or (and (<= (+ percent (* (- 1) (format 0))) 0) (>= (+ percent (* (- 1) (format 0))) 0)) (and (<= (+ s (* (- 1) (format 0))) 0) (>= (+ s (* (- 1) (format 0))) 0))) (and (<= (+ x (* (- 1) (format 0))) 0) (>= (+ x (* (- 1) (format 0))) 0))) (not (or (and (<= (+ percent (* (- 1) (format 0))) 0) (>= (+ percent (* (- 1) (format 0))) 0)) (and (<= (+ s (* (- 1) (format 0))) 0) (>= (+ s (* (- 1) (format 0))) 0)))))) +(assert (or (or (or (and (<= (+ percent (* (- 1) (format 0))) 0) (>= (+ percent (* (- 1) (format 0))) 0)) (and (<= (+ s (* (- 1) (format 0))) 0) (>= (+ s (* (- 1) (format 0))) 0))) (and (<= (+ x (* (- 1) (format 0))) 0) (>= (+ x (* (- 1) (format 0))) 0))) (not (and (<= (+ x (* (- 1) (format 0))) 0) (>= (+ x (* (- 1) (format 0))) 0))))) +(assert (or (or (and (<= (+ percent (* (- 1) (format 0))) 0) (>= (+ percent (* (- 1) (format 0))) 0)) (and (<= (+ s (* (- 1) (format 0))) 0) (>= (+ s (* (- 1) (format 0))) 0))) (and (<= (+ x (* (- 1) (format 0))) 0) (>= (+ x (* (- 1) (format 0))) 0)) (not (or (or (and (<= (+ percent (* (- 1) (format 0))) 0) (>= (+ percent (* (- 1) (format 0))) 0)) (and (<= (+ s (* (- 1) (format 0))) 0) (>= (+ s (* (- 1) (format 0))) 0))) (and (<= (+ x (* (- 1) (format 0))) 0) (>= (+ x (* (- 1) (format 0))) 0)))))) +(assert (or (not (and (<= (format 0) 3) (>= (format 0) 3))) (<= (format 0) 3))) +(assert (or (not (and (<= (format 0) 3) (>= (format 0) 3))) (>= (format 0) 3))) +(assert (or (not (<= (format 0) 3)) (not (>= (format 0) 3)) (and (<= (format 0) 3) (>= (format 0) 3)))) +(assert (or (or (or (or (and (<= (+ percent (* (- 1) (format 0))) 0) (>= (+ percent (* (- 1) (format 0))) 0)) (and (<= (+ s (* (- 1) (format 0))) 0) (>= (+ s (* (- 1) (format 0))) 0))) (and (<= (+ x (* (- 1) (format 0))) 0) (>= (+ x (* (- 1) (format 0))) 0))) (and (<= (format 0) 3) (>= (format 0) 3))) (not (or (or (and (<= (+ percent (* (- 1) (format 0))) 0) (>= (+ percent (* (- 1) (format 0))) 0)) (and (<= (+ s (* (- 1) (format 0))) 0) (>= (+ s (* (- 1) (format 0))) 0))) (and (<= (+ x (* (- 1) (format 0))) 0) (>= (+ x (* (- 1) (format 0))) 0)))))) +(assert (or (or (or (or (and (<= (+ percent (* (- 1) (format 0))) 0) (>= (+ percent (* (- 1) (format 0))) 0)) (and (<= (+ s (* (- 1) (format 0))) 0) (>= (+ s (* (- 1) (format 0))) 0))) (and (<= (+ x (* (- 1) (format 0))) 0) (>= (+ x (* (- 1) (format 0))) 0))) (and (<= (format 0) 3) (>= (format 0) 3))) (not (and (<= (format 0) 3) (>= (format 0) 3))))) +(assert (or (or (or (and (<= (+ percent (* (- 1) (format 0))) 0) (>= (+ percent (* (- 1) (format 0))) 0)) (and (<= (+ s (* (- 1) (format 0))) 0) (>= (+ s (* (- 1) (format 0))) 0))) (and (<= (+ x (* (- 1) (format 0))) 0) (>= (+ x (* (- 1) (format 0))) 0))) (and (<= (format 0) 3) (>= (format 0) 3)) (not (or (or (or (and (<= (+ percent (* (- 1) (format 0))) 0) (>= (+ percent (* (- 1) (format 0))) 0)) (and (<= (+ s (* (- 1) (format 0))) 0) (>= (+ s (* (- 1) (format 0))) 0))) (and (<= (+ x (* (- 1) (format 0))) 0) (>= (+ x (* (- 1) (format 0))) 0))) (and (<= (format 0) 3) (>= (format 0) 3)))))) +(assert (or (not (and (<= (format 0) 4) (>= (format 0) 4))) (<= (format 0) 4))) +(assert (or (not (and (<= (format 0) 4) (>= (format 0) 4))) (>= (format 0) 4))) +(assert (or (not (<= (format 0) 4)) (not (>= (format 0) 4)) (and (<= (format 0) 4) (>= (format 0) 4)))) +(assert (or (or (or (or (or (and (<= (+ percent (* (- 1) (format 0))) 0) (>= (+ percent (* (- 1) (format 0))) 0)) (and (<= (+ s (* (- 1) (format 0))) 0) (>= (+ s (* (- 1) (format 0))) 0))) (and (<= (+ x (* (- 1) (format 0))) 0) (>= (+ x (* (- 1) (format 0))) 0))) (and (<= (format 0) 3) (>= (format 0) 3))) (and (<= (format 0) 4) (>= (format 0) 4))) (not (or (or (or (and (<= (+ percent (* (- 1) (format 0))) 0) (>= (+ percent (* (- 1) (format 0))) 0)) (and (<= (+ s (* (- 1) (format 0))) 0) (>= (+ s (* (- 1) (format 0))) 0))) (and (<= (+ x (* (- 1) (format 0))) 0) (>= (+ x (* (- 1) (format 0))) 0))) (and (<= (format 0) 3) (>= (format 0) 3)))))) +(assert (or (or (or (or (or (and (<= (+ percent (* (- 1) (format 0))) 0) (>= (+ percent (* (- 1) (format 0))) 0)) (and (<= (+ s (* (- 1) (format 0))) 0) (>= (+ s (* (- 1) (format 0))) 0))) (and (<= (+ x (* (- 1) (format 0))) 0) (>= (+ x (* (- 1) (format 0))) 0))) (and (<= (format 0) 3) (>= (format 0) 3))) (and (<= (format 0) 4) (>= (format 0) 4))) (not (and (<= (format 0) 4) (>= (format 0) 4))))) +(assert (or (or (or (or (and (<= (+ percent (* (- 1) (format 0))) 0) (>= (+ percent (* (- 1) (format 0))) 0)) (and (<= (+ s (* (- 1) (format 0))) 0) (>= (+ s (* (- 1) (format 0))) 0))) (and (<= (+ x (* (- 1) (format 0))) 0) (>= (+ x (* (- 1) (format 0))) 0))) (and (<= (format 0) 3) (>= (format 0) 3))) (and (<= (format 0) 4) (>= (format 0) 4)) (not (or (or (or (or (and (<= (+ percent (* (- 1) (format 0))) 0) (>= (+ percent (* (- 1) (format 0))) 0)) (and (<= (+ s (* (- 1) (format 0))) 0) (>= (+ s (* (- 1) (format 0))) 0))) (and (<= (+ x (* (- 1) (format 0))) 0) (>= (+ x (* (- 1) (format 0))) 0))) (and (<= (format 0) 3) (>= (format 0) 3))) (and (<= (format 0) 4) (>= (format 0) 4)))))) +(assert (or (not (and (<= (format 0) 5) (>= (format 0) 5))) (<= (format 0) 5))) +(assert (or (not (and (<= (format 0) 5) (>= (format 0) 5))) (>= (format 0) 5))) +(assert (or (not (<= (format 0) 5)) (not (>= (format 0) 5)) (and (<= (format 0) 5) (>= (format 0) 5)))) +(assert (or (or (or (or (or (or (and (<= (+ percent (* (- 1) (format 0))) 0) (>= (+ percent (* (- 1) (format 0))) 0)) (and (<= (+ s (* (- 1) (format 0))) 0) (>= (+ s (* (- 1) (format 0))) 0))) (and (<= (+ x (* (- 1) (format 0))) 0) (>= (+ x (* (- 1) (format 0))) 0))) (and (<= (format 0) 3) (>= (format 0) 3))) (and (<= (format 0) 4) (>= (format 0) 4))) (and (<= (format 0) 5) (>= (format 0) 5))) (not (or (or (or (or (and (<= (+ percent (* (- 1) (format 0))) 0) (>= (+ percent (* (- 1) (format 0))) 0)) (and (<= (+ s (* (- 1) (format 0))) 0) (>= (+ s (* (- 1) (format 0))) 0))) (and (<= (+ x (* (- 1) (format 0))) 0) (>= (+ x (* (- 1) (format 0))) 0))) (and (<= (format 0) 3) (>= (format 0) 3))) (and (<= (format 0) 4) (>= (format 0) 4)))))) +(assert (or (or (or (or (or (or (and (<= (+ percent (* (- 1) (format 0))) 0) (>= (+ percent (* (- 1) (format 0))) 0)) (and (<= (+ s (* (- 1) (format 0))) 0) (>= (+ s (* (- 1) (format 0))) 0))) (and (<= (+ x (* (- 1) (format 0))) 0) (>= (+ x (* (- 1) (format 0))) 0))) (and (<= (format 0) 3) (>= (format 0) 3))) (and (<= (format 0) 4) (>= (format 0) 4))) (and (<= (format 0) 5) (>= (format 0) 5))) (not (and (<= (format 0) 5) (>= (format 0) 5))))) +(assert (or (or (or (or (or (and (<= (+ percent (* (- 1) (format 0))) 0) (>= (+ percent (* (- 1) (format 0))) 0)) (and (<= (+ s (* (- 1) (format 0))) 0) (>= (+ s (* (- 1) (format 0))) 0))) (and (<= (+ x (* (- 1) (format 0))) 0) (>= (+ x (* (- 1) (format 0))) 0))) (and (<= (format 0) 3) (>= (format 0) 3))) (and (<= (format 0) 4) (>= (format 0) 4))) (and (<= (format 0) 5) (>= (format 0) 5)) (not (or (or (or (or (or (and (<= (+ percent (* (- 1) (format 0))) 0) (>= (+ percent (* (- 1) (format 0))) 0)) (and (<= (+ s (* (- 1) (format 0))) 0) (>= (+ s (* (- 1) (format 0))) 0))) (and (<= (+ x (* (- 1) (format 0))) 0) (>= (+ x (* (- 1) (format 0))) 0))) (and (<= (format 0) 3) (>= (format 0) 3))) (and (<= (format 0) 4) (>= (format 0) 4))) (and (<= (format 0) 5) (>= (format 0) 5)))))) +(assert (or (not (and (<= (format 0) 6) (>= (format 0) 6))) (<= (format 0) 6))) +(assert (or (not (and (<= (format 0) 6) (>= (format 0) 6))) (>= (format 0) 6))) +(assert (or (not (<= (format 0) 6)) (not (>= (format 0) 6)) (and (<= (format 0) 6) (>= (format 0) 6)))) +(assert (or (or (or (or (or (or (or (and (<= (+ percent (* (- 1) (format 0))) 0) (>= (+ percent (* (- 1) (format 0))) 0)) (and (<= (+ s (* (- 1) (format 0))) 0) (>= (+ s (* (- 1) (format 0))) 0))) (and (<= (+ x (* (- 1) (format 0))) 0) (>= (+ x (* (- 1) (format 0))) 0))) (and (<= (format 0) 3) (>= (format 0) 3))) (and (<= (format 0) 4) (>= (format 0) 4))) (and (<= (format 0) 5) (>= (format 0) 5))) (and (<= (format 0) 6) (>= (format 0) 6))) (not (or (or (or (or (or (and (<= (+ percent (* (- 1) (format 0))) 0) (>= (+ percent (* (- 1) (format 0))) 0)) (and (<= (+ s (* (- 1) (format 0))) 0) (>= (+ s (* (- 1) (format 0))) 0))) (and (<= (+ x (* (- 1) (format 0))) 0) (>= (+ x (* (- 1) (format 0))) 0))) (and (<= (format 0) 3) (>= (format 0) 3))) (and (<= (format 0) 4) (>= (format 0) 4))) (and (<= (format 0) 5) (>= (format 0) 5)))))) +(assert (or (or (or (or (or (or (or (and (<= (+ percent (* (- 1) (format 0))) 0) (>= (+ percent (* (- 1) (format 0))) 0)) (and (<= (+ s (* (- 1) (format 0))) 0) (>= (+ s (* (- 1) (format 0))) 0))) (and (<= (+ x (* (- 1) (format 0))) 0) (>= (+ x (* (- 1) (format 0))) 0))) (and (<= (format 0) 3) (>= (format 0) 3))) (and (<= (format 0) 4) (>= (format 0) 4))) (and (<= (format 0) 5) (>= (format 0) 5))) (and (<= (format 0) 6) (>= (format 0) 6))) (not (and (<= (format 0) 6) (>= (format 0) 6))))) +(assert (or (or (or (or (or (or (and (<= (+ percent (* (- 1) (format 0))) 0) (>= (+ percent (* (- 1) (format 0))) 0)) (and (<= (+ s (* (- 1) (format 0))) 0) (>= (+ s (* (- 1) (format 0))) 0))) (and (<= (+ x (* (- 1) (format 0))) 0) (>= (+ x (* (- 1) (format 0))) 0))) (and (<= (format 0) 3) (>= (format 0) 3))) (and (<= (format 0) 4) (>= (format 0) 4))) (and (<= (format 0) 5) (>= (format 0) 5))) (and (<= (format 0) 6) (>= (format 0) 6)) (not (or (or (or (or (or (or (and (<= (+ percent (* (- 1) (format 0))) 0) (>= (+ percent (* (- 1) (format 0))) 0)) (and (<= (+ s (* (- 1) (format 0))) 0) (>= (+ s (* (- 1) (format 0))) 0))) (and (<= (+ x (* (- 1) (format 0))) 0) (>= (+ x (* (- 1) (format 0))) 0))) (and (<= (format 0) 3) (>= (format 0) 3))) (and (<= (format 0) 4) (>= (format 0) 4))) (and (<= (format 0) 5) (>= (format 0) 5))) (and (<= (format 0) 6) (>= (format 0) 6)))))) +(assert (or (not (and (<= (format 0) 255) (>= (format 0) 255))) (<= (format 0) 255))) +(assert (or (not (and (<= (format 0) 255) (>= (format 0) 255))) (>= (format 0) 255))) +(assert (or (not (<= (format 0) 255)) (not (>= (format 0) 255)) (and (<= (format 0) 255) (>= (format 0) 255)))) +(assert (or (or (or (or (or (or (or (and (<= (+ percent (* (- 1) (format 0))) 0) (>= (+ percent (* (- 1) (format 0))) 0)) (and (<= (+ s (* (- 1) (format 0))) 0) (>= (+ s (* (- 1) (format 0))) 0))) (and (<= (+ x (* (- 1) (format 0))) 0) (>= (+ x (* (- 1) (format 0))) 0))) (and (<= (format 0) 3) (>= (format 0) 3))) (and (<= (format 0) 4) (>= (format 0) 4))) (and (<= (format 0) 5) (>= (format 0) 5))) (and (<= (format 0) 6) (>= (format 0) 6))) (and (<= (format 0) 255) (>= (format 0) 255)))) +(assert (or (not (and (<= (+ percent (* (- 1) (format 1))) 0) (>= (+ percent (* (- 1) (format 1))) 0))) (<= (+ percent (* (- 1) (format 1))) 0))) +(assert (or (not (and (<= (+ percent (* (- 1) (format 1))) 0) (>= (+ percent (* (- 1) (format 1))) 0))) (>= (+ percent (* (- 1) (format 1))) 0))) +(assert (or (not (<= (+ percent (* (- 1) (format 1))) 0)) (not (>= (+ percent (* (- 1) (format 1))) 0)) (and (<= (+ percent (* (- 1) (format 1))) 0) (>= (+ percent (* (- 1) (format 1))) 0)))) +(assert (or (not (and (<= (+ s (* (- 1) (format 1))) 0) (>= (+ s (* (- 1) (format 1))) 0))) (<= (+ s (* (- 1) (format 1))) 0))) +(assert (or (not (and (<= (+ s (* (- 1) (format 1))) 0) (>= (+ s (* (- 1) (format 1))) 0))) (>= (+ s (* (- 1) (format 1))) 0))) +(assert (or (not (<= (+ s (* (- 1) (format 1))) 0)) (not (>= (+ s (* (- 1) (format 1))) 0)) (and (<= (+ s (* (- 1) (format 1))) 0) (>= (+ s (* (- 1) (format 1))) 0)))) +(assert (or (or (and (<= (+ percent (* (- 1) (format 1))) 0) (>= (+ percent (* (- 1) (format 1))) 0)) (and (<= (+ s (* (- 1) (format 1))) 0) (>= (+ s (* (- 1) (format 1))) 0))) (not (and (<= (+ percent (* (- 1) (format 1))) 0) (>= (+ percent (* (- 1) (format 1))) 0))))) +(assert (or (or (and (<= (+ percent (* (- 1) (format 1))) 0) (>= (+ percent (* (- 1) (format 1))) 0)) (and (<= (+ s (* (- 1) (format 1))) 0) (>= (+ s (* (- 1) (format 1))) 0))) (not (and (<= (+ s (* (- 1) (format 1))) 0) (>= (+ s (* (- 1) (format 1))) 0))))) +(assert (or (and (<= (+ percent (* (- 1) (format 1))) 0) (>= (+ percent (* (- 1) (format 1))) 0)) (and (<= (+ s (* (- 1) (format 1))) 0) (>= (+ s (* (- 1) (format 1))) 0)) (not (or (and (<= (+ percent (* (- 1) (format 1))) 0) (>= (+ percent (* (- 1) (format 1))) 0)) (and (<= (+ s (* (- 1) (format 1))) 0) (>= (+ s (* (- 1) (format 1))) 0)))))) +(assert (or (not (and (<= (+ x (* (- 1) (format 1))) 0) (>= (+ x (* (- 1) (format 1))) 0))) (<= (+ x (* (- 1) (format 1))) 0))) +(assert (or (not (and (<= (+ x (* (- 1) (format 1))) 0) (>= (+ x (* (- 1) (format 1))) 0))) (>= (+ x (* (- 1) (format 1))) 0))) +(assert (or (not (<= (+ x (* (- 1) (format 1))) 0)) (not (>= (+ x (* (- 1) (format 1))) 0)) (and (<= (+ x (* (- 1) (format 1))) 0) (>= (+ x (* (- 1) (format 1))) 0)))) +(assert (or (or (or (and (<= (+ percent (* (- 1) (format 1))) 0) (>= (+ percent (* (- 1) (format 1))) 0)) (and (<= (+ s (* (- 1) (format 1))) 0) (>= (+ s (* (- 1) (format 1))) 0))) (and (<= (+ x (* (- 1) (format 1))) 0) (>= (+ x (* (- 1) (format 1))) 0))) (not (or (and (<= (+ percent (* (- 1) (format 1))) 0) (>= (+ percent (* (- 1) (format 1))) 0)) (and (<= (+ s (* (- 1) (format 1))) 0) (>= (+ s (* (- 1) (format 1))) 0)))))) +(assert (or (or (or (and (<= (+ percent (* (- 1) (format 1))) 0) (>= (+ percent (* (- 1) (format 1))) 0)) (and (<= (+ s (* (- 1) (format 1))) 0) (>= (+ s (* (- 1) (format 1))) 0))) (and (<= (+ x (* (- 1) (format 1))) 0) (>= (+ x (* (- 1) (format 1))) 0))) (not (and (<= (+ x (* (- 1) (format 1))) 0) (>= (+ x (* (- 1) (format 1))) 0))))) +(assert (or (or (and (<= (+ percent (* (- 1) (format 1))) 0) (>= (+ percent (* (- 1) (format 1))) 0)) (and (<= (+ s (* (- 1) (format 1))) 0) (>= (+ s (* (- 1) (format 1))) 0))) (and (<= (+ x (* (- 1) (format 1))) 0) (>= (+ x (* (- 1) (format 1))) 0)) (not (or (or (and (<= (+ percent (* (- 1) (format 1))) 0) (>= (+ percent (* (- 1) (format 1))) 0)) (and (<= (+ s (* (- 1) (format 1))) 0) (>= (+ s (* (- 1) (format 1))) 0))) (and (<= (+ x (* (- 1) (format 1))) 0) (>= (+ x (* (- 1) (format 1))) 0)))))) +(assert (or (not (and (<= (format 1) 3) (>= (format 1) 3))) (<= (format 1) 3))) +(assert (or (not (and (<= (format 1) 3) (>= (format 1) 3))) (>= (format 1) 3))) +(assert (or (not (<= (format 1) 3)) (not (>= (format 1) 3)) (and (<= (format 1) 3) (>= (format 1) 3)))) +(assert (or (or (or (or (and (<= (+ percent (* (- 1) (format 1))) 0) (>= (+ percent (* (- 1) (format 1))) 0)) (and (<= (+ s (* (- 1) (format 1))) 0) (>= (+ s (* (- 1) (format 1))) 0))) (and (<= (+ x (* (- 1) (format 1))) 0) (>= (+ x (* (- 1) (format 1))) 0))) (and (<= (format 1) 3) (>= (format 1) 3))) (not (or (or (and (<= (+ percent (* (- 1) (format 1))) 0) (>= (+ percent (* (- 1) (format 1))) 0)) (and (<= (+ s (* (- 1) (format 1))) 0) (>= (+ s (* (- 1) (format 1))) 0))) (and (<= (+ x (* (- 1) (format 1))) 0) (>= (+ x (* (- 1) (format 1))) 0)))))) +(assert (or (or (or (or (and (<= (+ percent (* (- 1) (format 1))) 0) (>= (+ percent (* (- 1) (format 1))) 0)) (and (<= (+ s (* (- 1) (format 1))) 0) (>= (+ s (* (- 1) (format 1))) 0))) (and (<= (+ x (* (- 1) (format 1))) 0) (>= (+ x (* (- 1) (format 1))) 0))) (and (<= (format 1) 3) (>= (format 1) 3))) (not (and (<= (format 1) 3) (>= (format 1) 3))))) +(assert (or (or (or (and (<= (+ percent (* (- 1) (format 1))) 0) (>= (+ percent (* (- 1) (format 1))) 0)) (and (<= (+ s (* (- 1) (format 1))) 0) (>= (+ s (* (- 1) (format 1))) 0))) (and (<= (+ x (* (- 1) (format 1))) 0) (>= (+ x (* (- 1) (format 1))) 0))) (and (<= (format 1) 3) (>= (format 1) 3)) (not (or (or (or (and (<= (+ percent (* (- 1) (format 1))) 0) (>= (+ percent (* (- 1) (format 1))) 0)) (and (<= (+ s (* (- 1) (format 1))) 0) (>= (+ s (* (- 1) (format 1))) 0))) (and (<= (+ x (* (- 1) (format 1))) 0) (>= (+ x (* (- 1) (format 1))) 0))) (and (<= (format 1) 3) (>= (format 1) 3)))))) +(assert (or (not (and (<= (format 1) 4) (>= (format 1) 4))) (<= (format 1) 4))) +(assert (or (not (and (<= (format 1) 4) (>= (format 1) 4))) (>= (format 1) 4))) +(assert (or (not (<= (format 1) 4)) (not (>= (format 1) 4)) (and (<= (format 1) 4) (>= (format 1) 4)))) +(assert (or (or (or (or (or (and (<= (+ percent (* (- 1) (format 1))) 0) (>= (+ percent (* (- 1) (format 1))) 0)) (and (<= (+ s (* (- 1) (format 1))) 0) (>= (+ s (* (- 1) (format 1))) 0))) (and (<= (+ x (* (- 1) (format 1))) 0) (>= (+ x (* (- 1) (format 1))) 0))) (and (<= (format 1) 3) (>= (format 1) 3))) (and (<= (format 1) 4) (>= (format 1) 4))) (not (or (or (or (and (<= (+ percent (* (- 1) (format 1))) 0) (>= (+ percent (* (- 1) (format 1))) 0)) (and (<= (+ s (* (- 1) (format 1))) 0) (>= (+ s (* (- 1) (format 1))) 0))) (and (<= (+ x (* (- 1) (format 1))) 0) (>= (+ x (* (- 1) (format 1))) 0))) (and (<= (format 1) 3) (>= (format 1) 3)))))) +(assert (or (or (or (or (or (and (<= (+ percent (* (- 1) (format 1))) 0) (>= (+ percent (* (- 1) (format 1))) 0)) (and (<= (+ s (* (- 1) (format 1))) 0) (>= (+ s (* (- 1) (format 1))) 0))) (and (<= (+ x (* (- 1) (format 1))) 0) (>= (+ x (* (- 1) (format 1))) 0))) (and (<= (format 1) 3) (>= (format 1) 3))) (and (<= (format 1) 4) (>= (format 1) 4))) (not (and (<= (format 1) 4) (>= (format 1) 4))))) +(assert (or (or (or (or (and (<= (+ percent (* (- 1) (format 1))) 0) (>= (+ percent (* (- 1) (format 1))) 0)) (and (<= (+ s (* (- 1) (format 1))) 0) (>= (+ s (* (- 1) (format 1))) 0))) (and (<= (+ x (* (- 1) (format 1))) 0) (>= (+ x (* (- 1) (format 1))) 0))) (and (<= (format 1) 3) (>= (format 1) 3))) (and (<= (format 1) 4) (>= (format 1) 4)) (not (or (or (or (or (and (<= (+ percent (* (- 1) (format 1))) 0) (>= (+ percent (* (- 1) (format 1))) 0)) (and (<= (+ s (* (- 1) (format 1))) 0) (>= (+ s (* (- 1) (format 1))) 0))) (and (<= (+ x (* (- 1) (format 1))) 0) (>= (+ x (* (- 1) (format 1))) 0))) (and (<= (format 1) 3) (>= (format 1) 3))) (and (<= (format 1) 4) (>= (format 1) 4)))))) +(assert (or (not (and (<= (format 1) 5) (>= (format 1) 5))) (<= (format 1) 5))) +(assert (or (not (and (<= (format 1) 5) (>= (format 1) 5))) (>= (format 1) 5))) +(assert (or (not (<= (format 1) 5)) (not (>= (format 1) 5)) (and (<= (format 1) 5) (>= (format 1) 5)))) +(assert (or (or (or (or (or (or (and (<= (+ percent (* (- 1) (format 1))) 0) (>= (+ percent (* (- 1) (format 1))) 0)) (and (<= (+ s (* (- 1) (format 1))) 0) (>= (+ s (* (- 1) (format 1))) 0))) (and (<= (+ x (* (- 1) (format 1))) 0) (>= (+ x (* (- 1) (format 1))) 0))) (and (<= (format 1) 3) (>= (format 1) 3))) (and (<= (format 1) 4) (>= (format 1) 4))) (and (<= (format 1) 5) (>= (format 1) 5))) (not (or (or (or (or (and (<= (+ percent (* (- 1) (format 1))) 0) (>= (+ percent (* (- 1) (format 1))) 0)) (and (<= (+ s (* (- 1) (format 1))) 0) (>= (+ s (* (- 1) (format 1))) 0))) (and (<= (+ x (* (- 1) (format 1))) 0) (>= (+ x (* (- 1) (format 1))) 0))) (and (<= (format 1) 3) (>= (format 1) 3))) (and (<= (format 1) 4) (>= (format 1) 4)))))) +(assert (or (or (or (or (or (or (and (<= (+ percent (* (- 1) (format 1))) 0) (>= (+ percent (* (- 1) (format 1))) 0)) (and (<= (+ s (* (- 1) (format 1))) 0) (>= (+ s (* (- 1) (format 1))) 0))) (and (<= (+ x (* (- 1) (format 1))) 0) (>= (+ x (* (- 1) (format 1))) 0))) (and (<= (format 1) 3) (>= (format 1) 3))) (and (<= (format 1) 4) (>= (format 1) 4))) (and (<= (format 1) 5) (>= (format 1) 5))) (not (and (<= (format 1) 5) (>= (format 1) 5))))) +(assert (or (or (or (or (or (and (<= (+ percent (* (- 1) (format 1))) 0) (>= (+ percent (* (- 1) (format 1))) 0)) (and (<= (+ s (* (- 1) (format 1))) 0) (>= (+ s (* (- 1) (format 1))) 0))) (and (<= (+ x (* (- 1) (format 1))) 0) (>= (+ x (* (- 1) (format 1))) 0))) (and (<= (format 1) 3) (>= (format 1) 3))) (and (<= (format 1) 4) (>= (format 1) 4))) (and (<= (format 1) 5) (>= (format 1) 5)) (not (or (or (or (or (or (and (<= (+ percent (* (- 1) (format 1))) 0) (>= (+ percent (* (- 1) (format 1))) 0)) (and (<= (+ s (* (- 1) (format 1))) 0) (>= (+ s (* (- 1) (format 1))) 0))) (and (<= (+ x (* (- 1) (format 1))) 0) (>= (+ x (* (- 1) (format 1))) 0))) (and (<= (format 1) 3) (>= (format 1) 3))) (and (<= (format 1) 4) (>= (format 1) 4))) (and (<= (format 1) 5) (>= (format 1) 5)))))) +(assert (or (not (and (<= (format 1) 6) (>= (format 1) 6))) (<= (format 1) 6))) +(assert (or (not (and (<= (format 1) 6) (>= (format 1) 6))) (>= (format 1) 6))) +(assert (or (not (<= (format 1) 6)) (not (>= (format 1) 6)) (and (<= (format 1) 6) (>= (format 1) 6)))) +(assert (or (or (or (or (or (or (or (and (<= (+ percent (* (- 1) (format 1))) 0) (>= (+ percent (* (- 1) (format 1))) 0)) (and (<= (+ s (* (- 1) (format 1))) 0) (>= (+ s (* (- 1) (format 1))) 0))) (and (<= (+ x (* (- 1) (format 1))) 0) (>= (+ x (* (- 1) (format 1))) 0))) (and (<= (format 1) 3) (>= (format 1) 3))) (and (<= (format 1) 4) (>= (format 1) 4))) (and (<= (format 1) 5) (>= (format 1) 5))) (and (<= (format 1) 6) (>= (format 1) 6))) (not (or (or (or (or (or (and (<= (+ percent (* (- 1) (format 1))) 0) (>= (+ percent (* (- 1) (format 1))) 0)) (and (<= (+ s (* (- 1) (format 1))) 0) (>= (+ s (* (- 1) (format 1))) 0))) (and (<= (+ x (* (- 1) (format 1))) 0) (>= (+ x (* (- 1) (format 1))) 0))) (and (<= (format 1) 3) (>= (format 1) 3))) (and (<= (format 1) 4) (>= (format 1) 4))) (and (<= (format 1) 5) (>= (format 1) 5)))))) +(assert (or (or (or (or (or (or (or (and (<= (+ percent (* (- 1) (format 1))) 0) (>= (+ percent (* (- 1) (format 1))) 0)) (and (<= (+ s (* (- 1) (format 1))) 0) (>= (+ s (* (- 1) (format 1))) 0))) (and (<= (+ x (* (- 1) (format 1))) 0) (>= (+ x (* (- 1) (format 1))) 0))) (and (<= (format 1) 3) (>= (format 1) 3))) (and (<= (format 1) 4) (>= (format 1) 4))) (and (<= (format 1) 5) (>= (format 1) 5))) (and (<= (format 1) 6) (>= (format 1) 6))) (not (and (<= (format 1) 6) (>= (format 1) 6))))) +(assert (or (or (or (or (or (or (and (<= (+ percent (* (- 1) (format 1))) 0) (>= (+ percent (* (- 1) (format 1))) 0)) (and (<= (+ s (* (- 1) (format 1))) 0) (>= (+ s (* (- 1) (format 1))) 0))) (and (<= (+ x (* (- 1) (format 1))) 0) (>= (+ x (* (- 1) (format 1))) 0))) (and (<= (format 1) 3) (>= (format 1) 3))) (and (<= (format 1) 4) (>= (format 1) 4))) (and (<= (format 1) 5) (>= (format 1) 5))) (and (<= (format 1) 6) (>= (format 1) 6)) (not (or (or (or (or (or (or (and (<= (+ percent (* (- 1) (format 1))) 0) (>= (+ percent (* (- 1) (format 1))) 0)) (and (<= (+ s (* (- 1) (format 1))) 0) (>= (+ s (* (- 1) (format 1))) 0))) (and (<= (+ x (* (- 1) (format 1))) 0) (>= (+ x (* (- 1) (format 1))) 0))) (and (<= (format 1) 3) (>= (format 1) 3))) (and (<= (format 1) 4) (>= (format 1) 4))) (and (<= (format 1) 5) (>= (format 1) 5))) (and (<= (format 1) 6) (>= (format 1) 6)))))) +(assert (or (not (and (<= (format 1) 255) (>= (format 1) 255))) (<= (format 1) 255))) +(assert (or (not (and (<= (format 1) 255) (>= (format 1) 255))) (>= (format 1) 255))) +(assert (or (not (<= (format 1) 255)) (not (>= (format 1) 255)) (and (<= (format 1) 255) (>= (format 1) 255)))) +(assert (or (or (or (or (or (or (or (and (<= (+ percent (* (- 1) (format 1))) 0) (>= (+ percent (* (- 1) (format 1))) 0)) (and (<= (+ s (* (- 1) (format 1))) 0) (>= (+ s (* (- 1) (format 1))) 0))) (and (<= (+ x (* (- 1) (format 1))) 0) (>= (+ x (* (- 1) (format 1))) 0))) (and (<= (format 1) 3) (>= (format 1) 3))) (and (<= (format 1) 4) (>= (format 1) 4))) (and (<= (format 1) 5) (>= (format 1) 5))) (and (<= (format 1) 6) (>= (format 1) 6))) (and (<= (format 1) 255) (>= (format 1) 255)))) +(assert (or (not (and (<= (+ percent (* (- 1) (format 2))) 0) (>= (+ percent (* (- 1) (format 2))) 0))) (<= (+ percent (* (- 1) (format 2))) 0))) +(assert (or (not (and (<= (+ percent (* (- 1) (format 2))) 0) (>= (+ percent (* (- 1) (format 2))) 0))) (>= (+ percent (* (- 1) (format 2))) 0))) +(assert (or (not (<= (+ percent (* (- 1) (format 2))) 0)) (not (>= (+ percent (* (- 1) (format 2))) 0)) (and (<= (+ percent (* (- 1) (format 2))) 0) (>= (+ percent (* (- 1) (format 2))) 0)))) +(assert (or (not (and (<= (+ s (* (- 1) (format 2))) 0) (>= (+ s (* (- 1) (format 2))) 0))) (<= (+ s (* (- 1) (format 2))) 0))) +(assert (or (not (and (<= (+ s (* (- 1) (format 2))) 0) (>= (+ s (* (- 1) (format 2))) 0))) (>= (+ s (* (- 1) (format 2))) 0))) +(assert (or (not (<= (+ s (* (- 1) (format 2))) 0)) (not (>= (+ s (* (- 1) (format 2))) 0)) (and (<= (+ s (* (- 1) (format 2))) 0) (>= (+ s (* (- 1) (format 2))) 0)))) +(assert (or (or (and (<= (+ percent (* (- 1) (format 2))) 0) (>= (+ percent (* (- 1) (format 2))) 0)) (and (<= (+ s (* (- 1) (format 2))) 0) (>= (+ s (* (- 1) (format 2))) 0))) (not (and (<= (+ percent (* (- 1) (format 2))) 0) (>= (+ percent (* (- 1) (format 2))) 0))))) +(assert (or (or (and (<= (+ percent (* (- 1) (format 2))) 0) (>= (+ percent (* (- 1) (format 2))) 0)) (and (<= (+ s (* (- 1) (format 2))) 0) (>= (+ s (* (- 1) (format 2))) 0))) (not (and (<= (+ s (* (- 1) (format 2))) 0) (>= (+ s (* (- 1) (format 2))) 0))))) +(assert (or (and (<= (+ percent (* (- 1) (format 2))) 0) (>= (+ percent (* (- 1) (format 2))) 0)) (and (<= (+ s (* (- 1) (format 2))) 0) (>= (+ s (* (- 1) (format 2))) 0)) (not (or (and (<= (+ percent (* (- 1) (format 2))) 0) (>= (+ percent (* (- 1) (format 2))) 0)) (and (<= (+ s (* (- 1) (format 2))) 0) (>= (+ s (* (- 1) (format 2))) 0)))))) +(assert (or (not (and (<= (+ x (* (- 1) (format 2))) 0) (>= (+ x (* (- 1) (format 2))) 0))) (<= (+ x (* (- 1) (format 2))) 0))) +(assert (or (not (and (<= (+ x (* (- 1) (format 2))) 0) (>= (+ x (* (- 1) (format 2))) 0))) (>= (+ x (* (- 1) (format 2))) 0))) +(assert (or (not (<= (+ x (* (- 1) (format 2))) 0)) (not (>= (+ x (* (- 1) (format 2))) 0)) (and (<= (+ x (* (- 1) (format 2))) 0) (>= (+ x (* (- 1) (format 2))) 0)))) +(assert (or (or (or (and (<= (+ percent (* (- 1) (format 2))) 0) (>= (+ percent (* (- 1) (format 2))) 0)) (and (<= (+ s (* (- 1) (format 2))) 0) (>= (+ s (* (- 1) (format 2))) 0))) (and (<= (+ x (* (- 1) (format 2))) 0) (>= (+ x (* (- 1) (format 2))) 0))) (not (or (and (<= (+ percent (* (- 1) (format 2))) 0) (>= (+ percent (* (- 1) (format 2))) 0)) (and (<= (+ s (* (- 1) (format 2))) 0) (>= (+ s (* (- 1) (format 2))) 0)))))) +(assert (or (or (or (and (<= (+ percent (* (- 1) (format 2))) 0) (>= (+ percent (* (- 1) (format 2))) 0)) (and (<= (+ s (* (- 1) (format 2))) 0) (>= (+ s (* (- 1) (format 2))) 0))) (and (<= (+ x (* (- 1) (format 2))) 0) (>= (+ x (* (- 1) (format 2))) 0))) (not (and (<= (+ x (* (- 1) (format 2))) 0) (>= (+ x (* (- 1) (format 2))) 0))))) +(assert (or (or (and (<= (+ percent (* (- 1) (format 2))) 0) (>= (+ percent (* (- 1) (format 2))) 0)) (and (<= (+ s (* (- 1) (format 2))) 0) (>= (+ s (* (- 1) (format 2))) 0))) (and (<= (+ x (* (- 1) (format 2))) 0) (>= (+ x (* (- 1) (format 2))) 0)) (not (or (or (and (<= (+ percent (* (- 1) (format 2))) 0) (>= (+ percent (* (- 1) (format 2))) 0)) (and (<= (+ s (* (- 1) (format 2))) 0) (>= (+ s (* (- 1) (format 2))) 0))) (and (<= (+ x (* (- 1) (format 2))) 0) (>= (+ x (* (- 1) (format 2))) 0)))))) +(assert (or (not (and (<= (format 2) 3) (>= (format 2) 3))) (<= (format 2) 3))) +(assert (or (not (and (<= (format 2) 3) (>= (format 2) 3))) (>= (format 2) 3))) +(assert (or (not (<= (format 2) 3)) (not (>= (format 2) 3)) (and (<= (format 2) 3) (>= (format 2) 3)))) +(assert (or (or (or (or (and (<= (+ percent (* (- 1) (format 2))) 0) (>= (+ percent (* (- 1) (format 2))) 0)) (and (<= (+ s (* (- 1) (format 2))) 0) (>= (+ s (* (- 1) (format 2))) 0))) (and (<= (+ x (* (- 1) (format 2))) 0) (>= (+ x (* (- 1) (format 2))) 0))) (and (<= (format 2) 3) (>= (format 2) 3))) (not (or (or (and (<= (+ percent (* (- 1) (format 2))) 0) (>= (+ percent (* (- 1) (format 2))) 0)) (and (<= (+ s (* (- 1) (format 2))) 0) (>= (+ s (* (- 1) (format 2))) 0))) (and (<= (+ x (* (- 1) (format 2))) 0) (>= (+ x (* (- 1) (format 2))) 0)))))) +(assert (or (or (or (or (and (<= (+ percent (* (- 1) (format 2))) 0) (>= (+ percent (* (- 1) (format 2))) 0)) (and (<= (+ s (* (- 1) (format 2))) 0) (>= (+ s (* (- 1) (format 2))) 0))) (and (<= (+ x (* (- 1) (format 2))) 0) (>= (+ x (* (- 1) (format 2))) 0))) (and (<= (format 2) 3) (>= (format 2) 3))) (not (and (<= (format 2) 3) (>= (format 2) 3))))) +(assert (or (or (or (and (<= (+ percent (* (- 1) (format 2))) 0) (>= (+ percent (* (- 1) (format 2))) 0)) (and (<= (+ s (* (- 1) (format 2))) 0) (>= (+ s (* (- 1) (format 2))) 0))) (and (<= (+ x (* (- 1) (format 2))) 0) (>= (+ x (* (- 1) (format 2))) 0))) (and (<= (format 2) 3) (>= (format 2) 3)) (not (or (or (or (and (<= (+ percent (* (- 1) (format 2))) 0) (>= (+ percent (* (- 1) (format 2))) 0)) (and (<= (+ s (* (- 1) (format 2))) 0) (>= (+ s (* (- 1) (format 2))) 0))) (and (<= (+ x (* (- 1) (format 2))) 0) (>= (+ x (* (- 1) (format 2))) 0))) (and (<= (format 2) 3) (>= (format 2) 3)))))) +(assert (or (not (and (<= (format 2) 4) (>= (format 2) 4))) (<= (format 2) 4))) +(assert (or (not (and (<= (format 2) 4) (>= (format 2) 4))) (>= (format 2) 4))) +(assert (or (not (<= (format 2) 4)) (not (>= (format 2) 4)) (and (<= (format 2) 4) (>= (format 2) 4)))) +(assert (or (or (or (or (or (and (<= (+ percent (* (- 1) (format 2))) 0) (>= (+ percent (* (- 1) (format 2))) 0)) (and (<= (+ s (* (- 1) (format 2))) 0) (>= (+ s (* (- 1) (format 2))) 0))) (and (<= (+ x (* (- 1) (format 2))) 0) (>= (+ x (* (- 1) (format 2))) 0))) (and (<= (format 2) 3) (>= (format 2) 3))) (and (<= (format 2) 4) (>= (format 2) 4))) (not (or (or (or (and (<= (+ percent (* (- 1) (format 2))) 0) (>= (+ percent (* (- 1) (format 2))) 0)) (and (<= (+ s (* (- 1) (format 2))) 0) (>= (+ s (* (- 1) (format 2))) 0))) (and (<= (+ x (* (- 1) (format 2))) 0) (>= (+ x (* (- 1) (format 2))) 0))) (and (<= (format 2) 3) (>= (format 2) 3)))))) +(assert (or (or (or (or (or (and (<= (+ percent (* (- 1) (format 2))) 0) (>= (+ percent (* (- 1) (format 2))) 0)) (and (<= (+ s (* (- 1) (format 2))) 0) (>= (+ s (* (- 1) (format 2))) 0))) (and (<= (+ x (* (- 1) (format 2))) 0) (>= (+ x (* (- 1) (format 2))) 0))) (and (<= (format 2) 3) (>= (format 2) 3))) (and (<= (format 2) 4) (>= (format 2) 4))) (not (and (<= (format 2) 4) (>= (format 2) 4))))) +(assert (or (or (or (or (and (<= (+ percent (* (- 1) (format 2))) 0) (>= (+ percent (* (- 1) (format 2))) 0)) (and (<= (+ s (* (- 1) (format 2))) 0) (>= (+ s (* (- 1) (format 2))) 0))) (and (<= (+ x (* (- 1) (format 2))) 0) (>= (+ x (* (- 1) (format 2))) 0))) (and (<= (format 2) 3) (>= (format 2) 3))) (and (<= (format 2) 4) (>= (format 2) 4)) (not (or (or (or (or (and (<= (+ percent (* (- 1) (format 2))) 0) (>= (+ percent (* (- 1) (format 2))) 0)) (and (<= (+ s (* (- 1) (format 2))) 0) (>= (+ s (* (- 1) (format 2))) 0))) (and (<= (+ x (* (- 1) (format 2))) 0) (>= (+ x (* (- 1) (format 2))) 0))) (and (<= (format 2) 3) (>= (format 2) 3))) (and (<= (format 2) 4) (>= (format 2) 4)))))) +(assert (or (not (and (<= (format 2) 5) (>= (format 2) 5))) (<= (format 2) 5))) +(assert (or (not (and (<= (format 2) 5) (>= (format 2) 5))) (>= (format 2) 5))) +(assert (or (not (<= (format 2) 5)) (not (>= (format 2) 5)) (and (<= (format 2) 5) (>= (format 2) 5)))) +(assert (or (or (or (or (or (or (and (<= (+ percent (* (- 1) (format 2))) 0) (>= (+ percent (* (- 1) (format 2))) 0)) (and (<= (+ s (* (- 1) (format 2))) 0) (>= (+ s (* (- 1) (format 2))) 0))) (and (<= (+ x (* (- 1) (format 2))) 0) (>= (+ x (* (- 1) (format 2))) 0))) (and (<= (format 2) 3) (>= (format 2) 3))) (and (<= (format 2) 4) (>= (format 2) 4))) (and (<= (format 2) 5) (>= (format 2) 5))) (not (or (or (or (or (and (<= (+ percent (* (- 1) (format 2))) 0) (>= (+ percent (* (- 1) (format 2))) 0)) (and (<= (+ s (* (- 1) (format 2))) 0) (>= (+ s (* (- 1) (format 2))) 0))) (and (<= (+ x (* (- 1) (format 2))) 0) (>= (+ x (* (- 1) (format 2))) 0))) (and (<= (format 2) 3) (>= (format 2) 3))) (and (<= (format 2) 4) (>= (format 2) 4)))))) +(assert (or (or (or (or (or (or (and (<= (+ percent (* (- 1) (format 2))) 0) (>= (+ percent (* (- 1) (format 2))) 0)) (and (<= (+ s (* (- 1) (format 2))) 0) (>= (+ s (* (- 1) (format 2))) 0))) (and (<= (+ x (* (- 1) (format 2))) 0) (>= (+ x (* (- 1) (format 2))) 0))) (and (<= (format 2) 3) (>= (format 2) 3))) (and (<= (format 2) 4) (>= (format 2) 4))) (and (<= (format 2) 5) (>= (format 2) 5))) (not (and (<= (format 2) 5) (>= (format 2) 5))))) +(assert (or (or (or (or (or (and (<= (+ percent (* (- 1) (format 2))) 0) (>= (+ percent (* (- 1) (format 2))) 0)) (and (<= (+ s (* (- 1) (format 2))) 0) (>= (+ s (* (- 1) (format 2))) 0))) (and (<= (+ x (* (- 1) (format 2))) 0) (>= (+ x (* (- 1) (format 2))) 0))) (and (<= (format 2) 3) (>= (format 2) 3))) (and (<= (format 2) 4) (>= (format 2) 4))) (and (<= (format 2) 5) (>= (format 2) 5)) (not (or (or (or (or (or (and (<= (+ percent (* (- 1) (format 2))) 0) (>= (+ percent (* (- 1) (format 2))) 0)) (and (<= (+ s (* (- 1) (format 2))) 0) (>= (+ s (* (- 1) (format 2))) 0))) (and (<= (+ x (* (- 1) (format 2))) 0) (>= (+ x (* (- 1) (format 2))) 0))) (and (<= (format 2) 3) (>= (format 2) 3))) (and (<= (format 2) 4) (>= (format 2) 4))) (and (<= (format 2) 5) (>= (format 2) 5)))))) +(assert (or (not (and (<= (format 2) 6) (>= (format 2) 6))) (<= (format 2) 6))) +(assert (or (not (and (<= (format 2) 6) (>= (format 2) 6))) (>= (format 2) 6))) +(assert (or (not (<= (format 2) 6)) (not (>= (format 2) 6)) (and (<= (format 2) 6) (>= (format 2) 6)))) +(assert (or (or (or (or (or (or (or (and (<= (+ percent (* (- 1) (format 2))) 0) (>= (+ percent (* (- 1) (format 2))) 0)) (and (<= (+ s (* (- 1) (format 2))) 0) (>= (+ s (* (- 1) (format 2))) 0))) (and (<= (+ x (* (- 1) (format 2))) 0) (>= (+ x (* (- 1) (format 2))) 0))) (and (<= (format 2) 3) (>= (format 2) 3))) (and (<= (format 2) 4) (>= (format 2) 4))) (and (<= (format 2) 5) (>= (format 2) 5))) (and (<= (format 2) 6) (>= (format 2) 6))) (not (or (or (or (or (or (and (<= (+ percent (* (- 1) (format 2))) 0) (>= (+ percent (* (- 1) (format 2))) 0)) (and (<= (+ s (* (- 1) (format 2))) 0) (>= (+ s (* (- 1) (format 2))) 0))) (and (<= (+ x (* (- 1) (format 2))) 0) (>= (+ x (* (- 1) (format 2))) 0))) (and (<= (format 2) 3) (>= (format 2) 3))) (and (<= (format 2) 4) (>= (format 2) 4))) (and (<= (format 2) 5) (>= (format 2) 5)))))) +(assert (or (or (or (or (or (or (or (and (<= (+ percent (* (- 1) (format 2))) 0) (>= (+ percent (* (- 1) (format 2))) 0)) (and (<= (+ s (* (- 1) (format 2))) 0) (>= (+ s (* (- 1) (format 2))) 0))) (and (<= (+ x (* (- 1) (format 2))) 0) (>= (+ x (* (- 1) (format 2))) 0))) (and (<= (format 2) 3) (>= (format 2) 3))) (and (<= (format 2) 4) (>= (format 2) 4))) (and (<= (format 2) 5) (>= (format 2) 5))) (and (<= (format 2) 6) (>= (format 2) 6))) (not (and (<= (format 2) 6) (>= (format 2) 6))))) +(assert (or (or (or (or (or (or (and (<= (+ percent (* (- 1) (format 2))) 0) (>= (+ percent (* (- 1) (format 2))) 0)) (and (<= (+ s (* (- 1) (format 2))) 0) (>= (+ s (* (- 1) (format 2))) 0))) (and (<= (+ x (* (- 1) (format 2))) 0) (>= (+ x (* (- 1) (format 2))) 0))) (and (<= (format 2) 3) (>= (format 2) 3))) (and (<= (format 2) 4) (>= (format 2) 4))) (and (<= (format 2) 5) (>= (format 2) 5))) (and (<= (format 2) 6) (>= (format 2) 6)) (not (or (or (or (or (or (or (and (<= (+ percent (* (- 1) (format 2))) 0) (>= (+ percent (* (- 1) (format 2))) 0)) (and (<= (+ s (* (- 1) (format 2))) 0) (>= (+ s (* (- 1) (format 2))) 0))) (and (<= (+ x (* (- 1) (format 2))) 0) (>= (+ x (* (- 1) (format 2))) 0))) (and (<= (format 2) 3) (>= (format 2) 3))) (and (<= (format 2) 4) (>= (format 2) 4))) (and (<= (format 2) 5) (>= (format 2) 5))) (and (<= (format 2) 6) (>= (format 2) 6)))))) +(assert (or (not (and (<= (format 2) 255) (>= (format 2) 255))) (<= (format 2) 255))) +(assert (or (not (and (<= (format 2) 255) (>= (format 2) 255))) (>= (format 2) 255))) +(assert (or (not (<= (format 2) 255)) (not (>= (format 2) 255)) (and (<= (format 2) 255) (>= (format 2) 255)))) +(assert (or (or (or (or (or (or (or (and (<= (+ percent (* (- 1) (format 2))) 0) (>= (+ percent (* (- 1) (format 2))) 0)) (and (<= (+ s (* (- 1) (format 2))) 0) (>= (+ s (* (- 1) (format 2))) 0))) (and (<= (+ x (* (- 1) (format 2))) 0) (>= (+ x (* (- 1) (format 2))) 0))) (and (<= (format 2) 3) (>= (format 2) 3))) (and (<= (format 2) 4) (>= (format 2) 4))) (and (<= (format 2) 5) (>= (format 2) 5))) (and (<= (format 2) 6) (>= (format 2) 6))) (and (<= (format 2) 255) (>= (format 2) 255)))) +(assert (or (not (and (<= (+ percent (* (- 1) (format 3))) 0) (>= (+ percent (* (- 1) (format 3))) 0))) (<= (+ percent (* (- 1) (format 3))) 0))) +(assert (or (not (and (<= (+ percent (* (- 1) (format 3))) 0) (>= (+ percent (* (- 1) (format 3))) 0))) (>= (+ percent (* (- 1) (format 3))) 0))) +(assert (or (not (<= (+ percent (* (- 1) (format 3))) 0)) (not (>= (+ percent (* (- 1) (format 3))) 0)) (and (<= (+ percent (* (- 1) (format 3))) 0) (>= (+ percent (* (- 1) (format 3))) 0)))) +(assert (or (not (and (<= (+ s (* (- 1) (format 3))) 0) (>= (+ s (* (- 1) (format 3))) 0))) (<= (+ s (* (- 1) (format 3))) 0))) +(assert (or (not (and (<= (+ s (* (- 1) (format 3))) 0) (>= (+ s (* (- 1) (format 3))) 0))) (>= (+ s (* (- 1) (format 3))) 0))) +(assert (or (not (<= (+ s (* (- 1) (format 3))) 0)) (not (>= (+ s (* (- 1) (format 3))) 0)) (and (<= (+ s (* (- 1) (format 3))) 0) (>= (+ s (* (- 1) (format 3))) 0)))) +(assert (or (or (and (<= (+ percent (* (- 1) (format 3))) 0) (>= (+ percent (* (- 1) (format 3))) 0)) (and (<= (+ s (* (- 1) (format 3))) 0) (>= (+ s (* (- 1) (format 3))) 0))) (not (and (<= (+ percent (* (- 1) (format 3))) 0) (>= (+ percent (* (- 1) (format 3))) 0))))) +(assert (or (or (and (<= (+ percent (* (- 1) (format 3))) 0) (>= (+ percent (* (- 1) (format 3))) 0)) (and (<= (+ s (* (- 1) (format 3))) 0) (>= (+ s (* (- 1) (format 3))) 0))) (not (and (<= (+ s (* (- 1) (format 3))) 0) (>= (+ s (* (- 1) (format 3))) 0))))) +(assert (or (and (<= (+ percent (* (- 1) (format 3))) 0) (>= (+ percent (* (- 1) (format 3))) 0)) (and (<= (+ s (* (- 1) (format 3))) 0) (>= (+ s (* (- 1) (format 3))) 0)) (not (or (and (<= (+ percent (* (- 1) (format 3))) 0) (>= (+ percent (* (- 1) (format 3))) 0)) (and (<= (+ s (* (- 1) (format 3))) 0) (>= (+ s (* (- 1) (format 3))) 0)))))) +(assert (or (not (and (<= (+ x (* (- 1) (format 3))) 0) (>= (+ x (* (- 1) (format 3))) 0))) (<= (+ x (* (- 1) (format 3))) 0))) +(assert (or (not (and (<= (+ x (* (- 1) (format 3))) 0) (>= (+ x (* (- 1) (format 3))) 0))) (>= (+ x (* (- 1) (format 3))) 0))) +(assert (or (not (<= (+ x (* (- 1) (format 3))) 0)) (not (>= (+ x (* (- 1) (format 3))) 0)) (and (<= (+ x (* (- 1) (format 3))) 0) (>= (+ x (* (- 1) (format 3))) 0)))) +(assert (or (or (or (and (<= (+ percent (* (- 1) (format 3))) 0) (>= (+ percent (* (- 1) (format 3))) 0)) (and (<= (+ s (* (- 1) (format 3))) 0) (>= (+ s (* (- 1) (format 3))) 0))) (and (<= (+ x (* (- 1) (format 3))) 0) (>= (+ x (* (- 1) (format 3))) 0))) (not (or (and (<= (+ percent (* (- 1) (format 3))) 0) (>= (+ percent (* (- 1) (format 3))) 0)) (and (<= (+ s (* (- 1) (format 3))) 0) (>= (+ s (* (- 1) (format 3))) 0)))))) +(assert (or (or (or (and (<= (+ percent (* (- 1) (format 3))) 0) (>= (+ percent (* (- 1) (format 3))) 0)) (and (<= (+ s (* (- 1) (format 3))) 0) (>= (+ s (* (- 1) (format 3))) 0))) (and (<= (+ x (* (- 1) (format 3))) 0) (>= (+ x (* (- 1) (format 3))) 0))) (not (and (<= (+ x (* (- 1) (format 3))) 0) (>= (+ x (* (- 1) (format 3))) 0))))) +(assert (or (or (and (<= (+ percent (* (- 1) (format 3))) 0) (>= (+ percent (* (- 1) (format 3))) 0)) (and (<= (+ s (* (- 1) (format 3))) 0) (>= (+ s (* (- 1) (format 3))) 0))) (and (<= (+ x (* (- 1) (format 3))) 0) (>= (+ x (* (- 1) (format 3))) 0)) (not (or (or (and (<= (+ percent (* (- 1) (format 3))) 0) (>= (+ percent (* (- 1) (format 3))) 0)) (and (<= (+ s (* (- 1) (format 3))) 0) (>= (+ s (* (- 1) (format 3))) 0))) (and (<= (+ x (* (- 1) (format 3))) 0) (>= (+ x (* (- 1) (format 3))) 0)))))) +(assert (or (not (and (<= (format 3) 3) (>= (format 3) 3))) (<= (format 3) 3))) +(assert (or (not (and (<= (format 3) 3) (>= (format 3) 3))) (>= (format 3) 3))) +(assert (or (not (<= (format 3) 3)) (not (>= (format 3) 3)) (and (<= (format 3) 3) (>= (format 3) 3)))) +(assert (or (or (or (or (and (<= (+ percent (* (- 1) (format 3))) 0) (>= (+ percent (* (- 1) (format 3))) 0)) (and (<= (+ s (* (- 1) (format 3))) 0) (>= (+ s (* (- 1) (format 3))) 0))) (and (<= (+ x (* (- 1) (format 3))) 0) (>= (+ x (* (- 1) (format 3))) 0))) (and (<= (format 3) 3) (>= (format 3) 3))) (not (or (or (and (<= (+ percent (* (- 1) (format 3))) 0) (>= (+ percent (* (- 1) (format 3))) 0)) (and (<= (+ s (* (- 1) (format 3))) 0) (>= (+ s (* (- 1) (format 3))) 0))) (and (<= (+ x (* (- 1) (format 3))) 0) (>= (+ x (* (- 1) (format 3))) 0)))))) +(assert (or (or (or (or (and (<= (+ percent (* (- 1) (format 3))) 0) (>= (+ percent (* (- 1) (format 3))) 0)) (and (<= (+ s (* (- 1) (format 3))) 0) (>= (+ s (* (- 1) (format 3))) 0))) (and (<= (+ x (* (- 1) (format 3))) 0) (>= (+ x (* (- 1) (format 3))) 0))) (and (<= (format 3) 3) (>= (format 3) 3))) (not (and (<= (format 3) 3) (>= (format 3) 3))))) +(assert (or (or (or (and (<= (+ percent (* (- 1) (format 3))) 0) (>= (+ percent (* (- 1) (format 3))) 0)) (and (<= (+ s (* (- 1) (format 3))) 0) (>= (+ s (* (- 1) (format 3))) 0))) (and (<= (+ x (* (- 1) (format 3))) 0) (>= (+ x (* (- 1) (format 3))) 0))) (and (<= (format 3) 3) (>= (format 3) 3)) (not (or (or (or (and (<= (+ percent (* (- 1) (format 3))) 0) (>= (+ percent (* (- 1) (format 3))) 0)) (and (<= (+ s (* (- 1) (format 3))) 0) (>= (+ s (* (- 1) (format 3))) 0))) (and (<= (+ x (* (- 1) (format 3))) 0) (>= (+ x (* (- 1) (format 3))) 0))) (and (<= (format 3) 3) (>= (format 3) 3)))))) +(assert (or (not (and (<= (format 3) 4) (>= (format 3) 4))) (<= (format 3) 4))) +(assert (or (not (and (<= (format 3) 4) (>= (format 3) 4))) (>= (format 3) 4))) +(assert (or (not (<= (format 3) 4)) (not (>= (format 3) 4)) (and (<= (format 3) 4) (>= (format 3) 4)))) +(assert (or (or (or (or (or (and (<= (+ percent (* (- 1) (format 3))) 0) (>= (+ percent (* (- 1) (format 3))) 0)) (and (<= (+ s (* (- 1) (format 3))) 0) (>= (+ s (* (- 1) (format 3))) 0))) (and (<= (+ x (* (- 1) (format 3))) 0) (>= (+ x (* (- 1) (format 3))) 0))) (and (<= (format 3) 3) (>= (format 3) 3))) (and (<= (format 3) 4) (>= (format 3) 4))) (not (or (or (or (and (<= (+ percent (* (- 1) (format 3))) 0) (>= (+ percent (* (- 1) (format 3))) 0)) (and (<= (+ s (* (- 1) (format 3))) 0) (>= (+ s (* (- 1) (format 3))) 0))) (and (<= (+ x (* (- 1) (format 3))) 0) (>= (+ x (* (- 1) (format 3))) 0))) (and (<= (format 3) 3) (>= (format 3) 3)))))) +(assert (or (or (or (or (or (and (<= (+ percent (* (- 1) (format 3))) 0) (>= (+ percent (* (- 1) (format 3))) 0)) (and (<= (+ s (* (- 1) (format 3))) 0) (>= (+ s (* (- 1) (format 3))) 0))) (and (<= (+ x (* (- 1) (format 3))) 0) (>= (+ x (* (- 1) (format 3))) 0))) (and (<= (format 3) 3) (>= (format 3) 3))) (and (<= (format 3) 4) (>= (format 3) 4))) (not (and (<= (format 3) 4) (>= (format 3) 4))))) +(assert (or (or (or (or (and (<= (+ percent (* (- 1) (format 3))) 0) (>= (+ percent (* (- 1) (format 3))) 0)) (and (<= (+ s (* (- 1) (format 3))) 0) (>= (+ s (* (- 1) (format 3))) 0))) (and (<= (+ x (* (- 1) (format 3))) 0) (>= (+ x (* (- 1) (format 3))) 0))) (and (<= (format 3) 3) (>= (format 3) 3))) (and (<= (format 3) 4) (>= (format 3) 4)) (not (or (or (or (or (and (<= (+ percent (* (- 1) (format 3))) 0) (>= (+ percent (* (- 1) (format 3))) 0)) (and (<= (+ s (* (- 1) (format 3))) 0) (>= (+ s (* (- 1) (format 3))) 0))) (and (<= (+ x (* (- 1) (format 3))) 0) (>= (+ x (* (- 1) (format 3))) 0))) (and (<= (format 3) 3) (>= (format 3) 3))) (and (<= (format 3) 4) (>= (format 3) 4)))))) +(assert (or (not (and (<= (format 3) 5) (>= (format 3) 5))) (<= (format 3) 5))) +(assert (or (not (and (<= (format 3) 5) (>= (format 3) 5))) (>= (format 3) 5))) +(assert (or (not (<= (format 3) 5)) (not (>= (format 3) 5)) (and (<= (format 3) 5) (>= (format 3) 5)))) +(assert (or (or (or (or (or (or (and (<= (+ percent (* (- 1) (format 3))) 0) (>= (+ percent (* (- 1) (format 3))) 0)) (and (<= (+ s (* (- 1) (format 3))) 0) (>= (+ s (* (- 1) (format 3))) 0))) (and (<= (+ x (* (- 1) (format 3))) 0) (>= (+ x (* (- 1) (format 3))) 0))) (and (<= (format 3) 3) (>= (format 3) 3))) (and (<= (format 3) 4) (>= (format 3) 4))) (and (<= (format 3) 5) (>= (format 3) 5))) (not (or (or (or (or (and (<= (+ percent (* (- 1) (format 3))) 0) (>= (+ percent (* (- 1) (format 3))) 0)) (and (<= (+ s (* (- 1) (format 3))) 0) (>= (+ s (* (- 1) (format 3))) 0))) (and (<= (+ x (* (- 1) (format 3))) 0) (>= (+ x (* (- 1) (format 3))) 0))) (and (<= (format 3) 3) (>= (format 3) 3))) (and (<= (format 3) 4) (>= (format 3) 4)))))) +(assert (or (or (or (or (or (or (and (<= (+ percent (* (- 1) (format 3))) 0) (>= (+ percent (* (- 1) (format 3))) 0)) (and (<= (+ s (* (- 1) (format 3))) 0) (>= (+ s (* (- 1) (format 3))) 0))) (and (<= (+ x (* (- 1) (format 3))) 0) (>= (+ x (* (- 1) (format 3))) 0))) (and (<= (format 3) 3) (>= (format 3) 3))) (and (<= (format 3) 4) (>= (format 3) 4))) (and (<= (format 3) 5) (>= (format 3) 5))) (not (and (<= (format 3) 5) (>= (format 3) 5))))) +(assert (or (or (or (or (or (and (<= (+ percent (* (- 1) (format 3))) 0) (>= (+ percent (* (- 1) (format 3))) 0)) (and (<= (+ s (* (- 1) (format 3))) 0) (>= (+ s (* (- 1) (format 3))) 0))) (and (<= (+ x (* (- 1) (format 3))) 0) (>= (+ x (* (- 1) (format 3))) 0))) (and (<= (format 3) 3) (>= (format 3) 3))) (and (<= (format 3) 4) (>= (format 3) 4))) (and (<= (format 3) 5) (>= (format 3) 5)) (not (or (or (or (or (or (and (<= (+ percent (* (- 1) (format 3))) 0) (>= (+ percent (* (- 1) (format 3))) 0)) (and (<= (+ s (* (- 1) (format 3))) 0) (>= (+ s (* (- 1) (format 3))) 0))) (and (<= (+ x (* (- 1) (format 3))) 0) (>= (+ x (* (- 1) (format 3))) 0))) (and (<= (format 3) 3) (>= (format 3) 3))) (and (<= (format 3) 4) (>= (format 3) 4))) (and (<= (format 3) 5) (>= (format 3) 5)))))) +(assert (or (not (and (<= (format 3) 6) (>= (format 3) 6))) (<= (format 3) 6))) +(assert (or (not (and (<= (format 3) 6) (>= (format 3) 6))) (>= (format 3) 6))) +(assert (or (not (<= (format 3) 6)) (not (>= (format 3) 6)) (and (<= (format 3) 6) (>= (format 3) 6)))) +(assert (or (or (or (or (or (or (or (and (<= (+ percent (* (- 1) (format 3))) 0) (>= (+ percent (* (- 1) (format 3))) 0)) (and (<= (+ s (* (- 1) (format 3))) 0) (>= (+ s (* (- 1) (format 3))) 0))) (and (<= (+ x (* (- 1) (format 3))) 0) (>= (+ x (* (- 1) (format 3))) 0))) (and (<= (format 3) 3) (>= (format 3) 3))) (and (<= (format 3) 4) (>= (format 3) 4))) (and (<= (format 3) 5) (>= (format 3) 5))) (and (<= (format 3) 6) (>= (format 3) 6))) (not (or (or (or (or (or (and (<= (+ percent (* (- 1) (format 3))) 0) (>= (+ percent (* (- 1) (format 3))) 0)) (and (<= (+ s (* (- 1) (format 3))) 0) (>= (+ s (* (- 1) (format 3))) 0))) (and (<= (+ x (* (- 1) (format 3))) 0) (>= (+ x (* (- 1) (format 3))) 0))) (and (<= (format 3) 3) (>= (format 3) 3))) (and (<= (format 3) 4) (>= (format 3) 4))) (and (<= (format 3) 5) (>= (format 3) 5)))))) +(assert (or (or (or (or (or (or (or (and (<= (+ percent (* (- 1) (format 3))) 0) (>= (+ percent (* (- 1) (format 3))) 0)) (and (<= (+ s (* (- 1) (format 3))) 0) (>= (+ s (* (- 1) (format 3))) 0))) (and (<= (+ x (* (- 1) (format 3))) 0) (>= (+ x (* (- 1) (format 3))) 0))) (and (<= (format 3) 3) (>= (format 3) 3))) (and (<= (format 3) 4) (>= (format 3) 4))) (and (<= (format 3) 5) (>= (format 3) 5))) (and (<= (format 3) 6) (>= (format 3) 6))) (not (and (<= (format 3) 6) (>= (format 3) 6))))) +(assert (or (or (or (or (or (or (and (<= (+ percent (* (- 1) (format 3))) 0) (>= (+ percent (* (- 1) (format 3))) 0)) (and (<= (+ s (* (- 1) (format 3))) 0) (>= (+ s (* (- 1) (format 3))) 0))) (and (<= (+ x (* (- 1) (format 3))) 0) (>= (+ x (* (- 1) (format 3))) 0))) (and (<= (format 3) 3) (>= (format 3) 3))) (and (<= (format 3) 4) (>= (format 3) 4))) (and (<= (format 3) 5) (>= (format 3) 5))) (and (<= (format 3) 6) (>= (format 3) 6)) (not (or (or (or (or (or (or (and (<= (+ percent (* (- 1) (format 3))) 0) (>= (+ percent (* (- 1) (format 3))) 0)) (and (<= (+ s (* (- 1) (format 3))) 0) (>= (+ s (* (- 1) (format 3))) 0))) (and (<= (+ x (* (- 1) (format 3))) 0) (>= (+ x (* (- 1) (format 3))) 0))) (and (<= (format 3) 3) (>= (format 3) 3))) (and (<= (format 3) 4) (>= (format 3) 4))) (and (<= (format 3) 5) (>= (format 3) 5))) (and (<= (format 3) 6) (>= (format 3) 6)))))) +(assert (or (not (and (<= (format 3) 255) (>= (format 3) 255))) (<= (format 3) 255))) +(assert (or (not (and (<= (format 3) 255) (>= (format 3) 255))) (>= (format 3) 255))) +(assert (or (not (<= (format 3) 255)) (not (>= (format 3) 255)) (and (<= (format 3) 255) (>= (format 3) 255)))) +(assert (or (or (or (or (or (or (or (and (<= (+ percent (* (- 1) (format 3))) 0) (>= (+ percent (* (- 1) (format 3))) 0)) (and (<= (+ s (* (- 1) (format 3))) 0) (>= (+ s (* (- 1) (format 3))) 0))) (and (<= (+ x (* (- 1) (format 3))) 0) (>= (+ x (* (- 1) (format 3))) 0))) (and (<= (format 3) 3) (>= (format 3) 3))) (and (<= (format 3) 4) (>= (format 3) 4))) (and (<= (format 3) 5) (>= (format 3) 5))) (and (<= (format 3) 6) (>= (format 3) 6))) (and (<= (format 3) 255) (>= (format 3) 255)))) +(assert (or (not (and (<= (+ percent (* (- 1) (format 4))) 0) (>= (+ percent (* (- 1) (format 4))) 0))) (<= (+ percent (* (- 1) (format 4))) 0))) +(assert (or (not (and (<= (+ percent (* (- 1) (format 4))) 0) (>= (+ percent (* (- 1) (format 4))) 0))) (>= (+ percent (* (- 1) (format 4))) 0))) +(assert (or (not (<= (+ percent (* (- 1) (format 4))) 0)) (not (>= (+ percent (* (- 1) (format 4))) 0)) (and (<= (+ percent (* (- 1) (format 4))) 0) (>= (+ percent (* (- 1) (format 4))) 0)))) +(assert (or (not (and (<= (+ s (* (- 1) (format 4))) 0) (>= (+ s (* (- 1) (format 4))) 0))) (<= (+ s (* (- 1) (format 4))) 0))) +(assert (or (not (and (<= (+ s (* (- 1) (format 4))) 0) (>= (+ s (* (- 1) (format 4))) 0))) (>= (+ s (* (- 1) (format 4))) 0))) +(assert (or (not (<= (+ s (* (- 1) (format 4))) 0)) (not (>= (+ s (* (- 1) (format 4))) 0)) (and (<= (+ s (* (- 1) (format 4))) 0) (>= (+ s (* (- 1) (format 4))) 0)))) +(assert (or (or (and (<= (+ percent (* (- 1) (format 4))) 0) (>= (+ percent (* (- 1) (format 4))) 0)) (and (<= (+ s (* (- 1) (format 4))) 0) (>= (+ s (* (- 1) (format 4))) 0))) (not (and (<= (+ percent (* (- 1) (format 4))) 0) (>= (+ percent (* (- 1) (format 4))) 0))))) +(assert (or (or (and (<= (+ percent (* (- 1) (format 4))) 0) (>= (+ percent (* (- 1) (format 4))) 0)) (and (<= (+ s (* (- 1) (format 4))) 0) (>= (+ s (* (- 1) (format 4))) 0))) (not (and (<= (+ s (* (- 1) (format 4))) 0) (>= (+ s (* (- 1) (format 4))) 0))))) +(assert (or (and (<= (+ percent (* (- 1) (format 4))) 0) (>= (+ percent (* (- 1) (format 4))) 0)) (and (<= (+ s (* (- 1) (format 4))) 0) (>= (+ s (* (- 1) (format 4))) 0)) (not (or (and (<= (+ percent (* (- 1) (format 4))) 0) (>= (+ percent (* (- 1) (format 4))) 0)) (and (<= (+ s (* (- 1) (format 4))) 0) (>= (+ s (* (- 1) (format 4))) 0)))))) +(assert (or (not (and (<= (+ x (* (- 1) (format 4))) 0) (>= (+ x (* (- 1) (format 4))) 0))) (<= (+ x (* (- 1) (format 4))) 0))) +(assert (or (not (and (<= (+ x (* (- 1) (format 4))) 0) (>= (+ x (* (- 1) (format 4))) 0))) (>= (+ x (* (- 1) (format 4))) 0))) +(assert (or (not (<= (+ x (* (- 1) (format 4))) 0)) (not (>= (+ x (* (- 1) (format 4))) 0)) (and (<= (+ x (* (- 1) (format 4))) 0) (>= (+ x (* (- 1) (format 4))) 0)))) +(assert (or (or (or (and (<= (+ percent (* (- 1) (format 4))) 0) (>= (+ percent (* (- 1) (format 4))) 0)) (and (<= (+ s (* (- 1) (format 4))) 0) (>= (+ s (* (- 1) (format 4))) 0))) (and (<= (+ x (* (- 1) (format 4))) 0) (>= (+ x (* (- 1) (format 4))) 0))) (not (or (and (<= (+ percent (* (- 1) (format 4))) 0) (>= (+ percent (* (- 1) (format 4))) 0)) (and (<= (+ s (* (- 1) (format 4))) 0) (>= (+ s (* (- 1) (format 4))) 0)))))) +(assert (or (or (or (and (<= (+ percent (* (- 1) (format 4))) 0) (>= (+ percent (* (- 1) (format 4))) 0)) (and (<= (+ s (* (- 1) (format 4))) 0) (>= (+ s (* (- 1) (format 4))) 0))) (and (<= (+ x (* (- 1) (format 4))) 0) (>= (+ x (* (- 1) (format 4))) 0))) (not (and (<= (+ x (* (- 1) (format 4))) 0) (>= (+ x (* (- 1) (format 4))) 0))))) +(assert (or (or (and (<= (+ percent (* (- 1) (format 4))) 0) (>= (+ percent (* (- 1) (format 4))) 0)) (and (<= (+ s (* (- 1) (format 4))) 0) (>= (+ s (* (- 1) (format 4))) 0))) (and (<= (+ x (* (- 1) (format 4))) 0) (>= (+ x (* (- 1) (format 4))) 0)) (not (or (or (and (<= (+ percent (* (- 1) (format 4))) 0) (>= (+ percent (* (- 1) (format 4))) 0)) (and (<= (+ s (* (- 1) (format 4))) 0) (>= (+ s (* (- 1) (format 4))) 0))) (and (<= (+ x (* (- 1) (format 4))) 0) (>= (+ x (* (- 1) (format 4))) 0)))))) +(assert (or (not (and (<= (format 4) 3) (>= (format 4) 3))) (<= (format 4) 3))) +(assert (or (not (and (<= (format 4) 3) (>= (format 4) 3))) (>= (format 4) 3))) +(assert (or (not (<= (format 4) 3)) (not (>= (format 4) 3)) (and (<= (format 4) 3) (>= (format 4) 3)))) +(assert (or (or (or (or (and (<= (+ percent (* (- 1) (format 4))) 0) (>= (+ percent (* (- 1) (format 4))) 0)) (and (<= (+ s (* (- 1) (format 4))) 0) (>= (+ s (* (- 1) (format 4))) 0))) (and (<= (+ x (* (- 1) (format 4))) 0) (>= (+ x (* (- 1) (format 4))) 0))) (and (<= (format 4) 3) (>= (format 4) 3))) (not (or (or (and (<= (+ percent (* (- 1) (format 4))) 0) (>= (+ percent (* (- 1) (format 4))) 0)) (and (<= (+ s (* (- 1) (format 4))) 0) (>= (+ s (* (- 1) (format 4))) 0))) (and (<= (+ x (* (- 1) (format 4))) 0) (>= (+ x (* (- 1) (format 4))) 0)))))) +(assert (or (or (or (or (and (<= (+ percent (* (- 1) (format 4))) 0) (>= (+ percent (* (- 1) (format 4))) 0)) (and (<= (+ s (* (- 1) (format 4))) 0) (>= (+ s (* (- 1) (format 4))) 0))) (and (<= (+ x (* (- 1) (format 4))) 0) (>= (+ x (* (- 1) (format 4))) 0))) (and (<= (format 4) 3) (>= (format 4) 3))) (not (and (<= (format 4) 3) (>= (format 4) 3))))) +(assert (or (or (or (and (<= (+ percent (* (- 1) (format 4))) 0) (>= (+ percent (* (- 1) (format 4))) 0)) (and (<= (+ s (* (- 1) (format 4))) 0) (>= (+ s (* (- 1) (format 4))) 0))) (and (<= (+ x (* (- 1) (format 4))) 0) (>= (+ x (* (- 1) (format 4))) 0))) (and (<= (format 4) 3) (>= (format 4) 3)) (not (or (or (or (and (<= (+ percent (* (- 1) (format 4))) 0) (>= (+ percent (* (- 1) (format 4))) 0)) (and (<= (+ s (* (- 1) (format 4))) 0) (>= (+ s (* (- 1) (format 4))) 0))) (and (<= (+ x (* (- 1) (format 4))) 0) (>= (+ x (* (- 1) (format 4))) 0))) (and (<= (format 4) 3) (>= (format 4) 3)))))) +(assert (or (not (and (<= (format 4) 4) (>= (format 4) 4))) (<= (format 4) 4))) +(assert (or (not (and (<= (format 4) 4) (>= (format 4) 4))) (>= (format 4) 4))) +(assert (or (not (<= (format 4) 4)) (not (>= (format 4) 4)) (and (<= (format 4) 4) (>= (format 4) 4)))) +(assert (or (or (or (or (or (and (<= (+ percent (* (- 1) (format 4))) 0) (>= (+ percent (* (- 1) (format 4))) 0)) (and (<= (+ s (* (- 1) (format 4))) 0) (>= (+ s (* (- 1) (format 4))) 0))) (and (<= (+ x (* (- 1) (format 4))) 0) (>= (+ x (* (- 1) (format 4))) 0))) (and (<= (format 4) 3) (>= (format 4) 3))) (and (<= (format 4) 4) (>= (format 4) 4))) (not (or (or (or (and (<= (+ percent (* (- 1) (format 4))) 0) (>= (+ percent (* (- 1) (format 4))) 0)) (and (<= (+ s (* (- 1) (format 4))) 0) (>= (+ s (* (- 1) (format 4))) 0))) (and (<= (+ x (* (- 1) (format 4))) 0) (>= (+ x (* (- 1) (format 4))) 0))) (and (<= (format 4) 3) (>= (format 4) 3)))))) +(assert (or (or (or (or (or (and (<= (+ percent (* (- 1) (format 4))) 0) (>= (+ percent (* (- 1) (format 4))) 0)) (and (<= (+ s (* (- 1) (format 4))) 0) (>= (+ s (* (- 1) (format 4))) 0))) (and (<= (+ x (* (- 1) (format 4))) 0) (>= (+ x (* (- 1) (format 4))) 0))) (and (<= (format 4) 3) (>= (format 4) 3))) (and (<= (format 4) 4) (>= (format 4) 4))) (not (and (<= (format 4) 4) (>= (format 4) 4))))) +(assert (or (or (or (or (and (<= (+ percent (* (- 1) (format 4))) 0) (>= (+ percent (* (- 1) (format 4))) 0)) (and (<= (+ s (* (- 1) (format 4))) 0) (>= (+ s (* (- 1) (format 4))) 0))) (and (<= (+ x (* (- 1) (format 4))) 0) (>= (+ x (* (- 1) (format 4))) 0))) (and (<= (format 4) 3) (>= (format 4) 3))) (and (<= (format 4) 4) (>= (format 4) 4)) (not (or (or (or (or (and (<= (+ percent (* (- 1) (format 4))) 0) (>= (+ percent (* (- 1) (format 4))) 0)) (and (<= (+ s (* (- 1) (format 4))) 0) (>= (+ s (* (- 1) (format 4))) 0))) (and (<= (+ x (* (- 1) (format 4))) 0) (>= (+ x (* (- 1) (format 4))) 0))) (and (<= (format 4) 3) (>= (format 4) 3))) (and (<= (format 4) 4) (>= (format 4) 4)))))) +(assert (or (not (and (<= (format 4) 5) (>= (format 4) 5))) (<= (format 4) 5))) +(assert (or (not (and (<= (format 4) 5) (>= (format 4) 5))) (>= (format 4) 5))) +(assert (or (not (<= (format 4) 5)) (not (>= (format 4) 5)) (and (<= (format 4) 5) (>= (format 4) 5)))) +(assert (or (or (or (or (or (or (and (<= (+ percent (* (- 1) (format 4))) 0) (>= (+ percent (* (- 1) (format 4))) 0)) (and (<= (+ s (* (- 1) (format 4))) 0) (>= (+ s (* (- 1) (format 4))) 0))) (and (<= (+ x (* (- 1) (format 4))) 0) (>= (+ x (* (- 1) (format 4))) 0))) (and (<= (format 4) 3) (>= (format 4) 3))) (and (<= (format 4) 4) (>= (format 4) 4))) (and (<= (format 4) 5) (>= (format 4) 5))) (not (or (or (or (or (and (<= (+ percent (* (- 1) (format 4))) 0) (>= (+ percent (* (- 1) (format 4))) 0)) (and (<= (+ s (* (- 1) (format 4))) 0) (>= (+ s (* (- 1) (format 4))) 0))) (and (<= (+ x (* (- 1) (format 4))) 0) (>= (+ x (* (- 1) (format 4))) 0))) (and (<= (format 4) 3) (>= (format 4) 3))) (and (<= (format 4) 4) (>= (format 4) 4)))))) +(assert (or (or (or (or (or (or (and (<= (+ percent (* (- 1) (format 4))) 0) (>= (+ percent (* (- 1) (format 4))) 0)) (and (<= (+ s (* (- 1) (format 4))) 0) (>= (+ s (* (- 1) (format 4))) 0))) (and (<= (+ x (* (- 1) (format 4))) 0) (>= (+ x (* (- 1) (format 4))) 0))) (and (<= (format 4) 3) (>= (format 4) 3))) (and (<= (format 4) 4) (>= (format 4) 4))) (and (<= (format 4) 5) (>= (format 4) 5))) (not (and (<= (format 4) 5) (>= (format 4) 5))))) +(assert (or (or (or (or (or (and (<= (+ percent (* (- 1) (format 4))) 0) (>= (+ percent (* (- 1) (format 4))) 0)) (and (<= (+ s (* (- 1) (format 4))) 0) (>= (+ s (* (- 1) (format 4))) 0))) (and (<= (+ x (* (- 1) (format 4))) 0) (>= (+ x (* (- 1) (format 4))) 0))) (and (<= (format 4) 3) (>= (format 4) 3))) (and (<= (format 4) 4) (>= (format 4) 4))) (and (<= (format 4) 5) (>= (format 4) 5)) (not (or (or (or (or (or (and (<= (+ percent (* (- 1) (format 4))) 0) (>= (+ percent (* (- 1) (format 4))) 0)) (and (<= (+ s (* (- 1) (format 4))) 0) (>= (+ s (* (- 1) (format 4))) 0))) (and (<= (+ x (* (- 1) (format 4))) 0) (>= (+ x (* (- 1) (format 4))) 0))) (and (<= (format 4) 3) (>= (format 4) 3))) (and (<= (format 4) 4) (>= (format 4) 4))) (and (<= (format 4) 5) (>= (format 4) 5)))))) +(assert (or (not (and (<= (format 4) 6) (>= (format 4) 6))) (<= (format 4) 6))) +(assert (or (not (and (<= (format 4) 6) (>= (format 4) 6))) (>= (format 4) 6))) +(assert (or (not (<= (format 4) 6)) (not (>= (format 4) 6)) (and (<= (format 4) 6) (>= (format 4) 6)))) +(assert (or (or (or (or (or (or (or (and (<= (+ percent (* (- 1) (format 4))) 0) (>= (+ percent (* (- 1) (format 4))) 0)) (and (<= (+ s (* (- 1) (format 4))) 0) (>= (+ s (* (- 1) (format 4))) 0))) (and (<= (+ x (* (- 1) (format 4))) 0) (>= (+ x (* (- 1) (format 4))) 0))) (and (<= (format 4) 3) (>= (format 4) 3))) (and (<= (format 4) 4) (>= (format 4) 4))) (and (<= (format 4) 5) (>= (format 4) 5))) (and (<= (format 4) 6) (>= (format 4) 6))) (not (or (or (or (or (or (and (<= (+ percent (* (- 1) (format 4))) 0) (>= (+ percent (* (- 1) (format 4))) 0)) (and (<= (+ s (* (- 1) (format 4))) 0) (>= (+ s (* (- 1) (format 4))) 0))) (and (<= (+ x (* (- 1) (format 4))) 0) (>= (+ x (* (- 1) (format 4))) 0))) (and (<= (format 4) 3) (>= (format 4) 3))) (and (<= (format 4) 4) (>= (format 4) 4))) (and (<= (format 4) 5) (>= (format 4) 5)))))) +(assert (or (or (or (or (or (or (or (and (<= (+ percent (* (- 1) (format 4))) 0) (>= (+ percent (* (- 1) (format 4))) 0)) (and (<= (+ s (* (- 1) (format 4))) 0) (>= (+ s (* (- 1) (format 4))) 0))) (and (<= (+ x (* (- 1) (format 4))) 0) (>= (+ x (* (- 1) (format 4))) 0))) (and (<= (format 4) 3) (>= (format 4) 3))) (and (<= (format 4) 4) (>= (format 4) 4))) (and (<= (format 4) 5) (>= (format 4) 5))) (and (<= (format 4) 6) (>= (format 4) 6))) (not (and (<= (format 4) 6) (>= (format 4) 6))))) +(assert (or (or (or (or (or (or (and (<= (+ percent (* (- 1) (format 4))) 0) (>= (+ percent (* (- 1) (format 4))) 0)) (and (<= (+ s (* (- 1) (format 4))) 0) (>= (+ s (* (- 1) (format 4))) 0))) (and (<= (+ x (* (- 1) (format 4))) 0) (>= (+ x (* (- 1) (format 4))) 0))) (and (<= (format 4) 3) (>= (format 4) 3))) (and (<= (format 4) 4) (>= (format 4) 4))) (and (<= (format 4) 5) (>= (format 4) 5))) (and (<= (format 4) 6) (>= (format 4) 6)) (not (or (or (or (or (or (or (and (<= (+ percent (* (- 1) (format 4))) 0) (>= (+ percent (* (- 1) (format 4))) 0)) (and (<= (+ s (* (- 1) (format 4))) 0) (>= (+ s (* (- 1) (format 4))) 0))) (and (<= (+ x (* (- 1) (format 4))) 0) (>= (+ x (* (- 1) (format 4))) 0))) (and (<= (format 4) 3) (>= (format 4) 3))) (and (<= (format 4) 4) (>= (format 4) 4))) (and (<= (format 4) 5) (>= (format 4) 5))) (and (<= (format 4) 6) (>= (format 4) 6)))))) +(assert (or (not (and (<= (format 4) 255) (>= (format 4) 255))) (<= (format 4) 255))) +(assert (or (not (and (<= (format 4) 255) (>= (format 4) 255))) (>= (format 4) 255))) +(assert (or (not (<= (format 4) 255)) (not (>= (format 4) 255)) (and (<= (format 4) 255) (>= (format 4) 255)))) +(assert (or (or (or (or (or (or (or (and (<= (+ percent (* (- 1) (format 4))) 0) (>= (+ percent (* (- 1) (format 4))) 0)) (and (<= (+ s (* (- 1) (format 4))) 0) (>= (+ s (* (- 1) (format 4))) 0))) (and (<= (+ x (* (- 1) (format 4))) 0) (>= (+ x (* (- 1) (format 4))) 0))) (and (<= (format 4) 3) (>= (format 4) 3))) (and (<= (format 4) 4) (>= (format 4) 4))) (and (<= (format 4) 5) (>= (format 4) 5))) (and (<= (format 4) 6) (>= (format 4) 6))) (and (<= (format 4) 255) (>= (format 4) 255)))) +(assert (or (not (and (<= (+ percent (* (- 1) (format 5))) 0) (>= (+ percent (* (- 1) (format 5))) 0))) (<= (+ percent (* (- 1) (format 5))) 0))) +(assert (or (not (and (<= (+ percent (* (- 1) (format 5))) 0) (>= (+ percent (* (- 1) (format 5))) 0))) (>= (+ percent (* (- 1) (format 5))) 0))) +(assert (or (not (<= (+ percent (* (- 1) (format 5))) 0)) (not (>= (+ percent (* (- 1) (format 5))) 0)) (and (<= (+ percent (* (- 1) (format 5))) 0) (>= (+ percent (* (- 1) (format 5))) 0)))) +(assert (or (not (and (<= (+ s (* (- 1) (format 5))) 0) (>= (+ s (* (- 1) (format 5))) 0))) (<= (+ s (* (- 1) (format 5))) 0))) +(assert (or (not (and (<= (+ s (* (- 1) (format 5))) 0) (>= (+ s (* (- 1) (format 5))) 0))) (>= (+ s (* (- 1) (format 5))) 0))) +(assert (or (not (<= (+ s (* (- 1) (format 5))) 0)) (not (>= (+ s (* (- 1) (format 5))) 0)) (and (<= (+ s (* (- 1) (format 5))) 0) (>= (+ s (* (- 1) (format 5))) 0)))) +(assert (or (or (and (<= (+ percent (* (- 1) (format 5))) 0) (>= (+ percent (* (- 1) (format 5))) 0)) (and (<= (+ s (* (- 1) (format 5))) 0) (>= (+ s (* (- 1) (format 5))) 0))) (not (and (<= (+ percent (* (- 1) (format 5))) 0) (>= (+ percent (* (- 1) (format 5))) 0))))) +(assert (or (or (and (<= (+ percent (* (- 1) (format 5))) 0) (>= (+ percent (* (- 1) (format 5))) 0)) (and (<= (+ s (* (- 1) (format 5))) 0) (>= (+ s (* (- 1) (format 5))) 0))) (not (and (<= (+ s (* (- 1) (format 5))) 0) (>= (+ s (* (- 1) (format 5))) 0))))) +(assert (or (and (<= (+ percent (* (- 1) (format 5))) 0) (>= (+ percent (* (- 1) (format 5))) 0)) (and (<= (+ s (* (- 1) (format 5))) 0) (>= (+ s (* (- 1) (format 5))) 0)) (not (or (and (<= (+ percent (* (- 1) (format 5))) 0) (>= (+ percent (* (- 1) (format 5))) 0)) (and (<= (+ s (* (- 1) (format 5))) 0) (>= (+ s (* (- 1) (format 5))) 0)))))) +(assert (or (not (and (<= (+ x (* (- 1) (format 5))) 0) (>= (+ x (* (- 1) (format 5))) 0))) (<= (+ x (* (- 1) (format 5))) 0))) +(assert (or (not (and (<= (+ x (* (- 1) (format 5))) 0) (>= (+ x (* (- 1) (format 5))) 0))) (>= (+ x (* (- 1) (format 5))) 0))) +(assert (or (not (<= (+ x (* (- 1) (format 5))) 0)) (not (>= (+ x (* (- 1) (format 5))) 0)) (and (<= (+ x (* (- 1) (format 5))) 0) (>= (+ x (* (- 1) (format 5))) 0)))) +(assert (or (or (or (and (<= (+ percent (* (- 1) (format 5))) 0) (>= (+ percent (* (- 1) (format 5))) 0)) (and (<= (+ s (* (- 1) (format 5))) 0) (>= (+ s (* (- 1) (format 5))) 0))) (and (<= (+ x (* (- 1) (format 5))) 0) (>= (+ x (* (- 1) (format 5))) 0))) (not (or (and (<= (+ percent (* (- 1) (format 5))) 0) (>= (+ percent (* (- 1) (format 5))) 0)) (and (<= (+ s (* (- 1) (format 5))) 0) (>= (+ s (* (- 1) (format 5))) 0)))))) +(assert (or (or (or (and (<= (+ percent (* (- 1) (format 5))) 0) (>= (+ percent (* (- 1) (format 5))) 0)) (and (<= (+ s (* (- 1) (format 5))) 0) (>= (+ s (* (- 1) (format 5))) 0))) (and (<= (+ x (* (- 1) (format 5))) 0) (>= (+ x (* (- 1) (format 5))) 0))) (not (and (<= (+ x (* (- 1) (format 5))) 0) (>= (+ x (* (- 1) (format 5))) 0))))) +(assert (or (or (and (<= (+ percent (* (- 1) (format 5))) 0) (>= (+ percent (* (- 1) (format 5))) 0)) (and (<= (+ s (* (- 1) (format 5))) 0) (>= (+ s (* (- 1) (format 5))) 0))) (and (<= (+ x (* (- 1) (format 5))) 0) (>= (+ x (* (- 1) (format 5))) 0)) (not (or (or (and (<= (+ percent (* (- 1) (format 5))) 0) (>= (+ percent (* (- 1) (format 5))) 0)) (and (<= (+ s (* (- 1) (format 5))) 0) (>= (+ s (* (- 1) (format 5))) 0))) (and (<= (+ x (* (- 1) (format 5))) 0) (>= (+ x (* (- 1) (format 5))) 0)))))) +(assert (or (not (and (<= (format 5) 3) (>= (format 5) 3))) (<= (format 5) 3))) +(assert (or (not (and (<= (format 5) 3) (>= (format 5) 3))) (>= (format 5) 3))) +(assert (or (not (<= (format 5) 3)) (not (>= (format 5) 3)) (and (<= (format 5) 3) (>= (format 5) 3)))) +(assert (or (or (or (or (and (<= (+ percent (* (- 1) (format 5))) 0) (>= (+ percent (* (- 1) (format 5))) 0)) (and (<= (+ s (* (- 1) (format 5))) 0) (>= (+ s (* (- 1) (format 5))) 0))) (and (<= (+ x (* (- 1) (format 5))) 0) (>= (+ x (* (- 1) (format 5))) 0))) (and (<= (format 5) 3) (>= (format 5) 3))) (not (or (or (and (<= (+ percent (* (- 1) (format 5))) 0) (>= (+ percent (* (- 1) (format 5))) 0)) (and (<= (+ s (* (- 1) (format 5))) 0) (>= (+ s (* (- 1) (format 5))) 0))) (and (<= (+ x (* (- 1) (format 5))) 0) (>= (+ x (* (- 1) (format 5))) 0)))))) +(assert (or (or (or (or (and (<= (+ percent (* (- 1) (format 5))) 0) (>= (+ percent (* (- 1) (format 5))) 0)) (and (<= (+ s (* (- 1) (format 5))) 0) (>= (+ s (* (- 1) (format 5))) 0))) (and (<= (+ x (* (- 1) (format 5))) 0) (>= (+ x (* (- 1) (format 5))) 0))) (and (<= (format 5) 3) (>= (format 5) 3))) (not (and (<= (format 5) 3) (>= (format 5) 3))))) +(assert (or (or (or (and (<= (+ percent (* (- 1) (format 5))) 0) (>= (+ percent (* (- 1) (format 5))) 0)) (and (<= (+ s (* (- 1) (format 5))) 0) (>= (+ s (* (- 1) (format 5))) 0))) (and (<= (+ x (* (- 1) (format 5))) 0) (>= (+ x (* (- 1) (format 5))) 0))) (and (<= (format 5) 3) (>= (format 5) 3)) (not (or (or (or (and (<= (+ percent (* (- 1) (format 5))) 0) (>= (+ percent (* (- 1) (format 5))) 0)) (and (<= (+ s (* (- 1) (format 5))) 0) (>= (+ s (* (- 1) (format 5))) 0))) (and (<= (+ x (* (- 1) (format 5))) 0) (>= (+ x (* (- 1) (format 5))) 0))) (and (<= (format 5) 3) (>= (format 5) 3)))))) +(assert (or (not (and (<= (format 5) 4) (>= (format 5) 4))) (<= (format 5) 4))) +(assert (or (not (and (<= (format 5) 4) (>= (format 5) 4))) (>= (format 5) 4))) +(assert (or (not (<= (format 5) 4)) (not (>= (format 5) 4)) (and (<= (format 5) 4) (>= (format 5) 4)))) +(assert (or (or (or (or (or (and (<= (+ percent (* (- 1) (format 5))) 0) (>= (+ percent (* (- 1) (format 5))) 0)) (and (<= (+ s (* (- 1) (format 5))) 0) (>= (+ s (* (- 1) (format 5))) 0))) (and (<= (+ x (* (- 1) (format 5))) 0) (>= (+ x (* (- 1) (format 5))) 0))) (and (<= (format 5) 3) (>= (format 5) 3))) (and (<= (format 5) 4) (>= (format 5) 4))) (not (or (or (or (and (<= (+ percent (* (- 1) (format 5))) 0) (>= (+ percent (* (- 1) (format 5))) 0)) (and (<= (+ s (* (- 1) (format 5))) 0) (>= (+ s (* (- 1) (format 5))) 0))) (and (<= (+ x (* (- 1) (format 5))) 0) (>= (+ x (* (- 1) (format 5))) 0))) (and (<= (format 5) 3) (>= (format 5) 3)))))) +(assert (or (or (or (or (or (and (<= (+ percent (* (- 1) (format 5))) 0) (>= (+ percent (* (- 1) (format 5))) 0)) (and (<= (+ s (* (- 1) (format 5))) 0) (>= (+ s (* (- 1) (format 5))) 0))) (and (<= (+ x (* (- 1) (format 5))) 0) (>= (+ x (* (- 1) (format 5))) 0))) (and (<= (format 5) 3) (>= (format 5) 3))) (and (<= (format 5) 4) (>= (format 5) 4))) (not (and (<= (format 5) 4) (>= (format 5) 4))))) +(assert (or (or (or (or (and (<= (+ percent (* (- 1) (format 5))) 0) (>= (+ percent (* (- 1) (format 5))) 0)) (and (<= (+ s (* (- 1) (format 5))) 0) (>= (+ s (* (- 1) (format 5))) 0))) (and (<= (+ x (* (- 1) (format 5))) 0) (>= (+ x (* (- 1) (format 5))) 0))) (and (<= (format 5) 3) (>= (format 5) 3))) (and (<= (format 5) 4) (>= (format 5) 4)) (not (or (or (or (or (and (<= (+ percent (* (- 1) (format 5))) 0) (>= (+ percent (* (- 1) (format 5))) 0)) (and (<= (+ s (* (- 1) (format 5))) 0) (>= (+ s (* (- 1) (format 5))) 0))) (and (<= (+ x (* (- 1) (format 5))) 0) (>= (+ x (* (- 1) (format 5))) 0))) (and (<= (format 5) 3) (>= (format 5) 3))) (and (<= (format 5) 4) (>= (format 5) 4)))))) +(assert (or (not (and (<= (format 5) 5) (>= (format 5) 5))) (<= (format 5) 5))) +(assert (or (not (and (<= (format 5) 5) (>= (format 5) 5))) (>= (format 5) 5))) +(assert (or (not (<= (format 5) 5)) (not (>= (format 5) 5)) (and (<= (format 5) 5) (>= (format 5) 5)))) +(assert (or (or (or (or (or (or (and (<= (+ percent (* (- 1) (format 5))) 0) (>= (+ percent (* (- 1) (format 5))) 0)) (and (<= (+ s (* (- 1) (format 5))) 0) (>= (+ s (* (- 1) (format 5))) 0))) (and (<= (+ x (* (- 1) (format 5))) 0) (>= (+ x (* (- 1) (format 5))) 0))) (and (<= (format 5) 3) (>= (format 5) 3))) (and (<= (format 5) 4) (>= (format 5) 4))) (and (<= (format 5) 5) (>= (format 5) 5))) (not (or (or (or (or (and (<= (+ percent (* (- 1) (format 5))) 0) (>= (+ percent (* (- 1) (format 5))) 0)) (and (<= (+ s (* (- 1) (format 5))) 0) (>= (+ s (* (- 1) (format 5))) 0))) (and (<= (+ x (* (- 1) (format 5))) 0) (>= (+ x (* (- 1) (format 5))) 0))) (and (<= (format 5) 3) (>= (format 5) 3))) (and (<= (format 5) 4) (>= (format 5) 4)))))) +(assert (or (or (or (or (or (or (and (<= (+ percent (* (- 1) (format 5))) 0) (>= (+ percent (* (- 1) (format 5))) 0)) (and (<= (+ s (* (- 1) (format 5))) 0) (>= (+ s (* (- 1) (format 5))) 0))) (and (<= (+ x (* (- 1) (format 5))) 0) (>= (+ x (* (- 1) (format 5))) 0))) (and (<= (format 5) 3) (>= (format 5) 3))) (and (<= (format 5) 4) (>= (format 5) 4))) (and (<= (format 5) 5) (>= (format 5) 5))) (not (and (<= (format 5) 5) (>= (format 5) 5))))) +(assert (or (or (or (or (or (and (<= (+ percent (* (- 1) (format 5))) 0) (>= (+ percent (* (- 1) (format 5))) 0)) (and (<= (+ s (* (- 1) (format 5))) 0) (>= (+ s (* (- 1) (format 5))) 0))) (and (<= (+ x (* (- 1) (format 5))) 0) (>= (+ x (* (- 1) (format 5))) 0))) (and (<= (format 5) 3) (>= (format 5) 3))) (and (<= (format 5) 4) (>= (format 5) 4))) (and (<= (format 5) 5) (>= (format 5) 5)) (not (or (or (or (or (or (and (<= (+ percent (* (- 1) (format 5))) 0) (>= (+ percent (* (- 1) (format 5))) 0)) (and (<= (+ s (* (- 1) (format 5))) 0) (>= (+ s (* (- 1) (format 5))) 0))) (and (<= (+ x (* (- 1) (format 5))) 0) (>= (+ x (* (- 1) (format 5))) 0))) (and (<= (format 5) 3) (>= (format 5) 3))) (and (<= (format 5) 4) (>= (format 5) 4))) (and (<= (format 5) 5) (>= (format 5) 5)))))) +(assert (or (not (and (<= (format 5) 6) (>= (format 5) 6))) (<= (format 5) 6))) +(assert (or (not (and (<= (format 5) 6) (>= (format 5) 6))) (>= (format 5) 6))) +(assert (or (not (<= (format 5) 6)) (not (>= (format 5) 6)) (and (<= (format 5) 6) (>= (format 5) 6)))) +(assert (or (or (or (or (or (or (or (and (<= (+ percent (* (- 1) (format 5))) 0) (>= (+ percent (* (- 1) (format 5))) 0)) (and (<= (+ s (* (- 1) (format 5))) 0) (>= (+ s (* (- 1) (format 5))) 0))) (and (<= (+ x (* (- 1) (format 5))) 0) (>= (+ x (* (- 1) (format 5))) 0))) (and (<= (format 5) 3) (>= (format 5) 3))) (and (<= (format 5) 4) (>= (format 5) 4))) (and (<= (format 5) 5) (>= (format 5) 5))) (and (<= (format 5) 6) (>= (format 5) 6))) (not (or (or (or (or (or (and (<= (+ percent (* (- 1) (format 5))) 0) (>= (+ percent (* (- 1) (format 5))) 0)) (and (<= (+ s (* (- 1) (format 5))) 0) (>= (+ s (* (- 1) (format 5))) 0))) (and (<= (+ x (* (- 1) (format 5))) 0) (>= (+ x (* (- 1) (format 5))) 0))) (and (<= (format 5) 3) (>= (format 5) 3))) (and (<= (format 5) 4) (>= (format 5) 4))) (and (<= (format 5) 5) (>= (format 5) 5)))))) +(assert (or (or (or (or (or (or (or (and (<= (+ percent (* (- 1) (format 5))) 0) (>= (+ percent (* (- 1) (format 5))) 0)) (and (<= (+ s (* (- 1) (format 5))) 0) (>= (+ s (* (- 1) (format 5))) 0))) (and (<= (+ x (* (- 1) (format 5))) 0) (>= (+ x (* (- 1) (format 5))) 0))) (and (<= (format 5) 3) (>= (format 5) 3))) (and (<= (format 5) 4) (>= (format 5) 4))) (and (<= (format 5) 5) (>= (format 5) 5))) (and (<= (format 5) 6) (>= (format 5) 6))) (not (and (<= (format 5) 6) (>= (format 5) 6))))) +(assert (or (or (or (or (or (or (and (<= (+ percent (* (- 1) (format 5))) 0) (>= (+ percent (* (- 1) (format 5))) 0)) (and (<= (+ s (* (- 1) (format 5))) 0) (>= (+ s (* (- 1) (format 5))) 0))) (and (<= (+ x (* (- 1) (format 5))) 0) (>= (+ x (* (- 1) (format 5))) 0))) (and (<= (format 5) 3) (>= (format 5) 3))) (and (<= (format 5) 4) (>= (format 5) 4))) (and (<= (format 5) 5) (>= (format 5) 5))) (and (<= (format 5) 6) (>= (format 5) 6)) (not (or (or (or (or (or (or (and (<= (+ percent (* (- 1) (format 5))) 0) (>= (+ percent (* (- 1) (format 5))) 0)) (and (<= (+ s (* (- 1) (format 5))) 0) (>= (+ s (* (- 1) (format 5))) 0))) (and (<= (+ x (* (- 1) (format 5))) 0) (>= (+ x (* (- 1) (format 5))) 0))) (and (<= (format 5) 3) (>= (format 5) 3))) (and (<= (format 5) 4) (>= (format 5) 4))) (and (<= (format 5) 5) (>= (format 5) 5))) (and (<= (format 5) 6) (>= (format 5) 6)))))) +(assert (or (not (and (<= (format 5) 255) (>= (format 5) 255))) (<= (format 5) 255))) +(assert (or (not (and (<= (format 5) 255) (>= (format 5) 255))) (>= (format 5) 255))) +(assert (or (not (<= (format 5) 255)) (not (>= (format 5) 255)) (and (<= (format 5) 255) (>= (format 5) 255)))) +(assert (or (or (or (or (or (or (or (and (<= (+ percent (* (- 1) (format 5))) 0) (>= (+ percent (* (- 1) (format 5))) 0)) (and (<= (+ s (* (- 1) (format 5))) 0) (>= (+ s (* (- 1) (format 5))) 0))) (and (<= (+ x (* (- 1) (format 5))) 0) (>= (+ x (* (- 1) (format 5))) 0))) (and (<= (format 5) 3) (>= (format 5) 3))) (and (<= (format 5) 4) (>= (format 5) 4))) (and (<= (format 5) 5) (>= (format 5) 5))) (and (<= (format 5) 6) (>= (format 5) 6))) (and (<= (format 5) 255) (>= (format 5) 255)))) +(assert (or (not (and (<= (+ percent (* (- 1) (format 6))) 0) (>= (+ percent (* (- 1) (format 6))) 0))) (<= (+ percent (* (- 1) (format 6))) 0))) +(assert (or (not (and (<= (+ percent (* (- 1) (format 6))) 0) (>= (+ percent (* (- 1) (format 6))) 0))) (>= (+ percent (* (- 1) (format 6))) 0))) +(assert (or (not (<= (+ percent (* (- 1) (format 6))) 0)) (not (>= (+ percent (* (- 1) (format 6))) 0)) (and (<= (+ percent (* (- 1) (format 6))) 0) (>= (+ percent (* (- 1) (format 6))) 0)))) +(assert (or (not (and (<= (+ s (* (- 1) (format 6))) 0) (>= (+ s (* (- 1) (format 6))) 0))) (<= (+ s (* (- 1) (format 6))) 0))) +(assert (or (not (and (<= (+ s (* (- 1) (format 6))) 0) (>= (+ s (* (- 1) (format 6))) 0))) (>= (+ s (* (- 1) (format 6))) 0))) +(assert (or (not (<= (+ s (* (- 1) (format 6))) 0)) (not (>= (+ s (* (- 1) (format 6))) 0)) (and (<= (+ s (* (- 1) (format 6))) 0) (>= (+ s (* (- 1) (format 6))) 0)))) +(assert (or (or (and (<= (+ percent (* (- 1) (format 6))) 0) (>= (+ percent (* (- 1) (format 6))) 0)) (and (<= (+ s (* (- 1) (format 6))) 0) (>= (+ s (* (- 1) (format 6))) 0))) (not (and (<= (+ percent (* (- 1) (format 6))) 0) (>= (+ percent (* (- 1) (format 6))) 0))))) +(assert (or (or (and (<= (+ percent (* (- 1) (format 6))) 0) (>= (+ percent (* (- 1) (format 6))) 0)) (and (<= (+ s (* (- 1) (format 6))) 0) (>= (+ s (* (- 1) (format 6))) 0))) (not (and (<= (+ s (* (- 1) (format 6))) 0) (>= (+ s (* (- 1) (format 6))) 0))))) +(assert (or (and (<= (+ percent (* (- 1) (format 6))) 0) (>= (+ percent (* (- 1) (format 6))) 0)) (and (<= (+ s (* (- 1) (format 6))) 0) (>= (+ s (* (- 1) (format 6))) 0)) (not (or (and (<= (+ percent (* (- 1) (format 6))) 0) (>= (+ percent (* (- 1) (format 6))) 0)) (and (<= (+ s (* (- 1) (format 6))) 0) (>= (+ s (* (- 1) (format 6))) 0)))))) +(assert (or (not (and (<= (+ x (* (- 1) (format 6))) 0) (>= (+ x (* (- 1) (format 6))) 0))) (<= (+ x (* (- 1) (format 6))) 0))) +(assert (or (not (and (<= (+ x (* (- 1) (format 6))) 0) (>= (+ x (* (- 1) (format 6))) 0))) (>= (+ x (* (- 1) (format 6))) 0))) +(assert (or (not (<= (+ x (* (- 1) (format 6))) 0)) (not (>= (+ x (* (- 1) (format 6))) 0)) (and (<= (+ x (* (- 1) (format 6))) 0) (>= (+ x (* (- 1) (format 6))) 0)))) +(assert (or (or (or (and (<= (+ percent (* (- 1) (format 6))) 0) (>= (+ percent (* (- 1) (format 6))) 0)) (and (<= (+ s (* (- 1) (format 6))) 0) (>= (+ s (* (- 1) (format 6))) 0))) (and (<= (+ x (* (- 1) (format 6))) 0) (>= (+ x (* (- 1) (format 6))) 0))) (not (or (and (<= (+ percent (* (- 1) (format 6))) 0) (>= (+ percent (* (- 1) (format 6))) 0)) (and (<= (+ s (* (- 1) (format 6))) 0) (>= (+ s (* (- 1) (format 6))) 0)))))) +(assert (or (or (or (and (<= (+ percent (* (- 1) (format 6))) 0) (>= (+ percent (* (- 1) (format 6))) 0)) (and (<= (+ s (* (- 1) (format 6))) 0) (>= (+ s (* (- 1) (format 6))) 0))) (and (<= (+ x (* (- 1) (format 6))) 0) (>= (+ x (* (- 1) (format 6))) 0))) (not (and (<= (+ x (* (- 1) (format 6))) 0) (>= (+ x (* (- 1) (format 6))) 0))))) +(assert (or (or (and (<= (+ percent (* (- 1) (format 6))) 0) (>= (+ percent (* (- 1) (format 6))) 0)) (and (<= (+ s (* (- 1) (format 6))) 0) (>= (+ s (* (- 1) (format 6))) 0))) (and (<= (+ x (* (- 1) (format 6))) 0) (>= (+ x (* (- 1) (format 6))) 0)) (not (or (or (and (<= (+ percent (* (- 1) (format 6))) 0) (>= (+ percent (* (- 1) (format 6))) 0)) (and (<= (+ s (* (- 1) (format 6))) 0) (>= (+ s (* (- 1) (format 6))) 0))) (and (<= (+ x (* (- 1) (format 6))) 0) (>= (+ x (* (- 1) (format 6))) 0)))))) +(assert (or (not (and (<= (format 6) 3) (>= (format 6) 3))) (<= (format 6) 3))) +(assert (or (not (and (<= (format 6) 3) (>= (format 6) 3))) (>= (format 6) 3))) +(assert (or (not (<= (format 6) 3)) (not (>= (format 6) 3)) (and (<= (format 6) 3) (>= (format 6) 3)))) +(assert (or (or (or (or (and (<= (+ percent (* (- 1) (format 6))) 0) (>= (+ percent (* (- 1) (format 6))) 0)) (and (<= (+ s (* (- 1) (format 6))) 0) (>= (+ s (* (- 1) (format 6))) 0))) (and (<= (+ x (* (- 1) (format 6))) 0) (>= (+ x (* (- 1) (format 6))) 0))) (and (<= (format 6) 3) (>= (format 6) 3))) (not (or (or (and (<= (+ percent (* (- 1) (format 6))) 0) (>= (+ percent (* (- 1) (format 6))) 0)) (and (<= (+ s (* (- 1) (format 6))) 0) (>= (+ s (* (- 1) (format 6))) 0))) (and (<= (+ x (* (- 1) (format 6))) 0) (>= (+ x (* (- 1) (format 6))) 0)))))) + +(assert (or (or (or (and (<= (+ percent (* (- 1) (format 6))) 0) (>= (+ percent (* (- 1) (format 6))) 0)) (and (<= (+ s (* (- 1) (format 6))) 0) (>= (+ s (* (- 1) (format 6))) 0))) (and (<= (+ x (* (- 1) (format 6))) 0) (>= (+ x (* (- 1) (format 6))) 0))) (and (<= (format 6) 3) (>= (format 6) 3)) (not (or (or (or (and (<= (+ percent (* (- 1) (format 6))) 0) (>= (+ percent (* (- 1) (format 6))) 0)) (and (<= (+ s (* (- 1) (format 6))) 0) (>= (+ s (* (- 1) (format 6))) 0))) (and (<= (+ x (* (- 1) (format 6))) 0) (>= (+ x (* (- 1) (format 6))) 0))) (and (<= (format 6) 3) (>= (format 6) 3)))))) + +(assert (or (not (and (<= (format 6) 4) (>= (format 6) 4))) (<= (format 6) 4))) +(assert (or (not (and (<= (format 6) 4) (>= (format 6) 4))) (>= (format 6) 4))) +(assert (or (not (<= (format 6) 4)) (not (>= (format 6) 4)) (and (<= (format 6) 4) (>= (format 6) 4)))) +(assert (or (or (or (or (or (and (<= (+ percent (* (- 1) (format 6))) 0) (>= (+ percent (* (- 1) (format 6))) 0)) (and (<= (+ s (* (- 1) (format 6))) 0) (>= (+ s (* (- 1) (format 6))) 0))) (and (<= (+ x (* (- 1) (format 6))) 0) (>= (+ x (* (- 1) (format 6))) 0))) (and (<= (format 6) 3) (>= (format 6) 3))) (and (<= (format 6) 4) (>= (format 6) 4))) (not (or (or (or (and (<= (+ percent (* (- 1) (format 6))) 0) (>= (+ percent (* (- 1) (format 6))) 0)) (and (<= (+ s (* (- 1) (format 6))) 0) (>= (+ s (* (- 1) (format 6))) 0))) (and (<= (+ x (* (- 1) (format 6))) 0) (>= (+ x (* (- 1) (format 6))) 0))) (and (<= (format 6) 3) (>= (format 6) 3)))))) +(assert (or (or (or (or (or (and (<= (+ percent (* (- 1) (format 6))) 0) (>= (+ percent (* (- 1) (format 6))) 0)) (and (<= (+ s (* (- 1) (format 6))) 0) (>= (+ s (* (- 1) (format 6))) 0))) (and (<= (+ x (* (- 1) (format 6))) 0) (>= (+ x (* (- 1) (format 6))) 0))) (and (<= (format 6) 3) (>= (format 6) 3))) (and (<= (format 6) 4) (>= (format 6) 4))) (not (and (<= (format 6) 4) (>= (format 6) 4))))) +(assert (or (or (or (or (and (<= (+ percent (* (- 1) (format 6))) 0) (>= (+ percent (* (- 1) (format 6))) 0)) (and (<= (+ s (* (- 1) (format 6))) 0) (>= (+ s (* (- 1) (format 6))) 0))) (and (<= (+ x (* (- 1) (format 6))) 0) (>= (+ x (* (- 1) (format 6))) 0))) (and (<= (format 6) 3) (>= (format 6) 3))) (and (<= (format 6) 4) (>= (format 6) 4)) (not (or (or (or (or (and (<= (+ percent (* (- 1) (format 6))) 0) (>= (+ percent (* (- 1) (format 6))) 0)) (and (<= (+ s (* (- 1) (format 6))) 0) (>= (+ s (* (- 1) (format 6))) 0))) (and (<= (+ x (* (- 1) (format 6))) 0) (>= (+ x (* (- 1) (format 6))) 0))) (and (<= (format 6) 3) (>= (format 6) 3))) (and (<= (format 6) 4) (>= (format 6) 4)))))) +(assert (or (not (and (<= (format 6) 5) (>= (format 6) 5))) (<= (format 6) 5))) +(assert (or (not (and (<= (format 6) 5) (>= (format 6) 5))) (>= (format 6) 5))) +(assert (or (not (<= (format 6) 5)) (not (>= (format 6) 5)) (and (<= (format 6) 5) (>= (format 6) 5)))) +(assert (or (or (or (or (or (or (and (<= (+ percent (* (- 1) (format 6))) 0) (>= (+ percent (* (- 1) (format 6))) 0)) (and (<= (+ s (* (- 1) (format 6))) 0) (>= (+ s (* (- 1) (format 6))) 0))) (and (<= (+ x (* (- 1) (format 6))) 0) (>= (+ x (* (- 1) (format 6))) 0))) (and (<= (format 6) 3) (>= (format 6) 3))) (and (<= (format 6) 4) (>= (format 6) 4))) (and (<= (format 6) 5) (>= (format 6) 5))) (not (or (or (or (or (and (<= (+ percent (* (- 1) (format 6))) 0) (>= (+ percent (* (- 1) (format 6))) 0)) (and (<= (+ s (* (- 1) (format 6))) 0) (>= (+ s (* (- 1) (format 6))) 0))) (and (<= (+ x (* (- 1) (format 6))) 0) (>= (+ x (* (- 1) (format 6))) 0))) (and (<= (format 6) 3) (>= (format 6) 3))) (and (<= (format 6) 4) (>= (format 6) 4)))))) +(assert (or (or (or (or (or (or (and (<= (+ percent (* (- 1) (format 6))) 0) (>= (+ percent (* (- 1) (format 6))) 0)) (and (<= (+ s (* (- 1) (format 6))) 0) (>= (+ s (* (- 1) (format 6))) 0))) (and (<= (+ x (* (- 1) (format 6))) 0) (>= (+ x (* (- 1) (format 6))) 0))) (and (<= (format 6) 3) (>= (format 6) 3))) (and (<= (format 6) 4) (>= (format 6) 4))) (and (<= (format 6) 5) (>= (format 6) 5))) (not (and (<= (format 6) 5) (>= (format 6) 5))))) +(assert (or (or (or (or (or (and (<= (+ percent (* (- 1) (format 6))) 0) (>= (+ percent (* (- 1) (format 6))) 0)) (and (<= (+ s (* (- 1) (format 6))) 0) (>= (+ s (* (- 1) (format 6))) 0))) (and (<= (+ x (* (- 1) (format 6))) 0) (>= (+ x (* (- 1) (format 6))) 0))) (and (<= (format 6) 3) (>= (format 6) 3))) (and (<= (format 6) 4) (>= (format 6) 4))) (and (<= (format 6) 5) (>= (format 6) 5)) (not (or (or (or (or (or (and (<= (+ percent (* (- 1) (format 6))) 0) (>= (+ percent (* (- 1) (format 6))) 0)) (and (<= (+ s (* (- 1) (format 6))) 0) (>= (+ s (* (- 1) (format 6))) 0))) (and (<= (+ x (* (- 1) (format 6))) 0) (>= (+ x (* (- 1) (format 6))) 0))) (and (<= (format 6) 3) (>= (format 6) 3))) (and (<= (format 6) 4) (>= (format 6) 4))) (and (<= (format 6) 5) (>= (format 6) 5)))))) +(assert (or (not (and (<= (format 6) 6) (>= (format 6) 6))) (<= (format 6) 6))) +(assert (or (not (and (<= (format 6) 6) (>= (format 6) 6))) (>= (format 6) 6))) +(assert (or (not (<= (format 6) 6)) (not (>= (format 6) 6)) (and (<= (format 6) 6) (>= (format 6) 6)))) +(assert (or (or (or (or (or (or (or (and (<= (+ percent (* (- 1) (format 6))) 0) (>= (+ percent (* (- 1) (format 6))) 0)) (and (<= (+ s (* (- 1) (format 6))) 0) (>= (+ s (* (- 1) (format 6))) 0))) (and (<= (+ x (* (- 1) (format 6))) 0) (>= (+ x (* (- 1) (format 6))) 0))) (and (<= (format 6) 3) (>= (format 6) 3))) (and (<= (format 6) 4) (>= (format 6) 4))) (and (<= (format 6) 5) (>= (format 6) 5))) (and (<= (format 6) 6) (>= (format 6) 6))) (not (or (or (or (or (or (and (<= (+ percent (* (- 1) (format 6))) 0) (>= (+ percent (* (- 1) (format 6))) 0)) (and (<= (+ s (* (- 1) (format 6))) 0) (>= (+ s (* (- 1) (format 6))) 0))) (and (<= (+ x (* (- 1) (format 6))) 0) (>= (+ x (* (- 1) (format 6))) 0))) (and (<= (format 6) 3) (>= (format 6) 3))) (and (<= (format 6) 4) (>= (format 6) 4))) (and (<= (format 6) 5) (>= (format 6) 5)))))) +(assert (or (or (or (or (or (or (or (and (<= (+ percent (* (- 1) (format 6))) 0) (>= (+ percent (* (- 1) (format 6))) 0)) (and (<= (+ s (* (- 1) (format 6))) 0) (>= (+ s (* (- 1) (format 6))) 0))) (and (<= (+ x (* (- 1) (format 6))) 0) (>= (+ x (* (- 1) (format 6))) 0))) (and (<= (format 6) 3) (>= (format 6) 3))) (and (<= (format 6) 4) (>= (format 6) 4))) (and (<= (format 6) 5) (>= (format 6) 5))) (and (<= (format 6) 6) (>= (format 6) 6))) (not (and (<= (format 6) 6) (>= (format 6) 6))))) +(assert (or (or (or (or (or (or (and (<= (+ percent (* (- 1) (format 6))) 0) (>= (+ percent (* (- 1) (format 6))) 0)) (and (<= (+ s (* (- 1) (format 6))) 0) (>= (+ s (* (- 1) (format 6))) 0))) (and (<= (+ x (* (- 1) (format 6))) 0) (>= (+ x (* (- 1) (format 6))) 0))) (and (<= (format 6) 3) (>= (format 6) 3))) (and (<= (format 6) 4) (>= (format 6) 4))) (and (<= (format 6) 5) (>= (format 6) 5))) (and (<= (format 6) 6) (>= (format 6) 6)) (not (or (or (or (or (or (or (and (<= (+ percent (* (- 1) (format 6))) 0) (>= (+ percent (* (- 1) (format 6))) 0)) (and (<= (+ s (* (- 1) (format 6))) 0) (>= (+ s (* (- 1) (format 6))) 0))) (and (<= (+ x (* (- 1) (format 6))) 0) (>= (+ x (* (- 1) (format 6))) 0))) (and (<= (format 6) 3) (>= (format 6) 3))) (and (<= (format 6) 4) (>= (format 6) 4))) (and (<= (format 6) 5) (>= (format 6) 5))) (and (<= (format 6) 6) (>= (format 6) 6)))))) +(assert (or (not (and (<= (format 6) 255) (>= (format 6) 255))) (<= (format 6) 255))) +(assert (or (not (and (<= (format 6) 255) (>= (format 6) 255))) (>= (format 6) 255))) +(assert (or (not (<= (format 6) 255)) (not (>= (format 6) 255)) (and (<= (format 6) 255) (>= (format 6) 255)))) +(assert (or (or (or (or (or (or (or (and (<= (+ percent (* (- 1) (format 6))) 0) (>= (+ percent (* (- 1) (format 6))) 0)) (and (<= (+ s (* (- 1) (format 6))) 0) (>= (+ s (* (- 1) (format 6))) 0))) (and (<= (+ x (* (- 1) (format 6))) 0) (>= (+ x (* (- 1) (format 6))) 0))) (and (<= (format 6) 3) (>= (format 6) 3))) (and (<= (format 6) 4) (>= (format 6) 4))) (and (<= (format 6) 5) (>= (format 6) 5))) (and (<= (format 6) 6) (>= (format 6) 6))) (and (<= (format 6) 255) (>= (format 6) 255)))) +(assert (or (not (and (<= (+ percent (* (- 1) (format 7))) 0) (>= (+ percent (* (- 1) (format 7))) 0))) (<= (+ percent (* (- 1) (format 7))) 0))) +(assert (or (not (and (<= (+ percent (* (- 1) (format 7))) 0) (>= (+ percent (* (- 1) (format 7))) 0))) (>= (+ percent (* (- 1) (format 7))) 0))) +(assert (or (not (<= (+ percent (* (- 1) (format 7))) 0)) (not (>= (+ percent (* (- 1) (format 7))) 0)) (and (<= (+ percent (* (- 1) (format 7))) 0) (>= (+ percent (* (- 1) (format 7))) 0)))) +(assert (or (not (and (<= (+ s (* (- 1) (format 7))) 0) (>= (+ s (* (- 1) (format 7))) 0))) (<= (+ s (* (- 1) (format 7))) 0))) +(assert (or (not (and (<= (+ s (* (- 1) (format 7))) 0) (>= (+ s (* (- 1) (format 7))) 0))) (>= (+ s (* (- 1) (format 7))) 0))) +(assert (or (not (<= (+ s (* (- 1) (format 7))) 0)) (not (>= (+ s (* (- 1) (format 7))) 0)) (and (<= (+ s (* (- 1) (format 7))) 0) (>= (+ s (* (- 1) (format 7))) 0)))) +(assert (or (or (and (<= (+ percent (* (- 1) (format 7))) 0) (>= (+ percent (* (- 1) (format 7))) 0)) (and (<= (+ s (* (- 1) (format 7))) 0) (>= (+ s (* (- 1) (format 7))) 0))) (not (and (<= (+ percent (* (- 1) (format 7))) 0) (>= (+ percent (* (- 1) (format 7))) 0))))) +(assert (or (or (and (<= (+ percent (* (- 1) (format 7))) 0) (>= (+ percent (* (- 1) (format 7))) 0)) (and (<= (+ s (* (- 1) (format 7))) 0) (>= (+ s (* (- 1) (format 7))) 0))) (not (and (<= (+ s (* (- 1) (format 7))) 0) (>= (+ s (* (- 1) (format 7))) 0))))) +(assert (or (and (<= (+ percent (* (- 1) (format 7))) 0) (>= (+ percent (* (- 1) (format 7))) 0)) (and (<= (+ s (* (- 1) (format 7))) 0) (>= (+ s (* (- 1) (format 7))) 0)) (not (or (and (<= (+ percent (* (- 1) (format 7))) 0) (>= (+ percent (* (- 1) (format 7))) 0)) (and (<= (+ s (* (- 1) (format 7))) 0) (>= (+ s (* (- 1) (format 7))) 0)))))) +(assert (or (not (and (<= (+ x (* (- 1) (format 7))) 0) (>= (+ x (* (- 1) (format 7))) 0))) (<= (+ x (* (- 1) (format 7))) 0))) +(assert (or (not (and (<= (+ x (* (- 1) (format 7))) 0) (>= (+ x (* (- 1) (format 7))) 0))) (>= (+ x (* (- 1) (format 7))) 0))) +(assert (or (not (<= (+ x (* (- 1) (format 7))) 0)) (not (>= (+ x (* (- 1) (format 7))) 0)) (and (<= (+ x (* (- 1) (format 7))) 0) (>= (+ x (* (- 1) (format 7))) 0)))) +(assert (or (or (or (and (<= (+ percent (* (- 1) (format 7))) 0) (>= (+ percent (* (- 1) (format 7))) 0)) (and (<= (+ s (* (- 1) (format 7))) 0) (>= (+ s (* (- 1) (format 7))) 0))) (and (<= (+ x (* (- 1) (format 7))) 0) (>= (+ x (* (- 1) (format 7))) 0))) (not (or (and (<= (+ percent (* (- 1) (format 7))) 0) (>= (+ percent (* (- 1) (format 7))) 0)) (and (<= (+ s (* (- 1) (format 7))) 0) (>= (+ s (* (- 1) (format 7))) 0)))))) +(assert (or (or (or (and (<= (+ percent (* (- 1) (format 7))) 0) (>= (+ percent (* (- 1) (format 7))) 0)) (and (<= (+ s (* (- 1) (format 7))) 0) (>= (+ s (* (- 1) (format 7))) 0))) (and (<= (+ x (* (- 1) (format 7))) 0) (>= (+ x (* (- 1) (format 7))) 0))) (not (and (<= (+ x (* (- 1) (format 7))) 0) (>= (+ x (* (- 1) (format 7))) 0))))) +(assert (or (or (and (<= (+ percent (* (- 1) (format 7))) 0) (>= (+ percent (* (- 1) (format 7))) 0)) (and (<= (+ s (* (- 1) (format 7))) 0) (>= (+ s (* (- 1) (format 7))) 0))) (and (<= (+ x (* (- 1) (format 7))) 0) (>= (+ x (* (- 1) (format 7))) 0)) (not (or (or (and (<= (+ percent (* (- 1) (format 7))) 0) (>= (+ percent (* (- 1) (format 7))) 0)) (and (<= (+ s (* (- 1) (format 7))) 0) (>= (+ s (* (- 1) (format 7))) 0))) (and (<= (+ x (* (- 1) (format 7))) 0) (>= (+ x (* (- 1) (format 7))) 0)))))) +(assert (or (not (and (<= (format 7) 3) (>= (format 7) 3))) (<= (format 7) 3))) +(assert (or (not (and (<= (format 7) 3) (>= (format 7) 3))) (>= (format 7) 3))) +(assert (or (not (<= (format 7) 3)) (not (>= (format 7) 3)) (and (<= (format 7) 3) (>= (format 7) 3)))) +(assert (or (or (or (or (and (<= (+ percent (* (- 1) (format 7))) 0) (>= (+ percent (* (- 1) (format 7))) 0)) (and (<= (+ s (* (- 1) (format 7))) 0) (>= (+ s (* (- 1) (format 7))) 0))) (and (<= (+ x (* (- 1) (format 7))) 0) (>= (+ x (* (- 1) (format 7))) 0))) (and (<= (format 7) 3) (>= (format 7) 3))) (not (or (or (and (<= (+ percent (* (- 1) (format 7))) 0) (>= (+ percent (* (- 1) (format 7))) 0)) (and (<= (+ s (* (- 1) (format 7))) 0) (>= (+ s (* (- 1) (format 7))) 0))) (and (<= (+ x (* (- 1) (format 7))) 0) (>= (+ x (* (- 1) (format 7))) 0)))))) +(assert (or (or (or (or (and (<= (+ percent (* (- 1) (format 7))) 0) (>= (+ percent (* (- 1) (format 7))) 0)) (and (<= (+ s (* (- 1) (format 7))) 0) (>= (+ s (* (- 1) (format 7))) 0))) (and (<= (+ x (* (- 1) (format 7))) 0) (>= (+ x (* (- 1) (format 7))) 0))) (and (<= (format 7) 3) (>= (format 7) 3))) (not (and (<= (format 7) 3) (>= (format 7) 3))))) +(assert (or (or (or (and (<= (+ percent (* (- 1) (format 7))) 0) (>= (+ percent (* (- 1) (format 7))) 0)) (and (<= (+ s (* (- 1) (format 7))) 0) (>= (+ s (* (- 1) (format 7))) 0))) (and (<= (+ x (* (- 1) (format 7))) 0) (>= (+ x (* (- 1) (format 7))) 0))) (and (<= (format 7) 3) (>= (format 7) 3)) (not (or (or (or (and (<= (+ percent (* (- 1) (format 7))) 0) (>= (+ percent (* (- 1) (format 7))) 0)) (and (<= (+ s (* (- 1) (format 7))) 0) (>= (+ s (* (- 1) (format 7))) 0))) (and (<= (+ x (* (- 1) (format 7))) 0) (>= (+ x (* (- 1) (format 7))) 0))) (and (<= (format 7) 3) (>= (format 7) 3)))))) +(assert (or (not (and (<= (format 7) 4) (>= (format 7) 4))) (<= (format 7) 4))) +(assert (or (not (and (<= (format 7) 4) (>= (format 7) 4))) (>= (format 7) 4))) +(assert (or (not (<= (format 7) 4)) (not (>= (format 7) 4)) (and (<= (format 7) 4) (>= (format 7) 4)))) +(assert (or (or (or (or (or (and (<= (+ percent (* (- 1) (format 7))) 0) (>= (+ percent (* (- 1) (format 7))) 0)) (and (<= (+ s (* (- 1) (format 7))) 0) (>= (+ s (* (- 1) (format 7))) 0))) (and (<= (+ x (* (- 1) (format 7))) 0) (>= (+ x (* (- 1) (format 7))) 0))) (and (<= (format 7) 3) (>= (format 7) 3))) (and (<= (format 7) 4) (>= (format 7) 4))) (not (or (or (or (and (<= (+ percent (* (- 1) (format 7))) 0) (>= (+ percent (* (- 1) (format 7))) 0)) (and (<= (+ s (* (- 1) (format 7))) 0) (>= (+ s (* (- 1) (format 7))) 0))) (and (<= (+ x (* (- 1) (format 7))) 0) (>= (+ x (* (- 1) (format 7))) 0))) (and (<= (format 7) 3) (>= (format 7) 3)))))) +(assert (or (or (or (or (or (and (<= (+ percent (* (- 1) (format 7))) 0) (>= (+ percent (* (- 1) (format 7))) 0)) (and (<= (+ s (* (- 1) (format 7))) 0) (>= (+ s (* (- 1) (format 7))) 0))) (and (<= (+ x (* (- 1) (format 7))) 0) (>= (+ x (* (- 1) (format 7))) 0))) (and (<= (format 7) 3) (>= (format 7) 3))) (and (<= (format 7) 4) (>= (format 7) 4))) (not (and (<= (format 7) 4) (>= (format 7) 4))))) +(assert (or (or (or (or (and (<= (+ percent (* (- 1) (format 7))) 0) (>= (+ percent (* (- 1) (format 7))) 0)) (and (<= (+ s (* (- 1) (format 7))) 0) (>= (+ s (* (- 1) (format 7))) 0))) (and (<= (+ x (* (- 1) (format 7))) 0) (>= (+ x (* (- 1) (format 7))) 0))) (and (<= (format 7) 3) (>= (format 7) 3))) (and (<= (format 7) 4) (>= (format 7) 4)) (not (or (or (or (or (and (<= (+ percent (* (- 1) (format 7))) 0) (>= (+ percent (* (- 1) (format 7))) 0)) (and (<= (+ s (* (- 1) (format 7))) 0) (>= (+ s (* (- 1) (format 7))) 0))) (and (<= (+ x (* (- 1) (format 7))) 0) (>= (+ x (* (- 1) (format 7))) 0))) (and (<= (format 7) 3) (>= (format 7) 3))) (and (<= (format 7) 4) (>= (format 7) 4)))))) +(assert (or (not (and (<= (format 7) 5) (>= (format 7) 5))) (<= (format 7) 5))) +(assert (or (not (and (<= (format 7) 5) (>= (format 7) 5))) (>= (format 7) 5))) +(assert (or (not (<= (format 7) 5)) (not (>= (format 7) 5)) (and (<= (format 7) 5) (>= (format 7) 5)))) +(assert (or (or (or (or (or (or (and (<= (+ percent (* (- 1) (format 7))) 0) (>= (+ percent (* (- 1) (format 7))) 0)) (and (<= (+ s (* (- 1) (format 7))) 0) (>= (+ s (* (- 1) (format 7))) 0))) (and (<= (+ x (* (- 1) (format 7))) 0) (>= (+ x (* (- 1) (format 7))) 0))) (and (<= (format 7) 3) (>= (format 7) 3))) (and (<= (format 7) 4) (>= (format 7) 4))) (and (<= (format 7) 5) (>= (format 7) 5))) (not (or (or (or (or (and (<= (+ percent (* (- 1) (format 7))) 0) (>= (+ percent (* (- 1) (format 7))) 0)) (and (<= (+ s (* (- 1) (format 7))) 0) (>= (+ s (* (- 1) (format 7))) 0))) (and (<= (+ x (* (- 1) (format 7))) 0) (>= (+ x (* (- 1) (format 7))) 0))) (and (<= (format 7) 3) (>= (format 7) 3))) (and (<= (format 7) 4) (>= (format 7) 4)))))) +(assert (or (or (or (or (or (or (and (<= (+ percent (* (- 1) (format 7))) 0) (>= (+ percent (* (- 1) (format 7))) 0)) (and (<= (+ s (* (- 1) (format 7))) 0) (>= (+ s (* (- 1) (format 7))) 0))) (and (<= (+ x (* (- 1) (format 7))) 0) (>= (+ x (* (- 1) (format 7))) 0))) (and (<= (format 7) 3) (>= (format 7) 3))) (and (<= (format 7) 4) (>= (format 7) 4))) (and (<= (format 7) 5) (>= (format 7) 5))) (not (and (<= (format 7) 5) (>= (format 7) 5))))) +(assert (or (or (or (or (or (and (<= (+ percent (* (- 1) (format 7))) 0) (>= (+ percent (* (- 1) (format 7))) 0)) (and (<= (+ s (* (- 1) (format 7))) 0) (>= (+ s (* (- 1) (format 7))) 0))) (and (<= (+ x (* (- 1) (format 7))) 0) (>= (+ x (* (- 1) (format 7))) 0))) (and (<= (format 7) 3) (>= (format 7) 3))) (and (<= (format 7) 4) (>= (format 7) 4))) (and (<= (format 7) 5) (>= (format 7) 5)) (not (or (or (or (or (or (and (<= (+ percent (* (- 1) (format 7))) 0) (>= (+ percent (* (- 1) (format 7))) 0)) (and (<= (+ s (* (- 1) (format 7))) 0) (>= (+ s (* (- 1) (format 7))) 0))) (and (<= (+ x (* (- 1) (format 7))) 0) (>= (+ x (* (- 1) (format 7))) 0))) (and (<= (format 7) 3) (>= (format 7) 3))) (and (<= (format 7) 4) (>= (format 7) 4))) (and (<= (format 7) 5) (>= (format 7) 5)))))) +(assert (or (not (and (<= (format 7) 6) (>= (format 7) 6))) (<= (format 7) 6))) +(assert (or (not (and (<= (format 7) 6) (>= (format 7) 6))) (>= (format 7) 6))) +(assert (or (not (<= (format 7) 6)) (not (>= (format 7) 6)) (and (<= (format 7) 6) (>= (format 7) 6)))) +(assert (or (or (or (or (or (or (or (and (<= (+ percent (* (- 1) (format 7))) 0) (>= (+ percent (* (- 1) (format 7))) 0)) (and (<= (+ s (* (- 1) (format 7))) 0) (>= (+ s (* (- 1) (format 7))) 0))) (and (<= (+ x (* (- 1) (format 7))) 0) (>= (+ x (* (- 1) (format 7))) 0))) (and (<= (format 7) 3) (>= (format 7) 3))) (and (<= (format 7) 4) (>= (format 7) 4))) (and (<= (format 7) 5) (>= (format 7) 5))) (and (<= (format 7) 6) (>= (format 7) 6))) (not (or (or (or (or (or (and (<= (+ percent (* (- 1) (format 7))) 0) (>= (+ percent (* (- 1) (format 7))) 0)) (and (<= (+ s (* (- 1) (format 7))) 0) (>= (+ s (* (- 1) (format 7))) 0))) (and (<= (+ x (* (- 1) (format 7))) 0) (>= (+ x (* (- 1) (format 7))) 0))) (and (<= (format 7) 3) (>= (format 7) 3))) (and (<= (format 7) 4) (>= (format 7) 4))) (and (<= (format 7) 5) (>= (format 7) 5)))))) +(assert (or (or (or (or (or (or (or (and (<= (+ percent (* (- 1) (format 7))) 0) (>= (+ percent (* (- 1) (format 7))) 0)) (and (<= (+ s (* (- 1) (format 7))) 0) (>= (+ s (* (- 1) (format 7))) 0))) (and (<= (+ x (* (- 1) (format 7))) 0) (>= (+ x (* (- 1) (format 7))) 0))) (and (<= (format 7) 3) (>= (format 7) 3))) (and (<= (format 7) 4) (>= (format 7) 4))) (and (<= (format 7) 5) (>= (format 7) 5))) (and (<= (format 7) 6) (>= (format 7) 6))) (not (and (<= (format 7) 6) (>= (format 7) 6))))) +(assert (or (or (or (or (or (or (and (<= (+ percent (* (- 1) (format 7))) 0) (>= (+ percent (* (- 1) (format 7))) 0)) (and (<= (+ s (* (- 1) (format 7))) 0) (>= (+ s (* (- 1) (format 7))) 0))) (and (<= (+ x (* (- 1) (format 7))) 0) (>= (+ x (* (- 1) (format 7))) 0))) (and (<= (format 7) 3) (>= (format 7) 3))) (and (<= (format 7) 4) (>= (format 7) 4))) (and (<= (format 7) 5) (>= (format 7) 5))) (and (<= (format 7) 6) (>= (format 7) 6)) (not (or (or (or (or (or (or (and (<= (+ percent (* (- 1) (format 7))) 0) (>= (+ percent (* (- 1) (format 7))) 0)) (and (<= (+ s (* (- 1) (format 7))) 0) (>= (+ s (* (- 1) (format 7))) 0))) (and (<= (+ x (* (- 1) (format 7))) 0) (>= (+ x (* (- 1) (format 7))) 0))) (and (<= (format 7) 3) (>= (format 7) 3))) (and (<= (format 7) 4) (>= (format 7) 4))) (and (<= (format 7) 5) (>= (format 7) 5))) (and (<= (format 7) 6) (>= (format 7) 6)))))) +(assert (or (not (and (<= (format 7) 255) (>= (format 7) 255))) (<= (format 7) 255))) +(assert (or (not (and (<= (format 7) 255) (>= (format 7) 255))) (>= (format 7) 255))) +(assert (or (not (<= (format 7) 255)) (not (>= (format 7) 255)) (and (<= (format 7) 255) (>= (format 7) 255)))) +(assert (or (or (or (or (or (or (or (and (<= (+ percent (* (- 1) (format 7))) 0) (>= (+ percent (* (- 1) (format 7))) 0)) (and (<= (+ s (* (- 1) (format 7))) 0) (>= (+ s (* (- 1) (format 7))) 0))) (and (<= (+ x (* (- 1) (format 7))) 0) (>= (+ x (* (- 1) (format 7))) 0))) (and (<= (format 7) 3) (>= (format 7) 3))) (and (<= (format 7) 4) (>= (format 7) 4))) (and (<= (format 7) 5) (>= (format 7) 5))) (and (<= (format 7) 6) (>= (format 7) 6))) (and (<= (format 7) 255) (>= (format 7) 255)))) +(assert (or (not (and (<= (+ percent (* (- 1) (format 8))) 0) (>= (+ percent (* (- 1) (format 8))) 0))) (<= (+ percent (* (- 1) (format 8))) 0))) +(assert (or (not (and (<= (+ percent (* (- 1) (format 8))) 0) (>= (+ percent (* (- 1) (format 8))) 0))) (>= (+ percent (* (- 1) (format 8))) 0))) +(assert (or (not (<= (+ percent (* (- 1) (format 8))) 0)) (not (>= (+ percent (* (- 1) (format 8))) 0)) (and (<= (+ percent (* (- 1) (format 8))) 0) (>= (+ percent (* (- 1) (format 8))) 0)))) +(assert (or (not (and (<= (+ s (* (- 1) (format 8))) 0) (>= (+ s (* (- 1) (format 8))) 0))) (<= (+ s (* (- 1) (format 8))) 0))) +(assert (or (not (and (<= (+ s (* (- 1) (format 8))) 0) (>= (+ s (* (- 1) (format 8))) 0))) (>= (+ s (* (- 1) (format 8))) 0))) +(assert (or (not (<= (+ s (* (- 1) (format 8))) 0)) (not (>= (+ s (* (- 1) (format 8))) 0)) (and (<= (+ s (* (- 1) (format 8))) 0) (>= (+ s (* (- 1) (format 8))) 0)))) +(assert (or (or (and (<= (+ percent (* (- 1) (format 8))) 0) (>= (+ percent (* (- 1) (format 8))) 0)) (and (<= (+ s (* (- 1) (format 8))) 0) (>= (+ s (* (- 1) (format 8))) 0))) (not (and (<= (+ percent (* (- 1) (format 8))) 0) (>= (+ percent (* (- 1) (format 8))) 0))))) +(assert (or (or (and (<= (+ percent (* (- 1) (format 8))) 0) (>= (+ percent (* (- 1) (format 8))) 0)) (and (<= (+ s (* (- 1) (format 8))) 0) (>= (+ s (* (- 1) (format 8))) 0))) (not (and (<= (+ s (* (- 1) (format 8))) 0) (>= (+ s (* (- 1) (format 8))) 0))))) +(assert (or (and (<= (+ percent (* (- 1) (format 8))) 0) (>= (+ percent (* (- 1) (format 8))) 0)) (and (<= (+ s (* (- 1) (format 8))) 0) (>= (+ s (* (- 1) (format 8))) 0)) (not (or (and (<= (+ percent (* (- 1) (format 8))) 0) (>= (+ percent (* (- 1) (format 8))) 0)) (and (<= (+ s (* (- 1) (format 8))) 0) (>= (+ s (* (- 1) (format 8))) 0)))))) +(assert (or (not (and (<= (+ x (* (- 1) (format 8))) 0) (>= (+ x (* (- 1) (format 8))) 0))) (<= (+ x (* (- 1) (format 8))) 0))) +(assert (or (not (and (<= (+ x (* (- 1) (format 8))) 0) (>= (+ x (* (- 1) (format 8))) 0))) (>= (+ x (* (- 1) (format 8))) 0))) +(assert (or (not (<= (+ x (* (- 1) (format 8))) 0)) (not (>= (+ x (* (- 1) (format 8))) 0)) (and (<= (+ x (* (- 1) (format 8))) 0) (>= (+ x (* (- 1) (format 8))) 0)))) +(assert (or (or (or (and (<= (+ percent (* (- 1) (format 8))) 0) (>= (+ percent (* (- 1) (format 8))) 0)) (and (<= (+ s (* (- 1) (format 8))) 0) (>= (+ s (* (- 1) (format 8))) 0))) (and (<= (+ x (* (- 1) (format 8))) 0) (>= (+ x (* (- 1) (format 8))) 0))) (not (or (and (<= (+ percent (* (- 1) (format 8))) 0) (>= (+ percent (* (- 1) (format 8))) 0)) (and (<= (+ s (* (- 1) (format 8))) 0) (>= (+ s (* (- 1) (format 8))) 0)))))) +(assert (or (or (or (and (<= (+ percent (* (- 1) (format 8))) 0) (>= (+ percent (* (- 1) (format 8))) 0)) (and (<= (+ s (* (- 1) (format 8))) 0) (>= (+ s (* (- 1) (format 8))) 0))) (and (<= (+ x (* (- 1) (format 8))) 0) (>= (+ x (* (- 1) (format 8))) 0))) (not (and (<= (+ x (* (- 1) (format 8))) 0) (>= (+ x (* (- 1) (format 8))) 0))))) +(assert (or (or (and (<= (+ percent (* (- 1) (format 8))) 0) (>= (+ percent (* (- 1) (format 8))) 0)) (and (<= (+ s (* (- 1) (format 8))) 0) (>= (+ s (* (- 1) (format 8))) 0))) (and (<= (+ x (* (- 1) (format 8))) 0) (>= (+ x (* (- 1) (format 8))) 0)) (not (or (or (and (<= (+ percent (* (- 1) (format 8))) 0) (>= (+ percent (* (- 1) (format 8))) 0)) (and (<= (+ s (* (- 1) (format 8))) 0) (>= (+ s (* (- 1) (format 8))) 0))) (and (<= (+ x (* (- 1) (format 8))) 0) (>= (+ x (* (- 1) (format 8))) 0)))))) +(assert (or (not (and (<= (format 8) 3) (>= (format 8) 3))) (<= (format 8) 3))) +(assert (or (not (and (<= (format 8) 3) (>= (format 8) 3))) (>= (format 8) 3))) +(assert (or (not (<= (format 8) 3)) (not (>= (format 8) 3)) (and (<= (format 8) 3) (>= (format 8) 3)))) +(assert (or (or (or (or (and (<= (+ percent (* (- 1) (format 8))) 0) (>= (+ percent (* (- 1) (format 8))) 0)) (and (<= (+ s (* (- 1) (format 8))) 0) (>= (+ s (* (- 1) (format 8))) 0))) (and (<= (+ x (* (- 1) (format 8))) 0) (>= (+ x (* (- 1) (format 8))) 0))) (and (<= (format 8) 3) (>= (format 8) 3))) (not (or (or (and (<= (+ percent (* (- 1) (format 8))) 0) (>= (+ percent (* (- 1) (format 8))) 0)) (and (<= (+ s (* (- 1) (format 8))) 0) (>= (+ s (* (- 1) (format 8))) 0))) (and (<= (+ x (* (- 1) (format 8))) 0) (>= (+ x (* (- 1) (format 8))) 0)))))) +(assert (or (or (or (or (and (<= (+ percent (* (- 1) (format 8))) 0) (>= (+ percent (* (- 1) (format 8))) 0)) (and (<= (+ s (* (- 1) (format 8))) 0) (>= (+ s (* (- 1) (format 8))) 0))) (and (<= (+ x (* (- 1) (format 8))) 0) (>= (+ x (* (- 1) (format 8))) 0))) (and (<= (format 8) 3) (>= (format 8) 3))) (not (and (<= (format 8) 3) (>= (format 8) 3))))) +(assert (or (or (or (and (<= (+ percent (* (- 1) (format 8))) 0) (>= (+ percent (* (- 1) (format 8))) 0)) (and (<= (+ s (* (- 1) (format 8))) 0) (>= (+ s (* (- 1) (format 8))) 0))) (and (<= (+ x (* (- 1) (format 8))) 0) (>= (+ x (* (- 1) (format 8))) 0))) (and (<= (format 8) 3) (>= (format 8) 3)) (not (or (or (or (and (<= (+ percent (* (- 1) (format 8))) 0) (>= (+ percent (* (- 1) (format 8))) 0)) (and (<= (+ s (* (- 1) (format 8))) 0) (>= (+ s (* (- 1) (format 8))) 0))) (and (<= (+ x (* (- 1) (format 8))) 0) (>= (+ x (* (- 1) (format 8))) 0))) (and (<= (format 8) 3) (>= (format 8) 3)))))) +(assert (or (not (and (<= (format 8) 4) (>= (format 8) 4))) (<= (format 8) 4))) +(assert (or (not (and (<= (format 8) 4) (>= (format 8) 4))) (>= (format 8) 4))) +(assert (or (not (<= (format 8) 4)) (not (>= (format 8) 4)) (and (<= (format 8) 4) (>= (format 8) 4)))) +(assert (or (or (or (or (or (and (<= (+ percent (* (- 1) (format 8))) 0) (>= (+ percent (* (- 1) (format 8))) 0)) (and (<= (+ s (* (- 1) (format 8))) 0) (>= (+ s (* (- 1) (format 8))) 0))) (and (<= (+ x (* (- 1) (format 8))) 0) (>= (+ x (* (- 1) (format 8))) 0))) (and (<= (format 8) 3) (>= (format 8) 3))) (and (<= (format 8) 4) (>= (format 8) 4))) (not (or (or (or (and (<= (+ percent (* (- 1) (format 8))) 0) (>= (+ percent (* (- 1) (format 8))) 0)) (and (<= (+ s (* (- 1) (format 8))) 0) (>= (+ s (* (- 1) (format 8))) 0))) (and (<= (+ x (* (- 1) (format 8))) 0) (>= (+ x (* (- 1) (format 8))) 0))) (and (<= (format 8) 3) (>= (format 8) 3)))))) +(assert (or (or (or (or (or (and (<= (+ percent (* (- 1) (format 8))) 0) (>= (+ percent (* (- 1) (format 8))) 0)) (and (<= (+ s (* (- 1) (format 8))) 0) (>= (+ s (* (- 1) (format 8))) 0))) (and (<= (+ x (* (- 1) (format 8))) 0) (>= (+ x (* (- 1) (format 8))) 0))) (and (<= (format 8) 3) (>= (format 8) 3))) (and (<= (format 8) 4) (>= (format 8) 4))) (not (and (<= (format 8) 4) (>= (format 8) 4))))) +(assert (or (or (or (or (and (<= (+ percent (* (- 1) (format 8))) 0) (>= (+ percent (* (- 1) (format 8))) 0)) (and (<= (+ s (* (- 1) (format 8))) 0) (>= (+ s (* (- 1) (format 8))) 0))) (and (<= (+ x (* (- 1) (format 8))) 0) (>= (+ x (* (- 1) (format 8))) 0))) (and (<= (format 8) 3) (>= (format 8) 3))) (and (<= (format 8) 4) (>= (format 8) 4)) (not (or (or (or (or (and (<= (+ percent (* (- 1) (format 8))) 0) (>= (+ percent (* (- 1) (format 8))) 0)) (and (<= (+ s (* (- 1) (format 8))) 0) (>= (+ s (* (- 1) (format 8))) 0))) (and (<= (+ x (* (- 1) (format 8))) 0) (>= (+ x (* (- 1) (format 8))) 0))) (and (<= (format 8) 3) (>= (format 8) 3))) (and (<= (format 8) 4) (>= (format 8) 4)))))) +(assert (or (not (and (<= (format 8) 5) (>= (format 8) 5))) (<= (format 8) 5))) +(assert (or (not (and (<= (format 8) 5) (>= (format 8) 5))) (>= (format 8) 5))) +(assert (or (not (<= (format 8) 5)) (not (>= (format 8) 5)) (and (<= (format 8) 5) (>= (format 8) 5)))) +(assert (or (or (or (or (or (or (and (<= (+ percent (* (- 1) (format 8))) 0) (>= (+ percent (* (- 1) (format 8))) 0)) (and (<= (+ s (* (- 1) (format 8))) 0) (>= (+ s (* (- 1) (format 8))) 0))) (and (<= (+ x (* (- 1) (format 8))) 0) (>= (+ x (* (- 1) (format 8))) 0))) (and (<= (format 8) 3) (>= (format 8) 3))) (and (<= (format 8) 4) (>= (format 8) 4))) (and (<= (format 8) 5) (>= (format 8) 5))) (not (or (or (or (or (and (<= (+ percent (* (- 1) (format 8))) 0) (>= (+ percent (* (- 1) (format 8))) 0)) (and (<= (+ s (* (- 1) (format 8))) 0) (>= (+ s (* (- 1) (format 8))) 0))) (and (<= (+ x (* (- 1) (format 8))) 0) (>= (+ x (* (- 1) (format 8))) 0))) (and (<= (format 8) 3) (>= (format 8) 3))) (and (<= (format 8) 4) (>= (format 8) 4)))))) +(assert (or (or (or (or (or (or (and (<= (+ percent (* (- 1) (format 8))) 0) (>= (+ percent (* (- 1) (format 8))) 0)) (and (<= (+ s (* (- 1) (format 8))) 0) (>= (+ s (* (- 1) (format 8))) 0))) (and (<= (+ x (* (- 1) (format 8))) 0) (>= (+ x (* (- 1) (format 8))) 0))) (and (<= (format 8) 3) (>= (format 8) 3))) (and (<= (format 8) 4) (>= (format 8) 4))) (and (<= (format 8) 5) (>= (format 8) 5))) (not (and (<= (format 8) 5) (>= (format 8) 5))))) +(assert (or (or (or (or (or (and (<= (+ percent (* (- 1) (format 8))) 0) (>= (+ percent (* (- 1) (format 8))) 0)) (and (<= (+ s (* (- 1) (format 8))) 0) (>= (+ s (* (- 1) (format 8))) 0))) (and (<= (+ x (* (- 1) (format 8))) 0) (>= (+ x (* (- 1) (format 8))) 0))) (and (<= (format 8) 3) (>= (format 8) 3))) (and (<= (format 8) 4) (>= (format 8) 4))) (and (<= (format 8) 5) (>= (format 8) 5)) (not (or (or (or (or (or (and (<= (+ percent (* (- 1) (format 8))) 0) (>= (+ percent (* (- 1) (format 8))) 0)) (and (<= (+ s (* (- 1) (format 8))) 0) (>= (+ s (* (- 1) (format 8))) 0))) (and (<= (+ x (* (- 1) (format 8))) 0) (>= (+ x (* (- 1) (format 8))) 0))) (and (<= (format 8) 3) (>= (format 8) 3))) (and (<= (format 8) 4) (>= (format 8) 4))) (and (<= (format 8) 5) (>= (format 8) 5)))))) +(assert (or (not (and (<= (format 8) 6) (>= (format 8) 6))) (<= (format 8) 6))) +(assert (or (not (and (<= (format 8) 6) (>= (format 8) 6))) (>= (format 8) 6))) +(assert (or (not (<= (format 8) 6)) (not (>= (format 8) 6)) (and (<= (format 8) 6) (>= (format 8) 6)))) +(assert (or (or (or (or (or (or (or (and (<= (+ percent (* (- 1) (format 8))) 0) (>= (+ percent (* (- 1) (format 8))) 0)) (and (<= (+ s (* (- 1) (format 8))) 0) (>= (+ s (* (- 1) (format 8))) 0))) (and (<= (+ x (* (- 1) (format 8))) 0) (>= (+ x (* (- 1) (format 8))) 0))) (and (<= (format 8) 3) (>= (format 8) 3))) (and (<= (format 8) 4) (>= (format 8) 4))) (and (<= (format 8) 5) (>= (format 8) 5))) (and (<= (format 8) 6) (>= (format 8) 6))) (not (or (or (or (or (or (and (<= (+ percent (* (- 1) (format 8))) 0) (>= (+ percent (* (- 1) (format 8))) 0)) (and (<= (+ s (* (- 1) (format 8))) 0) (>= (+ s (* (- 1) (format 8))) 0))) (and (<= (+ x (* (- 1) (format 8))) 0) (>= (+ x (* (- 1) (format 8))) 0))) (and (<= (format 8) 3) (>= (format 8) 3))) (and (<= (format 8) 4) (>= (format 8) 4))) (and (<= (format 8) 5) (>= (format 8) 5)))))) +(assert (or (or (or (or (or (or (or (and (<= (+ percent (* (- 1) (format 8))) 0) (>= (+ percent (* (- 1) (format 8))) 0)) (and (<= (+ s (* (- 1) (format 8))) 0) (>= (+ s (* (- 1) (format 8))) 0))) (and (<= (+ x (* (- 1) (format 8))) 0) (>= (+ x (* (- 1) (format 8))) 0))) (and (<= (format 8) 3) (>= (format 8) 3))) (and (<= (format 8) 4) (>= (format 8) 4))) (and (<= (format 8) 5) (>= (format 8) 5))) (and (<= (format 8) 6) (>= (format 8) 6))) (not (and (<= (format 8) 6) (>= (format 8) 6))))) +(assert (or (or (or (or (or (or (and (<= (+ percent (* (- 1) (format 8))) 0) (>= (+ percent (* (- 1) (format 8))) 0)) (and (<= (+ s (* (- 1) (format 8))) 0) (>= (+ s (* (- 1) (format 8))) 0))) (and (<= (+ x (* (- 1) (format 8))) 0) (>= (+ x (* (- 1) (format 8))) 0))) (and (<= (format 8) 3) (>= (format 8) 3))) (and (<= (format 8) 4) (>= (format 8) 4))) (and (<= (format 8) 5) (>= (format 8) 5))) (and (<= (format 8) 6) (>= (format 8) 6)) (not (or (or (or (or (or (or (and (<= (+ percent (* (- 1) (format 8))) 0) (>= (+ percent (* (- 1) (format 8))) 0)) (and (<= (+ s (* (- 1) (format 8))) 0) (>= (+ s (* (- 1) (format 8))) 0))) (and (<= (+ x (* (- 1) (format 8))) 0) (>= (+ x (* (- 1) (format 8))) 0))) (and (<= (format 8) 3) (>= (format 8) 3))) (and (<= (format 8) 4) (>= (format 8) 4))) (and (<= (format 8) 5) (>= (format 8) 5))) (and (<= (format 8) 6) (>= (format 8) 6)))))) +(assert (or (not (and (<= (format 8) 255) (>= (format 8) 255))) (<= (format 8) 255))) +(assert (or (not (and (<= (format 8) 255) (>= (format 8) 255))) (>= (format 8) 255))) +(assert (or (not (<= (format 8) 255)) (not (>= (format 8) 255)) (and (<= (format 8) 255) (>= (format 8) 255)))) +(assert (or (or (or (or (or (or (or (and (<= (+ percent (* (- 1) (format 8))) 0) (>= (+ percent (* (- 1) (format 8))) 0)) (and (<= (+ s (* (- 1) (format 8))) 0) (>= (+ s (* (- 1) (format 8))) 0))) (and (<= (+ x (* (- 1) (format 8))) 0) (>= (+ x (* (- 1) (format 8))) 0))) (and (<= (format 8) 3) (>= (format 8) 3))) (and (<= (format 8) 4) (>= (format 8) 4))) (and (<= (format 8) 5) (>= (format 8) 5))) (and (<= (format 8) 6) (>= (format 8) 6))) (and (<= (format 8) 255) (>= (format 8) 255)))) +(assert (or (not (and (<= (+ percent (* (- 1) (format 9))) 0) (>= (+ percent (* (- 1) (format 9))) 0))) (<= (+ percent (* (- 1) (format 9))) 0))) +(assert (or (not (and (<= (+ percent (* (- 1) (format 9))) 0) (>= (+ percent (* (- 1) (format 9))) 0))) (>= (+ percent (* (- 1) (format 9))) 0))) +(assert (or (not (<= (+ percent (* (- 1) (format 9))) 0)) (not (>= (+ percent (* (- 1) (format 9))) 0)) (and (<= (+ percent (* (- 1) (format 9))) 0) (>= (+ percent (* (- 1) (format 9))) 0)))) +(assert (or (not (and (<= (+ s (* (- 1) (format 9))) 0) (>= (+ s (* (- 1) (format 9))) 0))) (<= (+ s (* (- 1) (format 9))) 0))) +(assert (or (not (and (<= (+ s (* (- 1) (format 9))) 0) (>= (+ s (* (- 1) (format 9))) 0))) (>= (+ s (* (- 1) (format 9))) 0))) +(assert (or (not (<= (+ s (* (- 1) (format 9))) 0)) (not (>= (+ s (* (- 1) (format 9))) 0)) (and (<= (+ s (* (- 1) (format 9))) 0) (>= (+ s (* (- 1) (format 9))) 0)))) +(assert (or (or (and (<= (+ percent (* (- 1) (format 9))) 0) (>= (+ percent (* (- 1) (format 9))) 0)) (and (<= (+ s (* (- 1) (format 9))) 0) (>= (+ s (* (- 1) (format 9))) 0))) (not (and (<= (+ percent (* (- 1) (format 9))) 0) (>= (+ percent (* (- 1) (format 9))) 0))))) +(assert (or (or (and (<= (+ percent (* (- 1) (format 9))) 0) (>= (+ percent (* (- 1) (format 9))) 0)) (and (<= (+ s (* (- 1) (format 9))) 0) (>= (+ s (* (- 1) (format 9))) 0))) (not (and (<= (+ s (* (- 1) (format 9))) 0) (>= (+ s (* (- 1) (format 9))) 0))))) +(assert (or (and (<= (+ percent (* (- 1) (format 9))) 0) (>= (+ percent (* (- 1) (format 9))) 0)) (and (<= (+ s (* (- 1) (format 9))) 0) (>= (+ s (* (- 1) (format 9))) 0)) (not (or (and (<= (+ percent (* (- 1) (format 9))) 0) (>= (+ percent (* (- 1) (format 9))) 0)) (and (<= (+ s (* (- 1) (format 9))) 0) (>= (+ s (* (- 1) (format 9))) 0)))))) +(assert (or (not (and (<= (+ x (* (- 1) (format 9))) 0) (>= (+ x (* (- 1) (format 9))) 0))) (<= (+ x (* (- 1) (format 9))) 0))) +(assert (or (not (and (<= (+ x (* (- 1) (format 9))) 0) (>= (+ x (* (- 1) (format 9))) 0))) (>= (+ x (* (- 1) (format 9))) 0))) +(assert (or (not (<= (+ x (* (- 1) (format 9))) 0)) (not (>= (+ x (* (- 1) (format 9))) 0)) (and (<= (+ x (* (- 1) (format 9))) 0) (>= (+ x (* (- 1) (format 9))) 0)))) +(assert (or (or (or (and (<= (+ percent (* (- 1) (format 9))) 0) (>= (+ percent (* (- 1) (format 9))) 0)) (and (<= (+ s (* (- 1) (format 9))) 0) (>= (+ s (* (- 1) (format 9))) 0))) (and (<= (+ x (* (- 1) (format 9))) 0) (>= (+ x (* (- 1) (format 9))) 0))) (not (or (and (<= (+ percent (* (- 1) (format 9))) 0) (>= (+ percent (* (- 1) (format 9))) 0)) (and (<= (+ s (* (- 1) (format 9))) 0) (>= (+ s (* (- 1) (format 9))) 0)))))) +(assert (or (or (or (and (<= (+ percent (* (- 1) (format 9))) 0) (>= (+ percent (* (- 1) (format 9))) 0)) (and (<= (+ s (* (- 1) (format 9))) 0) (>= (+ s (* (- 1) (format 9))) 0))) (and (<= (+ x (* (- 1) (format 9))) 0) (>= (+ x (* (- 1) (format 9))) 0))) (not (and (<= (+ x (* (- 1) (format 9))) 0) (>= (+ x (* (- 1) (format 9))) 0))))) +(assert (or (or (and (<= (+ percent (* (- 1) (format 9))) 0) (>= (+ percent (* (- 1) (format 9))) 0)) (and (<= (+ s (* (- 1) (format 9))) 0) (>= (+ s (* (- 1) (format 9))) 0))) (and (<= (+ x (* (- 1) (format 9))) 0) (>= (+ x (* (- 1) (format 9))) 0)) (not (or (or (and (<= (+ percent (* (- 1) (format 9))) 0) (>= (+ percent (* (- 1) (format 9))) 0)) (and (<= (+ s (* (- 1) (format 9))) 0) (>= (+ s (* (- 1) (format 9))) 0))) (and (<= (+ x (* (- 1) (format 9))) 0) (>= (+ x (* (- 1) (format 9))) 0)))))) +(assert (or (not (and (<= (format 9) 3) (>= (format 9) 3))) (<= (format 9) 3))) +(assert (or (not (and (<= (format 9) 3) (>= (format 9) 3))) (>= (format 9) 3))) +(assert (or (not (<= (format 9) 3)) (not (>= (format 9) 3)) (and (<= (format 9) 3) (>= (format 9) 3)))) +(assert (or (or (or (or (and (<= (+ percent (* (- 1) (format 9))) 0) (>= (+ percent (* (- 1) (format 9))) 0)) (and (<= (+ s (* (- 1) (format 9))) 0) (>= (+ s (* (- 1) (format 9))) 0))) (and (<= (+ x (* (- 1) (format 9))) 0) (>= (+ x (* (- 1) (format 9))) 0))) (and (<= (format 9) 3) (>= (format 9) 3))) (not (or (or (and (<= (+ percent (* (- 1) (format 9))) 0) (>= (+ percent (* (- 1) (format 9))) 0)) (and (<= (+ s (* (- 1) (format 9))) 0) (>= (+ s (* (- 1) (format 9))) 0))) (and (<= (+ x (* (- 1) (format 9))) 0) (>= (+ x (* (- 1) (format 9))) 0)))))) +(assert (or (or (or (or (and (<= (+ percent (* (- 1) (format 9))) 0) (>= (+ percent (* (- 1) (format 9))) 0)) (and (<= (+ s (* (- 1) (format 9))) 0) (>= (+ s (* (- 1) (format 9))) 0))) (and (<= (+ x (* (- 1) (format 9))) 0) (>= (+ x (* (- 1) (format 9))) 0))) (and (<= (format 9) 3) (>= (format 9) 3))) (not (and (<= (format 9) 3) (>= (format 9) 3))))) +(assert (or (or (or (and (<= (+ percent (* (- 1) (format 9))) 0) (>= (+ percent (* (- 1) (format 9))) 0)) (and (<= (+ s (* (- 1) (format 9))) 0) (>= (+ s (* (- 1) (format 9))) 0))) (and (<= (+ x (* (- 1) (format 9))) 0) (>= (+ x (* (- 1) (format 9))) 0))) (and (<= (format 9) 3) (>= (format 9) 3)) (not (or (or (or (and (<= (+ percent (* (- 1) (format 9))) 0) (>= (+ percent (* (- 1) (format 9))) 0)) (and (<= (+ s (* (- 1) (format 9))) 0) (>= (+ s (* (- 1) (format 9))) 0))) (and (<= (+ x (* (- 1) (format 9))) 0) (>= (+ x (* (- 1) (format 9))) 0))) (and (<= (format 9) 3) (>= (format 9) 3)))))) +(assert (or (not (and (<= (format 9) 4) (>= (format 9) 4))) (<= (format 9) 4))) +(assert (or (not (and (<= (format 9) 4) (>= (format 9) 4))) (>= (format 9) 4))) +(assert (or (not (<= (format 9) 4)) (not (>= (format 9) 4)) (and (<= (format 9) 4) (>= (format 9) 4)))) +(assert (or (or (or (or (or (and (<= (+ percent (* (- 1) (format 9))) 0) (>= (+ percent (* (- 1) (format 9))) 0)) (and (<= (+ s (* (- 1) (format 9))) 0) (>= (+ s (* (- 1) (format 9))) 0))) (and (<= (+ x (* (- 1) (format 9))) 0) (>= (+ x (* (- 1) (format 9))) 0))) (and (<= (format 9) 3) (>= (format 9) 3))) (and (<= (format 9) 4) (>= (format 9) 4))) (not (or (or (or (and (<= (+ percent (* (- 1) (format 9))) 0) (>= (+ percent (* (- 1) (format 9))) 0)) (and (<= (+ s (* (- 1) (format 9))) 0) (>= (+ s (* (- 1) (format 9))) 0))) (and (<= (+ x (* (- 1) (format 9))) 0) (>= (+ x (* (- 1) (format 9))) 0))) (and (<= (format 9) 3) (>= (format 9) 3)))))) +(assert (or (or (or (or (or (and (<= (+ percent (* (- 1) (format 9))) 0) (>= (+ percent (* (- 1) (format 9))) 0)) (and (<= (+ s (* (- 1) (format 9))) 0) (>= (+ s (* (- 1) (format 9))) 0))) (and (<= (+ x (* (- 1) (format 9))) 0) (>= (+ x (* (- 1) (format 9))) 0))) (and (<= (format 9) 3) (>= (format 9) 3))) (and (<= (format 9) 4) (>= (format 9) 4))) (not (and (<= (format 9) 4) (>= (format 9) 4))))) +(assert (or (or (or (or (and (<= (+ percent (* (- 1) (format 9))) 0) (>= (+ percent (* (- 1) (format 9))) 0)) (and (<= (+ s (* (- 1) (format 9))) 0) (>= (+ s (* (- 1) (format 9))) 0))) (and (<= (+ x (* (- 1) (format 9))) 0) (>= (+ x (* (- 1) (format 9))) 0))) (and (<= (format 9) 3) (>= (format 9) 3))) (and (<= (format 9) 4) (>= (format 9) 4)) (not (or (or (or (or (and (<= (+ percent (* (- 1) (format 9))) 0) (>= (+ percent (* (- 1) (format 9))) 0)) (and (<= (+ s (* (- 1) (format 9))) 0) (>= (+ s (* (- 1) (format 9))) 0))) (and (<= (+ x (* (- 1) (format 9))) 0) (>= (+ x (* (- 1) (format 9))) 0))) (and (<= (format 9) 3) (>= (format 9) 3))) (and (<= (format 9) 4) (>= (format 9) 4)))))) +(assert (or (not (and (<= (format 9) 5) (>= (format 9) 5))) (<= (format 9) 5))) +(assert (or (not (and (<= (format 9) 5) (>= (format 9) 5))) (>= (format 9) 5))) +(assert (or (not (<= (format 9) 5)) (not (>= (format 9) 5)) (and (<= (format 9) 5) (>= (format 9) 5)))) +(assert (or (or (or (or (or (or (and (<= (+ percent (* (- 1) (format 9))) 0) (>= (+ percent (* (- 1) (format 9))) 0)) (and (<= (+ s (* (- 1) (format 9))) 0) (>= (+ s (* (- 1) (format 9))) 0))) (and (<= (+ x (* (- 1) (format 9))) 0) (>= (+ x (* (- 1) (format 9))) 0))) (and (<= (format 9) 3) (>= (format 9) 3))) (and (<= (format 9) 4) (>= (format 9) 4))) (and (<= (format 9) 5) (>= (format 9) 5))) (not (or (or (or (or (and (<= (+ percent (* (- 1) (format 9))) 0) (>= (+ percent (* (- 1) (format 9))) 0)) (and (<= (+ s (* (- 1) (format 9))) 0) (>= (+ s (* (- 1) (format 9))) 0))) (and (<= (+ x (* (- 1) (format 9))) 0) (>= (+ x (* (- 1) (format 9))) 0))) (and (<= (format 9) 3) (>= (format 9) 3))) (and (<= (format 9) 4) (>= (format 9) 4)))))) +(assert (or (or (or (or (or (or (and (<= (+ percent (* (- 1) (format 9))) 0) (>= (+ percent (* (- 1) (format 9))) 0)) (and (<= (+ s (* (- 1) (format 9))) 0) (>= (+ s (* (- 1) (format 9))) 0))) (and (<= (+ x (* (- 1) (format 9))) 0) (>= (+ x (* (- 1) (format 9))) 0))) (and (<= (format 9) 3) (>= (format 9) 3))) (and (<= (format 9) 4) (>= (format 9) 4))) (and (<= (format 9) 5) (>= (format 9) 5))) (not (and (<= (format 9) 5) (>= (format 9) 5))))) +(assert (or (or (or (or (or (and (<= (+ percent (* (- 1) (format 9))) 0) (>= (+ percent (* (- 1) (format 9))) 0)) (and (<= (+ s (* (- 1) (format 9))) 0) (>= (+ s (* (- 1) (format 9))) 0))) (and (<= (+ x (* (- 1) (format 9))) 0) (>= (+ x (* (- 1) (format 9))) 0))) (and (<= (format 9) 3) (>= (format 9) 3))) (and (<= (format 9) 4) (>= (format 9) 4))) (and (<= (format 9) 5) (>= (format 9) 5)) (not (or (or (or (or (or (and (<= (+ percent (* (- 1) (format 9))) 0) (>= (+ percent (* (- 1) (format 9))) 0)) (and (<= (+ s (* (- 1) (format 9))) 0) (>= (+ s (* (- 1) (format 9))) 0))) (and (<= (+ x (* (- 1) (format 9))) 0) (>= (+ x (* (- 1) (format 9))) 0))) (and (<= (format 9) 3) (>= (format 9) 3))) (and (<= (format 9) 4) (>= (format 9) 4))) (and (<= (format 9) 5) (>= (format 9) 5)))))) +(assert (or (not (and (<= (format 9) 6) (>= (format 9) 6))) (<= (format 9) 6))) +(assert (or (not (and (<= (format 9) 6) (>= (format 9) 6))) (>= (format 9) 6))) +(assert (or (not (<= (format 9) 6)) (not (>= (format 9) 6)) (and (<= (format 9) 6) (>= (format 9) 6)))) +(assert (or (or (or (or (or (or (or (and (<= (+ percent (* (- 1) (format 9))) 0) (>= (+ percent (* (- 1) (format 9))) 0)) (and (<= (+ s (* (- 1) (format 9))) 0) (>= (+ s (* (- 1) (format 9))) 0))) (and (<= (+ x (* (- 1) (format 9))) 0) (>= (+ x (* (- 1) (format 9))) 0))) (and (<= (format 9) 3) (>= (format 9) 3))) (and (<= (format 9) 4) (>= (format 9) 4))) (and (<= (format 9) 5) (>= (format 9) 5))) (and (<= (format 9) 6) (>= (format 9) 6))) (not (or (or (or (or (or (and (<= (+ percent (* (- 1) (format 9))) 0) (>= (+ percent (* (- 1) (format 9))) 0)) (and (<= (+ s (* (- 1) (format 9))) 0) (>= (+ s (* (- 1) (format 9))) 0))) (and (<= (+ x (* (- 1) (format 9))) 0) (>= (+ x (* (- 1) (format 9))) 0))) (and (<= (format 9) 3) (>= (format 9) 3))) (and (<= (format 9) 4) (>= (format 9) 4))) (and (<= (format 9) 5) (>= (format 9) 5)))))) +(assert (or (or (or (or (or (or (or (and (<= (+ percent (* (- 1) (format 9))) 0) (>= (+ percent (* (- 1) (format 9))) 0)) (and (<= (+ s (* (- 1) (format 9))) 0) (>= (+ s (* (- 1) (format 9))) 0))) (and (<= (+ x (* (- 1) (format 9))) 0) (>= (+ x (* (- 1) (format 9))) 0))) (and (<= (format 9) 3) (>= (format 9) 3))) (and (<= (format 9) 4) (>= (format 9) 4))) (and (<= (format 9) 5) (>= (format 9) 5))) (and (<= (format 9) 6) (>= (format 9) 6))) (not (and (<= (format 9) 6) (>= (format 9) 6))))) +(assert (or (or (or (or (or (or (and (<= (+ percent (* (- 1) (format 9))) 0) (>= (+ percent (* (- 1) (format 9))) 0)) (and (<= (+ s (* (- 1) (format 9))) 0) (>= (+ s (* (- 1) (format 9))) 0))) (and (<= (+ x (* (- 1) (format 9))) 0) (>= (+ x (* (- 1) (format 9))) 0))) (and (<= (format 9) 3) (>= (format 9) 3))) (and (<= (format 9) 4) (>= (format 9) 4))) (and (<= (format 9) 5) (>= (format 9) 5))) (and (<= (format 9) 6) (>= (format 9) 6)) (not (or (or (or (or (or (or (and (<= (+ percent (* (- 1) (format 9))) 0) (>= (+ percent (* (- 1) (format 9))) 0)) (and (<= (+ s (* (- 1) (format 9))) 0) (>= (+ s (* (- 1) (format 9))) 0))) (and (<= (+ x (* (- 1) (format 9))) 0) (>= (+ x (* (- 1) (format 9))) 0))) (and (<= (format 9) 3) (>= (format 9) 3))) (and (<= (format 9) 4) (>= (format 9) 4))) (and (<= (format 9) 5) (>= (format 9) 5))) (and (<= (format 9) 6) (>= (format 9) 6)))))) +(assert (or (not (and (<= (format 9) 255) (>= (format 9) 255))) (<= (format 9) 255))) +(assert (or (not (and (<= (format 9) 255) (>= (format 9) 255))) (>= (format 9) 255))) +(assert (or (not (<= (format 9) 255)) (not (>= (format 9) 255)) (and (<= (format 9) 255) (>= (format 9) 255)))) +(assert (or (or (or (or (or (or (or (and (<= (+ percent (* (- 1) (format 9))) 0) (>= (+ percent (* (- 1) (format 9))) 0)) (and (<= (+ s (* (- 1) (format 9))) 0) (>= (+ s (* (- 1) (format 9))) 0))) (and (<= (+ x (* (- 1) (format 9))) 0) (>= (+ x (* (- 1) (format 9))) 0))) (and (<= (format 9) 3) (>= (format 9) 3))) (and (<= (format 9) 4) (>= (format 9) 4))) (and (<= (format 9) 5) (>= (format 9) 5))) (and (<= (format 9) 6) (>= (format 9) 6))) (and (<= (format 9) 255) (>= (format 9) 255)))) +(assert (or (not (and (<= (+ percent (* (- 1) (format 10))) 0) (>= (+ percent (* (- 1) (format 10))) 0))) (<= (+ percent (* (- 1) (format 10))) 0))) +(assert (or (not (and (<= (+ percent (* (- 1) (format 10))) 0) (>= (+ percent (* (- 1) (format 10))) 0))) (>= (+ percent (* (- 1) (format 10))) 0))) +(assert (or (not (<= (+ percent (* (- 1) (format 10))) 0)) (not (>= (+ percent (* (- 1) (format 10))) 0)) (and (<= (+ percent (* (- 1) (format 10))) 0) (>= (+ percent (* (- 1) (format 10))) 0)))) +(assert (or (not (and (<= (+ s (* (- 1) (format 10))) 0) (>= (+ s (* (- 1) (format 10))) 0))) (<= (+ s (* (- 1) (format 10))) 0))) +(assert (or (not (and (<= (+ s (* (- 1) (format 10))) 0) (>= (+ s (* (- 1) (format 10))) 0))) (>= (+ s (* (- 1) (format 10))) 0))) +(assert (or (not (<= (+ s (* (- 1) (format 10))) 0)) (not (>= (+ s (* (- 1) (format 10))) 0)) (and (<= (+ s (* (- 1) (format 10))) 0) (>= (+ s (* (- 1) (format 10))) 0)))) +(assert (or (or (and (<= (+ percent (* (- 1) (format 10))) 0) (>= (+ percent (* (- 1) (format 10))) 0)) (and (<= (+ s (* (- 1) (format 10))) 0) (>= (+ s (* (- 1) (format 10))) 0))) (not (and (<= (+ percent (* (- 1) (format 10))) 0) (>= (+ percent (* (- 1) (format 10))) 0))))) +(assert (or (or (and (<= (+ percent (* (- 1) (format 10))) 0) (>= (+ percent (* (- 1) (format 10))) 0)) (and (<= (+ s (* (- 1) (format 10))) 0) (>= (+ s (* (- 1) (format 10))) 0))) (not (and (<= (+ s (* (- 1) (format 10))) 0) (>= (+ s (* (- 1) (format 10))) 0))))) +(assert (or (and (<= (+ percent (* (- 1) (format 10))) 0) (>= (+ percent (* (- 1) (format 10))) 0)) (and (<= (+ s (* (- 1) (format 10))) 0) (>= (+ s (* (- 1) (format 10))) 0)) (not (or (and (<= (+ percent (* (- 1) (format 10))) 0) (>= (+ percent (* (- 1) (format 10))) 0)) (and (<= (+ s (* (- 1) (format 10))) 0) (>= (+ s (* (- 1) (format 10))) 0)))))) +(assert (or (not (and (<= (+ x (* (- 1) (format 10))) 0) (>= (+ x (* (- 1) (format 10))) 0))) (<= (+ x (* (- 1) (format 10))) 0))) +(assert (or (not (and (<= (+ x (* (- 1) (format 10))) 0) (>= (+ x (* (- 1) (format 10))) 0))) (>= (+ x (* (- 1) (format 10))) 0))) +(assert (or (not (<= (+ x (* (- 1) (format 10))) 0)) (not (>= (+ x (* (- 1) (format 10))) 0)) (and (<= (+ x (* (- 1) (format 10))) 0) (>= (+ x (* (- 1) (format 10))) 0)))) +(assert (or (or (or (and (<= (+ percent (* (- 1) (format 10))) 0) (>= (+ percent (* (- 1) (format 10))) 0)) (and (<= (+ s (* (- 1) (format 10))) 0) (>= (+ s (* (- 1) (format 10))) 0))) (and (<= (+ x (* (- 1) (format 10))) 0) (>= (+ x (* (- 1) (format 10))) 0))) (not (or (and (<= (+ percent (* (- 1) (format 10))) 0) (>= (+ percent (* (- 1) (format 10))) 0)) (and (<= (+ s (* (- 1) (format 10))) 0) (>= (+ s (* (- 1) (format 10))) 0)))))) +(assert (or (or (or (and (<= (+ percent (* (- 1) (format 10))) 0) (>= (+ percent (* (- 1) (format 10))) 0)) (and (<= (+ s (* (- 1) (format 10))) 0) (>= (+ s (* (- 1) (format 10))) 0))) (and (<= (+ x (* (- 1) (format 10))) 0) (>= (+ x (* (- 1) (format 10))) 0))) (not (and (<= (+ x (* (- 1) (format 10))) 0) (>= (+ x (* (- 1) (format 10))) 0))))) +(assert (or (or (and (<= (+ percent (* (- 1) (format 10))) 0) (>= (+ percent (* (- 1) (format 10))) 0)) (and (<= (+ s (* (- 1) (format 10))) 0) (>= (+ s (* (- 1) (format 10))) 0))) (and (<= (+ x (* (- 1) (format 10))) 0) (>= (+ x (* (- 1) (format 10))) 0)) (not (or (or (and (<= (+ percent (* (- 1) (format 10))) 0) (>= (+ percent (* (- 1) (format 10))) 0)) (and (<= (+ s (* (- 1) (format 10))) 0) (>= (+ s (* (- 1) (format 10))) 0))) (and (<= (+ x (* (- 1) (format 10))) 0) (>= (+ x (* (- 1) (format 10))) 0)))))) +(assert (or (not (and (<= (format 10) 3) (>= (format 10) 3))) (<= (format 10) 3))) +(assert (or (not (and (<= (format 10) 3) (>= (format 10) 3))) (>= (format 10) 3))) +(assert (or (not (<= (format 10) 3)) (not (>= (format 10) 3)) (and (<= (format 10) 3) (>= (format 10) 3)))) +(assert (or (or (or (or (and (<= (+ percent (* (- 1) (format 10))) 0) (>= (+ percent (* (- 1) (format 10))) 0)) (and (<= (+ s (* (- 1) (format 10))) 0) (>= (+ s (* (- 1) (format 10))) 0))) (and (<= (+ x (* (- 1) (format 10))) 0) (>= (+ x (* (- 1) (format 10))) 0))) (and (<= (format 10) 3) (>= (format 10) 3))) (not (or (or (and (<= (+ percent (* (- 1) (format 10))) 0) (>= (+ percent (* (- 1) (format 10))) 0)) (and (<= (+ s (* (- 1) (format 10))) 0) (>= (+ s (* (- 1) (format 10))) 0))) (and (<= (+ x (* (- 1) (format 10))) 0) (>= (+ x (* (- 1) (format 10))) 0)))))) +(assert (or (or (or (or (and (<= (+ percent (* (- 1) (format 10))) 0) (>= (+ percent (* (- 1) (format 10))) 0)) (and (<= (+ s (* (- 1) (format 10))) 0) (>= (+ s (* (- 1) (format 10))) 0))) (and (<= (+ x (* (- 1) (format 10))) 0) (>= (+ x (* (- 1) (format 10))) 0))) (and (<= (format 10) 3) (>= (format 10) 3))) (not (and (<= (format 10) 3) (>= (format 10) 3))))) +(assert (or (or (or (and (<= (+ percent (* (- 1) (format 10))) 0) (>= (+ percent (* (- 1) (format 10))) 0)) (and (<= (+ s (* (- 1) (format 10))) 0) (>= (+ s (* (- 1) (format 10))) 0))) (and (<= (+ x (* (- 1) (format 10))) 0) (>= (+ x (* (- 1) (format 10))) 0))) (and (<= (format 10) 3) (>= (format 10) 3)) (not (or (or (or (and (<= (+ percent (* (- 1) (format 10))) 0) (>= (+ percent (* (- 1) (format 10))) 0)) (and (<= (+ s (* (- 1) (format 10))) 0) (>= (+ s (* (- 1) (format 10))) 0))) (and (<= (+ x (* (- 1) (format 10))) 0) (>= (+ x (* (- 1) (format 10))) 0))) (and (<= (format 10) 3) (>= (format 10) 3)))))) +(assert (or (not (and (<= (format 10) 4) (>= (format 10) 4))) (<= (format 10) 4))) +(assert (or (not (and (<= (format 10) 4) (>= (format 10) 4))) (>= (format 10) 4))) +(assert (or (not (<= (format 10) 4)) (not (>= (format 10) 4)) (and (<= (format 10) 4) (>= (format 10) 4)))) +(assert (or (or (or (or (or (and (<= (+ percent (* (- 1) (format 10))) 0) (>= (+ percent (* (- 1) (format 10))) 0)) (and (<= (+ s (* (- 1) (format 10))) 0) (>= (+ s (* (- 1) (format 10))) 0))) (and (<= (+ x (* (- 1) (format 10))) 0) (>= (+ x (* (- 1) (format 10))) 0))) (and (<= (format 10) 3) (>= (format 10) 3))) (and (<= (format 10) 4) (>= (format 10) 4))) (not (or (or (or (and (<= (+ percent (* (- 1) (format 10))) 0) (>= (+ percent (* (- 1) (format 10))) 0)) (and (<= (+ s (* (- 1) (format 10))) 0) (>= (+ s (* (- 1) (format 10))) 0))) (and (<= (+ x (* (- 1) (format 10))) 0) (>= (+ x (* (- 1) (format 10))) 0))) (and (<= (format 10) 3) (>= (format 10) 3)))))) +(assert (or (or (or (or (or (and (<= (+ percent (* (- 1) (format 10))) 0) (>= (+ percent (* (- 1) (format 10))) 0)) (and (<= (+ s (* (- 1) (format 10))) 0) (>= (+ s (* (- 1) (format 10))) 0))) (and (<= (+ x (* (- 1) (format 10))) 0) (>= (+ x (* (- 1) (format 10))) 0))) (and (<= (format 10) 3) (>= (format 10) 3))) (and (<= (format 10) 4) (>= (format 10) 4))) (not (and (<= (format 10) 4) (>= (format 10) 4))))) +(assert (or (or (or (or (and (<= (+ percent (* (- 1) (format 10))) 0) (>= (+ percent (* (- 1) (format 10))) 0)) (and (<= (+ s (* (- 1) (format 10))) 0) (>= (+ s (* (- 1) (format 10))) 0))) (and (<= (+ x (* (- 1) (format 10))) 0) (>= (+ x (* (- 1) (format 10))) 0))) (and (<= (format 10) 3) (>= (format 10) 3))) (and (<= (format 10) 4) (>= (format 10) 4)) (not (or (or (or (or (and (<= (+ percent (* (- 1) (format 10))) 0) (>= (+ percent (* (- 1) (format 10))) 0)) (and (<= (+ s (* (- 1) (format 10))) 0) (>= (+ s (* (- 1) (format 10))) 0))) (and (<= (+ x (* (- 1) (format 10))) 0) (>= (+ x (* (- 1) (format 10))) 0))) (and (<= (format 10) 3) (>= (format 10) 3))) (and (<= (format 10) 4) (>= (format 10) 4)))))) +(assert (or (not (and (<= (format 10) 5) (>= (format 10) 5))) (<= (format 10) 5))) +(assert (or (not (and (<= (format 10) 5) (>= (format 10) 5))) (>= (format 10) 5))) +(assert (or (not (<= (format 10) 5)) (not (>= (format 10) 5)) (and (<= (format 10) 5) (>= (format 10) 5)))) +(assert (or (or (or (or (or (or (and (<= (+ percent (* (- 1) (format 10))) 0) (>= (+ percent (* (- 1) (format 10))) 0)) (and (<= (+ s (* (- 1) (format 10))) 0) (>= (+ s (* (- 1) (format 10))) 0))) (and (<= (+ x (* (- 1) (format 10))) 0) (>= (+ x (* (- 1) (format 10))) 0))) (and (<= (format 10) 3) (>= (format 10) 3))) (and (<= (format 10) 4) (>= (format 10) 4))) (and (<= (format 10) 5) (>= (format 10) 5))) (not (or (or (or (or (and (<= (+ percent (* (- 1) (format 10))) 0) (>= (+ percent (* (- 1) (format 10))) 0)) (and (<= (+ s (* (- 1) (format 10))) 0) (>= (+ s (* (- 1) (format 10))) 0))) (and (<= (+ x (* (- 1) (format 10))) 0) (>= (+ x (* (- 1) (format 10))) 0))) (and (<= (format 10) 3) (>= (format 10) 3))) (and (<= (format 10) 4) (>= (format 10) 4)))))) +(assert (or (or (or (or (or (or (and (<= (+ percent (* (- 1) (format 10))) 0) (>= (+ percent (* (- 1) (format 10))) 0)) (and (<= (+ s (* (- 1) (format 10))) 0) (>= (+ s (* (- 1) (format 10))) 0))) (and (<= (+ x (* (- 1) (format 10))) 0) (>= (+ x (* (- 1) (format 10))) 0))) (and (<= (format 10) 3) (>= (format 10) 3))) (and (<= (format 10) 4) (>= (format 10) 4))) (and (<= (format 10) 5) (>= (format 10) 5))) (not (and (<= (format 10) 5) (>= (format 10) 5))))) +(assert (or (or (or (or (or (and (<= (+ percent (* (- 1) (format 10))) 0) (>= (+ percent (* (- 1) (format 10))) 0)) (and (<= (+ s (* (- 1) (format 10))) 0) (>= (+ s (* (- 1) (format 10))) 0))) (and (<= (+ x (* (- 1) (format 10))) 0) (>= (+ x (* (- 1) (format 10))) 0))) (and (<= (format 10) 3) (>= (format 10) 3))) (and (<= (format 10) 4) (>= (format 10) 4))) (and (<= (format 10) 5) (>= (format 10) 5)) (not (or (or (or (or (or (and (<= (+ percent (* (- 1) (format 10))) 0) (>= (+ percent (* (- 1) (format 10))) 0)) (and (<= (+ s (* (- 1) (format 10))) 0) (>= (+ s (* (- 1) (format 10))) 0))) (and (<= (+ x (* (- 1) (format 10))) 0) (>= (+ x (* (- 1) (format 10))) 0))) (and (<= (format 10) 3) (>= (format 10) 3))) (and (<= (format 10) 4) (>= (format 10) 4))) (and (<= (format 10) 5) (>= (format 10) 5)))))) +(assert (or (not (and (<= (format 10) 6) (>= (format 10) 6))) (<= (format 10) 6))) +(assert (or (not (and (<= (format 10) 6) (>= (format 10) 6))) (>= (format 10) 6))) +(assert (or (not (<= (format 10) 6)) (not (>= (format 10) 6)) (and (<= (format 10) 6) (>= (format 10) 6)))) +(assert (or (or (or (or (or (or (or (and (<= (+ percent (* (- 1) (format 10))) 0) (>= (+ percent (* (- 1) (format 10))) 0)) (and (<= (+ s (* (- 1) (format 10))) 0) (>= (+ s (* (- 1) (format 10))) 0))) (and (<= (+ x (* (- 1) (format 10))) 0) (>= (+ x (* (- 1) (format 10))) 0))) (and (<= (format 10) 3) (>= (format 10) 3))) (and (<= (format 10) 4) (>= (format 10) 4))) (and (<= (format 10) 5) (>= (format 10) 5))) (and (<= (format 10) 6) (>= (format 10) 6))) (not (or (or (or (or (or (and (<= (+ percent (* (- 1) (format 10))) 0) (>= (+ percent (* (- 1) (format 10))) 0)) (and (<= (+ s (* (- 1) (format 10))) 0) (>= (+ s (* (- 1) (format 10))) 0))) (and (<= (+ x (* (- 1) (format 10))) 0) (>= (+ x (* (- 1) (format 10))) 0))) (and (<= (format 10) 3) (>= (format 10) 3))) (and (<= (format 10) 4) (>= (format 10) 4))) (and (<= (format 10) 5) (>= (format 10) 5)))))) +(assert (or (or (or (or (or (or (or (and (<= (+ percent (* (- 1) (format 10))) 0) (>= (+ percent (* (- 1) (format 10))) 0)) (and (<= (+ s (* (- 1) (format 10))) 0) (>= (+ s (* (- 1) (format 10))) 0))) (and (<= (+ x (* (- 1) (format 10))) 0) (>= (+ x (* (- 1) (format 10))) 0))) (and (<= (format 10) 3) (>= (format 10) 3))) (and (<= (format 10) 4) (>= (format 10) 4))) (and (<= (format 10) 5) (>= (format 10) 5))) (and (<= (format 10) 6) (>= (format 10) 6))) (not (and (<= (format 10) 6) (>= (format 10) 6))))) +(assert (or (or (or (or (or (or (and (<= (+ percent (* (- 1) (format 10))) 0) (>= (+ percent (* (- 1) (format 10))) 0)) (and (<= (+ s (* (- 1) (format 10))) 0) (>= (+ s (* (- 1) (format 10))) 0))) (and (<= (+ x (* (- 1) (format 10))) 0) (>= (+ x (* (- 1) (format 10))) 0))) (and (<= (format 10) 3) (>= (format 10) 3))) (and (<= (format 10) 4) (>= (format 10) 4))) (and (<= (format 10) 5) (>= (format 10) 5))) (and (<= (format 10) 6) (>= (format 10) 6)) (not (or (or (or (or (or (or (and (<= (+ percent (* (- 1) (format 10))) 0) (>= (+ percent (* (- 1) (format 10))) 0)) (and (<= (+ s (* (- 1) (format 10))) 0) (>= (+ s (* (- 1) (format 10))) 0))) (and (<= (+ x (* (- 1) (format 10))) 0) (>= (+ x (* (- 1) (format 10))) 0))) (and (<= (format 10) 3) (>= (format 10) 3))) (and (<= (format 10) 4) (>= (format 10) 4))) (and (<= (format 10) 5) (>= (format 10) 5))) (and (<= (format 10) 6) (>= (format 10) 6)))))) +(assert (or (not (and (<= (format 10) 255) (>= (format 10) 255))) (<= (format 10) 255))) +(assert (or (not (and (<= (format 10) 255) (>= (format 10) 255))) (>= (format 10) 255))) +(assert (or (not (<= (format 10) 255)) (not (>= (format 10) 255)) (and (<= (format 10) 255) (>= (format 10) 255)))) +(assert (or (or (or (or (or (or (or (and (<= (+ percent (* (- 1) (format 10))) 0) (>= (+ percent (* (- 1) (format 10))) 0)) (and (<= (+ s (* (- 1) (format 10))) 0) (>= (+ s (* (- 1) (format 10))) 0))) (and (<= (+ x (* (- 1) (format 10))) 0) (>= (+ x (* (- 1) (format 10))) 0))) (and (<= (format 10) 3) (>= (format 10) 3))) (and (<= (format 10) 4) (>= (format 10) 4))) (and (<= (format 10) 5) (>= (format 10) 5))) (and (<= (format 10) 6) (>= (format 10) 6))) (and (<= (format 10) 255) (>= (format 10) 255)))) +(assert (or (not (and (<= (+ percent (* (- 1) (format 11))) 0) (>= (+ percent (* (- 1) (format 11))) 0))) (<= (+ percent (* (- 1) (format 11))) 0))) +(assert (or (not (and (<= (+ percent (* (- 1) (format 11))) 0) (>= (+ percent (* (- 1) (format 11))) 0))) (>= (+ percent (* (- 1) (format 11))) 0))) +(assert (or (not (<= (+ percent (* (- 1) (format 11))) 0)) (not (>= (+ percent (* (- 1) (format 11))) 0)) (and (<= (+ percent (* (- 1) (format 11))) 0) (>= (+ percent (* (- 1) (format 11))) 0)))) +(assert (or (not (and (<= (+ s (* (- 1) (format 11))) 0) (>= (+ s (* (- 1) (format 11))) 0))) (<= (+ s (* (- 1) (format 11))) 0))) +(assert (or (not (and (<= (+ s (* (- 1) (format 11))) 0) (>= (+ s (* (- 1) (format 11))) 0))) (>= (+ s (* (- 1) (format 11))) 0))) +(assert (or (not (<= (+ s (* (- 1) (format 11))) 0)) (not (>= (+ s (* (- 1) (format 11))) 0)) (and (<= (+ s (* (- 1) (format 11))) 0) (>= (+ s (* (- 1) (format 11))) 0)))) +(assert (or (or (and (<= (+ percent (* (- 1) (format 11))) 0) (>= (+ percent (* (- 1) (format 11))) 0)) (and (<= (+ s (* (- 1) (format 11))) 0) (>= (+ s (* (- 1) (format 11))) 0))) (not (and (<= (+ percent (* (- 1) (format 11))) 0) (>= (+ percent (* (- 1) (format 11))) 0))))) +(assert (or (or (and (<= (+ percent (* (- 1) (format 11))) 0) (>= (+ percent (* (- 1) (format 11))) 0)) (and (<= (+ s (* (- 1) (format 11))) 0) (>= (+ s (* (- 1) (format 11))) 0))) (not (and (<= (+ s (* (- 1) (format 11))) 0) (>= (+ s (* (- 1) (format 11))) 0))))) +(assert (or (and (<= (+ percent (* (- 1) (format 11))) 0) (>= (+ percent (* (- 1) (format 11))) 0)) (and (<= (+ s (* (- 1) (format 11))) 0) (>= (+ s (* (- 1) (format 11))) 0)) (not (or (and (<= (+ percent (* (- 1) (format 11))) 0) (>= (+ percent (* (- 1) (format 11))) 0)) (and (<= (+ s (* (- 1) (format 11))) 0) (>= (+ s (* (- 1) (format 11))) 0)))))) +(assert (or (not (and (<= (+ x (* (- 1) (format 11))) 0) (>= (+ x (* (- 1) (format 11))) 0))) (<= (+ x (* (- 1) (format 11))) 0))) +(assert (or (not (and (<= (+ x (* (- 1) (format 11))) 0) (>= (+ x (* (- 1) (format 11))) 0))) (>= (+ x (* (- 1) (format 11))) 0))) +(assert (or (not (<= (+ x (* (- 1) (format 11))) 0)) (not (>= (+ x (* (- 1) (format 11))) 0)) (and (<= (+ x (* (- 1) (format 11))) 0) (>= (+ x (* (- 1) (format 11))) 0)))) +(assert (or (or (or (and (<= (+ percent (* (- 1) (format 11))) 0) (>= (+ percent (* (- 1) (format 11))) 0)) (and (<= (+ s (* (- 1) (format 11))) 0) (>= (+ s (* (- 1) (format 11))) 0))) (and (<= (+ x (* (- 1) (format 11))) 0) (>= (+ x (* (- 1) (format 11))) 0))) (not (or (and (<= (+ percent (* (- 1) (format 11))) 0) (>= (+ percent (* (- 1) (format 11))) 0)) (and (<= (+ s (* (- 1) (format 11))) 0) (>= (+ s (* (- 1) (format 11))) 0)))))) +(assert (or (or (or (and (<= (+ percent (* (- 1) (format 11))) 0) (>= (+ percent (* (- 1) (format 11))) 0)) (and (<= (+ s (* (- 1) (format 11))) 0) (>= (+ s (* (- 1) (format 11))) 0))) (and (<= (+ x (* (- 1) (format 11))) 0) (>= (+ x (* (- 1) (format 11))) 0))) (not (and (<= (+ x (* (- 1) (format 11))) 0) (>= (+ x (* (- 1) (format 11))) 0))))) +(assert (or (or (and (<= (+ percent (* (- 1) (format 11))) 0) (>= (+ percent (* (- 1) (format 11))) 0)) (and (<= (+ s (* (- 1) (format 11))) 0) (>= (+ s (* (- 1) (format 11))) 0))) (and (<= (+ x (* (- 1) (format 11))) 0) (>= (+ x (* (- 1) (format 11))) 0)) (not (or (or (and (<= (+ percent (* (- 1) (format 11))) 0) (>= (+ percent (* (- 1) (format 11))) 0)) (and (<= (+ s (* (- 1) (format 11))) 0) (>= (+ s (* (- 1) (format 11))) 0))) (and (<= (+ x (* (- 1) (format 11))) 0) (>= (+ x (* (- 1) (format 11))) 0)))))) +(assert (or (not (and (<= (format 11) 3) (>= (format 11) 3))) (<= (format 11) 3))) +(assert (or (not (and (<= (format 11) 3) (>= (format 11) 3))) (>= (format 11) 3))) +(assert (or (not (<= (format 11) 3)) (not (>= (format 11) 3)) (and (<= (format 11) 3) (>= (format 11) 3)))) +(assert (or (or (or (or (and (<= (+ percent (* (- 1) (format 11))) 0) (>= (+ percent (* (- 1) (format 11))) 0)) (and (<= (+ s (* (- 1) (format 11))) 0) (>= (+ s (* (- 1) (format 11))) 0))) (and (<= (+ x (* (- 1) (format 11))) 0) (>= (+ x (* (- 1) (format 11))) 0))) (and (<= (format 11) 3) (>= (format 11) 3))) (not (or (or (and (<= (+ percent (* (- 1) (format 11))) 0) (>= (+ percent (* (- 1) (format 11))) 0)) (and (<= (+ s (* (- 1) (format 11))) 0) (>= (+ s (* (- 1) (format 11))) 0))) (and (<= (+ x (* (- 1) (format 11))) 0) (>= (+ x (* (- 1) (format 11))) 0)))))) +(assert (or (or (or (or (and (<= (+ percent (* (- 1) (format 11))) 0) (>= (+ percent (* (- 1) (format 11))) 0)) (and (<= (+ s (* (- 1) (format 11))) 0) (>= (+ s (* (- 1) (format 11))) 0))) (and (<= (+ x (* (- 1) (format 11))) 0) (>= (+ x (* (- 1) (format 11))) 0))) (and (<= (format 11) 3) (>= (format 11) 3))) (not (and (<= (format 11) 3) (>= (format 11) 3))))) +(assert (or (or (or (and (<= (+ percent (* (- 1) (format 11))) 0) (>= (+ percent (* (- 1) (format 11))) 0)) (and (<= (+ s (* (- 1) (format 11))) 0) (>= (+ s (* (- 1) (format 11))) 0))) (and (<= (+ x (* (- 1) (format 11))) 0) (>= (+ x (* (- 1) (format 11))) 0))) (and (<= (format 11) 3) (>= (format 11) 3)) (not (or (or (or (and (<= (+ percent (* (- 1) (format 11))) 0) (>= (+ percent (* (- 1) (format 11))) 0)) (and (<= (+ s (* (- 1) (format 11))) 0) (>= (+ s (* (- 1) (format 11))) 0))) (and (<= (+ x (* (- 1) (format 11))) 0) (>= (+ x (* (- 1) (format 11))) 0))) (and (<= (format 11) 3) (>= (format 11) 3)))))) +(assert (or (not (and (<= (format 11) 4) (>= (format 11) 4))) (<= (format 11) 4))) +(assert (or (not (and (<= (format 11) 4) (>= (format 11) 4))) (>= (format 11) 4))) +(assert (or (not (<= (format 11) 4)) (not (>= (format 11) 4)) (and (<= (format 11) 4) (>= (format 11) 4)))) +(assert (or (or (or (or (or (and (<= (+ percent (* (- 1) (format 11))) 0) (>= (+ percent (* (- 1) (format 11))) 0)) (and (<= (+ s (* (- 1) (format 11))) 0) (>= (+ s (* (- 1) (format 11))) 0))) (and (<= (+ x (* (- 1) (format 11))) 0) (>= (+ x (* (- 1) (format 11))) 0))) (and (<= (format 11) 3) (>= (format 11) 3))) (and (<= (format 11) 4) (>= (format 11) 4))) (not (or (or (or (and (<= (+ percent (* (- 1) (format 11))) 0) (>= (+ percent (* (- 1) (format 11))) 0)) (and (<= (+ s (* (- 1) (format 11))) 0) (>= (+ s (* (- 1) (format 11))) 0))) (and (<= (+ x (* (- 1) (format 11))) 0) (>= (+ x (* (- 1) (format 11))) 0))) (and (<= (format 11) 3) (>= (format 11) 3)))))) +(assert (or (or (or (or (or (and (<= (+ percent (* (- 1) (format 11))) 0) (>= (+ percent (* (- 1) (format 11))) 0)) (and (<= (+ s (* (- 1) (format 11))) 0) (>= (+ s (* (- 1) (format 11))) 0))) (and (<= (+ x (* (- 1) (format 11))) 0) (>= (+ x (* (- 1) (format 11))) 0))) (and (<= (format 11) 3) (>= (format 11) 3))) (and (<= (format 11) 4) (>= (format 11) 4))) (not (and (<= (format 11) 4) (>= (format 11) 4))))) +(assert (or (or (or (or (and (<= (+ percent (* (- 1) (format 11))) 0) (>= (+ percent (* (- 1) (format 11))) 0)) (and (<= (+ s (* (- 1) (format 11))) 0) (>= (+ s (* (- 1) (format 11))) 0))) (and (<= (+ x (* (- 1) (format 11))) 0) (>= (+ x (* (- 1) (format 11))) 0))) (and (<= (format 11) 3) (>= (format 11) 3))) (and (<= (format 11) 4) (>= (format 11) 4)) (not (or (or (or (or (and (<= (+ percent (* (- 1) (format 11))) 0) (>= (+ percent (* (- 1) (format 11))) 0)) (and (<= (+ s (* (- 1) (format 11))) 0) (>= (+ s (* (- 1) (format 11))) 0))) (and (<= (+ x (* (- 1) (format 11))) 0) (>= (+ x (* (- 1) (format 11))) 0))) (and (<= (format 11) 3) (>= (format 11) 3))) (and (<= (format 11) 4) (>= (format 11) 4)))))) +(assert (or (not (and (<= (format 11) 5) (>= (format 11) 5))) (<= (format 11) 5))) +(assert (or (not (and (<= (format 11) 5) (>= (format 11) 5))) (>= (format 11) 5))) +(assert (or (not (<= (format 11) 5)) (not (>= (format 11) 5)) (and (<= (format 11) 5) (>= (format 11) 5)))) +(assert (or (or (or (or (or (or (and (<= (+ percent (* (- 1) (format 11))) 0) (>= (+ percent (* (- 1) (format 11))) 0)) (and (<= (+ s (* (- 1) (format 11))) 0) (>= (+ s (* (- 1) (format 11))) 0))) (and (<= (+ x (* (- 1) (format 11))) 0) (>= (+ x (* (- 1) (format 11))) 0))) (and (<= (format 11) 3) (>= (format 11) 3))) (and (<= (format 11) 4) (>= (format 11) 4))) (and (<= (format 11) 5) (>= (format 11) 5))) (not (or (or (or (or (and (<= (+ percent (* (- 1) (format 11))) 0) (>= (+ percent (* (- 1) (format 11))) 0)) (and (<= (+ s (* (- 1) (format 11))) 0) (>= (+ s (* (- 1) (format 11))) 0))) (and (<= (+ x (* (- 1) (format 11))) 0) (>= (+ x (* (- 1) (format 11))) 0))) (and (<= (format 11) 3) (>= (format 11) 3))) (and (<= (format 11) 4) (>= (format 11) 4)))))) +(assert (or (or (or (or (or (or (and (<= (+ percent (* (- 1) (format 11))) 0) (>= (+ percent (* (- 1) (format 11))) 0)) (and (<= (+ s (* (- 1) (format 11))) 0) (>= (+ s (* (- 1) (format 11))) 0))) (and (<= (+ x (* (- 1) (format 11))) 0) (>= (+ x (* (- 1) (format 11))) 0))) (and (<= (format 11) 3) (>= (format 11) 3))) (and (<= (format 11) 4) (>= (format 11) 4))) (and (<= (format 11) 5) (>= (format 11) 5))) (not (and (<= (format 11) 5) (>= (format 11) 5))))) +(assert (or (or (or (or (or (and (<= (+ percent (* (- 1) (format 11))) 0) (>= (+ percent (* (- 1) (format 11))) 0)) (and (<= (+ s (* (- 1) (format 11))) 0) (>= (+ s (* (- 1) (format 11))) 0))) (and (<= (+ x (* (- 1) (format 11))) 0) (>= (+ x (* (- 1) (format 11))) 0))) (and (<= (format 11) 3) (>= (format 11) 3))) (and (<= (format 11) 4) (>= (format 11) 4))) (and (<= (format 11) 5) (>= (format 11) 5)) (not (or (or (or (or (or (and (<= (+ percent (* (- 1) (format 11))) 0) (>= (+ percent (* (- 1) (format 11))) 0)) (and (<= (+ s (* (- 1) (format 11))) 0) (>= (+ s (* (- 1) (format 11))) 0))) (and (<= (+ x (* (- 1) (format 11))) 0) (>= (+ x (* (- 1) (format 11))) 0))) (and (<= (format 11) 3) (>= (format 11) 3))) (and (<= (format 11) 4) (>= (format 11) 4))) (and (<= (format 11) 5) (>= (format 11) 5)))))) +(assert (or (not (and (<= (format 11) 6) (>= (format 11) 6))) (<= (format 11) 6))) +(assert (or (not (and (<= (format 11) 6) (>= (format 11) 6))) (>= (format 11) 6))) +(assert (or (not (<= (format 11) 6)) (not (>= (format 11) 6)) (and (<= (format 11) 6) (>= (format 11) 6)))) +(assert (or (or (or (or (or (or (or (and (<= (+ percent (* (- 1) (format 11))) 0) (>= (+ percent (* (- 1) (format 11))) 0)) (and (<= (+ s (* (- 1) (format 11))) 0) (>= (+ s (* (- 1) (format 11))) 0))) (and (<= (+ x (* (- 1) (format 11))) 0) (>= (+ x (* (- 1) (format 11))) 0))) (and (<= (format 11) 3) (>= (format 11) 3))) (and (<= (format 11) 4) (>= (format 11) 4))) (and (<= (format 11) 5) (>= (format 11) 5))) (and (<= (format 11) 6) (>= (format 11) 6))) (not (or (or (or (or (or (and (<= (+ percent (* (- 1) (format 11))) 0) (>= (+ percent (* (- 1) (format 11))) 0)) (and (<= (+ s (* (- 1) (format 11))) 0) (>= (+ s (* (- 1) (format 11))) 0))) (and (<= (+ x (* (- 1) (format 11))) 0) (>= (+ x (* (- 1) (format 11))) 0))) (and (<= (format 11) 3) (>= (format 11) 3))) (and (<= (format 11) 4) (>= (format 11) 4))) (and (<= (format 11) 5) (>= (format 11) 5)))))) +(assert (or (or (or (or (or (or (or (and (<= (+ percent (* (- 1) (format 11))) 0) (>= (+ percent (* (- 1) (format 11))) 0)) (and (<= (+ s (* (- 1) (format 11))) 0) (>= (+ s (* (- 1) (format 11))) 0))) (and (<= (+ x (* (- 1) (format 11))) 0) (>= (+ x (* (- 1) (format 11))) 0))) (and (<= (format 11) 3) (>= (format 11) 3))) (and (<= (format 11) 4) (>= (format 11) 4))) (and (<= (format 11) 5) (>= (format 11) 5))) (and (<= (format 11) 6) (>= (format 11) 6))) (not (and (<= (format 11) 6) (>= (format 11) 6))))) +(assert (or (or (or (or (or (or (and (<= (+ percent (* (- 1) (format 11))) 0) (>= (+ percent (* (- 1) (format 11))) 0)) (and (<= (+ s (* (- 1) (format 11))) 0) (>= (+ s (* (- 1) (format 11))) 0))) (and (<= (+ x (* (- 1) (format 11))) 0) (>= (+ x (* (- 1) (format 11))) 0))) (and (<= (format 11) 3) (>= (format 11) 3))) (and (<= (format 11) 4) (>= (format 11) 4))) (and (<= (format 11) 5) (>= (format 11) 5))) (and (<= (format 11) 6) (>= (format 11) 6)) (not (or (or (or (or (or (or (and (<= (+ percent (* (- 1) (format 11))) 0) (>= (+ percent (* (- 1) (format 11))) 0)) (and (<= (+ s (* (- 1) (format 11))) 0) (>= (+ s (* (- 1) (format 11))) 0))) (and (<= (+ x (* (- 1) (format 11))) 0) (>= (+ x (* (- 1) (format 11))) 0))) (and (<= (format 11) 3) (>= (format 11) 3))) (and (<= (format 11) 4) (>= (format 11) 4))) (and (<= (format 11) 5) (>= (format 11) 5))) (and (<= (format 11) 6) (>= (format 11) 6)))))) +(assert (or (not (and (<= (format 11) 255) (>= (format 11) 255))) (<= (format 11) 255))) +(assert (or (not (and (<= (format 11) 255) (>= (format 11) 255))) (>= (format 11) 255))) +(assert (or (not (<= (format 11) 255)) (not (>= (format 11) 255)) (and (<= (format 11) 255) (>= (format 11) 255)))) +(assert (or (or (or (or (or (or (or (and (<= (+ percent (* (- 1) (format 11))) 0) (>= (+ percent (* (- 1) (format 11))) 0)) (and (<= (+ s (* (- 1) (format 11))) 0) (>= (+ s (* (- 1) (format 11))) 0))) (and (<= (+ x (* (- 1) (format 11))) 0) (>= (+ x (* (- 1) (format 11))) 0))) (and (<= (format 11) 3) (>= (format 11) 3))) (and (<= (format 11) 4) (>= (format 11) 4))) (and (<= (format 11) 5) (>= (format 11) 5))) (and (<= (format 11) 6) (>= (format 11) 6))) (and (<= (format 11) 255) (>= (format 11) 255)))) +(assert (or (not (and (<= (+ percent (* (- 1) (format 12))) 0) (>= (+ percent (* (- 1) (format 12))) 0))) (<= (+ percent (* (- 1) (format 12))) 0))) +(assert (or (not (and (<= (+ percent (* (- 1) (format 12))) 0) (>= (+ percent (* (- 1) (format 12))) 0))) (>= (+ percent (* (- 1) (format 12))) 0))) +(assert (or (not (<= (+ percent (* (- 1) (format 12))) 0)) (not (>= (+ percent (* (- 1) (format 12))) 0)) (and (<= (+ percent (* (- 1) (format 12))) 0) (>= (+ percent (* (- 1) (format 12))) 0)))) +(assert (or (not (and (<= (+ s (* (- 1) (format 12))) 0) (>= (+ s (* (- 1) (format 12))) 0))) (<= (+ s (* (- 1) (format 12))) 0))) +(assert (or (not (and (<= (+ s (* (- 1) (format 12))) 0) (>= (+ s (* (- 1) (format 12))) 0))) (>= (+ s (* (- 1) (format 12))) 0))) +(assert (or (not (<= (+ s (* (- 1) (format 12))) 0)) (not (>= (+ s (* (- 1) (format 12))) 0)) (and (<= (+ s (* (- 1) (format 12))) 0) (>= (+ s (* (- 1) (format 12))) 0)))) +(assert (or (or (and (<= (+ percent (* (- 1) (format 12))) 0) (>= (+ percent (* (- 1) (format 12))) 0)) (and (<= (+ s (* (- 1) (format 12))) 0) (>= (+ s (* (- 1) (format 12))) 0))) (not (and (<= (+ percent (* (- 1) (format 12))) 0) (>= (+ percent (* (- 1) (format 12))) 0))))) +(assert (or (or (and (<= (+ percent (* (- 1) (format 12))) 0) (>= (+ percent (* (- 1) (format 12))) 0)) (and (<= (+ s (* (- 1) (format 12))) 0) (>= (+ s (* (- 1) (format 12))) 0))) (not (and (<= (+ s (* (- 1) (format 12))) 0) (>= (+ s (* (- 1) (format 12))) 0))))) +(assert (or (and (<= (+ percent (* (- 1) (format 12))) 0) (>= (+ percent (* (- 1) (format 12))) 0)) (and (<= (+ s (* (- 1) (format 12))) 0) (>= (+ s (* (- 1) (format 12))) 0)) (not (or (and (<= (+ percent (* (- 1) (format 12))) 0) (>= (+ percent (* (- 1) (format 12))) 0)) (and (<= (+ s (* (- 1) (format 12))) 0) (>= (+ s (* (- 1) (format 12))) 0)))))) +(assert (or (not (and (<= (+ x (* (- 1) (format 12))) 0) (>= (+ x (* (- 1) (format 12))) 0))) (<= (+ x (* (- 1) (format 12))) 0))) +(assert (or (not (and (<= (+ x (* (- 1) (format 12))) 0) (>= (+ x (* (- 1) (format 12))) 0))) (>= (+ x (* (- 1) (format 12))) 0))) +(assert (or (not (<= (+ x (* (- 1) (format 12))) 0)) (not (>= (+ x (* (- 1) (format 12))) 0)) (and (<= (+ x (* (- 1) (format 12))) 0) (>= (+ x (* (- 1) (format 12))) 0)))) +(assert (or (or (or (and (<= (+ percent (* (- 1) (format 12))) 0) (>= (+ percent (* (- 1) (format 12))) 0)) (and (<= (+ s (* (- 1) (format 12))) 0) (>= (+ s (* (- 1) (format 12))) 0))) (and (<= (+ x (* (- 1) (format 12))) 0) (>= (+ x (* (- 1) (format 12))) 0))) (not (or (and (<= (+ percent (* (- 1) (format 12))) 0) (>= (+ percent (* (- 1) (format 12))) 0)) (and (<= (+ s (* (- 1) (format 12))) 0) (>= (+ s (* (- 1) (format 12))) 0)))))) +(assert (or (or (or (and (<= (+ percent (* (- 1) (format 12))) 0) (>= (+ percent (* (- 1) (format 12))) 0)) (and (<= (+ s (* (- 1) (format 12))) 0) (>= (+ s (* (- 1) (format 12))) 0))) (and (<= (+ x (* (- 1) (format 12))) 0) (>= (+ x (* (- 1) (format 12))) 0))) (not (and (<= (+ x (* (- 1) (format 12))) 0) (>= (+ x (* (- 1) (format 12))) 0))))) +(assert (or (or (and (<= (+ percent (* (- 1) (format 12))) 0) (>= (+ percent (* (- 1) (format 12))) 0)) (and (<= (+ s (* (- 1) (format 12))) 0) (>= (+ s (* (- 1) (format 12))) 0))) (and (<= (+ x (* (- 1) (format 12))) 0) (>= (+ x (* (- 1) (format 12))) 0)) (not (or (or (and (<= (+ percent (* (- 1) (format 12))) 0) (>= (+ percent (* (- 1) (format 12))) 0)) (and (<= (+ s (* (- 1) (format 12))) 0) (>= (+ s (* (- 1) (format 12))) 0))) (and (<= (+ x (* (- 1) (format 12))) 0) (>= (+ x (* (- 1) (format 12))) 0)))))) +(assert (or (not (and (<= (format 12) 3) (>= (format 12) 3))) (<= (format 12) 3))) +(assert (or (not (and (<= (format 12) 3) (>= (format 12) 3))) (>= (format 12) 3))) +(assert (or (not (<= (format 12) 3)) (not (>= (format 12) 3)) (and (<= (format 12) 3) (>= (format 12) 3)))) +(assert (or (or (or (or (and (<= (+ percent (* (- 1) (format 12))) 0) (>= (+ percent (* (- 1) (format 12))) 0)) (and (<= (+ s (* (- 1) (format 12))) 0) (>= (+ s (* (- 1) (format 12))) 0))) (and (<= (+ x (* (- 1) (format 12))) 0) (>= (+ x (* (- 1) (format 12))) 0))) (and (<= (format 12) 3) (>= (format 12) 3))) (not (or (or (and (<= (+ percent (* (- 1) (format 12))) 0) (>= (+ percent (* (- 1) (format 12))) 0)) (and (<= (+ s (* (- 1) (format 12))) 0) (>= (+ s (* (- 1) (format 12))) 0))) (and (<= (+ x (* (- 1) (format 12))) 0) (>= (+ x (* (- 1) (format 12))) 0)))))) +(assert (or (or (or (or (and (<= (+ percent (* (- 1) (format 12))) 0) (>= (+ percent (* (- 1) (format 12))) 0)) (and (<= (+ s (* (- 1) (format 12))) 0) (>= (+ s (* (- 1) (format 12))) 0))) (and (<= (+ x (* (- 1) (format 12))) 0) (>= (+ x (* (- 1) (format 12))) 0))) (and (<= (format 12) 3) (>= (format 12) 3))) (not (and (<= (format 12) 3) (>= (format 12) 3))))) +(assert (or (or (or (and (<= (+ percent (* (- 1) (format 12))) 0) (>= (+ percent (* (- 1) (format 12))) 0)) (and (<= (+ s (* (- 1) (format 12))) 0) (>= (+ s (* (- 1) (format 12))) 0))) (and (<= (+ x (* (- 1) (format 12))) 0) (>= (+ x (* (- 1) (format 12))) 0))) (and (<= (format 12) 3) (>= (format 12) 3)) (not (or (or (or (and (<= (+ percent (* (- 1) (format 12))) 0) (>= (+ percent (* (- 1) (format 12))) 0)) (and (<= (+ s (* (- 1) (format 12))) 0) (>= (+ s (* (- 1) (format 12))) 0))) (and (<= (+ x (* (- 1) (format 12))) 0) (>= (+ x (* (- 1) (format 12))) 0))) (and (<= (format 12) 3) (>= (format 12) 3)))))) +(assert (or (not (and (<= (format 12) 4) (>= (format 12) 4))) (<= (format 12) 4))) +(assert (or (not (and (<= (format 12) 4) (>= (format 12) 4))) (>= (format 12) 4))) +(assert (or (not (<= (format 12) 4)) (not (>= (format 12) 4)) (and (<= (format 12) 4) (>= (format 12) 4)))) +(assert (or (or (or (or (or (and (<= (+ percent (* (- 1) (format 12))) 0) (>= (+ percent (* (- 1) (format 12))) 0)) (and (<= (+ s (* (- 1) (format 12))) 0) (>= (+ s (* (- 1) (format 12))) 0))) (and (<= (+ x (* (- 1) (format 12))) 0) (>= (+ x (* (- 1) (format 12))) 0))) (and (<= (format 12) 3) (>= (format 12) 3))) (and (<= (format 12) 4) (>= (format 12) 4))) (not (or (or (or (and (<= (+ percent (* (- 1) (format 12))) 0) (>= (+ percent (* (- 1) (format 12))) 0)) (and (<= (+ s (* (- 1) (format 12))) 0) (>= (+ s (* (- 1) (format 12))) 0))) (and (<= (+ x (* (- 1) (format 12))) 0) (>= (+ x (* (- 1) (format 12))) 0))) (and (<= (format 12) 3) (>= (format 12) 3)))))) +(assert (or (or (or (or (or (and (<= (+ percent (* (- 1) (format 12))) 0) (>= (+ percent (* (- 1) (format 12))) 0)) (and (<= (+ s (* (- 1) (format 12))) 0) (>= (+ s (* (- 1) (format 12))) 0))) (and (<= (+ x (* (- 1) (format 12))) 0) (>= (+ x (* (- 1) (format 12))) 0))) (and (<= (format 12) 3) (>= (format 12) 3))) (and (<= (format 12) 4) (>= (format 12) 4))) (not (and (<= (format 12) 4) (>= (format 12) 4))))) +(assert (or (or (or (or (and (<= (+ percent (* (- 1) (format 12))) 0) (>= (+ percent (* (- 1) (format 12))) 0)) (and (<= (+ s (* (- 1) (format 12))) 0) (>= (+ s (* (- 1) (format 12))) 0))) (and (<= (+ x (* (- 1) (format 12))) 0) (>= (+ x (* (- 1) (format 12))) 0))) (and (<= (format 12) 3) (>= (format 12) 3))) (and (<= (format 12) 4) (>= (format 12) 4)) (not (or (or (or (or (and (<= (+ percent (* (- 1) (format 12))) 0) (>= (+ percent (* (- 1) (format 12))) 0)) (and (<= (+ s (* (- 1) (format 12))) 0) (>= (+ s (* (- 1) (format 12))) 0))) (and (<= (+ x (* (- 1) (format 12))) 0) (>= (+ x (* (- 1) (format 12))) 0))) (and (<= (format 12) 3) (>= (format 12) 3))) (and (<= (format 12) 4) (>= (format 12) 4)))))) +(assert (or (not (and (<= (format 12) 5) (>= (format 12) 5))) (<= (format 12) 5))) +(assert (or (not (and (<= (format 12) 5) (>= (format 12) 5))) (>= (format 12) 5))) +(assert (or (not (<= (format 12) 5)) (not (>= (format 12) 5)) (and (<= (format 12) 5) (>= (format 12) 5)))) +(assert (or (or (or (or (or (or (and (<= (+ percent (* (- 1) (format 12))) 0) (>= (+ percent (* (- 1) (format 12))) 0)) (and (<= (+ s (* (- 1) (format 12))) 0) (>= (+ s (* (- 1) (format 12))) 0))) (and (<= (+ x (* (- 1) (format 12))) 0) (>= (+ x (* (- 1) (format 12))) 0))) (and (<= (format 12) 3) (>= (format 12) 3))) (and (<= (format 12) 4) (>= (format 12) 4))) (and (<= (format 12) 5) (>= (format 12) 5))) (not (or (or (or (or (and (<= (+ percent (* (- 1) (format 12))) 0) (>= (+ percent (* (- 1) (format 12))) 0)) (and (<= (+ s (* (- 1) (format 12))) 0) (>= (+ s (* (- 1) (format 12))) 0))) (and (<= (+ x (* (- 1) (format 12))) 0) (>= (+ x (* (- 1) (format 12))) 0))) (and (<= (format 12) 3) (>= (format 12) 3))) (and (<= (format 12) 4) (>= (format 12) 4)))))) +(assert (or (or (or (or (or (or (and (<= (+ percent (* (- 1) (format 12))) 0) (>= (+ percent (* (- 1) (format 12))) 0)) (and (<= (+ s (* (- 1) (format 12))) 0) (>= (+ s (* (- 1) (format 12))) 0))) (and (<= (+ x (* (- 1) (format 12))) 0) (>= (+ x (* (- 1) (format 12))) 0))) (and (<= (format 12) 3) (>= (format 12) 3))) (and (<= (format 12) 4) (>= (format 12) 4))) (and (<= (format 12) 5) (>= (format 12) 5))) (not (and (<= (format 12) 5) (>= (format 12) 5))))) +(assert (or (or (or (or (or (and (<= (+ percent (* (- 1) (format 12))) 0) (>= (+ percent (* (- 1) (format 12))) 0)) (and (<= (+ s (* (- 1) (format 12))) 0) (>= (+ s (* (- 1) (format 12))) 0))) (and (<= (+ x (* (- 1) (format 12))) 0) (>= (+ x (* (- 1) (format 12))) 0))) (and (<= (format 12) 3) (>= (format 12) 3))) (and (<= (format 12) 4) (>= (format 12) 4))) (and (<= (format 12) 5) (>= (format 12) 5)) (not (or (or (or (or (or (and (<= (+ percent (* (- 1) (format 12))) 0) (>= (+ percent (* (- 1) (format 12))) 0)) (and (<= (+ s (* (- 1) (format 12))) 0) (>= (+ s (* (- 1) (format 12))) 0))) (and (<= (+ x (* (- 1) (format 12))) 0) (>= (+ x (* (- 1) (format 12))) 0))) (and (<= (format 12) 3) (>= (format 12) 3))) (and (<= (format 12) 4) (>= (format 12) 4))) (and (<= (format 12) 5) (>= (format 12) 5)))))) +(assert (or (not (and (<= (format 12) 6) (>= (format 12) 6))) (<= (format 12) 6))) +(assert (or (not (and (<= (format 12) 6) (>= (format 12) 6))) (>= (format 12) 6))) +(assert (or (not (<= (format 12) 6)) (not (>= (format 12) 6)) (and (<= (format 12) 6) (>= (format 12) 6)))) +(assert (or (or (or (or (or (or (or (and (<= (+ percent (* (- 1) (format 12))) 0) (>= (+ percent (* (- 1) (format 12))) 0)) (and (<= (+ s (* (- 1) (format 12))) 0) (>= (+ s (* (- 1) (format 12))) 0))) (and (<= (+ x (* (- 1) (format 12))) 0) (>= (+ x (* (- 1) (format 12))) 0))) (and (<= (format 12) 3) (>= (format 12) 3))) (and (<= (format 12) 4) (>= (format 12) 4))) (and (<= (format 12) 5) (>= (format 12) 5))) (and (<= (format 12) 6) (>= (format 12) 6))) (not (or (or (or (or (or (and (<= (+ percent (* (- 1) (format 12))) 0) (>= (+ percent (* (- 1) (format 12))) 0)) (and (<= (+ s (* (- 1) (format 12))) 0) (>= (+ s (* (- 1) (format 12))) 0))) (and (<= (+ x (* (- 1) (format 12))) 0) (>= (+ x (* (- 1) (format 12))) 0))) (and (<= (format 12) 3) (>= (format 12) 3))) (and (<= (format 12) 4) (>= (format 12) 4))) (and (<= (format 12) 5) (>= (format 12) 5)))))) +(assert (or (or (or (or (or (or (or (and (<= (+ percent (* (- 1) (format 12))) 0) (>= (+ percent (* (- 1) (format 12))) 0)) (and (<= (+ s (* (- 1) (format 12))) 0) (>= (+ s (* (- 1) (format 12))) 0))) (and (<= (+ x (* (- 1) (format 12))) 0) (>= (+ x (* (- 1) (format 12))) 0))) (and (<= (format 12) 3) (>= (format 12) 3))) (and (<= (format 12) 4) (>= (format 12) 4))) (and (<= (format 12) 5) (>= (format 12) 5))) (and (<= (format 12) 6) (>= (format 12) 6))) (not (and (<= (format 12) 6) (>= (format 12) 6))))) +(assert (or (or (or (or (or (or (and (<= (+ percent (* (- 1) (format 12))) 0) (>= (+ percent (* (- 1) (format 12))) 0)) (and (<= (+ s (* (- 1) (format 12))) 0) (>= (+ s (* (- 1) (format 12))) 0))) (and (<= (+ x (* (- 1) (format 12))) 0) (>= (+ x (* (- 1) (format 12))) 0))) (and (<= (format 12) 3) (>= (format 12) 3))) (and (<= (format 12) 4) (>= (format 12) 4))) (and (<= (format 12) 5) (>= (format 12) 5))) (and (<= (format 12) 6) (>= (format 12) 6)) (not (or (or (or (or (or (or (and (<= (+ percent (* (- 1) (format 12))) 0) (>= (+ percent (* (- 1) (format 12))) 0)) (and (<= (+ s (* (- 1) (format 12))) 0) (>= (+ s (* (- 1) (format 12))) 0))) (and (<= (+ x (* (- 1) (format 12))) 0) (>= (+ x (* (- 1) (format 12))) 0))) (and (<= (format 12) 3) (>= (format 12) 3))) (and (<= (format 12) 4) (>= (format 12) 4))) (and (<= (format 12) 5) (>= (format 12) 5))) (and (<= (format 12) 6) (>= (format 12) 6)))))) +(assert (or (not (and (<= (format 12) 255) (>= (format 12) 255))) (<= (format 12) 255))) +(assert (or (not (and (<= (format 12) 255) (>= (format 12) 255))) (>= (format 12) 255))) +(assert (or (not (<= (format 12) 255)) (not (>= (format 12) 255)) (and (<= (format 12) 255) (>= (format 12) 255)))) +(assert (or (or (or (or (or (or (or (and (<= (+ percent (* (- 1) (format 12))) 0) (>= (+ percent (* (- 1) (format 12))) 0)) (and (<= (+ s (* (- 1) (format 12))) 0) (>= (+ s (* (- 1) (format 12))) 0))) (and (<= (+ x (* (- 1) (format 12))) 0) (>= (+ x (* (- 1) (format 12))) 0))) (and (<= (format 12) 3) (>= (format 12) 3))) (and (<= (format 12) 4) (>= (format 12) 4))) (and (<= (format 12) 5) (>= (format 12) 5))) (and (<= (format 12) 6) (>= (format 12) 6))) (and (<= (format 12) 255) (>= (format 12) 255)))) +(assert (or (not (and (and (<= (+ percent (* (- 1) (format 0))) 0) (>= (+ percent (* (- 1) (format 0))) 0)) (and (<= (+ s (* (- 1) (format 1))) 0) (>= (+ s (* (- 1) (format 1))) 0)))) (and (<= (+ percent (* (- 1) (format 0))) 0) (>= (+ percent (* (- 1) (format 0))) 0)))) +(assert (or (not (and (and (<= (+ percent (* (- 1) (format 0))) 0) (>= (+ percent (* (- 1) (format 0))) 0)) (and (<= (+ s (* (- 1) (format 1))) 0) (>= (+ s (* (- 1) (format 1))) 0)))) (and (<= (+ s (* (- 1) (format 1))) 0) (>= (+ s (* (- 1) (format 1))) 0)))) +(assert (or (not (and (<= (+ percent (* (- 1) (format 0))) 0) (>= (+ percent (* (- 1) (format 0))) 0))) (not (and (<= (+ s (* (- 1) (format 1))) 0) (>= (+ s (* (- 1) (format 1))) 0))) (and (and (<= (+ percent (* (- 1) (format 0))) 0) (>= (+ percent (* (- 1) (format 0))) 0)) (and (<= (+ s (* (- 1) (format 1))) 0) (>= (+ s (* (- 1) (format 1))) 0))))) +(assert (or (not (and (<= (s_count 0) 1) (>= (s_count 0) 1))) (<= (s_count 0) 1))) +(assert (or (not (and (<= (s_count 0) 1) (>= (s_count 0) 1))) (>= (s_count 0) 1))) +(assert (or (not (<= (s_count 0) 1)) (not (>= (s_count 0) 1)) (and (<= (s_count 0) 1) (>= (s_count 0) 1)))) +(assert (or (not (and (and (<= (+ percent (* (- 1) (format 0))) 0) (>= (+ percent (* (- 1) (format 0))) 0)) (and (<= (+ s (* (- 1) (format 1))) 0) (>= (+ s (* (- 1) (format 1))) 0)))) (and (<= (s_count 0) 1) (>= (s_count 0) 1)))) +(assert (or (not (and (<= (s_count 0) 0) (>= (s_count 0) 0))) (<= (s_count 0) 0))) +(assert (or (not (and (<= (s_count 0) 0) (>= (s_count 0) 0))) (>= (s_count 0) 0))) +(assert (or (not (<= (s_count 0) 0)) (not (>= (s_count 0) 0)) (and (<= (s_count 0) 0) (>= (s_count 0) 0)))) +(assert (or (and (and (<= (+ percent (* (- 1) (format 0))) 0) (>= (+ percent (* (- 1) (format 0))) 0)) (and (<= (+ s (* (- 1) (format 1))) 0) (>= (+ s (* (- 1) (format 1))) 0))) (and (<= (s_count 0) 0) (>= (s_count 0) 0)))) +(assert (or (not (and (and (<= (+ percent (* (- 1) (format 1))) 0) (>= (+ percent (* (- 1) (format 1))) 0)) (and (<= (+ s (* (- 1) (format 2))) 0) (>= (+ s (* (- 1) (format 2))) 0)))) (and (<= (+ percent (* (- 1) (format 1))) 0) (>= (+ percent (* (- 1) (format 1))) 0)))) +(assert (or (not (and (and (<= (+ percent (* (- 1) (format 1))) 0) (>= (+ percent (* (- 1) (format 1))) 0)) (and (<= (+ s (* (- 1) (format 2))) 0) (>= (+ s (* (- 1) (format 2))) 0)))) (and (<= (+ s (* (- 1) (format 2))) 0) (>= (+ s (* (- 1) (format 2))) 0)))) +(assert (or (not (and (<= (+ percent (* (- 1) (format 1))) 0) (>= (+ percent (* (- 1) (format 1))) 0))) (not (and (<= (+ s (* (- 1) (format 2))) 0) (>= (+ s (* (- 1) (format 2))) 0))) (and (and (<= (+ percent (* (- 1) (format 1))) 0) (>= (+ percent (* (- 1) (format 1))) 0)) (and (<= (+ s (* (- 1) (format 2))) 0) (>= (+ s (* (- 1) (format 2))) 0))))) +(assert (or (not (and (<= (+ (s_count 0) (* (- 1) (s_count 1))) (- 1)) (>= (+ (s_count 0) (* (- 1) (s_count 1))) (- 1)))) (<= (+ (s_count 0) (* (- 1) (s_count 1))) (- 1)))) +(assert (or (not (and (<= (+ (s_count 0) (* (- 1) (s_count 1))) (- 1)) (>= (+ (s_count 0) (* (- 1) (s_count 1))) (- 1)))) (>= (+ (s_count 0) (* (- 1) (s_count 1))) (- 1)))) +(assert (or (not (<= (+ (s_count 0) (* (- 1) (s_count 1))) (- 1))) (not (>= (+ (s_count 0) (* (- 1) (s_count 1))) (- 1))) (and (<= (+ (s_count 0) (* (- 1) (s_count 1))) (- 1)) (>= (+ (s_count 0) (* (- 1) (s_count 1))) (- 1))))) +(assert (or (not (and (and (<= (+ percent (* (- 1) (format 1))) 0) (>= (+ percent (* (- 1) (format 1))) 0)) (and (<= (+ s (* (- 1) (format 2))) 0) (>= (+ s (* (- 1) (format 2))) 0)))) (and (<= (+ (s_count 0) (* (- 1) (s_count 1))) (- 1)) (>= (+ (s_count 0) (* (- 1) (s_count 1))) (- 1))))) +(assert (or (not (and (<= (+ (s_count 0) (* (- 1) (s_count 1))) 0) (>= (+ (s_count 0) (* (- 1) (s_count 1))) 0))) (<= (+ (s_count 0) (* (- 1) (s_count 1))) 0))) +(assert (or (not (and (<= (+ (s_count 0) (* (- 1) (s_count 1))) 0) (>= (+ (s_count 0) (* (- 1) (s_count 1))) 0))) (>= (+ (s_count 0) (* (- 1) (s_count 1))) 0))) +(assert (or (not (<= (+ (s_count 0) (* (- 1) (s_count 1))) 0)) (not (>= (+ (s_count 0) (* (- 1) (s_count 1))) 0)) (and (<= (+ (s_count 0) (* (- 1) (s_count 1))) 0) (>= (+ (s_count 0) (* (- 1) (s_count 1))) 0)))) +(assert (or (and (and (<= (+ percent (* (- 1) (format 1))) 0) (>= (+ percent (* (- 1) (format 1))) 0)) (and (<= (+ s (* (- 1) (format 2))) 0) (>= (+ s (* (- 1) (format 2))) 0))) (and (<= (+ (s_count 0) (* (- 1) (s_count 1))) 0) (>= (+ (s_count 0) (* (- 1) (s_count 1))) 0)))) +(assert (or (not (and (and (<= (+ percent (* (- 1) (format 2))) 0) (>= (+ percent (* (- 1) (format 2))) 0)) (and (<= (+ s (* (- 1) (format 3))) 0) (>= (+ s (* (- 1) (format 3))) 0)))) (and (<= (+ percent (* (- 1) (format 2))) 0) (>= (+ percent (* (- 1) (format 2))) 0)))) +(assert (or (not (and (and (<= (+ percent (* (- 1) (format 2))) 0) (>= (+ percent (* (- 1) (format 2))) 0)) (and (<= (+ s (* (- 1) (format 3))) 0) (>= (+ s (* (- 1) (format 3))) 0)))) (and (<= (+ s (* (- 1) (format 3))) 0) (>= (+ s (* (- 1) (format 3))) 0)))) +(assert (or (not (and (<= (+ percent (* (- 1) (format 2))) 0) (>= (+ percent (* (- 1) (format 2))) 0))) (not (and (<= (+ s (* (- 1) (format 3))) 0) (>= (+ s (* (- 1) (format 3))) 0))) (and (and (<= (+ percent (* (- 1) (format 2))) 0) (>= (+ percent (* (- 1) (format 2))) 0)) (and (<= (+ s (* (- 1) (format 3))) 0) (>= (+ s (* (- 1) (format 3))) 0))))) +(assert (or (not (and (<= (+ (s_count 1) (* (- 1) (s_count 2))) (- 1)) (>= (+ (s_count 1) (* (- 1) (s_count 2))) (- 1)))) (<= (+ (s_count 1) (* (- 1) (s_count 2))) (- 1)))) +(assert (or (not (and (<= (+ (s_count 1) (* (- 1) (s_count 2))) (- 1)) (>= (+ (s_count 1) (* (- 1) (s_count 2))) (- 1)))) (>= (+ (s_count 1) (* (- 1) (s_count 2))) (- 1)))) +(assert (or (not (<= (+ (s_count 1) (* (- 1) (s_count 2))) (- 1))) (not (>= (+ (s_count 1) (* (- 1) (s_count 2))) (- 1))) (and (<= (+ (s_count 1) (* (- 1) (s_count 2))) (- 1)) (>= (+ (s_count 1) (* (- 1) (s_count 2))) (- 1))))) +(assert (or (not (and (and (<= (+ percent (* (- 1) (format 2))) 0) (>= (+ percent (* (- 1) (format 2))) 0)) (and (<= (+ s (* (- 1) (format 3))) 0) (>= (+ s (* (- 1) (format 3))) 0)))) (and (<= (+ (s_count 1) (* (- 1) (s_count 2))) (- 1)) (>= (+ (s_count 1) (* (- 1) (s_count 2))) (- 1))))) +(assert (or (not (and (<= (+ (s_count 1) (* (- 1) (s_count 2))) 0) (>= (+ (s_count 1) (* (- 1) (s_count 2))) 0))) (<= (+ (s_count 1) (* (- 1) (s_count 2))) 0))) +(assert (or (not (and (<= (+ (s_count 1) (* (- 1) (s_count 2))) 0) (>= (+ (s_count 1) (* (- 1) (s_count 2))) 0))) (>= (+ (s_count 1) (* (- 1) (s_count 2))) 0))) +(assert (or (not (<= (+ (s_count 1) (* (- 1) (s_count 2))) 0)) (not (>= (+ (s_count 1) (* (- 1) (s_count 2))) 0)) (and (<= (+ (s_count 1) (* (- 1) (s_count 2))) 0) (>= (+ (s_count 1) (* (- 1) (s_count 2))) 0)))) +(assert (or (and (and (<= (+ percent (* (- 1) (format 2))) 0) (>= (+ percent (* (- 1) (format 2))) 0)) (and (<= (+ s (* (- 1) (format 3))) 0) (>= (+ s (* (- 1) (format 3))) 0))) (and (<= (+ (s_count 1) (* (- 1) (s_count 2))) 0) (>= (+ (s_count 1) (* (- 1) (s_count 2))) 0)))) +(assert (or (not (and (and (<= (+ percent (* (- 1) (format 3))) 0) (>= (+ percent (* (- 1) (format 3))) 0)) (and (<= (+ s (* (- 1) (format 4))) 0) (>= (+ s (* (- 1) (format 4))) 0)))) (and (<= (+ percent (* (- 1) (format 3))) 0) (>= (+ percent (* (- 1) (format 3))) 0)))) +(assert (or (not (and (and (<= (+ percent (* (- 1) (format 3))) 0) (>= (+ percent (* (- 1) (format 3))) 0)) (and (<= (+ s (* (- 1) (format 4))) 0) (>= (+ s (* (- 1) (format 4))) 0)))) (and (<= (+ s (* (- 1) (format 4))) 0) (>= (+ s (* (- 1) (format 4))) 0)))) +(assert (or (not (and (<= (+ percent (* (- 1) (format 3))) 0) (>= (+ percent (* (- 1) (format 3))) 0))) (not (and (<= (+ s (* (- 1) (format 4))) 0) (>= (+ s (* (- 1) (format 4))) 0))) (and (and (<= (+ percent (* (- 1) (format 3))) 0) (>= (+ percent (* (- 1) (format 3))) 0)) (and (<= (+ s (* (- 1) (format 4))) 0) (>= (+ s (* (- 1) (format 4))) 0))))) +(assert (or (not (and (<= (+ (s_count 2) (* (- 1) (s_count 3))) (- 1)) (>= (+ (s_count 2) (* (- 1) (s_count 3))) (- 1)))) (<= (+ (s_count 2) (* (- 1) (s_count 3))) (- 1)))) +(assert (or (not (and (<= (+ (s_count 2) (* (- 1) (s_count 3))) (- 1)) (>= (+ (s_count 2) (* (- 1) (s_count 3))) (- 1)))) (>= (+ (s_count 2) (* (- 1) (s_count 3))) (- 1)))) +(assert (or (not (<= (+ (s_count 2) (* (- 1) (s_count 3))) (- 1))) (not (>= (+ (s_count 2) (* (- 1) (s_count 3))) (- 1))) (and (<= (+ (s_count 2) (* (- 1) (s_count 3))) (- 1)) (>= (+ (s_count 2) (* (- 1) (s_count 3))) (- 1))))) +(assert (or (not (and (and (<= (+ percent (* (- 1) (format 3))) 0) (>= (+ percent (* (- 1) (format 3))) 0)) (and (<= (+ s (* (- 1) (format 4))) 0) (>= (+ s (* (- 1) (format 4))) 0)))) (and (<= (+ (s_count 2) (* (- 1) (s_count 3))) (- 1)) (>= (+ (s_count 2) (* (- 1) (s_count 3))) (- 1))))) +(assert (or (not (and (<= (+ (s_count 2) (* (- 1) (s_count 3))) 0) (>= (+ (s_count 2) (* (- 1) (s_count 3))) 0))) (<= (+ (s_count 2) (* (- 1) (s_count 3))) 0))) +(assert (or (not (and (<= (+ (s_count 2) (* (- 1) (s_count 3))) 0) (>= (+ (s_count 2) (* (- 1) (s_count 3))) 0))) (>= (+ (s_count 2) (* (- 1) (s_count 3))) 0))) +(assert (or (not (<= (+ (s_count 2) (* (- 1) (s_count 3))) 0)) (not (>= (+ (s_count 2) (* (- 1) (s_count 3))) 0)) (and (<= (+ (s_count 2) (* (- 1) (s_count 3))) 0) (>= (+ (s_count 2) (* (- 1) (s_count 3))) 0)))) +(assert (or (and (and (<= (+ percent (* (- 1) (format 3))) 0) (>= (+ percent (* (- 1) (format 3))) 0)) (and (<= (+ s (* (- 1) (format 4))) 0) (>= (+ s (* (- 1) (format 4))) 0))) (and (<= (+ (s_count 2) (* (- 1) (s_count 3))) 0) (>= (+ (s_count 2) (* (- 1) (s_count 3))) 0)))) +(assert (or (not (and (and (<= (+ percent (* (- 1) (format 4))) 0) (>= (+ percent (* (- 1) (format 4))) 0)) (and (<= (+ s (* (- 1) (format 5))) 0) (>= (+ s (* (- 1) (format 5))) 0)))) (and (<= (+ percent (* (- 1) (format 4))) 0) (>= (+ percent (* (- 1) (format 4))) 0)))) +(assert (or (not (and (and (<= (+ percent (* (- 1) (format 4))) 0) (>= (+ percent (* (- 1) (format 4))) 0)) (and (<= (+ s (* (- 1) (format 5))) 0) (>= (+ s (* (- 1) (format 5))) 0)))) (and (<= (+ s (* (- 1) (format 5))) 0) (>= (+ s (* (- 1) (format 5))) 0)))) +(assert (or (not (and (<= (+ percent (* (- 1) (format 4))) 0) (>= (+ percent (* (- 1) (format 4))) 0))) (not (and (<= (+ s (* (- 1) (format 5))) 0) (>= (+ s (* (- 1) (format 5))) 0))) (and (and (<= (+ percent (* (- 1) (format 4))) 0) (>= (+ percent (* (- 1) (format 4))) 0)) (and (<= (+ s (* (- 1) (format 5))) 0) (>= (+ s (* (- 1) (format 5))) 0))))) +(assert (or (not (and (<= (+ (s_count 3) (* (- 1) (s_count 4))) (- 1)) (>= (+ (s_count 3) (* (- 1) (s_count 4))) (- 1)))) (<= (+ (s_count 3) (* (- 1) (s_count 4))) (- 1)))) +(assert (or (not (and (<= (+ (s_count 3) (* (- 1) (s_count 4))) (- 1)) (>= (+ (s_count 3) (* (- 1) (s_count 4))) (- 1)))) (>= (+ (s_count 3) (* (- 1) (s_count 4))) (- 1)))) +(assert (or (not (<= (+ (s_count 3) (* (- 1) (s_count 4))) (- 1))) (not (>= (+ (s_count 3) (* (- 1) (s_count 4))) (- 1))) (and (<= (+ (s_count 3) (* (- 1) (s_count 4))) (- 1)) (>= (+ (s_count 3) (* (- 1) (s_count 4))) (- 1))))) +(assert (or (not (and (and (<= (+ percent (* (- 1) (format 4))) 0) (>= (+ percent (* (- 1) (format 4))) 0)) (and (<= (+ s (* (- 1) (format 5))) 0) (>= (+ s (* (- 1) (format 5))) 0)))) (and (<= (+ (s_count 3) (* (- 1) (s_count 4))) (- 1)) (>= (+ (s_count 3) (* (- 1) (s_count 4))) (- 1))))) +(assert (or (not (and (<= (+ (s_count 3) (* (- 1) (s_count 4))) 0) (>= (+ (s_count 3) (* (- 1) (s_count 4))) 0))) (<= (+ (s_count 3) (* (- 1) (s_count 4))) 0))) +(assert (or (not (and (<= (+ (s_count 3) (* (- 1) (s_count 4))) 0) (>= (+ (s_count 3) (* (- 1) (s_count 4))) 0))) (>= (+ (s_count 3) (* (- 1) (s_count 4))) 0))) +(assert (or (not (<= (+ (s_count 3) (* (- 1) (s_count 4))) 0)) (not (>= (+ (s_count 3) (* (- 1) (s_count 4))) 0)) (and (<= (+ (s_count 3) (* (- 1) (s_count 4))) 0) (>= (+ (s_count 3) (* (- 1) (s_count 4))) 0)))) +(assert (or (and (and (<= (+ percent (* (- 1) (format 4))) 0) (>= (+ percent (* (- 1) (format 4))) 0)) (and (<= (+ s (* (- 1) (format 5))) 0) (>= (+ s (* (- 1) (format 5))) 0))) (and (<= (+ (s_count 3) (* (- 1) (s_count 4))) 0) (>= (+ (s_count 3) (* (- 1) (s_count 4))) 0)))) +(assert (or (not (and (and (<= (+ percent (* (- 1) (format 5))) 0) (>= (+ percent (* (- 1) (format 5))) 0)) (and (<= (+ s (* (- 1) (format 6))) 0) (>= (+ s (* (- 1) (format 6))) 0)))) (and (<= (+ percent (* (- 1) (format 5))) 0) (>= (+ percent (* (- 1) (format 5))) 0)))) +(assert (or (not (and (and (<= (+ percent (* (- 1) (format 5))) 0) (>= (+ percent (* (- 1) (format 5))) 0)) (and (<= (+ s (* (- 1) (format 6))) 0) (>= (+ s (* (- 1) (format 6))) 0)))) (and (<= (+ s (* (- 1) (format 6))) 0) (>= (+ s (* (- 1) (format 6))) 0)))) +(assert (or (not (and (<= (+ percent (* (- 1) (format 5))) 0) (>= (+ percent (* (- 1) (format 5))) 0))) (not (and (<= (+ s (* (- 1) (format 6))) 0) (>= (+ s (* (- 1) (format 6))) 0))) (and (and (<= (+ percent (* (- 1) (format 5))) 0) (>= (+ percent (* (- 1) (format 5))) 0)) (and (<= (+ s (* (- 1) (format 6))) 0) (>= (+ s (* (- 1) (format 6))) 0))))) +(assert (or (not (and (<= (+ (s_count 4) (* (- 1) (s_count 5))) (- 1)) (>= (+ (s_count 4) (* (- 1) (s_count 5))) (- 1)))) (<= (+ (s_count 4) (* (- 1) (s_count 5))) (- 1)))) +(assert (or (not (and (<= (+ (s_count 4) (* (- 1) (s_count 5))) (- 1)) (>= (+ (s_count 4) (* (- 1) (s_count 5))) (- 1)))) (>= (+ (s_count 4) (* (- 1) (s_count 5))) (- 1)))) +(assert (or (not (<= (+ (s_count 4) (* (- 1) (s_count 5))) (- 1))) (not (>= (+ (s_count 4) (* (- 1) (s_count 5))) (- 1))) (and (<= (+ (s_count 4) (* (- 1) (s_count 5))) (- 1)) (>= (+ (s_count 4) (* (- 1) (s_count 5))) (- 1))))) +(assert (or (not (and (and (<= (+ percent (* (- 1) (format 5))) 0) (>= (+ percent (* (- 1) (format 5))) 0)) (and (<= (+ s (* (- 1) (format 6))) 0) (>= (+ s (* (- 1) (format 6))) 0)))) (and (<= (+ (s_count 4) (* (- 1) (s_count 5))) (- 1)) (>= (+ (s_count 4) (* (- 1) (s_count 5))) (- 1))))) +(assert (or (not (and (<= (+ (s_count 4) (* (- 1) (s_count 5))) 0) (>= (+ (s_count 4) (* (- 1) (s_count 5))) 0))) (<= (+ (s_count 4) (* (- 1) (s_count 5))) 0))) +(assert (or (not (and (<= (+ (s_count 4) (* (- 1) (s_count 5))) 0) (>= (+ (s_count 4) (* (- 1) (s_count 5))) 0))) (>= (+ (s_count 4) (* (- 1) (s_count 5))) 0))) +(assert (or (not (<= (+ (s_count 4) (* (- 1) (s_count 5))) 0)) (not (>= (+ (s_count 4) (* (- 1) (s_count 5))) 0)) (and (<= (+ (s_count 4) (* (- 1) (s_count 5))) 0) (>= (+ (s_count 4) (* (- 1) (s_count 5))) 0)))) +(assert (or (and (and (<= (+ percent (* (- 1) (format 5))) 0) (>= (+ percent (* (- 1) (format 5))) 0)) (and (<= (+ s (* (- 1) (format 6))) 0) (>= (+ s (* (- 1) (format 6))) 0))) (and (<= (+ (s_count 4) (* (- 1) (s_count 5))) 0) (>= (+ (s_count 4) (* (- 1) (s_count 5))) 0)))) +(assert (or (not (and (and (<= (+ percent (* (- 1) (format 6))) 0) (>= (+ percent (* (- 1) (format 6))) 0)) (and (<= (+ s (* (- 1) (format 7))) 0) (>= (+ s (* (- 1) (format 7))) 0)))) (and (<= (+ percent (* (- 1) (format 6))) 0) (>= (+ percent (* (- 1) (format 6))) 0)))) +(assert (or (not (and (and (<= (+ percent (* (- 1) (format 6))) 0) (>= (+ percent (* (- 1) (format 6))) 0)) (and (<= (+ s (* (- 1) (format 7))) 0) (>= (+ s (* (- 1) (format 7))) 0)))) (and (<= (+ s (* (- 1) (format 7))) 0) (>= (+ s (* (- 1) (format 7))) 0)))) +(assert (or (not (and (<= (+ percent (* (- 1) (format 6))) 0) (>= (+ percent (* (- 1) (format 6))) 0))) (not (and (<= (+ s (* (- 1) (format 7))) 0) (>= (+ s (* (- 1) (format 7))) 0))) (and (and (<= (+ percent (* (- 1) (format 6))) 0) (>= (+ percent (* (- 1) (format 6))) 0)) (and (<= (+ s (* (- 1) (format 7))) 0) (>= (+ s (* (- 1) (format 7))) 0))))) +(assert (or (not (and (<= (+ (s_count 5) (* (- 1) (s_count 6))) (- 1)) (>= (+ (s_count 5) (* (- 1) (s_count 6))) (- 1)))) (<= (+ (s_count 5) (* (- 1) (s_count 6))) (- 1)))) +(assert (or (not (and (<= (+ (s_count 5) (* (- 1) (s_count 6))) (- 1)) (>= (+ (s_count 5) (* (- 1) (s_count 6))) (- 1)))) (>= (+ (s_count 5) (* (- 1) (s_count 6))) (- 1)))) +(assert (or (not (<= (+ (s_count 5) (* (- 1) (s_count 6))) (- 1))) (not (>= (+ (s_count 5) (* (- 1) (s_count 6))) (- 1))) (and (<= (+ (s_count 5) (* (- 1) (s_count 6))) (- 1)) (>= (+ (s_count 5) (* (- 1) (s_count 6))) (- 1))))) +(assert (or (not (and (and (<= (+ percent (* (- 1) (format 6))) 0) (>= (+ percent (* (- 1) (format 6))) 0)) (and (<= (+ s (* (- 1) (format 7))) 0) (>= (+ s (* (- 1) (format 7))) 0)))) (and (<= (+ (s_count 5) (* (- 1) (s_count 6))) (- 1)) (>= (+ (s_count 5) (* (- 1) (s_count 6))) (- 1))))) +(assert (or (not (and (<= (+ (s_count 5) (* (- 1) (s_count 6))) 0) (>= (+ (s_count 5) (* (- 1) (s_count 6))) 0))) (<= (+ (s_count 5) (* (- 1) (s_count 6))) 0))) +(assert (or (not (and (<= (+ (s_count 5) (* (- 1) (s_count 6))) 0) (>= (+ (s_count 5) (* (- 1) (s_count 6))) 0))) (>= (+ (s_count 5) (* (- 1) (s_count 6))) 0))) +(assert (or (not (<= (+ (s_count 5) (* (- 1) (s_count 6))) 0)) (not (>= (+ (s_count 5) (* (- 1) (s_count 6))) 0)) (and (<= (+ (s_count 5) (* (- 1) (s_count 6))) 0) (>= (+ (s_count 5) (* (- 1) (s_count 6))) 0)))) +(assert (or (and (and (<= (+ percent (* (- 1) (format 6))) 0) (>= (+ percent (* (- 1) (format 6))) 0)) (and (<= (+ s (* (- 1) (format 7))) 0) (>= (+ s (* (- 1) (format 7))) 0))) (and (<= (+ (s_count 5) (* (- 1) (s_count 6))) 0) (>= (+ (s_count 5) (* (- 1) (s_count 6))) 0)))) +(assert (or (not (and (and (<= (+ percent (* (- 1) (format 7))) 0) (>= (+ percent (* (- 1) (format 7))) 0)) (and (<= (+ s (* (- 1) (format 8))) 0) (>= (+ s (* (- 1) (format 8))) 0)))) (and (<= (+ percent (* (- 1) (format 7))) 0) (>= (+ percent (* (- 1) (format 7))) 0)))) +(assert (or (not (and (and (<= (+ percent (* (- 1) (format 7))) 0) (>= (+ percent (* (- 1) (format 7))) 0)) (and (<= (+ s (* (- 1) (format 8))) 0) (>= (+ s (* (- 1) (format 8))) 0)))) (and (<= (+ s (* (- 1) (format 8))) 0) (>= (+ s (* (- 1) (format 8))) 0)))) +(assert (or (not (and (<= (+ percent (* (- 1) (format 7))) 0) (>= (+ percent (* (- 1) (format 7))) 0))) (not (and (<= (+ s (* (- 1) (format 8))) 0) (>= (+ s (* (- 1) (format 8))) 0))) (and (and (<= (+ percent (* (- 1) (format 7))) 0) (>= (+ percent (* (- 1) (format 7))) 0)) (and (<= (+ s (* (- 1) (format 8))) 0) (>= (+ s (* (- 1) (format 8))) 0))))) +(assert (or (not (and (<= (+ (s_count 6) (* (- 1) (s_count 7))) (- 1)) (>= (+ (s_count 6) (* (- 1) (s_count 7))) (- 1)))) (<= (+ (s_count 6) (* (- 1) (s_count 7))) (- 1)))) +(assert (or (not (and (<= (+ (s_count 6) (* (- 1) (s_count 7))) (- 1)) (>= (+ (s_count 6) (* (- 1) (s_count 7))) (- 1)))) (>= (+ (s_count 6) (* (- 1) (s_count 7))) (- 1)))) +(assert (or (not (<= (+ (s_count 6) (* (- 1) (s_count 7))) (- 1))) (not (>= (+ (s_count 6) (* (- 1) (s_count 7))) (- 1))) (and (<= (+ (s_count 6) (* (- 1) (s_count 7))) (- 1)) (>= (+ (s_count 6) (* (- 1) (s_count 7))) (- 1))))) +(assert (or (not (and (and (<= (+ percent (* (- 1) (format 7))) 0) (>= (+ percent (* (- 1) (format 7))) 0)) (and (<= (+ s (* (- 1) (format 8))) 0) (>= (+ s (* (- 1) (format 8))) 0)))) (and (<= (+ (s_count 6) (* (- 1) (s_count 7))) (- 1)) (>= (+ (s_count 6) (* (- 1) (s_count 7))) (- 1))))) +(assert (or (not (and (<= (+ (s_count 6) (* (- 1) (s_count 7))) 0) (>= (+ (s_count 6) (* (- 1) (s_count 7))) 0))) (<= (+ (s_count 6) (* (- 1) (s_count 7))) 0))) +(assert (or (not (and (<= (+ (s_count 6) (* (- 1) (s_count 7))) 0) (>= (+ (s_count 6) (* (- 1) (s_count 7))) 0))) (>= (+ (s_count 6) (* (- 1) (s_count 7))) 0))) +(assert (or (not (<= (+ (s_count 6) (* (- 1) (s_count 7))) 0)) (not (>= (+ (s_count 6) (* (- 1) (s_count 7))) 0)) (and (<= (+ (s_count 6) (* (- 1) (s_count 7))) 0) (>= (+ (s_count 6) (* (- 1) (s_count 7))) 0)))) +(assert (or (and (and (<= (+ percent (* (- 1) (format 7))) 0) (>= (+ percent (* (- 1) (format 7))) 0)) (and (<= (+ s (* (- 1) (format 8))) 0) (>= (+ s (* (- 1) (format 8))) 0))) (and (<= (+ (s_count 6) (* (- 1) (s_count 7))) 0) (>= (+ (s_count 6) (* (- 1) (s_count 7))) 0)))) +(assert (or (not (and (and (<= (+ percent (* (- 1) (format 8))) 0) (>= (+ percent (* (- 1) (format 8))) 0)) (and (<= (+ s (* (- 1) (format 9))) 0) (>= (+ s (* (- 1) (format 9))) 0)))) (and (<= (+ percent (* (- 1) (format 8))) 0) (>= (+ percent (* (- 1) (format 8))) 0)))) +(assert (or (not (and (and (<= (+ percent (* (- 1) (format 8))) 0) (>= (+ percent (* (- 1) (format 8))) 0)) (and (<= (+ s (* (- 1) (format 9))) 0) (>= (+ s (* (- 1) (format 9))) 0)))) (and (<= (+ s (* (- 1) (format 9))) 0) (>= (+ s (* (- 1) (format 9))) 0)))) +(assert (or (not (and (<= (+ percent (* (- 1) (format 8))) 0) (>= (+ percent (* (- 1) (format 8))) 0))) (not (and (<= (+ s (* (- 1) (format 9))) 0) (>= (+ s (* (- 1) (format 9))) 0))) (and (and (<= (+ percent (* (- 1) (format 8))) 0) (>= (+ percent (* (- 1) (format 8))) 0)) (and (<= (+ s (* (- 1) (format 9))) 0) (>= (+ s (* (- 1) (format 9))) 0))))) +(assert (or (not (and (<= (+ (s_count 7) (* (- 1) (s_count 8))) (- 1)) (>= (+ (s_count 7) (* (- 1) (s_count 8))) (- 1)))) (<= (+ (s_count 7) (* (- 1) (s_count 8))) (- 1)))) +(assert (or (not (and (<= (+ (s_count 7) (* (- 1) (s_count 8))) (- 1)) (>= (+ (s_count 7) (* (- 1) (s_count 8))) (- 1)))) (>= (+ (s_count 7) (* (- 1) (s_count 8))) (- 1)))) +(assert (or (not (<= (+ (s_count 7) (* (- 1) (s_count 8))) (- 1))) (not (>= (+ (s_count 7) (* (- 1) (s_count 8))) (- 1))) (and (<= (+ (s_count 7) (* (- 1) (s_count 8))) (- 1)) (>= (+ (s_count 7) (* (- 1) (s_count 8))) (- 1))))) +(assert (or (not (and (and (<= (+ percent (* (- 1) (format 8))) 0) (>= (+ percent (* (- 1) (format 8))) 0)) (and (<= (+ s (* (- 1) (format 9))) 0) (>= (+ s (* (- 1) (format 9))) 0)))) (and (<= (+ (s_count 7) (* (- 1) (s_count 8))) (- 1)) (>= (+ (s_count 7) (* (- 1) (s_count 8))) (- 1))))) +(assert (or (not (and (<= (+ (s_count 7) (* (- 1) (s_count 8))) 0) (>= (+ (s_count 7) (* (- 1) (s_count 8))) 0))) (<= (+ (s_count 7) (* (- 1) (s_count 8))) 0))) +(assert (or (not (and (<= (+ (s_count 7) (* (- 1) (s_count 8))) 0) (>= (+ (s_count 7) (* (- 1) (s_count 8))) 0))) (>= (+ (s_count 7) (* (- 1) (s_count 8))) 0))) +(assert (or (not (<= (+ (s_count 7) (* (- 1) (s_count 8))) 0)) (not (>= (+ (s_count 7) (* (- 1) (s_count 8))) 0)) (and (<= (+ (s_count 7) (* (- 1) (s_count 8))) 0) (>= (+ (s_count 7) (* (- 1) (s_count 8))) 0)))) +(assert (or (and (and (<= (+ percent (* (- 1) (format 8))) 0) (>= (+ percent (* (- 1) (format 8))) 0)) (and (<= (+ s (* (- 1) (format 9))) 0) (>= (+ s (* (- 1) (format 9))) 0))) (and (<= (+ (s_count 7) (* (- 1) (s_count 8))) 0) (>= (+ (s_count 7) (* (- 1) (s_count 8))) 0)))) +(assert (or (not (and (and (<= (+ percent (* (- 1) (format 9))) 0) (>= (+ percent (* (- 1) (format 9))) 0)) (and (<= (+ s (* (- 1) (format 10))) 0) (>= (+ s (* (- 1) (format 10))) 0)))) (and (<= (+ percent (* (- 1) (format 9))) 0) (>= (+ percent (* (- 1) (format 9))) 0)))) +(assert (or (not (and (and (<= (+ percent (* (- 1) (format 9))) 0) (>= (+ percent (* (- 1) (format 9))) 0)) (and (<= (+ s (* (- 1) (format 10))) 0) (>= (+ s (* (- 1) (format 10))) 0)))) (and (<= (+ s (* (- 1) (format 10))) 0) (>= (+ s (* (- 1) (format 10))) 0)))) +(assert (or (not (and (<= (+ percent (* (- 1) (format 9))) 0) (>= (+ percent (* (- 1) (format 9))) 0))) (not (and (<= (+ s (* (- 1) (format 10))) 0) (>= (+ s (* (- 1) (format 10))) 0))) (and (and (<= (+ percent (* (- 1) (format 9))) 0) (>= (+ percent (* (- 1) (format 9))) 0)) (and (<= (+ s (* (- 1) (format 10))) 0) (>= (+ s (* (- 1) (format 10))) 0))))) +(assert (or (not (and (<= (+ (s_count 8) (* (- 1) (s_count 9))) (- 1)) (>= (+ (s_count 8) (* (- 1) (s_count 9))) (- 1)))) (<= (+ (s_count 8) (* (- 1) (s_count 9))) (- 1)))) +(assert (or (not (and (<= (+ (s_count 8) (* (- 1) (s_count 9))) (- 1)) (>= (+ (s_count 8) (* (- 1) (s_count 9))) (- 1)))) (>= (+ (s_count 8) (* (- 1) (s_count 9))) (- 1)))) +(assert (or (not (<= (+ (s_count 8) (* (- 1) (s_count 9))) (- 1))) (not (>= (+ (s_count 8) (* (- 1) (s_count 9))) (- 1))) (and (<= (+ (s_count 8) (* (- 1) (s_count 9))) (- 1)) (>= (+ (s_count 8) (* (- 1) (s_count 9))) (- 1))))) +(assert (or (not (and (and (<= (+ percent (* (- 1) (format 9))) 0) (>= (+ percent (* (- 1) (format 9))) 0)) (and (<= (+ s (* (- 1) (format 10))) 0) (>= (+ s (* (- 1) (format 10))) 0)))) (and (<= (+ (s_count 8) (* (- 1) (s_count 9))) (- 1)) (>= (+ (s_count 8) (* (- 1) (s_count 9))) (- 1))))) +(assert (or (not (and (<= (+ (s_count 8) (* (- 1) (s_count 9))) 0) (>= (+ (s_count 8) (* (- 1) (s_count 9))) 0))) (<= (+ (s_count 8) (* (- 1) (s_count 9))) 0))) +(assert (or (not (and (<= (+ (s_count 8) (* (- 1) (s_count 9))) 0) (>= (+ (s_count 8) (* (- 1) (s_count 9))) 0))) (>= (+ (s_count 8) (* (- 1) (s_count 9))) 0))) +(assert (or (not (<= (+ (s_count 8) (* (- 1) (s_count 9))) 0)) (not (>= (+ (s_count 8) (* (- 1) (s_count 9))) 0)) (and (<= (+ (s_count 8) (* (- 1) (s_count 9))) 0) (>= (+ (s_count 8) (* (- 1) (s_count 9))) 0)))) +(assert (or (and (and (<= (+ percent (* (- 1) (format 9))) 0) (>= (+ percent (* (- 1) (format 9))) 0)) (and (<= (+ s (* (- 1) (format 10))) 0) (>= (+ s (* (- 1) (format 10))) 0))) (and (<= (+ (s_count 8) (* (- 1) (s_count 9))) 0) (>= (+ (s_count 8) (* (- 1) (s_count 9))) 0)))) +(assert (or (not (and (and (<= (+ percent (* (- 1) (format 10))) 0) (>= (+ percent (* (- 1) (format 10))) 0)) (and (<= (+ s (* (- 1) (format 11))) 0) (>= (+ s (* (- 1) (format 11))) 0)))) (and (<= (+ percent (* (- 1) (format 10))) 0) (>= (+ percent (* (- 1) (format 10))) 0)))) +(assert (or (not (and (and (<= (+ percent (* (- 1) (format 10))) 0) (>= (+ percent (* (- 1) (format 10))) 0)) (and (<= (+ s (* (- 1) (format 11))) 0) (>= (+ s (* (- 1) (format 11))) 0)))) (and (<= (+ s (* (- 1) (format 11))) 0) (>= (+ s (* (- 1) (format 11))) 0)))) +(assert (or (not (and (<= (+ percent (* (- 1) (format 10))) 0) (>= (+ percent (* (- 1) (format 10))) 0))) (not (and (<= (+ s (* (- 1) (format 11))) 0) (>= (+ s (* (- 1) (format 11))) 0))) (and (and (<= (+ percent (* (- 1) (format 10))) 0) (>= (+ percent (* (- 1) (format 10))) 0)) (and (<= (+ s (* (- 1) (format 11))) 0) (>= (+ s (* (- 1) (format 11))) 0))))) +(assert (or (not (and (<= (+ (s_count 9) (* (- 1) (s_count 10))) (- 1)) (>= (+ (s_count 9) (* (- 1) (s_count 10))) (- 1)))) (<= (+ (s_count 9) (* (- 1) (s_count 10))) (- 1)))) +(assert (or (not (and (<= (+ (s_count 9) (* (- 1) (s_count 10))) (- 1)) (>= (+ (s_count 9) (* (- 1) (s_count 10))) (- 1)))) (>= (+ (s_count 9) (* (- 1) (s_count 10))) (- 1)))) +(assert (or (not (<= (+ (s_count 9) (* (- 1) (s_count 10))) (- 1))) (not (>= (+ (s_count 9) (* (- 1) (s_count 10))) (- 1))) (and (<= (+ (s_count 9) (* (- 1) (s_count 10))) (- 1)) (>= (+ (s_count 9) (* (- 1) (s_count 10))) (- 1))))) +(assert (or (not (and (and (<= (+ percent (* (- 1) (format 10))) 0) (>= (+ percent (* (- 1) (format 10))) 0)) (and (<= (+ s (* (- 1) (format 11))) 0) (>= (+ s (* (- 1) (format 11))) 0)))) (and (<= (+ (s_count 9) (* (- 1) (s_count 10))) (- 1)) (>= (+ (s_count 9) (* (- 1) (s_count 10))) (- 1))))) +(assert (or (not (and (<= (+ (s_count 9) (* (- 1) (s_count 10))) 0) (>= (+ (s_count 9) (* (- 1) (s_count 10))) 0))) (<= (+ (s_count 9) (* (- 1) (s_count 10))) 0))) +(assert (or (not (and (<= (+ (s_count 9) (* (- 1) (s_count 10))) 0) (>= (+ (s_count 9) (* (- 1) (s_count 10))) 0))) (>= (+ (s_count 9) (* (- 1) (s_count 10))) 0))) +(assert (or (not (<= (+ (s_count 9) (* (- 1) (s_count 10))) 0)) (not (>= (+ (s_count 9) (* (- 1) (s_count 10))) 0)) (and (<= (+ (s_count 9) (* (- 1) (s_count 10))) 0) (>= (+ (s_count 9) (* (- 1) (s_count 10))) 0)))) +(assert (or (and (and (<= (+ percent (* (- 1) (format 10))) 0) (>= (+ percent (* (- 1) (format 10))) 0)) (and (<= (+ s (* (- 1) (format 11))) 0) (>= (+ s (* (- 1) (format 11))) 0))) (and (<= (+ (s_count 9) (* (- 1) (s_count 10))) 0) (>= (+ (s_count 9) (* (- 1) (s_count 10))) 0)))) +(assert (or (not (and (and (<= (+ percent (* (- 1) (format 11))) 0) (>= (+ percent (* (- 1) (format 11))) 0)) (and (<= (+ s (* (- 1) (format 12))) 0) (>= (+ s (* (- 1) (format 12))) 0)))) (and (<= (+ percent (* (- 1) (format 11))) 0) (>= (+ percent (* (- 1) (format 11))) 0)))) +(assert (or (not (and (and (<= (+ percent (* (- 1) (format 11))) 0) (>= (+ percent (* (- 1) (format 11))) 0)) (and (<= (+ s (* (- 1) (format 12))) 0) (>= (+ s (* (- 1) (format 12))) 0)))) (and (<= (+ s (* (- 1) (format 12))) 0) (>= (+ s (* (- 1) (format 12))) 0)))) +(assert (or (not (and (<= (+ percent (* (- 1) (format 11))) 0) (>= (+ percent (* (- 1) (format 11))) 0))) (not (and (<= (+ s (* (- 1) (format 12))) 0) (>= (+ s (* (- 1) (format 12))) 0))) (and (and (<= (+ percent (* (- 1) (format 11))) 0) (>= (+ percent (* (- 1) (format 11))) 0)) (and (<= (+ s (* (- 1) (format 12))) 0) (>= (+ s (* (- 1) (format 12))) 0))))) +(assert (or (not (and (<= (+ (s_count 10) (* (- 1) (s_count 11))) (- 1)) (>= (+ (s_count 10) (* (- 1) (s_count 11))) (- 1)))) (<= (+ (s_count 10) (* (- 1) (s_count 11))) (- 1)))) +(assert (or (not (and (<= (+ (s_count 10) (* (- 1) (s_count 11))) (- 1)) (>= (+ (s_count 10) (* (- 1) (s_count 11))) (- 1)))) (>= (+ (s_count 10) (* (- 1) (s_count 11))) (- 1)))) +(assert (or (not (<= (+ (s_count 10) (* (- 1) (s_count 11))) (- 1))) (not (>= (+ (s_count 10) (* (- 1) (s_count 11))) (- 1))) (and (<= (+ (s_count 10) (* (- 1) (s_count 11))) (- 1)) (>= (+ (s_count 10) (* (- 1) (s_count 11))) (- 1))))) +(assert (or (not (and (and (<= (+ percent (* (- 1) (format 11))) 0) (>= (+ percent (* (- 1) (format 11))) 0)) (and (<= (+ s (* (- 1) (format 12))) 0) (>= (+ s (* (- 1) (format 12))) 0)))) (and (<= (+ (s_count 10) (* (- 1) (s_count 11))) (- 1)) (>= (+ (s_count 10) (* (- 1) (s_count 11))) (- 1))))) +(assert (or (not (and (<= (+ (s_count 10) (* (- 1) (s_count 11))) 0) (>= (+ (s_count 10) (* (- 1) (s_count 11))) 0))) (<= (+ (s_count 10) (* (- 1) (s_count 11))) 0))) +(assert (or (not (and (<= (+ (s_count 10) (* (- 1) (s_count 11))) 0) (>= (+ (s_count 10) (* (- 1) (s_count 11))) 0))) (>= (+ (s_count 10) (* (- 1) (s_count 11))) 0))) +(assert (or (not (<= (+ (s_count 10) (* (- 1) (s_count 11))) 0)) (not (>= (+ (s_count 10) (* (- 1) (s_count 11))) 0)) (and (<= (+ (s_count 10) (* (- 1) (s_count 11))) 0) (>= (+ (s_count 10) (* (- 1) (s_count 11))) 0)))) +(assert (or (and (and (<= (+ percent (* (- 1) (format 11))) 0) (>= (+ percent (* (- 1) (format 11))) 0)) (and (<= (+ s (* (- 1) (format 12))) 0) (>= (+ s (* (- 1) (format 12))) 0))) (and (<= (+ (s_count 10) (* (- 1) (s_count 11))) 0) (>= (+ (s_count 10) (* (- 1) (s_count 11))) 0)))) +(assert (or (not (and (<= (+ s (* (- 1) (format 13))) 0) (>= (+ s (* (- 1) (format 13))) 0))) (<= (+ s (* (- 1) (format 13))) 0))) +(assert (or (not (and (<= (+ s (* (- 1) (format 13))) 0) (>= (+ s (* (- 1) (format 13))) 0))) (>= (+ s (* (- 1) (format 13))) 0))) +(assert (or (not (<= (+ s (* (- 1) (format 13))) 0)) (not (>= (+ s (* (- 1) (format 13))) 0)) (and (<= (+ s (* (- 1) (format 13))) 0) (>= (+ s (* (- 1) (format 13))) 0)))) +(assert (or (not (and (and (<= (+ percent (* (- 1) (format 12))) 0) (>= (+ percent (* (- 1) (format 12))) 0)) (and (<= (+ s (* (- 1) (format 13))) 0) (>= (+ s (* (- 1) (format 13))) 0)))) (and (<= (+ percent (* (- 1) (format 12))) 0) (>= (+ percent (* (- 1) (format 12))) 0)))) +(assert (or (not (and (and (<= (+ percent (* (- 1) (format 12))) 0) (>= (+ percent (* (- 1) (format 12))) 0)) (and (<= (+ s (* (- 1) (format 13))) 0) (>= (+ s (* (- 1) (format 13))) 0)))) (and (<= (+ s (* (- 1) (format 13))) 0) (>= (+ s (* (- 1) (format 13))) 0)))) +(assert (or (not (and (<= (+ percent (* (- 1) (format 12))) 0) (>= (+ percent (* (- 1) (format 12))) 0))) (not (and (<= (+ s (* (- 1) (format 13))) 0) (>= (+ s (* (- 1) (format 13))) 0))) (and (and (<= (+ percent (* (- 1) (format 12))) 0) (>= (+ percent (* (- 1) (format 12))) 0)) (and (<= (+ s (* (- 1) (format 13))) 0) (>= (+ s (* (- 1) (format 13))) 0))))) +(assert (or (not (and (<= (+ (s_count 11) (* (- 1) (s_count 12))) (- 1)) (>= (+ (s_count 11) (* (- 1) (s_count 12))) (- 1)))) (<= (+ (s_count 11) (* (- 1) (s_count 12))) (- 1)))) +(assert (or (not (and (<= (+ (s_count 11) (* (- 1) (s_count 12))) (- 1)) (>= (+ (s_count 11) (* (- 1) (s_count 12))) (- 1)))) (>= (+ (s_count 11) (* (- 1) (s_count 12))) (- 1)))) +(assert (or (not (<= (+ (s_count 11) (* (- 1) (s_count 12))) (- 1))) (not (>= (+ (s_count 11) (* (- 1) (s_count 12))) (- 1))) (and (<= (+ (s_count 11) (* (- 1) (s_count 12))) (- 1)) (>= (+ (s_count 11) (* (- 1) (s_count 12))) (- 1))))) +(assert (or (not (and (and (<= (+ percent (* (- 1) (format 12))) 0) (>= (+ percent (* (- 1) (format 12))) 0)) (and (<= (+ s (* (- 1) (format 13))) 0) (>= (+ s (* (- 1) (format 13))) 0)))) (and (<= (+ (s_count 11) (* (- 1) (s_count 12))) (- 1)) (>= (+ (s_count 11) (* (- 1) (s_count 12))) (- 1))))) +(assert (or (not (and (<= (+ (s_count 11) (* (- 1) (s_count 12))) 0) (>= (+ (s_count 11) (* (- 1) (s_count 12))) 0))) (<= (+ (s_count 11) (* (- 1) (s_count 12))) 0))) +(assert (or (not (and (<= (+ (s_count 11) (* (- 1) (s_count 12))) 0) (>= (+ (s_count 11) (* (- 1) (s_count 12))) 0))) (>= (+ (s_count 11) (* (- 1) (s_count 12))) 0))) +(assert (or (not (<= (+ (s_count 11) (* (- 1) (s_count 12))) 0)) (not (>= (+ (s_count 11) (* (- 1) (s_count 12))) 0)) (and (<= (+ (s_count 11) (* (- 1) (s_count 12))) 0) (>= (+ (s_count 11) (* (- 1) (s_count 12))) 0)))) +(assert (or (and (and (<= (+ percent (* (- 1) (format 12))) 0) (>= (+ percent (* (- 1) (format 12))) 0)) (and (<= (+ s (* (- 1) (format 13))) 0) (>= (+ s (* (- 1) (format 13))) 0))) (and (<= (+ (s_count 11) (* (- 1) (s_count 12))) 0) (>= (+ (s_count 11) (* (- 1) (s_count 12))) 0)))) +(assert (or (not (and (and (<= (+ percent (* (- 1) (format 0))) 0) (>= (+ percent (* (- 1) (format 0))) 0)) (and (<= (+ x (* (- 1) (format 1))) 0) (>= (+ x (* (- 1) (format 1))) 0)))) (and (<= (+ percent (* (- 1) (format 0))) 0) (>= (+ percent (* (- 1) (format 0))) 0)))) +(assert (or (not (and (and (<= (+ percent (* (- 1) (format 0))) 0) (>= (+ percent (* (- 1) (format 0))) 0)) (and (<= (+ x (* (- 1) (format 1))) 0) (>= (+ x (* (- 1) (format 1))) 0)))) (and (<= (+ x (* (- 1) (format 1))) 0) (>= (+ x (* (- 1) (format 1))) 0)))) +(assert (or (not (and (<= (+ percent (* (- 1) (format 0))) 0) (>= (+ percent (* (- 1) (format 0))) 0))) (not (and (<= (+ x (* (- 1) (format 1))) 0) (>= (+ x (* (- 1) (format 1))) 0))) (and (and (<= (+ percent (* (- 1) (format 0))) 0) (>= (+ percent (* (- 1) (format 0))) 0)) (and (<= (+ x (* (- 1) (format 1))) 0) (>= (+ x (* (- 1) (format 1))) 0))))) +(assert (or (not (and (<= (x_count 0) 1) (>= (x_count 0) 1))) (<= (x_count 0) 1))) +(assert (or (not (and (<= (x_count 0) 1) (>= (x_count 0) 1))) (>= (x_count 0) 1))) +(assert (or (not (<= (x_count 0) 1)) (not (>= (x_count 0) 1)) (and (<= (x_count 0) 1) (>= (x_count 0) 1)))) +(assert (or (not (and (and (<= (+ percent (* (- 1) (format 0))) 0) (>= (+ percent (* (- 1) (format 0))) 0)) (and (<= (+ x (* (- 1) (format 1))) 0) (>= (+ x (* (- 1) (format 1))) 0)))) (and (<= (x_count 0) 1) (>= (x_count 0) 1)))) +(assert (or (not (and (<= (x_count 0) 0) (>= (x_count 0) 0))) (<= (x_count 0) 0))) +(assert (or (not (and (<= (x_count 0) 0) (>= (x_count 0) 0))) (>= (x_count 0) 0))) +(assert (or (not (<= (x_count 0) 0)) (not (>= (x_count 0) 0)) (and (<= (x_count 0) 0) (>= (x_count 0) 0)))) +(assert (or (and (and (<= (+ percent (* (- 1) (format 0))) 0) (>= (+ percent (* (- 1) (format 0))) 0)) (and (<= (+ x (* (- 1) (format 1))) 0) (>= (+ x (* (- 1) (format 1))) 0))) (and (<= (x_count 0) 0) (>= (x_count 0) 0)))) +(assert (or (not (and (and (<= (+ percent (* (- 1) (format 1))) 0) (>= (+ percent (* (- 1) (format 1))) 0)) (and (<= (+ x (* (- 1) (format 2))) 0) (>= (+ x (* (- 1) (format 2))) 0)))) (and (<= (+ percent (* (- 1) (format 1))) 0) (>= (+ percent (* (- 1) (format 1))) 0)))) +(assert (or (not (and (and (<= (+ percent (* (- 1) (format 1))) 0) (>= (+ percent (* (- 1) (format 1))) 0)) (and (<= (+ x (* (- 1) (format 2))) 0) (>= (+ x (* (- 1) (format 2))) 0)))) (and (<= (+ x (* (- 1) (format 2))) 0) (>= (+ x (* (- 1) (format 2))) 0)))) +(assert (or (not (and (<= (+ percent (* (- 1) (format 1))) 0) (>= (+ percent (* (- 1) (format 1))) 0))) (not (and (<= (+ x (* (- 1) (format 2))) 0) (>= (+ x (* (- 1) (format 2))) 0))) (and (and (<= (+ percent (* (- 1) (format 1))) 0) (>= (+ percent (* (- 1) (format 1))) 0)) (and (<= (+ x (* (- 1) (format 2))) 0) (>= (+ x (* (- 1) (format 2))) 0))))) +(assert (or (not (and (<= (+ (x_count 0) (* (- 1) (x_count 1))) (- 1)) (>= (+ (x_count 0) (* (- 1) (x_count 1))) (- 1)))) (<= (+ (x_count 0) (* (- 1) (x_count 1))) (- 1)))) +(assert (or (not (and (<= (+ (x_count 0) (* (- 1) (x_count 1))) (- 1)) (>= (+ (x_count 0) (* (- 1) (x_count 1))) (- 1)))) (>= (+ (x_count 0) (* (- 1) (x_count 1))) (- 1)))) +(assert (or (not (<= (+ (x_count 0) (* (- 1) (x_count 1))) (- 1))) (not (>= (+ (x_count 0) (* (- 1) (x_count 1))) (- 1))) (and (<= (+ (x_count 0) (* (- 1) (x_count 1))) (- 1)) (>= (+ (x_count 0) (* (- 1) (x_count 1))) (- 1))))) +(assert (or (not (and (and (<= (+ percent (* (- 1) (format 1))) 0) (>= (+ percent (* (- 1) (format 1))) 0)) (and (<= (+ x (* (- 1) (format 2))) 0) (>= (+ x (* (- 1) (format 2))) 0)))) (and (<= (+ (x_count 0) (* (- 1) (x_count 1))) (- 1)) (>= (+ (x_count 0) (* (- 1) (x_count 1))) (- 1))))) +(assert (or (not (and (<= (+ (x_count 0) (* (- 1) (x_count 1))) 0) (>= (+ (x_count 0) (* (- 1) (x_count 1))) 0))) (<= (+ (x_count 0) (* (- 1) (x_count 1))) 0))) +(assert (or (not (and (<= (+ (x_count 0) (* (- 1) (x_count 1))) 0) (>= (+ (x_count 0) (* (- 1) (x_count 1))) 0))) (>= (+ (x_count 0) (* (- 1) (x_count 1))) 0))) +(assert (or (not (<= (+ (x_count 0) (* (- 1) (x_count 1))) 0)) (not (>= (+ (x_count 0) (* (- 1) (x_count 1))) 0)) (and (<= (+ (x_count 0) (* (- 1) (x_count 1))) 0) (>= (+ (x_count 0) (* (- 1) (x_count 1))) 0)))) +(assert (or (and (and (<= (+ percent (* (- 1) (format 1))) 0) (>= (+ percent (* (- 1) (format 1))) 0)) (and (<= (+ x (* (- 1) (format 2))) 0) (>= (+ x (* (- 1) (format 2))) 0))) (and (<= (+ (x_count 0) (* (- 1) (x_count 1))) 0) (>= (+ (x_count 0) (* (- 1) (x_count 1))) 0)))) +(assert (or (not (and (and (<= (+ percent (* (- 1) (format 2))) 0) (>= (+ percent (* (- 1) (format 2))) 0)) (and (<= (+ x (* (- 1) (format 3))) 0) (>= (+ x (* (- 1) (format 3))) 0)))) (and (<= (+ percent (* (- 1) (format 2))) 0) (>= (+ percent (* (- 1) (format 2))) 0)))) +(assert (or (not (and (and (<= (+ percent (* (- 1) (format 2))) 0) (>= (+ percent (* (- 1) (format 2))) 0)) (and (<= (+ x (* (- 1) (format 3))) 0) (>= (+ x (* (- 1) (format 3))) 0)))) (and (<= (+ x (* (- 1) (format 3))) 0) (>= (+ x (* (- 1) (format 3))) 0)))) +(assert (or (not (and (<= (+ percent (* (- 1) (format 2))) 0) (>= (+ percent (* (- 1) (format 2))) 0))) (not (and (<= (+ x (* (- 1) (format 3))) 0) (>= (+ x (* (- 1) (format 3))) 0))) (and (and (<= (+ percent (* (- 1) (format 2))) 0) (>= (+ percent (* (- 1) (format 2))) 0)) (and (<= (+ x (* (- 1) (format 3))) 0) (>= (+ x (* (- 1) (format 3))) 0))))) +(assert (or (not (and (<= (+ (x_count 1) (* (- 1) (x_count 2))) (- 1)) (>= (+ (x_count 1) (* (- 1) (x_count 2))) (- 1)))) (<= (+ (x_count 1) (* (- 1) (x_count 2))) (- 1)))) +(assert (or (not (and (<= (+ (x_count 1) (* (- 1) (x_count 2))) (- 1)) (>= (+ (x_count 1) (* (- 1) (x_count 2))) (- 1)))) (>= (+ (x_count 1) (* (- 1) (x_count 2))) (- 1)))) +(assert (or (not (<= (+ (x_count 1) (* (- 1) (x_count 2))) (- 1))) (not (>= (+ (x_count 1) (* (- 1) (x_count 2))) (- 1))) (and (<= (+ (x_count 1) (* (- 1) (x_count 2))) (- 1)) (>= (+ (x_count 1) (* (- 1) (x_count 2))) (- 1))))) +(assert (or (not (and (and (<= (+ percent (* (- 1) (format 2))) 0) (>= (+ percent (* (- 1) (format 2))) 0)) (and (<= (+ x (* (- 1) (format 3))) 0) (>= (+ x (* (- 1) (format 3))) 0)))) (and (<= (+ (x_count 1) (* (- 1) (x_count 2))) (- 1)) (>= (+ (x_count 1) (* (- 1) (x_count 2))) (- 1))))) +(assert (or (not (and (<= (+ (x_count 1) (* (- 1) (x_count 2))) 0) (>= (+ (x_count 1) (* (- 1) (x_count 2))) 0))) (<= (+ (x_count 1) (* (- 1) (x_count 2))) 0))) +(assert (or (not (and (<= (+ (x_count 1) (* (- 1) (x_count 2))) 0) (>= (+ (x_count 1) (* (- 1) (x_count 2))) 0))) (>= (+ (x_count 1) (* (- 1) (x_count 2))) 0))) +(assert (or (not (<= (+ (x_count 1) (* (- 1) (x_count 2))) 0)) (not (>= (+ (x_count 1) (* (- 1) (x_count 2))) 0)) (and (<= (+ (x_count 1) (* (- 1) (x_count 2))) 0) (>= (+ (x_count 1) (* (- 1) (x_count 2))) 0)))) +(assert (or (and (and (<= (+ percent (* (- 1) (format 2))) 0) (>= (+ percent (* (- 1) (format 2))) 0)) (and (<= (+ x (* (- 1) (format 3))) 0) (>= (+ x (* (- 1) (format 3))) 0))) (and (<= (+ (x_count 1) (* (- 1) (x_count 2))) 0) (>= (+ (x_count 1) (* (- 1) (x_count 2))) 0)))) +(assert (or (not (and (and (<= (+ percent (* (- 1) (format 3))) 0) (>= (+ percent (* (- 1) (format 3))) 0)) (and (<= (+ x (* (- 1) (format 4))) 0) (>= (+ x (* (- 1) (format 4))) 0)))) (and (<= (+ percent (* (- 1) (format 3))) 0) (>= (+ percent (* (- 1) (format 3))) 0)))) +(assert (or (not (and (and (<= (+ percent (* (- 1) (format 3))) 0) (>= (+ percent (* (- 1) (format 3))) 0)) (and (<= (+ x (* (- 1) (format 4))) 0) (>= (+ x (* (- 1) (format 4))) 0)))) (and (<= (+ x (* (- 1) (format 4))) 0) (>= (+ x (* (- 1) (format 4))) 0)))) +(assert (or (not (and (<= (+ percent (* (- 1) (format 3))) 0) (>= (+ percent (* (- 1) (format 3))) 0))) (not (and (<= (+ x (* (- 1) (format 4))) 0) (>= (+ x (* (- 1) (format 4))) 0))) (and (and (<= (+ percent (* (- 1) (format 3))) 0) (>= (+ percent (* (- 1) (format 3))) 0)) (and (<= (+ x (* (- 1) (format 4))) 0) (>= (+ x (* (- 1) (format 4))) 0))))) +(assert (or (not (and (<= (+ (x_count 2) (* (- 1) (x_count 3))) (- 1)) (>= (+ (x_count 2) (* (- 1) (x_count 3))) (- 1)))) (<= (+ (x_count 2) (* (- 1) (x_count 3))) (- 1)))) +(assert (or (not (and (<= (+ (x_count 2) (* (- 1) (x_count 3))) (- 1)) (>= (+ (x_count 2) (* (- 1) (x_count 3))) (- 1)))) (>= (+ (x_count 2) (* (- 1) (x_count 3))) (- 1)))) +(assert (or (not (<= (+ (x_count 2) (* (- 1) (x_count 3))) (- 1))) (not (>= (+ (x_count 2) (* (- 1) (x_count 3))) (- 1))) (and (<= (+ (x_count 2) (* (- 1) (x_count 3))) (- 1)) (>= (+ (x_count 2) (* (- 1) (x_count 3))) (- 1))))) +(assert (or (not (and (and (<= (+ percent (* (- 1) (format 3))) 0) (>= (+ percent (* (- 1) (format 3))) 0)) (and (<= (+ x (* (- 1) (format 4))) 0) (>= (+ x (* (- 1) (format 4))) 0)))) (and (<= (+ (x_count 2) (* (- 1) (x_count 3))) (- 1)) (>= (+ (x_count 2) (* (- 1) (x_count 3))) (- 1))))) +(assert (or (not (and (<= (+ (x_count 2) (* (- 1) (x_count 3))) 0) (>= (+ (x_count 2) (* (- 1) (x_count 3))) 0))) (<= (+ (x_count 2) (* (- 1) (x_count 3))) 0))) +(assert (or (not (and (<= (+ (x_count 2) (* (- 1) (x_count 3))) 0) (>= (+ (x_count 2) (* (- 1) (x_count 3))) 0))) (>= (+ (x_count 2) (* (- 1) (x_count 3))) 0))) +(assert (or (not (<= (+ (x_count 2) (* (- 1) (x_count 3))) 0)) (not (>= (+ (x_count 2) (* (- 1) (x_count 3))) 0)) (and (<= (+ (x_count 2) (* (- 1) (x_count 3))) 0) (>= (+ (x_count 2) (* (- 1) (x_count 3))) 0)))) +(assert (or (and (and (<= (+ percent (* (- 1) (format 3))) 0) (>= (+ percent (* (- 1) (format 3))) 0)) (and (<= (+ x (* (- 1) (format 4))) 0) (>= (+ x (* (- 1) (format 4))) 0))) (and (<= (+ (x_count 2) (* (- 1) (x_count 3))) 0) (>= (+ (x_count 2) (* (- 1) (x_count 3))) 0)))) +(assert (or (not (and (and (<= (+ percent (* (- 1) (format 4))) 0) (>= (+ percent (* (- 1) (format 4))) 0)) (and (<= (+ x (* (- 1) (format 5))) 0) (>= (+ x (* (- 1) (format 5))) 0)))) (and (<= (+ percent (* (- 1) (format 4))) 0) (>= (+ percent (* (- 1) (format 4))) 0)))) +(assert (or (not (and (and (<= (+ percent (* (- 1) (format 4))) 0) (>= (+ percent (* (- 1) (format 4))) 0)) (and (<= (+ x (* (- 1) (format 5))) 0) (>= (+ x (* (- 1) (format 5))) 0)))) (and (<= (+ x (* (- 1) (format 5))) 0) (>= (+ x (* (- 1) (format 5))) 0)))) +(assert (or (not (and (<= (+ percent (* (- 1) (format 4))) 0) (>= (+ percent (* (- 1) (format 4))) 0))) (not (and (<= (+ x (* (- 1) (format 5))) 0) (>= (+ x (* (- 1) (format 5))) 0))) (and (and (<= (+ percent (* (- 1) (format 4))) 0) (>= (+ percent (* (- 1) (format 4))) 0)) (and (<= (+ x (* (- 1) (format 5))) 0) (>= (+ x (* (- 1) (format 5))) 0))))) +(assert (or (not (and (<= (+ (x_count 3) (* (- 1) (x_count 4))) (- 1)) (>= (+ (x_count 3) (* (- 1) (x_count 4))) (- 1)))) (<= (+ (x_count 3) (* (- 1) (x_count 4))) (- 1)))) +(assert (or (not (and (<= (+ (x_count 3) (* (- 1) (x_count 4))) (- 1)) (>= (+ (x_count 3) (* (- 1) (x_count 4))) (- 1)))) (>= (+ (x_count 3) (* (- 1) (x_count 4))) (- 1)))) +(assert (or (not (<= (+ (x_count 3) (* (- 1) (x_count 4))) (- 1))) (not (>= (+ (x_count 3) (* (- 1) (x_count 4))) (- 1))) (and (<= (+ (x_count 3) (* (- 1) (x_count 4))) (- 1)) (>= (+ (x_count 3) (* (- 1) (x_count 4))) (- 1))))) +(assert (or (not (and (and (<= (+ percent (* (- 1) (format 4))) 0) (>= (+ percent (* (- 1) (format 4))) 0)) (and (<= (+ x (* (- 1) (format 5))) 0) (>= (+ x (* (- 1) (format 5))) 0)))) (and (<= (+ (x_count 3) (* (- 1) (x_count 4))) (- 1)) (>= (+ (x_count 3) (* (- 1) (x_count 4))) (- 1))))) +(assert (or (not (and (<= (+ (x_count 3) (* (- 1) (x_count 4))) 0) (>= (+ (x_count 3) (* (- 1) (x_count 4))) 0))) (<= (+ (x_count 3) (* (- 1) (x_count 4))) 0))) +(assert (or (not (and (<= (+ (x_count 3) (* (- 1) (x_count 4))) 0) (>= (+ (x_count 3) (* (- 1) (x_count 4))) 0))) (>= (+ (x_count 3) (* (- 1) (x_count 4))) 0))) +(assert (or (not (<= (+ (x_count 3) (* (- 1) (x_count 4))) 0)) (not (>= (+ (x_count 3) (* (- 1) (x_count 4))) 0)) (and (<= (+ (x_count 3) (* (- 1) (x_count 4))) 0) (>= (+ (x_count 3) (* (- 1) (x_count 4))) 0)))) +(assert (or (and (and (<= (+ percent (* (- 1) (format 4))) 0) (>= (+ percent (* (- 1) (format 4))) 0)) (and (<= (+ x (* (- 1) (format 5))) 0) (>= (+ x (* (- 1) (format 5))) 0))) (and (<= (+ (x_count 3) (* (- 1) (x_count 4))) 0) (>= (+ (x_count 3) (* (- 1) (x_count 4))) 0)))) +(assert (or (not (and (and (<= (+ percent (* (- 1) (format 5))) 0) (>= (+ percent (* (- 1) (format 5))) 0)) (and (<= (+ x (* (- 1) (format 6))) 0) (>= (+ x (* (- 1) (format 6))) 0)))) (and (<= (+ percent (* (- 1) (format 5))) 0) (>= (+ percent (* (- 1) (format 5))) 0)))) +(assert (or (not (and (and (<= (+ percent (* (- 1) (format 5))) 0) (>= (+ percent (* (- 1) (format 5))) 0)) (and (<= (+ x (* (- 1) (format 6))) 0) (>= (+ x (* (- 1) (format 6))) 0)))) (and (<= (+ x (* (- 1) (format 6))) 0) (>= (+ x (* (- 1) (format 6))) 0)))) +(assert (or (not (and (<= (+ percent (* (- 1) (format 5))) 0) (>= (+ percent (* (- 1) (format 5))) 0))) (not (and (<= (+ x (* (- 1) (format 6))) 0) (>= (+ x (* (- 1) (format 6))) 0))) (and (and (<= (+ percent (* (- 1) (format 5))) 0) (>= (+ percent (* (- 1) (format 5))) 0)) (and (<= (+ x (* (- 1) (format 6))) 0) (>= (+ x (* (- 1) (format 6))) 0))))) +(assert (or (not (and (<= (+ (x_count 4) (* (- 1) (x_count 5))) (- 1)) (>= (+ (x_count 4) (* (- 1) (x_count 5))) (- 1)))) (<= (+ (x_count 4) (* (- 1) (x_count 5))) (- 1)))) +(assert (or (not (and (<= (+ (x_count 4) (* (- 1) (x_count 5))) (- 1)) (>= (+ (x_count 4) (* (- 1) (x_count 5))) (- 1)))) (>= (+ (x_count 4) (* (- 1) (x_count 5))) (- 1)))) +(assert (or (not (<= (+ (x_count 4) (* (- 1) (x_count 5))) (- 1))) (not (>= (+ (x_count 4) (* (- 1) (x_count 5))) (- 1))) (and (<= (+ (x_count 4) (* (- 1) (x_count 5))) (- 1)) (>= (+ (x_count 4) (* (- 1) (x_count 5))) (- 1))))) +(assert (or (not (and (and (<= (+ percent (* (- 1) (format 5))) 0) (>= (+ percent (* (- 1) (format 5))) 0)) (and (<= (+ x (* (- 1) (format 6))) 0) (>= (+ x (* (- 1) (format 6))) 0)))) (and (<= (+ (x_count 4) (* (- 1) (x_count 5))) (- 1)) (>= (+ (x_count 4) (* (- 1) (x_count 5))) (- 1))))) +(assert (or (not (and (<= (+ (x_count 4) (* (- 1) (x_count 5))) 0) (>= (+ (x_count 4) (* (- 1) (x_count 5))) 0))) (<= (+ (x_count 4) (* (- 1) (x_count 5))) 0))) +(assert (or (not (and (<= (+ (x_count 4) (* (- 1) (x_count 5))) 0) (>= (+ (x_count 4) (* (- 1) (x_count 5))) 0))) (>= (+ (x_count 4) (* (- 1) (x_count 5))) 0))) +(assert (or (not (<= (+ (x_count 4) (* (- 1) (x_count 5))) 0)) (not (>= (+ (x_count 4) (* (- 1) (x_count 5))) 0)) (and (<= (+ (x_count 4) (* (- 1) (x_count 5))) 0) (>= (+ (x_count 4) (* (- 1) (x_count 5))) 0)))) +(assert (or (and (and (<= (+ percent (* (- 1) (format 5))) 0) (>= (+ percent (* (- 1) (format 5))) 0)) (and (<= (+ x (* (- 1) (format 6))) 0) (>= (+ x (* (- 1) (format 6))) 0))) (and (<= (+ (x_count 4) (* (- 1) (x_count 5))) 0) (>= (+ (x_count 4) (* (- 1) (x_count 5))) 0)))) +(assert (or (not (and (and (<= (+ percent (* (- 1) (format 6))) 0) (>= (+ percent (* (- 1) (format 6))) 0)) (and (<= (+ x (* (- 1) (format 7))) 0) (>= (+ x (* (- 1) (format 7))) 0)))) (and (<= (+ percent (* (- 1) (format 6))) 0) (>= (+ percent (* (- 1) (format 6))) 0)))) +(assert (or (not (and (and (<= (+ percent (* (- 1) (format 6))) 0) (>= (+ percent (* (- 1) (format 6))) 0)) (and (<= (+ x (* (- 1) (format 7))) 0) (>= (+ x (* (- 1) (format 7))) 0)))) (and (<= (+ x (* (- 1) (format 7))) 0) (>= (+ x (* (- 1) (format 7))) 0)))) +(assert (or (not (and (<= (+ percent (* (- 1) (format 6))) 0) (>= (+ percent (* (- 1) (format 6))) 0))) (not (and (<= (+ x (* (- 1) (format 7))) 0) (>= (+ x (* (- 1) (format 7))) 0))) (and (and (<= (+ percent (* (- 1) (format 6))) 0) (>= (+ percent (* (- 1) (format 6))) 0)) (and (<= (+ x (* (- 1) (format 7))) 0) (>= (+ x (* (- 1) (format 7))) 0))))) +(assert (or (not (and (<= (+ (x_count 5) (* (- 1) (x_count 6))) (- 1)) (>= (+ (x_count 5) (* (- 1) (x_count 6))) (- 1)))) (<= (+ (x_count 5) (* (- 1) (x_count 6))) (- 1)))) +(assert (or (not (and (<= (+ (x_count 5) (* (- 1) (x_count 6))) (- 1)) (>= (+ (x_count 5) (* (- 1) (x_count 6))) (- 1)))) (>= (+ (x_count 5) (* (- 1) (x_count 6))) (- 1)))) +(assert (or (not (<= (+ (x_count 5) (* (- 1) (x_count 6))) (- 1))) (not (>= (+ (x_count 5) (* (- 1) (x_count 6))) (- 1))) (and (<= (+ (x_count 5) (* (- 1) (x_count 6))) (- 1)) (>= (+ (x_count 5) (* (- 1) (x_count 6))) (- 1))))) +(assert (or (not (and (and (<= (+ percent (* (- 1) (format 6))) 0) (>= (+ percent (* (- 1) (format 6))) 0)) (and (<= (+ x (* (- 1) (format 7))) 0) (>= (+ x (* (- 1) (format 7))) 0)))) (and (<= (+ (x_count 5) (* (- 1) (x_count 6))) (- 1)) (>= (+ (x_count 5) (* (- 1) (x_count 6))) (- 1))))) +(assert (or (not (and (<= (+ (x_count 5) (* (- 1) (x_count 6))) 0) (>= (+ (x_count 5) (* (- 1) (x_count 6))) 0))) (<= (+ (x_count 5) (* (- 1) (x_count 6))) 0))) +(assert (or (not (and (<= (+ (x_count 5) (* (- 1) (x_count 6))) 0) (>= (+ (x_count 5) (* (- 1) (x_count 6))) 0))) (>= (+ (x_count 5) (* (- 1) (x_count 6))) 0))) +(assert (or (not (<= (+ (x_count 5) (* (- 1) (x_count 6))) 0)) (not (>= (+ (x_count 5) (* (- 1) (x_count 6))) 0)) (and (<= (+ (x_count 5) (* (- 1) (x_count 6))) 0) (>= (+ (x_count 5) (* (- 1) (x_count 6))) 0)))) +(assert (or (and (and (<= (+ percent (* (- 1) (format 6))) 0) (>= (+ percent (* (- 1) (format 6))) 0)) (and (<= (+ x (* (- 1) (format 7))) 0) (>= (+ x (* (- 1) (format 7))) 0))) (and (<= (+ (x_count 5) (* (- 1) (x_count 6))) 0) (>= (+ (x_count 5) (* (- 1) (x_count 6))) 0)))) +(assert (or (not (and (and (<= (+ percent (* (- 1) (format 7))) 0) (>= (+ percent (* (- 1) (format 7))) 0)) (and (<= (+ x (* (- 1) (format 8))) 0) (>= (+ x (* (- 1) (format 8))) 0)))) (and (<= (+ percent (* (- 1) (format 7))) 0) (>= (+ percent (* (- 1) (format 7))) 0)))) + + + +(assert (or (not (= (+ fmt0 (* (- 1) fmt1)) (- 11))) (not (>= (+ (x_count 8) (* (- 1) (x_count 9))) 0)) (not (<= (+ (x_count 8) (* (- 1) (x_count 9))) 0)) (not (>= (+ (x_count 7) (* (- 1) (x_count 8))) 0)) (not (<= (+ (x_count 7) (* (- 1) (x_count 8))) 0)) (not (>= (+ (x_count 6) (* (- 1) (x_count 7))) 0)) (not (<= (+ (x_count 6) (* (- 1) (x_count 7))) 0)) (not (>= (+ (x_count 4) (* (- 1) (x_count 5))) 0)) (not (<= (+ (x_count 4) (* (- 1) (x_count 5))) 0)) (not (>= (+ (x_count 2) (* (- 1) (x_count 3))) 0)) (not (<= (+ (x_count 2) (* (- 1) (x_count 3))) 0)) (not (>= (+ (x_count 5) (* (- 1) (x_count 6))) 0)) (not (<= (+ (x_count 5) (* (- 1) (x_count 6))) 0)) (not (>= (+ (x_count 3) (* (- 1) (x_count 4))) 0)) (not (<= (+ (x_count 3) (* (- 1) (x_count 4))) 0)) (not (>= (+ (x_count 1) (* (- 1) (x_count 2))) 0)) (not (<= (+ (x_count 1) (* (- 1) (x_count 2))) 0)) (not (>= (+ (x_count 0) (* (- 1) (x_count 1))) (- 1))) (not (<= (x_count 0) 1)) (not (>= (+ arg0 (* (- 1) arg1) (* 4 (s_count (+ (- 2) (* (- 1) fmt0) fmt1))) (* 4 (x_count (+ (- 2) (* (- 1) fmt0) fmt1)))) 0)) (not (>= distance 18)) (not (>= (+ arg1 (* (- 1) fmt0)) 0)) (not (<= (+ arg0 (* (- 1) fmt0) distance) 0)) (not (<= (s_count 0) 1)) (not (>= (+ (s_count 0) (* (- 1) (s_count 1))) 0)) (not (>= (+ (s_count 3) (* (- 1) (s_count 4))) 0)) (not (>= (+ (s_count 4) (* (- 1) (s_count 5))) 0)) (not (>= (+ (s_count 2) (* (- 1) (s_count 3))) 0)) (not (<= (+ (s_count 2) (* (- 1) (s_count 3))) 0)) (not (>= (+ (s_count 1) (* (- 1) (s_count 2))) 0)) (not (<= (+ (s_count 1) (* (- 1) (s_count 2))) 0)) (not (>= (+ (s_count 6) (* (- 1) (s_count 7))) (- 1))) (not (>= (+ (s_count 5) (* (- 1) (s_count 6))) 0)) (not (= (+ fmt0 (* (- 1) fmt1)) (- 11))) (not (>= (+ (s_count 8) (* (- 1) (s_count 9))) 0)) (not (<= (+ (s_count 8) (* (- 1) (s_count 9))) 0)) (not (>= (+ (s_count 7) (* (- 1) (s_count 8))) 0)) (not (<= (+ (s_count 7) (* (- 1) (s_count 8))) 0)))) +(assert (or (not (= (+ (x_count (+ (- 2) (* (- 1) fmt0) fmt1)) (* (- 1) (x_count 1))) 0)) (not (>= (+ (x_count 0) (* (- 1) (x_count 1))) (- 1))) (not (<= (x_count 0) 1)) (not (>= (+ arg0 (* (- 1) arg1) (* 4 (s_count (+ (- 2) (* (- 1) fmt0) fmt1))) (* 4 (x_count (+ (- 2) (* (- 1) fmt0) fmt1)))) 0)) (not (>= distance 18)) (not (>= (+ arg1 (* (- 1) fmt0)) 0)) (not (<= (+ arg0 (* (- 1) fmt0) distance) 0)) (not (<= (s_count 0) 1)) (not (>= (+ (s_count 0) (* (- 1) (s_count 1))) 0)) (not (>= (+ (s_count 3) (* (- 1) (s_count 4))) 0)) (not (>= (+ (s_count 4) (* (- 1) (s_count 5))) 0)) (not (= (+ (s_count 1) (* (- 1) (s_count 3))) 0)) (not (>= (+ (s_count 6) (* (- 1) (s_count 7))) (- 1))) (not (>= (+ (s_count 5) (* (- 1) (s_count 6))) 0)) (not (= (+ (s_count (+ (- 2) (* (- 1) fmt0) fmt1)) (* (- 1) (s_count 7))) 0)))) +(assert (or (not (<= (+ x (* (- 1) (format 10))) 0)) (not (>= x 120)) (not (<= (format 10) 6)))) +(assert (or (= (+ (s_count 1) (* (- 1) (s_count 3))) 0) (not (>= (+ (s_count 2) (* (- 1) (s_count 3))) 0)) (not (<= (+ (s_count 2) (* (- 1) (s_count 3))) 0)) (not (>= (+ (s_count 1) (* (- 1) (s_count 2))) 0)) (not (<= (+ (s_count 1) (* (- 1) (s_count 2))) 0)))) +(assert (or (not (= (+ fmt0 (* (- 1) fmt1)) (- 11))) (not (>= (+ (s_count 8) (* (- 1) (s_count 9))) 0)) (not (<= (+ (s_count 8) (* (- 1) (s_count 9))) 0)) (not (>= (+ (s_count 7) (* (- 1) (s_count 8))) 0)) (not (<= (+ (s_count 7) (* (- 1) (s_count 8))) 0)) (= (+ (s_count (+ (- 2) (* (- 1) fmt0) fmt1)) (* (- 1) (s_count 7))) 0))) +(assert (or (not (= (+ (s_count (+ (- 2) (* (- 1) fmt0) fmt1)) (* (- 1) (s_count 7))) 0)) (not (>= (+ (s_count 5) (* (- 1) (s_count 6))) (- 1))) (not (>= (+ (s_count 6) (* (- 1) (s_count 7))) (- 1))) (not (>= (+ (s_count 2) (* (- 1) (s_count 3))) 0)) (not (<= (+ (s_count 2) (* (- 1) (s_count 3))) 0)) (not (>= (+ (s_count 1) (* (- 1) (s_count 2))) 0)) (not (<= (+ (s_count 1) (* (- 1) (s_count 2))) 0)) (not (>= (+ (s_count 4) (* (- 1) (s_count 5))) (- 1))) (<= (+ (s_count 3) (* (- 1) (s_count 4))) (- 1)) (not (>= (+ (s_count 0) (* (- 1) (s_count 1))) 0)) (not (<= (s_count 0) 0)) (not (<= (+ arg0 (* (- 1) fmt0) distance) 0)) (not (>= (+ arg1 (* (- 1) fmt0)) 2)) (not (>= distance 18)) (not (>= (+ arg0 (* (- 1) arg1) (* 4 (s_count (+ (- 2) (* (- 1) fmt0) fmt1))) (* 4 (x_count (+ (- 2) (* (- 1) fmt0) fmt1)))) 0)) (not (<= (x_count 0) 0)) (not (>= (+ (x_count 0) (* (- 1) (x_count 1))) 0)) (not (>= (+ (x_count 1) (* (- 1) (x_count 2))) 0)) (not (>= (+ (x_count 3) (* (- 1) (x_count 4))) 0)) (not (>= (+ (x_count 5) (* (- 1) (x_count 6))) 0)) (not (>= (+ (x_count 6) (* (- 1) (x_count 7))) 0)) (not (>= (+ (x_count 4) (* (- 1) (x_count 5))) 0)) (not (>= (+ (x_count 2) (* (- 1) (x_count 3))) 0)) (not (>= (+ (x_count 7) (* (- 1) (x_count 8))) 0)) (not (>= (+ (x_count 8) (* (- 1) (x_count 9))) (- 1))) (not (= (+ fmt0 (* (- 1) fmt1)) (- 11))))) +(assert (or (not (= (+ (s_count (+ (- 2) (* (- 1) fmt0) fmt1)) (* (- 1) (s_count 7))) 0)) (not (>= (+ (s_count 5) (* (- 1) (s_count 6))) (- 1))) (not (>= (+ (s_count 6) (* (- 1) (s_count 7))) (- 1))) (not (= (+ (s_count 1) (* (- 1) (s_count 3))) 0)) (<= (+ (s_count 4) (* (- 1) (s_count 5))) (- 1)) (not (>= (+ (s_count 3) (* (- 1) (s_count 4))) 0)) (not (>= (+ (s_count 0) (* (- 1) (s_count 1))) 0)) (not (<= (s_count 0) 0)) (not (<= (+ arg0 (* (- 1) fmt0) distance) 0)) (not (>= (+ arg1 (* (- 1) fmt0)) 2)) (not (>= distance 18)) (not (>= (+ arg0 (* (- 1) arg1) (* 4 (s_count (+ (- 2) (* (- 1) fmt0) fmt1))) (* 4 (x_count (+ (- 2) (* (- 1) fmt0) fmt1)))) 0)) (not (<= (x_count 0) 1)) (not (>= (+ (x_count 0) (* (- 1) (x_count 1))) 0)) (not (>= (+ (x_count 1) (* (- 1) (x_count 2))) 0)) (not (>= (+ (x_count 3) (* (- 1) (x_count 4))) 0)) (not (>= (+ (x_count 5) (* (- 1) (x_count 6))) 0)) (not (>= (+ (x_count 6) (* (- 1) (x_count 7))) 0)) (not (>= (+ (x_count 4) (* (- 1) (x_count 5))) 0)) (not (>= (+ (x_count 2) (* (- 1) (x_count 3))) 0)) (not (>= (+ (x_count 7) (* (- 1) (x_count 8))) 0)) (not (>= (+ (x_count 8) (* (- 1) (x_count 9))) (- 1))) (not (= (+ fmt0 (* (- 1) fmt1)) (- 11))))) +(assert (or (not (<= (+ x (* (- 1) (format 2))) 0)) (not (>= x 120)) (not (<= (format 2) 6)))) +(assert (or (not (<= (+ x (* (- 1) (format 1))) 0)) (not (>= x 120)) (not (<= percent 37)) (not (>= (+ percent (* (- 1) (format 1))) 0)))) +(assert (or (not (>= (+ percent (* (- 1) (format 1))) 0)) (not (<= percent 37)) (not (>= s 115)) (not (<= (+ s (* (- 1) (format 1))) 0)))) +(assert (or (not (= (+ (s_count (+ (- 2) (* (- 1) fmt0) fmt1)) (* (- 1) (s_count 7))) 0)) (not (>= (+ (s_count 5) (* (- 1) (s_count 6))) (- 1))) (not (>= (+ (s_count 6) (* (- 1) (s_count 7))) (- 1))) (not (= (+ (s_count 1) (* (- 1) (s_count 3))) 0)) (<= (+ (s_count 4) (* (- 1) (s_count 5))) (- 1)) (not (>= (+ (s_count 3) (* (- 1) (s_count 4))) 0)) (not (>= (+ (s_count 0) (* (- 1) (s_count 1))) 0)) (not (<= (s_count 0) 0)) (not (<= (+ arg0 (* (- 1) fmt0) distance) 0)) (not (>= (+ arg1 (* (- 1) fmt0)) 2)) (not (>= distance 18)) (not (>= (+ arg0 (* (- 1) arg1) (* 4 (s_count (+ (- 2) (* (- 1) fmt0) fmt1))) (* 4 (x_count (+ (- 2) (* (- 1) fmt0) fmt1)))) 0)) (not (<= (x_count 0) 0)) (not (>= (+ (x_count 0) (* (- 1) (x_count 1))) (- 1))) (not (>= (+ (x_count 1) (* (- 1) (x_count 2))) 0)) (not (>= (+ (x_count 3) (* (- 1) (x_count 4))) 0)) (not (>= (+ (x_count 5) (* (- 1) (x_count 6))) 0)) (not (>= (+ (x_count 6) (* (- 1) (x_count 7))) 0)) (not (>= (+ (x_count 4) (* (- 1) (x_count 5))) 0)) (not (>= (+ (x_count 2) (* (- 1) (x_count 3))) 0)) (not (>= (+ (x_count 7) (* (- 1) (x_count 8))) 0)) (not (>= (+ (x_count 8) (* (- 1) (x_count 9))) (- 1))) (not (= (+ fmt0 (* (- 1) fmt1)) (- 11))))) +(assert (or (not (<= (+ x (* (- 1) (format 2))) 0)) (not (>= x 120)) (not (>= (+ adr_lo (* (- 1) (format arg1))) 0)) (not (<= adr_lo 3)) (not (= (+ (format arg1) (* (- 1) (format 2))) 0)))) +(assert (or (not (<= (+ x (* (- 1) (format 2))) 0)) (not (>= x 120)) (not (<= s 115)) (not (>= (+ s (* (- 1) (format 2))) 0)))) +(assert (or (= (+ (format 2) (* (- 1) (format (+ 1 fmt1)))) 0) (not (>= (+ (format 2) (* (- 1) (format (+ 1 fmt1)))) 0)) (not (<= (+ (format 2) (* (- 1) (format (+ 1 fmt1)))) 0)))) +(assert (or (not (>= (+ s (* (- 1) (format 2))) 0)) (not (<= (+ s (* (- 1) (format (+ 1 fmt1)))) 0)) (<= (+ (format 2) (* (- 1) (format (+ 1 fmt1)))) 0))) +(assert (or (not (<= (+ s (* (- 1) (format 2))) 0)) (not (>= (+ s (* (- 1) (format (+ 1 fmt1)))) 0)) (>= (+ (format 2) (* (- 1) (format (+ 1 fmt1)))) 0))) +(assert (or (not (= arg1 2)) (= (+ (format arg1) (* (- 1) (format 2))) 0))) +(assert (or (not (<= (+ s (* (- 1) (format 2))) 0)) (not (>= s 115)) (not (>= (+ adr_lo (* (- 1) (format arg1))) 0)) (not (<= adr_lo 3)) (not (= (+ (format arg1) (* (- 1) (format 2))) 0)))) +(assert (or (not (<= (+ arg0 (* (- 1) arg1) (* 4 (s_count (+ (- 2) (* (- 1) fmt0) fmt1))) (* 4 (x_count (+ (- 2) (* (- 1) fmt0) fmt1)))) 0)) (not (>= (+ arg0 (* (- 1) arg1) (* 4 (s_count (+ (- 2) (* (- 1) fmt0) fmt1))) (* 4 (x_count (+ (- 2) (* (- 1) fmt0) fmt1)))) 0)) (not (<= distance 18)) (not (>= distance 18)) (not (<= (+ arg0 (* (- 1) fmt0) distance) 0)) (not (>= (+ arg0 (* (- 1) fmt0) distance) 0)) (not (<= (+ arg1 (* (- 1) fmt0)) 3)) (not (>= (+ arg1 (* (- 1) fmt0)) 3)))) +(assert (or (not (<= (+ arg0 (* (- 1) arg1) (* 4 (s_count (+ (- 2) (* (- 1) fmt0) fmt1))) (* 4 (x_count (+ (- 2) (* (- 1) fmt0) fmt1)))) 0)) (not (>= (+ arg0 (* (- 1) arg1) (* 4 (s_count (+ (- 2) (* (- 1) fmt0) fmt1))) (* 4 (x_count (+ (- 2) (* (- 1) fmt0) fmt1)))) 0)) (not (<= distance 18)) (not (>= distance 18)) (not (<= (+ arg0 (* (- 1) fmt0) distance) 0)) (not (>= (+ arg0 (* (- 1) fmt0) distance) 0)) (not (<= (+ arg1 (* (- 1) fmt0)) 4)) (not (>= (+ arg1 (* (- 1) fmt0)) 4)))) +(assert (or (not (= (+ (s_count (+ (- 2) (* (- 1) fmt0) fmt1)) (* (- 1) (s_count 7))) 0)) (not (>= (+ (s_count 5) (* (- 1) (s_count 6))) (- 1))) (not (>= (+ (s_count 6) (* (- 1) (s_count 7))) (- 1))) (not (= (+ (s_count 1) (* (- 1) (s_count 3))) 0)) (<= (+ (s_count 4) (* (- 1) (s_count 5))) (- 1)) (not (>= (+ (s_count 3) (* (- 1) (s_count 4))) 0)) (not (>= (+ (s_count 0) (* (- 1) (s_count 1))) (- 1))) (not (<= (s_count 0) 0)) (not (<= (+ arg0 (* (- 1) fmt0) distance) 0)) (not (>= (+ arg1 (* (- 1) fmt0)) 2)) (not (>= distance 18)) (not (>= (+ arg0 (* (- 1) arg1) (* 4 (s_count (+ (- 2) (* (- 1) fmt0) fmt1))) (* 4 (x_count (+ (- 2) (* (- 1) fmt0) fmt1)))) 0)) (not (<= (x_count 0) 0)) (not (>= (+ (x_count 0) (* (- 1) (x_count 1))) 0)) (not (>= (+ (x_count 1) (* (- 1) (x_count 2))) 0)) (not (>= (+ (x_count 3) (* (- 1) (x_count 4))) 0)) (not (>= (+ (x_count 5) (* (- 1) (x_count 6))) 0)) (not (>= (+ (x_count 6) (* (- 1) (x_count 7))) 0)) (not (>= (+ (x_count 4) (* (- 1) (x_count 5))) 0)) (not (>= (+ (x_count 2) (* (- 1) (x_count 3))) 0)) (not (>= (+ (x_count 7) (* (- 1) (x_count 8))) 0)) (not (>= (+ (x_count 8) (* (- 1) (x_count 9))) (- 1))) (not (= (+ fmt0 (* (- 1) fmt1)) (- 11))))) +(assert (or (not (= (+ (s_count (+ (- 2) (* (- 1) fmt0) fmt1)) (* (- 1) (s_count 7))) 0)) (not (>= (+ (s_count 5) (* (- 1) (s_count 6))) (- 1))) (not (>= (+ (s_count 6) (* (- 1) (s_count 7))) (- 1))) (not (= (+ (s_count 1) (* (- 1) (s_count 3))) 0)) (<= (+ (s_count 4) (* (- 1) (s_count 5))) (- 1)) (not (>= (+ (s_count 3) (* (- 1) (s_count 4))) 0)) (not (>= (+ (s_count 0) (* (- 1) (s_count 1))) 0)) (not (<= (s_count 0) 1)) (not (<= (+ arg0 (* (- 1) fmt0) distance) 0)) (not (>= (+ arg1 (* (- 1) fmt0)) 2)) (not (>= distance 18)) (not (>= (+ arg0 (* (- 1) arg1) (* 4 (s_count (+ (- 2) (* (- 1) fmt0) fmt1))) (* 4 (x_count (+ (- 2) (* (- 1) fmt0) fmt1)))) 0)) (not (<= (x_count 0) 0)) (not (>= (+ (x_count 0) (* (- 1) (x_count 1))) 0)) (not (>= (+ (x_count 1) (* (- 1) (x_count 2))) 0)) (not (>= (+ (x_count 3) (* (- 1) (x_count 4))) 0)) (not (>= (+ (x_count 5) (* (- 1) (x_count 6))) 0)) (not (>= (+ (x_count 6) (* (- 1) (x_count 7))) 0)) (not (>= (+ (x_count 4) (* (- 1) (x_count 5))) 0)) (not (>= (+ (x_count 2) (* (- 1) (x_count 3))) 0)) (not (>= (+ (x_count 7) (* (- 1) (x_count 8))) 0)) (not (>= (+ (x_count 8) (* (- 1) (x_count 9))) (- 1))) (not (= (+ fmt0 (* (- 1) fmt1)) (- 11))))) +(assert (or (not (>= (+ s (* (- 1) (format 1))) 0)) (not (<= s 115)) (not (<= (+ x (* (- 1) (format 1))) 0)) (not (>= x 120)))) +(assert (or (= (+ fmt0 (* (- 1) fmt1)) (- 11)) (not (>= (+ fmt0 (* (- 1) fmt1)) (- 11))) (not (<= (+ fmt0 (* (- 1) fmt1)) (- 11))))) +(assert (or (not (<= fmt1 10)) (not (= fmt1 11)))) +(assert (or (= (+ fmt0 (* (- 1) fmt1)) (- 10)) (not (>= (+ fmt0 (* (- 1) fmt1)) (- 10))) (not (<= (+ fmt0 (* (- 1) fmt1)) (- 10))))) +(assert (or (not (= (+ fmt0 (* (- 1) fmt1)) (- 9))) (not (>= (+ (x_count 6) (* (- 1) (x_count 7))) 0)) (not (<= (+ (x_count 6) (* (- 1) (x_count 7))) 0)) (not (>= (+ (x_count 4) (* (- 1) (x_count 5))) 0)) (not (<= (+ (x_count 4) (* (- 1) (x_count 5))) 0)) (not (>= (+ (x_count 2) (* (- 1) (x_count 3))) 0)) (not (<= (+ (x_count 2) (* (- 1) (x_count 3))) 0)) (not (>= (+ (x_count 5) (* (- 1) (x_count 6))) 0)) (not (<= (+ (x_count 5) (* (- 1) (x_count 6))) 0)) (not (>= (+ (x_count 3) (* (- 1) (x_count 4))) 0)) (not (<= (+ (x_count 3) (* (- 1) (x_count 4))) 0)) (not (>= (+ (x_count 1) (* (- 1) (x_count 2))) 0)) (not (<= (+ (x_count 1) (* (- 1) (x_count 2))) 0)) (= (+ (x_count (+ (- 2) (* (- 1) fmt0) fmt1)) (* (- 1) (x_count 1))) 0))) +(assert (or (not (= (+ (x_count (+ (- 2) (* (- 1) fmt0) fmt1)) (* (- 1) (x_count 1))) 0)) (not (>= (+ (x_count 0) (* (- 1) (x_count 1))) (- 1))) (not (<= (x_count 0) 1)) (not (>= (+ arg0 (* (- 1) arg1) (* 4 (s_count (+ (- 2) (* (- 1) fmt0) fmt1))) (* 4 (x_count (+ (- 2) (* (- 1) fmt0) fmt1)))) 0)) (not (>= distance 18)) (not (>= (+ arg1 (* (- 1) fmt0)) 0)) (not (<= (+ arg0 (* (- 1) fmt0) distance) 0)) (not (<= (s_count 0) 0)) (not (>= (+ (s_count 0) (* (- 1) (s_count 1))) (- 1))) (not (>= (+ (s_count 3) (* (- 1) (s_count 4))) 0)) (not (>= (+ (s_count 4) (* (- 1) (s_count 5))) 0)) (not (= (+ (s_count 1) (* (- 1) (s_count 3))) 0)) (not (>= (+ (s_count 6) (* (- 1) (s_count 7))) (- 1))) (not (>= (+ (s_count 5) (* (- 1) (s_count 6))) 0)) (not (= (+ (s_count (+ (- 2) (* (- 1) fmt0) fmt1)) (* (- 1) (s_count 7))) 0)))) +(assert (or (= (+ fmt0 (* (- 1) fmt1)) (- 9)) (not (>= (+ fmt0 (* (- 1) fmt1)) (- 9))) (not (<= (+ fmt0 (* (- 1) fmt1)) (- 9))))) +(assert (or (not (>= fmt1 10)) (not (<= fmt1 9)))) +(assert (or (not (>= fmt1 10)) (not (= fmt1 9)))) +(assert (or (not (>= (+ (x_count 7) (* (- 1) (x_count 8))) 0)) (not (<= (+ (x_count 7) (* (- 1) (x_count 8))) 0)) (not (= (+ fmt0 (* (- 1) fmt1)) (- 10))) (not (>= (+ (x_count 6) (* (- 1) (x_count 7))) 0)) (not (<= (+ (x_count 6) (* (- 1) (x_count 7))) 0)) (not (>= (+ (x_count 4) (* (- 1) (x_count 5))) 0)) (not (<= (+ (x_count 4) (* (- 1) (x_count 5))) 0)) (not (>= (+ (x_count 2) (* (- 1) (x_count 3))) 0)) (not (<= (+ (x_count 2) (* (- 1) (x_count 3))) 0)) (not (>= (+ (x_count 5) (* (- 1) (x_count 6))) 0)) (not (<= (+ (x_count 5) (* (- 1) (x_count 6))) 0)) (not (>= (+ (x_count 3) (* (- 1) (x_count 4))) 0)) (not (<= (+ (x_count 3) (* (- 1) (x_count 4))) 0)) (not (>= (+ (x_count 1) (* (- 1) (x_count 2))) 0)) (not (<= (+ (x_count 1) (* (- 1) (x_count 2))) 0)) (= (+ (x_count (+ (- 2) (* (- 1) fmt0) fmt1)) (* (- 1) (x_count 1))) 0))) +(assert (or (not (<= fmt1 8)) (not (>= fmt1 9)))) +(assert (or (= (+ fmt0 (* (- 1) fmt1)) (- 8)) (not (>= (+ fmt0 (* (- 1) fmt1)) (- 8))) (not (<= (+ fmt0 (* (- 1) fmt1)) (- 8))))) +(assert (or (= (+ fmt0 (* (- 1) fmt1)) (- 7)) (not (>= (+ fmt0 (* (- 1) fmt1)) (- 7))) (not (<= (+ fmt0 (* (- 1) fmt1)) (- 7))))) +(assert (or (not (>= fmt1 7)) (not (<= fmt0 0)) (<= (+ fmt0 (* (- 1) fmt1)) (- 7)))) +(assert (or (not (<= fmt1 8)) (not (= fmt1 10)))) +(assert (or (not (<= fmt1 8)) (not (= fmt1 9)))) +(assert (or (not (>= fmt1 8)) (not (= fmt1 7)))) +(assert (or (not (>= (+ (x_count 6) (* (- 1) (x_count 7))) 0)) (not (<= (+ (x_count 6) (* (- 1) (x_count 7))) 0)) (not (= (+ fmt0 (* (- 1) fmt1)) (- 8))) (not (>= (+ (x_count 6) (* (- 1) (x_count 7))) 0)) (not (<= (+ (x_count 6) (* (- 1) (x_count 7))) 0)) (not (>= (+ (x_count 4) (* (- 1) (x_count 5))) 0)) (not (<= (+ (x_count 4) (* (- 1) (x_count 5))) 0)) (not (>= (+ (x_count 2) (* (- 1) (x_count 3))) 0)) (not (<= (+ (x_count 2) (* (- 1) (x_count 3))) 0)) (not (>= (+ (x_count 5) (* (- 1) (x_count 6))) 0)) (not (<= (+ (x_count 5) (* (- 1) (x_count 6))) 0)) (not (>= (+ (x_count 3) (* (- 1) (x_count 4))) 0)) (not (<= (+ (x_count 3) (* (- 1) (x_count 4))) 0)) (not (>= (+ (x_count 1) (* (- 1) (x_count 2))) 0)) (not (<= (+ (x_count 1) (* (- 1) (x_count 2))) 0)) (= (+ (x_count (+ (- 2) (* (- 1) fmt0) fmt1)) (* (- 1) (x_count 1))) 0))) +(assert (or (not (<= fmt1 7)) (not (= fmt1 8)))) +(assert (or (not (= (+ fmt0 (* (- 1) fmt1)) (- 7))) (not (>= (+ (x_count 4) (* (- 1) (x_count 5))) 0)) (not (<= (+ (x_count 4) (* (- 1) (x_count 5))) 0)) (not (>= (+ (x_count 2) (* (- 1) (x_count 3))) 0)) (not (<= (+ (x_count 2) (* (- 1) (x_count 3))) 0)) (not (>= (+ (x_count 3) (* (- 1) (x_count 4))) 0)) (not (<= (+ (x_count 3) (* (- 1) (x_count 4))) 0)) (not (>= (+ (x_count 1) (* (- 1) (x_count 2))) 0)) (not (<= (+ (x_count 1) (* (- 1) (x_count 2))) 0)) (= (+ (x_count (+ (- 2) (* (- 1) fmt0) fmt1)) (* (- 1) (x_count 1))) 0))) +(assert (or (>= fmt1 7) (not (= fmt1 7)))) +(assert (or (= fmt1 6) (not (= fmt1 6)))) +(assert (or (= (+ fmt0 (* (- 1) fmt1)) (- 6)) (not (= (+ fmt0 (* (- 1) fmt1)) (- 6))))) +(assert (or (= fmt1 6) (not (= fmt1 6)))) +(assert (or (= fmt1 6) (<= fmt1 5) (>= fmt1 7))) +(assert (or (= (+ fmt0 (* (- 1) fmt1)) (- 6)) (not (>= (+ fmt0 (* (- 1) fmt1)) (- 6))) (not (<= (+ fmt0 (* (- 1) fmt1)) (- 6))))) +(assert (or (not (>= (+ (x_count 2) (* (- 1) (x_count 3))) 0)) (not (<= (+ (x_count 2) (* (- 1) (x_count 3))) 0)) (not (>= (+ (x_count 3) (* (- 1) (x_count 4))) 0)) (not (<= (+ (x_count 3) (* (- 1) (x_count 4))) 0)) (not (>= (+ (x_count 1) (* (- 1) (x_count 2))) 0)) (not (<= (+ (x_count 1) (* (- 1) (x_count 2))) 0)) (= (+ (x_count (+ (- 2) (* (- 1) fmt0) fmt1)) (* (- 1) (x_count 1))) 0) (not (= (+ fmt0 (* (- 1) fmt1)) (- 6))))) +(assert (or (= (+ fmt0 (* (- 1) fmt1)) (- 6)) (not (>= (+ fmt0 (* (- 1) fmt1)) (- 6))) (not (<= (+ fmt0 (* (- 1) fmt1)) (- 6))))) +(assert (or (>= fmt1 5) (not (= fmt1 6)))) +(assert (or (= fmt1 3) (not (= fmt1 3)))) +(assert (or (= (+ arg1 (* (- 1) fmt1)) (- 1)) (not (= (+ arg1 (* (- 1) fmt1)) (- 1))))) +(assert (or (= (+ fmt0 (* (- 1) fmt1)) (- 3)) (not (= (+ fmt0 (* (- 1) fmt1)) (- 3))))) +(assert (or (= fmt1 3) (not (= fmt1 3)))) +(assert (or (= (+ arg1 (* (- 1) fmt1)) (- 1)) (not (= (+ arg1 (* (- 1) fmt1)) (- 1))))) +(assert (or (= fmt1 3) (not (>= fmt1 3)) (not (<= fmt1 3)))) +(assert (or (= (+ fmt0 (* (- 1) fmt1)) (- 3)) (not (>= (+ fmt0 (* (- 1) fmt1)) (- 3))) (not (<= (+ fmt0 (* (- 1) fmt1)) (- 3))))) +(assert (or (<= fmt1 3) (not (<= fmt0 0)) (not (>= (+ fmt0 (* (- 1) fmt1)) (- 3))))) +(assert (or (= (+ arg1 (* (- 1) fmt1)) (- 1)) (not (>= (+ arg1 (* (- 1) fmt1)) (- 1))) (not (<= (+ arg1 (* (- 1) fmt1)) (- 1))))) +(assert (or (<= (+ fmt0 (* (- 1) fmt1)) (- 4)) (not (>= (+ arg1 (* (- 1) fmt0)) 2)) (>= (+ arg1 (* (- 1) fmt1)) (- 1)))) +(assert (or (not (>= (+ fmt0 (* (- 1) fmt1)) (- 2))) (not (= (+ fmt0 (* (- 1) fmt1)) (- 3))))) +(assert (or (>= fmt1 3) (not (= fmt1 3)))) +(assert (or (= (+ arg1 (* (- 1) fmt1)) 0) (not (= (+ arg1 (* (- 1) fmt1)) 0)))) +(assert (or (= fmt1 2) (not (= fmt1 2)))) +(assert (or (= (+ fmt0 (* (- 1) fmt1)) (- 2)) (not (= (+ fmt0 (* (- 1) fmt1)) (- 2))))) +(assert (or (= (+ arg1 (* (- 1) fmt1)) 0) (not (= (+ arg1 (* (- 1) fmt1)) 0)))) +(assert (or (= (+ arg1 (* (- 1) fmt1)) 0) (not (>= (+ arg1 (* (- 1) fmt1)) 0)) (not (<= (+ arg1 (* (- 1) fmt1)) 0)))) +(assert (or (= (+ fmt0 (* (- 1) fmt1)) (- 2)) (not (>= (+ fmt0 (* (- 1) fmt1)) (- 2))) (not (<= (+ fmt0 (* (- 1) fmt1)) (- 2))))) +(assert (or (>= (+ fmt0 (* (- 1) fmt1)) (- 1)) (not (<= (+ arg1 (* (- 1) fmt0)) 2)) (<= (+ arg1 (* (- 1) fmt1)) 0))) +(assert (or (= fmt1 2) (not (>= fmt1 2)) (not (<= fmt1 2)))) +(assert (or (not (<= (+ arg1 (* (- 1) fmt1)) 0)) (<= (+ arg1 (* (- 1) fmt0)) 1) (>= fmt1 2) (not (>= fmt0 0)))) +(assert (or (not (<= (+ arg1 (* (- 1) fmt1)) (- 1))) (not (>= (+ arg1 (* (- 1) fmt1)) 0)))) +(assert (or (not (<= (+ arg1 (* (- 1) fmt1)) (- 1))) (not (= (+ arg1 (* (- 1) fmt1)) 0)))) +(assert (or (not (<= (+ fmt0 (* (- 1) fmt1)) (- 3))) (not (= (+ fmt0 (* (- 1) fmt1)) (- 2))))) +(assert (or (= (+ (x_count (+ (- 2) (* (- 1) fmt0) fmt1)) (* (- 1) (x_count 1))) 0) (not (= (+ fmt0 (* (- 1) fmt1)) (- 3))))) +(assert (or (= (+ fmt0 (* (- 1) fmt1)) (- 3)) (not (>= (+ fmt0 (* (- 1) fmt1)) (- 3))) (not (<= (+ fmt0 (* (- 1) fmt1)) (- 3))))) +(assert (or (not (<= fmt1 2)) (not (>= fmt1 3)))) +(assert (or (not (>= (+ arg1 (* (- 1) fmt1)) 0)) (not (= (+ arg1 (* (- 1) fmt1)) (- 1))))) +(assert (or (not (>= (+ (x_count 0) (* (- 1) (x_count 1))) 0)) (not (<= (+ (x_count 0) (* (- 1) (x_count 1))) 0)) (= (+ (x_count (+ (- 2) (* (- 1) fmt0) fmt1)) (* (- 1) (x_count 1))) 0) (not (= (+ fmt0 (* (- 1) fmt1)) (- 2))))) +(assert (or (= (+ fmt0 (* (- 1) fmt1)) (- 2)) (not (>= (+ fmt0 (* (- 1) fmt1)) (- 2))) (not (<= (+ fmt0 (* (- 1) fmt1)) (- 2))))) +(assert (or (not (>= fmt0 0)) (not (<= fmt1 3)) (>= (+ fmt0 (* (- 1) fmt1)) (- 3)))) +(assert (or (not (>= fmt1 5)) (not (= fmt1 2)))) +(assert (or (not (>= fmt1 5)) (not (= fmt1 3)))) +(assert (or (<= (+ arg1 (* (- 1) fmt0)) 2) (not (>= fmt0 0)) (not (<= arg1 2)))) +(assert (or (<= (+ fmt0 (* (- 1) fmt1)) (- 6)) (not (<= (+ arg1 (* (- 1) fmt1)) 0)) (<= (+ arg1 (* (- 1) fmt0)) 5))) +(assert (or (<= arg1 2) (not (= arg1 2)))) +(assert (or (not (<= (+ arg0 (* (- 1) arg1) (* 4 (s_count (+ (- 2) (* (- 1) fmt0) fmt1))) (* 4 (x_count (+ (- 2) (* (- 1) fmt0) fmt1)))) 0)) (not (>= (+ arg0 (* (- 1) arg1) (* 4 (s_count (+ (- 2) (* (- 1) fmt0) fmt1))) (* 4 (x_count (+ (- 2) (* (- 1) fmt0) fmt1)))) 0)) (not (<= distance 18)) (not (>= distance 18)) (not (<= (+ arg0 (* (- 1) fmt0) distance) 0)) (not (>= (+ arg0 (* (- 1) fmt0) distance) 0)) (not (<= (+ arg1 (* (- 1) fmt0)) 5)) (not (>= (+ arg1 (* (- 1) fmt0)) 5)))) +(assert (or (<= (+ arg1 (* (- 1) fmt1)) 0) (not (= (+ arg1 (* (- 1) fmt1)) 0)))) +(assert (or (<= (+ arg1 (* (- 1) fmt0)) 8) (not (<= (+ arg0 (* (- 1) fmt0) distance) 0)) (not (<= fmt_length 13)) (<= (+ arg0 (* (- 1) arg1) distance fmt_length) 4))) +(assert (or (not (<= (+ arg0 (* (- 1) arg1) (* 4 (s_count (+ (- 2) (* (- 1) fmt0) fmt1))) (* 4 (x_count (+ (- 2) (* (- 1) fmt0) fmt1)))) 0)) (not (>= (+ arg0 (* (- 1) arg1) (* 4 (s_count (+ (- 2) (* (- 1) fmt0) fmt1))) (* 4 (x_count (+ (- 2) (* (- 1) fmt0) fmt1)))) 0)) (not (<= distance 18)) (not (>= distance 18)) (not (<= (+ arg0 (* (- 1) fmt0) distance) 0)) (not (>= (+ arg0 (* (- 1) fmt0) distance) 0)) (not (<= (+ arg1 (* (- 1) fmt0)) 7)) (not (>= (+ arg1 (* (- 1) fmt0)) 7)))) +(assert (or (not (<= (+ arg1 (* (- 1) fmt1)) (- 3))) (not (>= (+ arg1 (* (- 1) fmt1)) (- 1))))) +(assert (or (not (<= (+ arg1 (* (- 1) fmt1)) (- 3))) (not (= (+ arg1 (* (- 1) fmt1)) (- 1))))) +(assert (or (not (= (+ fmt0 (* (- 1) fmt1)) (- 5))) (not (>= (+ (x_count 2) (* (- 1) (x_count 3))) 0)) (not (<= (+ (x_count 2) (* (- 1) (x_count 3))) 0)) (not (>= (+ (x_count 1) (* (- 1) (x_count 2))) 0)) (not (<= (+ (x_count 1) (* (- 1) (x_count 2))) 0)) (= (+ (x_count (+ (- 2) (* (- 1) fmt0) fmt1)) (* (- 1) (x_count 1))) 0))) +(assert (or (= (+ fmt0 (* (- 1) fmt1)) (- 5)) (not (>= (+ fmt0 (* (- 1) fmt1)) (- 5))) (not (<= (+ fmt0 (* (- 1) fmt1)) (- 5))))) +(assert (or (not (<= fmt0 0)) (not (>= fmt1 5)) (<= (+ fmt0 (* (- 1) fmt1)) (- 5)))) +(assert (or (<= (+ fmt0 (* (- 1) fmt1)) (- 5)) (not (= (+ arg1 (* (- 1) fmt1)) (- 3))) (not (>= (+ arg1 (* (- 1) fmt0)) 2)))) +(assert (or (>= fmt1 5) (not (= fmt1 5)))) +(assert (or (= fmt1 4) (not (= fmt1 4)))) +(assert (or (= (+ arg1 (* (- 1) fmt1)) (- 2)) (not (= (+ arg1 (* (- 1) fmt1)) (- 2))))) +(assert (or (= (+ fmt0 (* (- 1) fmt1)) (- 4)) (not (= (+ fmt0 (* (- 1) fmt1)) (- 4))))) +(assert (or (= (+ arg1 (* (- 1) fmt1)) (- 2)) (not (= (+ arg1 (* (- 1) fmt1)) (- 2))))) +(assert (or (= fmt1 4) (<= fmt1 3) (>= fmt1 5))) +(assert (or (= (+ arg1 (* (- 1) fmt1)) (- 2)) (not (>= (+ arg1 (* (- 1) fmt1)) (- 2))) (not (<= (+ arg1 (* (- 1) fmt1)) (- 2))))) +(assert (or (= (+ arg1 (* (- 1) fmt1)) (- 2)) (>= (+ arg1 (* (- 1) fmt1)) (- 1)) (>= (+ arg1 (* (- 1) fmt1)) (- 1)))) +(assert (or (>= (+ fmt0 (* (- 1) fmt1)) (- 3)) (not (>= (+ arg1 (* (- 1) fmt1)) (- 1))) (not (<= (+ arg1 (* (- 1) fmt0)) 2)))) +(assert (or (not (<= (+ arg1 (* (- 1) fmt1)) (- 2))) (not (= (+ arg1 (* (- 1) fmt1)) (- 1))))) +(assert (or (>= (+ arg1 (* (- 1) fmt1)) (- 2)) (<= (+ arg1 (* (- 1) fmt1)) (- 3)))) +(assert (or (= (+ fmt0 (* (- 1) fmt1)) (- 4)) (not (>= (+ fmt0 (* (- 1) fmt1)) (- 4))) (not (<= (+ fmt0 (* (- 1) fmt1)) (- 4))))) +(assert (or (not (>= (+ (x_count 1) (* (- 1) (x_count 2))) 0)) (not (<= (+ (x_count 1) (* (- 1) (x_count 2))) 0)) (= (+ (x_count (+ (- 2) (* (- 1) fmt0) fmt1)) (* (- 1) (x_count 1))) 0) (not (= (+ fmt0 (* (- 1) fmt1)) (- 4))))) +(assert (or (not (>= (+ arg1 (* (- 1) fmt0)) 0)) (not (= (+ (x_count (+ (- 2) (* (- 1) fmt0) fmt1)) (* (- 1) (x_count 1))) 0)) (not (>= (+ (x_count 0) (* (- 1) (x_count 1))) (- 1))) (not (<= (x_count 0) 0)) (not (>= (+ arg0 (* (- 1) arg1) (* 4 (s_count (+ (- 2) (* (- 1) fmt0) fmt1))) (* 4 (x_count (+ (- 2) (* (- 1) fmt0) fmt1)))) 0)) (not (>= distance 18)) (not (<= (+ arg0 (* (- 1) fmt0) distance) 0)) (not (<= (s_count 0) 0)) (not (>= (+ (s_count 0) (* (- 1) (s_count 1))) (- 1))) (not (>= (+ (s_count 3) (* (- 1) (s_count 4))) 0)) (not (>= (+ (s_count 4) (* (- 1) (s_count 5))) 0)) (not (= (+ (s_count 1) (* (- 1) (s_count 3))) 0)) (not (>= (+ (s_count 6) (* (- 1) (s_count 7))) (- 1))) (not (>= (+ (s_count 5) (* (- 1) (s_count 6))) (- 1))) (not (= (+ (s_count (+ (- 2) (* (- 1) fmt0) fmt1)) (* (- 1) (s_count 7))) 0)))) +(assert (or (not (= (+ (s_count (+ (- 2) (* (- 1) fmt0) fmt1)) (* (- 1) (s_count 7))) 0)) (not (>= (+ (s_count 5) (* (- 1) (s_count 6))) (- 1))) (not (>= (+ (s_count 6) (* (- 1) (s_count 7))) (- 1))) (<= (+ (s_count 4) (* (- 1) (s_count 5))) (- 1)) (not (>= (+ (s_count 3) (* (- 1) (s_count 4))) 0)) (not (>= (+ (s_count 0) (* (- 1) (s_count 1))) (- 1))) (not (<= (s_count 0) 0)) (not (<= (+ arg0 (* (- 1) fmt0) distance) 0)) (not (>= distance 18)) (not (>= (+ arg0 (* (- 1) arg1) (* 4 (s_count (+ (- 2) (* (- 1) fmt0) fmt1))) (* 4 (x_count (+ (- 2) (* (- 1) fmt0) fmt1)))) 0)) (not (<= (x_count 0) 0)) (not (>= (+ (x_count 0) (* (- 1) (x_count 1))) 0)) (not (= (+ (x_count (+ (- 2) (* (- 1) fmt0) fmt1)) (* (- 1) (x_count 1))) 0)) (not (>= (+ arg1 (* (- 1) fmt0)) 2)) (not (>= (+ (s_count 1) (* (- 1) (s_count 2))) 0)) (not (>= (+ (s_count 2) (* (- 1) (s_count 3))) (- 1))))) +(assert (or (not (<= (+ s (* (- 1) (format 2))) 0)) (not (>= s 115)) (not (>= (+ percent (* (- 1) (format 2))) 0)) (not (<= percent 37)))) +(assert (or (not (= (+ (s_count (+ (- 2) (* (- 1) fmt0) fmt1)) (* (- 1) (s_count 7))) 0)) (<= (+ (s_count 5) (* (- 1) (s_count 6))) (- 1)) (not (>= (+ (s_count 6) (* (- 1) (s_count 7))) (- 1))) (not (>= (+ (s_count 4) (* (- 1) (s_count 5))) (- 1))) (not (>= (+ (s_count 3) (* (- 1) (s_count 4))) 0)) (not (>= (+ (s_count 0) (* (- 1) (s_count 1))) (- 1))) (not (<= (s_count 0) 0)) (not (<= (+ arg0 (* (- 1) fmt0) distance) 0)) (not (>= distance 18)) (not (>= (+ arg0 (* (- 1) arg1) (* 4 (s_count (+ (- 2) (* (- 1) fmt0) fmt1))) (* 4 (x_count (+ (- 2) (* (- 1) fmt0) fmt1)))) 0)) (not (<= (x_count 0) 0)) (not (>= (+ (x_count 0) (* (- 1) (x_count 1))) 0)) (not (= (+ (x_count (+ (- 2) (* (- 1) fmt0) fmt1)) (* (- 1) (x_count 1))) 0)) (not (>= (+ arg1 (* (- 1) fmt0)) 2)) (not (>= (+ (s_count 1) (* (- 1) (s_count 2))) 0)) (not (>= (+ (s_count 2) (* (- 1) (s_count 3))) (- 1))))) +(assert (or (= (+ (s_count (+ (- 2) (* (- 1) fmt0) fmt1)) (* (- 1) (s_count 7))) 0) (not (>= (+ (s_count (+ (- 2) (* (- 1) fmt0) fmt1)) (* (- 1) (s_count 7))) 0)) (not (<= (+ (s_count (+ (- 2) (* (- 1) fmt0) fmt1)) (* (- 1) (s_count 7))) 0)))) +(assert (or (not (>= (format 4) 255)) (not (<= s 115)) (not (>= (+ s (* (- 1) (format 4))) 0)))) +(assert (or (not (>= (+ percent (* (- 1) (format 7))) 0)) (not (<= percent 37)) (not (>= s 115)) (not (<= (+ s (* (- 1) (format 7))) 0)))) +(assert (or (not (>= s 115)) (not (<= (+ s (* (- 1) (format 6))) 0)) (not (<= (format 6) 6)))) +(assert (or (not (>= (+ s (* (- 1) (format 4))) 0)) (not (<= s 115)) (not (>= x 120)) (not (<= (+ x (* (- 1) (format 4))) 0)))) +(assert (or (= (+ (x_count (+ (- 2) (* (- 1) fmt0) fmt1)) (* (- 1) (x_count 7))) 0) (not (>= (+ (x_count (+ (- 2) (* (- 1) fmt0) fmt1)) (* (- 1) (x_count 7))) 0)) (not (<= (+ (x_count (+ (- 2) (* (- 1) fmt0) fmt1)) (* (- 1) (x_count 7))) 0)))) +(assert (or (not (= (+ (x_count (+ (- 2) (* (- 1) fmt0) fmt1)) (* (- 1) (x_count 1))) 0)) (<= (+ (x_count (+ (- 2) (* (- 1) fmt0) fmt1)) (* (- 1) (x_count 7))) 0) (not (<= (+ (x_count 2) (* (- 1) (x_count 3))) 0)) (not (<= (+ (x_count 4) (* (- 1) (x_count 5))) 0)) (not (<= (+ (x_count 6) (* (- 1) (x_count 7))) 0)) (not (<= (+ (x_count 5) (* (- 1) (x_count 6))) 0)) (not (<= (+ (x_count 3) (* (- 1) (x_count 4))) 0)) (not (<= (+ (x_count 1) (* (- 1) (x_count 2))) 0)))) +(assert (or (<= (+ (s_count (+ (- 2) (* (- 1) fmt0) fmt1)) (* (- 1) (s_count 7))) 0) (>= (+ (s_count (+ (- 2) (* (- 1) fmt0) fmt1)) (* (- 1) (s_count 7))) 0))) +(assert (or (not (>= (+ (s_count 1) (* (- 1) (s_count 2))) 0)) (not (<= (+ (s_count 1) (* (- 1) (s_count 2))) 0)) (not (= (+ fmt0 (* (- 1) fmt1)) (- 4))) (= (+ (s_count (+ (- 2) (* (- 1) fmt0) fmt1)) (* (- 1) (s_count 1))) 0))) +(assert (or (not (>= (+ (s_count 0) (* (- 1) (s_count 1))) (- 1))) (not (<= (s_count 0) 1)) (not (<= (+ arg0 (* (- 1) fmt0) distance) 0)) (not (>= distance 18)) (not (>= (+ arg0 (* (- 1) arg1) (* 4 (s_count (+ (- 2) (* (- 1) fmt0) fmt1))) (* 4 (x_count (+ (- 2) (* (- 1) fmt0) fmt1)))) 0)) (not (<= (x_count 0) 1)) (not (>= (+ (x_count 0) (* (- 1) (x_count 1))) (- 1))) (not (= (+ (x_count (+ (- 2) (* (- 1) fmt0) fmt1)) (* (- 1) (x_count 1))) 0)) (not (>= (+ arg1 (* (- 1) fmt0)) 0)) (not (= (+ (s_count (+ (- 2) (* (- 1) fmt0) fmt1)) (* (- 1) (s_count 1))) 0)))) +(assert (or (= (+ fmt0 (* (- 1) fmt1)) (- 4)) (not (>= (+ fmt0 (* (- 1) fmt1)) (- 4))) (not (<= (+ fmt0 (* (- 1) fmt1)) (- 4))))) +(assert (or (not (<= fmt1 2)) (not (= fmt1 4)))) +(assert (or (not (>= (+ arg1 (* (- 1) fmt1)) 0)) (not (= (+ arg1 (* (- 1) fmt1)) (- 2))))) +(assert (or (not (>= (+ arg1 (* (- 1) fmt0)) 0)) (not (= (+ (x_count (+ (- 2) (* (- 1) fmt0) fmt1)) (* (- 1) (x_count 1))) 0)) (not (>= (+ (x_count 0) (* (- 1) (x_count 1))) (- 1))) (not (<= (x_count 0) 1)) (not (>= (+ arg0 (* (- 1) arg1) (* 4 (s_count (+ (- 2) (* (- 1) fmt0) fmt1))) (* 4 (x_count (+ (- 2) (* (- 1) fmt0) fmt1)))) 0)) (not (>= distance 18)) (not (<= (+ arg0 (* (- 1) fmt0) distance) 0)) (not (<= (s_count 0) 1)) (not (= (+ fmt0 (* (- 1) fmt1)) (- 2))))) +(assert (or (not (<= percent 37)) (not (>= (+ percent (* (- 1) (format 1))) 0)) (not (>= x 120)) (not (<= (+ x (* (- 1) (format 10))) 0)) (not (= (+ (format 1) (* (- 1) (format 10))) 0)))) +(assert (or (not (>= fmt1 3)) (not (= fmt1 2)))) +(assert (or (= arg1 6) (not (= arg1 6)))) +(assert (or (= arg1 6) (not (= arg1 6)))) +(assert (or (= arg1 6) (not (= arg1 6)))) +(assert (or (not (= (+ fmt0 (* (- 1) fmt1)) (- 3))) (= (+ (s_count (+ (- 2) (* (- 1) fmt0) fmt1)) (* (- 1) (s_count 1))) 0))) +(assert (or (not (>= fmt1 9)) (not (<= fmt1 5)))) +(assert (or (not (>= fmt1 9)) (not (= fmt1 5)))) +(assert (or (not (<= (+ arg0 (* (- 1) arg1) (* 4 (s_count (+ (- 2) (* (- 1) fmt0) fmt1))) (* 4 (x_count (+ (- 2) (* (- 1) fmt0) fmt1)))) 0)) (not (>= (+ arg0 (* (- 1) arg1) (* 4 (s_count (+ (- 2) (* (- 1) fmt0) fmt1))) (* 4 (x_count (+ (- 2) (* (- 1) fmt0) fmt1)))) 0)) (not (<= distance 18)) (not (>= distance 18)) (not (<= (+ arg0 (* (- 1) fmt0) distance) 0)) (not (>= (+ arg0 (* (- 1) fmt0) distance) 0)) (not (<= (+ arg1 (* (- 1) fmt0)) 8)) (not (>= (+ arg1 (* (- 1) fmt0)) 8)))) +(assert (or (not (<= (+ arg1 (* (- 1) fmt1)) (- 3))) (not (= (+ arg1 (* (- 1) fmt1)) (- 2))))) +(assert (or (not (>= (+ fmt0 (* (- 1) fmt1)) (- 8))) (not (= (+ fmt0 (* (- 1) fmt1)) (- 9))))) +(assert (or (= arg1 6) (not (>= arg1 6)) (not (<= arg1 6)))) +(assert (or (>= (+ arg1 (* (- 1) fmt1)) (- 1)) (not (>= (+ fmt0 (* (- 1) fmt1)) (- 8))) (not (<= fmt0 0)) (<= arg1 6))) +(assert (or (not (>= (+ arg1 (* (- 1) fmt1)) (- 3))) (not (<= (+ fmt0 (* (- 1) fmt1)) 0)) (not (>= (+ (s_count 2) (* (- 1) (s_count 3))) (- 1))) (not (>= (+ (s_count 1) (* (- 1) (s_count 2))) 0)) (not (= (+ (x_count (+ (- 2) (* (- 1) fmt0) fmt1)) (* (- 1) (x_count 1))) 0)) (not (>= (+ (x_count 0) (* (- 1) (x_count 1))) 0)) (not (<= (x_count 0) 0)) (not (>= (+ arg0 (* (- 1) arg1) (* 4 (s_count (+ (- 2) (* (- 1) fmt0) fmt1))) (* 4 (x_count (+ (- 2) (* (- 1) fmt0) fmt1)))) 0)) (not (>= distance 18)) (not (<= (+ arg0 (* (- 1) fmt0) distance) 0)) (not (<= (s_count 0) 0)) (not (>= (+ (s_count 0) (* (- 1) (s_count 1))) (- 1))) (not (>= (+ (s_count 3) (* (- 1) (s_count 4))) 0)) (not (>= (+ (s_count 4) (* (- 1) (s_count 5))) (- 1))) (not (= (+ fmt0 (* (- 1) fmt1)) (- 8))) (not (>= (+ (s_count 5) (* (- 1) (s_count 6))) 0)) (not (<= (+ (s_count 5) (* (- 1) (s_count 6))) 0)))) +(assert (or (not (>= (+ arg1 (* (- 1) fmt1)) (- 2))) (>= (+ arg1 (* (- 1) fmt1)) (- 3)))) +(assert (or (not (>= (+ percent (* (- 1) (format 3))) 0)) (not (<= percent 37)) (not (>= x 120)) (not (<= (+ x (* (- 1) (format 10))) 0)) (not (= (+ (format 3) (* (- 1) (format 10))) 0)))) +(assert (or (not (>= (+ arg1 (* (- 1) fmt1)) (- 1))) (not (= (+ arg1 (* (- 1) fmt1)) (- 2))))) +(assert (or (not (>= (+ percent (* (- 1) (format 5))) 0)) (not (<= (+ percent (* (- 1) (format 5))) 0)) (not (>= (+ percent (* (- 1) (format 7))) 0)) (not (<= (+ percent (* (- 1) (format 7))) 0)) (not (>= (+ percent (* (- 1) (format 5))) 0)) (not (<= (+ percent (* (- 1) (format 5))) 0)) (not (>= (+ percent (* (- 1) (format 3))) 0)) (not (<= (+ percent (* (- 1) (format 3))) 0)) (not (= fmt1 6)) (not (= (+ (format 12) (* (- 1) (format (+ 1 fmt1)))) 0)) (not (>= (+ x (* (- 1) (format 10))) 0)) (not (<= (+ x (* (- 1) (format 10))) 0)) (not (>= (+ x (* (- 1) (format 12))) 0)) (not (<= (+ x (* (- 1) (format 12))) 0)) (= (+ (format 3) (* (- 1) (format 10))) 0))) +(assert (or (= fmt1 6) (not (>= fmt1 6)) (not (<= fmt1 6)))) +(assert (or (not (>= fmt0 0)) (not (<= fmt1 5)) (>= (+ fmt0 (* (- 1) fmt1)) (- 5)))) +(assert (or (= (+ (format 12) (* (- 1) (format (+ 1 fmt1)))) 0) (not (>= (+ (format 12) (* (- 1) (format (+ 1 fmt1)))) 0)) (not (<= (+ (format 12) (* (- 1) (format (+ 1 fmt1)))) 0)))) +(assert (or (<= (+ (format 12) (* (- 1) (format (+ 1 fmt1)))) 0) (>= (+ (format 12) (* (- 1) (format (+ 1 fmt1)))) 0))) +(assert (or (not (>= fmt1 6)) (not (= fmt1 5)))) +(assert (or (not (>= (+ (s_count 0) (* (- 1) (s_count 1))) (- 1))) (not (<= (s_count 0) 1)) (not (>= (+ (s_count 1) (* (- 1) (s_count 2))) (- 1))) (not (>= (+ (s_count 2) (* (- 1) (s_count 3))) (- 1))) (not (= (+ (x_count (+ (- 2) (* (- 1) fmt0) fmt1)) (* (- 1) (x_count 1))) 0)) (not (>= (+ (x_count 0) (* (- 1) (x_count 1))) (- 1))) (>= (x_count 0) 1) (not (>= (+ arg0 (* (- 1) arg1) (* 4 (s_count (+ (- 2) (* (- 1) fmt0) fmt1))) (* 4 (x_count (+ (- 2) (* (- 1) fmt0) fmt1)))) 0)) (not (>= distance 18)) (not (<= (+ arg0 (* (- 1) fmt0) distance) 0)) (not (>= (+ arg1 (* (- 1) fmt0)) 6)) (not (>= (+ (s_count 3) (* (- 1) (s_count 4))) 0)) (not (<= (+ (s_count 3) (* (- 1) (s_count 4))) 0)) (not (= (+ fmt0 (* (- 1) fmt1)) (- 6))))) +(assert (or (not (>= fmt1 7)) (not (<= fmt1 6)))) +(assert (or (not (>= fmt1 7)) (not (= fmt1 6)))) +(assert (or (not (>= (+ arg1 (* (- 1) fmt0)) 0)) (not (>= (+ (s_count 2) (* (- 1) (s_count 3))) (- 1))) (not (>= (+ (s_count 1) (* (- 1) (s_count 2))) (- 1))) (not (= (+ (x_count (+ (- 2) (* (- 1) fmt0) fmt1)) (* (- 1) (x_count 1))) 0)) (not (>= (+ (x_count 0) (* (- 1) (x_count 1))) 0)) (not (<= (x_count 0) 0)) (not (>= (+ arg0 (* (- 1) arg1) (* 4 (s_count (+ (- 2) (* (- 1) fmt0) fmt1))) (* 4 (x_count (+ (- 2) (* (- 1) fmt0) fmt1)))) 0)) (not (>= distance 18)) (not (<= (+ arg0 (* (- 1) fmt0) distance) 0)) (not (<= (s_count 0) 0)) (not (>= (+ (s_count 0) (* (- 1) (s_count 1))) (- 1))) (not (>= (+ (s_count 3) (* (- 1) (s_count 4))) 0)) (not (>= (+ (s_count 4) (* (- 1) (s_count 5))) (- 1))) (not (= (+ fmt0 (* (- 1) fmt1)) (- 7))))) +(assert (or (<= (+ arg1 (* (- 1) fmt1)) 0) (not (<= (+ arg1 (* (- 1) fmt1)) (- 1))))) +(assert (or (= (+ arg1 (* (- 1) fmt1)) 1) (not (= (+ arg1 (* (- 1) fmt1)) 1)))) +(assert (or (not (>= (+ (s_count 0) (* (- 1) (s_count 1))) (- 1))) (not (<= (s_count 0) 1)) (not (>= (+ (s_count 1) (* (- 1) (s_count 2))) (- 1))) (not (>= (+ (s_count 2) (* (- 1) (s_count 3))) (- 1))) (not (= (+ (x_count (+ (- 2) (* (- 1) fmt0) fmt1)) (* (- 1) (x_count 1))) 0)) (not (>= (+ (x_count 0) (* (- 1) (x_count 1))) (- 1))) (>= (x_count 0) 1) (not (>= (+ arg0 (* (- 1) arg1) (* 4 (s_count (+ (- 2) (* (- 1) fmt0) fmt1))) (* 4 (x_count (+ (- 2) (* (- 1) fmt0) fmt1)))) 0)) (not (>= distance 18)) (not (<= (+ arg0 (* (- 1) fmt0) distance) 0)) (not (>= (+ arg1 (* (- 1) fmt0)) 6)) (not (= (+ fmt0 (* (- 1) fmt1)) (- 5))))) +(assert (or (not (>= (+ percent (* (- 1) (format 3))) 0)) (not (<= percent 37)) (not (>= s 115)) (not (<= (+ s (* (- 1) (format 3))) 0)))) +(assert (or (not (= fmt1 4)) (= (+ (format 2) (* (- 1) (format (+ 1 fmt1)))) 0) (not (>= (+ percent (* (- 1) (format 2))) 0)) (not (<= (+ percent (* (- 1) (format 2))) 0)) (not (>= (+ percent (* (- 1) (format 5))) 0)) (not (<= (+ percent (* (- 1) (format 5))) 0)))) +(assert (or (not (= (+ (format 2) (* (- 1) (format (+ 1 fmt1)))) 0)) (>= (+ (format 2) (* (- 1) (format (+ 1 fmt1)))) 0))) +(assert (or (not (>= (+ percent (* (- 1) (format 2))) 0)) (>= (+ percent (* (- 1) (format fmt1))) 0) (not (>= (+ s (* (- 1) (format 4))) 0)) (not (<= (+ s (* (- 1) (format 4))) 0)) (not (>= (+ s (* (- 1) (format 6))) 0)) (not (<= (+ s (* (- 1) (format 6))) 0)) (not (>= (+ percent (* (- 1) (format 2))) 0)) (not (<= (+ percent (* (- 1) (format 2))) 0)) (not (>= (+ percent (* (- 1) (format 5))) 0)) (not (<= (+ percent (* (- 1) (format 5))) 0)) (not (= fmt1 4)) (not (= arg1 6)) (not (>= (+ percent (* (- 1) (format 2))) 0)) (not (<= (+ percent (* (- 1) (format 2))) 0)) (not (= (+ (format arg1) (* (- 1) (format 2))) 0)) (not (>= (+ percent (* (- 1) (format 5))) 0)) (not (<= (+ percent (* (- 1) (format 5))) 0)))) +(assert (or (not (>= (+ (s_count 0) (* (- 1) (s_count 1))) (- 1))) (not (<= (s_count 0) 1)) (not (>= (+ (s_count 1) (* (- 1) (s_count 2))) (- 1))) (not (>= (+ (s_count 2) (* (- 1) (s_count 3))) (- 1))) (not (= (+ (x_count (+ (- 2) (* (- 1) fmt0) fmt1)) (* (- 1) (x_count 1))) 0)) (not (>= (+ (x_count 0) (* (- 1) (x_count 1))) (- 1))) (>= (x_count 0) 1) (not (>= (+ arg0 (* (- 1) arg1) (* 4 (s_count (+ (- 2) (* (- 1) fmt0) fmt1))) (* 4 (x_count (+ (- 2) (* (- 1) fmt0) fmt1)))) 0)) (not (>= distance 18)) (not (<= (+ arg0 (* (- 1) fmt0) distance) 0)) (not (>= (+ arg1 (* (- 1) fmt0)) 6)) (not (= (+ (s_count (+ (- 2) (* (- 1) fmt0) fmt1)) (* (- 1) (s_count 3))) 0)))) +(assert (or (not (<= percent 37)) (not (>= (+ percent (* (- 1) (format 2))) 0)) (not (>= s 115)) (not (<= (+ s (* (- 1) (format 3))) 0)) (not (= (+ (format 2) (* (- 1) (format 3))) 0)))) +(assert (or (not (>= (+ percent (* (- 1) (format 2))) 0)) (not (<= (+ percent (* (- 1) (format 2))) 0)) (not (>= (+ percent (* (- 1) (format 5))) 0)) (not (<= (+ percent (* (- 1) (format 5))) 0)) (not (= arg1 6)) (not (>= (+ s (* (- 1) (format 6))) 0)) (not (<= (+ s (* (- 1) (format 6))) 0)) (not (>= (+ s (* (- 1) (format 3))) 0)) (not (<= (+ s (* (- 1) (format 3))) 0)) (not (>= (+ percent (* (- 1) (format 2))) 0)) (not (<= (+ percent (* (- 1) (format 2))) 0)) (not (= (+ (format arg1) (* (- 1) (format 2))) 0)) (not (>= (+ percent (* (- 1) (format 5))) 0)) (not (<= (+ percent (* (- 1) (format 5))) 0)) (= (+ (format 2) (* (- 1) (format 3))) 0))) +(assert (or (= (+ (format arg1) (* (- 1) (format 2))) 0) (not (>= (+ (format arg1) (* (- 1) (format 2))) 0)) (not (<= (+ (format arg1) (* (- 1) (format 2))) 0)))) +(assert (or (>= (+ (format arg1) (* (- 1) (format 2))) 0) (<= (+ (format arg1) (* (- 1) (format 2))) 0))) +(assert (or (not (>= (+ percent (* (- 1) (format 5))) 0)) (not (<= (+ percent (* (- 1) (format 5))) 0)) (not (>= (+ percent (* (- 1) (format fmt1))) 0)) (not (<= (+ percent (* (- 1) (format fmt1))) 0)) (not (>= (+ s (* (- 1) (format 4))) 0)) (not (<= (+ s (* (- 1) (format 4))) 0)) (not (>= (+ s (* (- 1) (format 6))) 0)) (not (<= (+ s (* (- 1) (format 6))) 0)) (not (>= (+ percent (* (- 1) (format 2))) 0)) (not (<= (+ percent (* (- 1) (format 2))) 0)) (not (>= (+ percent (* (- 1) (format 5))) 0)) (not (<= (+ percent (* (- 1) (format 5))) 0)) (not (= fmt1 4)) (not (>= (+ s (* (- 1) (format 6))) 0)) (not (<= (+ s (* (- 1) (format 6))) 0)) (not (>= (+ s (* (- 1) (format 3))) 0)) (not (<= (+ s (* (- 1) (format 3))) 0)) (= (+ (format 2) (* (- 1) (format 3))) 0))) +(assert (or (not (>= (+ (s_count 2) (* (- 1) (s_count 3))) 0)) (not (<= (+ (s_count 2) (* (- 1) (s_count 3))) 0)) (not (= (+ fmt0 (* (- 1) fmt1)) (- 4))) (= (+ (s_count (+ (- 2) (* (- 1) fmt0) fmt1)) (* (- 1) (s_count 3))) 0))) +(assert (or (not (>= (+ (s_count 0) (* (- 1) (s_count 1))) (- 1))) (not (<= (s_count 0) 1)) (not (>= (+ (s_count 1) (* (- 1) (s_count 2))) (- 1))) (not (>= (+ (s_count 2) (* (- 1) (s_count 3))) (- 1))) (not (= (+ (x_count (+ (- 2) (* (- 1) fmt0) fmt1)) (* (- 1) (x_count 1))) 0)) (<= (+ (x_count 0) (* (- 1) (x_count 1))) (- 1)) (not (<= (x_count 0) 0)) (not (>= (+ arg0 (* (- 1) arg1) (* 4 (s_count (+ (- 2) (* (- 1) fmt0) fmt1))) (* 4 (x_count (+ (- 2) (* (- 1) fmt0) fmt1)))) 0)) (not (>= distance 18)) (not (<= (+ arg0 (* (- 1) fmt0) distance) 0)) (not (>= (+ arg1 (* (- 1) fmt0)) 2)) (not (= (+ (s_count (+ (- 2) (* (- 1) fmt0) fmt1)) (* (- 1) (s_count 3))) 0)))) +(assert (or (not (>= fmt1 8)) (not (= fmt1 4)))) +(assert (or (not (>= (+ arg1 (* (- 1) fmt0)) 0)) (not (>= (+ (s_count 2) (* (- 1) (s_count 3))) (- 1))) (not (>= (+ (s_count 1) (* (- 1) (s_count 2))) (- 1))) (not (= (+ (x_count (+ (- 2) (* (- 1) fmt0) fmt1)) (* (- 1) (x_count 1))) 0)) (not (>= (+ (x_count 0) (* (- 1) (x_count 1))) (- 1))) (not (<= (x_count 0) 0)) (not (>= (+ arg0 (* (- 1) arg1) (* 4 (s_count (+ (- 2) (* (- 1) fmt0) fmt1))) (* 4 (x_count (+ (- 2) (* (- 1) fmt0) fmt1)))) 0)) (not (>= distance 18)) (not (<= (+ arg0 (* (- 1) fmt0) distance) 0)) (not (<= (s_count 0) 0)) (not (>= (+ (s_count 0) (* (- 1) (s_count 1))) 0)) (not (>= (+ (s_count 3) (* (- 1) (s_count 4))) 0)) (not (>= (+ (s_count 4) (* (- 1) (s_count 5))) (- 1))) (not (= (+ fmt0 (* (- 1) fmt1)) (- 8))) (not (>= (+ (s_count 5) (* (- 1) (s_count 6))) 0)) (not (<= (+ (s_count 5) (* (- 1) (s_count 6))) 0)))) +(assert (or (not (>= (+ percent (* (- 1) (format fmt1))) 0)) (not (<= percent 37)) (not (>= s 115)) (not (<= (+ s (* (- 1) (format 3))) 0)) (not (= (+ (format fmt1) (* (- 1) (format 3))) 0)))) +(assert (or (not (>= s 115)) (not (<= (+ s (* (- 1) (format 3))) 0)) (not (<= (+ (format arg1) (* (- 1) (format 2))) 0)) (not (>= (+ percent (* (- 1) (format 2))) 0)) (not (<= percent 37)) (not (= (+ (format arg1) (* (- 1) (format 3))) 0)))) +(assert (or (not (>= x 120)) (not (<= (+ x (* (- 1) (format 2))) 0)) (not (<= s 115)) (not (>= (+ s (* (- 1) (format (+ 1 fmt1)))) 0)) (not (= (+ (format 2) (* (- 1) (format (+ 1 fmt1)))) 0)))) +(assert (or (<= (+ s (* (- 1) (format (+ 1 fmt1)))) 0) (not (<= (+ s (* (- 1) (format 6))) 0)) (not (= fmt1 7)) (not (>= (+ s (* (- 1) (format 8))) 0)) (not (<= (+ s (* (- 1) (format 8))) 0)) (not (>= (+ s (* (- 1) (format 6))) 0)) (not (<= (+ s (* (- 1) (format 6))) 0)))) +(assert (or (<= (+ percent (* (- 1) (format fmt1))) 0) (not (<= (+ percent (* (- 1) (format 1))) 0)) (not (= (+ (format fmt1) (* (- 1) (format 1))) 0)))) +(assert (or (not (>= (+ arg1 (* (- 1) fmt0)) 0)) (not (>= (+ (s_count 2) (* (- 1) (s_count 3))) (- 1))) (not (>= (+ (s_count 1) (* (- 1) (s_count 2))) (- 1))) (not (= (+ (x_count (+ (- 2) (* (- 1) fmt0) fmt1)) (* (- 1) (x_count 1))) 0)) (not (>= (+ (x_count 0) (* (- 1) (x_count 1))) (- 1))) (not (<= (x_count 0) 0)) (not (>= (+ arg0 (* (- 1) arg1) (* 4 (s_count (+ (- 2) (* (- 1) fmt0) fmt1))) (* 4 (x_count (+ (- 2) (* (- 1) fmt0) fmt1)))) 0)) (not (>= distance 18)) (not (<= (+ arg0 (* (- 1) fmt0) distance) 0)) (not (<= (s_count 0) 0)) (not (>= (+ (s_count 0) (* (- 1) (s_count 1))) 0)) (not (>= (+ (s_count 3) (* (- 1) (s_count 4))) 0)) (not (>= (+ (s_count 4) (* (- 1) (s_count 5))) (- 1))) (not (= (+ (s_count (+ (- 2) (* (- 1) fmt0) fmt1)) (* (- 1) (s_count 5))) 0)))) +(assert (or (not (>= (+ percent (* (- 1) (format 5))) 0)) (not (<= (+ percent (* (- 1) (format 5))) 0)) (not (>= (+ percent (* (- 1) (format 7))) 0)) (not (<= (+ percent (* (- 1) (format 7))) 0)) (not (= fmt1 7)) (not (>= (+ percent (* (- 1) (format 5))) 0)) (not (<= (+ percent (* (- 1) (format 5))) 0)) (not (>= (+ percent (* (- 1) (format 1))) 0)) (not (<= (+ percent (* (- 1) (format 1))) 0)) (= (+ (format fmt1) (* (- 1) (format 1))) 0))) +(assert (or (not (= (+ fmt0 (* (- 1) fmt1)) (- 7))) (= (+ (s_count (+ (- 2) (* (- 1) fmt0) fmt1)) (* (- 1) (s_count 5))) 0))) +(assert (or (not (<= (+ (s_count 2) (* (- 1) (s_count 3))) 0)) (>= (+ (s_count 1) (* (- 1) (s_count 2))) 0) (not (= (+ (s_count 1) (* (- 1) (s_count 3))) 0)))) +(assert (or (not (>= (+ percent (* (- 1) (format 6))) 0)) (not (<= (+ percent (* (- 1) (format 6))) 0)) (not (>= (+ percent (* (- 1) (format 2))) 0)) (not (<= (+ percent (* (- 1) (format 2))) 0)) (= (+ (format arg1) (* (- 1) (format 2))) 0) (not (= arg1 6)))) +(assert (or (not (= (+ (format arg1) (* (- 1) (format 2))) 0)) (>= (+ (format arg1) (* (- 1) (format 2))) 0))) +(assert (or (not (= fmt1 8)) (not (>= (+ percent (* (- 1) (format 6))) 0)) (not (<= (+ percent (* (- 1) (format 6))) 0)) (not (>= (+ percent (* (- 1) (format 2))) 0)) (not (<= (+ percent (* (- 1) (format 2))) 0)) (not (>= (+ s (* (- 1) (format 7))) 0)) (not (<= (+ s (* (- 1) (format 7))) 0)) (not (>= (+ s (* (- 1) (format 3))) 0)) (not (<= (+ s (* (- 1) (format 3))) 0)) (not (>= (+ percent (* (- 1) (format 6))) 0)) (not (<= (+ percent (* (- 1) (format 6))) 0)) (not (= (+ (format fmt1) (* (- 1) (format 1))) 0)) (not (>= (+ percent (* (- 1) (format 1))) 0)) (not (<= (+ percent (* (- 1) (format 1))) 0)) (= (+ (format 2) (* (- 1) (format 3))) 0) (not (>= (+ s (* (- 1) (format 8))) 0)) (not (<= (+ s (* (- 1) (format 8))) 0)) (not (>= (+ s (* (- 1) (format 7))) 0)) (not (<= (+ s (* (- 1) (format 7))) 0)))) +(assert (or (= (+ (format fmt1) (* (- 1) (format 1))) 0) (not (>= (+ (format fmt1) (* (- 1) (format 1))) 0)) (not (<= (+ (format fmt1) (* (- 1) (format 1))) 0)))) +(assert (or (>= (+ (format fmt1) (* (- 1) (format 1))) 0) (<= (+ (format fmt1) (* (- 1) (format 1))) 0))) +(assert (or (not (<= (+ percent (* (- 1) (format fmt1))) 0)) (not (>= (+ percent (* (- 1) (format 1))) 0)) (>= (+ (format fmt1) (* (- 1) (format 1))) 0))) +(assert (or (not (= fmt1 8)) (not (>= (+ s (* (- 1) (format 7))) 0)) (not (<= (+ s (* (- 1) (format 7))) 0)) (not (>= (+ s (* (- 1) (format 3))) 0)) (not (<= (+ s (* (- 1) (format 3))) 0)) (not (>= (+ s (* (- 1) (format 8))) 0)) (not (<= (+ s (* (- 1) (format 8))) 0)) (not (>= (+ s (* (- 1) (format 7))) 0)) (not (<= (+ s (* (- 1) (format 7))) 0)) (= (+ (format fmt1) (* (- 1) (format 3))) 0))) +(assert (or (not (= fmt1 8)) (not (>= (+ percent (* (- 1) (format 6))) 0)) (not (<= (+ percent (* (- 1) (format 6))) 0)) (not (>= (+ percent (* (- 1) (format 2))) 0)) (not (<= (+ percent (* (- 1) (format 2))) 0)) (not (>= (+ s (* (- 1) (format 7))) 0)) (not (<= (+ s (* (- 1) (format 7))) 0)) (not (>= (+ s (* (- 1) (format 3))) 0)) (not (<= (+ s (* (- 1) (format 3))) 0)) (= (+ (format 2) (* (- 1) (format 3))) 0) (not (>= (+ percent (* (- 1) (format 6))) 0)) (not (<= (+ percent (* (- 1) (format 6))) 0)) (not (>= (+ percent (* (- 1) (format 9))) 0)) (not (<= (+ percent (* (- 1) (format 9))) 0)) (not (>= (+ s (* (- 1) (format (+ 1 fmt1)))) 0)) (not (<= (+ s (* (- 1) (format (+ 1 fmt1)))) 0)) (not (>= (+ s (* (- 1) (format 7))) 0)) (not (<= (+ s (* (- 1) (format 7))) 0)))) +(assert (or (not (= fmt1 8)) (not (>= (+ percent (* (- 1) (format 6))) 0)) (not (<= (+ percent (* (- 1) (format 6))) 0)) (not (>= (+ percent (* (- 1) (format 2))) 0)) (not (<= (+ percent (* (- 1) (format 2))) 0)) (= (+ (format 2) (* (- 1) (format (+ 1 fmt1)))) 0) (not (>= (+ percent (* (- 1) (format 6))) 0)) (not (<= (+ percent (* (- 1) (format 6))) 0)) (not (>= (+ percent (* (- 1) (format 9))) 0)) (not (<= (+ percent (* (- 1) (format 9))) 0)))) +(assert (or (not (>= (+ (s_count 5) (* (- 1) (s_count 6))) (- 1))) (not (>= (+ (s_count 4) (* (- 1) (s_count 5))) (- 1))) (not (>= (+ (s_count 3) (* (- 1) (s_count 4))) (- 1))) (not (>= (+ (s_count 0) (* (- 1) (s_count 1))) (- 1))) (>= (s_count 0) 1) (not (>= (+ (s_count 1) (* (- 1) (s_count 2))) (- 1))) (not (>= (+ (s_count 2) (* (- 1) (s_count 3))) 0)) (not (= (+ (x_count (+ (- 2) (* (- 1) fmt0) fmt1)) (* (- 1) (x_count 1))) 0)) (not (>= (+ (x_count 0) (* (- 1) (x_count 1))) 0)) (not (<= (x_count 0) 0)) (not (>= (+ arg0 (* (- 1) arg1) (* 4 (s_count (+ (- 2) (* (- 1) fmt0) fmt1))) (* 4 (x_count (+ (- 2) (* (- 1) fmt0) fmt1)))) 0)) (not (>= distance 18)) (not (<= (+ arg0 (* (- 1) fmt0) distance) 0)) (not (>= (+ arg1 (* (- 1) fmt0)) 6)) (not (= (+ fmt0 (* (- 1) fmt1)) (- 8))))) +(assert (or (= (+ (format fmt1) (* (- 1) (format 3))) 0) (not (>= (+ (format fmt1) (* (- 1) (format 3))) 0)) (not (<= (+ (format fmt1) (* (- 1) (format 3))) 0)))) +(assert (or (>= (+ (format fmt1) (* (- 1) (format 3))) 0) (<= (+ (format fmt1) (* (- 1) (format 3))) 0))) +(assert (or (not (>= (+ (s_count 5) (* (- 1) (s_count 6))) (- 1))) (not (>= (+ (s_count 4) (* (- 1) (s_count 5))) (- 1))) (not (>= (+ (s_count 3) (* (- 1) (s_count 4))) (- 1))) (not (>= (+ (s_count 0) (* (- 1) (s_count 1))) (- 1))) (>= (s_count 0) 1) (not (>= (+ (s_count 1) (* (- 1) (s_count 2))) 0)) (not (>= (+ (s_count 2) (* (- 1) (s_count 3))) (- 1))) (not (= (+ (x_count (+ (- 2) (* (- 1) fmt0) fmt1)) (* (- 1) (x_count 1))) 0)) (not (>= (+ (x_count 0) (* (- 1) (x_count 1))) 0)) (not (<= (x_count 0) 0)) (not (>= (+ arg0 (* (- 1) arg1) (* 4 (s_count (+ (- 2) (* (- 1) fmt0) fmt1))) (* 4 (x_count (+ (- 2) (* (- 1) fmt0) fmt1)))) 0)) (not (>= distance 18)) (not (<= (+ arg0 (* (- 1) fmt0) distance) 0)) (not (>= (+ arg1 (* (- 1) fmt0)) 6)) (not (= (+ fmt0 (* (- 1) fmt1)) (- 8))))) +(assert (or (not (>= (+ percent (* (- 1) (format fmt1))) 0)) (not (>= s 115)) (not (<= percent 37)) (not (<= (+ s (* (- 1) (format 4))) 0)) (not (= (+ (format fmt1) (* (- 1) (format 4))) 0)))) +(assert (or (not (>= x 120)) (not (<= (+ x (* (- 1) (format 2))) 0)) (not (<= percent 37)) (not (>= (+ percent (* (- 1) (format 3))) 0)) (not (= (+ (format arg1) (* (- 1) (format 2))) 0)) (not (= (+ (format arg1) (* (- 1) (format 3))) 0)))) +(assert (or (not (>= x 120)) (not (<= (+ x (* (- 1) (format 2))) 0)) (not (<= percent 37)) (not (>= (+ percent (* (- 1) (format 3))) 0)) (not (= (+ (format 2) (* (- 1) (format 3))) 0)))) +(assert (or (not (= fmt1 8)) (not (>= (+ s (* (- 1) (format 8))) 0)) (not (<= (+ s (* (- 1) (format 8))) 0)) (not (>= (+ s (* (- 1) (format 7))) 0)) (not (<= (+ s (* (- 1) (format 7))) 0)) (not (>= (+ s (* (- 1) (format 4))) 0)) (not (<= (+ s (* (- 1) (format 4))) 0)) (not (>= (+ s (* (- 1) (format 7))) 0)) (not (<= (+ s (* (- 1) (format 7))) 0)) (= (+ (format fmt1) (* (- 1) (format 4))) 0))) +(assert (or (not (<= (format 8) 6)) (not (<= (+ percent (* (- 1) (format 8))) 0)) (not (>= percent 37)))) +(assert (or (not (>= (+ (s_count 5) (* (- 1) (s_count 6))) (- 1))) (not (>= (+ (s_count 4) (* (- 1) (s_count 5))) (- 1))) (not (>= (+ (s_count 3) (* (- 1) (s_count 4))) (- 1))) (<= (+ (s_count 0) (* (- 1) (s_count 1))) (- 1)) (not (<= (s_count 0) 0)) (not (>= (+ (s_count 1) (* (- 1) (s_count 2))) 0)) (not (>= (+ (s_count 2) (* (- 1) (s_count 3))) (- 1))) (not (= (+ (x_count (+ (- 2) (* (- 1) fmt0) fmt1)) (* (- 1) (x_count 1))) 0)) (not (>= (+ (x_count 0) (* (- 1) (x_count 1))) (- 1))) (not (<= (x_count 0) 0)) (not (>= (+ arg0 (* (- 1) arg1) (* 4 (s_count (+ (- 2) (* (- 1) fmt0) fmt1))) (* 4 (x_count (+ (- 2) (* (- 1) fmt0) fmt1)))) 0)) (not (>= distance 18)) (not (<= (+ arg0 (* (- 1) fmt0) distance) 0)) (not (>= (+ arg1 (* (- 1) fmt0)) 6)) (not (= (+ fmt0 (* (- 1) fmt1)) (- 8))))) +(assert (or (= (+ (x_count (+ (- 2) (* (- 1) fmt0) fmt1)) (* (- 1) (x_count 1))) 0) (not (>= (+ (x_count (+ (- 2) (* (- 1) fmt0) fmt1)) (* (- 1) (x_count 1))) 0)) (not (<= (+ (x_count (+ (- 2) (* (- 1) fmt0) fmt1)) (* (- 1) (x_count 1))) 0)))) +(assert (or (not (>= (+ s (* (- 1) (format 7))) 0)) (not (<= s 115)) (not (<= (+ x (* (- 1) (format 7))) 0)) (not (>= x 120)))) +(assert (or (>= (+ (x_count (+ (- 2) (* (- 1) fmt0) fmt1)) (* (- 1) (x_count 1))) 0) (<= (+ (x_count (+ (- 2) (* (- 1) fmt0) fmt1)) (* (- 1) (x_count 1))) 0))) +(assert (or (>= (+ (x_count (+ (- 2) (* (- 1) fmt0) fmt1)) (* (- 1) (x_count 7))) 0) (not (= (+ (x_count (+ (- 2) (* (- 1) fmt0) fmt1)) (* (- 1) (x_count 7))) 0)))) +(assert (or (not (<= (+ (x_count (+ (- 2) (* (- 1) fmt0) fmt1)) (* (- 1) (x_count 1))) 0)) (not (<= (+ (x_count 1) (* (- 1) (x_count 2))) 0)) (not (<= (+ (x_count 3) (* (- 1) (x_count 4))) 0)) (>= (+ (x_count 2) (* (- 1) (x_count 3))) 0) (not (= (+ fmt0 (* (- 1) fmt1)) (- 8))) (not (>= (+ (x_count 4) (* (- 1) (x_count 5))) 0)) (not (<= (+ (x_count 4) (* (- 1) (x_count 5))) 0)) (not (>= (+ (x_count 5) (* (- 1) (x_count 6))) 0)) (not (<= (+ (x_count 5) (* (- 1) (x_count 6))) 0)))) +(assert (or (not (>= (+ (s_count 5) (* (- 1) (s_count 6))) (- 1))) (not (>= (+ (s_count 4) (* (- 1) (s_count 5))) (- 1))) (not (>= (+ (s_count 3) (* (- 1) (s_count 4))) (- 1))) (not (>= (+ (s_count 0) (* (- 1) (s_count 1))) (- 1))) (not (<= (s_count 0) 1)) (<= (+ (s_count 1) (* (- 1) (s_count 2))) (- 1)) (not (>= (+ (s_count 2) (* (- 1) (s_count 3))) 0)) (>= (+ (x_count (+ (- 2) (* (- 1) fmt0) fmt1)) (* (- 1) (x_count 1))) 0) (not (>= (+ (x_count 0) (* (- 1) (x_count 1))) (- 1))) (not (<= (x_count 0) 0)) (not (>= (+ arg0 (* (- 1) arg1) (* 4 (s_count (+ (- 2) (* (- 1) fmt0) fmt1))) (* 4 (x_count (+ (- 2) (* (- 1) fmt0) fmt1)))) 0)) (not (>= distance 18)) (not (<= (+ arg0 (* (- 1) fmt0) distance) 0)) (not (>= (+ arg1 (* (- 1) fmt0)) 6)) (not (= (+ (s_count (+ (- 2) (* (- 1) fmt0) fmt1)) (* (- 1) (s_count 6))) 0)))) +(assert (or (not (= (+ fmt0 (* (- 1) fmt1)) (- 8))) (= (+ (s_count (+ (- 2) (* (- 1) fmt0) fmt1)) (* (- 1) (s_count 6))) 0))) +(assert (or (not (= (+ (s_count (+ (- 2) (* (- 1) fmt0) fmt1)) (* (- 1) (s_count 6))) 0)) (not (>= (+ arg1 (* (- 1) fmt0)) 0)) (not (<= (+ arg0 (* (- 1) fmt0) distance) 0)) (not (>= distance 18)) (not (>= (+ arg0 (* (- 1) arg1) (* 4 (s_count (+ (- 2) (* (- 1) fmt0) fmt1))) (* 4 (x_count (+ (- 2) (* (- 1) fmt0) fmt1)))) 0)) (not (<= (x_count 0) 1)) (not (>= (+ (x_count 0) (* (- 1) (x_count 1))) (- 1))) (not (>= (+ (s_count 2) (* (- 1) (s_count 3))) 0)) (not (>= (+ (s_count 1) (* (- 1) (s_count 2))) 0)) (not (<= (s_count 0) 0)) (not (>= (+ (s_count 0) (* (- 1) (s_count 1))) 0)) (not (>= (+ (s_count 3) (* (- 1) (s_count 4))) 0)) (not (>= (+ (s_count 4) (* (- 1) (s_count 5))) 0)) (not (>= (+ (s_count 5) (* (- 1) (s_count 6))) (- 1))) (not (= (+ (x_count (+ (- 2) (* (- 1) fmt0) fmt1)) (* (- 1) (x_count 7))) 0)) (not (>= (+ (x_count 2) (* (- 1) (x_count 3))) (- 1))) (not (>= (+ (x_count 4) (* (- 1) (x_count 5))) 0)) (not (>= (+ (x_count 6) (* (- 1) (x_count 7))) 0)) (not (>= (+ (x_count 5) (* (- 1) (x_count 6))) 0)) (not (>= (+ (x_count 3) (* (- 1) (x_count 4))) 0)) (not (>= (+ (x_count 1) (* (- 1) (x_count 2))) 0)))) +(assert (or (not (= (+ (s_count (+ (- 2) (* (- 1) fmt0) fmt1)) (* (- 1) (s_count 6))) 0)) (not (>= (+ arg1 (* (- 1) fmt0)) 0)) (not (<= (+ arg0 (* (- 1) fmt0) distance) 0)) (not (>= distance 18)) (not (>= (+ arg0 (* (- 1) arg1) (* 4 (s_count (+ (- 2) (* (- 1) fmt0) fmt1))) (* 4 (x_count (+ (- 2) (* (- 1) fmt0) fmt1)))) 0)) (not (<= (x_count 0) 1)) (not (>= (+ (x_count 0) (* (- 1) (x_count 1))) (- 1))) (not (>= (+ (s_count 2) (* (- 1) (s_count 3))) (- 1))) (not (>= (+ (s_count 1) (* (- 1) (s_count 2))) 0)) (not (<= (s_count 0) 0)) (not (>= (+ (s_count 0) (* (- 1) (s_count 1))) 0)) (not (>= (+ (s_count 3) (* (- 1) (s_count 4))) 0)) (not (>= (+ (s_count 4) (* (- 1) (s_count 5))) 0)) (not (>= (+ (s_count 5) (* (- 1) (s_count 6))) (- 1))) (>= (+ (x_count (+ (- 2) (* (- 1) fmt0) fmt1)) (* (- 1) (x_count 7))) 0) (not (>= (+ (x_count 2) (* (- 1) (x_count 3))) (- 1))) (not (>= (+ (x_count 4) (* (- 1) (x_count 5))) 0)) (not (>= (+ (x_count 6) (* (- 1) (x_count 7))) 0)) (not (>= (+ (x_count 5) (* (- 1) (x_count 6))) 0)) (not (>= (+ (x_count 3) (* (- 1) (x_count 4))) 0)) (not (>= (+ (x_count 1) (* (- 1) (x_count 2))) 0)))) +(assert (or (not (= (+ (s_count (+ (- 2) (* (- 1) fmt0) fmt1)) (* (- 1) (s_count 6))) 0)) (not (>= (+ arg1 (* (- 1) fmt0)) 0)) (not (<= (+ arg0 (* (- 1) fmt0) distance) 0)) (not (>= distance 18)) (not (>= (+ arg0 (* (- 1) arg1) (* 4 (s_count (+ (- 2) (* (- 1) fmt0) fmt1))) (* 4 (x_count (+ (- 2) (* (- 1) fmt0) fmt1)))) 0)) (not (<= (x_count 0) 1)) (not (>= (+ (x_count 0) (* (- 1) (x_count 1))) (- 1))) (not (>= (+ (s_count 2) (* (- 1) (s_count 3))) 0)) (not (>= (+ (s_count 1) (* (- 1) (s_count 2))) 0)) (not (<= (s_count 0) 0)) (not (>= (+ (s_count 0) (* (- 1) (s_count 1))) 0)) (not (>= (+ (s_count 3) (* (- 1) (s_count 4))) 0)) (not (>= (+ (s_count 4) (* (- 1) (s_count 5))) 0)) (not (>= (+ (s_count 5) (* (- 1) (s_count 6))) (- 1))) (not (>= (+ (x_count 1) (* (- 1) (x_count 2))) 0)) (not (>= (+ (x_count 3) (* (- 1) (x_count 4))) 0)) (not (>= (+ (x_count 2) (* (- 1) (x_count 3))) (- 1))) (not (= (+ fmt0 (* (- 1) fmt1)) (- 8))) (not (>= (+ (x_count 4) (* (- 1) (x_count 5))) 0)) (not (<= (+ (x_count 4) (* (- 1) (x_count 5))) 0)) (not (>= (+ (x_count 5) (* (- 1) (x_count 6))) 0)) (not (<= (+ (x_count 5) (* (- 1) (x_count 6))) 0)))) +(assert (or (not (>= x 120)) (not (<= (+ x (* (- 1) (format 5))) 0)) (not (<= s 115)) (not (>= (+ s (* (- 1) (format 5))) 0)))) +(assert (or (not (= (+ (s_count (+ (- 2) (* (- 1) fmt0) fmt1)) (* (- 1) (s_count 6))) 0)) (not (>= (+ arg1 (* (- 1) fmt0)) 0)) (not (<= (+ arg0 (* (- 1) fmt0) distance) 0)) (not (>= distance 18)) (not (>= (+ arg0 (* (- 1) arg1) (* 4 (s_count (+ (- 2) (* (- 1) fmt0) fmt1))) (* 4 (x_count (+ (- 2) (* (- 1) fmt0) fmt1)))) 0)) (not (<= (x_count 0) 1)) (not (>= (+ (x_count 0) (* (- 1) (x_count 1))) (- 1))) (not (>= (+ (s_count 2) (* (- 1) (s_count 3))) 0)) (not (>= (+ (s_count 1) (* (- 1) (s_count 2))) 0)) (not (<= (s_count 0) 0)) (not (>= (+ (s_count 0) (* (- 1) (s_count 1))) 0)) (not (>= (+ (s_count 3) (* (- 1) (s_count 4))) 0)) (not (>= (+ (s_count 4) (* (- 1) (s_count 5))) 0)) (not (>= (+ (s_count 5) (* (- 1) (s_count 6))) (- 1))) (not (>= (+ (x_count 1) (* (- 1) (x_count 2))) 0)) (not (>= (+ (x_count 3) (* (- 1) (x_count 4))) (- 1))) (not (>= (+ (x_count 2) (* (- 1) (x_count 3))) 0)) (not (= (+ fmt0 (* (- 1) fmt1)) (- 8))) (not (>= (+ (x_count 4) (* (- 1) (x_count 5))) 0)) (not (<= (+ (x_count 4) (* (- 1) (x_count 5))) 0)) (not (>= (+ (x_count 5) (* (- 1) (x_count 6))) 0)) (not (<= (+ (x_count 5) (* (- 1) (x_count 6))) 0)))) +(assert (or (not (>= (+ percent (* (- 1) (format 1))) 0)) (not (<= (+ percent (* (- 1) (format 1))) 0)) (not (>= (+ percent (* (- 1) (format 3))) 0)) (not (<= (+ percent (* (- 1) (format 3))) 0)) (not (>= (+ arg1 (* (- 1) fmt1)) 0)) (not (<= (+ arg1 (* (- 1) fmt1)) 0)) (not (= (+ (format arg1) (* (- 1) (format 3))) 0)) (= (+ (format fmt1) (* (- 1) (format 1))) 0))) +(assert (or (not (>= (+ arg1 (* (- 1) fmt1)) 0)) (not (<= (+ arg1 (* (- 1) fmt1)) 0)) (not (>= (+ percent (* (- 1) (format 6))) 0)) (not (<= (+ percent (* (- 1) (format 6))) 0)) (not (>= (+ percent (* (- 1) (format 1))) 0)) (not (<= (+ percent (* (- 1) (format 1))) 0)) (not (= arg1 6)) (= (+ (format fmt1) (* (- 1) (format 1))) 0))) +(assert (or (= (+ (format fmt1) (* (- 1) (format 4))) 0) (not (>= (+ (format fmt1) (* (- 1) (format 4))) 0)) (not (<= (+ (format fmt1) (* (- 1) (format 4))) 0)))) +(assert (or (<= (+ (format fmt1) (* (- 1) (format 3))) 0) (not (<= (+ percent (* (- 1) (format 3))) 0)) (not (= (+ (format fmt1) (* (- 1) (format 1))) 0)) (not (>= (+ percent (* (- 1) (format 1))) 0)))) +(assert (or (= (+ (format arg1) (* (- 1) (format 3))) 0) (not (>= (+ (format arg1) (* (- 1) (format 3))) 0)) (not (<= (+ (format arg1) (* (- 1) (format 3))) 0)))) +(assert (or (<= (+ (format arg1) (* (- 1) (format 3))) 0) (>= (+ (format arg1) (* (- 1) (format 3))) 0))) +(assert (or (<= (+ (format arg1) (* (- 1) (format 3))) 0) (not (<= (+ percent (* (- 1) (format 3))) 0)) (not (>= (+ percent (* (- 1) (format 1))) 0)) (not (>= (+ arg1 (* (- 1) fmt1)) 0)) (not (<= (+ arg1 (* (- 1) fmt1)) 0)) (not (= (+ (format fmt1) (* (- 1) (format 1))) 0)))) +(assert (or (>= (+ (format arg1) (* (- 1) (format 3))) 0) (not (>= (+ percent (* (- 1) (format 3))) 0)) (not (<= (+ percent (* (- 1) (format 1))) 0)) (not (>= (+ arg1 (* (- 1) fmt1)) 0)) (not (<= (+ arg1 (* (- 1) fmt1)) 0)) (not (= (+ (format fmt1) (* (- 1) (format 1))) 0)))) +(assert (or (<= (+ s (* (- 1) (format (+ 1 fmt1)))) 0) (not (<= (+ s (* (- 1) (format 7))) 0)) (not (= fmt1 6)))) +(assert (or (not (= (+ (s_count (+ (- 2) (* (- 1) fmt0) fmt1)) (* (- 1) (s_count 6))) 0)) (not (>= (+ arg1 (* (- 1) fmt0)) 0)) (not (<= (+ arg0 (* (- 1) fmt0) distance) 0)) (not (>= distance 18)) (not (>= (+ arg0 (* (- 1) arg1) (* 4 (s_count (+ (- 2) (* (- 1) fmt0) fmt1))) (* 4 (x_count (+ (- 2) (* (- 1) fmt0) fmt1)))) 0)) (not (<= (x_count 0) 1)) (not (>= (+ (x_count 0) (* (- 1) (x_count 1))) (- 1))) (not (>= (+ (s_count 2) (* (- 1) (s_count 3))) 0)) (not (>= (+ (s_count 1) (* (- 1) (s_count 2))) 0)) (not (<= (s_count 0) 0)) (not (>= (+ (s_count 0) (* (- 1) (s_count 1))) 0)) (not (>= (+ (s_count 3) (* (- 1) (s_count 4))) 0)) (not (>= (+ (s_count 4) (* (- 1) (s_count 5))) 0)) (not (>= (+ (s_count 5) (* (- 1) (s_count 6))) (- 1))) (not (>= (+ (x_count 1) (* (- 1) (x_count 2))) 0)) (not (>= (+ (x_count 3) (* (- 1) (x_count 4))) (- 1))) (not (>= (+ (x_count 2) (* (- 1) (x_count 3))) 0)) (not (= (+ (x_count (+ (- 2) (* (- 1) fmt0) fmt1)) (* (- 1) (x_count 4))) 0)))) +(assert (or (not (<= (+ (s_count 2) (* (- 1) (s_count 3))) 0)) (not (<= (+ (s_count 1) (* (- 1) (s_count 2))) 0)) (not (<= (+ (s_count 3) (* (- 1) (s_count 4))) 0)) (not (<= (+ (s_count 4) (* (- 1) (s_count 5))) 0)) (>= (+ (s_count 5) (* (- 1) (s_count 6))) 0) (not (= (+ (s_count 1) (* (- 1) (s_count 6))) 0)))) +(assert (or (not (>= (+ (s_count 3) (* (- 1) (s_count 4))) 0)) (not (<= (+ (s_count 3) (* (- 1) (s_count 4))) 0)) (not (>= (+ (s_count 2) (* (- 1) (s_count 3))) 0)) (not (<= (+ (s_count 2) (* (- 1) (s_count 3))) 0)) (not (>= (+ (s_count 1) (* (- 1) (s_count 2))) 0)) (not (<= (+ (s_count 1) (* (- 1) (s_count 2))) 0)) (= (+ (s_count 1) (* (- 1) (s_count 6))) 0) (not (= (+ fmt0 (* (- 1) fmt1)) (- 6))) (not (>= (+ (s_count 6) (* (- 1) (s_count 7))) 0)) (not (<= (+ (s_count 6) (* (- 1) (s_count 7))) 0)) (not (= (+ (s_count (+ (- 2) (* (- 1) fmt0) fmt1)) (* (- 1) (s_count 7))) 0)))) +(assert (or (= (+ (s_count (+ (- 2) (* (- 1) fmt0) fmt1)) (* (- 1) (s_count 6))) 0) (not (>= (+ (s_count (+ (- 2) (* (- 1) fmt0) fmt1)) (* (- 1) (s_count 6))) 0)) (not (<= (+ (s_count (+ (- 2) (* (- 1) fmt0) fmt1)) (* (- 1) (s_count 6))) 0)))) +(assert (or (>= (+ (s_count (+ (- 2) (* (- 1) fmt0) fmt1)) (* (- 1) (s_count 6))) 0) (<= (+ (s_count (+ (- 2) (* (- 1) fmt0) fmt1)) (* (- 1) (s_count 6))) 0))) +(assert (or (= (+ (s_count (+ (- 2) (* (- 1) fmt0) fmt1)) (* (- 1) (s_count 1))) 0) (not (>= (+ (s_count (+ (- 2) (* (- 1) fmt0) fmt1)) (* (- 1) (s_count 1))) 0)) (not (<= (+ (s_count (+ (- 2) (* (- 1) fmt0) fmt1)) (* (- 1) (s_count 1))) 0)))) +(assert (or (= (+ (s_count (+ (- 2) (* (- 1) fmt0) fmt1)) (* (- 1) (s_count 3))) 0) (not (>= (+ (s_count (+ (- 2) (* (- 1) fmt0) fmt1)) (* (- 1) (s_count 3))) 0)) (not (<= (+ (s_count (+ (- 2) (* (- 1) fmt0) fmt1)) (* (- 1) (s_count 3))) 0)))) +(assert (or (= (+ (s_count (+ (- 2) (* (- 1) fmt0) fmt1)) (* (- 1) (s_count 5))) 0) (not (>= (+ (s_count (+ (- 2) (* (- 1) fmt0) fmt1)) (* (- 1) (s_count 5))) 0)) (not (<= (+ (s_count (+ (- 2) (* (- 1) fmt0) fmt1)) (* (- 1) (s_count 5))) 0)))) +(assert (or (>= (+ (s_count (+ (- 2) (* (- 1) fmt0) fmt1)) (* (- 1) (s_count 5))) 0) (<= (+ (s_count (+ (- 2) (* (- 1) fmt0) fmt1)) (* (- 1) (s_count 5))) 0))) +(assert (or (>= (+ (s_count (+ (- 2) (* (- 1) fmt0) fmt1)) (* (- 1) (s_count 3))) 0) (<= (+ (s_count (+ (- 2) (* (- 1) fmt0) fmt1)) (* (- 1) (s_count 3))) 0))) +(assert (or (>= (+ (s_count (+ (- 2) (* (- 1) fmt0) fmt1)) (* (- 1) (s_count 1))) 0) (<= (+ (s_count (+ (- 2) (* (- 1) fmt0) fmt1)) (* (- 1) (s_count 1))) 0))) +(assert (or (not (>= (+ (s_count 3) (* (- 1) (s_count 4))) 0)) (not (<= (+ (s_count 3) (* (- 1) (s_count 4))) 0)) (not (>= (+ (s_count 2) (* (- 1) (s_count 3))) 0)) (not (<= (+ (s_count 2) (* (- 1) (s_count 3))) 0)) (not (>= (+ (s_count 1) (* (- 1) (s_count 2))) 0)) (not (<= (+ (s_count 1) (* (- 1) (s_count 2))) 0)) (not (= (+ fmt0 (* (- 1) fmt1)) (- 6))) (= (+ (s_count (+ (- 2) (* (- 1) fmt0) fmt1)) (* (- 1) (s_count 1))) 0))) +(assert (or (not (= (+ (s_count (+ (- 2) (* (- 1) fmt0) fmt1)) (* (- 1) (s_count 1))) 0)) (>= (+ (s_count (+ (- 2) (* (- 1) fmt0) fmt1)) (* (- 1) (s_count 1))) 0))) +(assert (or (not (= (+ fmt0 (* (- 1) fmt1)) (- 6))) (= (+ (x_count (+ (- 2) (* (- 1) fmt0) fmt1)) (* (- 1) (x_count 4))) 0))) +(assert (or (not (= (+ (s_count (+ (- 2) (* (- 1) fmt0) fmt1)) (* (- 1) (s_count 1))) 0)) (not (>= (+ arg1 (* (- 1) fmt0)) 0)) (not (<= (+ arg0 (* (- 1) fmt0) distance) 0)) (not (>= distance 18)) (not (>= (+ arg0 (* (- 1) arg1) (* 4 (s_count (+ (- 2) (* (- 1) fmt0) fmt1))) (* 4 (x_count (+ (- 2) (* (- 1) fmt0) fmt1)))) 0)) (not (<= (x_count 0) 1)) (not (>= (+ (x_count 0) (* (- 1) (x_count 1))) (- 1))) (not (<= (s_count 0) 1)) (not (>= (+ (s_count 0) (* (- 1) (s_count 1))) 0)) (not (>= (+ (x_count 1) (* (- 1) (x_count 2))) 0)) (not (>= (+ (x_count 3) (* (- 1) (x_count 4))) (- 1))) (not (>= (+ (x_count 2) (* (- 1) (x_count 3))) 0)) (not (= (+ (x_count (+ (- 2) (* (- 1) fmt0) fmt1)) (* (- 1) (x_count 4))) 0)))) +(assert (or (not (>= (+ (x_count 4) (* (- 1) (x_count 5))) 0)) (not (<= (+ (x_count 4) (* (- 1) (x_count 5))) 0)) (not (= (+ fmt0 (* (- 1) fmt1)) (- 7))) (= (+ (x_count (+ (- 2) (* (- 1) fmt0) fmt1)) (* (- 1) (x_count 4))) 0))) +(assert (or (not (= (+ (s_count (+ (- 2) (* (- 1) fmt0) fmt1)) (* (- 1) (s_count 1))) 0)) (not (>= (+ arg1 (* (- 1) fmt0)) 0)) (not (<= (+ arg0 (* (- 1) fmt0) distance) 0)) (not (>= distance 18)) (not (>= (+ arg0 (* (- 1) arg1) (* 4 (s_count (+ (- 2) (* (- 1) fmt0) fmt1))) (* 4 (x_count (+ (- 2) (* (- 1) fmt0) fmt1)))) 0)) (not (<= (x_count 0) 1)) (not (<= (s_count 0) 1)) (not (>= (+ (s_count 0) (* (- 1) (s_count 1))) (- 1))) (not (= (+ fmt0 (* (- 1) fmt1)) (- 2))))) +(assert (or (not (<= (+ s (* (- 1) (format 7))) 0)) (not (>= s 115)) (not (<= percent 37)) (not (>= (+ percent (* (- 1) (format 1))) 0)) (not (= (+ (format 1) (* (- 1) (format 7))) 0)))) +(assert (or (not (>= x 120)) (not (<= (+ x (* (- 1) (format 2))) 0)) (not (<= percent 37)) (not (>= (+ percent (* (- 1) (format 1))) 0)) (not (= (+ (format 1) (* (- 1) (format 2))) 0)))) +(assert (or (not (>= (+ (s_count 2) (* (- 1) (s_count 3))) 0)) (not (<= (+ (s_count 2) (* (- 1) (s_count 3))) 0)) (not (>= (+ (s_count 1) (* (- 1) (s_count 2))) 0)) (not (<= (+ (s_count 1) (* (- 1) (s_count 2))) 0)) (not (= (+ (s_count (+ (- 2) (* (- 1) fmt0) fmt1)) (* (- 1) (s_count 3))) 0)) (= (+ (s_count (+ (- 2) (* (- 1) fmt0) fmt1)) (* (- 1) (s_count 1))) 0))) +(assert (or (<= (+ (s_count 6) (* (- 1) (s_count 7))) (- 1)) (>= (+ (s_count (+ (- 2) (* (- 1) fmt0) fmt1)) (* (- 1) (s_count 7))) 0) (not (>= (+ (s_count 2) (* (- 1) (s_count 3))) 0)) (not (>= (+ (s_count 1) (* (- 1) (s_count 2))) 0)) (not (>= (+ (s_count 3) (* (- 1) (s_count 4))) 0)) (not (>= (+ (s_count 4) (* (- 1) (s_count 5))) 0)) (not (>= (+ (s_count 5) (* (- 1) (s_count 6))) (- 1))) (<= (+ (s_count (+ (- 2) (* (- 1) fmt0) fmt1)) (* (- 1) (s_count 1))) 0))) +(assert (or (<= (+ (s_count (+ (- 2) (* (- 1) fmt0) fmt1)) (* (- 1) (s_count 1))) 0) (not (>= (+ (s_count 5) (* (- 1) (s_count 6))) (- 1))) (not (>= (+ (s_count 4) (* (- 1) (s_count 5))) 0)) (not (>= (+ (s_count 3) (* (- 1) (s_count 4))) 0)) (not (>= (+ (s_count 1) (* (- 1) (s_count 2))) 0)) (not (>= (+ (s_count 2) (* (- 1) (s_count 3))) 0)) (>= (+ (s_count (+ (- 2) (* (- 1) fmt0) fmt1)) (* (- 1) (s_count 6))) 0))) +(assert (or (not (<= (+ (s_count (+ (- 2) (* (- 1) fmt0) fmt1)) (* (- 1) (s_count 1))) 0)) (not (<= (+ (s_count 1) (* (- 1) (s_count 2))) 0)) (not (<= (+ (s_count 2) (* (- 1) (s_count 3))) 0)) (<= (+ (s_count (+ (- 2) (* (- 1) fmt0) fmt1)) (* (- 1) (s_count 3))) 0))) +(assert (or (not (>= (+ percent (* (- 1) (format 4))) 0)) (not (<= (+ percent (* (- 1) (format 4))) 0)) (not (>= (+ percent (* (- 1) (format 1))) 0)) (not (<= (+ percent (* (- 1) (format 1))) 0)) (not (= (+ (format fmt1) (* (- 1) (format 4))) 0)) (not (= fmt1 2)) (= (+ (format 1) (* (- 1) (format 2))) 0))) +(assert (or (>= (+ (format fmt1) (* (- 1) (format 4))) 0) (not (>= (+ percent (* (- 1) (format 4))) 0)) (not (= (+ (format fmt1) (* (- 1) (format 1))) 0)) (not (<= (+ percent (* (- 1) (format 1))) 0)))) +(assert (or (>= (+ (format fmt1) (* (- 1) (format 4))) 0) (not (>= (+ percent (* (- 1) (format 4))) 0)) (not (<= (+ percent (* (- 1) (format fmt1))) 0)))) +(assert (or (not (<= (+ (format fmt1) (* (- 1) (format 4))) 0)) (not (>= (+ percent (* (- 1) (format 4))) 0)) (<= (+ (format fmt1) (* (- 1) (format 1))) 0) (not (<= (+ percent (* (- 1) (format 1))) 0)))) +(assert (or (not (= fmt1 2)) (not (>= (+ percent (* (- 1) (format 1))) 0)) (not (<= (+ percent (* (- 1) (format 1))) 0)) (not (>= (+ percent (* (- 1) (format 3))) 0)) (not (<= (+ percent (* (- 1) (format 3))) 0)) (= (+ (format 1) (* (- 1) (format 7))) 0) (not (>= (+ s (* (- 1) (format (+ 1 fmt1)))) 0)) (not (<= (+ s (* (- 1) (format (+ 1 fmt1)))) 0)) (not (>= (+ s (* (- 1) (format 7))) 0)) (not (<= (+ s (* (- 1) (format 7))) 0)))) +(assert (or (not (>= (+ (s_count 0) (* (- 1) (s_count 1))) 0)) (not (<= (+ (s_count 0) (* (- 1) (s_count 1))) 0)) (not (= (+ fmt0 (* (- 1) fmt1)) (- 2))) (= (+ (s_count (+ (- 2) (* (- 1) fmt0) fmt1)) (* (- 1) (s_count 1))) 0))) +(assert (or (not (>= (+ (x_count 2) (* (- 1) (x_count 3))) 0)) (not (<= (+ (x_count 2) (* (- 1) (x_count 3))) 0)) (not (= (+ (x_count (+ (- 2) (* (- 1) fmt0) fmt1)) (* (- 1) (x_count 4))) 0)) (not (>= (+ (x_count 3) (* (- 1) (x_count 4))) 0)) (not (<= (+ (x_count 3) (* (- 1) (x_count 4))) 0)) (not (>= (+ (x_count 1) (* (- 1) (x_count 2))) 0)) (not (<= (+ (x_count 1) (* (- 1) (x_count 2))) 0)) (= (+ (x_count (+ (- 2) (* (- 1) fmt0) fmt1)) (* (- 1) (x_count 1))) 0))) +(assert (or (not (= (+ (s_count (+ (- 2) (* (- 1) fmt0) fmt1)) (* (- 1) (s_count 6))) 0)) (not (<= (+ (s_count 3) (* (- 1) (s_count 4))) 0)) (not (<= (+ (s_count 4) (* (- 1) (s_count 5))) 0)) (not (<= (+ (s_count 5) (* (- 1) (s_count 6))) 0)) (>= (+ (s_count (+ (- 2) (* (- 1) fmt0) fmt1)) (* (- 1) (s_count 3))) 0))) +(assert (or (not (<= (+ (s_count (+ (- 2) (* (- 1) fmt0) fmt1)) (* (- 1) (s_count 1))) 0)) (not (<= (+ (s_count 5) (* (- 1) (s_count 6))) 0)) (>= (+ (s_count 4) (* (- 1) (s_count 5))) 0) (not (<= (+ (s_count 3) (* (- 1) (s_count 4))) 0)) (not (<= (+ (s_count 1) (* (- 1) (s_count 2))) 0)) (not (<= (+ (s_count 2) (* (- 1) (s_count 3))) 0)) (not (= (+ (s_count (+ (- 2) (* (- 1) fmt0) fmt1)) (* (- 1) (s_count 6))) 0)))) +(assert (or (not (= (+ (s_count (+ (- 2) (* (- 1) fmt0) fmt1)) (* (- 1) (s_count 6))) 0)) (>= (+ (s_count (+ (- 2) (* (- 1) fmt0) fmt1)) (* (- 1) (s_count 6))) 0))) +(assert (or (not (>= fmt1 8)) (not (<= fmt1 6)))) + +(assert (or (not (= (+ fmt0 (* (- 1) fmt1)) (- 8))) (= (+ (x_count (+ (- 2) (* (- 1) fmt0) fmt1)) (* (- 1) (x_count 1))) 0) (not (>= (+ (x_count 4) (* (- 1) (x_count 5))) 0)) (not (<= (+ (x_count 4) (* (- 1) (x_count 5))) 0)) (not (>= (+ (x_count 2) (* (- 1) (x_count 3))) 0)) (not (<= (+ (x_count 2) (* (- 1) (x_count 3))) 0)) (not (>= (+ (x_count 5) (* (- 1) (x_count 6))) 0)) (not (<= (+ (x_count 5) (* (- 1) (x_count 6))) 0)) (not (>= (+ (x_count 3) (* (- 1) (x_count 4))) 0)) (not (<= (+ (x_count 3) (* (- 1) (x_count 4))) 0)) (not (>= (+ (x_count 1) (* (- 1) (x_count 2))) 0)) (not (<= (+ (x_count 1) (* (- 1) (x_count 2))) 0)))) +(assert (or (= (+ (s_count 1) (* (- 1) (s_count 6))) 0) (not (>= (+ (s_count 1) (* (- 1) (s_count 6))) 0)) (not (<= (+ (s_count 1) (* (- 1) (s_count 6))) 0)))) +(assert (or (not (<= (+ (s_count 2) (* (- 1) (s_count 3))) 0)) (not (<= (+ (s_count 1) (* (- 1) (s_count 2))) 0)) (not (<= (+ (s_count 3) (* (- 1) (s_count 4))) 0)) (not (<= (+ (s_count 4) (* (- 1) (s_count 5))) 0)) (not (<= (+ (s_count 5) (* (- 1) (s_count 6))) 0)) (<= (+ (s_count 1) (* (- 1) (s_count 6))) 0))) +(assert (or (not (= (+ (s_count (+ (- 2) (* (- 1) fmt0) fmt1)) (* (- 1) (s_count 6))) 0)) (not (>= (+ (s_count 2) (* (- 1) (s_count 3))) (- 1))) (not (>= (+ (s_count 1) (* (- 1) (s_count 2))) (- 1))) (not (>= (+ (s_count 3) (* (- 1) (s_count 4))) (- 1))) (<= (+ (s_count 4) (* (- 1) (s_count 5))) (- 1)) (not (>= (+ (s_count 5) (* (- 1) (s_count 6))) 0)) (not (>= (+ arg1 (* (- 1) fmt0)) 6)) (not (<= (+ arg0 (* (- 1) fmt0) distance) 0)) (not (>= distance 18)) (not (>= (+ arg0 (* (- 1) arg1) (* 4 (s_count (+ (- 2) (* (- 1) fmt0) fmt1))) (* 4 (x_count (+ (- 2) (* (- 1) fmt0) fmt1)))) 0)) (not (<= (x_count 0) 0)) (not (>= (+ (x_count 0) (* (- 1) (x_count 1))) (- 1))) (not (<= (s_count 0) 0)) (not (>= (+ (s_count 0) (* (- 1) (s_count 1))) 0)) (not (>= (+ (x_count 1) (* (- 1) (x_count 2))) 0)) (not (>= (+ (x_count 3) (* (- 1) (x_count 4))) 0)) (not (>= (+ (x_count 5) (* (- 1) (x_count 6))) (- 1))) (not (>= (+ (x_count 4) (* (- 1) (x_count 5))) 0)) (not (>= (+ (x_count 2) (* (- 1) (x_count 3))) 0)) (not (= (+ fmt0 (* (- 1) fmt1)) (- 8))))) +(assert (or (not (>= s 115)) (not (<= (+ s (* (- 1) (format (+ 1 fmt1)))) 0)) (not (>= (+ percent (* (- 1) (format 1))) 0)) (not (<= percent 37)) (not (= (+ (format 1) (* (- 1) (format (+ 1 fmt1)))) 0)))) +(assert (or (not (<= (+ (format fmt1) (* (- 1) (format 4))) 0)) (not (>= (+ percent (* (- 1) (format 4))) 0)) (not (>= x 120)) (not (<= (+ x (* (- 1) (format 2))) 0)) (not (<= percent 37)) (not (= (+ (format fmt1) (* (- 1) (format 2))) 0)))) +(assert (or (not (= fmt1 8)) (not (>= (+ x (* (- 1) (format 7))) 0)) (not (<= (+ x (* (- 1) (format 7))) 0)) (not (>= (+ x (* (- 1) (format 1))) 0)) (not (<= (+ x (* (- 1) (format 1))) 0)) (= (+ (format fmt1) (* (- 1) (format 1))) 0) (not (>= (+ x (* (- 1) (format 7))) 0)) (not (<= (+ x (* (- 1) (format 7))) 0)) (not (>= (+ x (* (- 1) (format 8))) 0)) (not (<= (+ x (* (- 1) (format 8))) 0)))) +(assert (or (not (= (+ (s_count (+ (- 2) (* (- 1) fmt0) fmt1)) (* (- 1) (s_count 6))) 0)) (not (>= (+ (s_count 2) (* (- 1) (s_count 3))) (- 1))) (not (>= (+ (s_count 1) (* (- 1) (s_count 2))) (- 1))) (not (>= (+ (s_count 3) (* (- 1) (s_count 4))) (- 1))) (<= (+ (s_count 4) (* (- 1) (s_count 5))) (- 1)) (not (>= (+ (s_count 5) (* (- 1) (s_count 6))) 0)) (not (>= (+ arg1 (* (- 1) fmt0)) 6)) (not (<= (+ arg0 (* (- 1) fmt0) distance) 0)) (not (>= distance 18)) (not (>= (+ arg0 (* (- 1) arg1) (* 4 (s_count (+ (- 2) (* (- 1) fmt0) fmt1))) (* 4 (x_count (+ (- 2) (* (- 1) fmt0) fmt1)))) 0)) (not (<= (x_count 0) 1)) (not (>= (+ (x_count 0) (* (- 1) (x_count 1))) 0)) (not (<= (s_count 0) 0)) (not (>= (+ (s_count 0) (* (- 1) (s_count 1))) 0)) (not (>= (+ (x_count 1) (* (- 1) (x_count 2))) 0)) (not (>= (+ (x_count 3) (* (- 1) (x_count 4))) 0)) (not (>= (+ (x_count 5) (* (- 1) (x_count 6))) (- 1))) (not (>= (+ (x_count 4) (* (- 1) (x_count 5))) 0)) (not (>= (+ (x_count 2) (* (- 1) (x_count 3))) 0)) (not (= (+ fmt0 (* (- 1) fmt1)) (- 8))))) +(assert (or (not (>= s 115)) (not (<= (+ s (* (- 1) (format (+ 1 fmt1)))) 0)) (not (>= (+ percent (* (- 1) (format 0))) 0)) (not (<= percent 37)) (not (= (+ (format 0) (* (- 1) (format (+ 1 fmt1)))) 0)))) +(assert (or (not (>= (format 8) 255)) (not (<= percent 37)) (not (<= (+ (format fmt1) (* (- 1) (format 4))) 0)) (not (>= (+ percent (* (- 1) (format 4))) 0)) (not (= (+ (format fmt1) (* (- 1) (format 8))) 0)))) +(assert (or (not (>= x 120)) (not (<= s 115)) (not (>= (+ s (* (- 1) (format 1))) 0)) (not (<= (+ x (* (- 1) (format 10))) 0)) (not (= (+ (format 1) (* (- 1) (format 10))) 0)))) +(assert (or (not (>= x 120)) (not (<= s 115)) (not (>= (+ s (* (- 1) (format 1))) 0)) (not (<= (+ x (* (- 1) (format 7))) 0)) (not (= (+ (format 1) (* (- 1) (format 7))) 0)))) +(assert (or (not (>= (+ x (* (- 1) (format 7))) 0)) (not (<= (+ x (* (- 1) (format 7))) 0)) (not (>= (+ x (* (- 1) (format 2))) 0)) (not (<= (+ x (* (- 1) (format 2))) 0)) (not (= (+ (format 1) (* (- 1) (format 2))) 0)) (= (+ (format 1) (* (- 1) (format 7))) 0))) +(assert (or (not (= fmt1 8)) (= (+ (format fmt1) (* (- 1) (format 8))) 0))) +(assert (or (<= (+ (format fmt1) (* (- 1) (format 4))) 0) (>= (+ (format fmt1) (* (- 1) (format 4))) 0))) +(assert (or (not (= (+ (format fmt1) (* (- 1) (format 8))) 0)) (not (>= (format 8) 255)) (not (<= s 115)) (not (>= (+ s (* (- 1) (format 1))) 0)) (not (<= (+ (format fmt1) (* (- 1) (format 1))) 0)))) +(assert (or (not (= (+ (format fmt1) (* (- 1) (format 8))) 0)) (not (<= percent 37)) (not (>= (format 8) 255)) (not (>= (+ percent (* (- 1) (format fmt1))) 0)))) +(assert (or (not (= fmt1 8)) (not (>= (+ percent (* (- 1) (format 6))) 0)) (not (<= (+ percent (* (- 1) (format 6))) 0)) (not (>= (+ percent (* (- 1) (format 9))) 0)) (not (<= (+ percent (* (- 1) (format 9))) 0)) (not (>= (+ percent (* (- 1) (format 6))) 0)) (not (<= (+ percent (* (- 1) (format 6))) 0)) (not (>= (+ percent (* (- 1) (format 0))) 0)) (not (<= (+ percent (* (- 1) (format 0))) 0)) (= (+ (format 0) (* (- 1) (format (+ 1 fmt1)))) 0))) +(assert (or (not (= (+ (s_count (+ (- 2) (* (- 1) fmt0) fmt1)) (* (- 1) (s_count 6))) 0)) (not (>= (+ (s_count 2) (* (- 1) (s_count 3))) (- 1))) (not (>= (+ (s_count 1) (* (- 1) (s_count 2))) (- 1))) (not (>= (+ (s_count 3) (* (- 1) (s_count 4))) (- 1))) (<= (+ (s_count 4) (* (- 1) (s_count 5))) (- 1)) (not (>= (+ (s_count 5) (* (- 1) (s_count 6))) 0)) (not (>= (+ arg1 (* (- 1) fmt0)) 6)) (not (<= (+ arg0 (* (- 1) fmt0) distance) 0)) (not (>= distance 18)) (not (>= (+ arg0 (* (- 1) arg1) (* 4 (s_count (+ (- 2) (* (- 1) fmt0) fmt1))) (* 4 (x_count (+ (- 2) (* (- 1) fmt0) fmt1)))) 0)) (not (<= (x_count 0) 0)) (not (>= (+ (x_count 0) (* (- 1) (x_count 1))) 0)) (not (<= (s_count 0) 1)) (not (>= (+ (s_count 0) (* (- 1) (s_count 1))) 0)) (not (>= (+ (x_count 1) (* (- 1) (x_count 2))) 0)) (not (>= (+ (x_count 3) (* (- 1) (x_count 4))) 0)) (not (>= (+ (x_count 5) (* (- 1) (x_count 6))) (- 1))) (not (>= (+ (x_count 4) (* (- 1) (x_count 5))) 0)) (not (>= (+ (x_count 2) (* (- 1) (x_count 3))) 0)) (not (= (+ fmt0 (* (- 1) fmt1)) (- 8))))) +(assert (or (not (= (+ (s_count (+ (- 2) (* (- 1) fmt0) fmt1)) (* (- 1) (s_count 6))) 0)) (not (>= (+ (s_count 2) (* (- 1) (s_count 3))) (- 1))) (not (>= (+ (s_count 1) (* (- 1) (s_count 2))) (- 1))) (<= (+ (s_count 3) (* (- 1) (s_count 4))) (- 1)) (not (>= (+ (s_count 4) (* (- 1) (s_count 5))) 0)) (not (>= (+ (s_count 5) (* (- 1) (s_count 6))) 0)) (not (>= (+ arg1 (* (- 1) fmt0)) 6)) (not (<= (+ arg0 (* (- 1) fmt0) distance) 0)) (not (>= distance 18)) (not (>= (+ arg0 (* (- 1) arg1) (* 4 (s_count (+ (- 2) (* (- 1) fmt0) fmt1))) (* 4 (x_count (+ (- 2) (* (- 1) fmt0) fmt1)))) 0)) (not (<= (x_count 0) 0)) (not (>= (+ (x_count 0) (* (- 1) (x_count 1))) 0)) (not (<= (s_count 0) 1)) (not (>= (+ (s_count 0) (* (- 1) (s_count 1))) 0)) (not (>= (+ (x_count 1) (* (- 1) (x_count 2))) 0)) (not (>= (+ (x_count 3) (* (- 1) (x_count 4))) (- 1))) (not (>= (+ (x_count 5) (* (- 1) (x_count 6))) (- 1))) (not (>= (+ (x_count 4) (* (- 1) (x_count 5))) 0)) (not (>= (+ (x_count 2) (* (- 1) (x_count 3))) 0)) (not (= (+ fmt0 (* (- 1) fmt1)) (- 8))))) +(assert (or (not (= (+ (s_count (+ (- 2) (* (- 1) fmt0) fmt1)) (* (- 1) (s_count 1))) 0)) (>= (+ (s_count 5) (* (- 1) (s_count 6))) 0) (not (<= (+ (s_count 4) (* (- 1) (s_count 5))) 0)) (not (<= (+ (s_count 3) (* (- 1) (s_count 4))) 0)) (not (<= (+ (s_count 1) (* (- 1) (s_count 2))) 0)) (not (<= (+ (s_count 2) (* (- 1) (s_count 3))) 0)) (not (= (+ (s_count (+ (- 2) (* (- 1) fmt0) fmt1)) (* (- 1) (s_count 6))) 0)))) +(assert (or (not (= (+ (s_count (+ (- 2) (* (- 1) fmt0) fmt1)) (* (- 1) (s_count 6))) 0)) (not (<= (+ (s_count 5) (* (- 1) (s_count 6))) 0)) (>= (+ (s_count (+ (- 2) (* (- 1) fmt0) fmt1)) (* (- 1) (s_count 5))) 0))) +(assert (or (not (= (+ fmt0 (* (- 1) fmt1)) (- 8))) (not (>= (+ (x_count 4) (* (- 1) (x_count 5))) 0)) (not (<= (+ (x_count 4) (* (- 1) (x_count 5))) 0)) (not (>= (+ (x_count 5) (* (- 1) (x_count 6))) 0)) (not (<= (+ (x_count 5) (* (- 1) (x_count 6))) 0)) (= (+ (x_count (+ (- 2) (* (- 1) fmt0) fmt1)) (* (- 1) (x_count 4))) 0))) +(assert (or (not (= (+ (s_count (+ (- 2) (* (- 1) fmt0) fmt1)) (* (- 1) (s_count 6))) 0)) (not (>= (+ (s_count 2) (* (- 1) (s_count 3))) (- 1))) (not (>= (+ (s_count 1) (* (- 1) (s_count 2))) (- 1))) (<= (+ (s_count 3) (* (- 1) (s_count 4))) (- 1)) (not (>= (+ (s_count 4) (* (- 1) (s_count 5))) 0)) (not (>= (+ (s_count 5) (* (- 1) (s_count 6))) (- 1))) (not (>= (+ arg1 (* (- 1) fmt0)) 6)) (not (<= (+ arg0 (* (- 1) fmt0) distance) 0)) (not (>= distance 18)) (not (>= (+ arg0 (* (- 1) arg1) (* 4 (s_count (+ (- 2) (* (- 1) fmt0) fmt1))) (* 4 (x_count (+ (- 2) (* (- 1) fmt0) fmt1)))) 0)) (not (<= (x_count 0) 0)) (not (>= (+ (x_count 0) (* (- 1) (x_count 1))) 0)) (not (<= (s_count 0) 1)) (not (>= (+ (s_count 0) (* (- 1) (s_count 1))) 0)) (not (>= (+ (x_count 1) (* (- 1) (x_count 2))) 0)) (not (>= (+ (x_count 3) (* (- 1) (x_count 4))) (- 1))) (not (>= (+ (x_count 2) (* (- 1) (x_count 3))) 0)) (not (= (+ (x_count (+ (- 2) (* (- 1) fmt0) fmt1)) (* (- 1) (x_count 4))) 0)))) +(assert (or (not (= (+ (s_count (+ (- 2) (* (- 1) fmt0) fmt1)) (* (- 1) (s_count 6))) 0)) (not (>= (+ (s_count 2) (* (- 1) (s_count 3))) (- 1))) (not (>= (+ (s_count 1) (* (- 1) (s_count 2))) (- 1))) (<= (+ (s_count 3) (* (- 1) (s_count 4))) (- 1)) (not (>= (+ (s_count 4) (* (- 1) (s_count 5))) 0)) (not (>= (+ (s_count 5) (* (- 1) (s_count 6))) (- 1))) (not (>= (+ arg1 (* (- 1) fmt0)) 6)) (not (<= (+ arg0 (* (- 1) fmt0) distance) 0)) (not (>= distance 18)) (not (>= (+ arg0 (* (- 1) arg1) (* 4 (s_count (+ (- 2) (* (- 1) fmt0) fmt1))) (* 4 (x_count (+ (- 2) (* (- 1) fmt0) fmt1)))) 0)) (not (<= (x_count 0) 1)) (not (>= (+ (x_count 0) (* (- 1) (x_count 1))) 0)) (not (<= (s_count 0) 0)) (not (>= (+ (s_count 0) (* (- 1) (s_count 1))) 0)) (not (>= (+ (x_count 1) (* (- 1) (x_count 2))) 0)) (not (>= (+ (x_count 3) (* (- 1) (x_count 4))) (- 1))) (not (>= (+ (x_count 2) (* (- 1) (x_count 3))) 0)) (not (= (+ (x_count (+ (- 2) (* (- 1) fmt0) fmt1)) (* (- 1) (x_count 4))) 0)))) + + +(check-sat) +(exit) diff --git a/test/regress/regress0/uflia/xs-09-16-3-4-1-5.smt b/test/regress/regress0/uflia/xs-09-16-3-4-1-5.smt new file mode 100644 index 000000000..d9158d400 --- /dev/null +++ b/test/regress/regress0/uflia/xs-09-16-3-4-1-5.smt @@ -0,0 +1,29 @@ +(benchmark mathsat +:source { MathSat group } +:logic QF_UFLIA +:status unsat +:category { industrial } +:difficulty { 2 } +:extrafuns ((fmt1 Int)) +:extrafuns ((fmt0 Int)) +:extrafuns ((arg1 Int)) +:extrafuns ((arg0 Int)) +:extrafuns ((fmt_length Int)) +:extrafuns ((distance Int)) +:extrafuns ((adr_hi Int)) +:extrafuns ((adr_medhi Int)) +:extrafuns ((adr_medlo Int)) +:extrafuns ((adr_lo Int)) +:extrafuns ((select_format Int Int)) +:extrafuns ((percent Int)) +:extrafuns ((s Int)) +:extrafuns ((s_count Int Int)) +:extrafuns ((x Int)) +:extrafuns ((x_count Int Int)) +:formula +(flet ($concval (and (and (and (and (and (and (and (and (= distance 16) (= fmt_length 9)) (= adr_lo 3)) (= adr_medlo 4)) (= adr_medhi 1)) (= adr_hi 5)) (= percent 37)) (= s 115)) (= x 120))) +(flet ($attack (and (and (and (and (and (and (and (= fmt0 0) (= arg0 (- fmt0 distance))) (>= arg1 fmt0)) (< fmt1 (- (+ fmt0 fmt_length) 1))) (> fmt1 (+ fmt0 1))) (>= arg1 (+ arg0 distance))) (< arg1 (- (+ (+ arg0 distance) fmt_length) 4))) (= arg1 (+ (+ arg0 (* 4 (s_count (- (- fmt1 2) fmt0)))) (* 4 (x_count (- (- fmt1 2) fmt0))))))) +(flet ($restrict (or (or (or (or (or (or (or (or (or (or (or (or (or (or (or (or (or (or (or (or (or (or (or (or (or (or (or (or (or (or (or (or (or (or (or (or (or (or (or (or (or (or (or (or (or (or (or (or (or (or (or (or (or (or (or (or (or (or (or (or (or (or (or (or (or (or (or (or (or (or (or (= (select_format 0) percent) (= (select_format 0) s)) (= (select_format 0) x)) (= (select_format 0) adr_lo)) (= (select_format 0) adr_medlo)) (= (select_format 0) adr_medhi)) (= (select_format 0) adr_hi)) (= (select_format 0) 255)) (= (select_format 1) percent)) (= (select_format 1) s)) (= (select_format 1) x)) (= (select_format 1) adr_lo)) (= (select_format 1) adr_medlo)) (= (select_format 1) adr_medhi)) (= (select_format 1) adr_hi)) (= (select_format 1) 255)) (= (select_format 2) percent)) (= (select_format 2) s)) (= (select_format 2) x)) (= (select_format 2) adr_lo)) (= (select_format 2) adr_medlo)) (= (select_format 2) adr_medhi)) (= (select_format 2) adr_hi)) (= (select_format 2) 255)) (= (select_format 3) percent)) (= (select_format 3) s)) (= (select_format 3) x)) (= (select_format 3) adr_lo)) (= (select_format 3) adr_medlo)) (= (select_format 3) adr_medhi)) (= (select_format 3) adr_hi)) (= (select_format 3) 255)) (= (select_format 4) percent)) (= (select_format 4) s)) (= (select_format 4) x)) (= (select_format 4) adr_lo)) (= (select_format 4) adr_medlo)) (= (select_format 4) adr_medhi)) (= (select_format 4) adr_hi)) (= (select_format 4) 255)) (= (select_format 5) percent)) (= (select_format 5) s)) (= (select_format 5) x)) (= (select_format 5) adr_lo)) (= (select_format 5) adr_medlo)) (= (select_format 5) adr_medhi)) (= (select_format 5) adr_hi)) (= (select_format 5) 255)) (= (select_format 6) percent)) (= (select_format 6) s)) (= (select_format 6) x)) (= (select_format 6) adr_lo)) (= (select_format 6) adr_medlo)) (= (select_format 6) adr_medhi)) (= (select_format 6) adr_hi)) (= (select_format 6) 255)) (= (select_format 7) percent)) (= (select_format 7) s)) (= (select_format 7) x)) (= (select_format 7) adr_lo)) (= (select_format 7) adr_medlo)) (= (select_format 7) adr_medhi)) (= (select_format 7) adr_hi)) (= (select_format 7) 255)) (= (select_format 8) percent)) (= (select_format 8) s)) (= (select_format 8) x)) (= (select_format 8) adr_lo)) (= (select_format 8) adr_medlo)) (= (select_format 8) adr_medhi)) (= (select_format 8) adr_hi)) (= (select_format 8) 255))) +(flet ($counterdef (and (and (and (and (and (and (and (and (and (and (and (and (and (and (and (and (and (if_then_else (and (= (select_format 0) percent) (= (select_format 1) s)) (= (s_count 0) 1) (= (s_count 0) 0)) (if_then_else (and (= (select_format 1) percent) (= (select_format 2) s)) (= (s_count 1) (+ (s_count 0) 1)) (= (s_count 1) (s_count 0)))) (if_then_else (and (= (select_format 2) percent) (= (select_format 3) s)) (= (s_count 2) (+ (s_count 1) 1)) (= (s_count 2) (s_count 1)))) (if_then_else (and (= (select_format 3) percent) (= (select_format 4) s)) (= (s_count 3) (+ (s_count 2) 1)) (= (s_count 3) (s_count 2)))) (if_then_else (and (= (select_format 4) percent) (= (select_format 5) s)) (= (s_count 4) (+ (s_count 3) 1)) (= (s_count 4) (s_count 3)))) (if_then_else (and (= (select_format 5) percent) (= (select_format 6) s)) (= (s_count 5) (+ (s_count 4) 1)) (= (s_count 5) (s_count 4)))) (if_then_else (and (= (select_format 6) percent) (= (select_format 7) s)) (= (s_count 6) (+ (s_count 5) 1)) (= (s_count 6) (s_count 5)))) (if_then_else (and (= (select_format 7) percent) (= (select_format 8) s)) (= (s_count 7) (+ (s_count 6) 1)) (= (s_count 7) (s_count 6)))) (if_then_else (and (= (select_format 8) percent) (= (select_format 9) s)) (= (s_count 8) (+ (s_count 7) 1)) (= (s_count 8) (s_count 7)))) (if_then_else (and (= (select_format 0) percent) (= (select_format 1) x)) (= (x_count 0) 1) (= (x_count 0) 0))) (if_then_else (and (= (select_format 1) percent) (= (select_format 2) x)) (= (x_count 1) (+ (x_count 0) 1)) (= (x_count 1) (x_count 0)))) (if_then_else (and (= (select_format 2) percent) (= (select_format 3) x)) (= (x_count 2) (+ (x_count 1) 1)) (= (x_count 2) (x_count 1)))) (if_then_else (and (= (select_format 3) percent) (= (select_format 4) x)) (= (x_count 3) (+ (x_count 2) 1)) (= (x_count 3) (x_count 2)))) (if_then_else (and (= (select_format 4) percent) (= (select_format 5) x)) (= (x_count 4) (+ (x_count 3) 1)) (= (x_count 4) (x_count 3)))) (if_then_else (and (= (select_format 5) percent) (= (select_format 6) x)) (= (x_count 5) (+ (x_count 4) 1)) (= (x_count 5) (x_count 4)))) (if_then_else (and (= (select_format 6) percent) (= (select_format 7) x)) (= (x_count 6) (+ (x_count 5) 1)) (= (x_count 6) (x_count 5)))) (if_then_else (and (= (select_format 7) percent) (= (select_format 8) x)) (= (x_count 7) (+ (x_count 6) 1)) (= (x_count 7) (x_count 6)))) (if_then_else (and (= (select_format 8) percent) (= (select_format 9) x)) (= (x_count 8) (+ (x_count 7) 1)) (= (x_count 8) (x_count 7))))) +(flet ($integral (and (or (or (or (or (or (or (or (or (= fmt1 (+ fmt0 0)) (= fmt1 (+ fmt0 1))) (= fmt1 (+ fmt0 2))) (= fmt1 (+ fmt0 3))) (= fmt1 (+ fmt0 4))) (= fmt1 (+ fmt0 5))) (= fmt1 (+ fmt0 6))) (= fmt1 (+ fmt0 7))) (= fmt1 (+ fmt0 8))) (or (or (or (or (or (= arg1 (+ fmt0 0)) (= arg1 (+ fmt0 1))) (= arg1 (+ fmt0 2))) (= arg1 (+ fmt0 3))) (= arg1 (+ fmt0 4))) (= arg1 (+ fmt0 5))))) +(and (and (and (and (and $concval $attack) $restrict) $counterdef) $integral) (not (and (and (and (and (and (= (select_format fmt1) percent) (= (select_format (+ fmt1 1)) s)) (= (select_format arg1) adr_lo)) (= (select_format (+ arg1 1)) adr_medlo)) (= (select_format (+ arg1 2)) adr_medhi)) (= (select_format (+ arg1 3)) adr_hi)))))))))) diff --git a/test/unit/theory/theory_arith_white.h b/test/unit/theory/theory_arith_white.h index 41d370aac..c6d6e3e2e 100644 --- a/test/unit/theory/theory_arith_white.h +++ b/test/unit/theory/theory_arith_white.h @@ -125,7 +125,8 @@ public: Node x = d_nm->mkVar(*d_realType); Node c = d_nm->mkConst(d_zero); - Node leq = d_nm->mkNode(LEQ, x, c); + Node gt = d_nm->mkNode(GT, x, c); + Node leq = gt.notNode(); fakeTheoryEnginePreprocess(leq); d_arith->assertFact(leq, true); @@ -149,37 +150,36 @@ public: Node c0 = d_nm->mkConst(d_zero); Node c1 = d_nm->mkConst(d_one); - Node leq0 = d_nm->mkNode(LEQ, x, c0); - Node leq1 = d_nm->mkNode(LEQ, x, c1); + Node gt0 = d_nm->mkNode(GT, x, c0); + Node gt1 = d_nm->mkNode(GT, x, c1); Node geq1 = d_nm->mkNode(GEQ, x, c1); - Node lt1 = d_nm->mkNode(NOT, geq1); - Node gt0 = d_nm->mkNode(NOT, leq0); - Node gt1 = d_nm->mkNode(NOT, leq1); + Node leq0 = gt0.notNode(); + Node leq1 = gt1.notNode(); + Node lt1 = geq1.notNode(); fakeTheoryEnginePreprocess(leq0); fakeTheoryEnginePreprocess(leq1); fakeTheoryEnginePreprocess(geq1); + d_arith->presolve(); d_arith->assertFact(lt1, true); - - d_arith->check(d_level); d_arith->propagate(d_level); - Node gt1ThenGt0 = NodeBuilder<2>(IMPLIES) << gt1 << gt0; - Node geq1ThenGt0 = NodeBuilder<2>(IMPLIES) << geq1 << gt0; - Node lt1ThenLeq1 = NodeBuilder<2>(IMPLIES) << lt1 << leq1; - TS_ASSERT_EQUALS(d_outputChannel.getNumCalls(), 3u); + Node gt0Orlt1 = NodeBuilder<2>(OR) << gt0 << lt1; + Node geq0OrLeq1 = NodeBuilder<2>(OR) << geq1 << leq1; + + cout << d_outputChannel.getIthNode(0) << endl; + cout << d_outputChannel.getIthNode(1) << endl; + + TS_ASSERT_EQUALS(d_outputChannel.getNumCalls(), 2u); TS_ASSERT_EQUALS(d_outputChannel.getIthCallType(0), LEMMA); - TS_ASSERT_EQUALS(d_outputChannel.getIthNode(0), gt1ThenGt0); + TS_ASSERT_EQUALS(d_outputChannel.getIthNode(0), gt0Orlt1); TS_ASSERT_EQUALS(d_outputChannel.getIthCallType(1), LEMMA); - TS_ASSERT_EQUALS(d_outputChannel.getIthNode(1), geq1ThenGt0); - - TS_ASSERT_EQUALS(d_outputChannel.getIthCallType(2), LEMMA); - TS_ASSERT_EQUALS(d_outputChannel.getIthNode(2), lt1ThenLeq1); + TS_ASSERT_EQUALS(d_outputChannel.getIthNode(1), geq0OrLeq1); } @@ -188,72 +188,70 @@ public: Node c0 = d_nm->mkConst(d_zero); Node c1 = d_nm->mkConst(d_one); - Node leq0 = d_nm->mkNode(LEQ, x, c0); - Node leq1 = d_nm->mkNode(LEQ, x, c1); + Node gt0 = d_nm->mkNode(GT, x, c0); + Node gt1 = d_nm->mkNode(GT, x, c1); Node geq1 = d_nm->mkNode(GEQ, x, c1); - Node lt1 = d_nm->mkNode(NOT, geq1); - Node gt0 = d_nm->mkNode(NOT, leq0); - Node gt1 = d_nm->mkNode(NOT, leq1); + Node leq0 = gt0.notNode(); + Node leq1 = gt1.notNode(); + Node lt1 = geq1.notNode(); fakeTheoryEnginePreprocess(leq0); fakeTheoryEnginePreprocess(leq1); fakeTheoryEnginePreprocess(geq1); + d_arith->presolve(); d_arith->assertFact(leq0, true); - - d_arith->check(d_level); + d_arith->propagate(d_level); - Node gt1ThenGt0 = NodeBuilder<2>(IMPLIES) << gt1 << gt0; - Node geq1ThenGt0 = NodeBuilder<2>(IMPLIES) << geq1 << gt0; - Node lt1ThenLeq1 = NodeBuilder<2>(IMPLIES) << lt1 << leq1; + Node gt0Orlt1 = NodeBuilder<2>(OR) << gt0 << lt1; + Node geq0OrLeq1 = NodeBuilder<2>(OR) << geq1 << leq1; - TS_ASSERT_EQUALS(d_outputChannel.getNumCalls(), 3u); + cout << d_outputChannel.getIthNode(0) << endl; + cout << d_outputChannel.getIthNode(1) << endl; + + TS_ASSERT_EQUALS(d_outputChannel.getNumCalls(), 2u); TS_ASSERT_EQUALS(d_outputChannel.getIthCallType(0), LEMMA); - TS_ASSERT_EQUALS(d_outputChannel.getIthNode(0), gt1ThenGt0); + TS_ASSERT_EQUALS(d_outputChannel.getIthNode(0), gt0Orlt1); TS_ASSERT_EQUALS(d_outputChannel.getIthCallType(1), LEMMA); - TS_ASSERT_EQUALS(d_outputChannel.getIthNode(1), geq1ThenGt0); - - TS_ASSERT_EQUALS(d_outputChannel.getIthCallType(2), LEMMA); - TS_ASSERT_EQUALS(d_outputChannel.getIthNode(2), lt1ThenLeq1); + TS_ASSERT_EQUALS(d_outputChannel.getIthNode(1), geq0OrLeq1); } + void testTPLeq1() { Node x = d_nm->mkVar(*d_realType); Node c0 = d_nm->mkConst(d_zero); Node c1 = d_nm->mkConst(d_one); - Node leq0 = d_nm->mkNode(LEQ, x, c0); - Node leq1 = d_nm->mkNode(LEQ, x, c1); + Node gt0 = d_nm->mkNode(GT, x, c0); + Node gt1 = d_nm->mkNode(GT, x, c1); Node geq1 = d_nm->mkNode(GEQ, x, c1); - Node lt1 = d_nm->mkNode(NOT, geq1); - Node gt0 = d_nm->mkNode(NOT, leq0); - Node gt1 = d_nm->mkNode(NOT, leq1); + Node leq0 = gt0.notNode(); + Node leq1 = gt1.notNode(); + Node lt1 = geq1.notNode(); fakeTheoryEnginePreprocess(leq0); fakeTheoryEnginePreprocess(leq1); fakeTheoryEnginePreprocess(geq1); + d_arith->presolve(); d_arith->assertFact(leq1, true); - - d_arith->check(d_level); d_arith->propagate(d_level); - Node gt1ThenGt0 = NodeBuilder<2>(IMPLIES) << gt1 << gt0; - Node geq1ThenGt0 = NodeBuilder<2>(IMPLIES) << geq1 << gt0; - Node lt1ThenLeq1 = NodeBuilder<2>(IMPLIES) << lt1 << leq1; + Node gt0Orlt1 = NodeBuilder<2>(OR) << gt0 << lt1; + Node geq0OrLeq1 = NodeBuilder<2>(OR) << geq1 << leq1; + + cout << d_outputChannel.getIthNode(0) << endl; + cout << d_outputChannel.getIthNode(1) << endl; - TS_ASSERT_EQUALS(d_outputChannel.getNumCalls(), 3u); + TS_ASSERT_EQUALS(d_outputChannel.getNumCalls(), 2u); TS_ASSERT_EQUALS(d_outputChannel.getIthCallType(0), LEMMA); - TS_ASSERT_EQUALS(d_outputChannel.getIthNode(0), gt1ThenGt0); + TS_ASSERT_EQUALS(d_outputChannel.getIthNode(0), gt0Orlt1); TS_ASSERT_EQUALS(d_outputChannel.getIthCallType(1), LEMMA); - TS_ASSERT_EQUALS(d_outputChannel.getIthNode(1), geq1ThenGt0); - - TS_ASSERT_EQUALS(d_outputChannel.getIthCallType(2), LEMMA); - TS_ASSERT_EQUALS(d_outputChannel.getIthNode(2), lt1ThenLeq1); + TS_ASSERT_EQUALS(d_outputChannel.getIthNode(1), geq0OrLeq1); } }; -- 2.30.2